HU182902B - Process for preparing dipeptide derivatives with hypotensive activity - Google Patents
Process for preparing dipeptide derivatives with hypotensive activity Download PDFInfo
- Publication number
- HU182902B HU182902B HU79ME2324A HUME002324A HU182902B HU 182902 B HU182902 B HU 182902B HU 79ME2324 A HU79ME2324 A HU 79ME2324A HU ME002324 A HUME002324 A HU ME002324A HU 182902 B HU182902 B HU 182902B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- proline
- pro
- compound
- acid
- Prior art date
Links
- 108010016626 Dipeptides Proteins 0.000 title claims abstract description 21
- 238000004519 manufacturing process Methods 0.000 title description 2
- 230000001077 hypotensive effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 108
- 238000000034 method Methods 0.000 claims abstract description 26
- 238000004587 chromatography analysis Methods 0.000 claims abstract description 25
- 238000006243 chemical reaction Methods 0.000 claims abstract description 20
- 125000006239 protecting group Chemical group 0.000 claims abstract description 19
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 230000008569 process Effects 0.000 claims abstract description 14
- 238000002360 preparation method Methods 0.000 claims abstract description 12
- 150000002576 ketones Chemical class 0.000 claims abstract description 9
- 239000003638 chemical reducing agent Substances 0.000 claims abstract description 8
- 239000002220 antihypertensive agent Substances 0.000 claims abstract description 7
- 229940030600 antihypertensive agent Drugs 0.000 claims abstract description 6
- 238000001640 fractional crystallisation Methods 0.000 claims abstract description 4
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 4
- -1 hydroxy, hydroxyamino Chemical group 0.000 claims description 84
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 claims description 53
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 28
- WPWUFUBLGADILS-WDSKDSINSA-N Ala-Pro Chemical compound C[C@H](N)C(=O)N1CCC[C@H]1C(O)=O WPWUFUBLGADILS-WDSKDSINSA-N 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 15
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 14
- 239000002585 base Substances 0.000 claims description 12
- 238000009833 condensation Methods 0.000 claims description 11
- 230000005494 condensation Effects 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 9
- 150000001413 amino acids Chemical class 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 8
- 229940024606 amino acid Drugs 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000005984 hydrogenation reaction Methods 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 239000007868 Raney catalyst Substances 0.000 claims description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 4
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 4
- 239000002934 diuretic Substances 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- LNCFUHAPNTYMJB-IUCAKERBSA-N His-Pro Chemical compound C([C@H](N)C(=O)N1[C@@H](CCC1)C(O)=O)C1=CN=CN1 LNCFUHAPNTYMJB-IUCAKERBSA-N 0.000 claims description 3
- AIXUQKMMBQJZCU-IUCAKERBSA-N Lys-Pro Chemical compound NCCCC[C@H](N)C(=O)N1CCC[C@H]1C(O)=O AIXUQKMMBQJZCU-IUCAKERBSA-N 0.000 claims description 3
- OZILORBBPKKGRI-RYUDHWBXSA-N Phe-Arg Chemical compound NC(N)=NCCC[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CC=CC=C1 OZILORBBPKKGRI-RYUDHWBXSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 229940030606 diuretics Drugs 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 125000006564 (C4-C8) cycloalkyl group Chemical group 0.000 claims description 2
- OMNVYXHOSHNURL-WPRPVWTQSA-N Ala-Phe Chemical compound C[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 OMNVYXHOSHNURL-WPRPVWTQSA-N 0.000 claims description 2
- MMFKFJORZBJVNF-UWVGGRQHSA-N His-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CN=CN1 MMFKFJORZBJVNF-UWVGGRQHSA-N 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000012445 acidic reagent Substances 0.000 claims 3
- 229910052763 palladium Inorganic materials 0.000 claims 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 150000001412 amines Chemical class 0.000 claims 2
- 150000003862 amino acid derivatives Chemical class 0.000 claims 2
- 239000002671 adjuvant Substances 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 230000008025 crystallization Effects 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 claims 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical group [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 1
- HXEACLLIILLPRG-UHFFFAOYSA-N pipecolic acid Chemical compound OC(=O)C1CCCCN1 HXEACLLIILLPRG-UHFFFAOYSA-N 0.000 claims 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims 1
- 206010020772 Hypertension Diseases 0.000 abstract description 5
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 abstract description 4
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 abstract description 4
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 abstract description 4
- 102000005862 Angiotensin II Human genes 0.000 abstract description 3
- 101800000734 Angiotensin-1 Proteins 0.000 abstract description 3
- 102400000344 Angiotensin-1 Human genes 0.000 abstract description 3
- 101800000733 Angiotensin-2 Proteins 0.000 abstract description 3
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 abstract description 3
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 abstract description 3
- 229950006323 angiotensin ii Drugs 0.000 abstract description 3
- 241000124008 Mammalia Species 0.000 abstract description 2
- 230000001631 hypertensive effect Effects 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 83
- 239000000243 solution Substances 0.000 description 82
- 239000000203 mixture Substances 0.000 description 71
- 239000000047 product Substances 0.000 description 71
- 238000001819 mass spectrum Methods 0.000 description 66
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 64
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 59
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 59
- 239000011541 reaction mixture Substances 0.000 description 46
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 42
- 150000001793 charged compounds Chemical class 0.000 description 42
- 239000011347 resin Substances 0.000 description 39
- 229920005989 resin Polymers 0.000 description 39
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 31
- 239000003456 ion exchange resin Substances 0.000 description 31
- 229920003303 ion-exchange polymer Polymers 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 29
- 230000002378 acidificating effect Effects 0.000 description 23
- 239000002244 precipitate Substances 0.000 description 23
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- PPKAIMDMNWBOKN-UHFFFAOYSA-N 2-Oxo-4-phenylbutyric acid Chemical compound OC(=O)C(=O)CCC1=CC=CC=C1 PPKAIMDMNWBOKN-UHFFFAOYSA-N 0.000 description 19
- 108010087924 alanylproline Proteins 0.000 description 18
- 238000004108 freeze drying Methods 0.000 description 18
- 229960002429 proline Drugs 0.000 description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 14
- 238000010521 absorption reaction Methods 0.000 description 14
- 229910052717 sulfur Inorganic materials 0.000 description 14
- 239000002904 solvent Substances 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 11
- 241000894007 species Species 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 239000003480 eluent Substances 0.000 description 9
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 8
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 8
- 239000002808 molecular sieve Substances 0.000 description 8
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 229960003767 alanine Drugs 0.000 description 6
- 235000001014 amino acid Nutrition 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 238000010828 elution Methods 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 238000002523 gelfiltration Methods 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 238000004809 thin layer chromatography Methods 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 230000036772 blood pressure Effects 0.000 description 5
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 239000011877 solvent mixture Substances 0.000 description 5
- LGKQVMSGOUJVCB-UHFFFAOYSA-N 5-methyl-3-oxohexanoic acid Chemical compound CC(C)CC(=O)CC(O)=O LGKQVMSGOUJVCB-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- ZITOPJKFJBLAMM-LURJTMIESA-N (2s)-1-(2-oxopropanoyl)pyrrolidine-2-carboxylic acid Chemical compound CC(=O)C(=O)N1CCC[C@H]1C(O)=O ZITOPJKFJBLAMM-LURJTMIESA-N 0.000 description 3
- HLBPRUWPRRRMCK-PPSBICQBSA-N (2s)-1-[(2s)-2-(1-carboxyethylamino)propanoyl]pyrrolidine-2-carboxylic acid Chemical compound OC(=O)C(C)N[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O HLBPRUWPRRRMCK-PPSBICQBSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- 235000004279 alanine Nutrition 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 3
- 229940106681 chloroacetic acid Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 238000006114 decarboxylation reaction Methods 0.000 description 3
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 3
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 3
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 description 3
- 238000001641 gel filtration chromatography Methods 0.000 description 3
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 3
- 239000008108 microcrystalline cellulose Substances 0.000 description 3
- 229940016286 microcrystalline cellulose Drugs 0.000 description 3
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000001179 sorption measurement Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- LZFZMUMEGBBDTC-JDLVMGNASA-N (2s)-1-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 LZFZMUMEGBBDTC-JDLVMGNASA-N 0.000 description 2
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 2
- FGSBNBBHOZHUBO-UHFFFAOYSA-N 2-oxoadipic acid Chemical compound OC(=O)CCCC(=O)C(O)=O FGSBNBBHOZHUBO-UHFFFAOYSA-N 0.000 description 2
- AYZZGFLBVPUZQH-UHFFFAOYSA-N 4-(1h-indol-3-yl)-2-oxobutanoic acid Chemical compound C1=CC=C2C(CCC(=O)C(=O)O)=CNC2=C1 AYZZGFLBVPUZQH-UHFFFAOYSA-N 0.000 description 2
- HNZMKKXVFZVKII-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C=C1 HNZMKKXVFZVKII-UHFFFAOYSA-N 0.000 description 2
- 239000005541 ACE inhibitor Substances 0.000 description 2
- ZSOICJZJSRWNHX-ACZMJKKPSA-N Ala-Ile Chemical compound CC[C@H](C)[C@@H](C([O-])=O)NC(=O)[C@H](C)[NH3+] ZSOICJZJSRWNHX-ACZMJKKPSA-N 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- 101800004538 Bradykinin Proteins 0.000 description 2
- 102400000967 Bradykinin Human genes 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 2
- 241000282414 Homo sapiens Species 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 229920000881 Modified starch Polymers 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- WBAXJMCUFIXCNI-WDSKDSINSA-N Ser-Pro Chemical compound OC[C@H](N)C(=O)N1CCC[C@H]1C(O)=O WBAXJMCUFIXCNI-WDSKDSINSA-N 0.000 description 2
- HEMHJVSKTPXQMS-DYCDLGHISA-M Sodium hydroxide-d Chemical compound [Na+].[2H][O-] HEMHJVSKTPXQMS-DYCDLGHISA-M 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 2
- VVCLBQFBKZQOAF-NSHDSACASA-N benzyl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OCC1=CC=CC=C1 VVCLBQFBKZQOAF-NSHDSACASA-N 0.000 description 2
- CNNBRFOPQDCGFV-UHFFFAOYSA-N benzyl 2-oxopropanoate Chemical compound CC(=O)C(=O)OCC1=CC=CC=C1 CNNBRFOPQDCGFV-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- 238000011097 chromatography purification Methods 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 229960002003 hydrochlorothiazide Drugs 0.000 description 2
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- BTNMPGBKDVTSJY-UHFFFAOYSA-N keto-phenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=CC=C1 BTNMPGBKDVTSJY-UHFFFAOYSA-N 0.000 description 2
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- QSDRPVSYKHAVAZ-UHFFFAOYSA-N n-benzyl-2-oxo-4-phenylbutanamide Chemical compound C=1C=CC=CC=1CNC(=O)C(=O)CCC1=CC=CC=C1 QSDRPVSYKHAVAZ-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- UYTSRQMXRROFPU-REOHCLBHSA-N (2r)-2-amino-3-fluoropropanoic acid Chemical compound FC[C@H](N)C(O)=O UYTSRQMXRROFPU-REOHCLBHSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BZBYEAWKJNCPLB-UHFFFAOYSA-N 1,3-dithiane-2-carboxylic acid Chemical compound OC(=O)C1SCCCS1 BZBYEAWKJNCPLB-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- 125000005978 1-naphthyloxy group Chemical group 0.000 description 1
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 1
- TXVBFPWALPUJCW-UHFFFAOYSA-N 2-(2-oxoethyl)-4-phenylbutanoic acid Chemical compound O=CCC(C(=O)O)CCC1=CC=CC=C1 TXVBFPWALPUJCW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- HLWYCVRTMYVOPL-FHNOQDHRSA-N 2-[[(1S)-2-[1-[(2S)-2-aminopropanoyl]cyclohexa-2,4-dien-1-yl]-1-carboxyethyl]-methylamino]-4-phenylbutanoic acid Chemical compound C([C@H](N(C)C(CCC=1C=CC=CC=1)C(O)=O)C(O)=O)C1(C(=O)[C@@H](N)C)CC=CC=C1 HLWYCVRTMYVOPL-FHNOQDHRSA-N 0.000 description 1
- JRMAQQQTXDJDNC-UHFFFAOYSA-M 2-ethoxy-2-oxoacetate Chemical compound CCOC(=O)C([O-])=O JRMAQQQTXDJDNC-UHFFFAOYSA-M 0.000 description 1
- RSUOYCBRWUTZAO-UHFFFAOYSA-N 2-oxo-3-phenoxypropanoic acid Chemical compound OC(=O)C(=O)COC1=CC=CC=C1 RSUOYCBRWUTZAO-UHFFFAOYSA-N 0.000 description 1
- 239000001903 2-oxo-3-phenylpropanoic acid Substances 0.000 description 1
- QDJVGSZTQJRNKQ-UHFFFAOYSA-N 2-oxo-4-(4-phenoxyphenyl)butanoic acid Chemical compound C1=CC(CCC(=O)C(=O)O)=CC=C1OC1=CC=CC=C1 QDJVGSZTQJRNKQ-UHFFFAOYSA-N 0.000 description 1
- TYEYBOSBBBHJIV-UHFFFAOYSA-N 2-oxobutanoic acid Chemical compound CCC(=O)C(O)=O TYEYBOSBBBHJIV-UHFFFAOYSA-N 0.000 description 1
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- CMFCCYFQTHPJKO-UHFFFAOYSA-N 3-benzyl-2-oxopentanoic acid Chemical compound OC(=O)C(=O)C(CC)CC1=CC=CC=C1 CMFCCYFQTHPJKO-UHFFFAOYSA-N 0.000 description 1
- ZKRDTNHGGOKJNM-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C(Cl)=C1 ZKRDTNHGGOKJNM-UHFFFAOYSA-N 0.000 description 1
- BBMFSGOFUHEVNP-UHFFFAOYSA-N 4-hydroxy-2-methylbenzoic acid Chemical compound CC1=CC(O)=CC=C1C(O)=O BBMFSGOFUHEVNP-UHFFFAOYSA-N 0.000 description 1
- CIBNXHHWVVKRDY-UHFFFAOYSA-N 5-methyl-2-oxohexanoic acid Chemical compound CC(C)CCC(=O)C(O)=O CIBNXHHWVVKRDY-UHFFFAOYSA-N 0.000 description 1
- HMJVYQBHXHOGRX-UHFFFAOYSA-N 7-methyl-3-oxooctanoic acid Chemical compound CC(C)CCCC(=O)CC(O)=O HMJVYQBHXHOGRX-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- WUGMRIBZSVSJNP-UFBFGSQYSA-N Ala-Trp Chemical compound C1=CC=C2C(C[C@H](NC(=O)[C@@H](N)C)C(O)=O)=CNC2=C1 WUGMRIBZSVSJNP-UFBFGSQYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- JISFODBYLDFTHL-UHFFFAOYSA-N C(#N)B(Cl)Cl.[Na] Chemical compound C(#N)B(Cl)Cl.[Na] JISFODBYLDFTHL-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N D-alpha-Ala Natural products CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-UWTATZPHSA-N L-Alanine Natural products C[C@@H](N)C(O)=O QNAYBMKLOCPYGJ-UWTATZPHSA-N 0.000 description 1
- BXRMEWOQUXOLDH-LURJTMIESA-N L-Histidine methyl ester Chemical compound COC(=O)[C@@H](N)CC1=CN=CN1 BXRMEWOQUXOLDH-LURJTMIESA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- 239000004395 L-leucine Substances 0.000 description 1
- VLJNHYLEOZPXFW-BYPYZUCNSA-N L-prolinamide Chemical compound NC(=O)[C@@H]1CCCN1 VLJNHYLEOZPXFW-BYPYZUCNSA-N 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- DZLNHFMRPBPULJ-VKHMYHEASA-N L-thioproline Chemical compound OC(=O)[C@@H]1CSCN1 DZLNHFMRPBPULJ-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- BQVUABVGYYSDCJ-ZFWWWQNUSA-N Leu-Trp Chemical compound C1=CC=C2C(C[C@H](NC(=O)[C@@H](N)CC(C)C)C(O)=O)=CNC2=C1 BQVUABVGYYSDCJ-ZFWWWQNUSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 235000006679 Mentha X verticillata Nutrition 0.000 description 1
- 235000002899 Mentha suaveolens Nutrition 0.000 description 1
- 235000001636 Mentha x rotundifolia Nutrition 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- BQVUABVGYYSDCJ-UHFFFAOYSA-N Nalpha-L-Leucyl-L-tryptophan Natural products C1=CC=C2C(CC(NC(=O)C(N)CC(C)C)C(O)=O)=CNC2=C1 BQVUABVGYYSDCJ-UHFFFAOYSA-N 0.000 description 1
- SJDKUTPJUNHECQ-UHFFFAOYSA-N OC(=O)C(=O)CC1CCCCC1.OC(=O)C(=O)CC1CCCCC1 Chemical compound OC(=O)C(=O)CC1CCCCC1.OC(=O)C(=O)CC1CCCCC1 SJDKUTPJUNHECQ-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000165780 Preussia/Sporomiella species complex Species 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- WIQBZDCJCRFGKA-UHFFFAOYSA-M Sodium-3-methyl-2-oxobutyrate Chemical compound [Na+].CC(C)C(=O)C([O-])=O WIQBZDCJCRFGKA-UHFFFAOYSA-M 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- DEDGUGJNLNLJSR-UHFFFAOYSA-N alpha-hydroxycinnamic acid Natural products OC(=O)C(O)=CC1=CC=CC=C1 DEDGUGJNLNLJSR-UHFFFAOYSA-N 0.000 description 1
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- HAVZTGSQJIEKPI-UHFFFAOYSA-N benzothiadiazine Chemical compound C1=CC=C2C=NNSC2=C1 HAVZTGSQJIEKPI-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- NEDMOHHWRPHBAL-MERQFXBCSA-N benzyl (2s)-pyrrolidin-1-ium-2-carboxylate;chloride Chemical compound Cl.O=C([C@H]1NCCC1)OCC1=CC=CC=C1 NEDMOHHWRPHBAL-MERQFXBCSA-N 0.000 description 1
- VRGGUJQQXDHSCN-UHFFFAOYSA-N benzyl 6-(1,3-dioxoisoindol-2-yl)-2-oxohexanoate Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCCC(=O)C(=O)OCC1=CC=CC=C1 VRGGUJQQXDHSCN-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- RTGHRDFWYQHVFW-UHFFFAOYSA-N beta-Ketoadipic acid Natural products OC(=O)CCC(=O)CC(O)=O RTGHRDFWYQHVFW-UHFFFAOYSA-N 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical class CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- CEKLPTFJRJMSKC-UHFFFAOYSA-N butyl 2-oxo-4-phenylbutanoate Chemical compound CCCCOC(=O)C(=O)CCC1=CC=CC=C1 CEKLPTFJRJMSKC-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000006243 carbonyl protecting group Chemical group 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- OKKJLVBELUTLKV-MICDWDOJSA-N deuteriomethanol Chemical compound [2H]CO OKKJLVBELUTLKV-MICDWDOJSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 229950010030 dl-alanine Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- AVOLMBLBETYQHX-UHFFFAOYSA-N etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 description 1
- STPXIOGYOLJXMZ-UHFFFAOYSA-N ethyl 2-oxo-4-phenylbutanoate Chemical compound CCOC(=O)C(=O)CCC1=CC=CC=C1 STPXIOGYOLJXMZ-UHFFFAOYSA-N 0.000 description 1
- IHASFDBVENKSHI-UHFFFAOYSA-N ethyl 2-phenoxybutanoate Chemical compound CCOC(=O)C(CC)OC1=CC=CC=C1 IHASFDBVENKSHI-UHFFFAOYSA-N 0.000 description 1
- TVXNBEQHOFXBPI-UHFFFAOYSA-N ethyl 3-benzyl-2-oxopentanoate Chemical compound C(C)OC(C(C(CC1=CC=CC=C1)CC)=O)=O TVXNBEQHOFXBPI-UHFFFAOYSA-N 0.000 description 1
- MGSWAHQQBHNCEI-UHFFFAOYSA-N ethyl 4-methyl-2-oxopentanoate Chemical compound CCOC(=O)C(=O)CC(C)C MGSWAHQQBHNCEI-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 108700039708 galantide Proteins 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000019717 geranium oil Nutrition 0.000 description 1
- 239000010648 geranium oil Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229960003136 leucine Drugs 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VJXKYPIBDBDIJL-JTQLQIEISA-N methyl (2s)-2-(methylamino)-3-phenylpropanoate Chemical compound COC(=O)[C@@H](NC)CC1=CC=CC=C1 VJXKYPIBDBDIJL-JTQLQIEISA-N 0.000 description 1
- KCUNTYMNJVXYKZ-JTQLQIEISA-N methyl (2s)-2-amino-3-(1h-indol-3-yl)propanoate Chemical compound C1=CC=C2C(C[C@H](N)C(=O)OC)=CNC2=C1 KCUNTYMNJVXYKZ-JTQLQIEISA-N 0.000 description 1
- UIHPNZDZCOEZEN-YFKPBYRVSA-N methyl (2s)-2-amino-4-methylsulfanylbutanoate Chemical compound COC(=O)[C@@H](N)CCSC UIHPNZDZCOEZEN-YFKPBYRVSA-N 0.000 description 1
- APCHKWZTSCBBJX-RGMNGODLSA-N methyl (2s)-piperidine-2-carboxylate;hydrochloride Chemical compound [Cl-].COC(=O)[C@@H]1CCCC[NH2+]1 APCHKWZTSCBBJX-RGMNGODLSA-N 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- 125000004492 methyl ester group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical group 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- UJQMLHKSZKBMMO-UHFFFAOYSA-N n,n-diethylethanamine;pyridine Chemical compound C1=CC=NC=C1.CCN(CC)CC UJQMLHKSZKBMMO-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- RORXPBSQGSNAIO-UHFFFAOYSA-N o-ethyl butanethioate Chemical compound CCCC(=S)OCC RORXPBSQGSNAIO-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 238000006485 reductive methylation reaction Methods 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012609 strong anion exchange resin Substances 0.000 description 1
- 239000012607 strong cation exchange resin Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- XJJBXZIKXFOMLP-ZETCQYMHSA-N tert-butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)[C@@H]1CCCN1 XJJBXZIKXFOMLP-ZETCQYMHSA-N 0.000 description 1
- QQWYQAQQADNEIC-UHFFFAOYSA-N tert-butyl [[cyano(phenyl)methylidene]amino] carbonate Chemical compound CC(C)(C)OC(=O)ON=C(C#N)C1=CC=CC=C1 QQWYQAQQADNEIC-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
- 238000006227 trimethylsilylation reaction Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/10—Antioedematous agents; Diuretics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
- C07K5/0222—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2 with the first amino acid being heterocyclic, e.g. Pro, Trp
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S530/00—Chemistry: natural resins or derivatives; peptides or proteins; lignins or reaction products thereof
- Y10S530/80—Antihypertensive peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Molecular Biology (AREA)
- Genetics & Genomics (AREA)
- Biophysics (AREA)
- Biochemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Heart & Thoracic Surgery (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Cardiology (AREA)
- Peptides Or Proteins (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US96824978A | 1978-12-11 | 1978-12-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182902B true HU182902B (en) | 1984-03-28 |
Family
ID=25513965
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79ME2324A HU182902B (en) | 1978-12-11 | 1979-12-10 | Process for preparing dipeptide derivatives with hypotensive activity |
Country Status (33)
| Country | Link |
|---|---|
| US (2) | US4374829A (enExample) |
| EP (1) | EP0012401B1 (enExample) |
| JP (3) | JPS5581845A (enExample) |
| KR (3) | KR850000847B1 (enExample) |
| AR (1) | AR231971A1 (enExample) |
| AU (1) | AU530380B2 (enExample) |
| BG (6) | BG38787A3 (enExample) |
| CA (4) | CA1302005C (enExample) |
| CS (1) | CS237311B2 (enExample) |
| DD (1) | DD148770A5 (enExample) |
| DE (2) | DE19375005I2 (enExample) |
| DK (1) | DK165455C (enExample) |
| EG (1) | EG14182A (enExample) |
| ES (2) | ES8101540A1 (enExample) |
| FI (1) | FI68405C (enExample) |
| GR (1) | GR72251B (enExample) |
| HK (1) | HK27487A (enExample) |
| HU (1) | HU182902B (enExample) |
| IE (1) | IE48922B1 (enExample) |
| IL (1) | IL58849A (enExample) |
| LU (1) | LU90173I2 (enExample) |
| MA (1) | MA18664A1 (enExample) |
| NL (4) | NL930008I2 (enExample) |
| NO (3) | NO151622C (enExample) |
| NZ (1) | NZ192312A (enExample) |
| PH (1) | PH24268A (enExample) |
| PL (2) | PL126126B1 (enExample) |
| PT (1) | PT70542A (enExample) |
| RO (4) | RO85072B (enExample) |
| SU (1) | SU1287756A3 (enExample) |
| YU (3) | YU42655B (enExample) |
| ZA (1) | ZA796688B (enExample) |
| ZW (1) | ZW24479A1 (enExample) |
Families Citing this family (399)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
| US4595675A (en) * | 1979-09-19 | 1986-06-17 | Hoechst Aktiengesellschaft | Bicyclic α-iminocarboxylic acid compounds having hypotensive activity |
| US4616030A (en) * | 1979-12-07 | 1986-10-07 | Adir | Perhydroindole-2-carboxylic acids as antihypertensives |
| FR2503155A2 (fr) * | 1980-10-02 | 1982-10-08 | Science Union & Cie | Nouveaux imino diacides substitues, leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| US4616031A (en) * | 1979-12-07 | 1986-10-07 | Adir | Perhydroindole-2-carboxylic acids as antihypertensives |
| US4644008A (en) * | 1979-12-07 | 1987-02-17 | Adir | Perhydroindole-2-carboxylic acids as antihypertensives |
| US4508729A (en) * | 1979-12-07 | 1985-04-02 | Adir | Substituted iminodiacids, their preparation and pharmaceutical compositions containing them |
| US4616029A (en) * | 1979-12-07 | 1986-10-07 | Adir | Perhydromdole-2-carboxylic acids as antihypertensives |
| JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
| IE52663B1 (en) * | 1980-04-02 | 1988-01-20 | Warner Lambert Co | Substituted acyl derivatives of octahydro-1h-indole-2-carboxylic acids |
| US4350704A (en) * | 1980-10-06 | 1982-09-21 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids |
| FR2480747A1 (fr) * | 1980-04-17 | 1981-10-23 | Roques Bernard | Derives d'acides amines et leur application therapeutique |
| PT73522B (en) * | 1980-08-18 | 1983-07-14 | Merck & Co Inc | Process for preparing substituted caprylolactam derivatives as antihypertensives |
| GR74635B (enExample) * | 1980-08-18 | 1984-06-29 | Merck & Co Inc | |
| IL63540A0 (en) * | 1980-08-18 | 1981-11-30 | Merck & Co Inc | Substituted enantholactam derivatives as antihypertensives |
| EP0048159A3 (en) * | 1980-09-17 | 1982-05-12 | University Of Miami | Novel carboxyalkyl peptides and thioethers and ethers of peptides as antihypertensive agents |
| US4344949A (en) * | 1980-10-03 | 1982-08-17 | Warner-Lambert Company | Substituted acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids |
| GR75775B (enExample) * | 1980-10-06 | 1984-08-02 | Merck & Co Inc | |
| ZA817261B (en) * | 1980-10-23 | 1982-09-29 | Schering Corp | Carboxyalkyl dipeptides,processes for their production and pharmaceutical compositions containing them |
| DE3174844D1 (en) * | 1980-10-23 | 1986-07-24 | Schering Corp | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them |
| US4296110A (en) * | 1980-10-28 | 1981-10-20 | E. I. Du Pont De Nemours And Company | Antihypertensive I-substituted cyclic lactam-2-carboxylic acids |
| AU543804B2 (en) * | 1980-10-31 | 1985-05-02 | Takeda Chemical Industries Ltd. | Amides having bicyclic substituents on nitrogen |
| GB2086390B (en) * | 1980-11-03 | 1984-06-06 | Ciba Geigy Ag | 1-carboxy-azaalkanoylindoline-2-carboxylic acids process for their manufacture pharmaceutical preparations containing these compounds and their therapeutic application |
| US4462943A (en) * | 1980-11-24 | 1984-07-31 | E. R. Squibb & Sons, Inc. | Carboxyalkyl amino acid derivatives of various substituted prolines |
| CY1406A (en) * | 1980-12-18 | 1988-04-22 | Schering Corp | Substituted dipeptides, processes for their preparation and pharmaceutical compositions containing them and their use in the inhibition of enkephalinase |
| US4906615A (en) * | 1980-12-18 | 1990-03-06 | Schering Corporation | Substituted dipeptides as inhibitors of enkephalinases |
| IE53315B1 (en) * | 1980-12-18 | 1988-10-12 | Schering Corp | Substituted dipeptides,processes for their preparation and pharmaceutical compositions containing them and their use in the inhibition of enkephalinase |
| DE3260505D1 (en) * | 1981-01-23 | 1984-09-13 | Takeda Chemical Industries Ltd | Alicyclic compounds, their production and use |
| US4532342A (en) * | 1981-02-20 | 1985-07-30 | Warner-Lambert Company | N-substituted amino acids as intermediates in the preparation of acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids |
| DE3272505D1 (en) * | 1981-03-09 | 1986-09-18 | Merck & Co Inc | Substituted thiazolidine carboxylic acid analogs and derivatives as antihypertensives |
| US4512979A (en) | 1981-03-23 | 1985-04-23 | Merck & Co., Inc. | Dipeptides containing thialysine and related amino acids as antihypertensives |
| US4820729A (en) * | 1981-03-30 | 1989-04-11 | Rorer Pharmaceutical Corporation | N-substituted-amido-amino acids |
| AU556932B2 (en) * | 1981-03-30 | 1986-11-27 | Usv Pharmaceutical Corp. | Dipetide with heterocyclic groiup |
| US4510322A (en) * | 1981-07-13 | 1985-04-09 | Merck & Co., Inc. | Indacrinone having enhanced uricosuric |
| US4454291A (en) * | 1981-07-20 | 1984-06-12 | American Home Products Corporation | N-(2-Substituted-1-oxoalkyl)-2,3-dihydro-1H-indole-2-carboxylic acid derivatives |
| US4454292A (en) * | 1981-07-20 | 1984-06-12 | American Home Products Corporation | N-[2-Substituted-1-oxoalkyl]-2,3-dihydro-1H-indole-2-carboxylic acid derivatives |
| CS226907B1 (en) * | 1981-08-07 | 1984-04-16 | Kasafirek Evzen | Alkylamides of carboxyalkanoylpeptides |
| ZA826022B (en) * | 1981-08-21 | 1983-08-31 | Univ Miami | Novel complex amido and imido derivatives of carboxyalkyl peptides and thioethers and ethers of peptides |
| US4766110A (en) * | 1981-08-21 | 1988-08-23 | Ryan James W | Novel complex amido and imido derivatives of carboxyalkyl peptides |
| DE3226768A1 (de) * | 1981-11-05 | 1983-05-26 | Hoechst Ag, 6230 Frankfurt | Derivate der cis, endo-2-azabicyclo-(3.3.0)-octan-3-carbonsaeure, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung |
| US4410520A (en) * | 1981-11-09 | 1983-10-18 | Ciba-Geigy Corporation | 3-Amino-[1]-benzazepin-2-one-1-alkanoic acids |
| EP0079522B1 (en) * | 1981-11-09 | 1986-05-07 | Merck & Co. Inc. | N-carboxymethyl(amidino)lysyl-proline antihypertensive agents |
| EP0079521A1 (en) * | 1981-11-09 | 1983-05-25 | Merck & Co. Inc. | Process for preparation of carboxyalkyldipeptide derivatives |
| EP0081094A1 (en) * | 1981-11-12 | 1983-06-15 | Merck & Co. Inc. | Substituted omega-amino-carboxymethyldipeptide antihypertensive agents |
| EP0080822A1 (en) * | 1981-11-27 | 1983-06-08 | Beecham Group Plc | Anti-hypertensive prolinol-based peptides |
| US4503043A (en) * | 1981-12-07 | 1985-03-05 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-isoindole-1-carboxylic acids |
| NZ202903A (en) * | 1981-12-29 | 1988-01-08 | Hoechst Ag | 1-- pe pyrrol-2-yl-carboxylic acid derivatives and pharmaceutical compositions |
| JPS58126851A (ja) * | 1982-01-11 | 1983-07-28 | メルク エンド カムパニー インコーポレーテッド | 抗高血圧剤として有用なアミノアシル含有ジペプチド誘導体 |
| DE3378266D1 (en) * | 1982-01-11 | 1988-11-24 | Merck & Co Inc | Aminoacyl-containing dipeptide derivatives useful as antihypertensives |
| US4555502A (en) * | 1982-09-30 | 1985-11-26 | Merck & Co., Inc. | Aminoacyl-containing dipeptide derivatives useful as antihypertensives |
| IE54551B1 (en) * | 1982-01-22 | 1989-11-22 | Ici Plc | Amide derivatives |
| US4665087A (en) * | 1982-02-22 | 1987-05-12 | Ciba-Geigy Corporation | 1-(carbamyl, thiocarbamyl, and iminocarbamyl)-indoline derivatives |
| DE3360065D1 (en) * | 1982-03-08 | 1985-03-28 | Schering Corp | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them |
| US4410807A (en) * | 1982-03-26 | 1983-10-18 | Kay Industries, Inc. | Regulating device for polyphase electrical circuits |
| DE3211397A1 (de) * | 1982-03-27 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | Spiro (4.(3+n))-2-aza-3-carbonsaeure-derivate, verfahren zu ihrer herstellung, diese enthaltende mittel und ihre verwendung |
| DE3211676A1 (de) * | 1982-03-30 | 1983-10-06 | Hoechst Ag | Neue derivate von cycloalka (c) pyrrol-carbonsaeuren, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung sowie neue cycloalka (c) pyrrol-carbonsaeuren als zwischenstufen und verfahren zu deren herstellung |
| JPS58188847A (ja) * | 1982-04-26 | 1983-11-04 | Takeda Chem Ind Ltd | ペプチド誘導体 |
| US4681886A (en) * | 1982-04-30 | 1987-07-21 | E. R. Squibb & Sons, Inc. | Substituted 4-phenoxy or 4-phenylthio prolines |
| US4555503A (en) * | 1982-05-05 | 1985-11-26 | Merck & Co., Inc. | N2 -(Substituted)carboxymethyl-N6 -(substituted)-lysyl-and αε-aminoalkyl)glycyl amino acid antihypertensive agents |
| US4483850A (en) * | 1982-05-10 | 1984-11-20 | Merck & Co., Inc. | N-Terminal substituted oligopeptide converting enzyme inhibitors |
| ZA833214B (en) * | 1982-05-12 | 1983-12-28 | Hoffmann La Roche | Bicyclic compounds |
| GB2128984B (en) * | 1982-05-12 | 1985-05-22 | Hoffmann La Roche | Diaza-bicyclic compounds |
| AU563196B2 (en) * | 1982-05-18 | 1987-07-02 | Smithkline Beckman Corporation | Peptide prodrug transport system |
| JPS6058233B2 (ja) * | 1982-05-24 | 1985-12-19 | 田辺製薬株式会社 | 2−オキソイミダゾリジン誘導体及びその製法 |
| US4442030A (en) * | 1982-06-07 | 1984-04-10 | Merck & Co., Inc. | Process for preparing carboxyalkyl dipeptides |
| DE3376649D1 (en) * | 1982-06-17 | 1988-06-23 | Schering Corp | Substituted dipeptides, methods for their production, pharmaceutical compositions containing them, method for making such pharmaceutical compositions |
| US4442089A (en) * | 1982-07-06 | 1984-04-10 | E. R. Squibb & Sons, Inc. | Method for treating glaucoma with topical or systemic ACE inhibitor compositions |
| EP0099709A3 (en) * | 1982-07-19 | 1985-11-13 | Imperial Chemical Industries Plc | Amide derivatives |
| US4473575A (en) * | 1982-07-19 | 1984-09-25 | Ciba-Geigy Corporation | 3-Amino-(1)-benzazepin-2-one-1-alkanoic acids |
| US4470973A (en) * | 1982-07-19 | 1984-09-11 | E. R. Squibb & Sons, Inc. | Substituted peptide compounds |
| AU1643283A (en) * | 1982-07-19 | 1984-01-26 | E.R. Squibb & Sons, Inc. | Substituted peptides |
| US4736066A (en) * | 1982-07-19 | 1988-04-05 | E. R. Squibb & Sons, Inc. | Intermediate for substituted peptide compounds |
| US4661515A (en) * | 1982-07-21 | 1987-04-28 | Usv Pharmaceutical Corporation | Compounds having angiotensin converting enzyme inhibitory activity and diuretic activity |
| US4621092A (en) * | 1982-07-22 | 1986-11-04 | E. R. Squibb & Sons, Inc. | Substituted proline compounds, composition and method of use |
| US4742067A (en) * | 1982-07-22 | 1988-05-03 | E. R. Squibb & Sons, Inc. | Acylalkylaminocarbonyl substituted amino and imino acid compounds |
| US4487716A (en) * | 1982-08-23 | 1984-12-11 | American Home Products Corporation | N-(1-Carboxy-3-phenylpropyl)-dipeptides |
| US4439364A (en) * | 1982-09-01 | 1984-03-27 | E. I. Du Pont De Nemours & Company | Process for preparing antihypertensive 1-substituted cyclic lactam-2-carboxylic acids and their derivatives |
| US4866173A (en) * | 1982-09-22 | 1989-09-12 | Rorer Pharmaceutical Corporation | Therapeutic substituted semicarbazides |
| US4500713A (en) * | 1982-09-23 | 1985-02-19 | Usv Pharmaceutical Corporation | Therapeutic dipeptides |
| US4634716A (en) * | 1982-09-30 | 1987-01-06 | Merck & Co., Inc. | Substituted N-carboxymethyl-aminoacylaminoalkanoic acids useful as antihypertensive agents |
| US4499079A (en) * | 1982-11-18 | 1985-02-12 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy alkanoyl and cycloalkanoyl peptides |
| US4587234A (en) * | 1982-11-18 | 1986-05-06 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy alkanoyl and cycloalkanoyl peptides |
| US4642315A (en) * | 1982-11-18 | 1987-02-10 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy alkanoyl and cycloalkanoyl peptides |
| US4482544A (en) * | 1982-11-29 | 1984-11-13 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| US4456595A (en) * | 1982-12-06 | 1984-06-26 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy aroly peptides |
| US4826812A (en) * | 1982-12-27 | 1989-05-02 | Schering Corporation | Antiglaucoma agent |
| DE3300774A1 (de) * | 1983-01-12 | 1984-07-12 | Hoechst Ag, 6230 Frankfurt | Neue spirocyclische aminosaeuren, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung sowie neue spirocyclische aminosaeuren als zwischenprodukte und verfahren zu deren herstellung |
| US4496541A (en) * | 1983-01-12 | 1985-01-29 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| DE3302125A1 (de) * | 1983-01-22 | 1984-07-26 | Boehringer Ingelheim KG, 6507 Ingelheim | Aminosaeure-derivate, verfahren zu ihrer herstellung und verwendung |
| EP0115091A1 (en) * | 1983-01-27 | 1984-08-08 | ENI-Ente Nazionale Idrocarburi | N-carboxyacyl derivatives of cyclic amino acids, useful as antihypertensives |
| US5175306A (en) * | 1983-01-31 | 1992-12-29 | Hoechst Aktiengesellschaft | Process for the resolution of racemates of optically active bicyclic imino-α-carboxylic esters |
| US4659711A (en) * | 1983-01-31 | 1987-04-21 | Usv Pharmaceutical Corporation | 1,2,3,4-Tetrahydrophthalazine and hexahydropyridazine compounds for treating hypertension |
| US4711884A (en) * | 1983-02-28 | 1987-12-08 | E. R. Squibb & Sons, Inc. | Thiazine and thiazepine containing compounds |
| US4596791A (en) * | 1983-03-16 | 1986-06-24 | Usv Pharmaceutical Corp. | Compounds for treating hypertension |
| US4666906A (en) * | 1983-03-16 | 1987-05-19 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| US4481191A (en) * | 1983-03-30 | 1984-11-06 | The Regents Of The University Of California | Method for controlling blood pressure |
| GB8311286D0 (en) * | 1983-04-26 | 1983-06-02 | Searle & Co | Carboxyalkyl peptide derivatives |
| US4585758A (en) * | 1983-05-20 | 1986-04-29 | Usv Pharmaceutical Corp. | Angiotensin-converting enzyme inhibitors |
| EP0127124A3 (en) * | 1983-05-23 | 1987-04-08 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| US4574079A (en) * | 1983-05-27 | 1986-03-04 | Gavras Haralambos P | Radiolabeled angiotensin converting enzyme inhibitors for radiolabeling mammalian organ sites |
| US4584285A (en) * | 1983-06-02 | 1986-04-22 | Schering Corporation | Antihypertensive agents |
| US4783444A (en) * | 1984-09-17 | 1988-11-08 | Schering Corporation | Antiglaucoma compositions and methods |
| US4840772A (en) * | 1983-06-02 | 1989-06-20 | Schering Corporation | Antiglaucoma compositions and methods |
| US4472384A (en) * | 1983-06-15 | 1984-09-18 | Merck & Co., Inc. | Antihypertensive composition |
| US4514391A (en) * | 1983-07-21 | 1985-04-30 | E. R. Squibb & Sons, Inc. | Hydroxy substituted peptide compounds |
| DE3333454A1 (de) * | 1983-09-16 | 1985-04-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von n-alkylierten dipeptiden und deren estern |
| DE3333455A1 (de) * | 1983-09-16 | 1985-04-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung n-alkylierter dipeptide und deren estern |
| EP0137746A3 (en) * | 1983-09-22 | 1986-01-08 | FISONS plc | Nitrogen substituted angiotensin converting enzyme inhibitors |
| US4642355A (en) * | 1984-02-24 | 1987-02-10 | Otsuka Pharmaceutical Factory, Inc. | Proline derivatives |
| WO1985003873A1 (en) * | 1984-03-01 | 1985-09-12 | Vernon Erk | Method of treating hypertension in vertebrates |
| FI850948L (fi) * | 1984-03-12 | 1985-09-13 | Pfizer | Renin inhibitorer som innehaoller statin eller dess derivat. |
| US4536501A (en) * | 1984-03-30 | 1985-08-20 | E. R. Squibb & Sons, Inc. | Substituted 4-phenoxy or 4-phenylthio prolines |
| US4568666A (en) * | 1984-10-18 | 1986-02-04 | G. D. Searle & Co. | Carboxylalkyl peptide derivatives |
| DE3413710A1 (de) * | 1984-04-12 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur behandlung der herzinsuffizienz |
| DE3482590D1 (de) | 1984-04-12 | 1990-08-02 | Searle & Co | Carboxyalkyl-peptid-derivate. |
| US5684016A (en) * | 1984-04-12 | 1997-11-04 | Hoechst Aktiengesellschaft | Method of treating cardiac insufficiency |
| US4558150A (en) * | 1984-04-19 | 1985-12-10 | E. R. Squibb & Sons, Inc. | Intermediates for preparing amino thiol dipeptides |
| US4500518A (en) * | 1984-04-19 | 1985-02-19 | E. R. Squibb & Sons, Inc. | Amino thiol dipeptides |
| AU569789B2 (en) * | 1984-05-03 | 1988-02-18 | Brigham And Women's Hospital | A.c.e. inhibitors to treat renal diseases |
| US4558037A (en) * | 1984-06-04 | 1985-12-10 | Merck & Co., Inc. | Cardiovascular composition |
| EP0168769A3 (en) * | 1984-07-16 | 1989-02-08 | Merck & Co. Inc. | Process for preparing carboxyalkyl dipeptides |
| US4801721A (en) * | 1984-08-16 | 1989-01-31 | Ryan James W | Stereospecific synthesis of carboxyalkyl peptides |
| USH642H (en) | 1984-08-20 | 1989-06-06 | E. R. Squibb & Sons, Inc. | Substituted urido amino and imino acids and esters |
| US4626545A (en) * | 1984-08-27 | 1986-12-02 | Merck & Co., Inc. | Amino acid derivatives as enzyme inhibitors |
| DE3431541A1 (de) * | 1984-08-28 | 1986-03-06 | Hoechst Ag, 6230 Frankfurt | Cis,endo-2-azabicycloalkan-3-carbonsaeure-derivate, verfahren zu deren herstellung, deren verwendung sowie zwischenprodukte bei deren herstellung |
| GB8422165D0 (en) * | 1984-09-01 | 1984-10-03 | Wellcome Found | Compounds |
| US4746676A (en) * | 1984-09-12 | 1988-05-24 | Rorer Pharmaceutical Corporation | Carboxyalkyl dipeptide compounds |
| IT1176983B (it) * | 1984-10-16 | 1987-08-26 | Zambon Spa | Dipeptidi ad attivita' farmacologica |
| DE3437917A1 (de) * | 1984-10-17 | 1986-04-17 | Bayer Ag, 5090 Leverkusen | Kombination von dihydropyridinen mit ace-hemmern sowie ihre verwendung in arzneimitteln |
| FR2575163B1 (fr) * | 1984-12-20 | 1987-03-20 | Sanofi Sa | Tri- et tetrapeptides reduits inhibiteurs de la secretion gastrique, procede d'obtention et compositions pharmaceutiques les contenant |
| CS250699B2 (en) * | 1984-12-21 | 1987-05-14 | Pfizer | Method of octahydro-6-azaindole's depetidic derivatives production |
| EP0187037A3 (en) * | 1984-12-21 | 1988-03-23 | Takeda Chemical Industries, Ltd. | Piperidine derivatives, their production and use |
| US4762821A (en) * | 1985-03-22 | 1988-08-09 | Syntex (U.S.A.) Inc. | N',N"-dialkylguanidino dipeptides |
| CN86101850A (zh) * | 1985-03-22 | 1987-02-04 | 森得克斯(美国)有限公司 | N,n′-二烷基胍基二肽的制造方法与用途 |
| DE3680578D1 (de) * | 1985-04-16 | 1991-09-05 | Suntory Ltd | Dipeptid-derivate, verfahren zur herstellung, pharmazeutische zusammensetzungen und ihre anwendung. |
| ES8604609A1 (es) * | 1985-07-02 | 1986-02-01 | Uriach & Cia Sa J | Procedimiento para la obtencion de la 1-(n-(1(r,s)-(etoxi- carbonil)-3-fenilpropil)-l-alanil)-l-prolina |
| ATE72431T1 (de) | 1985-08-31 | 1992-02-15 | Fisons Plc | 5-gliedrige heterocyclische angiotensinumwandlungsenzym-inhibitoren. |
| US5256687A (en) * | 1985-09-09 | 1993-10-26 | Hoechst Aktiengesellschaft | Pharmaceutical composition for the treatment of high blood pressure |
| DE3532036A1 (de) * | 1985-09-09 | 1987-03-26 | Hoechst Ag | Pharmazeutische zubereitung zur behandlung des bluthochdrucks |
| US5231080A (en) * | 1985-10-15 | 1993-07-27 | Hoechst Aktiengesellschaft | Method for the treatment of atherosclerosis, thrombosis, and peripheral vessel disease |
| US4886813A (en) * | 1985-11-13 | 1989-12-12 | Otsuka Pharmaceutical Factory, Inc. | Proline derivatives |
| JPH0653757B2 (ja) * | 1985-12-06 | 1994-07-20 | 味の素株式会社 | プロリン誘導体の芳香族スルホン酸塩 |
| JPH0662671B2 (ja) * | 1986-01-17 | 1994-08-17 | 株式会社大塚製薬工場 | プロリン誘導体 |
| US4771037A (en) * | 1986-01-21 | 1988-09-13 | Ici Americas Inc. | N-carboxyalkyl compounds |
| IL81707A0 (en) * | 1986-02-28 | 1987-09-16 | Wellcome Found | Heteroaromatic derivatives,their preparation and pharmaceutical compositions containing them |
| IL81704A0 (en) * | 1986-02-28 | 1987-09-16 | Wellcome Found | Naphthyl and indolyl derivatives,their preparation and pharmaceutical compositions containing them |
| US5231084A (en) * | 1986-03-27 | 1993-07-27 | Hoechst Aktiengesellschaft | Compounds having a cognition adjuvant action, agents containing them, and the use thereof for the treatment and prophylaxis of cognitive dysfuncitons |
| EP0239306B1 (en) | 1986-03-27 | 1993-06-02 | Merck Frosst Canada Inc. | Tetrahydrocarbazole esters |
| US4738850A (en) * | 1986-05-27 | 1988-04-19 | E. R. Squibb & Sons, Inc. | Controlled release formulation and method |
| EP0566157A1 (en) | 1986-06-20 | 1993-10-20 | Schering Corporation | Neutral metalloendopeptidase inhibitors in the treatment of hypertension |
| US4749688A (en) * | 1986-06-20 | 1988-06-07 | Schering Corporation | Use of neutral metalloendopeptidase inhibitors in the treatment of hypertension |
| EP0254032A3 (en) * | 1986-06-20 | 1990-09-05 | Schering Corporation | Neutral metalloendopeptidase inhibitors in the treatment of hypertension |
| AT395012B (de) * | 1986-06-27 | 1992-08-25 | Richter Gedeon Vegyeszet | Verfahren zur herstellung von n-(1(s)|thoxycarbonyl-3-phenyl-propyl)-(s)-alanyl-(s)prolin und von dessen saeureadditionssalzen |
| DE3627613A1 (de) * | 1986-08-14 | 1988-02-18 | Merck Patent Gmbh | Pharmazeutische zubereitung |
| DE3774975D1 (de) * | 1986-09-10 | 1992-01-16 | Syntex Inc | Selektive amidinierung von diaminen. |
| US5948939A (en) * | 1986-09-10 | 1999-09-07 | Syntex (U.S.A.) Inc. | Selective amidination of diamines |
| DE3633496A1 (de) * | 1986-10-02 | 1988-04-14 | Hoechst Ag | Kombination von angiotensin-converting-enzyme-hemmern mit calciumantagonisten sowie deren verwendung in arzneimitteln |
| DE3639879A1 (de) * | 1986-11-21 | 1988-06-01 | Hoechst Ag | Verfahren zur herstellung von mono-, bi- und tricyclischen aminosaeuren, zwischenprodukte dieses verfahrens sowie ein verfahren zu deren herstellung |
| JPH075633B2 (ja) * | 1987-02-19 | 1995-01-25 | アサヒビール株式会社 | アミノ酸誘導体その製造方法及び血圧降下剤 |
| CA1313724C (en) * | 1987-02-19 | 1993-02-16 | Shizuo Saito | Aminoacid derivatives as antihypertensives |
| US4837354A (en) * | 1987-02-26 | 1989-06-06 | Merrell Dow Pharmaceuticals Inc. | Process for making and isolating (R)-2-hydroxy-4-phenylbutyric acid and esters |
| US5262436A (en) * | 1987-03-27 | 1993-11-16 | Schering Corporation | Acylamino acid antihypertensives in the treatment of congestive heart failure |
| JPH0657707B2 (ja) * | 1987-05-25 | 1994-08-03 | 吉富製薬株式会社 | ピペリジン化合物 |
| CA1337400C (en) * | 1987-06-08 | 1995-10-24 | Norma G. Delaney | Inhibitors of neutral endopeptidase |
| DE3722007A1 (de) * | 1987-07-03 | 1989-01-12 | Hoechst Ag | Verfahren zur herstellung bicyclischer aminocarbonsaeuren, zwischenprodukte dieses verfahrens und deren verwendung |
| FR2619813B1 (fr) * | 1987-08-28 | 1991-05-03 | Adir | Nouveaux derives de l'acide aza - 2 bicyclooctane carboxylique - 3, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent |
| USH734H (en) | 1988-03-07 | 1990-02-06 | E. R. Squibb & Sons, Inc. | Method for inhibiting onset of or treating migraine headaches employing an ACE inhibitor |
| DE3739690A1 (de) * | 1987-11-24 | 1989-06-08 | Hoechst Ag | Stabilisierte arzneistoffe, verfahren zu ihrer herstellung sowie stabile arzneizubereitungen |
| US5110927A (en) * | 1987-12-31 | 1992-05-05 | The United States Of America As Represented By The Department Of Health And Human Services | Prazosin analog with increased selectivity and duration of action |
| DE3803225A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ag | Aminosaeureamide mit psychotroper wirkung, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
| US5136044A (en) * | 1988-04-04 | 1992-08-04 | Kanegafuchi Kagaku Kogyo Kabushiki Kaisha | N2 -carboxy-3-phenylpropyl)-l-lysine derivative and process of producing lysinolpril using the compound |
| IL90189A0 (en) * | 1988-06-01 | 1989-12-15 | Squibb & Sons Inc | Pharmaceutical compositions containing a benzazepine-type calcium channel blocker |
| GB8827308D0 (en) * | 1988-11-23 | 1988-12-29 | British Bio Technology | Compounds |
| GB8827305D0 (en) * | 1988-11-23 | 1988-12-29 | British Bio Technology | Compounds |
| SE506179C2 (sv) * | 1989-01-23 | 1997-11-17 | Ciba Geigy Ag | Farmaceutisk lågkomposition av benazepril och ett tiaziddiuretikum |
| ZA902661B (en) * | 1989-04-10 | 1991-01-30 | Schering Corp | Mercapto-acyl amino acids |
| DE3915236A1 (de) * | 1989-05-10 | 1990-11-15 | Merck Patent Gmbh | Pharmazeutische zubereitung |
| FI94339C (fi) | 1989-07-21 | 1995-08-25 | Warner Lambert Co | Menetelmä farmaseuttisesti käyttökelpoisen /R-(R*,R*)/-2-(4-fluorifenyyli)- , -dihydroksi-5-(1-metyylietyyli)-3-fenyyli-4-/(fenyyliamino)karbonyyli/-1H-pyrroli-1-heptaanihapon ja sen farmaseuttisesti hyväksyttävien suolojen valmistamiseksi |
| US5110799A (en) * | 1989-07-28 | 1992-05-05 | Merck & Co., Inc. | Antiherpetic agents |
| DE3926606A1 (de) * | 1989-08-11 | 1991-02-14 | Hoechst Ag | Verfahren zur behandlung der cardialen sowie der vasculaeren hypertrophie und hyperplasie |
| GB8919251D0 (en) * | 1989-08-24 | 1989-10-04 | British Bio Technology | Compounds |
| US5212165A (en) * | 1989-10-23 | 1993-05-18 | E. R. Squibb & Sons, Inc. | Method for rehabilitating the vasorelaxant action of the coronary arteries impaired through atherosclerosis or hypercholesterolemia employing an ace inhibitor |
| US5389610A (en) * | 1989-11-21 | 1995-02-14 | Schering Corporation | Carboxyalkylcarbonyl aminoacid endopeptidase inhibitors |
| AU7168091A (en) * | 1989-12-22 | 1991-07-24 | Schering Corporation | Mercaptocycloacyl aminoacid endopeptidase inhibitors |
| US5075302A (en) * | 1990-03-09 | 1991-12-24 | Schering Corporation | Mercaptoacyl aminolactam endopeptidase inhibitors |
| US5821232A (en) * | 1990-05-11 | 1998-10-13 | Pfizer Inc. | Synergistic therapeutic compositions and methods |
| AU653724B2 (en) * | 1990-05-11 | 1994-10-13 | Pfizer Inc. | Synergistic therapeutic compositions and methods |
| US5166143A (en) * | 1990-05-31 | 1992-11-24 | E. R. Squibb & Sons, Inc. | Method for preventing onset of restenosis after angioplasty employing an ace inhibitor |
| US6300362B1 (en) | 1990-07-25 | 2001-10-09 | Novartis Ag (Formerly Sandoz Ltd.) | Stabilized pharmaceutical compositions comprising acid donors |
| US5173506A (en) * | 1990-08-16 | 1992-12-22 | Schering Corporation | N-(mercaptoalkyl)ureas and carbamates |
| TW197945B (enExample) * | 1990-11-27 | 1993-01-11 | Hoechst Ag | |
| EP0490379A3 (de) * | 1990-12-13 | 1992-06-24 | BERLIN-CHEMIE Aktiengesellschaft | Diaminosäurederivate und pharmazeutische Zusammensetzungen |
| US5124152A (en) * | 1991-01-07 | 1992-06-23 | Fisons Corporation | Parenteral formulation of metolazone |
| GB9102635D0 (en) * | 1991-02-07 | 1991-03-27 | British Bio Technology | Compounds |
| US5530161A (en) * | 1991-07-08 | 1996-06-25 | British Bio-Technology Limited | Hydroxamic acid based collagenase inhibitors |
| US5977160A (en) * | 1992-04-10 | 1999-11-02 | Brigham And Women's Hospital, Inc. | Methods for reducing risk of repeat myocardial infarction and increasing survival in heart attack victims |
| US5972990A (en) * | 1992-04-10 | 1999-10-26 | Brigham And Women's Hospital, Inc. | Methods for reducing risk of repeat myocardial infarction and increasing survival in heart attack victims |
| US5552397A (en) * | 1992-05-18 | 1996-09-03 | E. R. Squibb & Sons, Inc. | Substituted azepinone dual inhibitors of angiotensin converting enzyme and neutral exdopeptidase |
| US5504080A (en) * | 1992-10-28 | 1996-04-02 | Bristol-Myers Squibb Co. | Benzo-fused lactams |
| US5589499A (en) * | 1992-11-25 | 1996-12-31 | Weth; Gosbert | Dopaminergic agents for the treatment of cerebral and peripheral blood flow disorders |
| FR2701948B1 (fr) * | 1993-02-22 | 1996-07-26 | Exsymol Sa | Produit de couplage de l'histamine ou l'histamine méthyl-substituée et d'un acide aminé, procédé de préparation et applications thérapeutiques, cosmétologiques et agroalimentaires. |
| US5455353A (en) * | 1993-03-24 | 1995-10-03 | Hoffmann-La Roche Inc. | 4-(benzyl-2-oxo-oxazolidin-5 ylmethyl)N tertbutyl-decahydroisoquinoline-3-carboxamides |
| US5654294A (en) * | 1993-05-13 | 1997-08-05 | Bristol-Myers Squibb | Spiro lactam dual action inhibitors |
| US5508272A (en) * | 1993-06-15 | 1996-04-16 | Bristol-Myers Squibb Company | Compounds containing a fused bicycle ring and processes therefor |
| PT634175E (pt) * | 1993-07-15 | 2001-06-29 | Hoffmann La Roche | Combinacao farmaceutica que contem um inibidor do sistema renina-angiotensina e o antagonista de endotelina |
| US5362727A (en) * | 1993-07-26 | 1994-11-08 | Bristol-Myers Squibb | Substituted azepino[2,1-a]isoquinoline compounds |
| FR2711990B1 (fr) * | 1993-11-05 | 1995-12-08 | Exsymol Sa | Produit pseudodipeptide possédant un groupement imidazole, et applications thérapeutiques, cosmétologiques et agroalimentaires. |
| US5525723A (en) * | 1993-11-18 | 1996-06-11 | Bristol-Myers Squibb Co. | Compounds containing a fused multiple ring lactam |
| CA2186606A1 (en) * | 1994-03-29 | 1995-10-05 | Edward B. Nelson | Treatment of atherosclerosis with angiotensin ii receptor blocking imidazoles |
| AU2394795A (en) * | 1994-04-28 | 1995-11-29 | Du Pont Merck Pharmaceutical Company, The | Hydroxamic acid and amino acid derivatives and their use as anti-arthritic agents |
| US5616775A (en) * | 1994-05-05 | 1997-04-01 | Bristol-Myers Squibb Co. | Process for preparing homocystein analogs useful as intermediates for compounds containing a fused bicyclic ring |
| WO1996002564A1 (en) * | 1994-07-13 | 1996-02-01 | Lek, Tovarna Farmacevtskih In Kemicnih Izdelkov, D.D. | Process for the preparation of compounds having ace inhibitory action as well as novel compounds useful as starting materials or intermediates in said process |
| US5562921A (en) * | 1994-07-15 | 1996-10-08 | Sherman; Bernard C. | Stable solid pharmaceutical compositions containing enalapril maleate |
| US5601801A (en) * | 1994-08-02 | 1997-02-11 | Merck Frosst Canada, Inc. | Radiolabelled angiotensin converting enzyme inhibitors |
| CN1065860C (zh) * | 1994-08-27 | 2001-05-16 | 王隶书 | 提取盐酸甜菜碱工艺 |
| DE4431530C2 (de) * | 1994-09-03 | 2002-01-31 | Degussa | Verfahren zur Herstellung von 2-[3(S)-Amino-2(R)-hydroxy-4-phenylbutyl]-N-tert.butyl-decahydro-(4aS,8aS)-isochinolin-3(S)-carboxamid |
| US5587375A (en) * | 1995-02-17 | 1996-12-24 | Bristol-Myers Squibb Company | Azepinone compounds useful in the inhibition of ACE and NEP |
| AU5445596A (en) | 1995-04-11 | 1996-10-30 | Merck & Co., Inc. | Bioprocess for production of dipeptide based compounds |
| US5877313A (en) * | 1995-05-17 | 1999-03-02 | Bristol-Myers Squibb | Benzo-fused azepinone and piperidinone compounds useful in the inhibition of ACE and NEP |
| US5635504A (en) * | 1995-06-07 | 1997-06-03 | Bristol-Myers Squibb Co. | Diazepine containing dual action inhibitors |
| US5650408A (en) * | 1995-06-07 | 1997-07-22 | Karanewsky; Donald S. | Thiazolo benzazepine containing dual action inhibitors |
| US7056935B2 (en) | 1995-06-07 | 2006-06-06 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US20020042377A1 (en) * | 1995-06-07 | 2002-04-11 | Steiner Joseph P. | Rotamase enzyme activity inhibitors |
| US5859031A (en) * | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
| CN1053437C (zh) * | 1995-07-19 | 2000-06-14 | 五洲药厂 | 赖诺普利合成方法 |
| US5573780A (en) * | 1995-08-04 | 1996-11-12 | Apotex Usa Inc. | Stable solid formulation of enalapril salt and process for preparation thereof |
| US5550127A (en) * | 1995-09-07 | 1996-08-27 | Pantano; James A. | Method of treatment for eiph in racing stock |
| US5670655A (en) * | 1995-09-15 | 1997-09-23 | Merck & Co. Inc. | Method for analyzing isomers of enalapril and enalaprilat |
| CA2231043A1 (en) * | 1995-09-15 | 1997-03-20 | Xue-Zhi Qin | Method for analyzing isomers of enalapril and enalaprilat |
| US5801197A (en) * | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| WO1997049392A1 (en) * | 1996-06-24 | 1997-12-31 | Merck & Co., Inc. | A composition of enalapril and losartan |
| CA2182258C (en) * | 1996-07-29 | 2001-04-17 | K.S. Keshava Murthy | Sodium enalapril complex and the use thereof to make sodium enalapril |
| US5801187A (en) * | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
| US6218424B1 (en) | 1996-09-25 | 2001-04-17 | Gpi Nil Holdings, Inc. | Heterocyclic ketone and thioester compounds and uses |
| US5786378A (en) * | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
| RU2140261C1 (ru) * | 1997-04-03 | 1999-10-27 | Открытое акционерное общество "АЙ СИ ЭН Лексредства" | Твердая лекарственная форма на основе малеата эналаприла |
| US5945441A (en) | 1997-06-04 | 1999-08-31 | Gpi Nil Holdings, Inc. | Pyrrolidine carboxylate hair revitalizing agents |
| US6274602B1 (en) * | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic thioester and ketone hair growth compositions and uses |
| US20010049381A1 (en) | 1997-06-04 | 2001-12-06 | Gpl Nil Holdings, Inc., | Pyrrolidine derivative hair growth compositions and uses |
| US6187784B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Pipecolic acid derivative hair growth compositions and uses |
| US6271244B1 (en) | 1998-06-03 | 2001-08-07 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioester hair growth compositions and uses |
| US6187796B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Sulfone hair growth compositions and uses |
| RU2141483C1 (ru) * | 1997-07-04 | 1999-11-20 | Небольсин Владимир Евгеньевич | Производные пептидов или их фармацевтически приемлемые соли, способ их получения, применение и фармацевтическая композиция |
| US6570062B1 (en) * | 1997-07-21 | 2003-05-27 | Ohio University | Synthetic genes for plant gums and other hydroxyproline-rich glycoproteins |
| US6548642B1 (en) * | 1997-07-21 | 2003-04-15 | Ohio University | Synthetic genes for plant gums |
| US7378506B2 (en) * | 1997-07-21 | 2008-05-27 | Ohio University | Synthetic genes for plant gums and other hydroxyproline-rich glycoproteins |
| US6639050B1 (en) | 1997-07-21 | 2003-10-28 | Ohio University | Synthetic genes for plant gums and other hydroxyproline-rich glycoproteins |
| IN184759B (enExample) | 1997-07-22 | 2000-09-23 | Kaneka Corp | |
| IT1299341B1 (it) * | 1998-02-09 | 2000-03-16 | Pfc Italiana Srl | Processo per la produzione di alcossicarbonildipeptidi intermedi nella sintesi del lisinopril. |
| US6296871B1 (en) | 1998-04-12 | 2001-10-02 | Ranbaxy Laboratories Limited | Stable solid pharmaceutical compositions containing enalapril maleate |
| US6429215B1 (en) | 1998-06-03 | 2002-08-06 | Gpi Nil Holdings, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US6172087B1 (en) | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
| CA2334204A1 (en) | 1998-06-03 | 1999-12-09 | Gpi Nil Holdings, Inc. | Heterocyclic ester and amide hair growth compositions and uses |
| SK18302000A3 (sk) | 1998-06-03 | 2001-06-11 | Gpi Nil Holdings, Inc. | N-viazané sulfónamidy n-heterocyklických karboxylových kyselín a izosterov karboxylových kyselín, farmaceutický prostriedok s ich obsahom a ich použitie |
| HK1038879B (zh) * | 1998-06-05 | 2004-10-08 | 沃尼尔‧朗伯公司 | 利用氧化镁稳定的含ace抑制剂的组合物 |
| HUP0004149A3 (en) * | 1998-07-21 | 2002-09-30 | Kaneka Corp | Method for crystallizing maleic acid salt of n-(1(s)-ethoxycarbonyl-3-phenylpropyl)-l-alanyl-l-proline |
| US6218423B1 (en) | 1998-08-14 | 2001-04-17 | Gpi Nil Holdings, Inc. | Pyrrolidine derivatives for vision and memory disorders |
| US6376517B1 (en) | 1998-08-14 | 2002-04-23 | Gpi Nil Holdings, Inc. | Pipecolic acid derivatives for vision and memory disorders |
| US7338976B1 (en) | 1998-08-14 | 2008-03-04 | Gpi Nil Holdings, Inc. | Heterocyclic esters or amides for vision and memory disorders |
| US6506788B1 (en) | 1998-08-14 | 2003-01-14 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioesters for vision and memory disorders |
| US6395758B1 (en) | 1998-08-14 | 2002-05-28 | Gpi Nil Holdings, Inc. | Small molecule carbamates or ureas for vision and memory disorders |
| US6399648B1 (en) | 1998-08-14 | 2002-06-04 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic ester, amide, thioester, or ketone for vision and memory disorders |
| US6337340B1 (en) | 1998-08-14 | 2002-01-08 | Gpi Nil Holdings, Inc. | Carboxylic acids and isosteres of heterocyclic ring compounds having multiple heteroatoms for vision and memory disorders |
| US6384056B1 (en) | 1998-08-14 | 2002-05-07 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters or ketones for vision and memory disorders |
| US6335348B1 (en) | 1998-08-14 | 2002-01-01 | Gpi Nil Holdings, Inc. | Nitrogen-containing linear and azepinyl/ compositions and uses for vision and memory disorders |
| US6339101B1 (en) | 1998-08-14 | 2002-01-15 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of N-heterocyclic carboxylic acids or isosteres for vision and memory disorders |
| US6333340B1 (en) | 1998-08-14 | 2001-12-25 | Gpi Nil Holdings, Inc. | Small molecule sulfonamides for vision and memory disorders |
| US6191144B1 (en) | 1998-08-17 | 2001-02-20 | Warner-Lambert Company | Method of using angiotensin converting enzyme inhibitor to stimulate angiogenesis |
| WO2000018392A1 (en) | 1998-09-25 | 2000-04-06 | Glycox Corporation Limited | Fructosamine oxidase: antagonists and inhibitors |
| US6462072B1 (en) | 1998-09-21 | 2002-10-08 | Gpi Nil Holdings, Inc. | Cyclic ester or amide derivatives |
| EP1115842A4 (en) * | 1998-09-25 | 2002-08-21 | Glycox Corp Ltd | Fructosamine oxidase assay: methods and materials |
| NZ333206A (en) | 1998-12-08 | 2000-07-28 | Bernard Charles Sherman | Solid pharmaceutical compositions comprising a stable magnesium salt of quinapril that acts as a ACE (Angiotensin Converting Enzyme) inhibitor |
| US6048874A (en) * | 1999-01-26 | 2000-04-11 | Medeva Pharmaceuticals Manufacturing, Inc. | Parenteral metolazone formulations |
| US6555139B2 (en) | 1999-06-28 | 2003-04-29 | Wockhardt Europe Limited | Preparation of micron-size pharmaceutical particles by microfluidization |
| CA2382547A1 (en) * | 1999-09-21 | 2001-03-29 | Stephen R. Hanson | Methods and compositions for treating platelet-related disosders |
| US20030113330A1 (en) * | 1999-11-08 | 2003-06-19 | Uhal Bruce D. | Methods for treating pulmonary fibrosis |
| US6569456B2 (en) | 2000-01-13 | 2003-05-27 | Osmotica Corp. | Osmotic device containing diltiazem and an ACE inhibitor or diuretic |
| DE60138535D1 (de) * | 2000-02-04 | 2009-06-10 | Children S Hospital Res Founda | Verwendung von lysosomal acid lipase zur behandlung von atherosklerose und ähnlichen krankheiten |
| US6635277B2 (en) | 2000-04-12 | 2003-10-21 | Wockhardt Limited | Composition for pulsatile delivery of diltiazem and process of manufacture |
| ATE532070T1 (de) | 2000-12-14 | 2011-11-15 | Brigham & Womens Hospital | Entzündungsmarker zum nachweis und zur prävention von diabetes mellitus |
| US6462174B1 (en) | 2001-06-25 | 2002-10-08 | Astrazeneca Ab | Amorphous compound |
| US6458769B1 (en) | 2001-06-25 | 2002-10-01 | Astrazeneca Ab | Amorphous compound |
| US6627760B1 (en) | 2001-06-25 | 2003-09-30 | Astrazeneca Ab | Amorphous compound |
| EP1443919A4 (en) * | 2001-11-16 | 2006-03-22 | Bristol Myers Squibb Co | DOUBLE INHIBITORS OF THE FATTY ACID BINDING PROTEIN OF THE ADIPOCYTES AND THE FATTY ACID BINDING PROTEIN OF KERATINOCYTES |
| SI21101A (sl) * | 2001-11-26 | 2003-06-30 | LEK farmacevtska dru�ba d.d. | Koncentriranje vodnih frakcij lisinoprila z reverzno osmozo |
| DK1487431T3 (da) | 2002-03-08 | 2012-08-20 | Philera New Zealand Ltd | Forebyggelse og/eller behandling af cardiovaskulær sygdom og/eller dermed associeret hjertefejl |
| US20030215526A1 (en) * | 2002-03-08 | 2003-11-20 | Scott Stofik | Stable formulations of angiotensin converting enzyme (ACE) inhibitors |
| HUE027779T2 (en) | 2002-05-09 | 2016-11-28 | Brigham & Womens Hospital Inc | 1L1RL-1 is a marker of cardiovascular disease |
| EP1513868B1 (en) * | 2002-06-19 | 2006-08-09 | EOS Eczacibasi Ozgun Kimyasal Urunler Sanayi Ve Ti Caret A.S. | Process for the production of lisinopril |
| JP3835763B2 (ja) | 2002-08-19 | 2006-10-18 | ファイザー・プロダクツ・インク | 増殖亢進疾患のための組み合わせ治療 |
| EP1539129A4 (en) * | 2002-08-20 | 2006-03-08 | Protemix Corp Ltd | DOSAGE FORMS AND RELEVANT THERAPIES |
| CA2498757A1 (en) * | 2002-09-11 | 2004-03-25 | Toaeiyo Ltd. | Proline ester and preparation containing the same for percutaneous administration |
| US20040110241A1 (en) * | 2002-12-06 | 2004-06-10 | Segal Mark S. | Materials and methods for monitoring vascular endothelial function |
| EP1585500B8 (en) * | 2002-12-20 | 2017-07-26 | Auritec Pharmaceuticals | Coated particles for sustained-release pharmaceutical administration |
| CL2004000366A1 (es) * | 2003-02-26 | 2005-01-07 | Pharmacia Corp Sa Organizada B | USO DE UNA COMBINACION DE UN COMPUESTO DERIVADO DE PIRAZOL INHIBIDOR DE QUINASA p38, Y UN INHIBIDOR DE ACE PARA TRATAR DISFUNCION RENAL, ENFERMEDAD CARDIOVASCULAR Y VASCULAR, RETINOPATIA, NEUROPATIA, EDEMA, DISFUNCION ENDOTELIAL O INSULINOPATIA. |
| CL2004000544A1 (es) * | 2003-03-18 | 2005-01-28 | Pharmacia Corp Sa Organizada B | Uso de una combinacion farmaceutica, de un antagonista del receptor de aldosterona y un inhibidor de endopeptidasa neutral, util para el tratamiento y prevencion de una condicion patologica relacionada con hipertension, disfuncion renal, insulinopati |
| US20060252120A1 (en) * | 2003-05-09 | 2006-11-09 | Kieliszewski Marcia J | Synthetic genes for plant gums and other hydroxyproline-rich glycoproteins |
| SG141430A1 (en) | 2003-05-30 | 2008-04-28 | Ranbaxy Lab Ltd | Substituted pyrrole derivatives and their use as hmg-co inhibitors |
| US7459474B2 (en) * | 2003-06-11 | 2008-12-02 | Bristol-Myers Squibb Company | Modulators of the glucocorticoid receptor and method |
| US20040265238A1 (en) * | 2003-06-27 | 2004-12-30 | Imtiaz Chaudry | Inhalable formulations for treating pulmonary hypertension and methods of using same |
| US20060089374A1 (en) * | 2003-07-17 | 2006-04-27 | Glenn Cornett | Enantiomeric compositions of cicletanine, alone and in combination with other agents, for the treatment of disease |
| CA2532807A1 (en) * | 2003-07-17 | 2005-02-03 | Cotherix, Inc. | Combination therapies for treatment of hypertension and complications in patients with diabetes or metabolic syndrome |
| US20050037063A1 (en) * | 2003-07-21 | 2005-02-17 | Bolton Anthony E. | Combined therapies |
| SI2384753T1 (sl) | 2003-08-29 | 2016-06-30 | The Brigham And Women's Hospital, Inc. | Hidantoinski derivati kot inhibitorji celične nekroze |
| US7371759B2 (en) * | 2003-09-25 | 2008-05-13 | Bristol-Myers Squibb Company | HMG-CoA reductase inhibitors and method |
| US20050153885A1 (en) * | 2003-10-08 | 2005-07-14 | Yun Anthony J. | Treatment of conditions through modulation of the autonomic nervous system |
| US7420059B2 (en) * | 2003-11-20 | 2008-09-02 | Bristol-Myers Squibb Company | HMG-CoA reductase inhibitors and method |
| EP1697746B1 (en) | 2003-12-05 | 2012-02-22 | The Cleveland Clinic Foundation | Risk markers for cardiovascular disease |
| US20050159364A1 (en) * | 2003-12-19 | 2005-07-21 | Cooper Garth J. | Copper antagonist compounds |
| WO2005069845A2 (en) * | 2004-01-14 | 2005-08-04 | Ohio University | Methods of producing peptides/proteins in plants and peptides/proteins produced thereby |
| US8623812B2 (en) * | 2004-04-19 | 2014-01-07 | Ohio University | Cross-linkable glycoproteins and methods of making the same |
| US7803838B2 (en) * | 2004-06-04 | 2010-09-28 | Forest Laboratories Holdings Limited | Compositions comprising nebivolol |
| RU2266751C1 (ru) * | 2004-06-04 | 2005-12-27 | Открытое акционерное общество "Химико-фармацевтический комбинат "АКРИХИН" (ОАО "АКРИХИН") | Комбинированное гипотензивное средство |
| US7582796B2 (en) | 2004-07-19 | 2009-09-01 | Protemix Corporation Limited | Synthesis of triethylenetetramines |
| EP2343553A1 (en) | 2004-10-06 | 2011-07-13 | The Brigham and Women's Hospital | Relevance of achieved levels of markers of systemic inflammation following treatment |
| EP1848424B1 (en) * | 2005-01-31 | 2017-04-05 | Mylan Laboratories, Inc | Pharmaceutical composition comprising hydroxylated nebivolol |
| ZA200710880B (en) * | 2005-05-27 | 2009-06-24 | Univ Cape Town | Angiotensin I-converting enzyme (ace) inhibitors |
| AP2896A (en) | 2005-05-31 | 2014-05-31 | Mylan Lab Inc | Compositions comprising nebivolol |
| US20080242834A1 (en) * | 2005-07-08 | 2008-10-02 | Ohio University | Methods of Predicting Hyp-Glycosylation Sites For Proteins Expressed and Secreted in Plant Cells, and Related Methods and Products |
| US20090297496A1 (en) * | 2005-09-08 | 2009-12-03 | Childrens Hospital Medical Center | Lysosomal Acid Lipase Therapy for NAFLD and Related Diseases |
| US8119358B2 (en) * | 2005-10-11 | 2012-02-21 | Tethys Bioscience, Inc. | Diabetes-related biomarkers and methods of use thereof |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| BRPI0618379A2 (pt) | 2005-11-08 | 2011-08-30 | Ranbaxy Lab Ltd | processo para preparação do hemi-sal de cálcio do ácido (3r,5r) -7-[2-(4-fluorofenil)-5-isopropil-3-fenil-4-[(4-hidroxime tilfenilamino) carbonil]-pirrol-1-il] -3, 5-diidroxi heptanóico |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| US7592461B2 (en) | 2005-12-21 | 2009-09-22 | Bristol-Myers Squibb Company | Indane modulators of glucocorticoid receptor, AP-1, and/or NF-κB activity and use thereof |
| EP1984010A4 (en) * | 2006-02-17 | 2010-09-08 | Nitromed Inc | METHOD FOR USE OF HYDRALAZIN COMPOUNDS AND ISOSORBIDE DINITRATE OR ISOSORBIDE MONONITRATE |
| US20090186817A1 (en) * | 2006-03-21 | 2009-07-23 | Amylin Pharmaceuticals, Inc. | Peptide-peptidase inhibitor conjugates and methods of using same |
| US20070238770A1 (en) * | 2006-04-05 | 2007-10-11 | Bristol-Myers Squibb Company | Process for preparing novel crystalline forms of peliglitazar, novel stable forms produced therein and formulations |
| US20080057590A1 (en) | 2006-06-07 | 2008-03-06 | Mickey Urdea | Markers associated with arteriovascular events and methods of use thereof |
| WO2008057862A2 (en) | 2006-11-01 | 2008-05-15 | Bristol-Myers Squibb Company | MODULATORS OF GLUCOCORTICOID RECEPTOR, AP-1, AND/OR NF-ϰB ACTIVITY AND USE THEREOF |
| US8198311B2 (en) | 2006-11-01 | 2012-06-12 | Bristol-Myers Squibb Company | Modulators of glucocorticoid receptor, AP-1, and/or NF-κB activity and use thereof |
| CN101663262B (zh) | 2006-12-01 | 2014-03-26 | 百时美施贵宝公司 | 用于治疗动脉粥样硬化和心血管疾病的作为cetp抑制剂的n-(3-苄基)-2,2-(二苯基)-丙-1胺衍生物 |
| WO2008131224A2 (en) | 2007-04-18 | 2008-10-30 | Tethys Bioscience, Inc. | Diabetes-related biomarkers and methods of use thereof |
| AU2008261102B2 (en) | 2007-06-04 | 2013-11-28 | Bausch Health Ireland Limited | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| US8598314B2 (en) * | 2007-09-27 | 2013-12-03 | Amylin Pharmaceuticals, Llc | Peptide-peptidase-inhibitor conjugates and methods of making and using same |
| EP2211906A2 (en) * | 2007-11-07 | 2010-08-04 | Janssen Pharmaceutica, N.V. | Combination therapy comprising angiotensin converting enzyme inhibitors and vasopressin receptor antagonists |
| US7828840B2 (en) * | 2007-11-15 | 2010-11-09 | Med Institute, Inc. | Medical devices and methods for local delivery of angiotensin II type 2 receptor antagonists |
| EP3239170B1 (en) | 2008-06-04 | 2019-03-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| GB2462022B (en) | 2008-06-16 | 2011-05-25 | Biovascular Inc | Controlled release compositions of agents that reduce circulating levels of platelets and methods thereof |
| WO2010009319A2 (en) | 2008-07-16 | 2010-01-21 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| SI23149A (sl) | 2009-09-21 | 2011-03-31 | Silverstone Pharma | Nove benzatinske soli ACE inhibitorjev, postopek za njihovo pripravo in njihova uporaba za zdravljenje kardiovaskularnih bolezni |
| US8119817B2 (en) * | 2009-09-29 | 2012-02-21 | Degussa-Huels Ag | Process for separating the diastereomers of RSS-and SSS-N- α [1-carboxy-3-phenylpropyl] lysylproline |
| AU2011210508B2 (en) | 2010-02-01 | 2015-01-29 | The Hospital For Sick Children | Remote ischemic conditioning for treatment and prevention of restenosis |
| EP2552331B1 (en) | 2010-03-31 | 2020-01-08 | The Hospital For Sick Children | Use of remote ischemic conditioning to improve outcome after myocardial infarction |
| SG10201502029RA (en) | 2010-04-08 | 2015-05-28 | Hospital For Sick Children | Use of remote ischemic conditioning for traumatic injury |
| EP2585051B2 (en) | 2010-06-23 | 2020-04-08 | KRKA, tovarna zdravil, d.d., Novo mesto | Pharmaceutical oral dosage forms comprising lercanidipine and enalapril and their pharmaceutically acceptable salts |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| CN103261168B (zh) | 2010-12-15 | 2015-08-05 | 施万生物制药研发Ip有限责任公司 | 脑啡肽酶抑制剂 |
| PL2651896T3 (pl) | 2010-12-15 | 2016-01-29 | Theravance Biopharma R&D Ip Llc | Inhibitory neprylizyny |
| WO2012085249A2 (en) | 2010-12-24 | 2012-06-28 | Krka, D.D., Novo Mesto | Homogenous pharmaceutical oral dosage forms comprising lercanidipine and enalapril or their pharmaceutically acceptable salts |
| WO2012112742A1 (en) | 2011-02-17 | 2012-08-23 | Theravance, Inc. | Substituted aminobutyric derivatives as neprilysin inhibitors |
| JP5959066B2 (ja) | 2011-02-17 | 2016-08-02 | セラヴァンス バイオファーマ アール&ディー アイピー, エルエルシー | ネプリライシン阻害剤としての置換アミノ酪酸誘導体 |
| EP2714648B1 (en) | 2011-05-31 | 2017-08-16 | Theravance Biopharma R&D IP, LLC | Neprilysin inhibitors |
| CN103582630B (zh) | 2011-05-31 | 2016-08-17 | 施万生物制药研发Ip有限责任公司 | 脑啡肽酶抑制剂 |
| US8513244B2 (en) | 2011-05-31 | 2013-08-20 | Theravance, Inc. | Neprilysin inhibitors |
| JP6134316B2 (ja) | 2011-07-18 | 2017-05-24 | クリティカル ケア ダイアグノスティクス インコーポレイテッド | 心臓血管疾患を治療する方法および運動療法の有効性を予測する方法 |
| BR112014004370A2 (pt) | 2011-08-26 | 2017-03-21 | Wockhardt Ltd | métodos para tratar distúrbios cardiovasculares |
| TWI560172B (en) | 2011-11-02 | 2016-12-01 | Theravance Biopharma R&D Ip Llc | Neprilysin inhibitors |
| CA2873214C (en) | 2012-05-11 | 2021-02-16 | Reset Therapeutics, Inc. | Carbazole-containing sulfonamides as cryptochrome modulators |
| WO2013181332A1 (en) | 2012-05-31 | 2013-12-05 | Theravance, Inc. | Nitric oxide donor neprilysin inhibitors |
| CA2873328A1 (en) | 2012-06-08 | 2013-12-12 | Theravance Biopharma R&D Ip, Llc | Neprilysin inhibitors |
| NZ702749A (en) | 2012-06-08 | 2017-01-27 | Theravance Biopharma R&D Ip Llc | Neprilysin inhibitors |
| EP2879666B1 (en) | 2012-08-01 | 2020-04-08 | Tavakoli, Zahra | Free flowing, frozen compositions comprising a therapeutic agent |
| AR092073A1 (es) | 2012-08-08 | 2015-03-18 | Theravance Inc | Inhibidores de neprilisina |
| US8568747B1 (en) | 2012-10-05 | 2013-10-29 | Silvergate Pharmaceuticals, Inc. | Enalapril compositions |
| PT2964616T (pt) | 2013-03-05 | 2017-08-08 | Theravance Biopharma R&D Ip Llc | Inibidores da neprilisina |
| WO2014151200A2 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| EP2968276A4 (en) | 2013-03-15 | 2017-02-15 | President and Fellows of Harvard College | Hybrid necroptosis inhibitors |
| EP2970384A1 (en) | 2013-03-15 | 2016-01-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| RU2015144689A (ru) | 2013-03-21 | 2017-04-25 | ЮПРАКСИЯ ФАРМАСЬЮТИКАЛЗ ЮЭсЭй ЭлЭлСи | Композиция для инъекций с замедленным высвобождением и способ ее применения для лечения воспаления в суставах и связанной с такими воспалениями боли |
| WO2014170786A1 (en) | 2013-04-17 | 2014-10-23 | Pfizer Inc. | N-piperidin-3-ylbenzamide derivatives for treating cardiovascular diseases |
| HRP20240805T1 (hr) | 2013-06-05 | 2024-09-27 | Bausch Health Ireland Limited | Ultra-pročišćeni agonisti guanilat-ciklaze c, postupak njihove pripreme i uporabe |
| WO2015027021A1 (en) | 2013-08-22 | 2015-02-26 | Bristol-Myers Squibb Company | Imide and acylurea derivatives as modulators of the glucocorticoid receptor |
| MX2016009760A (es) | 2014-01-30 | 2016-11-08 | Theravance Biopharma R&D Ip Llc | Inhibidores de neprilisina. |
| AU2015211041B2 (en) | 2014-01-30 | 2018-11-08 | Theravance Biopharma R&D Ip, Llc | 5-biphenyl-4-heteroarylcarbonylamino-pentanoic acid derivatives as neprilysin inhibitors |
| TWI690521B (zh) | 2014-04-07 | 2020-04-11 | 美商同步製藥公司 | 作為隱花色素調節劑之含有咔唑之醯胺類、胺基甲酸酯類及脲類 |
| RS58120B1 (sr) | 2014-07-31 | 2019-02-28 | Pharmathen Sa | Kompozicija orodisperzibilnog filma koja sadrži enalapril za lečenje hipertenzije kod pedijatrijske populacije |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| RU2726623C2 (ru) | 2015-02-11 | 2020-07-15 | ТЕРЕВАНС БАЙОФАРМА Ар энд Ди АйПи, ЭлЭлСи | (2s,4r)-5-(5'-хлор-2'-фторбифенил-4-ил)-4-(этоксиоксалиламино)-2-гидроксиметил-2-метилпентановая кислота |
| HRP20210040T1 (hr) | 2015-02-19 | 2021-04-02 | Theravance Biopharma R&D Ip, Llc | (2r,4r)-5-(5′-klor-2’-fluorbifenil-4-il)-2-hidroksi-4-[(5-metiloksazol-2-karbonil)amino]pentanska kiselina |
| AU2016343952A1 (en) | 2015-10-27 | 2018-05-10 | Eupraxia Pharmaceuticals Inc. | Sustained release formulations of local anesthetics |
| US9463183B1 (en) | 2015-10-30 | 2016-10-11 | Silvergate Pharmaceuticals, Inc. | Lisinopril formulations |
| RS62172B1 (sr) | 2016-03-08 | 2021-08-31 | Theravance Biopharma R&D Ip Llc | Kristalna (2s,4r)-5-(5’-hloro-2-fluoro-[1,1’-bifenil]-4-il)-2-(etoksimetil)-4-(3-hidroksi izoksazol-5-karboksamido)-2-metilpentanska kiselina i njene upotrebe |
| US9669008B1 (en) | 2016-03-18 | 2017-06-06 | Silvergate Pharmaceuticals, Inc. | Enalapril formulations |
| WO2018097999A1 (en) * | 2016-11-23 | 2018-05-31 | The Regents Of The University Of California | Compositions and methods for modulating protease activity |
| CA3080193A1 (en) * | 2017-10-26 | 2019-05-02 | Southern Research Institute | Dipeptide analogs as tgf-beta inhibitors |
| CN109734775A (zh) * | 2018-12-31 | 2019-05-10 | 辰欣药业股份有限公司 | 一种马来酸依那普利的精制方法 |
| AU2020209215B2 (en) | 2019-01-18 | 2023-02-02 | Astrazeneca Ab | PCSK9 inhibitors and methods of use thereof |
| US11130775B2 (en) | 2019-05-20 | 2021-09-28 | H. Lundbeck A/S | Solid forms of (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(((4aR,10aR)-7-hydroxy-1-propyl-1,2,3,4,4A,5,10,10A-octahydrobenzo[g]quinolin-6-yl)oxy)tetrahydro-2H-pyran-2-carboxylic acid |
| US11111263B2 (en) * | 2019-05-20 | 2021-09-07 | H. Lundbeck A/S | Process for the manufacture of (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(((4aR,10aR)-7-hydroxy-1-propyl-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-6-yl)oxy)tetrahydro-2H-pyran-2-carboxylic acid |
| US11168056B2 (en) | 2019-05-20 | 2021-11-09 | H. Lundbeck A/S | Process for the manufacturing of (6aR,10aR)-7-propyl-6,6a,7,8,9,10,10a,11-octahydro-[1,3]dioxolo[4′,5′:5,6]benzo[1,2-G]quinoline and (4aR,10aR)-1-propyl-1,2,3,4,4a,5,10,10a-octahydro-benzo[G]quinoline-6,7-diol |
| JP7514859B2 (ja) | 2019-05-21 | 2024-07-11 | ハー・ルンドベック・アクチエゼルスカベット | パーキンソン病の治療に使用するための新規なカテコールアミンプロドラッグ |
| WO2020234277A1 (en) | 2019-05-21 | 2020-11-26 | H. Lundbeck A/S | Catecholamine carbamate prodrugs for use in the treatment of parkinson s disease |
| CN113727979B (zh) | 2019-05-21 | 2024-09-20 | H.隆德贝克有限公司 | 用于治疗帕金森病的新儿茶酚胺前药 |
| US12391650B2 (en) | 2019-05-21 | 2025-08-19 | H. Lundbeck A/S | Catecholamine prodrugs for use in the treatment of Parkinson's disease |
| US20240124520A1 (en) * | 2019-10-16 | 2024-04-18 | The Board Of Trustees Of The Leland Stanford Junior University | N-acylated histidine dipeptides as anticancer agents |
| GB2595203A (en) | 2020-03-03 | 2021-11-24 | Alkaloid Ad Skopje | Formulation |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2256445C3 (de) * | 1972-11-17 | 1981-11-05 | Hoechst Ag, 6000 Frankfurt | Heptapeptide, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Präparate |
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
-
1979
- 1979-12-03 IL IL58849A patent/IL58849A/xx unknown
- 1979-12-04 FI FI793799A patent/FI68405C/fi not_active IP Right Cessation
- 1979-12-04 NZ NZ192312A patent/NZ192312A/en unknown
- 1979-12-04 PT PT70542A patent/PT70542A/pt unknown
- 1979-12-04 MA MA18866A patent/MA18664A1/fr unknown
- 1979-12-04 AU AU53461/79A patent/AU530380B2/en not_active Expired
- 1979-12-06 CA CA000341340A patent/CA1302005C/en not_active Expired - Lifetime
- 1979-12-07 GR GR60709A patent/GR72251B/el unknown
- 1979-12-07 ZW ZW244/79A patent/ZW24479A1/xx unknown
- 1979-12-08 RO RO108579A patent/RO85072B/ro unknown
- 1979-12-08 RO RO108580A patent/RO85073B/ro unknown
- 1979-12-08 RO RO7999486A patent/RO80264A/ro unknown
- 1979-12-08 RO RO108578A patent/RO85071B/ro unknown
- 1979-12-08 DD DD79217487A patent/DD148770A5/de unknown
- 1979-12-09 EG EG731/79A patent/EG14182A/xx active
- 1979-12-10 SU SU792851802A patent/SU1287756A3/ru active
- 1979-12-10 IE IE2382/79A patent/IE48922B1/en active Protection Beyond IP Right Term
- 1979-12-10 BG BG045870A patent/BG38787A3/xx unknown
- 1979-12-10 BG BG068627A patent/BG39467A3/xx unknown
- 1979-12-10 BG BG068624A patent/BG39294A3/xx unknown
- 1979-12-10 BG BG068626A patent/BG39466A3/xx unknown
- 1979-12-10 ZA ZA00796688A patent/ZA796688B/xx unknown
- 1979-12-10 PL PL1979220298A patent/PL126126B1/pl unknown
- 1979-12-10 PL PL1979232126A patent/PL131140B1/pl unknown
- 1979-12-10 DE DE1993175005 patent/DE19375005I2/de active Active
- 1979-12-10 HU HU79ME2324A patent/HU182902B/hu unknown
- 1979-12-10 YU YU3000/79A patent/YU42655B/xx unknown
- 1979-12-10 BG BG068623A patent/BG39293A3/xx unknown
- 1979-12-10 NO NO794010A patent/NO151622C/no unknown
- 1979-12-10 DK DK523579A patent/DK165455C/da not_active IP Right Cessation
- 1979-12-10 DE DE7979105015T patent/DE2966767D1/de not_active Expired
- 1979-12-10 EP EP79105015A patent/EP0012401B1/en not_active Expired
- 1979-12-10 BG BG068625A patent/BG39295A3/xx unknown
- 1979-12-11 CS CS798645A patent/CS237311B2/cs unknown
- 1979-12-11 JP JP15986979A patent/JPS5581845A/ja active Granted
- 1979-12-11 ES ES486786A patent/ES8101540A1/es not_active Expired
- 1979-12-11 KR KR7904273A patent/KR850000847B1/ko not_active Expired
-
1980
- 1980-08-14 ES ES494300A patent/ES494300A0/es active Granted
- 1980-08-29 PH PH24512A patent/PH24268A/en unknown
-
1981
- 1981-02-17 US US06/235,335 patent/US4374829A/en not_active Expired - Lifetime
- 1981-09-22 AR AR286844A patent/AR231971A1/es active
-
1982
- 1982-09-27 US US06/423,916 patent/US4472380A/en not_active Expired - Lifetime
- 1982-11-17 YU YU2566/82A patent/YU43532B/xx unknown
- 1982-11-17 YU YU2567/82A patent/YU43533B/xx unknown
-
1984
- 1984-01-17 KR KR1019840000192A patent/KR840005083A/ko not_active Abandoned
- 1984-04-21 KR KR1019840002123A patent/KR850000846B1/ko not_active Expired
-
1986
- 1986-09-16 CA CA000518334A patent/CA1275349C/en not_active Expired - Lifetime
- 1986-09-16 CA CA000518335A patent/CA1300313C/en not_active Expired - Lifetime
-
1987
- 1987-04-09 HK HK274/87A patent/HK27487A/en not_active IP Right Cessation
-
1988
- 1988-09-07 CA CA000576716A patent/CA1276559C/en not_active Expired - Lifetime
-
1989
- 1989-09-13 JP JP1238330A patent/JPH02131496A/ja active Granted
- 1989-09-13 JP JP1238329A patent/JPH02131430A/ja active Granted
-
1993
- 1993-02-09 NL NL930008C patent/NL930008I2/nl unknown
- 1993-02-09 NL NL930006C patent/NL930006I2/nl unknown
- 1993-02-09 NL NL930007C patent/NL930007I2/nl unknown
-
1995
- 1995-08-02 NO NO1995007C patent/NO1995007I1/no unknown
-
1996
- 1996-02-23 NO NO1996004C patent/NO1996004I1/no unknown
-
1997
- 1997-06-19 NL NL970022C patent/NL970022I1/nl unknown
- 1997-11-19 LU LU90173C patent/LU90173I2/fr unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU182902B (en) | Process for preparing dipeptide derivatives with hypotensive activity | |
| US4350704A (en) | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids | |
| US4818749A (en) | Carboxyalkyl dipeptides and medical use thereof in treating hypertension and congestive heart failure | |
| US4344949A (en) | Substituted acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids | |
| US4431644A (en) | Antihypertensive agents | |
| HU195520B (en) | Process for producing sulfamoyl-group-containing /carboxy-alkyl/-dipeptides and pharmaceuticals comprising the same | |
| EP0051391B1 (en) | Bicyclic compounds, their production and use | |
| EP0037231A2 (en) | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids | |
| CS247159B2 (en) | Method of cis,endo-2-azabicyclo(3,3,1) octal-3-carboxyl acid's derivatives production | |
| HU185324B (en) | Process for preparing 1-carboxy-azaalkanoyl-indoline-2-carboxylic acid derivatives | |
| US4425355A (en) | Substituted acyl derivatives of chair form of octahydro-1H-indole-2-carboxylic acids | |
| US4587050A (en) | Substituted enantholactam derivatives as antihypertensives | |
| EP0046289B1 (en) | Substituted enantholactam derivatives as antihypertensives, a process for preparing and a pharmaceutical composition containing them, and intermediates | |
| JPH0559105B2 (enExample) | ||
| US4680392A (en) | Substituted caprolactam derivatives as antihypertensives | |
| EP0058567B1 (en) | Substituted acyl derivatives of octahydro-1h-isoindole-1-carboxylic acids and esters | |
| US4532342A (en) | N-substituted amino acids as intermediates in the preparation of acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids | |
| US4959372A (en) | Anti-hypertensive substituted 2-azabicyclooctane-3-carboxylic acids | |
| CA1275350C (en) | Lisinopril | |
| US4897379A (en) | N-[N.sup.α -(1(S)-carboxy-3-cyclohexylpropyl)-L-lysyl]-N-cyclopentylglycine as antihypertensives | |
| EP0279750B1 (en) | Aminoacid derivatives as antihypertensives | |
| CA1287446C (en) | Bicyclic compounds, their production and use | |
| HU192107B (en) | Process for production of substituted dipeptides hindering encefalinase | |
| HU187880B (en) | Process for preparing octqhydro-1h-indola-2-carboxylic acid acyl derivatives | |
| BG60368B2 (bg) | Производни на аминокиселини с антихипертензивно действие |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |