DE3142982C2 - Carbostyrilverbindungen, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten - Google Patents
Carbostyrilverbindungen, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthaltenInfo
- Publication number
- DE3142982C2 DE3142982C2 DE3142982A DE3142982A DE3142982C2 DE 3142982 C2 DE3142982 C2 DE 3142982C2 DE 3142982 A DE3142982 A DE 3142982A DE 3142982 A DE3142982 A DE 3142982A DE 3142982 C2 DE3142982 C2 DE 3142982C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- dihydrocarbostyril
- piperazinyl
- groups
- carbostyril
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title claims abstract description 47
- 238000002360 preparation method Methods 0.000 title abstract description 19
- 238000000034 method Methods 0.000 title abstract description 5
- 239000003814 drug Substances 0.000 title abstract description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 73
- -1 Carbostyril compound Chemical class 0.000 claims description 245
- 125000000217 alkyl group Chemical group 0.000 claims description 50
- 125000003545 alkoxy group Chemical group 0.000 claims description 27
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 25
- 125000005843 halogen group Chemical group 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 125000003277 amino group Chemical group 0.000 claims description 13
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- ZVNYJIZDIRKMBF-UHFFFAOYSA-N Vesnarinone Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 ZVNYJIZDIRKMBF-UHFFFAOYSA-N 0.000 claims description 7
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 claims description 6
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 6
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000005400 pyridylcarbonyl group Chemical group N1=C(C=CC=C1)C(=O)* 0.000 claims description 4
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 claims 1
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical class N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims 1
- 239000000496 cardiotonic agent Substances 0.000 abstract description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 176
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 144
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 112
- 239000000203 mixture Substances 0.000 description 108
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 94
- 239000000243 solution Substances 0.000 description 78
- 239000011541 reaction mixture Substances 0.000 description 71
- 239000013078 crystal Substances 0.000 description 56
- 238000000921 elemental analysis Methods 0.000 description 47
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- 239000008187 granular material Substances 0.000 description 41
- 235000019441 ethanol Nutrition 0.000 description 38
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 38
- 239000000843 powder Substances 0.000 description 37
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 36
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 35
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- 238000001914 filtration Methods 0.000 description 29
- 238000000354 decomposition reaction Methods 0.000 description 27
- 125000004432 carbon atom Chemical group C* 0.000 description 26
- 238000003756 stirring Methods 0.000 description 24
- 238000002844 melting Methods 0.000 description 23
- 230000008018 melting Effects 0.000 description 23
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 22
- 238000001816 cooling Methods 0.000 description 22
- 238000010898 silica gel chromatography Methods 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 19
- 229910000027 potassium carbonate Inorganic materials 0.000 description 19
- 238000005406 washing Methods 0.000 description 19
- 239000007858 starting material Substances 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 16
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- 235000017557 sodium bicarbonate Nutrition 0.000 description 15
- FSQOWYCPSKDQHL-UHFFFAOYSA-N 6-piperazin-1-yl-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1N1CCNCC1 FSQOWYCPSKDQHL-UHFFFAOYSA-N 0.000 description 14
- 239000010410 layer Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 11
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- SAJOKJMYVGBVJK-UHFFFAOYSA-N 5-piperazin-1-yl-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2N1CCNCC1 SAJOKJMYVGBVJK-UHFFFAOYSA-N 0.000 description 9
- 241000282472 Canis lupus familiaris Species 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 230000017531 blood circulation Effects 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 210000003540 papillary muscle Anatomy 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 230000003177 cardiotonic effect Effects 0.000 description 4
- QSKWJTXWJJOJFP-UHFFFAOYSA-N chloroform;ethoxyethane Chemical compound ClC(Cl)Cl.CCOCC QSKWJTXWJJOJFP-UHFFFAOYSA-N 0.000 description 4
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 4
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 210000005245 right atrium Anatomy 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 3
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 3
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 3
- VTLUOUFVWFOPNQ-UHFFFAOYSA-N 5-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 VTLUOUFVWFOPNQ-UHFFFAOYSA-N 0.000 description 3
- SWGPIDCNYAYXMJ-UHFFFAOYSA-N 5-chloro-2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1C=O SWGPIDCNYAYXMJ-UHFFFAOYSA-N 0.000 description 3
- GOAOWWBTKNGCSQ-UHFFFAOYSA-N 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C3C=CC(=O)NC3=CC=2)CC1 GOAOWWBTKNGCSQ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 230000001057 ionotropic effect Effects 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 239000012046 mixed solvent Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 3
- 229960002275 pentobarbital sodium Drugs 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 2
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 2
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 2
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 2
- NIBFJPXGNVPNHK-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-4-carbaldehyde Chemical group C1=CC(C=O)=C2OC(F)(F)OC2=C1 NIBFJPXGNVPNHK-UHFFFAOYSA-N 0.000 description 2
- YCWRFIYBUQBHJI-UHFFFAOYSA-N 2-(4-aminophenyl)acetonitrile Chemical group NC1=CC=C(CC#N)C=C1 YCWRFIYBUQBHJI-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- VIOBGCWEHLRBEP-UHFFFAOYSA-N 3,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1OC VIOBGCWEHLRBEP-UHFFFAOYSA-N 0.000 description 2
- MXUXWLYVXJICEU-UHFFFAOYSA-N 3-(2-nitro-5-piperazin-1-ylphenyl)prop-2-enoic acid Chemical compound C1=C([N+]([O-])=O)C(C=CC(=O)O)=CC(N2CCNCC2)=C1 MXUXWLYVXJICEU-UHFFFAOYSA-N 0.000 description 2
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 2
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 2
- LOQLDQJTSMKBJU-UHFFFAOYSA-N 4-(chloromethyl)benzonitrile Chemical compound ClCC1=CC=C(C#N)C=C1 LOQLDQJTSMKBJU-UHFFFAOYSA-N 0.000 description 2
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 2
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 2
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 2
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- LBHJSKCEXWYCGO-UHFFFAOYSA-N 5-(4-prop-2-ynylpiperazin-1-yl)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2N1CCN(CC#C)CC1 LBHJSKCEXWYCGO-UHFFFAOYSA-N 0.000 description 2
- DIWRKYVGQWXMSU-UHFFFAOYSA-N 5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-2-nitrobenzaldehyde Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C(C=O)C(=CC=2)[N+]([O-])=O)CC1 DIWRKYVGQWXMSU-UHFFFAOYSA-N 0.000 description 2
- SFRZVJOZAZBQON-UHFFFAOYSA-N 5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 SFRZVJOZAZBQON-UHFFFAOYSA-N 0.000 description 2
- YPGMJGGXAFZUPP-UHFFFAOYSA-N 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-1-methyl-3,4-dihydroquinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)N(C)C3=CC=2)CC1 YPGMJGGXAFZUPP-UHFFFAOYSA-N 0.000 description 2
- KWGWYMOBBLMJIT-UHFFFAOYSA-N 6-[4-(4-bromobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(Br)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 KWGWYMOBBLMJIT-UHFFFAOYSA-N 0.000 description 2
- KDERKHIIBKNVDH-UHFFFAOYSA-N 6-[4-(4-chlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(Cl)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 KDERKHIIBKNVDH-UHFFFAOYSA-N 0.000 description 2
- ROVRJVOHFLXINQ-UHFFFAOYSA-N 6-[4-(4-methoxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 ROVRJVOHFLXINQ-UHFFFAOYSA-N 0.000 description 2
- QNUNKRZBLOTDOL-UHFFFAOYSA-N 6-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(Cl)=CC=C1CN1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 QNUNKRZBLOTDOL-UHFFFAOYSA-N 0.000 description 2
- IWTYGBDXLRIWRD-UHFFFAOYSA-N 6-[4-[(4-hydroxyphenyl)methyl]piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(O)=CC=C1CN1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 IWTYGBDXLRIWRD-UHFFFAOYSA-N 0.000 description 2
- CSEGHLSSIVRMAZ-UHFFFAOYSA-N 6-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1CN1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 CSEGHLSSIVRMAZ-UHFFFAOYSA-N 0.000 description 2
- RYXAGNHPWGDUPR-UHFFFAOYSA-N 8-amino-1h-quinolin-2-one Chemical compound C1=C(O)N=C2C(N)=CC=CC2=C1 RYXAGNHPWGDUPR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 208000001840 Dandruff Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 2
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- 229960001008 heparin sodium Drugs 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000002537 isoquinolines Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 210000003205 muscle Anatomy 0.000 description 2
- MLFWBQLSVXHIKK-UHFFFAOYSA-N n-(2-oxo-3,4-dihydro-1h-quinolin-8-yl)acetamide Chemical compound C1CC(=O)NC2=C1C=CC=C2NC(=O)C MLFWBQLSVXHIKK-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 210000000596 ventricular septum Anatomy 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- CGEOYYBCLBIBLG-UHFFFAOYSA-N (4-carbonochloridoylphenyl) acetate Chemical compound CC(=O)OC1=CC=C(C(Cl)=O)C=C1 CGEOYYBCLBIBLG-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- AIPJZPPOFWCJRC-UHFFFAOYSA-N 1,2-dichloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1Cl AIPJZPPOFWCJRC-UHFFFAOYSA-N 0.000 description 1
- ZRSGZIMDIHBXIN-UHFFFAOYSA-N 1,3-benzodioxole-5-carbonyl chloride Chemical compound ClC(=O)C1=CC=C2OCOC2=C1 ZRSGZIMDIHBXIN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- TZIQIQHZYKXECC-UHFFFAOYSA-N 1-benzyl-6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-3,4-dihydroquinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)N(CC=4C=CC=CC=4)C3=CC=2)CC1 TZIQIQHZYKXECC-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 1
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 description 1
- 125000000301 2-(3-chlorophenyl)ethyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical compound ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000003816 2-hydroxybenzoyl group Chemical group OC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000006290 2-hydroxybenzyl group Chemical group [H]OC1=C(C([H])=C([H])C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002379 2-iodobenzoyl group Chemical group IC1=C(C(=O)*)C=CC=C1 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- ZUECNOPOSZYFTM-UHFFFAOYSA-N 2-nitro-5-piperazin-1-ylbenzaldehyde Chemical compound C1=C(C=O)C([N+](=O)[O-])=CC=C1N1CCNCC1 ZUECNOPOSZYFTM-UHFFFAOYSA-N 0.000 description 1
- LFORZJWYWBWUOA-UHFFFAOYSA-N 2-nitro-5-piperazin-1-ylbenzaldehyde;hydrochloride Chemical compound Cl.C1=C(C=O)C([N+](=O)[O-])=CC=C1N1CCNCC1 LFORZJWYWBWUOA-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004362 3,4,5-trichlorophenyl group Chemical group [H]C1=C(Cl)C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- DAUAQNGYDSHRET-UHFFFAOYSA-N 3,4-dimethoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1OC DAUAQNGYDSHRET-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- GGHLXLVPNZMBQR-UHFFFAOYSA-N 3,5-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC(Cl)=C1 GGHLXLVPNZMBQR-UHFFFAOYSA-N 0.000 description 1
- NNOHXABAQAGKRZ-UHFFFAOYSA-N 3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=CC([N+]([O-])=O)=C1 NNOHXABAQAGKRZ-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- RBAIQCOXSCKMDX-UHFFFAOYSA-N 3-[2-amino-5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]phenyl]prop-2-enoic acid Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C(C=CC(O)=O)C(N)=CC=2)CC1 RBAIQCOXSCKMDX-UHFFFAOYSA-N 0.000 description 1
- GPPFXJLGSAMBRF-UHFFFAOYSA-N 3-[2-amino-5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]phenyl]propanoic acid Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C(CCC(O)=O)C(N)=CC=2)CC1 GPPFXJLGSAMBRF-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- 125000006482 3-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(I)=C1[H])C([H])([H])* 0.000 description 1
- JSGVZVOGOQILFM-UHFFFAOYSA-N 3-methoxy-1-butanol Chemical compound COC(C)CCO JSGVZVOGOQILFM-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HEBZGZUHSZBHBN-UHFFFAOYSA-N 3-piperazin-1-yl-3,4-dihydro-1h-quinolin-2-one Chemical compound O=C1NC2=CC=CC=C2CC1N1CCNCC1 HEBZGZUHSZBHBN-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WWHJLVMBXXXUFO-UHFFFAOYSA-N 4-(chloromethyl)-1,2-dimethoxybenzene Chemical compound COC1=CC=C(CCl)C=C1OC WWHJLVMBXXXUFO-UHFFFAOYSA-N 0.000 description 1
- FOMVMXBARQUECW-UHFFFAOYSA-N 4-(chloromethyl)aniline Chemical compound NC1=CC=C(CCl)C=C1 FOMVMXBARQUECW-UHFFFAOYSA-N 0.000 description 1
- SSIMHHUMYMHNID-UHFFFAOYSA-N 4-(chloromethyl)phenol Chemical compound OC1=CC=C(CCl)C=C1 SSIMHHUMYMHNID-UHFFFAOYSA-N 0.000 description 1
- OOAQKJZZKAZBFA-UHFFFAOYSA-N 4-[4-(2-oxo-1h-quinolin-6-yl)piperazine-1-carbonyl]benzonitrile Chemical compound C1CN(C=2C=C3C=CC(=O)NC3=CC=2)CCN1C(=O)C1=CC=C(C#N)C=C1 OOAQKJZZKAZBFA-UHFFFAOYSA-N 0.000 description 1
- NZPQFXFVQKLUJF-UHFFFAOYSA-N 4-[4-(2-oxo-3,4-dihydro-1h-quinolin-5-yl)piperazine-1-carbonyl]benzonitrile Chemical compound C1CN(C=2C=3CCC(=O)NC=3C=CC=2)CCN1C(=O)C1=CC=C(C#N)C=C1 NZPQFXFVQKLUJF-UHFFFAOYSA-N 0.000 description 1
- MTHPNXMLJUYSLR-UHFFFAOYSA-N 4-[4-(2-oxo-3,4-dihydro-1h-quinolin-6-yl)piperazine-1-carbonyl]benzonitrile Chemical compound C1CN(C=2C=C3CCC(=O)NC3=CC=2)CCN1C(=O)C1=CC=C(C#N)C=C1 MTHPNXMLJUYSLR-UHFFFAOYSA-N 0.000 description 1
- DENKGPBHLYFNGK-UHFFFAOYSA-N 4-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Br)C=C1 DENKGPBHLYFNGK-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- CSUMAMILPSMSJH-UHFFFAOYSA-N 5-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 CSUMAMILPSMSJH-UHFFFAOYSA-N 0.000 description 1
- UWEDHQOWAIDOQQ-UHFFFAOYSA-N 5-[4-(4-aminobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(N)=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 UWEDHQOWAIDOQQ-UHFFFAOYSA-N 0.000 description 1
- OMYXTBPXDLIUTR-UHFFFAOYSA-N 5-[4-(4-hydroxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(O)=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 OMYXTBPXDLIUTR-UHFFFAOYSA-N 0.000 description 1
- ATHRSIUYKUYNSU-UHFFFAOYSA-N 5-[4-(4-methoxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 ATHRSIUYKUYNSU-UHFFFAOYSA-N 0.000 description 1
- ARULQKOHQVFVQL-UHFFFAOYSA-N 5-[4-(4-methylbenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 ARULQKOHQVFVQL-UHFFFAOYSA-N 0.000 description 1
- QCNCZZLYIZHYBP-UHFFFAOYSA-N 5-[4-(4-nitrobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 QCNCZZLYIZHYBP-UHFFFAOYSA-N 0.000 description 1
- OJUJKPDEGKDYTJ-UHFFFAOYSA-N 5-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one;dihydrochloride Chemical compound Cl.Cl.C1=C(OC)C(OC)=CC=C1CN1CCN(C=2C=3CCC(=O)NC=3C=CC=2)CC1 OJUJKPDEGKDYTJ-UHFFFAOYSA-N 0.000 description 1
- LQLRSDWGVVYEEN-UHFFFAOYSA-N 6-(4-benzoylpiperazin-1-yl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(C=2C=C3CCC(=O)NC3=CC=2)CCN1C(=O)C1=CC=CC=C1 LQLRSDWGVVYEEN-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- MIQUHCCIOSTZCW-UHFFFAOYSA-N 6-(4-methylsulfonylpiperazin-1-yl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(S(=O)(=O)C)CCN1C1=CC=C(NC(=O)CC2)C2=C1 MIQUHCCIOSTZCW-UHFFFAOYSA-N 0.000 description 1
- DSEWCLYQUPMXKA-UHFFFAOYSA-N 6-(4-prop-2-ynylpiperazin-1-yl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1N1CCN(CC#C)CC1 DSEWCLYQUPMXKA-UHFFFAOYSA-N 0.000 description 1
- KMXNZMPCJAZCSA-UHFFFAOYSA-N 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1H-quinolin-2-one Chemical compound C1OC=2C=C(CN3CCN(CC3)C=3C=C4C=CC(NC4=CC=3)=O)C=CC=2O1 KMXNZMPCJAZCSA-UHFFFAOYSA-N 0.000 description 1
- YTQDWLYEPXEYHE-UHFFFAOYSA-N 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C2OCOC2=CC(CN2CCN(CC2)C=2C=C3CCC(NC3=CC=2)=O)=C1 YTQDWLYEPXEYHE-UHFFFAOYSA-N 0.000 description 1
- XDXLBTJSMIESEX-UHFFFAOYSA-N 6-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound COC1=C(OC)C(OC)=CC(C(=O)N2CCN(CC2)C=2C=C3C=CC(=O)NC3=CC=2)=C1 XDXLBTJSMIESEX-UHFFFAOYSA-N 0.000 description 1
- QRUIYAGOFQRASI-UHFFFAOYSA-N 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-1-prop-2-ynyl-3,4-dihydroquinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)N(CC#C)C3=CC=2)CC1 QRUIYAGOFQRASI-UHFFFAOYSA-N 0.000 description 1
- CSMVDDCKNVLUSR-UHFFFAOYSA-N 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-8-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C(OC)C=3NC(=O)CCC=3C=2)CC1 CSMVDDCKNVLUSR-UHFFFAOYSA-N 0.000 description 1
- ASIOBLGSDPEUMZ-UHFFFAOYSA-N 6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound ClC1=CC=CC(C(=O)N2CCN(CC2)C=2C=C3CCC(=O)NC3=CC=2)=C1 ASIOBLGSDPEUMZ-UHFFFAOYSA-N 0.000 description 1
- DWMQSQKBAKADTI-UHFFFAOYSA-N 6-[4-(4-ethylbenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(CC)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 DWMQSQKBAKADTI-UHFFFAOYSA-N 0.000 description 1
- IKBXUOMXOHOONF-UHFFFAOYSA-N 6-[4-(4-methoxybenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1C(=O)N1CCN(C=2C=C3C=CC(=O)NC3=CC=2)CC1 IKBXUOMXOHOONF-UHFFFAOYSA-N 0.000 description 1
- SOERBNVYIIFMHP-UHFFFAOYSA-N 6-[4-(4-nitrobenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCN(C=2C=C3C=CC(=O)NC3=CC=2)CC1 SOERBNVYIIFMHP-UHFFFAOYSA-N 0.000 description 1
- ZJWFOQQXXHEERH-UHFFFAOYSA-N 6-[4-(4-nitrobenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 ZJWFOQQXXHEERH-UHFFFAOYSA-N 0.000 description 1
- VLOAJLMJBDCDMX-UHFFFAOYSA-N 6-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1CN1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 VLOAJLMJBDCDMX-UHFFFAOYSA-N 0.000 description 1
- OATRLJAEGAKZGI-UHFFFAOYSA-N 6-[4-[2-(4-hydroxyphenyl)acetyl]piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=CC(O)=CC=C1CC(=O)N1CCN(C=2C=C3C=CC(=O)NC3=CC=2)CC1 OATRLJAEGAKZGI-UHFFFAOYSA-N 0.000 description 1
- CHJWUJWTIIXMHS-UHFFFAOYSA-N 6-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1CC(=O)N1CCN(C=2C=C3C=CC(=O)NC3=CC=2)CC1 CHJWUJWTIIXMHS-UHFFFAOYSA-N 0.000 description 1
- VBFYBDANGZHMGY-UHFFFAOYSA-N 6-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1CC(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 VBFYBDANGZHMGY-UHFFFAOYSA-N 0.000 description 1
- ZIZYIXOCLFNGAL-UHFFFAOYSA-N 6-[bis(2-chloroethyl)amino]-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(N(CCCl)CCCl)=CC=C21 ZIZYIXOCLFNGAL-UHFFFAOYSA-N 0.000 description 1
- BXXSCBCILYHKRB-UHFFFAOYSA-N 6-amino-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=CC(N)=CC=C21 BXXSCBCILYHKRB-UHFFFAOYSA-N 0.000 description 1
- NFWVCYWFUIFIKU-UHFFFAOYSA-N 6-amino-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(N)=CC=C21 NFWVCYWFUIFIKU-UHFFFAOYSA-N 0.000 description 1
- MQWZSSIUHXNNTM-UHFFFAOYSA-N 6-bromo-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(Br)=CC=C21 MQWZSSIUHXNNTM-UHFFFAOYSA-N 0.000 description 1
- XQIJAUKBSYKENP-UHFFFAOYSA-N 6-piperazin-1-yl-3,4-dihydro-1h-quinolin-2-one;hydrobromide Chemical compound Br.C=1C=C2NC(=O)CCC2=CC=1N1CCNCC1 XQIJAUKBSYKENP-UHFFFAOYSA-N 0.000 description 1
- RAHHHIJABMWIET-UHFFFAOYSA-N 7-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound COC1=C(OC)C(OC)=CC(C(=O)N2CCN(CC2)C=2C=C3NC(=O)CCC3=CC=2)=C1 RAHHHIJABMWIET-UHFFFAOYSA-N 0.000 description 1
- DAOHVIWNVNCIDY-UHFFFAOYSA-N 7-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=C3NC(=O)CCC3=CC=2)CC1 DAOHVIWNVNCIDY-UHFFFAOYSA-N 0.000 description 1
- IUOWEQARPUACGO-UHFFFAOYSA-N 7-[4-(4-methylbenzenecarbothioyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1C(=S)N1CCN(C=2C=C3NC(=O)CCC3=CC=2)CC1 IUOWEQARPUACGO-UHFFFAOYSA-N 0.000 description 1
- KSQKSHQUEREEKM-UHFFFAOYSA-N 7-amino-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(N)=CC=C21 KSQKSHQUEREEKM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- BNUGGAKATGOSNV-UHFFFAOYSA-N 8-(4-benzoylpiperazin-1-yl)-1h-quinolin-2-one Chemical compound C1CN(C=2C=3NC(=O)C=CC=3C=CC=2)CCN1C(=O)C1=CC=CC=C1 BNUGGAKATGOSNV-UHFFFAOYSA-N 0.000 description 1
- CNFQUZSREVYAJM-UHFFFAOYSA-N 8-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C2OCOC2=CC(C(N2CCN(CC2)C=2C=3NC(=O)CCC=3C=CC=2)=O)=C1 CNFQUZSREVYAJM-UHFFFAOYSA-N 0.000 description 1
- FAXBPGFGMLGKBV-UHFFFAOYSA-N 8-[4-(2-chlorobenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound ClC1=CC=CC=C1C(=O)N1CCN(C=2C=3NC(=O)C=CC=3C=CC=2)CC1 FAXBPGFGMLGKBV-UHFFFAOYSA-N 0.000 description 1
- VRCYCGUBYCBXIG-UHFFFAOYSA-N 8-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=3NC(=O)CCC=3C=CC=2)CC1 VRCYCGUBYCBXIG-UHFFFAOYSA-N 0.000 description 1
- JUGZPYXHTPQDDC-UHFFFAOYSA-N 8-[4-(4-chlorobenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=CC(Cl)=CC=C1C(=O)N1CCN(C=2C=3NC(=O)C=CC=3C=CC=2)CC1 JUGZPYXHTPQDDC-UHFFFAOYSA-N 0.000 description 1
- CSGQJXCJWQKORX-UHFFFAOYSA-N 8-[4-(4-methoxybenzoyl)piperazin-1-yl]-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1C(=O)N1CCN(C=2C=3NC(=O)C=CC=3C=CC=2)CC1 CSGQJXCJWQKORX-UHFFFAOYSA-N 0.000 description 1
- CJJPEKRGZXXOLX-UHFFFAOYSA-N 8-[4-(4-methylbenzenecarbothioyl)piperazin-1-yl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1C(=S)N1CCN(C=2C=3NC(=O)CCC=3C=CC=2)CC1 CJJPEKRGZXXOLX-UHFFFAOYSA-N 0.000 description 1
- NBPZIANVPVVMLX-UHFFFAOYSA-N 8-piperazin-1-yl-1h-quinolin-2-one Chemical compound C=12NC(=O)C=CC2=CC=CC=1N1CCNCC1 NBPZIANVPVVMLX-UHFFFAOYSA-N 0.000 description 1
- 229930008281 A03AD01 - Papaverine Natural products 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- AVSNKIHZQLEWAO-UHFFFAOYSA-N COC1=C(C=CC=C1)C(=O)N1CCN(CC1)C1=CC=C2NC(=O)CCC2=C1 Chemical compound COC1=C(C=CC=C1)C(=O)N1CCN(CC1)C1=CC=C2NC(=O)CCC2=C1 AVSNKIHZQLEWAO-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GPVDHNVGGIAOQT-UHFFFAOYSA-N Veratric acid Natural products COC1=CC=C(C(O)=O)C(OC)=C1 GPVDHNVGGIAOQT-UHFFFAOYSA-N 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- YKAZVQBTAAUTIM-UHFFFAOYSA-N [4-(4-aminophenyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C=2C=CC(N)=CC=2)CC1 YKAZVQBTAAUTIM-UHFFFAOYSA-N 0.000 description 1
- LEOBHGNHJGAFMS-UHFFFAOYSA-N [4-[4-(2-oxo-3,4-dihydro-1h-quinolin-6-yl)piperazine-1-carbonyl]phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1C(=O)N1CCN(C=2C=C3CCC(=O)NC3=CC=2)CC1 LEOBHGNHJGAFMS-UHFFFAOYSA-N 0.000 description 1
- PRQVRXOXEIYUNA-UHFFFAOYSA-L [K+].[K+].[O-]C([O-])=O.ClC(Cl)Cl Chemical compound [K+].[K+].[O-]C([O-])=O.ClC(Cl)Cl PRQVRXOXEIYUNA-UHFFFAOYSA-L 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 230000001746 atrial effect Effects 0.000 description 1
- LFYJSSARVMHQJB-QIXNEVBVSA-N bakuchiol Chemical compound CC(C)=CCC[C@@](C)(C=C)\C=C\C1=CC=C(O)C=C1 LFYJSSARVMHQJB-QIXNEVBVSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical group N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000005792 cardiovascular activity Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- RYGMFSIKBFXOCR-AHCXROLUSA-N copper-60 Chemical compound [60Cu] RYGMFSIKBFXOCR-AHCXROLUSA-N 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- DUUBBKBUCZZDGQ-UHFFFAOYSA-N ethyl 4-(2-oxo-1h-quinolin-6-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=CC=C(NC(=O)C=C2)C2=C1 DUUBBKBUCZZDGQ-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000006332 fluoro benzoyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 229940057952 methanol Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- MPXAYYWSDIKNTP-UHFFFAOYSA-N n-(2-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC=C1N MPXAYYWSDIKNTP-UHFFFAOYSA-N 0.000 description 1
- BUNFNRVLMKHKIT-UHFFFAOYSA-N n-(2-nitrophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC=C1[N+]([O-])=O BUNFNRVLMKHKIT-UHFFFAOYSA-N 0.000 description 1
- DACCAZYFGKHWPY-UHFFFAOYSA-N n-(2-oxo-1h-quinolin-8-yl)acetamide Chemical compound C1=CC(=O)NC2=C1C=CC=C2NC(=O)C DACCAZYFGKHWPY-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- GTDQGKWDWVUKTI-UHFFFAOYSA-N o-aminoacetophenone Chemical compound CC(=O)C1=CC=CC=C1N GTDQGKWDWVUKTI-UHFFFAOYSA-N 0.000 description 1
- 125000006504 o-cyanobenzyl group Chemical group [H]C1=C([H])C(C#N)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229960001789 papaverine Drugs 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- LJZPPWWHKPGCHS-UHFFFAOYSA-N propargyl chloride Chemical compound ClCC#C LJZPPWWHKPGCHS-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 239000012261 resinous substance Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 229940030010 trimethoxybenzene Drugs 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/40—Nitrogen atoms attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Heart & Thoracic Surgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Hospice & Palliative Care (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP55154071A JPS5777676A (en) | 1980-10-31 | 1980-10-31 | Carbostyril derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3142982A1 DE3142982A1 (de) | 1982-06-24 |
| DE3142982C2 true DE3142982C2 (de) | 1985-12-19 |
Family
ID=15576252
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3142982A Expired DE3142982C2 (de) | 1980-10-31 | 1981-10-29 | Carbostyrilverbindungen, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten |
| DE3153260A Expired DE3153260C2 (cg-RX-API-DMAC7.html) | 1980-10-31 | 1981-10-29 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3153260A Expired DE3153260C2 (cg-RX-API-DMAC7.html) | 1980-10-31 | 1981-10-29 |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4415572A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5777676A (cg-RX-API-DMAC7.html) |
| KR (1) | KR860001944B1 (cg-RX-API-DMAC7.html) |
| AR (2) | AR242563A1 (cg-RX-API-DMAC7.html) |
| AT (1) | AT381701B (cg-RX-API-DMAC7.html) |
| AU (1) | AU524419B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE890942A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1209575A (cg-RX-API-DMAC7.html) |
| CH (2) | CH650782A5 (cg-RX-API-DMAC7.html) |
| DE (2) | DE3142982C2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK155665C (cg-RX-API-DMAC7.html) |
| ES (3) | ES507198A0 (cg-RX-API-DMAC7.html) |
| FI (1) | FI77450C (cg-RX-API-DMAC7.html) |
| FR (2) | FR2493320B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2086896B (cg-RX-API-DMAC7.html) |
| IT (2) | IT1210585B (cg-RX-API-DMAC7.html) |
| MX (1) | MX8481A (cg-RX-API-DMAC7.html) |
| NL (2) | NL194205C (cg-RX-API-DMAC7.html) |
| NO (1) | NO158099C (cg-RX-API-DMAC7.html) |
| PH (1) | PH17962A (cg-RX-API-DMAC7.html) |
| PT (1) | PT73910B (cg-RX-API-DMAC7.html) |
| SE (2) | SE448877B (cg-RX-API-DMAC7.html) |
| SU (1) | SU1426452A3 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA817515B (cg-RX-API-DMAC7.html) |
Families Citing this family (63)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5883677A (ja) * | 1981-11-11 | 1983-05-19 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| JPS5929667A (ja) * | 1982-08-13 | 1984-02-16 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体および強心剤 |
| CH655110A5 (de) * | 1982-09-03 | 1986-03-27 | Otsuka Pharma Co Ltd | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. |
| US4730000A (en) * | 1984-04-09 | 1988-03-08 | Abbott Laboratories | Quinoline antibacterial compounds |
| DK169601B1 (da) * | 1983-10-17 | 1994-12-19 | Duphar Int Res | Piperazinderivater og farmaceutisk præparat indeholdende et sådant derivat, samt piperazinderivater med mellemproduktanvendelse |
| JPS60126270A (ja) * | 1983-12-14 | 1985-07-05 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| PT79699B (en) * | 1983-12-22 | 1986-12-10 | Pfizer | Process for preparing quinolone inotropic agents |
| US4774246A (en) * | 1984-01-26 | 1988-09-27 | Abbott Laboratories | Quinoline antibacterial compounds |
| ES8608874A1 (es) * | 1984-05-29 | 1986-09-01 | Pfizer | Un procedimiento para la preparacion de una 2-(1h)-quinolona |
| JPS60256133A (ja) * | 1984-06-01 | 1985-12-17 | Fuji Photo Film Co Ltd | 放射線画像情報記録読取装置 |
| EP0168003B1 (en) * | 1984-07-06 | 1991-04-03 | Otsuka Pharmaceutical Co., Ltd. | Oxindol compounds, compositions containing same and processes for preparing same |
| JPH07100696B2 (ja) * | 1984-12-18 | 1995-11-01 | 大塚製薬株式会社 | カルボスチリル誘導体 |
| US4760064A (en) * | 1984-12-18 | 1988-07-26 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril compounds, compositions containing same and processes for preparing same |
| JPS61145162A (ja) * | 1984-12-19 | 1986-07-02 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| ATE44528T1 (de) * | 1984-12-21 | 1989-07-15 | Duphar Int Res | Arzneimittel mit antipsychotischer wirkung. |
| ATE81975T1 (de) * | 1984-12-21 | 1992-11-15 | Duphar Int Res | Arzneimittel mit psychotroper wirkung. |
| US4845100A (en) * | 1985-04-12 | 1989-07-04 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof, processes for preparing the same and cardiotonic composition containing the same |
| DE3524067A1 (de) * | 1985-07-05 | 1987-01-08 | Boehringer Mannheim Gmbh | Neue benzimidazole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel sowie zwischenprodukte |
| US4666913A (en) * | 1985-11-22 | 1987-05-19 | William H. Rorer, Inc. | Hydroxy and aminothiazolyl-benzodiazinone compounds, cardiotonic compositions including the same, and their uses |
| GB8529362D0 (en) * | 1985-11-28 | 1986-01-02 | Pfizer Ltd | Quinolone cardiac stimulants |
| JPH0625123B2 (ja) * | 1985-12-12 | 1994-04-06 | 大塚製薬株式会社 | カルボスチリル誘導体−シクロデキストリン包接化合物 |
| US4689325A (en) * | 1985-12-23 | 1987-08-25 | Abbott Laboratories | Isoxazolo-pyrido-phenoxazine and isothiazolo-pyrido-phenoxazine derivatives |
| US4687770A (en) * | 1985-12-23 | 1987-08-18 | Abbott Laboratories | Isoxazolo-pyrido-benzoxazine and isothiazolo-pyrido-benzoxazine derivatives |
| DK111387A (da) * | 1986-03-05 | 1987-09-06 | Otsuka Pharma Co Ltd | Carbostyrilderivater og salte deraf, laegemiddel indeholdende saadanne derivater samt fremgangsmaade til fremstilling af derivaterne |
| US5358949A (en) * | 1986-03-05 | 1994-10-25 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof and anti-arrhythmic agents containing the carbostyril derivatives |
| US5166160A (en) * | 1986-12-23 | 1992-11-24 | Burroughs Wellcome Co. | Quinoline compound |
| GB8630702D0 (en) * | 1986-12-23 | 1987-02-04 | Wellcome Found | Quinoline compound |
| JPS63225357A (ja) * | 1987-03-12 | 1988-09-20 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| GB8827189D0 (en) * | 1988-11-21 | 1988-12-29 | Fujisawa Pharmaceutical Co | 2(1h)-quinolinone compounds processes for preparation thereof & pharmaceutical composition comprising same |
| CA2090876A1 (en) * | 1991-07-03 | 1993-01-04 | Satoru Nakai | Apoptosis regulating composition |
| US5658912A (en) * | 1991-07-03 | 1997-08-19 | Otsuka Pharmaceutical Co., Ltd. | Apoptosis regulating composition |
| JP2597953B2 (ja) * | 1991-12-10 | 1997-04-09 | 大塚製薬株式会社 | 制癌剤 |
| JP2686887B2 (ja) * | 1992-08-11 | 1997-12-08 | キッセイ薬品工業株式会社 | ピペリジノ−3,4−ジヒドロカルボスチリル誘導体 |
| AU666577B2 (en) * | 1992-08-19 | 1996-02-15 | Otsuka Pharmaceutical Co., Ltd. | Apoptosis regulator |
| JP2826790B2 (ja) * | 1992-12-26 | 1998-11-18 | キッセイ薬品工業株式会社 | 3,4−ジヒドロカルボスチリル誘導体 |
| JP3054743B2 (ja) * | 1993-03-02 | 2000-06-19 | 大塚製薬株式会社 | 移植組織の拒絶反応抑制剤 |
| JPH0733664A (ja) * | 1993-07-26 | 1995-02-03 | Otsuka Pharmaceut Co Ltd | 平滑筋細胞増殖抑制剤 |
| GB9326373D0 (en) * | 1993-12-23 | 1994-02-23 | Zeneca Ltd | Chemical compounds |
| GB9326232D0 (en) * | 1993-12-23 | 1994-02-23 | Zeneca Ltd | Chemical compounds |
| US5504093A (en) * | 1994-08-01 | 1996-04-02 | Otsuka Pharmaceutical Co., Ltd. | Method for inhibiting nucleoside and nucleobase transport in mammalian cells, and method for inhibition of DNA virus replication |
| PL189256B1 (pl) | 1996-03-29 | 2005-07-29 | Duphar Int Res | Związki piperazyny i piperydyny, sposób ich wytwarzania, kompozycja farmaceutyczna zawierająca te związki, zastosowanie tych związków do wytwarzania leków |
| GB2312843A (en) * | 1996-05-07 | 1997-11-12 | Merck & Co Inc | Method of treating rheumatoid arthritis |
| US5684007A (en) * | 1996-09-05 | 1997-11-04 | Otsuka Pharmaceutical Co., Ltd. | Methods for inhibiting cardiac fibroblast growth and cardiac fibrosis |
| BR0013597A (pt) * | 1999-08-27 | 2002-07-16 | Ligand Pharm Inc | Compostos e métodos moduladores de receptor de androgênio |
| EP1212322A2 (en) | 1999-08-27 | 2002-06-12 | Ligand Pharmaceuticals Incorporated | 8-substituted-6-trifluoromethyl-9-pyrido[3,2-g]quinoline compounds as androgen receptor modulators |
| US6566372B1 (en) * | 1999-08-27 | 2003-05-20 | Ligand Pharmaceuticals Incorporated | Bicyclic androgen and progesterone receptor modulator compounds and methods |
| EP1216221A2 (en) | 1999-09-14 | 2002-06-26 | Ligand Pharmaceuticals Incorporated | Rxr modulators with improved pharmacologic profile |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| MXPA06001751A (es) * | 2003-08-22 | 2006-05-12 | Ligand Pharm Inc | Derivados de 6-cicloamino-2-quinolinona como compuestos moduladores de receptor de androgeno. |
| EP1865951A1 (en) * | 2005-03-14 | 2007-12-19 | Nycomed GmbH | Method for preventing cardiovascular diseases |
| EP2407459A1 (en) | 2005-09-27 | 2012-01-18 | Shionogi & Co., Ltd. | Synthetic intermediate in the production of a sulfonamide derivative having PGD2 receptor antagonistic activity |
| MX354786B (es) | 2007-06-04 | 2018-03-21 | Synergy Pharmaceuticals Inc | Agonistas de guanilato ciclasa utiles para el tratamiento de trastornos gastrointestinales, inflamacion, cancer y otros trastornos. |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| CA2930674A1 (en) | 2008-06-04 | 2009-12-10 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| JP2011528375A (ja) | 2008-07-16 | 2011-11-17 | シナジー ファーマシューティカルズ インコーポレイテッド | 胃腸障害、炎症、癌、およびその他の障害の治療のために有用なグアニル酸シクラーゼのアゴニスト |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| KR102034748B1 (ko) | 2011-03-01 | 2019-10-21 | 시너지 파마슈티컬즈 인코포레이티드 | 구아닐레이트 사이클라제 c 작용제의 제조 방법 |
| EP3718557A3 (en) | 2013-02-25 | 2020-10-21 | Bausch Health Ireland Limited | Guanylate cyclase receptor agonist sp-333 for use in colonic cleansing |
| CA2905435A1 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| US9708367B2 (en) | 2013-03-15 | 2017-07-18 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase and their uses |
| EP4424697A3 (en) | 2013-06-05 | 2024-12-25 | Bausch Health Ireland Limited | Ultra-pure agonists of guanylate cyclase c, method of making and using same |
| CA2920856A1 (en) | 2013-08-09 | 2015-02-12 | Ardelyx, Inc. | Ph modulating compounds for inhibiting gastrointestinal phosphate uptake |
| CN114340631A (zh) | 2019-05-21 | 2022-04-12 | 阿德利克斯股份有限公司 | 用于降低患者的血清磷酸盐的组合 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1278385B (de) * | 1965-03-30 | 1968-09-26 | Bayer Ag | Aufhellungsmittel |
| GB1299172A (en) * | 1968-10-15 | 1972-12-06 | Lilly Industries Ltd | Heterocyclic anti-inflammatory agents |
| GB1574665A (en) * | 1976-05-08 | 1980-09-10 | Otsuka Pharma Co Ltd | 3,4-dihydrocarbostyril derivatives and process for preparing the same |
| JPS54130589A (en) * | 1978-03-31 | 1979-10-09 | Yoshitomi Pharmaceut Ind Ltd | Pyridazine derivative and its preparation |
| JPS54135785A (en) * | 1978-04-12 | 1979-10-22 | Yoshitomi Pharmaceut Ind Ltd | Pyridazinone derivative and its preparation |
| JPS54138585A (en) * | 1978-04-18 | 1979-10-27 | Yoshitomi Pharmaceut Ind Ltd | Pyridazine derivative and its preparation |
| JPS54141785A (en) * | 1978-04-26 | 1979-11-05 | Yoshitomi Pharmaceut Ind Ltd | Preparation of carboxylic acid derivative |
| JPS6017072B2 (ja) * | 1978-09-05 | 1985-04-30 | 三菱電機株式会社 | 赤熱金属検出器 |
| JPS5549319A (en) * | 1978-10-06 | 1980-04-09 | Yoshitomi Pharmaceut Ind Ltd | Remedy for suppression of blood platelet-agglutination |
| JPS5553283A (en) * | 1978-10-12 | 1980-04-18 | Yoshitomi Pharmaceut Ind Ltd | Pyridazinone derivative |
| JPS5576872A (en) * | 1978-12-06 | 1980-06-10 | Yoshitomi Pharmaceut Ind Ltd | Imidazolidinone derivative |
| JPS5583781A (en) * | 1978-12-19 | 1980-06-24 | Yoshitomi Pharmaceut Ind Ltd | Pyridazinone derivative |
-
1980
- 1980-10-31 JP JP55154071A patent/JPS5777676A/ja active Granted
-
1981
- 1981-10-29 ZA ZA817515A patent/ZA817515B/xx unknown
- 1981-10-29 SU SU813349303A patent/SU1426452A3/ru active
- 1981-10-29 CA CA000389068A patent/CA1209575A/en not_active Expired
- 1981-10-29 DE DE3142982A patent/DE3142982C2/de not_active Expired
- 1981-10-29 ES ES507198A patent/ES507198A0/es active Granted
- 1981-10-29 AT AT0460281A patent/AT381701B/de not_active IP Right Cessation
- 1981-10-29 DE DE3153260A patent/DE3153260C2/de not_active Expired
- 1981-10-29 IT IT8149588A patent/IT1210585B/it active
- 1981-10-30 PT PT73910A patent/PT73910B/pt unknown
- 1981-10-30 AU AU76996/81A patent/AU524419B2/en not_active Expired
- 1981-10-30 CH CH6942/81A patent/CH650782A5/de not_active IP Right Cessation
- 1981-10-30 PH PH26427A patent/PH17962A/en unknown
- 1981-10-30 NL NL8104923A patent/NL194205C/nl not_active IP Right Cessation
- 1981-10-30 FI FI813408A patent/FI77450C/fi not_active IP Right Cessation
- 1981-10-30 BE BE0/206407A patent/BE890942A/fr not_active IP Right Cessation
- 1981-10-30 DK DK480381A patent/DK155665C/da not_active IP Right Cessation
- 1981-10-30 US US06/316,572 patent/US4415572A/en not_active Expired - Lifetime
- 1981-10-30 SE SE8106430A patent/SE448877B/sv not_active IP Right Cessation
- 1981-10-30 GB GB8132743A patent/GB2086896B/en not_active Expired
- 1981-10-30 NO NO813678A patent/NO158099C/no not_active IP Right Cessation
- 1981-10-30 FR FR8120470A patent/FR2493320B1/fr not_active Expired
- 1981-10-30 CH CH199/85A patent/CH656616A5/de not_active IP Right Cessation
- 1981-10-31 KR KR1019810004240A patent/KR860001944B1/ko not_active Expired
-
1983
- 1983-03-15 ES ES520637A patent/ES520637A0/es active Granted
- 1983-03-15 ES ES520638A patent/ES520638A0/es active Granted
- 1983-05-06 AR AR83292954A patent/AR242563A1/es active
-
1984
- 1984-03-21 AR AR84296053A patent/AR242375A1/es active
- 1984-10-11 NL NL8403096A patent/NL8403096A/nl not_active Application Discontinuation
- 1984-10-19 FR FR848416085A patent/FR2552760B1/fr not_active Expired
- 1984-12-06 SE SE8406209A patent/SE466655B/sv not_active IP Right Cessation
-
1985
- 1985-03-26 IT IT8547867A patent/IT1226479B/it active
- 1985-08-09 MX MX848185A patent/MX8481A/es unknown
Non-Patent Citations (4)
| Title |
|---|
| BEILSTEIN: Handbuch der organischen Chemie, E II (9), 1949, S.402 |
| Chemical Abstracts, Bd.92, 1980, 110 195 z |
| NICHTS-ERMITTELT |
| WEISSBERGER: The Chemistry of Heterocyclic Compounds, T.1, 1977, S.209 |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3142982C2 (de) | Carbostyrilverbindungen, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten | |
| DE3486043T2 (de) | Chinolinzwischenprodukte fuer die synthese von 1h-imidazo(4,5-c)chinolinen und 1h-imidazo(4,5-c)chinolin-4-aminen. | |
| AT392790B (de) | Verfahren zur herstellung von neuen 2,3-dihydro-2-oxo-1h-imidazo-(4,5-b)-chinolinyletherderivaten und den pharmazeutisch vertraeglichen salzen davon | |
| DE3204892C2 (cg-RX-API-DMAC7.html) | ||
| AT390257B (de) | Verfahren zur herstellung neuer imidazo(4,5-b)chinolin-derivate | |
| DE2825048C2 (cg-RX-API-DMAC7.html) | ||
| DE3586794T2 (de) | Arzneimittel mit psychotroper wirkung. | |
| EP0339416B1 (de) | Gegebenenfalls alpha-substituierte 4-(Chinolin-2-yl-methoxy)phenylessigsäuren und -ester | |
| DE3782687T2 (de) | Aminoimidazochinolin-derivate. | |
| AT390732B (de) | Pharmazeutika enthaltend pyrazole | |
| DE2658544A1 (de) | Carbostyrilderivate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel | |
| DD211555A5 (de) | Verfahren zur herstellung neuer 4-amino-6,7-dimethoxychinolin-derivate | |
| DE69015541T2 (de) | Chinolinderivate, deren Herstellung und Verwendung. | |
| DE2927988A1 (de) | Neue 8-phenyl-purine, deren herstellung und deren verwendung als arzneimittel | |
| DE69733427T2 (de) | Tetrahydrobezindol derivate | |
| DD262023A5 (de) | Verfahren zur herstellung von dihydropyridinen | |
| DE3622036A1 (de) | Benzimidazolderivate | |
| EP0118854B1 (de) | Chinoloncarbonsäure enthaltende bakterizide Mittel | |
| DE3880077T2 (de) | Mittel gegen angst. | |
| EP0250361B1 (de) | Disubstituierte Piperazine | |
| DE60009931T2 (de) | Muscarin-antagonisten | |
| CH650783A5 (de) | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. | |
| DE3242344A1 (de) | Neue alkylendiaminoderivate, ihre herstellung und diese verbindungen enthaltende arzneimittel | |
| CH643553A5 (de) | 4-amino-2-piperidinochinazolin-derivate, verfahren zu ihrer herstellung und solche derivate enthaltende arzneimittel. | |
| DE2225765A1 (de) | 3- eckige Klammer auf 2-(4-Phenyl-lpiperazinyl)-äthyl eckige Klammer zu -indoline |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3153260 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3153260 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 3153260 Format of ref document f/p: P |