DD294023A5 - Therapeutische mittel - Google Patents
Therapeutische mittel Download PDFInfo
- Publication number
- DD294023A5 DD294023A5 DD89336816A DD33681689A DD294023A5 DD 294023 A5 DD294023 A5 DD 294023A5 DD 89336816 A DD89336816 A DD 89336816A DD 33681689 A DD33681689 A DD 33681689A DD 294023 A5 DD294023 A5 DD 294023A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- formula
- group
- carbon atoms
- methyl
- compounds
- Prior art date
Links
- 239000003814 drug Substances 0.000 title abstract description 3
- 229940124597 therapeutic agent Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 158
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 82
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 57
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 50
- 150000003839 salts Chemical class 0.000 claims abstract description 45
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 39
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 19
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 17
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 14
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 12
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 6
- 125000003277 amino group Chemical group 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract 2
- -1 Aminophenyl compound Chemical class 0.000 claims description 218
- 238000006243 chemical reaction Methods 0.000 claims description 92
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 73
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 48
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 43
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 34
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 31
- 238000002360 preparation method Methods 0.000 claims description 28
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 21
- 229960004279 formaldehyde Drugs 0.000 claims description 21
- 235000019256 formaldehyde Nutrition 0.000 claims description 21
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 18
- 125000002947 alkylene group Chemical group 0.000 claims description 17
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 17
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 16
- 150000001412 amines Chemical class 0.000 claims description 15
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 229940046892 lead acetate Drugs 0.000 claims description 14
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- 239000002585 base Substances 0.000 claims description 10
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 10
- 239000004202 carbamide Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 claims description 8
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 claims description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000001718 carbodiimides Chemical class 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 2
- 150000003951 lactams Chemical class 0.000 claims description 2
- 125000006353 oxyethylene group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000002837 carbocyclic group Chemical group 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 claims 1
- 239000003472 antidiabetic agent Substances 0.000 abstract description 3
- 229940126904 hypoglycaemic agent Drugs 0.000 abstract description 2
- 208000013016 Hypoglycemia Diseases 0.000 abstract 1
- 230000003178 anti-diabetic effect Effects 0.000 abstract 1
- 229940079593 drug Drugs 0.000 abstract 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract 1
- 229940127017 oral antidiabetic Drugs 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- 238000003786 synthesis reaction Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 315
- 239000000203 mixture Substances 0.000 description 240
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 210
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 185
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 174
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 145
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 124
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 123
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 75
- 239000000243 solution Substances 0.000 description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 63
- 239000000047 product Substances 0.000 description 58
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 55
- 239000003921 oil Substances 0.000 description 51
- 235000019198 oils Nutrition 0.000 description 51
- 238000002844 melting Methods 0.000 description 46
- 230000008018 melting Effects 0.000 description 46
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 41
- 239000002904 solvent Substances 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 34
- 239000007787 solid Substances 0.000 description 33
- 238000010992 reflux Methods 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 25
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 24
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 24
- 239000001530 fumaric acid Substances 0.000 description 23
- 229960004198 guanidine Drugs 0.000 description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 22
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 21
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 20
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 20
- 238000004587 chromatography analysis Methods 0.000 description 19
- 239000003480 eluent Substances 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 17
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 17
- QKWLVAYDAHQMLG-UHFFFAOYSA-N 2-morpholin-4-ylaniline Chemical compound NC1=CC=CC=C1N1CCOCC1 QKWLVAYDAHQMLG-UHFFFAOYSA-N 0.000 description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000001704 evaporation Methods 0.000 description 15
- 230000008020 evaporation Effects 0.000 description 15
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 15
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 13
- 239000000126 substance Substances 0.000 description 13
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 12
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000012267 brine Substances 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 11
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 11
- 235000011114 ammonium hydroxide Nutrition 0.000 description 11
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 10
- 238000005859 coupling reaction Methods 0.000 description 10
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical class I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229910021529 ammonia Inorganic materials 0.000 description 9
- POZRVZJJTULAOH-LHZXLZLDSA-N danazol Chemical compound C1[C@]2(C)[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=CC2=C1C=NO2 POZRVZJJTULAOH-LHZXLZLDSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- KQNKJJBFUFKYFX-UHFFFAOYSA-N acetic acid;trihydrate Chemical compound O.O.O.CC(O)=O KQNKJJBFUFKYFX-UHFFFAOYSA-N 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 8
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 8
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 7
- 230000007935 neutral effect Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000008103 glucose Substances 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- WOCANZVRSXYFPS-UHFFFAOYSA-N methyl n'-(2-morpholin-4-ylphenyl)carbamimidothioate;hydroiodide Chemical compound I.CSC(=N)NC1=CC=CC=C1N1CCOCC1 WOCANZVRSXYFPS-UHFFFAOYSA-N 0.000 description 6
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 229910001220 stainless steel Inorganic materials 0.000 description 5
- 239000010935 stainless steel Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- YMJLUEVJOLZYNU-UHFFFAOYSA-N 1-butyl-2-methyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCCCNC(NC)=NC1=CC=CC=C1N1CCOCC1 YMJLUEVJOLZYNU-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- WPQZSUSLLBSFIH-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;iodide Chemical compound I.NC(N)=O WPQZSUSLLBSFIH-UHFFFAOYSA-N 0.000 description 4
- 230000001476 alcoholic effect Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical group C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 4
- 150000003585 thioureas Chemical class 0.000 description 4
- AQYPBQKDGHHKBD-UHFFFAOYSA-N (2-morpholin-4-ylphenyl)cyanamide Chemical compound N#CNC1=CC=CC=C1N1CCOCC1 AQYPBQKDGHHKBD-UHFFFAOYSA-N 0.000 description 3
- YIMGGHGOVMBIJO-UHFFFAOYSA-N 1,1-dimethyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CN(C)C(N)=NC1=CC=CC=C1N1CCOCC1 YIMGGHGOVMBIJO-UHFFFAOYSA-N 0.000 description 3
- OWOQFKKPHWXCKM-UHFFFAOYSA-N 1,1-dimethyl-3-(2-morpholin-4-ylphenyl)thiourea Chemical compound CN(C)C(=S)NC1=CC=CC=C1N1CCOCC1 OWOQFKKPHWXCKM-UHFFFAOYSA-N 0.000 description 3
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 3
- SLSVHNSMVHATQA-UHFFFAOYSA-N 2,2-dimethyl-n'-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CC(C)(C)C(=N)NC1=CC=CC=C1N1CCOCC1 SLSVHNSMVHATQA-UHFFFAOYSA-N 0.000 description 3
- NDAJNMAAXXIADY-UHFFFAOYSA-N 2-methylpropanimidamide Chemical compound CC(C)C(N)=N NDAJNMAAXXIADY-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 3
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 229930012538 Paclitaxel Natural products 0.000 description 3
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 3
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 230000002218 hypoglycaemic effect Effects 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- AYBOKXXQIIWKAJ-UHFFFAOYSA-N methyl n'-methyl-n-(2-morpholin-4-ylphenyl)carbamimidothioate;hydroiodide Chemical compound I.CSC(=NC)NC1=CC=CC=C1N1CCOCC1 AYBOKXXQIIWKAJ-UHFFFAOYSA-N 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 229960001592 paclitaxel Drugs 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 3
- 229960002218 sodium chlorite Drugs 0.000 description 3
- 239000011343 solid material Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- CMMLLKHOSNEVFO-UHFFFAOYSA-N (2-morpholin-4-ylphenyl)thiourea Chemical compound NC(=S)NC1=CC=CC=C1N1CCOCC1 CMMLLKHOSNEVFO-UHFFFAOYSA-N 0.000 description 2
- JFXFQLTTXMZHBM-UHFFFAOYSA-N (2-piperidin-1-ylphenyl)thiourea Chemical compound NC(=S)NC1=CC=CC=C1N1CCCCC1 JFXFQLTTXMZHBM-UHFFFAOYSA-N 0.000 description 2
- VGICPVCQAZPROO-UHFFFAOYSA-N (3-methyl-2-morpholin-4-ylphenyl)thiourea Chemical compound CC1=CC=CC(NC(N)=S)=C1N1CCOCC1 VGICPVCQAZPROO-UHFFFAOYSA-N 0.000 description 2
- KUYYWVDLLLFAAA-UHFFFAOYSA-N (5-chloro-2-morpholin-4-ylphenyl)cyanamide Chemical compound N#CNC1=CC(Cl)=CC=C1N1CCOCC1 KUYYWVDLLLFAAA-UHFFFAOYSA-N 0.000 description 2
- FDOGAHCLAIGGEZ-UHFFFAOYSA-N (5-chloro-2-morpholin-4-ylphenyl)thiourea Chemical compound NC(=S)NC1=CC(Cl)=CC=C1N1CCOCC1 FDOGAHCLAIGGEZ-UHFFFAOYSA-N 0.000 description 2
- VJRKYCLWDMCDTO-UHFFFAOYSA-N (5-cyano-2-morpholin-4-ylphenyl)thiourea Chemical compound NC(=S)NC1=CC(C#N)=CC=C1N1CCOCC1 VJRKYCLWDMCDTO-UHFFFAOYSA-N 0.000 description 2
- SOWKCCAHSVVGPU-UHFFFAOYSA-N (5-fluoro-2-morpholin-4-ylphenyl)thiourea Chemical compound NC(=S)NC1=CC(F)=CC=C1N1CCOCC1 SOWKCCAHSVVGPU-UHFFFAOYSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- ZFMPDYCKJRMUTD-UHFFFAOYSA-N 1,1-dimethyl-2-(5-methylsulfanyl-2-morpholin-4-ylphenyl)guanidine Chemical compound CN(C)C(N)=NC1=CC(SC)=CC=C1N1CCOCC1 ZFMPDYCKJRMUTD-UHFFFAOYSA-N 0.000 description 2
- JZWXIHLNCRFQDL-UHFFFAOYSA-N 1,2-dimethyl-3-(5-methyl-2-morpholin-4-ylphenyl)guanidine Chemical compound CNC(NC)=NC1=CC(C)=CC=C1N1CCOCC1 JZWXIHLNCRFQDL-UHFFFAOYSA-N 0.000 description 2
- RKNLYMYCMBQNSG-UHFFFAOYSA-N 1,3-dimethyl-n-(2-thiomorpholin-4-ylphenyl)imidazolidin-2-imine Chemical compound CN1CCN(C)C1=NC1=CC=CC=C1N1CCSCC1 RKNLYMYCMBQNSG-UHFFFAOYSA-N 0.000 description 2
- HBAIZGPCSAAFSU-UHFFFAOYSA-N 1-(2-hydroxyethyl)imidazolidin-2-one Chemical compound OCCN1CCNC1=O HBAIZGPCSAAFSU-UHFFFAOYSA-N 0.000 description 2
- LHSJVYODFKJLOR-UHFFFAOYSA-N 1-butyl-2-methyl-3-(5-methyl-2-morpholin-4-ylphenyl)guanidine Chemical compound CCCCNC(NC)=NC1=CC(C)=CC=C1N1CCOCC1 LHSJVYODFKJLOR-UHFFFAOYSA-N 0.000 description 2
- OPIOJBPNNOORPK-UHFFFAOYSA-N 1-butyl-3-(5-chloro-2-morpholin-4-ylphenyl)thiourea Chemical compound CCCCNC(=S)NC1=CC(Cl)=CC=C1N1CCOCC1 OPIOJBPNNOORPK-UHFFFAOYSA-N 0.000 description 2
- JZDBCWJVHNVLLS-UHFFFAOYSA-N 1-ethyl-1,3,3-trimethyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCN(C)C(N(C)C)=NC1=CC=CC=C1N1CCOCC1 JZDBCWJVHNVLLS-UHFFFAOYSA-N 0.000 description 2
- FGFWHCOPGCHCKF-UHFFFAOYSA-N 1-ethyl-1-methyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCN(C)C(N)=NC1=CC=CC=C1N1CCOCC1 FGFWHCOPGCHCKF-UHFFFAOYSA-N 0.000 description 2
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 2
- HGUFODBRKLSHSI-UHFFFAOYSA-N 2,3,7,8-tetrachloro-dibenzo-p-dioxin Chemical compound O1C2=CC(Cl)=C(Cl)C=C2OC2=C1C=C(Cl)C(Cl)=C2 HGUFODBRKLSHSI-UHFFFAOYSA-N 0.000 description 2
- MKJDUTHNQPJPAI-UHFFFAOYSA-N 2-(2-oxoimidazolidin-1-yl)ethyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCCN1CCNC1=O MKJDUTHNQPJPAI-UHFFFAOYSA-N 0.000 description 2
- DYPMOFPPFNCXLJ-UHFFFAOYSA-N 2-(3-methyl-2-oxoimidazolidin-1-yl)ethyl benzoate Chemical compound O=C1N(C)CCN1CCOC(=O)C1=CC=CC=C1 DYPMOFPPFNCXLJ-UHFFFAOYSA-N 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- HNAAKIPAJBGKCC-UHFFFAOYSA-N 2-morpholin-4-ylaniline;hydrochloride Chemical compound Cl.NC1=CC=CC=C1N1CCOCC1 HNAAKIPAJBGKCC-UHFFFAOYSA-N 0.000 description 2
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- BFPUBGCFJMIZDF-UHFFFAOYSA-N 2-pyrrolidin-1-ylaniline Chemical compound NC1=CC=CC=C1N1CCCC1 BFPUBGCFJMIZDF-UHFFFAOYSA-N 0.000 description 2
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- UXQVCAUVMIYSDD-UHFFFAOYSA-N 3-isothiocyanato-4-morpholin-4-ylbenzonitrile Chemical compound S=C=NC1=CC(C#N)=CC=C1N1CCOCC1 UXQVCAUVMIYSDD-UHFFFAOYSA-N 0.000 description 2
- KHVJNKFFYBDEAF-UHFFFAOYSA-N 4-(4-fluoro-2-isothiocyanatophenyl)morpholine Chemical compound S=C=NC1=CC(F)=CC=C1N1CCOCC1 KHVJNKFFYBDEAF-UHFFFAOYSA-N 0.000 description 2
- UPERWIGIMKKWRJ-UHFFFAOYSA-N 4-[2-isothiocyanato-4-(trifluoromethyl)phenyl]morpholine Chemical compound S=C=NC1=CC(C(F)(F)F)=CC=C1N1CCOCC1 UPERWIGIMKKWRJ-UHFFFAOYSA-N 0.000 description 2
- NSVHSRBHIFWVGP-UHFFFAOYSA-N 5-fluoro-2-morpholin-4-ylaniline Chemical compound NC1=CC(F)=CC=C1N1CCOCC1 NSVHSRBHIFWVGP-UHFFFAOYSA-N 0.000 description 2
- FABHEYAZAOCBCH-UHFFFAOYSA-N 5-methyl-2-morpholin-4-ylaniline Chemical compound NC1=CC(C)=CC=C1N1CCOCC1 FABHEYAZAOCBCH-UHFFFAOYSA-N 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N Acetylene Chemical compound C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000907681 Morpho Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- OOFVCRQBROGLRK-UHFFFAOYSA-N [2-[bis(2-methoxyethyl)amino]phenyl]thiourea Chemical compound COCCN(CCOC)C1=CC=CC=C1NC(N)=S OOFVCRQBROGLRK-UHFFFAOYSA-N 0.000 description 2
- LNDXVNYTVMIKED-UHFFFAOYSA-N [2-morpholin-4-yl-5-(trifluoromethyl)phenyl]thiourea Chemical compound NC(=S)NC1=CC(C(F)(F)F)=CC=C1N1CCOCC1 LNDXVNYTVMIKED-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 2
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 2
- LIMQQADUEULBSO-UHFFFAOYSA-N butyl isothiocyanate Chemical compound CCCCN=C=S LIMQQADUEULBSO-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- PHFQLYPOURZARY-UHFFFAOYSA-N chromium trinitrate Chemical compound [Cr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PHFQLYPOURZARY-UHFFFAOYSA-N 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 description 2
- 239000002702 enteric coating Substances 0.000 description 2
- 238000009505 enteric coating Methods 0.000 description 2
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- JXYZHMPRERWTPM-UHFFFAOYSA-N hydron;morpholine;chloride Chemical compound Cl.C1COCCN1 JXYZHMPRERWTPM-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- NPTMHWWBARRCMP-UHFFFAOYSA-N methyl n'-methyl-n-(5-methyl-2-morpholin-4-ylphenyl)carbamimidothioate;hydroiodide Chemical compound I.CSC(=NC)NC1=CC(C)=CC=C1N1CCOCC1 NPTMHWWBARRCMP-UHFFFAOYSA-N 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- GAGYTSOEDMAYIA-UHFFFAOYSA-N n'-(2-morpholin-4-ylphenyl)butanimidamide Chemical compound CCCC(=N)NC1=CC=CC=C1N1CCOCC1 GAGYTSOEDMAYIA-UHFFFAOYSA-N 0.000 description 2
- VCDBLXGXXUBKIS-UHFFFAOYSA-N n-methyl-n'-(2-morpholin-4-ylphenyl)methanediimine Chemical compound CN=C=NC1=CC=CC=C1N1CCOCC1 VCDBLXGXXUBKIS-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- JEHAYQACLBXPFA-UHFFFAOYSA-N (2-methyl-6-morpholin-4-ylphenyl)thiourea Chemical compound CC1=CC=CC(N2CCOCC2)=C1NC(N)=S JEHAYQACLBXPFA-UHFFFAOYSA-N 0.000 description 1
- AHVKUQNZOIILGF-UHFFFAOYSA-N (4-methoxy-2-morpholin-4-ylphenyl)cyanamide Chemical compound COC1=CC=C(NC#N)C(N2CCOCC2)=C1 AHVKUQNZOIILGF-UHFFFAOYSA-N 0.000 description 1
- DYMVJWOTOQCATD-UHFFFAOYSA-N (5-fluoro-2-morpholin-4-ylphenyl)cyanamide Chemical compound N#CNC1=CC(F)=CC=C1N1CCOCC1 DYMVJWOTOQCATD-UHFFFAOYSA-N 0.000 description 1
- KCOYHFNCTWXETP-UHFFFAOYSA-N (carbamothioylamino)thiourea Chemical compound NC(=S)NNC(N)=S KCOYHFNCTWXETP-UHFFFAOYSA-N 0.000 description 1
- WHHDLFMIKFEKHM-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,2-dimethyl-3-(5-methyl-2-morpholin-4-ylphenyl)guanidine Chemical compound OC(=O)\C=C\C(O)=O.CNC(=NC)NC1=CC(C)=CC=C1N1CCOCC1 WHHDLFMIKFEKHM-WLHGVMLRSA-N 0.000 description 1
- OULNZNAOEADVJM-WLHGVMLRSA-N (e)-but-2-enedioic acid;2-[3-methyl-2-(2-morpholin-4-ylphenyl)iminoimidazolidin-1-yl]ethyl benzoate Chemical compound OC(=O)\C=C\C(O)=O.C=1C=CC=C(N2CCOCC2)C=1N=C1N(C)CCN1CCOC(=O)C1=CC=CC=C1 OULNZNAOEADVJM-WLHGVMLRSA-N 0.000 description 1
- KJJQAGBCYUBELI-WLHGVMLRSA-N (e)-but-2-enedioic acid;4-methyl-n-(2-morpholin-4-ylphenyl)-3,4-dihydro-2h-pyrrol-5-amine Chemical compound OC(=O)\C=C\C(O)=O.CC1CCNC1=NC1=CC=CC=C1N1CCOCC1 KJJQAGBCYUBELI-WLHGVMLRSA-N 0.000 description 1
- KHABPRMUUQCJLV-TYYBGVCCSA-N (e)-but-2-enedioic acid;guanidine Chemical compound NC(N)=N.OC(=O)\C=C\C(O)=O KHABPRMUUQCJLV-TYYBGVCCSA-N 0.000 description 1
- LHXCUWOJEALYLZ-WLHGVMLRSA-N (e)-but-2-enedioic acid;morpholine Chemical compound C1COCCN1.OC(=O)\C=C\C(O)=O LHXCUWOJEALYLZ-WLHGVMLRSA-N 0.000 description 1
- IGVOMGGEJQWSBE-WLHGVMLRSA-N (e)-but-2-enedioic acid;n',2,2-trimethyl-n-[2-(morpholin-4-ylmethyl)phenyl]propanimidamide Chemical compound OC(=O)\C=C\C(O)=O.CNC(C(C)(C)C)=NC1=CC=CC=C1CN1CCOCC1 IGVOMGGEJQWSBE-WLHGVMLRSA-N 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- GPCBEYBKBZUWEP-UHFFFAOYSA-N 1,1,2-trimethyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound CNC(N(C)C)=NC1=CC=CC=C1N1CCOCC1 GPCBEYBKBZUWEP-UHFFFAOYSA-N 0.000 description 1
- QKUOKKCUFHBMIO-UHFFFAOYSA-N 1,1,3,3-tetramethyl-2-(2-morpholin-4-ylphenyl)guanidine;hydroiodide Chemical compound I.CN(C)C(N(C)C)=NC1=CC=CC=C1N1CCOCC1 QKUOKKCUFHBMIO-UHFFFAOYSA-N 0.000 description 1
- FHCKDCVPDZBKEA-UHFFFAOYSA-N 1,1,3-trimethyl-3-pentylurea Chemical compound CCCCCN(C)C(=O)N(C)C FHCKDCVPDZBKEA-UHFFFAOYSA-N 0.000 description 1
- BLUKMJWFJBXGQX-UHFFFAOYSA-N 1,1-bis(2-methoxyethyl)-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound COCCN(CCOC)C(N)=NC1=CC=CC=C1N1CCOCC1 BLUKMJWFJBXGQX-UHFFFAOYSA-N 0.000 description 1
- DCEQKRORMZMZHV-UHFFFAOYSA-N 1,1-diethyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCN(CC)C(N)=NC1=CC=CC=C1N1CCOCC1 DCEQKRORMZMZHV-UHFFFAOYSA-N 0.000 description 1
- WVLQNRALFCAULM-UHFFFAOYSA-N 1,1-dimethyl-2-(2-methyl-6-morpholin-4-ylphenyl)guanidine Chemical compound CN(C)C(N)=NC1=C(C)C=CC=C1N1CCOCC1 WVLQNRALFCAULM-UHFFFAOYSA-N 0.000 description 1
- OHFMKFHVEXXQGP-UHFFFAOYSA-N 1,1-dimethyl-2-(2-piperidin-1-ylphenyl)guanidine Chemical compound CN(C)C(N)=NC1=CC=CC=C1N1CCCCC1 OHFMKFHVEXXQGP-UHFFFAOYSA-N 0.000 description 1
- UWDMXYWIYRWPCF-UHFFFAOYSA-N 1,1-dimethyl-2-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]guanidine Chemical compound CN(C)C(N)=NC1=CC(C(F)(F)F)=CC=C1N1CCOCC1 UWDMXYWIYRWPCF-UHFFFAOYSA-N 0.000 description 1
- OZTPZKOTNKOWFT-UHFFFAOYSA-N 1,1-dimethyl-2-[5-(2-methylpropyl)-2-morpholin-4-ylphenyl]guanidine Chemical compound CN(C)C(N)=NC1=CC(CC(C)C)=CC=C1N1CCOCC1 OZTPZKOTNKOWFT-UHFFFAOYSA-N 0.000 description 1
- HMMICDMDSIUFIP-UHFFFAOYSA-N 1,2-dimethyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound CNC(NC)=NC1=CC=CC=C1N1CCOCC1 HMMICDMDSIUFIP-UHFFFAOYSA-N 0.000 description 1
- XOIJIQNLLZTAOI-UHFFFAOYSA-N 1,2-dimethyl-3-[2-(1,2,4-oxathiazinan-4-yl)phenyl]guanidine Chemical compound CNC(=NC)NC1=CC=CC=C1N1CSOCC1 XOIJIQNLLZTAOI-UHFFFAOYSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- KWPVLUWTOJHTFX-UHFFFAOYSA-N 1,3,3-trimethylpyrrolidin-2-one Chemical compound CN1CCC(C)(C)C1=O KWPVLUWTOJHTFX-UHFFFAOYSA-N 0.000 description 1
- MSVZOIZEBAPKPL-UHFFFAOYSA-N 1,3-diethyl-n-(2-morpholin-4-ylphenyl)imidazolidin-2-imine Chemical compound CCN1CCN(CC)C1=NC1=CC=CC=C1N1CCOCC1 MSVZOIZEBAPKPL-UHFFFAOYSA-N 0.000 description 1
- FBCAJWQEFIFURV-UHFFFAOYSA-N 1,3-dimethyl-n-(2-morpholin-4-ylphenyl)imidazolidin-2-imine Chemical compound CN1CCN(C)C1=NC1=CC=CC=C1N1CCOCC1 FBCAJWQEFIFURV-UHFFFAOYSA-N 0.000 description 1
- GVVZVAGNYVMATE-UHFFFAOYSA-N 1,3-dimethyl-n-(2-morpholin-4-ylphenyl)piperidin-2-imine Chemical compound CC1CCCN(C)C1=NC1=CC=CC=C1N1CCOCC1 GVVZVAGNYVMATE-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- ATDLANNMDBYQDO-UHFFFAOYSA-N 1-(2-isothiocyanato-3-methylphenyl)piperidine Chemical compound CC1=CC=CC(N2CCCCC2)=C1N=C=S ATDLANNMDBYQDO-UHFFFAOYSA-N 0.000 description 1
- CJMUPCHCOYBPLD-UHFFFAOYSA-N 1-(2-isothiocyanatophenyl)piperidine Chemical compound S=C=NC1=CC=CC=C1N1CCCCC1 CJMUPCHCOYBPLD-UHFFFAOYSA-N 0.000 description 1
- GJWWEGYULZSQLT-UHFFFAOYSA-N 1-(2-methoxyethyl)-1-methyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound COCCN(C)C(N)=NC1=CC=CC=C1N1CCOCC1 GJWWEGYULZSQLT-UHFFFAOYSA-N 0.000 description 1
- SOOKQBIOWOIWBS-UHFFFAOYSA-N 1-(2-methoxyethyl)-2-methyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound COCCNC(NC)=NC1=CC=CC=C1N1CCOCC1 SOOKQBIOWOIWBS-UHFFFAOYSA-N 0.000 description 1
- QHHCHYAXPBQVJX-UHFFFAOYSA-N 1-(2-methoxyethyl)-3-methylimidazolidin-2-one Chemical compound COCCN1CCN(C)C1=O QHHCHYAXPBQVJX-UHFFFAOYSA-N 0.000 description 1
- WTYRIHBHPIZRRM-UHFFFAOYSA-N 1-(5-chloro-2-morpholin-4-ylphenyl)-2,3-dimethylguanidine Chemical compound CNC(NC)=NC1=CC(Cl)=CC=C1N1CCOCC1 WTYRIHBHPIZRRM-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- KHABMOXCEDCYAU-UHFFFAOYSA-N 1-benzyl-3-methylpyrrolidin-2-one Chemical compound O=C1C(C)CCN1CC1=CC=CC=C1 KHABMOXCEDCYAU-UHFFFAOYSA-N 0.000 description 1
- QFMDSZDYQRMENV-UHFFFAOYSA-N 1-butyl-1,3,3-trimethyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCCCN(C)C(N(C)C)=NC1=CC=CC=C1N1CCOCC1 QFMDSZDYQRMENV-UHFFFAOYSA-N 0.000 description 1
- XSMQZBJOJPZQCX-UHFFFAOYSA-N 1-butyl-1,3,3-trimethylurea Chemical compound CCCCN(C)C(=O)N(C)C XSMQZBJOJPZQCX-UHFFFAOYSA-N 0.000 description 1
- DMZQVBMPUFJGFR-UHFFFAOYSA-N 1-butyl-1-methyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCCCN(C)C(N)=NC1=CC=CC=C1N1CCOCC1 DMZQVBMPUFJGFR-UHFFFAOYSA-N 0.000 description 1
- ODWQLZXUHXWHON-UHFFFAOYSA-N 1-butyl-2-methyl-3-(2-methyl-6-morpholin-4-ylphenyl)guanidine Chemical compound CCCCNC(NC)=NC1=C(C)C=CC=C1N1CCOCC1 ODWQLZXUHXWHON-UHFFFAOYSA-N 0.000 description 1
- OAXRDUZQOFLVPR-UHFFFAOYSA-N 1-butyl-3-(2-morpholin-4-ylphenyl)thiourea Chemical compound CCCCNC(=S)NC1=CC=CC=C1N1CCOCC1 OAXRDUZQOFLVPR-UHFFFAOYSA-N 0.000 description 1
- LFTAGZLDVBSLSD-UHFFFAOYSA-N 1-butyl-3-(5-fluoro-2-morpholin-4-ylphenyl)-2-methylguanidine Chemical compound CCCCNC(NC)=NC1=CC(F)=CC=C1N1CCOCC1 LFTAGZLDVBSLSD-UHFFFAOYSA-N 0.000 description 1
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 1
- WJPCLVRIKPPQNQ-UHFFFAOYSA-N 1-ethyl-1-(2-methoxyethyl)-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound COCCN(CC)C(N)=NC1=CC=CC=C1N1CCOCC1 WJPCLVRIKPPQNQ-UHFFFAOYSA-N 0.000 description 1
- DYAJNGLMRPAFOA-UHFFFAOYSA-N 1-ethyl-2-methyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCNC(NC)=NC1=CC=CC=C1N1CCOCC1 DYAJNGLMRPAFOA-UHFFFAOYSA-N 0.000 description 1
- ZWXTUKIOAVCZIO-UHFFFAOYSA-N 1-methyl-1-(2-methylsulfanylethyl)-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound CSCCN(C)C(N)=NC1=CC=CC=C1N1CCOCC1 ZWXTUKIOAVCZIO-UHFFFAOYSA-N 0.000 description 1
- RRLCNWRKOSQAIK-UHFFFAOYSA-N 1-methyl-3-(2-methyl-6-morpholin-4-ylphenyl)thiourea Chemical compound CNC(=S)NC1=C(C)C=CC=C1N1CCOCC1 RRLCNWRKOSQAIK-UHFFFAOYSA-N 0.000 description 1
- HPVGVXDYXJMSKS-UHFFFAOYSA-N 1-methyl-3-(2-morpholin-4-ylphenyl)thiourea Chemical compound CNC(=S)NC1=CC=CC=C1N1CCOCC1 HPVGVXDYXJMSKS-UHFFFAOYSA-N 0.000 description 1
- MOOWCIKASIHXIX-UHFFFAOYSA-N 1-methyl-3-(2-pyrrolidin-1-ylphenyl)thiourea Chemical compound CNC(=S)NC1=CC=CC=C1N1CCCC1 MOOWCIKASIHXIX-UHFFFAOYSA-N 0.000 description 1
- DFVVGPBWZWKHKC-UHFFFAOYSA-N 1-methyl-3-(5-methyl-2-morpholin-4-ylphenyl)thiourea Chemical compound CNC(=S)NC1=CC(C)=CC=C1N1CCOCC1 DFVVGPBWZWKHKC-UHFFFAOYSA-N 0.000 description 1
- VDQQJMHXZCMNMU-UHFFFAOYSA-N 1-phenylpyrrolidine Chemical compound C1CCCN1C1=CC=CC=C1 VDQQJMHXZCMNMU-UHFFFAOYSA-N 0.000 description 1
- YDVUQEDSAJAWFE-UHFFFAOYSA-N 1-tert-butyl-2-methyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound CC(C)(C)NC(NC)=NC1=CC=CC=C1N1CCOCC1 YDVUQEDSAJAWFE-UHFFFAOYSA-N 0.000 description 1
- KVDQSIAWZJZZQV-UHFFFAOYSA-N 1-tert-butyl-2-methyl-3-(4-methyl-2-morpholin-4-ylphenyl)guanidine Chemical compound CC(C)(C)NC(NC)=NC1=CC=C(C)C=C1N1CCOCC1 KVDQSIAWZJZZQV-UHFFFAOYSA-N 0.000 description 1
- XJGCEDDGGJFSKH-UHFFFAOYSA-N 1-tert-butyl-2-methyl-3-(4-methylsulfanyl-2-morpholin-4-ylphenyl)guanidine Chemical compound CC(C)(C)NC(NC)=NC1=CC=C(SC)C=C1N1CCOCC1 XJGCEDDGGJFSKH-UHFFFAOYSA-N 0.000 description 1
- ZEIUQLDGNBLIKO-UHFFFAOYSA-N 1-tert-butyl-2-methyl-3-[2-(1,2,4-oxathiazinan-4-yl)phenyl]guanidine Chemical compound CC(C)(C)NC(=NC)NC1=CC=CC=C1N1CSOCC1 ZEIUQLDGNBLIKO-UHFFFAOYSA-N 0.000 description 1
- ZFFAFLAJTAZNCA-UHFFFAOYSA-N 1-tert-butyl-2-methyl-3-[4-(methylsulfanylmethyl)-2-morpholin-4-ylphenyl]guanidine Chemical compound CC(C)(C)NC(NC)=NC1=CC=C(CSC)C=C1N1CCOCC1 ZFFAFLAJTAZNCA-UHFFFAOYSA-N 0.000 description 1
- ZNHIINPTKBZRFF-UHFFFAOYSA-N 1-tert-butyl-3-(4-fluoro-2-morpholin-4-ylphenyl)-2-methylguanidine Chemical compound CC(C)(C)NC(NC)=NC1=CC=C(F)C=C1N1CCOCC1 ZNHIINPTKBZRFF-UHFFFAOYSA-N 0.000 description 1
- FSUPKDUNLKQBCN-UHFFFAOYSA-N 1H-pyrrole-2-carboximidamide Chemical compound NC(=N)C1=CC=CN1 FSUPKDUNLKQBCN-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- MUHCXIXLBPLESV-UHFFFAOYSA-N 2,2-dimethyl-n'-[2-(morpholin-4-ylmethyl)phenyl]propanimidamide Chemical compound CC(C)(C)C(=N)NC1=CC=CC=C1CN1CCOCC1 MUHCXIXLBPLESV-UHFFFAOYSA-N 0.000 description 1
- UKUVVAMSXXBMRX-UHFFFAOYSA-N 2,4,5-trithia-1,3-diarsabicyclo[1.1.1]pentane Chemical group S1[As]2S[As]1S2 UKUVVAMSXXBMRX-UHFFFAOYSA-N 0.000 description 1
- UXQSLUMLBUONSI-UHFFFAOYSA-N 2-(2-methoxyethyl)-1-(2-morpholin-4-ylphenyl)guanidine Chemical compound COCCNC(N)=NC1=CC=CC=C1N1CCOCC1 UXQSLUMLBUONSI-UHFFFAOYSA-N 0.000 description 1
- TVXXNUVILCBXRU-UHFFFAOYSA-N 2-(2-methoxyethyl)-1-(2-piperidin-1-ylphenyl)guanidine Chemical compound COCCNC(N)=NC1=CC=CC=C1N1CCCCC1 TVXXNUVILCBXRU-UHFFFAOYSA-N 0.000 description 1
- XNPSFFSMEXSPKL-UHFFFAOYSA-N 2-(2-methoxyethyl)guanidine Chemical compound COCCN=C(N)N XNPSFFSMEXSPKL-UHFFFAOYSA-N 0.000 description 1
- DGNVJSAZKRFGMJ-UHFFFAOYSA-N 2-(2-methylpyrrolidin-1-yl)aniline Chemical compound CC1CCCN1C1=CC=CC=C1N DGNVJSAZKRFGMJ-UHFFFAOYSA-N 0.000 description 1
- ICSHCPATZANHRG-UHFFFAOYSA-N 2-(3-methyl-2-oxoimidazolidin-1-yl)ethyl acetate Chemical compound CN1CCN(CCOC(C)=O)C1=O ICSHCPATZANHRG-UHFFFAOYSA-N 0.000 description 1
- VFQRQOCAKNYDLF-UHFFFAOYSA-N 2-(4-methoxy-2-morpholin-4-ylphenyl)-1,1-dimethylguanidine Chemical compound COC1=CC=C(N=C(N)N(C)C)C(N2CCOCC2)=C1 VFQRQOCAKNYDLF-UHFFFAOYSA-N 0.000 description 1
- NZUZWGVKWAAUMH-UHFFFAOYSA-N 2-(5-cyano-2-morpholin-4-ylphenyl)-1,1-dimethylguanidine Chemical compound CN(C)C(N)=NC1=CC(C#N)=CC=C1N1CCOCC1 NZUZWGVKWAAUMH-UHFFFAOYSA-N 0.000 description 1
- LGTLXSYUSFFCRQ-UHFFFAOYSA-N 2-(5-ethyl-2-morpholin-4-ylphenyl)-1,1-dimethylguanidine Chemical compound CN(C)C(N)=NC1=CC(CC)=CC=C1N1CCOCC1 LGTLXSYUSFFCRQ-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- BNBJMXCRCHPDIG-UHFFFAOYSA-N 2-(morpholin-4-ylmethyl)aniline Chemical compound NC1=CC=CC=C1CN1CCOCC1 BNBJMXCRCHPDIG-UHFFFAOYSA-N 0.000 description 1
- ASEWKVACNDUPPV-UHFFFAOYSA-N 2-(morpholin-4-ylmethyl)aniline;dihydrochloride Chemical compound Cl.Cl.NC1=CC=CC=C1CN1CCOCC1 ASEWKVACNDUPPV-UHFFFAOYSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- XNZSPCSJWIIKJC-UHFFFAOYSA-N 2-[2-(dimethylamino)phenyl]-1,1-dimethylguanidine Chemical compound CN(C)C(N)=NC1=CC=CC=C1N(C)C XNZSPCSJWIIKJC-UHFFFAOYSA-N 0.000 description 1
- BMKNHYSUYQXQBX-UHFFFAOYSA-N 2-butyl-1-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCCCNC(N)=NC1=CC=CC=C1N1CCOCC1 BMKNHYSUYQXQBX-UHFFFAOYSA-N 0.000 description 1
- BLOJHKBEZQXFEB-UHFFFAOYSA-N 2-butyl-1-ethyl-3-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCCCNC(NCC)=NC1=CC=CC=C1N1CCOCC1 BLOJHKBEZQXFEB-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- KXOGDEVRJMWOSP-UHFFFAOYSA-N 2-ethyl-1-(2-morpholin-4-ylphenyl)guanidine Chemical compound CCNC(N)=NC1=CC=CC=C1N1CCOCC1 KXOGDEVRJMWOSP-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- DAAVYQQFXKNSLP-UHFFFAOYSA-N 2-methyl-1-(2-morpholin-4-ylphenyl)-3-pentylguanidine Chemical compound CCCCCNC(NC)=NC1=CC=CC=C1N1CCOCC1 DAAVYQQFXKNSLP-UHFFFAOYSA-N 0.000 description 1
- BSZMEBLZPOKRNW-UHFFFAOYSA-N 2-methyl-1-(2-morpholin-4-ylphenyl)-3-propylguanidine Chemical compound CCCNC(NC)=NC1=CC=CC=C1N1CCOCC1 BSZMEBLZPOKRNW-UHFFFAOYSA-N 0.000 description 1
- HSFSECZWADULIV-UHFFFAOYSA-N 2-methyl-1-(2-morpholin-4-ylphenyl)guanidine Chemical compound CNC(N)=NC1=CC=CC=C1N1CCOCC1 HSFSECZWADULIV-UHFFFAOYSA-N 0.000 description 1
- ULZVZRVDMKHKAL-UHFFFAOYSA-N 2-methyl-2-n-propan-2-ylpropane-1,2-diamine Chemical compound CC(C)NC(C)(C)CN ULZVZRVDMKHKAL-UHFFFAOYSA-N 0.000 description 1
- IWXICDBISVWHGV-UHFFFAOYSA-N 2-methyl-6-piperidin-1-ylaniline Chemical compound CC1=CC=CC(N2CCCCC2)=C1N IWXICDBISVWHGV-UHFFFAOYSA-N 0.000 description 1
- WECUSHSUUIHVCH-UHFFFAOYSA-N 2-methyl-n'-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CC(C)C(=N)NC1=CC=CC=C1N1CCOCC1 WECUSHSUUIHVCH-UHFFFAOYSA-N 0.000 description 1
- CYWGSFFHHMQKET-UHFFFAOYSA-N 2-methylsulfanylethanamine Chemical compound CSCCN CYWGSFFHHMQKET-UHFFFAOYSA-N 0.000 description 1
- CNVOJNRNRNAOOP-UHFFFAOYSA-N 2-morpholin-4-yl-5-(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC=C1N1CCOCC1 CNVOJNRNRNAOOP-UHFFFAOYSA-N 0.000 description 1
- VWMWWYQIPLGBPM-UHFFFAOYSA-N 2-n,2-n-bis(2-methoxyethyl)benzene-1,2-diamine Chemical compound COCCN(CCOC)C1=CC=CC=C1N VWMWWYQIPLGBPM-UHFFFAOYSA-N 0.000 description 1
- OYECAJPUPWFCSL-UHFFFAOYSA-N 2-piperidin-1-ylaniline Chemical compound NC1=CC=CC=C1N1CCCCC1 OYECAJPUPWFCSL-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- OZSNMDQOXOXTNX-UHFFFAOYSA-N 3-[2-(2-morpholin-4-ylphenyl)iminopiperidin-1-yl]propanenitrile Chemical compound N#CCCN1CCCCC1=NC1=CC=CC=C1N1CCOCC1 OZSNMDQOXOXTNX-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- ZFRALOPNZCFSBA-UHFFFAOYSA-N 3-amino-4-morpholin-4-ylbenzonitrile Chemical compound NC1=CC(C#N)=CC=C1N1CCOCC1 ZFRALOPNZCFSBA-UHFFFAOYSA-N 0.000 description 1
- GYILGUCNWIUUOX-UHFFFAOYSA-N 4-(2-isothiocyanato-6-methylphenyl)morpholine Chemical compound CC1=CC=CC(N=C=S)=C1N1CCOCC1 GYILGUCNWIUUOX-UHFFFAOYSA-N 0.000 description 1
- ZNIVBGRYSLARJS-UHFFFAOYSA-N 4-(2-morpholin-4-ylphenyl)morpholine Chemical compound C1COCCN1C1=CC=CC=C1N1CCOCC1 ZNIVBGRYSLARJS-UHFFFAOYSA-N 0.000 description 1
- OFWPPBDBRPIZRT-UHFFFAOYSA-N 4-(4-chloro-2-isothiocyanatophenyl)morpholine Chemical compound S=C=NC1=CC(Cl)=CC=C1N1CCOCC1 OFWPPBDBRPIZRT-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- JTSFIVQMXUDGAB-UHFFFAOYSA-N 4-thiomorpholin-4-ylmorpholine Chemical group C1COCCN1N1CCSCC1 JTSFIVQMXUDGAB-UHFFFAOYSA-N 0.000 description 1
- XBDOGBDXBXBNLH-UHFFFAOYSA-N 5-chloro-2-(morpholin-4-ylmethyl)aniline Chemical compound NC1=CC(Cl)=CC=C1CN1CCOCC1 XBDOGBDXBXBNLH-UHFFFAOYSA-N 0.000 description 1
- UNDBLGNMBLCRNJ-UHFFFAOYSA-N 5-chloro-2-morpholin-4-ylaniline Chemical compound NC1=CC(Cl)=CC=C1N1CCOCC1 UNDBLGNMBLCRNJ-UHFFFAOYSA-N 0.000 description 1
- USFKFIGZQHXLEV-UHFFFAOYSA-N 5-methyl-n-(2-morpholin-4-ylphenyl)-4,5-dihydro-1h-imidazol-2-amine Chemical compound N1C(C)CNC1=NC1=CC=CC=C1N1CCOCC1 USFKFIGZQHXLEV-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 description 1
- 229940123208 Biguanide Drugs 0.000 description 1
- MPHOWMDBCDBDTM-UHFFFAOYSA-N C(C=CC(=O)O)(=O)O.C(CCC)(=N)N Chemical compound C(C=CC(=O)O)(=O)O.C(CCC)(=N)N MPHOWMDBCDBDTM-UHFFFAOYSA-N 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 208000031969 Eye Hemorrhage Diseases 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 244000294411 Mirabilis expansa Species 0.000 description 1
- 235000015429 Mirabilis expansa Nutrition 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 description 1
- BJJXEIIEASWRLT-UHFFFAOYSA-N OC(=O)C(O)C(O)C(O)=O.CN(C)C(N)=NC1=CC(C)=CC=C1N1CCOCC1 Chemical compound OC(=O)C(O)C(O)C(O)=O.CN(C)C(N)=NC1=CC(C)=CC=C1N1CCOCC1 BJJXEIIEASWRLT-UHFFFAOYSA-N 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 239000005700 Putrescine Substances 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 241001178520 Stomatepia mongo Species 0.000 description 1
- 241000838698 Togo Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- ZYTBQICKIJOOAB-UHFFFAOYSA-N [2-(1,2,4-oxathiazinan-4-yl)phenyl]thiourea Chemical compound NC(=S)NC1=CC=CC=C1N1CSOCC1 ZYTBQICKIJOOAB-UHFFFAOYSA-N 0.000 description 1
- HEVVYRPCQLBYTC-UHFFFAOYSA-N [methyl(methylamino)amino]methanamine Chemical compound CNN(C)CN HEVVYRPCQLBYTC-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- CHIHQLCVLOXUJW-UHFFFAOYSA-N benzoic anhydride Chemical compound C=1C=CC=CC=1C(=O)OC(=O)C1=CC=CC=C1 CHIHQLCVLOXUJW-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000006480 benzoylation reaction Methods 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- KZGLRFIQMPDBDV-UHFFFAOYSA-N boric acid;guanidine Chemical compound NC(N)=N.OB(O)O KZGLRFIQMPDBDV-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- RXKUYBRRTKRGME-UHFFFAOYSA-N butanimidamide Chemical compound CCCC(N)=N RXKUYBRRTKRGME-UHFFFAOYSA-N 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- CKQQMPJQZXIYMJ-UHFFFAOYSA-N dihydrate;dihydrochloride Chemical compound O.O.Cl.Cl CKQQMPJQZXIYMJ-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000002662 enteric coated tablet Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 201000001421 hyperglycemia Diseases 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 238000010902 jet-milling Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- XLOFXCBOAGRHBN-UHFFFAOYSA-N methyl n'-(2-methyl-6-piperidin-1-ylphenyl)carbamimidothioate;hydroiodide Chemical compound I.CSC(=N)NC1=C(C)C=CC=C1N1CCCCC1 XLOFXCBOAGRHBN-UHFFFAOYSA-N 0.000 description 1
- ONLUETIGUPBGLU-UHFFFAOYSA-N methyl n'-butyl-n-(5-chloro-2-morpholin-4-ylphenyl)carbamimidothioate;hydroiodide Chemical compound I.CCCCN=C(SC)NC1=CC(Cl)=CC=C1N1CCOCC1 ONLUETIGUPBGLU-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 1
- 235000013536 miso Nutrition 0.000 description 1
- VSEAAEQOQBMPQF-UHFFFAOYSA-N morpholin-3-one Chemical compound O=C1COCCN1 VSEAAEQOQBMPQF-UHFFFAOYSA-N 0.000 description 1
- QGJAVGUBPSOFKS-UHFFFAOYSA-N morpholine;dihydrochloride Chemical compound Cl.Cl.C1COCCN1 QGJAVGUBPSOFKS-UHFFFAOYSA-N 0.000 description 1
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- FFLYAXRFHNBAPK-UHFFFAOYSA-N n',2,2-trimethyl-n-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CNC(C(C)(C)C)=NC1=CC=CC=C1N1CCOCC1 FFLYAXRFHNBAPK-UHFFFAOYSA-N 0.000 description 1
- ZHOLTTIAXKORSU-UHFFFAOYSA-N n',2-dimethyl-n-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CNC(C(C)C)=NC1=CC=CC=C1N1CCOCC1 ZHOLTTIAXKORSU-UHFFFAOYSA-N 0.000 description 1
- PTGWNQXYFRYROU-UHFFFAOYSA-N n'-(2-morpholin-4-ylphenyl)ethanimidamide Chemical compound CC(=N)NC1=CC=CC=C1N1CCOCC1 PTGWNQXYFRYROU-UHFFFAOYSA-N 0.000 description 1
- BLUUWKVYAFKWFO-UHFFFAOYSA-N n'-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CCC(=N)NC1=CC=CC=C1N1CCOCC1 BLUUWKVYAFKWFO-UHFFFAOYSA-N 0.000 description 1
- BENIFPFKIDBRNI-UHFFFAOYSA-N n'-(5-fluoro-2-morpholin-4-ylphenyl)-2-methylpropanimidamide Chemical compound CC(C)C(=N)NC1=CC(F)=CC=C1N1CCOCC1 BENIFPFKIDBRNI-UHFFFAOYSA-N 0.000 description 1
- KJEHJFZPGYRZSQ-UHFFFAOYSA-N n'-ethyl-n-(2-morpholin-4-ylphenyl)butanimidamide Chemical compound CCCC(NCC)=NC1=CC=CC=C1N1CCOCC1 KJEHJFZPGYRZSQ-UHFFFAOYSA-N 0.000 description 1
- QJJHFYANTFCVCU-UHFFFAOYSA-N n'-methyl-n-(2-morpholin-4-ylphenyl)butanimidamide Chemical compound CCCC(NC)=NC1=CC=CC=C1N1CCOCC1 QJJHFYANTFCVCU-UHFFFAOYSA-N 0.000 description 1
- GNJFKDGGDZJFNE-UHFFFAOYSA-N n'-methyl-n-(2-morpholin-4-ylphenyl)hexanimidamide Chemical compound CCCCCC(NC)=NC1=CC=CC=C1N1CCOCC1 GNJFKDGGDZJFNE-UHFFFAOYSA-N 0.000 description 1
- YBLQLBPYIJUTQF-UHFFFAOYSA-N n'-methyl-n-(2-morpholin-4-ylphenyl)pentanimidamide Chemical compound CCCCC(NC)=NC1=CC=CC=C1N1CCOCC1 YBLQLBPYIJUTQF-UHFFFAOYSA-N 0.000 description 1
- MOYZWYDTBGRGIZ-UHFFFAOYSA-N n'-methyl-n-(2-morpholin-4-ylphenyl)pyrrolidine-1-carboximidamide Chemical compound C1CCCN1C(NC)=NC1=CC=CC=C1N1CCOCC1 MOYZWYDTBGRGIZ-UHFFFAOYSA-N 0.000 description 1
- QHJABUZHRJTCAR-UHFFFAOYSA-N n'-methylpropane-1,3-diamine Chemical compound CNCCCN QHJABUZHRJTCAR-UHFFFAOYSA-N 0.000 description 1
- QMKKJBRRKIKWFK-UHFFFAOYSA-N n,2,2-trimethylpropanamide Chemical compound CNC(=O)C(C)(C)C QMKKJBRRKIKWFK-UHFFFAOYSA-N 0.000 description 1
- AGTUASCWDGKYTM-UHFFFAOYSA-N n,n,2,2-tetramethyl-n'-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CN(C)C(C(C)(C)C)=NC1=CC=CC=C1N1CCOCC1 AGTUASCWDGKYTM-UHFFFAOYSA-N 0.000 description 1
- ASAXNYWEZWNBOU-UHFFFAOYSA-N n,n,2-trimethyl-n'-(2-morpholin-4-ylphenyl)propanimidamide Chemical compound CC(C)C(N(C)C)=NC1=CC=CC=C1N1CCOCC1 ASAXNYWEZWNBOU-UHFFFAOYSA-N 0.000 description 1
- YRHCBULSLFMFHF-UHFFFAOYSA-N n,n-dimethyl-n'-(2-morpholin-4-ylphenyl)butanimidamide Chemical compound CCCC(N(C)C)=NC1=CC=CC=C1N1CCOCC1 YRHCBULSLFMFHF-UHFFFAOYSA-N 0.000 description 1
- BKDWVLKGKILUQI-UHFFFAOYSA-N n,n-dimethyl-n'-(2-morpholin-4-ylphenyl)pentanimidamide Chemical compound CCCCC(N(C)C)=NC1=CC=CC=C1N1CCOCC1 BKDWVLKGKILUQI-UHFFFAOYSA-N 0.000 description 1
- FYYRPPUFMRGGNG-UHFFFAOYSA-N n,n-dimethylpiperidine-1-carboxamide Chemical compound CN(C)C(=O)N1CCCCC1 FYYRPPUFMRGGNG-UHFFFAOYSA-N 0.000 description 1
- XUYVJGGBHWQISS-UHFFFAOYSA-N n-(2-morpholin-4-ylphenyl)-2,3,4,5-tetrahydropyridin-6-amine Chemical compound N1CCCCC1=NC1=CC=CC=C1N1CCOCC1 XUYVJGGBHWQISS-UHFFFAOYSA-N 0.000 description 1
- AKQLUDQDDATCNB-UHFFFAOYSA-N n-(2-morpholin-4-ylphenyl)-4,5,6,7-tetrahydro-1h-1,3-diazepin-2-amine Chemical compound C1COCCN1C1=CC=CC=C1N=C1NCCCCN1 AKQLUDQDDATCNB-UHFFFAOYSA-N 0.000 description 1
- XJODFGYWLXTNQT-UHFFFAOYSA-N n-(5-chloro-2-pyrrolidin-1-ylphenyl)-2,3,4,5-tetrahydropyridin-6-amine Chemical compound C1CCCNC1=NC1=CC(Cl)=CC=C1N1CCCC1 XJODFGYWLXTNQT-UHFFFAOYSA-N 0.000 description 1
- FAKVHTGDHWPUGT-UHFFFAOYSA-N n-[2-(azepan-1-yl)phenyl]-2,3,4,5-tetrahydropyridin-6-amine Chemical compound N1CCCCC1=NC1=CC=CC=C1N1CCCCCC1 FAKVHTGDHWPUGT-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WIIWCWCZHZBQFZ-UHFFFAOYSA-N n-phenyl-1,2,4-oxathiazinan-4-amine Chemical compound C1SOCCN1NC1=CC=CC=C1 WIIWCWCZHZBQFZ-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 1
- 229940100692 oral suspension Drugs 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- JAMNHZBIQDNHMM-UHFFFAOYSA-N pivalonitrile Chemical compound CC(C)(C)C#N JAMNHZBIQDNHMM-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- SIXLXDIJGIWWFU-UHFFFAOYSA-N pyritinol Chemical compound OCC1=C(O)C(C)=NC=C1CSSCC1=CN=C(C)C(O)=C1CO SIXLXDIJGIWWFU-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C257/00—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines
- C07C257/10—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/18—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D223/12—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D225/00—Heterocyclic compounds containing rings of more than seven members having one nitrogen atom as the only ring hetero atom
- C07D225/04—Heterocyclic compounds containing rings of more than seven members having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/50—Nitrogen atoms not forming part of a nitro radical with carbocyclic radicals directly attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Diabetes (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Endocrinology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Emergency Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Steroid Compounds (AREA)
- Saccharide Compounds (AREA)
- Indole Compounds (AREA)
- Soy Sauces And Products Related Thereto (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
- Thermotherapy And Cooling Therapy Devices (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB898903592A GB8903592D0 (en) | 1989-02-16 | 1989-02-16 | Therapeutic agents |
Publications (1)
Publication Number | Publication Date |
---|---|
DD294023A5 true DD294023A5 (de) | 1991-09-19 |
Family
ID=10651840
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DD89336816A DD294023A5 (de) | 1989-02-16 | 1989-12-29 | Therapeutische mittel |
Country Status (26)
Country | Link |
---|---|
US (2) | US5223498A (uk) |
EP (1) | EP0385038B1 (uk) |
JP (1) | JP2545475B2 (uk) |
AT (1) | ATE90074T1 (uk) |
BG (1) | BG60557B1 (uk) |
CS (1) | CS277609B6 (uk) |
DD (1) | DD294023A5 (uk) |
DE (1) | DE68906880T2 (uk) |
DK (1) | DK640889A (uk) |
ES (1) | ES2055115T3 (uk) |
FI (1) | FI95565C (uk) |
GB (1) | GB8903592D0 (uk) |
GE (1) | GEP19981040B (uk) |
HU (1) | HU211571A9 (uk) |
IL (1) | IL92963A (uk) |
LT (3) | LT3960B (uk) |
LV (1) | LV10619B (uk) |
MY (1) | MY105052A (uk) |
NO (1) | NO177993C (uk) |
PL (2) | PL162960B1 (uk) |
PT (1) | PT92770B (uk) |
RO (2) | RO107945B1 (uk) |
RU (3) | RU1826969C (uk) |
UA (2) | UA27713C2 (uk) |
YU (1) | YU48164B (uk) |
ZA (1) | ZA899941B (uk) |
Families Citing this family (13)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0273712B1 (en) * | 1986-12-27 | 1990-12-12 | Konica Corporation | Light-sensitive silver halide photographic material |
IN172842B (uk) * | 1990-05-17 | 1993-12-11 | Boots Pharmaceuticals Limited | |
GB9418912D0 (en) * | 1994-09-20 | 1994-11-09 | Fisons Corp | Pharmaceutically active compounds |
WO1996017612A1 (en) * | 1994-12-08 | 1996-06-13 | Knoll Aktiengesellschaft | Use of substituted phenylamidine and phenylguanidine compounds for the treatment of cerebral and cardiac ischaemia, convulsion and sickle cell anaemia |
TW397812B (en) * | 1995-02-11 | 2000-07-11 | Astra Ab | Bicyclic isothiourea derivatives useful in therapy |
WO1997046515A1 (fr) * | 1996-06-04 | 1997-12-11 | Chugai Seiyaku Kabushiki Kaisha | Benzenes substitues ne presentant pas d'effets inhibiteurs |
US6756389B2 (en) * | 1996-08-09 | 2004-06-29 | Cambridge Neuroscience, Inc. | Pharmaceutically active compounds and methods of use |
US6187203B1 (en) * | 1998-12-01 | 2001-02-13 | Academia Sinica | Sample purification apparatus and method |
AU2230501A (en) * | 1999-12-28 | 2001-07-09 | Nissan Chemical Industries Ltd. | Heterocyclic imino compounds and fungicides and insecticides for agricultural and horticultural use |
CN1395467A (zh) * | 2000-09-07 | 2003-02-05 | 美国拜尔公司 | 用作孕酮受体结合剂的环和非环脒以及包含它们的药物组合物 |
PE20070182A1 (es) * | 2005-07-29 | 2007-03-06 | Wyeth Corp | Derivados cianopirrol-fenil amida como moduladores del receptor de progesterona |
PE20070341A1 (es) * | 2005-07-29 | 2007-04-13 | Wyeth Corp | Derivados de pirrol como moduladores del receptor de progesterona |
PE20070404A1 (es) * | 2005-07-29 | 2007-05-10 | Wyeth Corp | Compuestos derivados de cianopirrol-sulfonamida como moduladores del receptor de progesterona |
Family Cites Families (86)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DD81857A (uk) * | ||||
CA372219A (en) | 1938-03-01 | Kienzle Fritz | Perforating device | |
US77978A (en) | 1868-05-19 | Improvement in low-water indicators | ||
US672015A (en) | 1900-10-05 | 1901-04-16 | Alfred Schlatter | Automatic switch for groups of transformers. |
GB861527A (en) * | 1958-05-16 | 1961-02-22 | Ici Ltd | New salts of penicillins |
US3622596A (en) * | 1960-10-14 | 1971-11-23 | A Wander Sa Dr | Carbanilide compounds |
CH459172A (de) * | 1961-09-11 | 1968-07-15 | Wander Ag Dr A | Verfahren zur Herstellung mehrbasischer Verbindungen |
US3867448A (en) * | 1962-03-08 | 1975-02-18 | Ciba Geigy Ag | Trifluoromethylphenyl-formamadines and acetamidines |
NL299929A (uk) * | 1962-10-30 | |||
US3479437A (en) * | 1963-08-26 | 1969-11-18 | Stauffer Chemical Co | Guanidine complexes as fungicides |
US3320229A (en) * | 1963-08-26 | 1967-05-16 | Stauffer Chemical Co | Complexes of guanidines with completely halogenated acetones |
US3636219A (en) * | 1964-03-02 | 1972-01-18 | Du Pont | Anticholinergic compositions containing certain thiazolines or imidazolines |
US3399211A (en) * | 1964-03-10 | 1968-08-27 | Merck & Co Inc | Production of 2-aryl-4(5)-nitroimidazoles |
US3479401A (en) * | 1966-06-28 | 1969-11-18 | Merck & Co Inc | Guanidinoaryl and guanidinomethylaryl compounds |
DE1670274A1 (de) * | 1966-10-31 | 1970-07-16 | Boehringer Sohn Ingelheim | Neues Verfahren zur Herstellung von 2-Arylamino-1,3-diazacycloalkenen-(2) |
IL30281A (en) * | 1967-07-11 | 1971-12-29 | Chinoin Gyogyszer Es Vegyeszet | Amidine history and process for their preparation |
US3925471A (en) * | 1970-06-13 | 1975-12-09 | Bayer Ag | Aminophenylamidines their production and their medicinal use |
US3925470A (en) * | 1970-06-13 | 1975-12-09 | Bayer Ag | Aminophenylamidines, their production and their medicinal use |
US3903302A (en) * | 1970-06-13 | 1975-09-02 | Bayer Ag | Aminophenylamidines as anthelmintic agents |
US3919315A (en) * | 1970-06-13 | 1975-11-11 | Bayer Ag | New aminophenylamidines, their production and their medicinal use |
US3996247A (en) * | 1970-06-13 | 1976-12-07 | Bayer Aktiengesellschaft | Substituted 4-aminophenylamidines |
US3923888A (en) * | 1970-06-13 | 1975-12-02 | Bayer Ag | Aminophenylamidines, their production and their medicinal use |
US4013676A (en) * | 1970-06-13 | 1977-03-22 | Bayer Aktiengesellschaft | Aminophenylamidines, their production and their pharmaceutical use |
US3911010A (en) * | 1970-06-13 | 1975-10-07 | Bayer Ag | Aminophenylamidines, their production and their pharmaceutical use |
DE2029297A1 (de) * | 1970-06-13 | 1971-12-30 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Neue Aminophenyl-cycloamidine, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
DE2029299C3 (de) * | 1970-06-13 | 1980-08-21 | Bayer Ag, 5090 Leverkusen | Neue Aminophenylamidine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
US3911013A (en) * | 1970-06-13 | 1975-10-07 | Bayer Ag | New aminophenylamidines, their production and their medicinal use |
US4018814A (en) * | 1970-06-13 | 1977-04-19 | Bayer Aktiengesellschaft | Aromatic amides and carbomates of phenylamidines |
US3911014A (en) * | 1970-06-13 | 1975-10-07 | Bayer Ag | Aminophenylamidines, their production and their medicinal use |
DE2029298C3 (de) * | 1970-06-13 | 1980-04-17 | Bayer Ag, 5090 Leverkusen | Aminophenylamidine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
FR2098352A7 (en) * | 1970-07-13 | 1972-03-10 | Fahlberg List Veb | Hydroxyguanidines - with selective herbicidal activity |
GB1311913A (en) * | 1970-09-05 | 1973-03-28 | Fahlberg List Veb | Herbicidal hydroxyguanidines |
US3897474A (en) * | 1972-10-12 | 1975-07-29 | Ciba Geigy Corp | Thiol and dithiol carbamate acid ester derivatives of phenyl formamidine |
US3965176A (en) * | 1973-06-20 | 1976-06-22 | Schering Corporation | Novel substituted amidines |
IL44905A (en) * | 1973-06-25 | 1977-03-31 | Ciba Geigy Ag | N-alkyl-n-(n-alkylformimidoyl)-n'-phenylformamidine derivatives their preparation and use in pest control |
SE7411169L (sv) * | 1974-09-04 | 1976-03-05 | Wander Ag Dr A | Forfarande for framstellning av nya organiska foreningar |
JPS51118832A (en) * | 1975-04-09 | 1976-10-19 | Sumitomo Chem Co Ltd | A non-medical antibacterial, 3-pyridyl substituted guanidine |
US4211867A (en) * | 1976-03-19 | 1980-07-08 | Mcneil Laboratories, Incorporated | Nitrogen heterocyclic carboximidamide compounds |
DE2626128A1 (de) * | 1976-06-11 | 1977-12-22 | Beiersdorf Ag | N-substituierte benzimidazolin-2-one und verfahren zu deren herstellung |
US4414211A (en) * | 1978-09-18 | 1983-11-08 | Mcneilab, Inc. | Heterocyclic derivatives of guanidine |
US4182865A (en) * | 1978-09-18 | 1980-01-08 | Mcneil Laboratories, Inc. | Diaza-cyclic derivatives of guanidine |
DE2848786C3 (de) * | 1978-11-10 | 1981-05-21 | Ibm Deutschland Gmbh, 7000 Stuttgart | Schaltungsanordnung für die Synchronisierung der Auftrittszeitpunkte von Druckhammeraufschlag mit dem Eintreffen der Drucktype an der Druckstelle |
AU5263779A (en) * | 1978-11-29 | 1980-05-29 | Beecham Group Limited | Derivatives of thiazolidin-2-ylidene and oxazolidin-2-ylidene with hypoglycaemic acitivity |
US4247705A (en) * | 1979-02-06 | 1981-01-27 | A. H. Robins Company, Inc. | 4-Substituted 2-iminoimidazolidine compounds |
CA1138451A (en) * | 1979-04-03 | 1982-12-28 | Ikuo Ueda | 2-imidazoline derivatives, process for the preparation thereof and the pharmaceutical composition of the same |
ZA802161B (en) * | 1979-04-11 | 1981-04-29 | Ciba Geigy Ag | Guanidines,processes for producing them,and pharmaceutical preparations containing sucn compounds |
IN150250B (uk) * | 1979-04-16 | 1982-08-28 | Ciba Geigy India Ltd | |
EP0018134B1 (en) * | 1979-04-21 | 1984-03-14 | Beecham Group Plc | Dihydropyridine derivatives, processes for their preparation and pharmaceutical compositions containing them |
US4342764A (en) * | 1979-05-29 | 1982-08-03 | Ciba-Geigy Corporation | Guanidine compounds, pharmaceutical compositions and use |
JPS55160764A (en) * | 1979-05-29 | 1980-12-13 | Ciba Geigy Ag | Guanidine* its manufacture and pharmaceutic medicine containing same |
DD144919A1 (de) * | 1979-07-20 | 1980-11-12 | Rainer Beckert | Verfahren zur herstellung von 2,5-diaryl-3,4-diarylimino-1,2,5-thiadiazolidin-s-oxiden |
JPS5618969A (en) * | 1979-07-24 | 1981-02-23 | Toyama Chem Co Ltd | Novel 1-(4-aminobenzyl)-2,3-dioxopiperazine derivative, its acid addition salt, and their preparation |
US4340609A (en) * | 1980-01-02 | 1982-07-20 | William H. Rorer, Inc. | Amidinourea derivative veterinary compositions for suppression of parasitemia |
US4287201A (en) * | 1980-03-03 | 1981-09-01 | Merck & Co., Inc. | Anovulatory method and chicken feed compositions |
US4281004A (en) * | 1980-03-31 | 1981-07-28 | Pfizer Inc. | Phenylguanidine therapeutic agents |
DE3168754D1 (en) * | 1980-07-09 | 1985-03-21 | Beecham Group Plc | Clonidine derivatives useful in the treatment of diarrhoea |
US4348406A (en) * | 1980-10-20 | 1982-09-07 | Schering Corporation | Novel guanidine derivatives |
US4735959A (en) * | 1981-01-10 | 1988-04-05 | Dr. Karl Thomae Gmbh | Carboxylic acid amides and pharmaceutical compositions containing them |
DE3225188A1 (de) * | 1982-07-06 | 1984-01-12 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue phenylessigsaeurederivate, ihre herstellung und diese verbindungen enthaltende arzneimittel |
DE3100575A1 (de) * | 1981-01-10 | 1982-09-02 | Dr. Karl Thomae Gmbh, 7950 Biberach | "neue benzoesaeuren, ihre herstellung und ihre verwendung als arzneimittel" |
EP0070084A3 (en) * | 1981-04-24 | 1983-02-16 | Beecham Group Plc | Imidazoline derivatives |
US4461904A (en) * | 1981-11-20 | 1984-07-24 | Alcon Laboratories, Inc. | 2-(Trisubstituted phenylimino)-imidazolines |
DE3375783D1 (en) * | 1982-07-06 | 1988-04-07 | Thomae Gmbh Dr K | Phenyl-acetic-acid derivatives, their preparation and pharmaceutical compostions containing them |
US4533739A (en) * | 1982-10-12 | 1985-08-06 | G. D. Searle & Co. | 2-[(Aminophenyl and amidophenyl)amino]-1-azacycloalkanes having antidiarrheal activity |
DD216021A5 (de) * | 1983-01-13 | 1984-11-28 | Rhone Poulenc Sante | Verfahren zur herstellung eines neuen pyrrolderivates |
FR2539417A1 (fr) * | 1983-01-13 | 1984-07-20 | Rhone Poulenc Sante | Nouveaux pyrrolo-1, 2 heterocycles, leur preparation et les medicaments qui les contiennent |
SU1114674A1 (ru) * | 1983-02-08 | 1984-09-23 | Предприятие П/Я Р-6913 | Способ получени гидрохлоридов производных @ , @ -дифенил бензамидина |
GB8304593D0 (en) * | 1983-02-18 | 1983-03-23 | Beecham Group Plc | Amidines |
US4735942A (en) * | 1984-01-09 | 1988-04-05 | Janssen Pharmaceutica, N.V. | [[4-[4-(4-phenyl-1-piperazinyl)phenoxymethyl]-1,3-dioxolan-2-yl]-methyl]-1H-imidazoles and 1H-1,2,4-triazoles having antimicrobial properties |
US4861879A (en) * | 1983-02-28 | 1989-08-29 | Janssen Pharmaceutica N.V. | [[4-[4-Phenyl-1-piperazinyl)phenoxymethyl]-1-3-dioxolan-2-yl]-methyl]-1H-imidazoles and 1H-1,2,4-triazoles |
US4619931A (en) * | 1983-02-28 | 1986-10-28 | Janssen Pharmaceutica, N.V. | [[4-[4-(4-phenyl-1-piperazinyl)phenoxymethyl]-1,3-dioxolan-2-yl]methyl]-1H-imidazoles and 1H-1,2,4-triazoles |
FR2549049B1 (fr) * | 1983-07-13 | 1986-06-20 | Chauvin Blache Lab | Nouvelles amidines, leur procede de preparation et leur application therapeutique |
US4701447A (en) * | 1983-09-23 | 1987-10-20 | Schering Corporation | N-((2-nitro)phenyl)-N' (organic acid) guanidine anthelmintics |
US4723029A (en) * | 1983-09-23 | 1988-02-02 | Schering Corporation | Organic acid-substituted guanidine anthelmintics |
JPS60100559A (ja) * | 1983-11-05 | 1985-06-04 | Morishita Seiyaku Kk | 2−アニリノ−1,6−ジヒドロ−6−オキソ−5−ピリミジンカルボン酸誘導体,その製法及び該化合物を含有する抗アレルギ−剤 |
US4579951A (en) * | 1984-03-19 | 1986-04-01 | G. D. Searle & Co. | Substituted (azacycloalk-2-yl)iminophenols and esters thereof |
US4560690A (en) * | 1984-04-30 | 1985-12-24 | Pfizer Inc. | 2-(N-substituted guanidino)-4-hetero-arylthiazole antiulcer agents |
EP0164204A1 (en) * | 1984-05-12 | 1985-12-11 | FISONS plc | Novel pharmaceutically useful pyrimidines |
HU192986B (en) * | 1984-05-23 | 1987-08-28 | Egyt Gyogyszervegyeszeti Gyar | Process for production of imidasodiline derivatives |
US4656270A (en) * | 1985-03-15 | 1987-04-07 | Mcneilab, Inc. | Process for producing guanidines such as linogliride |
US4693850A (en) * | 1985-03-15 | 1987-09-15 | Mcneilab, Inc. | Methane sulfonic acid derivatives |
DE3518917A1 (de) * | 1985-05-25 | 1986-11-27 | Bayer Ag, 5090 Leverkusen | Substituierte benzochinolizine, verfahren zur herstellung und ihre verwendung in arzneimitteln |
DE3529692A1 (de) * | 1985-08-20 | 1987-02-26 | Bayer Ag | Verwendung von lactamamiden als leistungsfoerderer bei tieren |
CA1292472C (en) * | 1985-12-03 | 1991-11-26 | Alfonsus Guilielmus Knaeps | Derivatives of ¬¬4-¬4-(4-phenyl-1-piperazinyl)- phenoxymethyl|-1,3-dioxolan-2-yl|methyl|-1h-imidazoles and 1h-1,2,4-triazoles |
ATE135699T1 (de) * | 1986-01-13 | 1996-04-15 | American Cyanamid Co | 4,5,6-substituierte 2-pyrimidinamine |
GB8602025D0 (en) | 1986-01-28 | 1986-03-05 | Reid M | Orthopaedic trolley |
-
1989
- 1989-02-16 GB GB898903592A patent/GB8903592D0/en active Pending
- 1989-12-13 FI FI895956A patent/FI95565C/fi not_active IP Right Cessation
- 1989-12-14 NO NO895023A patent/NO177993C/no not_active IP Right Cessation
- 1989-12-18 DK DK640889A patent/DK640889A/da not_active Application Discontinuation
- 1989-12-19 MY MYPI89001812A patent/MY105052A/en unknown
- 1989-12-27 CS CS897433A patent/CS277609B6/cs not_active IP Right Cessation
- 1989-12-28 YU YU248589A patent/YU48164B/sh unknown
- 1989-12-28 BG BG90783A patent/BG60557B1/bg unknown
- 1989-12-28 EP EP89313636A patent/EP0385038B1/en not_active Expired - Lifetime
- 1989-12-28 ES ES89313636T patent/ES2055115T3/es not_active Expired - Lifetime
- 1989-12-28 DE DE8989313636T patent/DE68906880T2/de not_active Expired - Fee Related
- 1989-12-28 AT AT89313636T patent/ATE90074T1/de not_active IP Right Cessation
- 1989-12-28 US US07/458,237 patent/US5223498A/en not_active Expired - Lifetime
- 1989-12-28 ZA ZA899941A patent/ZA899941B/xx unknown
- 1989-12-29 RU SU894742813A patent/RU1826969C/ru active
- 1989-12-29 PL PL28307489A patent/PL162960B1/pl unknown
- 1989-12-29 PL PL89295913A patent/PL161961B1/pl unknown
- 1989-12-29 JP JP1345135A patent/JP2545475B2/ja not_active Expired - Fee Related
- 1989-12-29 UA UA5011043A patent/UA27713C2/uk unknown
- 1989-12-29 PT PT92770A patent/PT92770B/pt not_active IP Right Cessation
- 1989-12-29 UA UA4742813A patent/UA19156A/uk unknown
- 1989-12-29 DD DD89336816A patent/DD294023A5/de unknown
- 1989-12-30 RO RO147103A patent/RO107945B1/ro unknown
- 1989-12-30 RO RO143555A patent/RO105807B1/ro unknown
-
1990
- 1990-01-03 IL IL9296390A patent/IL92963A/en not_active IP Right Cessation
- 1990-12-03 RU SU904831862A patent/RU1797610C/ru active
-
1992
- 1992-02-27 RU SU925011043A patent/RU2052452C1/ru active
-
1993
- 1993-01-27 US US08/009,807 patent/US5373008A/en not_active Expired - Fee Related
- 1993-06-30 LV LVP-93-815A patent/LV10619B/en unknown
- 1993-12-21 LT LTIP1647A patent/LT3960B/lt not_active IP Right Cessation
- 1993-12-21 LT LTIP1646A patent/LT3958B/lt not_active IP Right Cessation
- 1993-12-21 LT LTIP1648A patent/LT3961B/lt not_active IP Right Cessation
-
1994
- 1994-10-06 GE GEAP19942233A patent/GEP19981040B/en unknown
-
1995
- 1995-06-30 HU HU95P/P00688P patent/HU211571A9/hu unknown
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE69906397T2 (de) | Benzosulfonderivate | |
DE69104041T2 (de) | Orthosubstituierte biphenylguanidinderivate sowie diese enthaltende antidiabetische oder hypoglykämische mittel. | |
CH660484A5 (de) | In 1-stellung durch einen heterocyclischen rest substituierte 4-((2,5-pyrrolidindion-1-yl)alkyl)piperazin-verbindungen. | |
DD294023A5 (de) | Therapeutische mittel | |
US4731383A (en) | Aminoguanidine compounds, their compositions and pharmaceutical uses | |
DE69910083T2 (de) | Katecholhydrazon-derivate, verfahren zu ihrer herstellung und pharmazeutische zusammensetzungen die diese enthalten | |
DE68919154T2 (de) | Benzodiazepinverbindungen und ihre Verwendung als Arzneimittel. | |
KR0168398B1 (ko) | 당뇨병 및 과혈당증 치료제로 유용한 화합물 및 이의 제조방법 | |
EP0456133A1 (de) | Hydrazone | |
CH449632A (de) | Verfahren zur Herstellung von cyclischen Diazacycloalkanverbindungen | |
DE2131034A1 (de) | Acylharnstoffe und verfahren zu ihrer herstellung | |
US4112105A (en) | Anti-inflammatory 3-(substituted-amino)-2,1-benzisothiazoles | |
DE2108185A1 (en) | N-(3-aminoalkyl-2-oxo-2h-1-benzopyran-7-yl) ureas - as coronary vasodilators | |
DE2036181A1 (de) | Benzamidine und Verfahren zu ihrer Her stellung | |
AT346841B (de) | Verfahren zur herstellung von neuen 3- phenylindolinen und ihren salzen | |
AT387773B (de) | Verfahren zur herstellung von 1-heteroaryl-4-((2,5-pyrrolidindion-1-yl)aklyl) iperazin-derivaten | |
DE3121137A1 (de) | Neue pyridazino(4,5-b)indole, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen, zwischenprodukte und deren herstellung" | |
AT333751B (de) | Verfahren zur herstellung von neuen anilinobenzothiazolderivaten und ihren salzen | |
DE1545682A1 (de) | Neue Thiosemicarbazone | |
SI8912485A (sl) | Nova hipoglikemična sredstva in postopek za njihovo pripravo | |
CH400162A (de) | Verfahren zur Herstellung von neuen N-heterocyclischen Verbindungen | |
CH605749A5 (en) | 2-Aminoalkyl-3-phenyl isoindole derivs | |
CH362082A (de) | Verfahren zur Herstellung neuer Benzimidazole | |
DD263761A5 (de) | Verfahren zur herstellung von pyridin-derivaten | |
HRP930669A2 (en) | Transdermal terapheutic system with physostigmin as an active substance |