DE2559942C2 - In α-Stellung geschützte Oxyimino-β-oxo-γ-halogenbuttersäurederivate und ihre Verwendung zur Herstellung entsprechender 2-Amino-thiazol-4-yl-essigsäurederivate - Google Patents
In α-Stellung geschützte Oxyimino-β-oxo-γ-halogenbuttersäurederivate und ihre Verwendung zur Herstellung entsprechender 2-Amino-thiazol-4-yl-essigsäurederivateInfo
- Publication number
- DE2559942C2 DE2559942C2 DE2559942A DE2559942A DE2559942C2 DE 2559942 C2 DE2559942 C2 DE 2559942C2 DE 2559942 A DE2559942 A DE 2559942A DE 2559942 A DE2559942 A DE 2559942A DE 2559942 C2 DE2559942 C2 DE 2559942C2
- Authority
- DE
- Germany
- Prior art keywords
- acid derivatives
- compounds
- preparation
- amino
- thiazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims description 6
- DYCLHZPOADTVKK-UHFFFAOYSA-N 2-(2-azaniumyl-1,3-thiazol-4-yl)acetate Chemical class NC1=NC(CC(O)=O)=CS1 DYCLHZPOADTVKK-UHFFFAOYSA-N 0.000 title claims description 4
- 239000002253 acid Substances 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 17
- 150000002148 esters Chemical class 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 150000003585 thioureas Chemical class 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- -1 Oxyimino - Chemical class 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- UXTFKIJKRJJXNV-UHFFFAOYSA-N 1-$l^{1}-oxidanylethanone Chemical compound CC([O])=O UXTFKIJKRJJXNV-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical class [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical class [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical class [H]C([H])([H])* 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000001436 propyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical class [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical class 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical class [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/34—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/40—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/587—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with aliphatic hydrocarbon radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms, said aliphatic radicals being substituted in the alpha-position to the ring by a hetero atom, e.g. with m >= 0, Z being a singly or a doubly bound hetero atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP49146567A JPS5760345B2 (forum.php) | 1974-12-19 | 1974-12-19 | |
GB24611/75A GB1536281A (en) | 1975-06-09 | 1975-06-09 | Cephem compounds |
Publications (1)
Publication Number | Publication Date |
---|---|
DE2559942C2 true DE2559942C2 (de) | 1985-02-28 |
Family
ID=26257200
Family Applications (3)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2559942A Expired DE2559942C2 (de) | 1974-12-19 | 1975-12-17 | In α-Stellung geschützte Oxyimino-β-oxo-γ-halogenbuttersäurederivate und ihre Verwendung zur Herstellung entsprechender 2-Amino-thiazol-4-yl-essigsäurederivate |
DE2556736A Expired DE2556736C2 (de) | 1974-12-19 | 1975-12-17 | Cephemverbindungen und sie enthaltende Arzneimittel |
DE2560398A Expired DE2560398C2 (de) | 1974-12-19 | 1975-12-17 | 2-Amino-thiazol-4-yl-essigsäure-Derivate und Verfahren zu deren Herstellung |
Family Applications After (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2556736A Expired DE2556736C2 (de) | 1974-12-19 | 1975-12-17 | Cephemverbindungen und sie enthaltende Arzneimittel |
DE2560398A Expired DE2560398C2 (de) | 1974-12-19 | 1975-12-17 | 2-Amino-thiazol-4-yl-essigsäure-Derivate und Verfahren zu deren Herstellung |
Country Status (18)
Country | Link |
---|---|
US (6) | US4098888A (forum.php) |
AT (1) | AT357521B (forum.php) |
AU (1) | AU500104B2 (forum.php) |
BE (1) | BE836813A (forum.php) |
BG (1) | BG60437B2 (forum.php) |
CA (3) | CA1216284A (forum.php) |
CH (4) | CH624119A5 (forum.php) |
DE (3) | DE2559942C2 (forum.php) |
DK (2) | DK154939C (forum.php) |
ES (4) | ES443627A1 (forum.php) |
FR (4) | FR2294690A1 (forum.php) |
GB (1) | GB1536283A (forum.php) |
HU (1) | HU179798B (forum.php) |
MX (1) | MX5097E (forum.php) |
NL (4) | NL183703C (forum.php) |
NO (1) | NO157933C (forum.php) |
PH (2) | PH13731A (forum.php) |
SE (2) | SE442202B (forum.php) |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2710282A1 (de) | 1976-03-09 | 1977-09-15 | Fujisawa Pharmaceutical Co | 3,7-disubstituierte-3-cephem-4- carbonsaeureverbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel |
DE2760288A1 (forum.php) * | 1976-03-09 | 1985-05-09 |
Families Citing this family (166)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4191762A (en) | 1974-03-14 | 1980-03-04 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted amino-2 or 3-cephem-4-carboxylic acid compounds |
US4297489A (en) * | 1974-09-03 | 1981-10-27 | Bristol-Myers Company | 7-α-Amino-substituted acylamino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
US4182868A (en) * | 1974-10-29 | 1980-01-08 | Takeda Chemical Industries, Ltd. | 7-Methoxycephalosporin derivatives |
JPS5760345B2 (forum.php) * | 1974-12-19 | 1982-12-18 | Takeda Chemical Industries Ltd | |
DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
US4196205A (en) * | 1976-01-23 | 1980-04-01 | Roussel Uclaf | 3-Acetoxymethyl-7-(iminoacetamido)-cephalosporanic acid derivatives |
DE2760123C2 (de) | 1976-01-23 | 1986-04-30 | Roussel-Uclaf, Paris | 7-Aminothiazolyl-syn-oxyiminoacetamidocephalosporansäuren, ihre Herstellung und sie enthaltende pharmazeutische Zusammensetzungen |
SE440655B (sv) | 1976-01-23 | 1985-08-12 | Roussel Uclaf | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra |
US4299829A (en) | 1976-03-12 | 1981-11-10 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem 4-carboxylic acid compounds |
US4202893A (en) | 1976-03-25 | 1980-05-13 | Roussel Uclaf | Alkyloximes of 7-amino-thiazolyl-acetamido-cephalosporanic acids |
FR2345153A1 (fr) * | 1976-03-25 | 1977-10-21 | Roussel Uclaf | Nouvelles alcoyloximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
JPS5946237B2 (ja) * | 1976-04-02 | 1984-11-10 | 武田薬品工業株式会社 | セフアロスポリン誘導体およびその製造法 |
US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
US4364943A (en) * | 1976-04-12 | 1982-12-21 | Fujisawa Pharmaceutical Co., Ltd. | Syn-isomer of 7-[2-alkoxyimino-2-(2-amino-alkanoylamino-or haloalkanoylamino-thiazol-4-yl) acetamids]-3-[hexanoyl-, or phenylalkanoyl-oxymethyl or benzothiazolylthiomethyl]-3-cephem-4-carboxylic acid |
US4493833A (en) * | 1976-04-12 | 1985-01-15 | Fujisawa Pharmaceutical Co., Ltd. | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds |
US4804752A (en) * | 1976-04-12 | 1989-02-14 | Fujisawa Pharmaceutical Co., Ltd. | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
US4331664A (en) * | 1976-04-12 | 1982-05-25 | Fujisawa Pharmaceutical Co., Ltd. | Syn isomer of 7-[2-cyclo(lower) alkoxyimino-2-(2-amino-or substituted aminothiazol-4-yl)acetamido]-3-lower alkanoyloxymethyl or heterocyclicthiomethyl-3-cephem-4-carboxylic acid compounds |
US4431643A (en) * | 1976-04-12 | 1984-02-14 | Fujisawa Pharmaceutical Co., Ltd. | Syn-isomer of 3-substituted-7-[2-cyclopentyloxyimino-2-(2-aminothiazol-4-yl)-acetamido]-3 |
FR2367756B1 (fr) * | 1976-04-12 | 1985-07-05 | Fujisawa Pharmaceutical Co | Derives 2-alcoxyamino-2-(amino-1,3-thiazolyl) acetiques et leur utilisation |
DK162391C (da) * | 1976-04-12 | 1992-03-09 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af syn-isomerer af 3,7-disubstituerede 3-cephem-4-carboxylsyreforbindelser |
US4304770A (en) * | 1976-04-12 | 1981-12-08 | Fujisawa Pharmaceutical Co., Ltd. | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
DE2760482C2 (de) * | 1976-04-14 | 1995-02-09 | Takeda Chemical Industries Ltd | Pharmazeutische Zubereitungen, enthaltend ein 7-[2-(2-aminothiazol-4yl)-2-(syn)-methoxyiminoacetamido]cephalosporinderivat |
GR63088B (en) * | 1976-04-14 | 1979-08-09 | Takeda Chemical Industries Ltd | Preparation process of novel cephalosporins |
DE2760488C2 (de) * | 1976-04-14 | 1994-04-07 | Takeda Chemical Industries Ltd | Cephalosporinderivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
DE2760491C2 (de) * | 1976-09-08 | 1995-04-20 | Takeda Chemical Industries Ltd | Pharmazeutische Zubereitungen enthaltend Pivaloyloxymethyl 7- 2-(2-aminothiazol-4-yl)-2-(syn)mehtoxyiminoacetamido desacetoxycephalosporanat und dessen Salze |
FI771866A7 (forum.php) * | 1976-06-28 | 1977-12-29 | Fujisawa Pharmaceutical Co | |
US4963542A (en) * | 1976-09-08 | 1990-10-16 | Takeda Chemical Industries, Ltd. | Cephalosporin derivatives |
JPS6011713B2 (ja) * | 1976-09-08 | 1985-03-27 | 武田薬品工業株式会社 | セフアロスポリン誘導体およびその製造法 |
GB1592149A (en) * | 1976-10-08 | 1981-07-01 | Fujisawa Pharmaceutical Co | 3 7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for preparation thereof |
BE862300A (fr) * | 1976-12-27 | 1978-06-23 | Fujisawa Pharmaceutical Co | Nouveaux composes de cephalosporine et procedes pour leur preparation |
JPS53144594A (en) * | 1976-12-27 | 1978-12-15 | Fujisawa Pharmaceut Co Ltd | 3,7-di-substitued-3-cephem-4-carboxylic acid derivatives |
JPS53101393A (en) | 1977-02-17 | 1978-09-04 | Takeda Chem Ind Ltd | Cephalosporin derivatives and process for their preparation |
JPS6011714B2 (ja) | 1977-02-17 | 1985-03-27 | 武田薬品工業株式会社 | セフアロスポリン誘導体およびその製造法 |
FR2381053A1 (fr) * | 1977-02-18 | 1978-09-15 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-thiadiazolyl thiomethyl 7-aminothiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
JPS53103493A (en) * | 1977-02-18 | 1978-09-08 | Takeda Chem Ind Ltd | Cephalosporin derivatives and process for their preparation |
DE2710902A1 (de) * | 1977-03-12 | 1978-09-21 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
PH17188A (en) * | 1977-03-14 | 1984-06-14 | Fujisawa Pharmaceutical Co | New cephem and cepham compounds and their pharmaceutical compositions and method of use |
US4841062A (en) * | 1977-03-14 | 1989-06-20 | Fujisawa Pharmaceutical Company, Limited | New cephem and cepham compounds and processes for preparation thereof |
SE439312B (sv) | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
GB1579533A (en) * | 1977-03-26 | 1980-11-19 | Farmaceutici Italia | Cephalosporins and their preparation |
DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
DE2716677C2 (de) * | 1977-04-15 | 1985-10-10 | Hoechst Ag, 6230 Frankfurt | Cephemderivate und Verfahren zu ihrer Herstellung |
US5089490A (en) * | 1977-04-02 | 1992-02-18 | Hoechst Aktiengesellschaft | Cephem derivatives |
DE2857696C2 (de) * | 1977-07-23 | 1984-08-30 | Toyama Chemical Co. Ltd., Tokio / Tokyo | Cephalosporine |
JPS609719B2 (ja) * | 1977-08-06 | 1985-03-12 | 武田薬品工業株式会社 | セフアロスポリン誘導体およびその製造法 |
FR2400519A1 (fr) * | 1977-08-17 | 1979-03-16 | Roussel Uclaf | Forme cristalline du sel de sodium d'un derive oximine de l'acide 7-amino-thiazolyl acetamido cephalosporanique, son procede de preparation et son application comme medicament |
US4370326A (en) * | 1977-09-13 | 1983-01-25 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds and composition |
IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
FR2410655A1 (fr) * | 1977-12-05 | 1979-06-29 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-substitue 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
JPS5936891B2 (ja) | 1977-12-09 | 1984-09-06 | 武田薬品工業株式会社 | 保護基の脱離方法 |
DE2758001A1 (de) | 1977-12-24 | 1979-07-12 | Hoechst Ag | Cephalosporinderivate und verfahren zu ihrer herstellung |
FR2387235A1 (fr) * | 1978-01-23 | 1978-11-10 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 3,7-disubstitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus, ayant une forte activite antibacterienne |
JPS54112892A (en) * | 1978-02-23 | 1979-09-04 | Shionogi & Co Ltd | Substituted imidazolidinyl-3-chloro-3-cephem-4-carboxylic acid |
US4180658A (en) * | 1978-02-24 | 1979-12-25 | Bristol-Myers Company | 7[-2-Alkoxyamino(acetamido)]cephalosporin derivatives |
JPS54117494A (en) * | 1978-03-03 | 1979-09-12 | Takeda Chem Ind Ltd | Cephalosporin compound and its preparation |
FR2421907A1 (fr) * | 1978-04-07 | 1979-11-02 | Roussel Uclaf | Nouvelles cephalosporines derivees de l'acide 7-/2-(2-amino 4-thiazolyl)2-(carboxymethoxyimino/acetamido 3-substitue cephalosporanique, leur procede de preparation et leur application comme medicaments |
SE445350B (sv) * | 1978-04-14 | 1986-06-16 | Roussel Uclaf | Oximderivat av 3-azidometyl-7-amino-tiazolyl-acetamido-cefalosporansyra och dess anvendning som antibiotika |
DE2818263A1 (de) * | 1978-04-26 | 1979-11-08 | Bayer Ag | Beta-lactamantibiotika |
AR229883A1 (es) * | 1978-05-26 | 1983-12-30 | Glaxo Group Ltd | Procedimiento para la preparacion de antibiotico(6r,7r)-7-((z)-2-(2-aminotiazol-4-il)-2-(2-carboxiprop-2-oxiimino)-acetamido)-3-(1-piridinometil)-cef-3-em-4-carboxilato |
CH641468A5 (de) * | 1978-05-30 | 1984-02-29 | Hoffmann La Roche | Cephemderivate. |
JPS54160392A (en) * | 1978-06-02 | 1979-12-19 | Takeda Chem Ind Ltd | Cephalosporin derivative and its preparation |
US4461767A (en) * | 1978-06-16 | 1984-07-24 | E. R. Squibb & Sons, Inc. | Iminothiazolyl ureido cephalosporins |
US4501743A (en) * | 1978-06-16 | 1985-02-26 | E. R. Squibb & Sons, Inc. | Iminothiazolyl ureido cephalosporins |
US4268509A (en) * | 1978-07-10 | 1981-05-19 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds and processes for preparation thereof |
EP0009548B1 (en) * | 1978-07-17 | 1985-01-16 | Fujisawa Pharmaceutical Co., Ltd. | Cephalosporin derivatives, process for their preparation and pharmaceutical compositions containing them |
JPS6058239B2 (ja) * | 1978-07-20 | 1985-12-19 | 山之内製薬株式会社 | 新規セフアロスポリン誘導体 |
US4372952A (en) * | 1978-07-31 | 1983-02-08 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US4284631A (en) * | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
US4305937A (en) * | 1978-08-17 | 1981-12-15 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds and antibacterial pharmaceutical compositions containing them |
US4703046A (en) * | 1978-09-08 | 1987-10-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds and processes for preparation thereof |
US4341775A (en) * | 1978-09-11 | 1982-07-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
EP0048504B1 (en) * | 1978-09-12 | 1988-08-17 | Fujisawa Pharmaceutical Co., Ltd. | Intermediate compounds for preparing cephem compounds; processes for their preparation and processes for preparing cephem compounds |
US4220761A (en) * | 1978-09-12 | 1980-09-02 | Fujisawa Pharmaceutical Co., Ltd. | 7-[Substituted oximinoacetamido]-3-[hydroxy alkyltetrazolo]cephalosporin derivatives |
US4327093A (en) * | 1978-10-24 | 1982-04-27 | Fujisawa Pharmaceutical Co., Ltd. | 3,7-Disubstituted-2 or 3-cephem-4-carboxylic acid compounds |
CA1130280A (en) * | 1978-10-27 | 1982-08-24 | Cynthia H. O'callaghan | Cephalosporin compounds |
DK480679A (da) * | 1978-11-15 | 1980-05-16 | Glaxo Group Ltd | Fremgangsmaade til fremstilling af cephalosporinforbindelser |
US4313945A (en) * | 1978-11-23 | 1982-02-02 | Ciba-Geigy Corporation | 7-Thiazolyl-acetamido-cephem derivatives with terminal aminocarboxylic acid grouping |
JPS5579393A (en) * | 1978-12-11 | 1980-06-14 | Takeda Chem Ind Ltd | Cephalosporin derivative and its preparation |
AU536842B2 (en) * | 1978-12-29 | 1984-05-24 | Fujisawa Pharmaceutical Co., Ltd. | Cephalosporin antibiotics |
US4332798A (en) * | 1978-12-29 | 1982-06-01 | Fujisawa Pharmaceutical Co., Ltd. | 7-Amino-thia-diazole oxyimino derivatives of cephem and cephem compounds |
FR2445830A1 (fr) * | 1979-01-05 | 1980-08-01 | Roussel Uclaf | Nouveaux derives de l'acide (4-thiazolyl) acetique procede de preparation |
ES8103101A1 (es) * | 1979-03-22 | 1981-02-16 | Glaxo Group Ltd | Un procedimiento para la preparacion de antibioticos de ce- falosporina |
US4237128A (en) * | 1979-04-12 | 1980-12-02 | E. R. Squibb & Sons, Inc. | 7-[2-(2-Amino-4-thiazolyl)-2-[(1-carboxy-1,1-dialkyl)alkoxyimino]acetamido]cephem sulfoxides |
AU534807B2 (en) * | 1979-05-23 | 1984-02-16 | Rhone-Poulenc Industries | 3-thiovinyl cephalosporins |
FR2457296A1 (fr) * | 1979-05-23 | 1980-12-19 | Rhone Poulenc Ind | Nouveaux derives de vinyl-3 cephalosporines et leur preparation |
DE3064106D1 (en) * | 1979-06-07 | 1983-08-18 | Yamanouchi Pharma Co Ltd | 7-(thiazolylpropionamido) cephalosporins, their preparation, and pharmaceutical compositions containing them |
US4275062A (en) * | 1979-09-19 | 1981-06-23 | E. R. Squibb & Sons, Inc. | Aminothiazolyl ureido sulfoxide cephalosporins |
US4252951A (en) * | 1979-10-09 | 1981-02-24 | Eli Lilly And Company | Isolation of syn-7-(2-amino-4-thiazolyl)-(methoxyimino)acetamido-3-acetoxymethyl-3-cephem-4-carboxylic acid |
US4381299A (en) * | 1980-03-07 | 1983-04-26 | Fujisawa Pharmaceutical Co., Ltd. | 7-Amino-thiadiazole oxyimino derivatives of cephem and cepham compounds |
US4332800A (en) * | 1979-10-12 | 1982-06-01 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US4338313A (en) * | 1979-10-12 | 1982-07-06 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US4271157A (en) * | 1980-02-28 | 1981-06-02 | E. R. Squibb & Sons, Inc. | Imidazole derivatives of 7-[(2-amino-4-thiazolyl)-oximino] cephalosporins |
US4409215A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical Co., Ltd. | 7-Acylamino-3-substituted cephalosporanic acid derivatives and processes for the preparation thereof |
US4409214A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical, Co., Ltd. | 7-Acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
US5243043A (en) * | 1980-02-18 | 1993-09-07 | Roussel Uclaf | Cephalosporins |
DE3006888A1 (de) * | 1980-02-23 | 1981-09-10 | Hoechst Ag, 6000 Frankfurt | Cephalosporinderivate und verfahren zu ihrer herstellung |
DE3007685A1 (de) | 1980-02-29 | 1981-10-01 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue cephylosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
US4252802A (en) * | 1980-03-13 | 1981-02-24 | E. R. Squibb & Sons, Inc. | Hydroxamic acid derivatives of 7-[(2-amino-4-thiazolyl)-oximino] cephalosporins |
IL63207A (en) * | 1980-07-24 | 1985-09-29 | Lonza Ag | Process for the preparation of 2-(2-aminothiazole-4-yl)-2-(syn)-methoxyiminoacetic acid esters |
US4399132A (en) * | 1980-08-11 | 1983-08-16 | American Cyanamid Company | 7-Beta-[alpha-syn-methoxyimino-alpha-(2-aminothiazol-4-yl)-acetamido]-3-[(1,2,3-thiadiazol-5-ylthio)methyl]-3-cephem-4-carboxylic acid and C1 -C6 alkyl derivatives thereof |
US4486425A (en) * | 1980-09-30 | 1984-12-04 | Sankyo Company Limited | 7-[2-(2-Aminothiazol-4-yl)-2-(syn)-methoxyiminoacetamido]-3-methoxymethyl-3-cephem-4-carboxylates |
US4367228A (en) * | 1980-10-29 | 1983-01-04 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compound and composition |
US4431642A (en) * | 1980-12-01 | 1984-02-14 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US4427677A (en) * | 1980-12-31 | 1984-01-24 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
DE3177090D1 (en) * | 1980-12-31 | 1989-09-28 | Fujisawa Pharmaceutical Co | 7-acylaminocephalosporanic acid derivatives and processes for the preparation thereof |
JPS57154175A (en) * | 1981-03-16 | 1982-09-22 | Mitsui Toatsu Chem Inc | 2-thiazoleamine derivative, its preparation, and drug composition comprising it |
JPS6011917B2 (ja) * | 1981-04-09 | 1985-03-28 | 山之内製薬株式会社 | 新規なセファロスポリン化合物 |
DE3117438A1 (de) * | 1981-05-02 | 1982-11-18 | Hoechst Ag, 6000 Frankfurt | Cephemderivate und verfahren zu ihrer herstellung |
DE3118732A1 (de) * | 1981-05-12 | 1982-12-02 | Hoechst Ag, 6000 Frankfurt | Cephalosporinderivate und verfahren zu ihrer herstellung |
US4396620A (en) * | 1981-09-08 | 1983-08-02 | Eli Lilly And Company | Cephalosporin quinolinium betaines |
US4396619A (en) * | 1981-09-08 | 1983-08-02 | Eli Lilly And Company | Cephalosporin betaines |
US4594417A (en) * | 1981-10-30 | 1986-06-10 | Eli Lilly Company | Crystalline antibiotic salt |
US4400503A (en) * | 1981-10-30 | 1983-08-23 | Eli Lilly And Company | Purification of syn-7-[[(2-amino-4-thiazolyl)(methoxyimino) acetyl]amino]-3-methyl-3-cephem-4-carboxylic acid |
DE3269474D1 (en) * | 1981-11-13 | 1986-04-03 | Glaxo Group Ltd | Thiazole derivatives and their use in the manufacture of beta-lactam antibiotics |
US4426528A (en) | 1982-04-01 | 1984-01-17 | Eli Lilly And Company | Purification of syn-(2-aminothiazol-4-yl)methoxyimino)acetic acid |
JPS5910593A (ja) | 1982-06-28 | 1984-01-20 | Bristol Mayers Kenkyusho Kk | セフアロスポリン誘導体 |
SE8303727L (sv) * | 1982-06-30 | 1984-02-03 | Glaxo Group Ltd | Cefalosporinantibiotika |
DE3239365A1 (de) * | 1982-10-23 | 1984-04-26 | Bayer Ag, 5090 Leverkusen | Neue cephalosporine und verfahren zu ihrer herstellung |
US4480120A (en) * | 1983-03-24 | 1984-10-30 | Eastman Kodak Company | Process for the preparation of alkyl-2-alkoxyimino-3-oxo-4-chlorobutyrates |
DE3485860T2 (de) * | 1983-12-29 | 1993-01-14 | Mochida Pharm Co Ltd | Cephalosporinverbindungen, verfahren zu ihrer herstellung und pharmazeutishe praeparate. |
US4788185A (en) * | 1984-04-23 | 1988-11-29 | Takeda Chemical Industries, Ltd. | Cephalosporin compounds |
PH22107A (en) * | 1984-06-07 | 1988-06-01 | Takeda Chemical Industries Ltd | 3-pyrazolo(1,5-a)pyrdinium cephem compounds |
ES8704943A1 (es) * | 1984-12-27 | 1987-04-16 | Banyu Pharma Co Ltd | Un procedimiento para la fabricacion de derivados de cefalosporina. |
ATE89826T1 (de) * | 1985-03-01 | 1993-06-15 | Takeda Chemical Industries Ltd | Antibakterielle verbindungen, ihre herstellung und verwendung. |
US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4698338A (en) * | 1986-02-19 | 1987-10-06 | Eli Lilly And Company | 7[2-(2-aminothiazol-4-yl)-2-benzyloximino]acetamido-3[4-alkyl-5-oxo-6-hydroxy-3,4-dihydro-1,2,4-triazin-3-yl]thiomethyl cephalosporins |
US4814328A (en) * | 1986-03-19 | 1989-03-21 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives, and antibacterial agents |
JPS6310795A (ja) * | 1986-03-25 | 1988-01-18 | Takeda Chem Ind Ltd | 選択性除草化合物 |
JPS635091A (ja) * | 1986-06-26 | 1988-01-11 | Senjiyu Seiyaku Kk | 着色防止方法 |
US4959495A (en) * | 1986-07-28 | 1990-09-25 | American Cyanamid Company | Process for the preparation of intermediates used to produce aminothiazoloximino cephalosporins |
US5066799A (en) * | 1986-07-28 | 1991-11-19 | American Cyanamid Company | Intermediates for the preparation of aminothiazoloximino cephalosporins |
FR2621589B1 (fr) * | 1987-10-08 | 1990-03-02 | Sanofi Sa | Derives des cephalosporines a pharmacocinetique amelioree, procede pour leur preparation et compositions pharmaceutiques les contenant |
WO1993013108A1 (en) * | 1987-03-11 | 1993-07-08 | Susumu Nakanishi | Substituted 3-cephem compounds as antibacterial agents |
US5242913A (en) * | 1987-03-11 | 1993-09-07 | Pfizer Inc. | Substituted 3-cephem compounds as antibacterial agents |
US5223496A (en) * | 1987-11-10 | 1993-06-29 | The Upjohn Company | Cephalosporin antibiotics |
DE3804841A1 (de) * | 1988-02-17 | 1989-08-31 | Hoechst Ag | Cephalosporinderivate und verfahren zu ihrer herstellung |
EP0333082A3 (en) * | 1988-03-15 | 1991-05-02 | Takeda Chemical Industries, Ltd. | Cephem compounds, their production and use |
DE3809845A1 (de) * | 1988-03-24 | 1989-10-12 | Hoechst Ag | Verfahren zur herstellung von 4-halo-3-oxo-2-alkoxyiminobuttersaeureestern |
NO175152C (no) * | 1988-10-07 | 1994-09-07 | Sankyo Co | Analogifremgangsmåte for fremstilling av terapeutisk aktive 3-aryloksymetyl-cefalosporinderivater |
DE3919259A1 (de) * | 1989-06-13 | 1990-12-20 | Hoechst Ag | Kristalline cephem-saeureadditionssalze und verfahren zu ihrer herstellung |
KR940000112B1 (ko) * | 1990-07-05 | 1994-01-05 | 주식회사 대웅제약 | 신규의 3-치환 세펨화합물 및 그의 제조방법 |
IL113744A (en) * | 1990-11-09 | 1998-06-15 | Eisai Co Ltd | 3-cephem derivatives and their preparation |
YU48484B (sh) * | 1991-05-24 | 1998-09-18 | Hoechst Aktiengesellschaft | Kristalne kiselinske adicione soli diastereomerno čistih 1-(2,2-dimetilpropioniloksi)-etilestara 3-cefem-4-karbonske kiseline |
US5281589A (en) * | 1991-06-15 | 1994-01-25 | Cheil Foods & Chemicals, Inc. | 3-fused pyridiniummethyl cephalosporins |
AT396108B (de) * | 1991-08-21 | 1993-06-25 | Biochemie Gmbh | Neues verfahren und neue zwischenprodukte zur herstellung von 7-aminocephalosporansaeurederivaten |
DE59209994D1 (de) * | 1991-09-07 | 2004-04-29 | Aventis Pharma Gmbh | Diastereomer des 3-Cephem-4-carbonsäure-1-(-isopropoxycarbonyloxy)ethylesters und Verfahren zu dessen Herstellung |
TW212181B (forum.php) * | 1992-02-14 | 1993-09-01 | Hoechst Ag | |
DE59308295D1 (de) * | 1992-05-21 | 1998-04-30 | Hoechst Ag | Verfahren zur Spaltung von Cephalosporin Prodrugestern zu 7-Amino-3-methoxymethylceph-3-em-4-carbonsäure |
ATE202109T1 (de) * | 1993-03-12 | 2001-06-15 | Upjohn Co | Kristallines ceftiofur (freie säure) |
KR100194994B1 (ko) * | 1993-06-05 | 1999-06-15 | 손경식 | 새로운 세펨 화합물 |
TW369530B (en) * | 1993-06-10 | 1999-09-11 | Lucky Ltd | Process for preparing cephalosporin compounds from reactive organic acid derivatives |
US6468995B1 (en) * | 1993-09-09 | 2002-10-22 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US5661144A (en) * | 1994-08-16 | 1997-08-26 | Meiji Seika Kabushiki Kaisha | Cephem derivatives with 3-substituted bis heterocycles |
US5574154A (en) * | 1994-09-29 | 1996-11-12 | Alnejma Bulk Pharmaceutical Co. A.B.P.C. | Process for the preparation of cephalosporanic compounds |
GB9423459D0 (en) * | 1994-11-21 | 1995-01-11 | Biochemie Gmbh | Silylation process |
AT402928B (de) * | 1994-12-23 | 1997-09-25 | Biochemie Gmbh | Neues verfahren zur herstellung von cefotaxim |
KR0164458B1 (ko) * | 1995-04-04 | 1999-01-15 | 김은영 | 암모니오세팔로스포린 계열 항생제 및 그의 제조방법 |
US5872249A (en) * | 1995-09-01 | 1999-02-16 | Korea Institute Of Science And Technology | 3-ammoniopropenyl cephalosporin compounds as antibacterial agents and process for preparing the same |
AU690482B2 (en) * | 1996-03-18 | 1998-04-23 | Ranbaxy Laboratories Limited | Process for producing cephalosporin antibiotics |
IN184690B (forum.php) * | 1996-03-18 | 2000-09-23 | Ranbaxy Lab Ltd | |
US7842791B2 (en) * | 2002-12-19 | 2010-11-30 | Nancy Jean Britten | Dispersible pharmaceutical compositions |
US7847093B2 (en) * | 2003-04-16 | 2010-12-07 | Sandoz Ag | Processes for the preparations of cefepime |
WO2004092183A2 (en) | 2003-04-16 | 2004-10-28 | Sandoz Ag | Processes for the preparations of cefepime |
US20050119244A1 (en) * | 2003-12-02 | 2005-06-02 | Acs Dobfar S.P.A. | Process for preparing cephalosporins with salified intermediate |
WO2005076694A2 (en) * | 2004-01-16 | 2005-08-25 | Wockhardt Limited | Improved process for the production of cefotaxime sodium |
CN105153197B (zh) * | 2015-07-28 | 2017-05-31 | 齐鲁安替制药有限公司 | 一种头孢中间体的制备方法 |
Family Cites Families (27)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2542812A (en) * | 1946-04-03 | 1951-02-20 | Walter H Hartung | Preparation of aminoacidamides |
US2470083A (en) * | 1946-04-03 | 1949-05-17 | Walter H Hartung | Ethers of oximino acid chlorides |
US3038007A (en) * | 1958-05-23 | 1962-06-05 | Reeve Edward Wilkins | Process for the preparation of dl-threonine |
US3104258A (en) * | 1958-09-25 | 1963-09-17 | Fmc Corp | Novel synthesis of amino acids |
US3167549A (en) * | 1961-05-18 | 1965-01-26 | Smith Kline French Lab | Derivatives of 7-aminocephalosporanic acid |
US3360515A (en) * | 1964-07-24 | 1967-12-26 | Fujisawa Pharmaceutical Co | 7-(condensed n-containing heterocyclic carbonamido) cephalosporanic acid and derivatives thereof |
US3338897A (en) * | 1965-03-10 | 1967-08-29 | Fujisawa Pharmacentical Co Ltd | 7-(alpha-substituted acyl amino) cephalosporanic acid and derivatives thereof |
US3661977A (en) * | 1968-04-25 | 1972-05-09 | Shionogi & Co | Novel dioximes and processes for preparing the same |
GB1364453A (en) * | 1970-11-06 | 1974-08-21 | Gist Brocades Nv | Penicillanic and cepholosporanic acid derivatives |
US3855213A (en) * | 1971-02-18 | 1974-12-17 | Smith Kline French Lab | 3-heterocyclic thiomethyl-cephalosporins |
US4024134A (en) * | 1971-01-29 | 1977-05-17 | Glaxo Laboratories Limited | Syn isomers of cephalosporins having α-hydroximino- or α-acyloxyiminoacylamido groups at position-7 |
US4024133A (en) * | 1971-05-14 | 1977-05-17 | Glaxo Laboratories Limited | 7β-[2-Etherified oximino-2-(thienyl-,furyl- or pyridylacetamido)]cephalosporins |
US3971778A (en) * | 1972-05-12 | 1976-07-27 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino)acylamido groups at the 7-position |
US4024137A (en) * | 1971-05-14 | 1977-05-17 | Glaxo Laboratories Limited | 7β-[2-Etherified oximino-2-(phenyl- or naphthylacetamido)] cephalosporins |
US3966717A (en) * | 1971-05-14 | 1976-06-29 | Glaxo Laboratories Limited | 7-β-Acylamido-3-carbamoyloxymethylceph-3-em-4-carboxylic acids and salts thereof |
US3974153A (en) * | 1971-05-14 | 1976-08-10 | Glaxo Laboratories Limited | 7-Hydrocarbonoxy imino-acetamido-3-carbamoyloxy methylceph-3-em-4 carboxylic acids |
GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
US3821207A (en) * | 1971-06-21 | 1974-06-28 | Smithkline Corp | 7-heterocyclic substituted cephalosporins |
YU36181B (en) * | 1971-11-29 | 1982-02-25 | Merck & Co Inc | Process for obtaining 7-(2-thienylacetamido)-7-methoxy-3-carbamoyloxymethyl-3-cephem-4-carboxylates |
US4032521A (en) * | 1972-12-29 | 1977-06-28 | Merck & Co., Inc. | Cephalosporin phosphonic acid, sulfonic acid and sulfonamide compounds |
US4308380A (en) * | 1973-03-15 | 1981-12-29 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-2 or 3-cephem-4-carboxylic acid derivatives |
DE2512284A1 (de) * | 1974-03-28 | 1975-10-09 | Fujisawa Pharmaceutical Co | Cephalosporansaeurederivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel |
IE41697B1 (en) * | 1974-09-27 | 1980-02-27 | Rhone Poulenc Ind | New cephalosporin derivatives their preparation and compositions containing them |
US4668783A (en) * | 1974-12-19 | 1987-05-26 | Takeda Chemical Industries, Ltd. | Thiazolylacetamido cephalosporin compounds |
GB1536281A (en) * | 1975-06-09 | 1978-12-20 | Takeda Chemical Industries Ltd | Cephem compounds |
DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
US4011216A (en) * | 1975-04-11 | 1977-03-08 | Bristol-Myers Company | Δ2,3-0-2-Isocephem-4-carboxylic acid and derivatives thereof as antibacterial agents |
-
1975
- 1975-12-04 DK DK548875A patent/DK154939C/da not_active IP Right Cessation
- 1975-12-15 PH PH17868A patent/PH13731A/en unknown
- 1975-12-17 FR FR7538703A patent/FR2294690A1/fr active Granted
- 1975-12-17 DE DE2559942A patent/DE2559942C2/de not_active Expired
- 1975-12-17 HU HU75TA1464A patent/HU179798B/hu unknown
- 1975-12-17 DE DE2556736A patent/DE2556736C2/de not_active Expired
- 1975-12-17 GB GB28892/78A patent/GB1536283A/en not_active Expired
- 1975-12-17 NO NO754296A patent/NO157933C/no unknown
- 1975-12-17 SE SE7514286A patent/SE442202B/xx not_active IP Right Cessation
- 1975-12-17 MX MX752873U patent/MX5097E/es unknown
- 1975-12-17 DE DE2560398A patent/DE2560398C2/de not_active Expired
- 1975-12-18 AU AU87667/75A patent/AU500104B2/en not_active Expired
- 1975-12-18 NL NLAANVRAGE7514811,A patent/NL183703C/xx active Protection Beyond IP Right Term
- 1975-12-18 CA CA000242004A patent/CA1216284A/en not_active Expired
- 1975-12-18 ES ES443627A patent/ES443627A1/es not_active Expired
- 1975-12-18 BE BE162887A patent/BE836813A/xx not_active IP Right Cessation
- 1975-12-19 US US05/642,356 patent/US4098888A/en not_active Expired - Lifetime
- 1975-12-19 CH CH1655675A patent/CH624119A5/de not_active IP Right Cessation
-
1976
- 1976-11-29 FR FR7635966A patent/FR2357552A1/fr not_active Withdrawn
-
1977
- 1977-04-16 ES ES457891A patent/ES457891A1/es not_active Expired
- 1977-07-12 PH PH19987A patent/PH14161A/en unknown
- 1977-07-18 AT AT517277A patent/AT357521B/de not_active IP Right Cessation
- 1977-11-28 CH CH1451477A patent/CH631437A5/de not_active IP Right Cessation
- 1977-12-06 ES ES464771A patent/ES464771A1/es not_active Expired
- 1977-12-06 ES ES464772A patent/ES464772A1/es not_active Expired
- 1977-12-09 DK DK552377A patent/DK155086C/da active
-
1978
- 1978-01-18 US US05/870,932 patent/US4205180A/en not_active Expired - Lifetime
- 1978-01-20 NL NL7800731A patent/NL7800731A/xx not_active Application Discontinuation
- 1978-10-31 CA CA000315026A patent/CA1137492A/en not_active Expired
- 1978-10-31 CA CA315,025A patent/CA1128957A/en not_active Expired
-
1979
- 1979-04-03 SE SE7902954A patent/SE445454B/sv not_active IP Right Cessation
- 1979-05-11 FR FR7912111A patent/FR2434146A1/fr active Granted
- 1979-09-28 FR FR7924297A patent/FR2468599B1/fr not_active Expired
-
1980
- 1980-05-23 CH CH407680A patent/CH633544A5/de not_active IP Right Cessation
- 1980-05-23 CH CH407580A patent/CH628058A5/de not_active IP Right Cessation
- 1980-05-27 NL NL8003054A patent/NL8003054A/nl active Search and Examination
-
1983
- 1983-06-24 US US06/525,663 patent/US4514565A/en not_active Expired - Lifetime
-
1988
- 1988-06-07 US US07/203,409 patent/US4912212A/en not_active Expired - Fee Related
- 1988-06-07 US US07/203,410 patent/US4973684A/en not_active Expired - Fee Related
-
1990
- 1990-01-08 US US07/462,492 patent/US5583216A/en not_active Expired - Lifetime
-
1994
- 1994-02-11 BG BG098461A patent/BG60437B2/bg unknown
-
1995
- 1995-08-22 NL NL950016C patent/NL950016I1/nl unknown
Non-Patent Citations (1)
Title |
---|
NICHTS-ERMITTELT * |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2710282A1 (de) | 1976-03-09 | 1977-09-15 | Fujisawa Pharmaceutical Co | 3,7-disubstituierte-3-cephem-4- carbonsaeureverbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel |
DE2760288A1 (forum.php) * | 1976-03-09 | 1985-05-09 |
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2559942C2 (de) | In α-Stellung geschützte Oxyimino-β-oxo-γ-halogenbuttersäurederivate und ihre Verwendung zur Herstellung entsprechender 2-Amino-thiazol-4-yl-essigsäurederivate | |
EP0081674A1 (de) | Zwischenprodukte, Verfahren zu deren Herstellung und Verfahren zur Herstellung von Cephalosporinen | |
EP0002735A2 (de) | Verfahren zur Herstellung von Piperonylidencrotonsäureamiden | |
DE3881836T2 (de) | N-(Biphenylmethyl)-3-hydroxyglutaraminsäure und -derivate als hypocholesterolemische Agenzien. | |
DD263055A1 (de) | Verfahren zur herstellung substituierter 3-amino-5-phenyl-thiophene | |
DE2055796C2 (de) | Verfahren zur Herstellung von 7-Aminocephalosporansäure-Derivaten | |
CH513849A (de) | Verfahren zur Herstellung von Pyrrolinverbindungen | |
CH621351A5 (forum.php) | ||
EP0089485A2 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
DE912693C (de) | Verfahren zur Herstellung von 3-Oxy-4-carboxyphenylisothiocyanaten | |
EP0261668B1 (de) | Verfahren zur Herstellung von 4-Alkoxy-2(5H)-thiophenonen | |
DE2129887A1 (de) | 2,4,6-trijodbenzoesaeure-derivate, verfahren zu ihrer herstellung und ihre verwendung als roentgenkontrastmittel | |
DE2064096B2 (de) | Verfahren zur Herstellung von in 6-Stellung substituierten 2,4-Dichlorpyrimidin-5-carbonsäureester | |
EP0012868A1 (de) | 1,2,3-Thiadiazol-5-yl-thioglycolsäure, deren Derivate sowie Verfahren zu deren Herstellung | |
AT331804B (de) | Verfahren zur herstellung von neuen 6-aza-3h-1,4-benzodiazepinen, deren optischen isomeren und deren salzen | |
SU455084A1 (ru) | Способ получени полифторированных 1,3-диоксинафталинов или 1,3-диоксибензолов | |
DE942994C (de) | Verfahren zur Herstellung von 5-Nitrothiophenderivaten | |
JP3214139B2 (ja) | パントテン酸誘導体の製造方法 | |
EP0221494A1 (de) | Verfahren zur Herstellung von Glykolsäureamiden | |
AT358563B (de) | Verfahren zur herstellung von neuen hydroxy- aethyliden-cyanessigsaeure-aniliden sowie von deren physiologisch vertraeglichen salzen | |
AT367394B (de) | Verfahren zur herstellung neuer indanderivate | |
DE701901C (de) | Verfahren zur Herstellung von Thioformamidverbindungen | |
DE3405446C2 (forum.php) | ||
DE2627709A1 (de) | Verfahren zur herstellung von pentahalogenphenyl-malonsaeureestern | |
CH377801A (de) | Verfahren zur Herstellung von neuen N-Arylsulfonylcarbaminsäure-derivaten |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OI | Miscellaneous see part 1 | ||
OI | Miscellaneous see part 1 | ||
8110 | Request for examination paragraph 44 | ||
AC | Divided out of |
Ref country code: DE Ref document number: 2556736 Format of ref document f/p: P |
|
D2 | Grant after examination | ||
8364 | No opposition during term of opposition |