DE3901791A1 - Verfahren und vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen - Google Patents
Verfahren und vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellenInfo
- Publication number
- DE3901791A1 DE3901791A1 DE3901791A DE3901791A DE3901791A1 DE 3901791 A1 DE3901791 A1 DE 3901791A1 DE 3901791 A DE3901791 A DE 3901791A DE 3901791 A DE3901791 A DE 3901791A DE 3901791 A1 DE3901791 A1 DE 3901791A1
- Authority
- DE
- Germany
- Prior art keywords
- ring spinning
- drafting
- suction zones
- fiber
- stretched
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000835 fiber Substances 0.000 title claims description 45
- 238000000034 method Methods 0.000 title claims description 6
- 238000007664 blowing Methods 0.000 claims description 32
- 238000007378 ring spinning Methods 0.000 claims description 28
- 238000011144 upstream manufacturing Methods 0.000 claims description 5
- 230000002093 peripheral effect Effects 0.000 claims description 2
- 238000009826 distribution Methods 0.000 description 8
- 238000009987 spinning Methods 0.000 description 7
- 238000005192 partition Methods 0.000 description 3
- 238000010276 construction Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 229920006240 drawn fiber Polymers 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 235000021156 lunch Nutrition 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- XYKWNRUXCOIMFZ-UHFFFAOYSA-N tepoxalin Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC(Cl)=CC=2)=CC(CCC(=O)N(C)O)=N1 XYKWNRUXCOIMFZ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H5/00—Drafting machines or arrangements ; Threading of roving into drafting machine
- D01H5/18—Drafting machines or arrangements without fallers or like pinned bars
- D01H5/70—Constructional features of drafting elements
- D01H5/74—Rollers or roller bearings
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H13/00—Other common constructional features, details or accessories
- D01H13/04—Guides for slivers, rovings, or yarns; Smoothing dies
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H1/00—Spinning or twisting machines in which the product is wound-up continuously
- D01H1/02—Spinning or twisting machines in which the product is wound-up continuously ring type
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H5/00—Drafting machines or arrangements ; Threading of roving into drafting machine
- D01H5/18—Drafting machines or arrangements without fallers or like pinned bars
- D01H5/70—Constructional features of drafting elements
- D01H5/72—Fibre-condensing guides
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Spinning Or Twisting Of Yarns (AREA)
- Preliminary Treatment Of Fibers (AREA)
- Branching, Merging, And Special Transfer Between Conveyors (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT0033088A AT395864B (de) | 1988-02-15 | 1988-02-15 | Vorrichtung zum zufuehren einer verstreckten faserlunte zu einer ringspinnstelle |
| AT0068288A AT397667B (de) | 1988-02-15 | 1988-03-14 | Vorrichtung zum zuführen einer verstreckten faserlunte zu einer ringspinnstelle |
| AT0083488A AT397106B (de) | 1988-03-29 | 1988-03-29 | Verfahren und vorrichtung zum zuführen verstreckter faserlunten zu ringspinnstellen |
| AT0142988A AT397668B (de) | 1988-02-15 | 1988-06-01 | Vorrichtung zum zuführen einer verstreckten faserlunte zu einer ringspinnstelle |
| AT0149788A AT395611B (de) | 1988-04-01 | 1988-06-09 | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen |
| AT0168788A AT395865B (de) | 1988-06-29 | 1988-06-29 | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen |
| AT0187688A AT395866B (de) | 1988-07-22 | 1988-07-22 | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen |
| AT0287488A AT391327B (de) | 1988-11-23 | 1988-11-23 | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3901791A1 true DE3901791A1 (de) | 1989-08-24 |
| DE3901791C2 DE3901791C2 (enExample) | 1991-10-10 |
Family
ID=27569961
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3901791A Granted DE3901791A1 (de) | 1988-02-15 | 1989-01-21 | Verfahren und vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5085046A (enExample) |
| JP (1) | JPH0726256B2 (enExample) |
| KR (1) | KR930011942B1 (enExample) |
| CH (1) | CH681022A5 (enExample) |
| CZ (1) | CZ283138B6 (enExample) |
| DE (1) | DE3901791A1 (enExample) |
| ES (1) | ES2012651A6 (enExample) |
| FR (1) | FR2627194B1 (enExample) |
| GB (1) | GB2215743B (enExample) |
| IT (1) | IT1232468B (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3927936A1 (de) * | 1988-09-29 | 1990-04-05 | Fehrer Ernst | Vorrichtung zum herstellen eines garnes |
| DE3930449A1 (de) * | 1989-09-12 | 1991-03-21 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zur erzeugung eines textilgarnes |
| DE4002051C1 (en) * | 1990-01-24 | 1991-05-23 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach, De | Prodn. of textile yarn from sliver - by subjecting sliver to drafting, then dividing it into 2 sub-sections which are brought together at joining point and twisting into yarn |
| DE4002989A1 (de) * | 1990-02-01 | 1991-08-14 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zur erzeugung eines textilgarnes |
| US5222352A (en) * | 1990-04-28 | 1993-06-29 | Fritz Stahlecker | Process and an arrangement for spinning staple fibers into a yarn |
| US5285624A (en) * | 1990-10-17 | 1994-02-15 | Hans Stahlecker | Arrangement for pneumatic false-twist spinning |
| DE19839601A1 (de) * | 1998-08-31 | 2000-03-02 | Rieter Ag Maschf | Spinnmaschine mit Kepa-Streckwerk |
| DE19637828B4 (de) * | 1996-09-17 | 2005-05-12 | Maschinenfabrik Rieter Ag | Streckwerk zum Führen eines Vorgarns |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3927739A1 (de) * | 1989-08-23 | 1991-02-28 | Fritz Stahlecker | Verfahren und vorrichtung zum falschdrallspinnen |
| US5228281A (en) * | 1989-11-04 | 1993-07-20 | Fritz Stahlecker | Arrangement and method for false-twist spinning |
| DE3939777A1 (de) * | 1989-12-01 | 1991-06-06 | Fritz Stahlecker | Vorrichtung zum falschdrallspinnen |
| DE4022969A1 (de) * | 1990-07-19 | 1992-01-23 | Stahlecker Fritz | Spinnmaschine zum pneumatischen falschdrallspinnen |
| DE4118957A1 (de) * | 1991-06-08 | 1992-12-10 | Fritz Stahlecker | Spinnmaschine |
| AT398086B (de) | 1993-02-15 | 1994-09-26 | Fehrer Ernst | Streckwerk für eine ringspinnvorrichtung |
| AT408668B (de) * | 1994-06-23 | 2002-02-25 | Rieter Ag Maschf | Ringspinnverfahren und ringspinnmaschine |
| DE19514408C5 (de) * | 1994-06-23 | 2007-08-16 | Maschinenfabrik Rieter Ag | Ringspinnverfahren |
| CH691814A5 (de) | 1994-06-30 | 2001-10-31 | Rieter Ag Maschf | Ringspinnmaschine für verdichtetes Garn. |
| EP0690158A1 (de) | 1994-06-30 | 1996-01-03 | Maschinenfabrik Rieter Ag | Ringspinnmaschine mit Schrägflanschring |
| DE4426278B4 (de) * | 1994-07-25 | 2007-02-01 | Maschinenfabrik Rieter Ag | Spinnmaschine mit Kondensationsstufe |
| AT402949B (de) | 1995-01-25 | 1997-09-25 | Fehrer Ernst | Streckwerk für eine ringspinnvorrichtung |
| DE19625306B4 (de) * | 1996-06-25 | 2005-03-17 | Maschinenfabrik Rieter Ag | Spinnmaschine |
| DE19625526B4 (de) * | 1996-06-26 | 2007-04-26 | Maschinenfabrik Rieter Ag | Streckwerk zum Führen eines Faserverbandes zu einer Spinnstelle einer Spinnmaschine |
| EP0903430B1 (de) * | 1997-09-23 | 2003-04-09 | Maschinenfabrik Rieter Ag | Spinnverfahren und Spinnmaschine mit Kondensiervorrichtung |
| AT407405B (de) * | 1997-09-30 | 2001-03-26 | Fehrer Textilmasch | Vorrichtung zum bündeln einer verstreckten faserlunte |
| DE19815050B4 (de) * | 1998-04-03 | 2005-09-22 | Saurer Gmbh & Co. Kg | Verdichtungsstreckwerk für eine Spinnmaschine |
| DE19815051A1 (de) * | 1998-04-03 | 1999-10-14 | Zinser Textilmaschinen Gmbh | Spinnmaschine mit einem einen Saugrotor aufweisenden Streckwerk |
| DE19836135A1 (de) * | 1998-08-10 | 2000-02-17 | Stahlecker Fritz | Vorrichtung zum Verdichten eines Faserverbandes an einer Ringspinnmaschine |
| US6209300B1 (en) * | 1999-01-14 | 2001-04-03 | Fritz Stahlecker | Apparatus for pneumatic condensing of a drafted fiber strand and method of making and using same |
| DE19903113A1 (de) * | 1999-01-27 | 2000-08-03 | Stahlecker Fritz | Vorrichtung zum Verdichten eines verstreckten Faserverbandes |
| DE19921966B4 (de) * | 1999-05-12 | 2011-02-10 | Spindelfabrik Suessen Gmbh | Vorrichtung zum Verdichten eines verstreckten Faserverbandes |
| EP1134309B1 (de) * | 2000-03-08 | 2003-12-17 | Zinser Textilmaschinen GmbH | Streckwerk mit nachgeordneter Verdichtungzone für eine Spinnereimaschine |
| FR2817878A1 (fr) * | 2000-12-12 | 2002-06-14 | Schlumberger Cie N | Dispositif reducteur de pilosite pour machines a filer |
| DE10104803A1 (de) * | 2001-01-29 | 2002-08-01 | Stahlecker Fritz | Spinnmaschine mit einer Vielzahl nebeneinander angeordneter Spinnstellen |
| US20040044321A1 (en) * | 2002-08-27 | 2004-03-04 | Kainth Arvinder Pal Singh | Superabsorbent materials having controlled gel-bed friction angles and cohesion values and composites made from same |
| CN102926061A (zh) * | 2012-11-09 | 2013-02-13 | 无锡市新康纺机有限公司 | 粗纱机的吸风口结合件 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4332059A (en) * | 1978-09-29 | 1982-06-01 | Rieter Machine Works Limited | Drive for drafting arrangement rolls of long spinning machines |
| DE3842120A1 (de) * | 1987-12-14 | 1989-06-29 | Murata Machinery Ltd | Verfahren und vorrichtung zum spinnen |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US365280A (en) * | 1887-06-21 | Feed a | ||
| US2274424A (en) * | 1940-06-12 | 1942-02-24 | Miller Jonas Holding Co Inc | Sliver making machine |
| US3135023A (en) * | 1958-06-27 | 1964-06-02 | Johnson & Johnson | Method and apparatus for making strands, yarns, and the like |
| US3018521A (en) * | 1958-06-27 | 1962-01-30 | Chicopee Mfg Corp | Apparatus for making strands, yarns, and the like |
| CH417420A (fr) * | 1963-08-14 | 1966-07-15 | Deering Milliken Res Corp | Appareil pour l'étirage de fibres textiles |
| US3230584A (en) * | 1964-03-05 | 1966-01-25 | Johnson & Johnson | Methods and apparatus for making strands, rovings, yarns and the like |
| DE2318619A1 (de) * | 1973-04-13 | 1974-11-07 | Krupp Gmbh | Ringspinnmaschine |
| JPS543988A (en) * | 1977-06-13 | 1979-01-12 | Rinnai Kk | Method of working end surface of window glass |
| JPS5943124A (ja) * | 1982-09-01 | 1984-03-10 | Toyoda Autom Loom Works Ltd | リング精紡機 |
| DE3402084A1 (de) * | 1984-01-21 | 1985-08-01 | W. Schlafhorst & Co, 4050 Mönchengladbach | Verfahren und vorrichtung zur spinnfasernformation |
| DE3448514C2 (de) * | 1984-01-21 | 1995-08-31 | Brockmanns Karl Josef Dr Ing | Faservorlageverstreckvorrichtung |
| IN164144B (enExample) * | 1984-05-18 | 1989-01-21 | Rieter Ag Maschf | |
| US4672800A (en) * | 1985-10-24 | 1987-06-16 | Ernst Fehrer | Process and apparatus for making a yarn |
| AT384039B (de) * | 1986-03-07 | 1987-09-25 | Fehrer Ernst | Vorrichtung zum herstellen eines garnes |
-
1989
- 1989-01-21 DE DE3901791A patent/DE3901791A1/de active Granted
- 1989-01-31 US US07/304,723 patent/US5085046A/en not_active Expired - Lifetime
- 1989-01-31 GB GB8902036A patent/GB2215743B/en not_active Expired - Lifetime
- 1989-02-02 IT IT8912418A patent/IT1232468B/it active
- 1989-02-14 CZ CS89959A patent/CZ283138B6/cs not_active IP Right Cessation
- 1989-02-14 JP JP1032914A patent/JPH0726256B2/ja not_active Expired - Fee Related
- 1989-02-15 ES ES8900536A patent/ES2012651A6/es not_active Expired - Lifetime
- 1989-02-15 CH CH528/89A patent/CH681022A5/de not_active IP Right Cessation
- 1989-02-15 KR KR1019890001715A patent/KR930011942B1/ko not_active Expired - Fee Related
- 1989-02-15 FR FR898901998A patent/FR2627194B1/fr not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4332059A (en) * | 1978-09-29 | 1982-06-01 | Rieter Machine Works Limited | Drive for drafting arrangement rolls of long spinning machines |
| DE3842120A1 (de) * | 1987-12-14 | 1989-06-29 | Murata Machinery Ltd | Verfahren und vorrichtung zum spinnen |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3927936A1 (de) * | 1988-09-29 | 1990-04-05 | Fehrer Ernst | Vorrichtung zum herstellen eines garnes |
| DE3930449A1 (de) * | 1989-09-12 | 1991-03-21 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zur erzeugung eines textilgarnes |
| DE4002051C1 (en) * | 1990-01-24 | 1991-05-23 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach, De | Prodn. of textile yarn from sliver - by subjecting sliver to drafting, then dividing it into 2 sub-sections which are brought together at joining point and twisting into yarn |
| DE4002989A1 (de) * | 1990-02-01 | 1991-08-14 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zur erzeugung eines textilgarnes |
| US5222352A (en) * | 1990-04-28 | 1993-06-29 | Fritz Stahlecker | Process and an arrangement for spinning staple fibers into a yarn |
| US5285624A (en) * | 1990-10-17 | 1994-02-15 | Hans Stahlecker | Arrangement for pneumatic false-twist spinning |
| DE19637828B4 (de) * | 1996-09-17 | 2005-05-12 | Maschinenfabrik Rieter Ag | Streckwerk zum Führen eines Vorgarns |
| DE19839601A1 (de) * | 1998-08-31 | 2000-03-02 | Rieter Ag Maschf | Spinnmaschine mit Kepa-Streckwerk |
Also Published As
| Publication number | Publication date |
|---|---|
| CZ283138B6 (cs) | 1998-01-14 |
| KR930011942B1 (ko) | 1993-12-22 |
| GB8902036D0 (en) | 1989-03-22 |
| GB2215743B (en) | 1991-07-24 |
| CS8900959A2 (en) | 1991-10-15 |
| GB2215743A (en) | 1989-09-27 |
| IT1232468B (it) | 1992-02-17 |
| FR2627194A1 (fr) | 1989-08-18 |
| ES2012651A6 (es) | 1990-04-01 |
| JPH0726256B2 (ja) | 1995-03-22 |
| US5085046A (en) | 1992-02-04 |
| IT8912418A0 (it) | 1989-02-02 |
| JPH01266226A (ja) | 1989-10-24 |
| KR890013241A (ko) | 1989-09-22 |
| DE3901791C2 (enExample) | 1991-10-10 |
| CH681022A5 (enExample) | 1992-12-31 |
| FR2627194B1 (fr) | 1992-05-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3901791C2 (enExample) | ||
| DE3927936C2 (enExample) | ||
| EP0635590B2 (de) | Doppelriemchen-Streckwerk | |
| DE2620118A1 (de) | Garnspinnmaschine | |
| CH693420A5 (de) | Vorrichtung zum Spinnen eines Fadens. | |
| DE4032940A1 (de) | Vorrichtung zum pneumatischen falschdrallspinnen | |
| DE10236450A1 (de) | Spinnmaschine mit einem Mehrstufen-Verdichtungs-Streckwerk | |
| DE10251727A1 (de) | Verfahren und Vorrichtung zur Herstellung von Flyerlunte | |
| CH654342A5 (de) | Spinnmaschine. | |
| EP1302572A2 (de) | Spinnmaschine zum Herstellen von Coregarn | |
| DE3741783C2 (enExample) | ||
| CH648874A5 (de) | Vorrichtung zur herstellung von effektgarn. | |
| DE3618314C2 (enExample) | ||
| DE3018551C2 (enExample) | ||
| EP3688209B1 (de) | Verdichtereinrichtung | |
| DD283428A5 (de) | Verfahren und vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen | |
| AT397106B (de) | Verfahren und vorrichtung zum zuführen verstreckter faserlunten zu ringspinnstellen | |
| DE3006863A1 (de) | Vorrichtung zur herstellung von effektgarn | |
| AT395866B (de) | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen | |
| AT395611B (de) | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen | |
| AT397668B (de) | Vorrichtung zum zuführen einer verstreckten faserlunte zu einer ringspinnstelle | |
| AT385526B (de) | Vorrichtung zum herstellen eines garnes | |
| AT395865B (de) | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen | |
| AT397670B (de) | Vorrichtung zum zuführen einer verstreckten faserlunte zu einer ringspinnstelle | |
| AT393699B (de) | Vorrichtung zum zufuehren je einer verstreckten faserlunte zu wenigstens zwei ringspinnstellen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |