AU618523B2 - Liquid enzyme formulation - Google Patents
Liquid enzyme formulation Download PDFInfo
- Publication number
- AU618523B2 AU618523B2 AU11656/88A AU1165688A AU618523B2 AU 618523 B2 AU618523 B2 AU 618523B2 AU 11656/88 A AU11656/88 A AU 11656/88A AU 1165688 A AU1165688 A AU 1165688A AU 618523 B2 AU618523 B2 AU 618523B2
- Authority
- AU
- Australia
- Prior art keywords
- liquid
- enzyme formulation
- liquid enzyme
- formulation
- enzymes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 102000004190 Enzymes Human genes 0.000 title claims description 160
- 108090000790 Enzymes Proteins 0.000 title claims description 160
- 239000007788 liquid Substances 0.000 title claims description 133
- 239000000203 mixture Substances 0.000 title claims description 78
- 238000009472 formulation Methods 0.000 title claims description 60
- 229940088598 enzyme Drugs 0.000 claims description 159
- 108091005804 Peptidases Proteins 0.000 claims description 44
- 102000035195 Peptidases Human genes 0.000 claims description 43
- 239000004365 Protease Substances 0.000 claims description 36
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 30
- 238000002360 preparation method Methods 0.000 claims description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 25
- 102000013142 Amylases Human genes 0.000 claims description 17
- 108010065511 Amylases Proteins 0.000 claims description 17
- 108090001060 Lipase Proteins 0.000 claims description 17
- 235000019418 amylase Nutrition 0.000 claims description 17
- 102000004882 Lipase Human genes 0.000 claims description 15
- 238000002791 soaking Methods 0.000 claims description 15
- 239000004367 Lipase Substances 0.000 claims description 14
- 239000010985 leather Substances 0.000 claims description 14
- 235000019421 lipase Nutrition 0.000 claims description 14
- 230000008569 process Effects 0.000 claims description 14
- 230000002255 enzymatic effect Effects 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 239000004094 surface-active agent Substances 0.000 claims description 12
- 241000228212 Aspergillus Species 0.000 claims description 11
- 229940025131 amylases Drugs 0.000 claims description 11
- 239000002270 dispersing agent Substances 0.000 claims description 11
- 229910021485 fumed silica Inorganic materials 0.000 claims description 11
- 239000003599 detergent Substances 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 238000009835 boiling Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 102000016938 Catalase Human genes 0.000 claims description 6
- 108010053835 Catalase Proteins 0.000 claims description 6
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 claims description 6
- 108010084185 Cellulases Proteins 0.000 claims description 5
- 102000005575 Cellulases Human genes 0.000 claims description 5
- 238000005238 degreasing Methods 0.000 claims description 5
- 239000012669 liquid formulation Substances 0.000 claims description 5
- 239000000377 silicon dioxide Substances 0.000 claims description 5
- 239000001913 cellulose Substances 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- 238000009990 desizing Methods 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 239000000758 substrate Substances 0.000 claims description 4
- 108091005507 Neutral proteases Proteins 0.000 claims description 3
- 102000035092 Neutral proteases Human genes 0.000 claims description 3
- 238000004061 bleaching Methods 0.000 claims description 3
- 150000002978 peroxides Chemical class 0.000 claims description 3
- 108091005508 Acid proteases Proteins 0.000 claims description 2
- 102100031375 Endothelial lipase Human genes 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 108010091371 endoglucanase 1 Proteins 0.000 claims description 2
- 108010091384 endoglucanase 2 Proteins 0.000 claims description 2
- 108010092450 endoglucanase Z Proteins 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims 1
- 235000012239 silicon dioxide Nutrition 0.000 claims 1
- 230000000694 effects Effects 0.000 description 61
- 239000000047 product Substances 0.000 description 18
- 230000002538 fungal effect Effects 0.000 description 13
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 12
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 11
- 238000006887 Ullmann reaction Methods 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 235000012216 bentonite Nutrition 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 241000283690 Bos taurus Species 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- -1 penicillase Proteins 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 210000003491 skin Anatomy 0.000 description 9
- 239000004382 Amylase Substances 0.000 description 8
- 235000014469 Bacillus subtilis Nutrition 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- 150000002191 fatty alcohols Chemical class 0.000 description 8
- 235000019833 protease Nutrition 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 244000063299 Bacillus subtilis Species 0.000 description 7
- 108010059892 Cellulase Proteins 0.000 description 7
- 230000009471 action Effects 0.000 description 7
- 239000000440 bentonite Substances 0.000 description 7
- 229910000278 bentonite Inorganic materials 0.000 description 7
- 229940106157 cellulase Drugs 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 241000235527 Rhizopus Species 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 239000012736 aqueous medium Substances 0.000 description 6
- 230000001580 bacterial effect Effects 0.000 description 6
- 238000005516 engineering process Methods 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 235000019419 proteases Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 238000003860 storage Methods 0.000 description 6
- 239000000080 wetting agent Substances 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 229910002019 Aerosil® 380 Inorganic materials 0.000 description 5
- 241000228245 Aspergillus niger Species 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 108010059820 Polygalacturonase Proteins 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 108090000637 alpha-Amylases Proteins 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 108010093305 exopolygalacturonase Proteins 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 210000001519 tissue Anatomy 0.000 description 5
- 229910002012 Aerosil® Inorganic materials 0.000 description 4
- 241000228230 Aspergillus parasiticus Species 0.000 description 4
- 241000228251 Aspergillus phoenicis Species 0.000 description 4
- 108091005658 Basic proteases Proteins 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 102000004139 alpha-Amylases Human genes 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 229940079919 digestives enzyme preparation Drugs 0.000 description 4
- 235000013305 food Nutrition 0.000 description 4
- 229940059442 hemicellulase Drugs 0.000 description 4
- 108010002430 hemicellulase Proteins 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 230000002797 proteolythic effect Effects 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000003981 vehicle Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 102000009027 Albumins Human genes 0.000 description 3
- 108010088751 Albumins Proteins 0.000 description 3
- 240000006439 Aspergillus oryzae Species 0.000 description 3
- 241000193830 Bacillus <bacterium> Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- 102000001554 Hemoglobins Human genes 0.000 description 3
- 108010054147 Hemoglobins Proteins 0.000 description 3
- 101000628483 Homo sapiens Suppressor of tumorigenicity 7 protein-like Proteins 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000235395 Mucor Species 0.000 description 3
- 239000004435 Oxo alcohol Substances 0.000 description 3
- 241000235525 Rhizomucor pusillus Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 102100026721 Suppressor of tumorigenicity 7 protein-like Human genes 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 108010019077 beta-Amylase Proteins 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 238000005554 pickling Methods 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- 241000228197 Aspergillus flavus Species 0.000 description 2
- 241001112078 Aspergillus usamii Species 0.000 description 2
- 241000194108 Bacillus licheniformis Species 0.000 description 2
- 102000004308 Carboxylic Ester Hydrolases Human genes 0.000 description 2
- 108090000863 Carboxylic Ester Hydrolases Proteins 0.000 description 2
- 108090000746 Chymosin Proteins 0.000 description 2
- 108090000317 Chymotrypsin Proteins 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 229920001503 Glucan Polymers 0.000 description 2
- 102100022624 Glucoamylase Human genes 0.000 description 2
- 108010068370 Glutens Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 102000004157 Hydrolases Human genes 0.000 description 2
- 108090000604 Hydrolases Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000228143 Penicillium Species 0.000 description 2
- 240000005384 Rhizopus oryzae Species 0.000 description 2
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 2
- 108010022999 Serine Proteases Proteins 0.000 description 2
- 102000012479 Serine Proteases Human genes 0.000 description 2
- 241000187747 Streptomyces Species 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- 108090000631 Trypsin Proteins 0.000 description 2
- 102000004142 Trypsin Human genes 0.000 description 2
- 108060005989 Tryptase Proteins 0.000 description 2
- 102000001400 Tryptase Human genes 0.000 description 2
- 241000282485 Vulpes vulpes Species 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 235000015278 beef Nutrition 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229960002376 chymotrypsin Drugs 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- MUCZHBLJLSDCSD-UHFFFAOYSA-N diisopropyl fluorophosphate Chemical compound CC(C)OP(F)(=O)OC(C)C MUCZHBLJLSDCSD-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000006911 enzymatic reaction Methods 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 229960005051 fluostigmine Drugs 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 235000021312 gluten Nutrition 0.000 description 2
- 239000004519 grease Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000003262 industrial enzyme Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 230000000813 microbial effect Effects 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000010008 shearing Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000012588 trypsin Substances 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LHENQXAPVKABON-UHFFFAOYSA-N 1-methoxypropan-1-ol Chemical compound CCC(O)OC LHENQXAPVKABON-UHFFFAOYSA-N 0.000 description 1
- XUJLWPFSUCHPQL-UHFFFAOYSA-N 11-methyldodecan-1-ol Chemical compound CC(C)CCCCCCCCCCO XUJLWPFSUCHPQL-UHFFFAOYSA-N 0.000 description 1
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N 2-(2-butoxyethoxy)ethanol Chemical compound CCCCOCCOCCO OAYXUHPQHDHDDZ-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- IEORSVTYLWZQJQ-UHFFFAOYSA-N 2-(2-nonylphenoxy)ethanol Chemical compound CCCCCCCCCC1=CC=CC=C1OCCO IEORSVTYLWZQJQ-UHFFFAOYSA-N 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- JBVOQKNLGSOPNZ-UHFFFAOYSA-N 2-propan-2-ylbenzenesulfonic acid Chemical compound CC(C)C1=CC=CC=C1S(O)(=O)=O JBVOQKNLGSOPNZ-UHFFFAOYSA-N 0.000 description 1
- MQWCXKGKQLNYQG-UHFFFAOYSA-N 4-methylcyclohexan-1-ol Chemical compound CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000003291 Armoracia rusticana Species 0.000 description 1
- 235000011330 Armoracia rusticana Nutrition 0.000 description 1
- 241001513093 Aspergillus awamori Species 0.000 description 1
- 241000459887 Aspergillus luchuensis Species 0.000 description 1
- 235000002247 Aspergillus oryzae Nutrition 0.000 description 1
- 108090000145 Bacillolysin Proteins 0.000 description 1
- 241000193375 Bacillus alcalophilus Species 0.000 description 1
- 241000193744 Bacillus amyloliquefaciens Species 0.000 description 1
- 241000193747 Bacillus firmus Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000606215 Bacteroides vulgatus Species 0.000 description 1
- 108010004032 Bromelains Proteins 0.000 description 1
- 108090000712 Cathepsin B Proteins 0.000 description 1
- 102000004225 Cathepsin B Human genes 0.000 description 1
- 108090000258 Cathepsin D Proteins 0.000 description 1
- 102000003908 Cathepsin D Human genes 0.000 description 1
- 102000005600 Cathepsins Human genes 0.000 description 1
- 108010084457 Cathepsins Proteins 0.000 description 1
- 240000001817 Cereus hexagonus Species 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- FVIGODVHAVLZOO-UHFFFAOYSA-N Dixanthogen Chemical compound CCOC(=S)SSC(=S)OCC FVIGODVHAVLZOO-UHFFFAOYSA-N 0.000 description 1
- 108700034307 EC 3.4.22.4 Proteins 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 102000016942 Elastin Human genes 0.000 description 1
- 108010014258 Elastin Proteins 0.000 description 1
- 241000178951 Endomyces Species 0.000 description 1
- 241001246273 Endothia Species 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- 108090000270 Ficain Proteins 0.000 description 1
- 244000168141 Geotrichum candidum Species 0.000 description 1
- 235000017388 Geotrichum candidum Nutrition 0.000 description 1
- 108050008938 Glucoamylases Proteins 0.000 description 1
- 108010015776 Glucose oxidase Proteins 0.000 description 1
- 239000004366 Glucose oxidase Substances 0.000 description 1
- 102000008214 Glutamate decarboxylase Human genes 0.000 description 1
- 108091022930 Glutamate decarboxylase Proteins 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 101001056976 Halobacterium salinarum (strain ATCC 700922 / JCM 11081 / NRC-1) Catalase-peroxidase Proteins 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108010093096 Immobilized Enzymes Proteins 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- 241000192041 Micrococcus Species 0.000 description 1
- 241000237852 Mollusca Species 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- 241000221960 Neurospora Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 102100026367 Pancreatic alpha-amylase Human genes 0.000 description 1
- 102000019280 Pancreatic lipases Human genes 0.000 description 1
- 108050006759 Pancreatic lipases Proteins 0.000 description 1
- 108010019160 Pancreatin Proteins 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000228150 Penicillium chrysogenum Species 0.000 description 1
- 241000985513 Penicillium oxalicum Species 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- 102000003992 Peroxidases Human genes 0.000 description 1
- 241001482237 Pica Species 0.000 description 1
- HCBIBCJNVBAKAB-UHFFFAOYSA-N Procaine hydrochloride Chemical compound Cl.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 HCBIBCJNVBAKAB-UHFFFAOYSA-N 0.000 description 1
- 102000016611 Proteoglycans Human genes 0.000 description 1
- 108010067787 Proteoglycans Proteins 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000589538 Pseudomonas fragi Species 0.000 description 1
- 241000589774 Pseudomonas sp. Species 0.000 description 1
- 241000235004 Saccharomycopsis fibuligera Species 0.000 description 1
- 241000015473 Schizothorax griseus Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- 241000187438 Streptomyces fradiae Species 0.000 description 1
- 241000938061 Streptomyces thermophilus Species 0.000 description 1
- 108010056079 Subtilisins Proteins 0.000 description 1
- 102000005158 Subtilisins Human genes 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000779819 Syncarpia glomulifera Species 0.000 description 1
- 241000223258 Thermomyces lanuginosus Species 0.000 description 1
- 241000222354 Trametes Species 0.000 description 1
- 241000223259 Trichoderma Species 0.000 description 1
- 241000223261 Trichoderma viride Species 0.000 description 1
- 241000179532 [Candida] cylindracea Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 235000015197 apple juice Nutrition 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000020054 awamori Nutrition 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 108010051210 beta-Fructofuranosidase Proteins 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000019835 bromelain Nutrition 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 229940071118 cumenesulfonate Drugs 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920002549 elastin Polymers 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000019836 ficin Nutrition 0.000 description 1
- POTUGHMKJGOKRI-UHFFFAOYSA-N ficin Chemical compound FI=CI=N POTUGHMKJGOKRI-UHFFFAOYSA-N 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 238000004362 fungal culture Methods 0.000 description 1
- 238000010574 gas phase reaction Methods 0.000 description 1
- 229940116332 glucose oxidase Drugs 0.000 description 1
- 235000019420 glucose oxidase Nutrition 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000002414 glycolytic effect Effects 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000001573 invertase Substances 0.000 description 1
- 235000011073 invertase Nutrition 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 238000001471 micro-filtration Methods 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229940055695 pancreatin Drugs 0.000 description 1
- 229940055729 papain Drugs 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 108040007629 peroxidase activity proteins Proteins 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 235000021110 pickles Nutrition 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000001739 pinus spp. Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011164 primary particle Substances 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000009974 thixotropic effect Effects 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 229940036248 turpentine Drugs 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 238000000108 ultra-filtration Methods 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N9/00—Enzymes; Proenzymes; Compositions thereof; Processes for preparing, activating, inhibiting, separating or purifying enzymes
-
- C—CHEMISTRY; METALLURGY
- C14—SKINS; HIDES; PELTS; LEATHER
- C14C—CHEMICAL TREATMENT OF HIDES, SKINS OR LEATHER, e.g. TANNING, IMPREGNATING, FINISHING; APPARATUS THEREFOR; COMPOSITIONS FOR TANNING
- C14C1/00—Chemical treatment prior to tanning
- C14C1/06—Facilitating unhairing, e.g. by painting, by liming
- C14C1/065—Enzymatic unhairing
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N9/00—Enzymes; Proenzymes; Compositions thereof; Processes for preparing, activating, inhibiting, separating or purifying enzymes
- C12N9/96—Stabilising an enzyme by forming an adduct or a composition; Forming enzyme conjugates
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Engineering & Computer Science (AREA)
- Zoology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Genetics & Genomics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Health & Medical Sciences (AREA)
- Biotechnology (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- General Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Medicinal Chemistry (AREA)
- Microbiology (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- General Chemical & Material Sciences (AREA)
- Enzymes And Modification Thereof (AREA)
- Treatment And Processing Of Natural Fur Or Leather (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Immobilizing And Processing Of Enzymes And Microorganisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3704465 | 1987-02-13 | ||
| DE3704465A DE3704465C2 (de) | 1987-02-13 | 1987-02-13 | Flüssig-Formulierungen von Enzymen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU1165688A AU1165688A (en) | 1988-08-18 |
| AU618523B2 true AU618523B2 (en) | 1992-01-02 |
Family
ID=6320872
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU11656/88A Ceased AU618523B2 (en) | 1987-02-13 | 1988-02-12 | Liquid enzyme formulation |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US5102422A (enExample) |
| JP (1) | JP2703250B2 (enExample) |
| KR (1) | KR960016075B1 (enExample) |
| AU (1) | AU618523B2 (enExample) |
| BR (1) | BR8805403A (enExample) |
| CH (1) | CH677798A5 (enExample) |
| DE (1) | DE3704465C2 (enExample) |
| DK (1) | DK73688A (enExample) |
| ES (1) | ES2008974A6 (enExample) |
| FI (1) | FI93656C (enExample) |
| FR (1) | FR2610947B1 (enExample) |
| GB (1) | GB2201960B (enExample) |
| IT (1) | IT1219015B (enExample) |
| SE (1) | SE500913C2 (enExample) |
| WO (1) | WO1988006183A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU645412B2 (en) * | 1991-03-26 | 1994-01-13 | Rohm Gmbh | Enzymatically supported methods for liming and bating |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5273898A (en) * | 1986-10-17 | 1993-12-28 | Noro Nordisk A/S | Thermally stable and positionally non-specific lipase isolated from Candida |
| DE3922748B4 (de) * | 1989-07-11 | 2006-01-05 | Röhm GmbH & Co. KG | Enzymatisches Weichverfahren |
| DE3927286C2 (de) * | 1989-08-18 | 1997-07-24 | Roehm Gmbh | Wäßrige Enzym-Flüssigformulierungen |
| DE4023601A1 (de) * | 1990-07-25 | 1992-01-30 | Henkel Kgaa | Fluessige enzymzubereitung |
| US5320959A (en) * | 1990-08-15 | 1994-06-14 | Rhone-Poulenc Inc. | Liquid lipase from animal origin and method of preparation |
| ES2174820T3 (es) * | 1991-01-16 | 2002-11-16 | Procter & Gamble | Composiciones detergentes compactas con celulasa de alta actividad. |
| US5443750A (en) * | 1991-01-16 | 1995-08-22 | The Procter & Gamble Company | Detergent compositions with high activity cellulase and softening clays |
| US5525509A (en) * | 1991-03-26 | 1996-06-11 | Rohm Gmbh | Method for the enzymatic liming of skins and hides |
| EP0540784B1 (en) * | 1991-11-06 | 2000-01-19 | The Procter & Gamble Company | Dye transfer inhibiting compositions |
| DK148492D0 (enExample) * | 1992-12-10 | 1992-12-10 | Novo Nordisk As | |
| GB9309243D0 (en) * | 1993-05-05 | 1993-06-16 | Allied Colloids Ltd | Enzyme dispersions,their production and compositions containing them |
| US5587108A (en) * | 1994-10-06 | 1996-12-24 | European Touch Co., Inc. | Styrene monomer based nail tip blender and brush cleaner |
| CN1570151A (zh) * | 1994-10-07 | 2005-01-26 | 诺沃奇梅兹有限公司 | 将生皮或表皮加工成皮革的方法 |
| JP3625503B2 (ja) | 1994-11-11 | 2005-03-02 | 旭化成ファーマ株式会社 | 臨床検査用複合酵素含有組成物 |
| WO1996017088A1 (en) * | 1994-11-28 | 1996-06-06 | Novo Nordisk A/S | Enzymatic degreasing of skins and hides |
| DE29503135U1 (de) * | 1995-02-24 | 1995-05-24 | Röhm GmbH, 64293 Darmstadt | Mehrfunktionelle Lederbearbeitungsmittel |
| US5531898A (en) * | 1995-04-06 | 1996-07-02 | International Organic Solutions Corp. | Sewage and contamination remediation and materials for effecting same |
| DE69737828T2 (de) * | 1996-04-29 | 2008-03-06 | Novozymes A/S | Flüssige, nichtwässrige enzyme enthaltende zusammensetzungen |
| US6121041A (en) * | 1996-07-31 | 2000-09-19 | St. Jude Medical, Inc. | Use of microorganisms for decellularizing bioprosthetic tissue |
| US7153818B2 (en) | 2000-07-28 | 2006-12-26 | Henkel Kgaa | Amylolytic enzyme extracted from bacillus sp. A 7-7 (DSM 12368) and washing and cleaning agents containing this novel amylolytic enzyme |
| US7001724B1 (en) * | 2000-11-28 | 2006-02-21 | Applera Corporation | Compositions, methods, and kits for isolating nucleic acids using surfactants and proteases |
| WO2003052092A2 (en) * | 2001-12-19 | 2003-06-26 | Dsm Ip Assets B.V. | Method for the inactivation of amylase in the presence of protease |
| DE10221152B4 (de) * | 2002-05-13 | 2008-10-30 | Schill + Seilacher Ag | Verfahren zur Herstellung sauberer Blößen in der Wasserwerkstatt |
| US7198647B2 (en) * | 2002-07-15 | 2007-04-03 | Council Of Scientific And Industrial Research | Process for lime and sulfide free unhairing of skins or hides using animal and/or plant enzymes |
| DE10237259A1 (de) * | 2002-08-14 | 2004-02-26 | Basf Ag | Formulierung für den Einsatz in der Chromfrei- oder Chromgerbung |
| GB2393185B (en) * | 2002-09-17 | 2005-10-12 | Generics | A novel process for the preparation of 3,3'-azo-bis(6-hydroxybenzoic acid) and its derivatives |
| US7013838B2 (en) * | 2002-12-20 | 2006-03-21 | Frank Jay Hague | Bleached expanded pigskin and products |
| CN1164770C (zh) * | 2002-12-20 | 2004-09-01 | 周青标 | 宠物咀嚼用猪皮漂白发泡工艺及其制品 |
| WO2005059184A2 (en) | 2003-12-17 | 2005-06-30 | Akzo Nobel N.V. | Process for treating animal skins |
| US7416869B2 (en) * | 2004-08-19 | 2008-08-26 | Lonza Ltd. | Enzyme delivery systems, application in water based products |
| WO2008021987A2 (en) * | 2006-08-10 | 2008-02-21 | Jon Barron | Proteolytic enzyme formulations |
| EP2601316A4 (en) * | 2010-08-05 | 2017-07-05 | West Bengal University Of Technology | Hide processing methods and compositions |
| EP2632861B1 (en) * | 2010-10-26 | 2018-05-23 | Novozymes Biologicals, Inc. | Wastewater treatment compositions |
| CN103046383B (zh) * | 2012-11-27 | 2016-05-04 | 江南大学 | 一种酶氧一浴棉型织物低温前处理方法 |
| US9776887B2 (en) | 2013-12-04 | 2017-10-03 | Zhuangdou Zhang | Tannery process with effluent recycling |
| RU2588984C2 (ru) * | 2014-07-04 | 2016-07-10 | Михаил Вячеславович Новиков | Способ выделки меховых шкурок |
| AU2015271965B2 (en) * | 2014-12-22 | 2017-09-07 | Zhuangdou ZHANG | Tannery process with effluent recycling |
| CN114806737B (zh) * | 2022-04-28 | 2023-09-15 | 应急管理部天津消防研究所 | 一种灭火防护服装PAHs污染专用清洁剂及其制备方法和应用 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU552398B2 (en) * | 1982-08-30 | 1986-05-29 | Colgate-Palmolive Pty. Ltd. | Stabilized enzyme-containing detergent composition |
| AU590589B2 (en) * | 1985-07-26 | 1989-11-09 | Colgate-Palmolive Pty. Ltd. | Fabric softening liquid detergent |
| AU590891B2 (en) * | 1985-07-26 | 1989-11-23 | Colgate-Palmolive Company, The | Stabilized built liquid detergent composition containing enzymes |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE200519C (enExample) * | 1907-06-06 | |||
| DE288095C (de) * | 1914-11-11 | 1915-10-18 | Roehm Otto | Verfahren zum Weichen von Häuten und Fellen |
| DE847947C (de) * | 1943-09-11 | 1952-08-28 | Roehm & Haas G M B H | Beizverfahren fuer Pelzfelle |
| DE1219620B (de) * | 1953-09-04 | 1966-06-23 | Roehm & Haas Gmbh | Verfahren zur Herstellung gerbfertiger Bloessen |
| DE927464C (de) * | 1953-09-04 | 1955-05-09 | Roehm & Haas G M B H | Verfahren zur Herstellung gerbfertiger Bloessen |
| DE976602C (de) * | 1954-02-16 | 1964-01-02 | Roehm & Haas G M B H | Weichverfahren fuer rohe tierische Felle und Haeute |
| DE941680C (de) * | 1954-04-17 | 1956-04-19 | Roehm & Haas G M B H | Verfahren zur Vorbehandlung von geweichten Pelzfellen fuer die Gerbung |
| DE976107C (de) * | 1954-05-19 | 1963-02-28 | Roehm & Haas G M B H | Verfahren zum Beizen tierischer Hautbloessen fuer Chevreauleder |
| DE1023183B (de) * | 1954-06-30 | 1958-01-23 | Roehm & Haas Gmbh | Verfahren zum AEschern von Fellen und Haeuten mit Hilfe von Schimmelpilztryptase |
| DE941811C (de) * | 1954-11-18 | 1956-04-19 | Roehm & Haas G M B H | Verfahren zur Herstellung gerbfertiger Bloessen |
| DE974813C (de) * | 1954-12-24 | 1961-05-04 | Roehm & Haas G M B H | Verfahren zum Beizen tierischer Hautbloessen |
| DE975095C (de) * | 1955-01-01 | 1961-08-10 | Roehm & Haas G M B H | Verfahren zum Beizen tierischer Bloessen mit Pankreasenzympraeparaten |
| DE976928C (de) * | 1955-01-08 | 1964-08-20 | Roehm & Haas G M B H | Verfahren zum Beizen tierischer Bloessen |
| DE1120066B (de) * | 1955-03-23 | 1961-12-21 | Roehm & Haas Gmbh | Verfahren zum Beizen tierischer Hautbloessen |
| FR1125307A (fr) * | 1955-03-30 | 1956-10-29 | Roehm & Haas Gmbh | Procédé enzymatique de délainage et de débourrage |
| DE1026038B (de) * | 1955-03-30 | 1958-03-13 | Roehm & Haas Gmbh | Enthaaren und Entwollen gruener oder geweichter Felle |
| DE1034317B (de) * | 1955-05-27 | 1958-07-17 | Roehm & Haas Gmbh | Verfahren zum Weichen von Rohhaeuten und -fellen |
| DE1022748B (de) * | 1955-11-30 | 1958-01-16 | Roehm & Haas Gmbh | Weichen von Fellen und Haeuten |
| DE1203416B (de) * | 1956-04-14 | 1965-10-21 | Roehm & Haas Gmbh | Verfahren zur Herstellung tierischer Bloessen |
| DE1211349B (de) * | 1959-03-26 | 1966-02-24 | Roehm & Haas Gmbh | Enzymatische Enthaarung mit Pankreastryptase |
| DE1155560B (de) * | 1960-06-04 | 1963-10-10 | Roehm & Haas Gmbh | Enthaaren von Haeuten und Fellen mit Hilfe proteolytischer Enzyme |
| DE1230169B (de) * | 1962-04-06 | 1966-12-08 | Roehm & Haas Gmbh | Verfahren zur Herstellung gerbfertiger Bloessen |
| DE1282837B (enExample) * | 1963-05-09 | 1968-11-14 | ||
| DE1288728B (de) * | 1963-07-27 | 1969-02-06 | Roehm & Haas Gmbh | Verfahren zur Herstellung gerbfertiger Bloessen |
| DE1282838B (de) * | 1964-01-22 | 1968-11-14 | Roehm & Haas Gmbh | Verfahren zum Weichen, Enthaaren oder Beizen von Fellen oder Haeuten mit proteolytischen Enzymen |
| DE1669353A1 (de) * | 1967-02-17 | 1970-03-05 | Roehm & Haas Gmbh | Verfahren zur Lockerung des Fasergefueges von Rauchwaren |
| DE1669354C3 (de) * | 1967-03-03 | 1975-04-10 | Roehm Gmbh, 6100 Darmstadt | Verfahren zur Entfernung von Grannenhaaren auf Pelzfellen |
| US3557002A (en) * | 1967-11-15 | 1971-01-19 | Procter & Gamble | Stabilized aqueous enzyme preparation |
| CH515994A (de) * | 1968-04-13 | 1971-11-30 | Roehm Gmbh | Enzymatisches Enthaarungsverfahren |
| US3600319A (en) * | 1968-06-25 | 1971-08-17 | Procter & Gamble | Process for application of enzymes to spray-dried detergent granules |
| US3741902A (en) * | 1971-05-24 | 1973-06-26 | Purex Corp | Laundry prespotter composition |
| US3746649A (en) * | 1971-10-01 | 1973-07-17 | J Barrett | Stable liquid enzyme product |
| US3781212A (en) * | 1972-10-27 | 1973-12-25 | Townsend & Townsend | Aerosol enzyme detergents stabilized with carbon dioxide |
| ES421535A1 (es) * | 1973-01-13 | 1976-06-16 | Roehm Gmbh | Procedimiento para la preparacion de pellejos dispuestos para curtir a partir de cuero y pieles de origen animal. |
| IT1011668B (it) * | 1973-04-28 | 1977-02-10 | Roehm Gmbh | Procedimento di purga delle pelli |
| DE2404789C3 (de) * | 1974-02-01 | 1979-02-15 | Roehm Gmbh, 6100 Darmstadt | Verfahren zur Herstellung gerbfertiger Blößen aus tierischen Häuten und Fellen |
| DE2536256C3 (de) * | 1975-08-14 | 1979-08-30 | Bergmann, Christian, 2061 Nahe | Der Abstützung der Propellerwelle eines Schiffes dienende Stevenlagerung |
| DE2705671C3 (de) * | 1977-02-11 | 1982-02-25 | Fa. Carl Freudenberg, 6940 Weinheim | Verfahren zum Aufarbeiten von Hautabfällen |
| IT1151796B (it) * | 1982-06-09 | 1986-12-24 | Ravizza Spa | Shampoo a base enzimatica |
| DE3312840A1 (de) * | 1983-04-09 | 1984-10-11 | Röhm GmbH, 6100 Darmstadt | Verfahren zur nassentfettung von hautmaterial |
| US4519934A (en) * | 1983-04-19 | 1985-05-28 | Novo Industri A/S | Liquid enzyme concentrates containing alpha-amylase |
| DE3429047A1 (de) * | 1984-08-07 | 1986-02-20 | Röhm GmbH, 6100 Darmstadt | Enzymatisches enthaarungsverfahren |
| DE3440750A1 (de) * | 1984-11-08 | 1986-05-07 | Röhm GmbH, 6100 Darmstadt | Verfahren zum hautaufschluss von grossviehhaeuten und kalbfellen |
| US4753750A (en) * | 1984-12-31 | 1988-06-28 | Delaware | Liquid laundry detergent composition and method of use |
| DE3513253C2 (de) * | 1985-04-13 | 1997-04-10 | Roehm Gmbh | Verfahren zur raschen enzymatischen Enthaarung von Häuten |
| US4673647A (en) * | 1985-05-06 | 1987-06-16 | Miles Laboratories, Inc. | Process to solubilize enzymes and an enzyme liquid product produced thereby |
-
1987
- 1987-02-13 DE DE3704465A patent/DE3704465C2/de not_active Revoked
-
1988
- 1988-01-26 SE SE8800238A patent/SE500913C2/sv unknown
- 1988-02-03 US US07/152,020 patent/US5102422A/en not_active Expired - Lifetime
- 1988-02-05 CH CH410/88A patent/CH677798A5/de not_active IP Right Cessation
- 1988-02-08 ES ES8800351A patent/ES2008974A6/es not_active Expired
- 1988-02-10 WO PCT/DE1988/000061 patent/WO1988006183A1/de not_active Ceased
- 1988-02-10 BR BR8805403A patent/BR8805403A/pt not_active IP Right Cessation
- 1988-02-12 AU AU11656/88A patent/AU618523B2/en not_active Ceased
- 1988-02-12 IT IT67104/88A patent/IT1219015B/it active
- 1988-02-12 JP JP63029013A patent/JP2703250B2/ja not_active Expired - Lifetime
- 1988-02-12 DK DK073688A patent/DK73688A/da not_active Application Discontinuation
- 1988-02-12 GB GB8803314A patent/GB2201960B/en not_active Expired - Lifetime
- 1988-02-12 FR FR888801671A patent/FR2610947B1/fr not_active Expired
- 1988-02-13 KR KR1019880001431A patent/KR960016075B1/ko not_active Expired - Fee Related
- 1988-10-06 FI FI884592A patent/FI93656C/fi not_active IP Right Cessation
-
1989
- 1989-10-16 US US07/421,576 patent/US4943530A/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU552398B2 (en) * | 1982-08-30 | 1986-05-29 | Colgate-Palmolive Pty. Ltd. | Stabilized enzyme-containing detergent composition |
| AU590589B2 (en) * | 1985-07-26 | 1989-11-09 | Colgate-Palmolive Pty. Ltd. | Fabric softening liquid detergent |
| AU590891B2 (en) * | 1985-07-26 | 1989-11-23 | Colgate-Palmolive Company, The | Stabilized built liquid detergent composition containing enzymes |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU645412B2 (en) * | 1991-03-26 | 1994-01-13 | Rohm Gmbh | Enzymatically supported methods for liming and bating |
Also Published As
| Publication number | Publication date |
|---|---|
| US4943530A (en) | 1990-07-24 |
| DK73688A (da) | 1988-08-14 |
| IT8867104A0 (it) | 1988-02-12 |
| FR2610947A1 (fr) | 1988-08-19 |
| CH677798A5 (enExample) | 1991-06-28 |
| US5102422A (en) | 1992-04-07 |
| SE8800238D0 (sv) | 1988-01-26 |
| AU1165688A (en) | 1988-08-18 |
| FI884592A0 (fi) | 1988-10-06 |
| GB2201960B (en) | 1990-11-21 |
| FI93656B (fi) | 1995-01-31 |
| JP2703250B2 (ja) | 1998-01-26 |
| FI884592L (fi) | 1988-10-06 |
| SE500913C2 (sv) | 1994-09-26 |
| DE3704465A1 (de) | 1988-08-25 |
| FR2610947B1 (fr) | 1989-12-08 |
| ES2008974A6 (es) | 1989-08-16 |
| DK73688D0 (da) | 1988-02-12 |
| KR960016075B1 (ko) | 1996-11-27 |
| GB2201960A (en) | 1988-09-14 |
| WO1988006183A1 (fr) | 1988-08-25 |
| SE8800238L (sv) | 1988-08-14 |
| BR8805403A (pt) | 1989-08-15 |
| KR880010113A (ko) | 1988-10-07 |
| IT1219015B (it) | 1990-04-24 |
| GB8803314D0 (en) | 1988-03-09 |
| FI93656C (fi) | 1995-05-10 |
| JPS63216480A (ja) | 1988-09-08 |
| DE3704465C2 (de) | 1995-11-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU618523B2 (en) | Liquid enzyme formulation | |
| US5089414A (en) | Enzymatic soaking method | |
| TW203102B (enExample) | ||
| AU697192B2 (en) | Enzyme preparations for use in leather processing | |
| GB2044294A (en) | Enzymatic bating process | |
| US5169771A (en) | Method for making a sedimentation resistant stable enzyme dispersion | |
| US5525509A (en) | Method for the enzymatic liming of skins and hides | |
| US5508195A (en) | Method for liming hides and skins | |
| GB2250289A (en) | Preparations containing protease-tannin complex | |
| US20080220499A1 (en) | Novel protease for industrial applications | |
| US6451586B1 (en) | Enzyme preparation containing protease | |
| AU676600B2 (en) | Enzymatically-aided liming process | |
| Hemalatha | Industrial Applications of Alkaline Protease with Novel Properties from Bacillus Cereus Strain S8 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |