HU217079B - Új eljárás 5-(2-klór-alkil)-tiazol-származékok előállítására - Google Patents
Új eljárás 5-(2-klór-alkil)-tiazol-származékok előállítására Download PDFInfo
- Publication number
- HU217079B HU217079B HU9401262A HU9401262A HU217079B HU 217079 B HU217079 B HU 217079B HU 9401262 A HU9401262 A HU 9401262A HU 9401262 A HU9401262 A HU 9401262A HU 217079 B HU217079 B HU 217079B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- chloro
- process according
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 48
- 238000002360 preparation method Methods 0.000 title claims abstract description 14
- 150000007979 thiazole derivatives Chemical class 0.000 title claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 50
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 19
- 239000003054 catalyst Substances 0.000 claims abstract description 14
- 239000003960 organic solvent Substances 0.000 claims abstract description 14
- 239000002253 acid Substances 0.000 claims abstract description 12
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- 239000007864 aqueous solution Substances 0.000 claims abstract description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 21
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 claims description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 14
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 14
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 14
- -1 aliphatic alcohols Chemical class 0.000 claims description 11
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 238000005984 hydrogenation reaction Methods 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 6
- 229910052763 palladium Inorganic materials 0.000 claims description 6
- 238000005660 chlorination reaction Methods 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 3
- 239000012320 chlorinating reagent Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 3
- 229910052711 selenium Inorganic materials 0.000 claims description 3
- 239000011669 selenium Substances 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 2
- 239000000194 fatty acid Substances 0.000 claims description 2
- 229930195729 fatty acid Natural products 0.000 claims description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 abstract description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 abstract 2
- 239000005711 Benzoic acid Substances 0.000 abstract 1
- 235000010233 benzoic acid Nutrition 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 28
- 239000000460 chlorine Substances 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- 238000000921 elemental analysis Methods 0.000 description 16
- 239000003921 oil Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- QOCBYUYXAYWNIW-UHFFFAOYSA-N 2-chloro-5-(2-chloroethyl)-4-methyl-1,3-thiazole Chemical compound CC=1N=C(Cl)SC=1CCCl QOCBYUYXAYWNIW-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 10
- MUNVMJWLFQIMTQ-UHFFFAOYSA-N (1-chloro-4-oxopentan-3-yl) thiocyanate Chemical compound ClCCC(C(=O)C)SC#N MUNVMJWLFQIMTQ-UHFFFAOYSA-N 0.000 description 9
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- PCLITLDOTJTVDJ-UHFFFAOYSA-N Chlormethiazole Chemical compound CC=1N=CSC=1CCCl PCLITLDOTJTVDJ-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- NOSBOKVYSXXKFL-UHFFFAOYSA-N 3,5-dichloropentan-2-one Chemical compound CC(=O)C(Cl)CCCl NOSBOKVYSXXKFL-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 5
- HJLZTYJNTROXOS-UHFFFAOYSA-N 5-(2-chloroethyl)-4-methyl-3h-1,3-thiazol-2-one Chemical compound CC=1NC(=O)SC=1CCCl HJLZTYJNTROXOS-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- ZHGFGCVGAWZQNQ-UHFFFAOYSA-N (5-chloro-2-oxoheptan-3-yl) thiocyanate Chemical compound CCC(Cl)CC(C(C)=O)SC#N ZHGFGCVGAWZQNQ-UHFFFAOYSA-N 0.000 description 3
- OELCKVRGGUWIKQ-UHFFFAOYSA-N (5-chloro-2-oxohexan-3-yl) thiocyanate Chemical compound CC(Cl)CC(C(C)=O)SC#N OELCKVRGGUWIKQ-UHFFFAOYSA-N 0.000 description 3
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 3
- OCFJOPKQBDPPGU-UHFFFAOYSA-N 2-chloro-5-(2-chlorobutyl)-4-methyl-1,3-thiazole Chemical compound CCC(Cl)CC=1SC(Cl)=NC=1C OCFJOPKQBDPPGU-UHFFFAOYSA-N 0.000 description 3
- ZQGSRCVHQGHGOT-UHFFFAOYSA-N 2-chloro-5-(2-chloropropyl)-4-methyl-1,3-thiazole Chemical compound CC(Cl)CC=1SC(Cl)=NC=1C ZQGSRCVHQGHGOT-UHFFFAOYSA-N 0.000 description 3
- DCYIWPGXDRVDSG-UHFFFAOYSA-N 3,5-dichloroheptan-2-one Chemical compound CCC(Cl)CC(Cl)C(C)=O DCYIWPGXDRVDSG-UHFFFAOYSA-N 0.000 description 3
- RDLSLDUOUDBZEE-UHFFFAOYSA-N 3,5-dichlorohexan-2-one Chemical compound CC(Cl)CC(Cl)C(C)=O RDLSLDUOUDBZEE-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 229960004414 clomethiazole Drugs 0.000 description 3
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 150000002540 isothiocyanates Chemical class 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical class NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 2
- CZWWCTHQXBMHDA-UHFFFAOYSA-N 3h-1,3-thiazol-2-one Chemical class OC1=NC=CS1 CZWWCTHQXBMHDA-UHFFFAOYSA-N 0.000 description 2
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical class SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 description 2
- SYTQSMOVMUXZOG-UHFFFAOYSA-N 5-(2-chlorobutyl)-4-methyl-3h-1,3-thiazol-2-one Chemical compound CCC(Cl)CC=1SC(O)=NC=1C SYTQSMOVMUXZOG-UHFFFAOYSA-N 0.000 description 2
- VTOZAWFXXADUTJ-UHFFFAOYSA-N 5-(2-chloropropyl)-4-methyl-3h-1,3-thiazol-2-one Chemical compound CC(Cl)CC=1SC(O)=NC=1C VTOZAWFXXADUTJ-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- YNNGZCVDIREDDK-UHFFFAOYSA-N aminocarbamodithioic acid Chemical class NNC(S)=S YNNGZCVDIREDDK-UHFFFAOYSA-N 0.000 description 2
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 2
- 229940011051 isopropyl acetate Drugs 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- BEGREHRAUWCAHV-UHFFFAOYSA-N 2-bromo-1,3-thiazole-4-carboxylic acid Chemical compound OC(=O)C1=CSC(Br)=N1 BEGREHRAUWCAHV-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- XXWRIJZGJRUCAE-UHFFFAOYSA-N 5-(2-chlorobutyl)-4-methyl-1,3-thiazole Chemical compound CCC(Cl)CC=1SC=NC=1C XXWRIJZGJRUCAE-UHFFFAOYSA-N 0.000 description 1
- OFXYKSLKNMTBHK-UHFFFAOYSA-N 5-(2-chloroethyl)-4-methyl-1,3-thiazole;hydrochloride Chemical compound Cl.CC=1N=CSC=1CCCl OFXYKSLKNMTBHK-UHFFFAOYSA-N 0.000 description 1
- CZIRNNUXUNXCFN-UHFFFAOYSA-N 5-(2-chloropropyl)-4-methyl-1,3-thiazole Chemical compound CC(Cl)CC=1SC=NC=1C CZIRNNUXUNXCFN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- WJGAPUXHSQQWQF-UHFFFAOYSA-N acetic acid;hydrochloride Chemical compound Cl.CC(O)=O WJGAPUXHSQQWQF-UHFFFAOYSA-N 0.000 description 1
- PZAGQUOSOTUKEC-UHFFFAOYSA-N acetic acid;sulfuric acid Chemical compound CC(O)=O.OS(O)(=O)=O PZAGQUOSOTUKEC-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 229940124575 antispasmodic agent Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical class OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 235000015220 hamburgers Nutrition 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C331/00—Derivatives of thiocyanic acid or of isothiocyanic acid
- C07C331/02—Thiocyanates
- C07C331/04—Thiocyanates having sulfur atoms of thiocyanate groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/34—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU9401262A HU217079B (hu) | 1991-10-30 | 1992-10-30 | Új eljárás 5-(2-klór-alkil)-tiazol-származékok előállítására |
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU3402/91A HU215840B (hu) | 1991-10-30 | 1991-10-30 | Eljárás 2-klór-tiazol-származékok előállítására |
| HU913404A HU207724B (en) | 1991-10-30 | 1991-10-30 | New process for producing thiazols |
| HU3403/91A HU215850B (hu) | 1991-10-30 | 1991-10-30 | Eljárás tiocianáto-keton-származékok előállítására |
| HU9201125A HUT66222A (en) | 1992-04-03 | 1992-04-03 | 2-hydroxy-4-methyl-5-halogenoalkyl-1,3-thiazole derivatives and process for producing them |
| HUP9201124A HU215849B (hu) | 1992-04-03 | 1992-04-03 | Eljárás 2-klór-4-metil-5-(halogén-alkil)-1,3-tiazol-származékok előállítására |
| HU9401262A HU217079B (hu) | 1991-10-30 | 1992-10-30 | Új eljárás 5-(2-klór-alkil)-tiazol-származékok előállítására |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU9401262D0 HU9401262D0 (en) | 1994-08-29 |
| HUT70739A HUT70739A (en) | 1995-10-30 |
| HU217079B true HU217079B (hu) | 1999-11-29 |
Family
ID=27517525
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9401262A HU217079B (hu) | 1991-10-30 | 1992-10-30 | Új eljárás 5-(2-klór-alkil)-tiazol-származékok előállítására |
Country Status (24)
| Country | Link |
|---|---|
| US (2) | US5648498A (enExample) |
| EP (2) | EP0546306B1 (enExample) |
| JP (1) | JP3190959B2 (enExample) |
| KR (1) | KR100218131B1 (enExample) |
| AT (1) | ATE151761T1 (enExample) |
| AU (1) | AU664868B2 (enExample) |
| CA (1) | CA2121488A1 (enExample) |
| CZ (1) | CZ283402B6 (enExample) |
| DE (1) | DE69219154T2 (enExample) |
| DK (1) | DK0619815T3 (enExample) |
| ES (1) | ES2100365T3 (enExample) |
| FI (1) | FI105476B (enExample) |
| GR (1) | GR3023842T3 (enExample) |
| HK (1) | HK93397A (enExample) |
| HR (1) | HRP921128B1 (enExample) |
| HU (1) | HU217079B (enExample) |
| IL (1) | IL103586A (enExample) |
| IS (1) | IS1688B (enExample) |
| LV (1) | LV12130B (enExample) |
| NO (1) | NO304650B1 (enExample) |
| PL (1) | PL172013B1 (enExample) |
| SI (1) | SI9200292B (enExample) |
| SK (1) | SK279665B6 (enExample) |
| WO (1) | WO1993009107A1 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19548417A1 (de) * | 1995-12-22 | 1997-06-26 | Bayer Ag | Verfahren zur Herstellung von 2-Chlor-5-chlormethylthiazol |
| HUP0900267A2 (en) | 2009-04-30 | 2011-03-28 | Sanofi Aventis | Process for preparing of thiazole amines and intermediates thereof |
| KR102799767B1 (ko) * | 2022-11-30 | 2025-04-23 | 주식회사 그립인 | 모형을 형성하는 방향제 발산 장치 |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1808893A (en) * | 1931-06-09 | Leon c | ||
| GB456751A (en) * | 1935-05-13 | 1936-11-13 | Ig Farbenindustrie Ag | Process for the manufacture of 4-alkyl-5-hydroxy-alkylthiazoles |
| CH200248A (de) * | 1937-03-12 | 1938-09-30 | Hoffmann La Roche | Verfahren zur Darstellung von 4-Methyl-5-B-chloräthylthiazol. |
| US2395453A (en) * | 1944-02-26 | 1946-02-26 | Rohm & Haas | Beta-thiocyano ketones and method for their preparation |
| FR1274353A (fr) * | 1955-09-28 | 1961-10-27 | Procédé de préparation des méthyl-4 bêta-halogénoéthyl-5 thiazoles et de leurs sels | |
| DE1082903B (de) * | 1957-10-11 | 1960-06-09 | Basf Ag | Verfahren zur Herstellung von Rhodanverbindungen |
| DE1515197C3 (de) * | 1964-05-06 | 1974-08-15 | Steigerwald Strahltechnik Gmbh, 8000 Muenchen | Energiestrahl-Schweiß verfahren |
| GB1053696A (enExample) * | 1964-08-12 | |||
| US3670004A (en) * | 1969-01-07 | 1972-06-13 | Buckman Labor Inc | Thiocyano substituted acrylates and propionates and their use as pesticides |
| FR2152345A1 (en) * | 1971-09-06 | 1973-04-27 | Roussel Uclaf | Alpha-(2-thiazolyl)oxyalkanoic acids and derivatives - - with analgesic,antiinflammatory and antipyretic activity |
| DE2236796A1 (de) * | 1972-07-27 | 1974-02-07 | Georg Dipl Chem Dr Herbertz | 2-hydroxy-4-methyl-5-(2-chloraethyl)thiazol |
| DE2339109A1 (de) * | 1973-08-02 | 1975-02-20 | Bayer Ag | Alpha-halogenketone |
| DE2423981A1 (de) * | 1974-05-17 | 1975-11-27 | Bayer Ag | Alpha - halogenketone |
| DE2823658A1 (de) * | 1978-05-30 | 1979-12-06 | Bayer Ag | Mittel zur bekaempfung von pflanzenbakteriosen |
| US4377693A (en) * | 1979-10-01 | 1983-03-22 | Monsanto Company | 2-Chloro-4,5-disubstituted-thiazoles useful as herbicidal safeners |
| US4284426A (en) * | 1979-10-01 | 1981-08-18 | Monsanto Company | 2-Chloro-4,5-disubstituted-thiazoles useful as herbicidal safeners |
| US4284784A (en) * | 1980-05-22 | 1981-08-18 | Merck & Co., Inc. | Process for the preparation of 4-methyl thiazole |
| SU943233A1 (ru) * | 1980-07-18 | 1982-07-15 | Ереванский государственный университет | @ -Роданвинилметилкетон в качестве мономера дл синтеза ионитов и полиэлектролитов и способ его получени |
| GB8705447D0 (en) * | 1987-03-09 | 1987-04-15 | Autopia Terakat Accessories Lt | Glass frail |
| US4822813A (en) * | 1987-03-11 | 1989-04-18 | Uniroyal Chemical Ltd./Uniroyal Chemical Ltee | 3-(2-Haloalkyl)-1,4-oxathiins and 2-(2-haloalkyl)-1,4-dithiins, and treatment of leukemia and tumors therewith |
| SE8900564D0 (sv) * | 1989-02-17 | 1989-02-17 | Astra Ab | Novel medicinal use |
| US5180833A (en) * | 1990-03-16 | 1993-01-19 | Takeda Chemical Industries, Ltd. | Process for the preparation of chlorothiazole derivatives |
| HU206198B (en) * | 1990-09-21 | 1992-09-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing rhodanidoisobutyric acid |
-
1992
- 1992-10-29 IS IS3937A patent/IS1688B/is unknown
- 1992-10-29 HR HR1125/92A patent/HRP921128B1/xx not_active IP Right Cessation
- 1992-10-29 IL IL103586A patent/IL103586A/xx not_active IP Right Cessation
- 1992-10-30 US US08/232,207 patent/US5648498A/en not_active Expired - Lifetime
- 1992-10-30 EP EP92118606A patent/EP0546306B1/en not_active Expired - Lifetime
- 1992-10-30 AU AU29123/92A patent/AU664868B2/en not_active Ceased
- 1992-10-30 CZ CZ941034A patent/CZ283402B6/cs not_active IP Right Cessation
- 1992-10-30 ES ES92923097T patent/ES2100365T3/es not_active Expired - Lifetime
- 1992-10-30 DK DK92923097.7T patent/DK0619815T3/da active
- 1992-10-30 WO PCT/HU1992/000042 patent/WO1993009107A1/en not_active Ceased
- 1992-10-30 AT AT92923097T patent/ATE151761T1/de not_active IP Right Cessation
- 1992-10-30 SI SI9200292A patent/SI9200292B/sl unknown
- 1992-10-30 PL PL92303342A patent/PL172013B1/pl unknown
- 1992-10-30 DE DE69219154T patent/DE69219154T2/de not_active Expired - Lifetime
- 1992-10-30 CA CA002121488A patent/CA2121488A1/en not_active Withdrawn
- 1992-10-30 KR KR1019940701422A patent/KR100218131B1/ko not_active Expired - Fee Related
- 1992-10-30 EP EP92923097A patent/EP0619815B1/en not_active Expired - Lifetime
- 1992-10-30 HU HU9401262A patent/HU217079B/hu not_active IP Right Cessation
- 1992-10-30 SK SK501-94A patent/SK279665B6/sk unknown
- 1992-10-30 JP JP50829893A patent/JP3190959B2/ja not_active Expired - Lifetime
-
1994
- 1994-04-28 NO NO940004A patent/NO304650B1/no not_active IP Right Cessation
- 1994-04-29 FI FI941996A patent/FI105476B/fi active
-
1995
- 1995-06-05 US US08/464,308 patent/US5534644A/en not_active Expired - Lifetime
-
1997
- 1997-06-19 GR GR970401480T patent/GR3023842T3/el unknown
- 1997-06-26 HK HK93397A patent/HK93397A/en not_active IP Right Cessation
-
1998
- 1998-04-16 LV LVP-98-68A patent/LV12130B/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI77457C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 5-substituerade oxazolidin-2,4-dionderivat samt mellanprodukter anvaendbara vid foerfarandet. | |
| US4174397A (en) | Thiazolidine derivatives | |
| HU201537B (en) | Process for producing 2-chloro-5-chloromethylthiazole | |
| US4061647A (en) | Thiazolidine derivatives | |
| HUP0104942A2 (hu) | Policiklusos tiazolidin-2-ilidén-aminok, eljárás a vegyületek előállítására és gyógyszerként történő alkalmazásuk | |
| HU217079B (hu) | Új eljárás 5-(2-klór-alkil)-tiazol-származékok előállítására | |
| FI61487B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 4-(3-sulfamoylfenyl)-4-hydroxi-1,3-tiatzolidin-derivat | |
| NO154132B (no) | Analogifremgangsm¨te til fremstilling av terapeutisk aktiv e tiazolinderivater. | |
| CZ2003522A3 (cs) | Kontinuální způsob přípravy pesticidních chlorthiazolů | |
| JP3042870B2 (ja) | イソチアゾリン―3―オン誘導体の製造方法 | |
| US6861522B2 (en) | Process for the manufacture of thiazole derivatives with pesticidal activity | |
| RU2103264C1 (ru) | Способ получения производных тиазола или их солей присоединения кислот, 5-хлор-3-тиоцианато-2-алканон и способ его получения | |
| HU198915B (en) | Process for producing new 2-thiazolidinone derivatives and pharmaceutical compositions containing them | |
| MC1135A1 (fr) | Derives de thiazine | |
| Forlani et al. | Intermediates in the halogenation of some 2-aminothiazoles | |
| US4118501A (en) | Thiazolidine derivatives | |
| Wang et al. | Quinazolines. IX. A Study of an Unusual Reaction of 5-Diazoacetyl-1, 3-dimethyl-2, 4-quinazolinedione1 | |
| HU198701B (en) | New process for producing halogeno-alkyl-thiazols condenzed with rings of benzene or pyridine | |
| KR790001861B1 (ko) | 티아졸리딘 유도체의 제조방법 | |
| JPH05286929A (ja) | 複素環式アルデヒドまたはケトンの製造方法 | |
| HU190660B (en) | Process for producing novel benzothiazole-2/3h/-on derivative | |
| JPH0667931B2 (ja) | テトラヒドロ―2h―インダゾール誘導体 | |
| JPH0667932B2 (ja) | 4,5,6,7―テトラヒドロ―2h―インダゾール誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |