CH273302A - Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. - Google Patents
Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes.Info
- Publication number
- CH273302A CH273302A CH273302DA CH273302A CH 273302 A CH273302 A CH 273302A CH 273302D A CH273302D A CH 273302DA CH 273302 A CH273302 A CH 273302A
- Authority
- CH
- Switzerland
- Prior art keywords
- chromium
- dye
- monoazo dye
- metal
- monoazo
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 8
- 229910052751 metal Inorganic materials 0.000 title claims description 6
- 239000002184 metal Substances 0.000 title claims description 6
- 239000000975 dye Substances 0.000 claims description 18
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 14
- 239000011651 chromium Substances 0.000 claims description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 9
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 229910052804 chromium Inorganic materials 0.000 claims description 8
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 210000002268 wool Anatomy 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims 1
- 230000001419 dependent effect Effects 0.000 claims 1
- 239000002253 acid Substances 0.000 description 7
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 229940032330 sulfuric acid Drugs 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001845 chromium compounds Chemical class 0.000 description 3
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical class [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QOWZHEWZFLTYQP-UHFFFAOYSA-K chromium(3+);triformate Chemical compound [Cr+3].[O-]C=O.[O-]C=O.[O-]C=O QOWZHEWZFLTYQP-UHFFFAOYSA-K 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910021563 chromium fluoride Inorganic materials 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- -1 monoazo carbate Chemical compound 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29D—PRODUCING PARTICULAR ARTICLES FROM PLASTICS OR FROM SUBSTANCES IN A PLASTIC STATE
- B29D30/00—Producing pneumatic or solid tyres or parts thereof
- B29D30/06—Pneumatic tyres or parts thereof (e.g. produced by casting, moulding, compression moulding, injection moulding, centrifugal casting)
- B29D30/52—Unvulcanised treads, e.g. on used tyres; Retreading
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/01—Complex metal compounds of azo dyes characterised by the method of metallisation
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH273298T | 1948-02-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH273302A true CH273302A (de) | 1951-01-31 |
Family
ID=25731441
Family Applications (10)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH273300D CH273300A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273302D CH273302A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273299D CH273299A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH270540D CH270540A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273298D CH273298A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273301D CH273301A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273297D CH273297A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273305D CH273305A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273303D CH273303A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH274425D CH274425A (de) | 1948-02-26 | 1948-12-24 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH273300D CH273300A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
Family Applications After (8)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH273299D CH273299A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH270540D CH270540A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273298D CH273298A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273301D CH273301A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273297D CH273297A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273305D CH273305A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH273303D CH273303A (de) | 1948-02-26 | 1948-02-26 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
| CH274425D CH274425A (de) | 1948-02-26 | 1948-12-24 | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. |
Country Status (5)
| Country | Link |
|---|---|
| AT (1) | AT166451B (h) |
| CH (10) | CH273300A (h) |
| DE (1) | DE848979C (h) |
| DK (1) | DK74309C (h) |
| NL (1) | NL69348C (h) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2599147A (en) * | 1948-02-26 | 1952-06-03 | Ciba Ltd | Chromiferous monoazo-dyestuffs |
| DE1016866B (de) * | 1955-04-01 | 1957-10-03 | Basf Ag | Verfahren zur Herstellung chromhaltiger o, o'-Dioxyazofarbstoffe |
| DE2855970A1 (de) * | 1978-12-23 | 1980-07-10 | Hoechst Ag | Verfahren zur herstellung von 2,5-dialkoxy-anilin-4-sulfonsaeuren |
| CN107345081A (zh) * | 2017-07-24 | 2017-11-14 | 北京泛博清洁技术研究院有限公司 | 裘皮用可循环染色酸性红色染料化合物及其合成与应用方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE474997C (de) * | 1926-08-29 | 1929-04-15 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von komplexen Metallverbindungen von o-Oxyazofarbstoffen |
| DE617085C (de) * | 1932-06-05 | 1935-08-12 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von Azofarbstoffen |
-
1948
- 1948-02-26 CH CH273300D patent/CH273300A/de unknown
- 1948-02-26 CH CH273302D patent/CH273302A/de unknown
- 1948-02-26 CH CH273299D patent/CH273299A/de unknown
- 1948-02-26 CH CH270540D patent/CH270540A/de unknown
- 1948-02-26 CH CH273298D patent/CH273298A/de unknown
- 1948-02-26 CH CH273301D patent/CH273301A/de unknown
- 1948-02-26 CH CH273297D patent/CH273297A/de unknown
- 1948-02-26 CH CH273305D patent/CH273305A/de unknown
- 1948-02-26 CH CH273303D patent/CH273303A/de unknown
- 1948-12-24 CH CH274425D patent/CH274425A/de unknown
-
1949
- 1949-01-23 DE DE1949P0032243 patent/DE848979C/de not_active Expired
- 1949-01-27 DK DK28649A patent/DK74309C/da active
- 1949-01-31 AT AT166451D patent/AT166451B/de active
- 1949-02-23 NL NL145046A patent/NL69348C/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| CH273297A (de) | 1951-01-31 |
| CH274425A (de) | 1951-03-31 |
| AT166451B (de) | 1950-08-10 |
| CH270540A (de) | 1950-09-15 |
| CH273303A (de) | 1951-01-31 |
| CH273305A (de) | 1951-01-31 |
| CH273298A (de) | 1951-01-31 |
| CH273301A (de) | 1951-01-31 |
| DK74309C (da) | 1952-06-16 |
| CH273300A (de) | 1951-01-31 |
| CH273299A (de) | 1951-01-31 |
| DE848979C (de) | 1952-09-11 |
| NL69348C (h) | 1951-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH273302A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| DE658780C (de) | Verfahren zur Herstellung von Pyrenabkoemmlingen | |
| CH286358A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH286356A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| DE466961C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| CH282734A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH286354A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH286357A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| DE659840C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| CH286351A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH286352A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH286353A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH286355A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| DE913458C (de) | Verfahren zur Herstellung komplexer Chromverbindungen von Monoazofarbstoffen | |
| DE656380C (de) | Verfahren zur Herstellung von Leukoestern von Farbstoffen der Anthrachinonreihe | |
| DE557125C (de) | Verfahren zur Herstellung faerbender Umwandlungsprodukte von Azofarbstoffen | |
| CH273304A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| CH295300A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| CH312571A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes | |
| CH290297A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| CH306376A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. | |
| CH310248A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| CH267269A (de) | Verfahren zur Herstellung eines Azofarbstoffes. | |
| CH180269A (de) | Verfahren zur Darstellung eines aus einem Trisazofarbstoff erhaltenen, färbenden Reaktionsproduktes. | |
| CH312569A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes |