IL104824A - Heterobicyclic compounds and pharmaceutical compositions containing them - Google Patents
Heterobicyclic compounds and pharmaceutical compositions containing themInfo
- Publication number
- IL104824A IL104824A IL10482493A IL10482493A IL104824A IL 104824 A IL104824 A IL 104824A IL 10482493 A IL10482493 A IL 10482493A IL 10482493 A IL10482493 A IL 10482493A IL 104824 A IL104824 A IL 104824A
- Authority
- IL
- Israel
- Prior art keywords
- benzopyran
- oxo
- phenyl
- methyl
- piperazinyl
- Prior art date
Links
- 125000002618 bicyclic heterocycle group Chemical group 0.000 title claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 424
- 125000001424 substituent group Chemical group 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 20
- 239000000651 prodrug Substances 0.000 claims abstract description 12
- 229940002612 prodrug Drugs 0.000 claims abstract description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 11
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 8
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 3
- -1 hydroxymethylene group Chemical group 0.000 claims description 73
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 46
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 42
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 5
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 5
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- UUBJKHVFGWGJKX-UHFFFAOYSA-N hydrate tetrahydrochloride Chemical compound O.Cl.Cl.Cl.Cl UUBJKHVFGWGJKX-UHFFFAOYSA-N 0.000 claims description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000005277 alkyl imino group Chemical group 0.000 claims description 3
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 claims description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 2
- PLUMFQNYUVGHER-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate Chemical compound COC1=CC=CC=C1N1CCN(CCCOC(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 PLUMFQNYUVGHER-UHFFFAOYSA-N 0.000 claims 2
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 claims 1
- AIHBTWJKGJLMQK-UHFFFAOYSA-N 1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-(3-methyl-4-oxo-2-phenylchromen-8-yl)urea Chemical compound COC1=CC=CC=C1N1CCN(CCNC(=O)NC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 AIHBTWJKGJLMQK-UHFFFAOYSA-N 0.000 claims 1
- JNQNNKJQSLBPRU-UHFFFAOYSA-N 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-1-(3-methyl-4-oxo-2-phenylchromen-8-yl)urea Chemical compound COC1=CC=CC=C1N1CCN(CCCN(C(N)=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 JNQNNKJQSLBPRU-UHFFFAOYSA-N 0.000 claims 1
- VKFKZXYBWCJYEL-UHFFFAOYSA-N 2-(4-acetamidophenyl)-n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4h-chromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C=3OC(=C(C)CC=3C=CC=2)C=2C=CC(NC(C)=O)=CC=2)CC1 VKFKZXYBWCJYEL-UHFFFAOYSA-N 0.000 claims 1
- OTTBKKADQUBYBE-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4h-chromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C=3OC(=C(C)CC=3C=CC=2)C=2C=CC(O)=CC=2)CC1 OTTBKKADQUBYBE-UHFFFAOYSA-N 0.000 claims 1
- JUVOUCMSCDSJKT-UHFFFAOYSA-N 2-(4-methoxyphenyl)-n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxochromene-8-carboxamide Chemical compound C1=CC(OC)=CC=C1C1=C(C)C(=O)C2=CC=CC(C(=O)NCCCN3CCN(CC3)C=3C(=CC=CC=3)OC)=C2O1 JUVOUCMSCDSJKT-UHFFFAOYSA-N 0.000 claims 1
- WDCJTOYZECAXFV-UHFFFAOYSA-N 2-benzoyl-3-ethyl-n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-1-benzofuran-7-carboxamide Chemical compound C1=CC=C2C(CC)=C(C(=O)C=3C=CC=CC=3)OC2=C1C(=O)NCCCN(CC1)CCN1C1=CC=CC=C1OC WDCJTOYZECAXFV-UHFFFAOYSA-N 0.000 claims 1
- YCNHLYALQVNKLF-UHFFFAOYSA-N 2-cyclohexyl-n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxochromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(C4CCCCC4)O3)=O)C=CC=2)CC1 YCNHLYALQVNKLF-UHFFFAOYSA-N 0.000 claims 1
- ONWDJAVBRVVPJB-UHFFFAOYSA-N 3-[4-(2-chlorophenyl)piperazin-1-yl]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)OCCCN(CC1)CCN1C1=CC=CC=C1Cl ONWDJAVBRVVPJB-UHFFFAOYSA-N 0.000 claims 1
- YBBPHQCZDDELQR-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]-n-(3-methyl-4-oxo-2-phenylchromen-8-yl)propanamide Chemical compound COC1=CC=CC=C1N1CCN(CCC(=O)NC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 YBBPHQCZDDELQR-UHFFFAOYSA-N 0.000 claims 1
- PITPWFZWDVXSRM-UHFFFAOYSA-N 3-methyl-4-oxo-2-phenyl-n-[3-(4-phenylpiperidin-1-yl)propyl]chromene-8-carboxamide Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)NCCCN(CC1)CCC1C1=CC=CC=C1 PITPWFZWDVXSRM-UHFFFAOYSA-N 0.000 claims 1
- VQMKJJVRCUJKEZ-UHFFFAOYSA-N 3-methyl-4-oxo-2-phenyl-n-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]chromene-8-carboxamide Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)NCCCN(CC1)CCN1C1=NC=CC=N1 VQMKJJVRCUJKEZ-UHFFFAOYSA-N 0.000 claims 1
- AMUIEDQXJUZYCZ-UHFFFAOYSA-N 3-methyl-8-[2-[4-(2-methylphenyl)piperazin-1-yl]acetyl]-2-phenylchromen-4-one Chemical compound CC1=CC=CC=C1N1CCN(CC(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 AMUIEDQXJUZYCZ-UHFFFAOYSA-N 0.000 claims 1
- QDNHGZLDPJIVMR-UHFFFAOYSA-N 6-(methanesulfonamido)-n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=C(NS(C)(=O)=O)C=2)CC1 QDNHGZLDPJIVMR-UHFFFAOYSA-N 0.000 claims 1
- ZHNYUEGVRRIORY-UHFFFAOYSA-N 8-[2-[2-(2-ethoxyphenoxy)ethylamino]ethoxymethyl]-3-methyl-2-phenylchromen-4-one Chemical compound CCOC1=CC=CC=C1OCCNCCOCC1=CC=CC2=C1OC(C=1C=CC=CC=1)=C(C)C2=O ZHNYUEGVRRIORY-UHFFFAOYSA-N 0.000 claims 1
- ROIAXBYUMAEGHD-UHFFFAOYSA-N 8-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethoxymethyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCOCC=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 ROIAXBYUMAEGHD-UHFFFAOYSA-N 0.000 claims 1
- HZJHNFOSGZTPOE-UHFFFAOYSA-N 8-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCNC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 HZJHNFOSGZTPOE-UHFFFAOYSA-N 0.000 claims 1
- PFSGMIQTZYGVAX-UHFFFAOYSA-N 8-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylsulfanylmethyl]-3-methyl-2-phenylchromen-4-one;hydrochloride Chemical compound Cl.COC1=CC=CC=C1N1CCN(CCSCC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 PFSGMIQTZYGVAX-UHFFFAOYSA-N 0.000 claims 1
- UEVUYQDBNPGDNB-UHFFFAOYSA-N 8-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylsulfinylmethyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCS(=O)CC=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 UEVUYQDBNPGDNB-UHFFFAOYSA-N 0.000 claims 1
- TWVXROHAQOEUQA-UHFFFAOYSA-N 8-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylsulfonylmethyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCS(=O)(=O)CC=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 TWVXROHAQOEUQA-UHFFFAOYSA-N 0.000 claims 1
- TTWAZPUHJYFZBE-UHFFFAOYSA-N 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylsulfonyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCCS(=O)(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 TTWAZPUHJYFZBE-UHFFFAOYSA-N 0.000 claims 1
- LNGUSSHELAJOGC-UHFFFAOYSA-N 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butanoyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCCC(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 LNGUSSHELAJOGC-UHFFFAOYSA-N 0.000 claims 1
- OOUKKARFQUIEJY-UHFFFAOYSA-N 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylamino]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCCCNC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 OOUKKARFQUIEJY-UHFFFAOYSA-N 0.000 claims 1
- WBWMQLSFKCZZKH-UHFFFAOYSA-N 8-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl-methylamino]methyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCN(C)CC=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 WBWMQLSFKCZZKH-UHFFFAOYSA-N 0.000 claims 1
- OFJQVZWDPUFURL-UHFFFAOYSA-N [2-[4-[3-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]propyl]piperazin-1-yl]phenyl] acetate Chemical compound CC(=O)OC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 OFJQVZWDPUFURL-UHFFFAOYSA-N 0.000 claims 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims 1
- OEXBPTHVPRUTQB-UHFFFAOYSA-N n-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2-(4-oxo-2-phenylchromen-8-yl)acetamide Chemical compound COC1=CC=CC=C1N1CCN(CCNC(=O)CC=2C3=C(C(C=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 OEXBPTHVPRUTQB-UHFFFAOYSA-N 0.000 claims 1
- FWSZQMLRAZLIOL-UHFFFAOYSA-N n-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 FWSZQMLRAZLIOL-UHFFFAOYSA-N 0.000 claims 1
- YPDGPJDAJSYIFA-UHFFFAOYSA-N n-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methyl-4-oxo-2-phenylchromene-8-sulfonamide Chemical compound COC1=CC=CC=C1N1CCN(CCNS(=O)(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 YPDGPJDAJSYIFA-UHFFFAOYSA-N 0.000 claims 1
- MCLOMZZRMDQNQC-UHFFFAOYSA-N n-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-n,3-dimethyl-4-oxo-2-phenylchromene-8-sulfonamide Chemical compound COC1=CC=CC=C1N1CCN(CCN(C)S(=O)(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 MCLOMZZRMDQNQC-UHFFFAOYSA-N 0.000 claims 1
- GTQDOUPAZUUECE-UHFFFAOYSA-N n-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-n-[(3-methyl-4-oxo-2-phenylchromen-8-yl)methyl]acetamide Chemical compound COC1=CC=CC=C1N1CCN(CCN(CC=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)C(C)=O)CC1 GTQDOUPAZUUECE-UHFFFAOYSA-N 0.000 claims 1
- NUFZAKVXJKBCKH-UHFFFAOYSA-N n-[3-[4-(2-hydroxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)NCCCN(CC1)CCN1C1=CC=CC=C1O NUFZAKVXJKBCKH-UHFFFAOYSA-N 0.000 claims 1
- KSBGCFBIJRSOLC-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-(3-methyl-4-oxothiophen-2-yl)-4h-chromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C=3OC(=CCC=3C=CC=2)C=2SCC(=O)C=2C)CC1 KSBGCFBIJRSOLC-UHFFFAOYSA-N 0.000 claims 1
- PBSDQNKLWORARF-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-2-(4-methylphenyl)-4-oxochromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC(C)=CC=3)=O)C=CC=2)CC1 PBSDQNKLWORARF-UHFFFAOYSA-N 0.000 claims 1
- YCAOYABUUCKMON-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-2-(4-nitrophenyl)-4-oxochromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC(=CC=3)[N+]([O-])=O)=O)C=CC=2)CC1 YCAOYABUUCKMON-UHFFFAOYSA-N 0.000 claims 1
- GRXPZTBNFXKRSU-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-(trifluoromethyl)chromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(O3)C(F)(F)F)=O)C=CC=2)CC1 GRXPZTBNFXKRSU-UHFFFAOYSA-N 0.000 claims 1
- DUCNHKDCVVSJLG-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 DUCNHKDCVVSJLG-UHFFFAOYSA-N 0.000 claims 1
- CRDHCIIFWPLAMU-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-sulfonamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNS(=O)(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 CRDHCIIFWPLAMU-UHFFFAOYSA-N 0.000 claims 1
- NRWWPLYJZTZGKO-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-4-oxo-2-phenylthiochromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCNC(=O)C=2C3=C(C(C=C(S3)C=3C=CC=CC=3)=O)C=CC=2)CC1 NRWWPLYJZTZGKO-UHFFFAOYSA-N 0.000 claims 1
- UMHJUOKYLRNBCX-UHFFFAOYSA-N n-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-n-(3-methyl-4-oxo-2-phenylchromen-8-yl)acetamide Chemical compound COC1=CC=CC=C1N1CCN(CCCN(C(C)=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 UMHJUOKYLRNBCX-UHFFFAOYSA-N 0.000 claims 1
- IQTMRJWHZXBCTB-UHFFFAOYSA-N n-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)NCCCN(CC1)CCC1C(=O)C1=CC=C(F)C=C1 IQTMRJWHZXBCTB-UHFFFAOYSA-N 0.000 claims 1
- LPWBPYNLZMZUST-UHFFFAOYSA-N n-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound COC1=CC=CC=C1N1CCN(CCCCNC(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 LPWBPYNLZMZUST-UHFFFAOYSA-N 0.000 claims 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 claims 1
- 210000001635 urinary tract Anatomy 0.000 abstract description 6
- 150000001412 amines Chemical class 0.000 abstract description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 abstract description 2
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 abstract description 2
- 206010020772 Hypertension Diseases 0.000 abstract description 2
- 208000004403 Prostatic Hyperplasia Diseases 0.000 abstract description 2
- 125000005842 heteroatom Chemical group 0.000 abstract description 2
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical group C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 abstract 1
- 201000010099 disease Diseases 0.000 abstract 1
- 125000005647 linker group Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 417
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 313
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 306
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 296
- 239000000543 intermediate Substances 0.000 description 261
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 240
- 229910001868 water Inorganic materials 0.000 description 234
- 239000000243 solution Substances 0.000 description 191
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 188
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 173
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 163
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 146
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 146
- 239000002904 solvent Substances 0.000 description 131
- 239000000203 mixture Substances 0.000 description 130
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 129
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 115
- 238000006243 chemical reaction Methods 0.000 description 114
- 235000019439 ethyl acetate Nutrition 0.000 description 105
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 96
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 96
- 239000011541 reaction mixture Substances 0.000 description 77
- 238000000034 method Methods 0.000 description 75
- 229910052938 sodium sulfate Inorganic materials 0.000 description 73
- 235000011152 sodium sulphate Nutrition 0.000 description 73
- 238000010992 reflux Methods 0.000 description 72
- 238000003756 stirring Methods 0.000 description 72
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 71
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 69
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 67
- 239000000741 silica gel Substances 0.000 description 67
- 229910002027 silica gel Inorganic materials 0.000 description 67
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 66
- 239000002585 base Substances 0.000 description 61
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 54
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- 235000011167 hydrochloric acid Nutrition 0.000 description 49
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 45
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 45
- 238000002844 melting Methods 0.000 description 41
- 230000008018 melting Effects 0.000 description 41
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 40
- 238000003818 flash chromatography Methods 0.000 description 40
- 238000001704 evaporation Methods 0.000 description 39
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 38
- 239000012044 organic layer Substances 0.000 description 36
- 229910000027 potassium carbonate Inorganic materials 0.000 description 36
- 238000001816 cooling Methods 0.000 description 35
- 230000008020 evaporation Effects 0.000 description 34
- 238000000746 purification Methods 0.000 description 34
- 238000002425 crystallisation Methods 0.000 description 33
- 230000008025 crystallization Effects 0.000 description 33
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 32
- 229960000583 acetic acid Drugs 0.000 description 31
- 239000003208 petroleum Substances 0.000 description 31
- VNZLQLYBRIOLFZ-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCNCC1 VNZLQLYBRIOLFZ-UHFFFAOYSA-N 0.000 description 30
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 30
- 238000004440 column chromatography Methods 0.000 description 29
- 235000011054 acetic acid Nutrition 0.000 description 27
- 235000011181 potassium carbonates Nutrition 0.000 description 27
- 238000000967 suction filtration Methods 0.000 description 27
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 26
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 26
- 239000003586 protic polar solvent Substances 0.000 description 26
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 24
- 239000012074 organic phase Substances 0.000 description 24
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 20
- 238000001914 filtration Methods 0.000 description 20
- 238000010438 heat treatment Methods 0.000 description 20
- 239000002798 polar solvent Substances 0.000 description 20
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 20
- 239000007787 solid Substances 0.000 description 20
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 19
- 239000012043 crude product Substances 0.000 description 19
- 239000012279 sodium borohydride Substances 0.000 description 19
- 229910000033 sodium borohydride Inorganic materials 0.000 description 19
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 18
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 18
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical class OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 17
- 239000007858 starting material Substances 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 239000000010 aprotic solvent Substances 0.000 description 16
- 238000009835 boiling Methods 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 15
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 15
- 239000011780 sodium chloride Substances 0.000 description 15
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 14
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 14
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 14
- 101150041968 CDC13 gene Proteins 0.000 description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 13
- 125000003118 aryl group Chemical group 0.000 description 13
- 235000011149 sulphuric acid Nutrition 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 13
- GPFVBEXADULZAD-UHFFFAOYSA-N 3-methyl-4-oxo-2-phenylchromene-8-carbonyl chloride Chemical compound O1C2=C(C(Cl)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 GPFVBEXADULZAD-UHFFFAOYSA-N 0.000 description 12
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 12
- 230000009467 reduction Effects 0.000 description 12
- 229910000104 sodium hydride Inorganic materials 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 11
- 238000007363 ring formation reaction Methods 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 11
- 239000002841 Lewis acid Substances 0.000 description 10
- 244000309464 bull Species 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 102000005962 receptors Human genes 0.000 description 10
- 108020003175 receptors Proteins 0.000 description 10
- 238000005406 washing Methods 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 230000002378 acidificating effect Effects 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 150000007517 lewis acids Chemical class 0.000 description 9
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 9
- 229920000137 polyphosphoric acid Polymers 0.000 description 9
- 235000015320 potassium carbonate Nutrition 0.000 description 9
- 235000017557 sodium bicarbonate Nutrition 0.000 description 9
- 239000001117 sulphuric acid Substances 0.000 description 9
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 8
- AECRGCYUBPXQBU-UHFFFAOYSA-N 8-amino-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(N)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 AECRGCYUBPXQBU-UHFFFAOYSA-N 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- 238000005481 NMR spectroscopy Methods 0.000 description 8
- GAMYVSCDDLXAQW-AOIWZFSPSA-N Thermopsosid Natural products O(C)c1c(O)ccc(C=2Oc3c(c(O)cc(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O4)c3)C(=O)C=2)c1 GAMYVSCDDLXAQW-AOIWZFSPSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 8
- 238000000605 extraction Methods 0.000 description 8
- 229930003944 flavone Natural products 0.000 description 8
- 235000011949 flavones Nutrition 0.000 description 8
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 8
- VHBFFQKBGNRLFZ-UHFFFAOYSA-N vitamin p Natural products O1C2=CC=CC=C2C(=O)C=C1C1=CC=CC=C1 VHBFFQKBGNRLFZ-UHFFFAOYSA-N 0.000 description 8
- 239000011592 zinc chloride Substances 0.000 description 8
- 235000005074 zinc chloride Nutrition 0.000 description 8
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 7
- PFFBVVXRQFBACM-UHFFFAOYSA-N 3-methyl-4-oxo-2-phenylchromene-8-carbaldehyde Chemical compound O1C2=C(C=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 PFFBVVXRQFBACM-UHFFFAOYSA-N 0.000 description 7
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 7
- 150000002212 flavone derivatives Chemical class 0.000 description 7
- 235000019256 formaldehyde Nutrition 0.000 description 7
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000012258 stirred mixture Substances 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- WEMCZZDLULONHY-UHFFFAOYSA-N ethyl 2-hydroxy-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1O WEMCZZDLULONHY-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000011701 zinc Substances 0.000 description 6
- MUSOMUXTQGJZKD-UHFFFAOYSA-N 1-(2-chloroethyl)-4-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCN(CCCl)CC1 MUSOMUXTQGJZKD-UHFFFAOYSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 230000037361 pathway Effects 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- ONJRTQUWKRDCTA-UHFFFAOYSA-N 2h-thiochromene Chemical compound C1=CC=C2C=CCSC2=C1 ONJRTQUWKRDCTA-UHFFFAOYSA-N 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 4
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical compound S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 4
- SPIUTQOUKAMGCX-UHFFFAOYSA-N flavoxate Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)OCCN1CCCCC1 SPIUTQOUKAMGCX-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 150000002391 heterocyclic compounds Chemical class 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 230000009466 transformation Effects 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- OIZBMQFOSPOOIS-UHFFFAOYSA-N 1-(3-chloropropyl)-4-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCN(CCCCl)CC1 OIZBMQFOSPOOIS-UHFFFAOYSA-N 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 3
- OVGGXHMQXIQOBR-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine Chemical compound COC1=CC=CC=C1N1CCN(CCCN)CC1 OVGGXHMQXIQOBR-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- 239000004342 Benzoyl peroxide Substances 0.000 description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000001562 benzopyrans Chemical group 0.000 description 3
- 229960003328 benzoyl peroxide Drugs 0.000 description 3
- 235000019400 benzoyl peroxide Nutrition 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Substances Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229960000855 flavoxate Drugs 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- 231100000053 low toxicity Toxicity 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 235000011150 stannous chloride Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 3
- OTXJEUQUKNCKPS-UHFFFAOYSA-N (3-methyl-4-oxo-2-phenylchromen-8-yl)methyl carbamimidothioate Chemical compound O1C2=C(CSC(N)=N)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 OTXJEUQUKNCKPS-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2,2'-azo-bis-isobutyronitrile Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 2
- ROCQBXNHIFPJMQ-UHFFFAOYSA-N 2-(2-bromoethoxy)-1,3-dimethoxybenzene Chemical compound COC1=CC=CC(OC)=C1OCCBr ROCQBXNHIFPJMQ-UHFFFAOYSA-N 0.000 description 2
- SOOARYARZPXNAL-UHFFFAOYSA-N 2-(Methylthio)phenol Chemical compound CSC1=CC=CC=C1O SOOARYARZPXNAL-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- BNKPFZVIJZNDLZ-UHFFFAOYSA-N 2-hydroxy-3-propanoylbenzoic acid Chemical compound CCC(=O)C1=CC=CC(C(O)=O)=C1O BNKPFZVIJZNDLZ-UHFFFAOYSA-N 0.000 description 2
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 2
- KMMBBZOSQNLLMN-UHFFFAOYSA-N 3-methylflavone-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 KMMBBZOSQNLLMN-UHFFFAOYSA-N 0.000 description 2
- UFJPFLDFMPVGRW-UHFFFAOYSA-N 4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-amine Chemical compound COC1=CC=CC=C1N1CCN(CCCCN)CC1 UFJPFLDFMPVGRW-UHFFFAOYSA-N 0.000 description 2
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 229910003074 TiCl4 Inorganic materials 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- NNTOJPXOCKCMKR-UHFFFAOYSA-N boron;pyridine Chemical compound [B].C1=CC=NC=C1 NNTOJPXOCKCMKR-UHFFFAOYSA-N 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 150000007942 carboxylates Chemical group 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- KTRFZWJCHOQHMN-UHFFFAOYSA-N chloromethanethioic s-acid Chemical compound SC(Cl)=O KTRFZWJCHOQHMN-UHFFFAOYSA-N 0.000 description 2
- 239000007822 coupling agent Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000001212 derivatisation Methods 0.000 description 2
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229940093476 ethylene glycol Drugs 0.000 description 2
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 2
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- YUIMWZDRXNUGMO-UHFFFAOYSA-N methyl 4-oxo-2-phenylthiochromene-8-carboxylate Chemical compound COC(=O)C1=CC=CC(C(C=2)=O)=C1SC=2C1=CC=CC=C1 YUIMWZDRXNUGMO-UHFFFAOYSA-N 0.000 description 2
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- 230000027939 micturition Effects 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 229940076279 serotonin Drugs 0.000 description 2
- 230000002295 serotoninergic effect Effects 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 210000003932 urinary bladder Anatomy 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- ZMJROFABTGTBHD-UHFFFAOYSA-N (2-ethoxycarbonyl-6-propanoylphenyl) thiophene-2-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C1=CC=CS1 ZMJROFABTGTBHD-UHFFFAOYSA-N 0.000 description 1
- VQTYZZPDAFGNCK-UHFFFAOYSA-N (2-methyl-1-piperidin-1-ylpropan-2-yl) 3-methyl-4-oxo-2-phenylchromene-8-carboxylate Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)OC(C)(C)CN1CCCCC1 VQTYZZPDAFGNCK-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- QCSZDAARWAAPHR-UHFFFAOYSA-N (3-methyl-4-oxo-2-phenylchromen-8-yl)methanesulfonyl chloride Chemical compound O1C2=C(CS(Cl)(=O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 QCSZDAARWAAPHR-UHFFFAOYSA-N 0.000 description 1
- ABERUOJGWHYBJL-UHFFFAOYSA-N (4-fluorophenyl)-piperidin-4-ylmethanone Chemical compound C1=CC(F)=CC=C1C(=O)C1CCNCC1 ABERUOJGWHYBJL-UHFFFAOYSA-N 0.000 description 1
- PYHRZPFZZDCOPH-QXGOIDDHSA-N (S)-amphetamine sulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.C[C@H](N)CC1=CC=CC=C1.C[C@H](N)CC1=CC=CC=C1 PYHRZPFZZDCOPH-QXGOIDDHSA-N 0.000 description 1
- KHIRUDOKZKVYIK-ZHACJKMWSA-N (e)-3-(3-methyl-4-oxo-2-phenylchromen-8-yl)prop-2-enoic acid Chemical compound O1C2=C(\C=C\C(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 KHIRUDOKZKVYIK-ZHACJKMWSA-N 0.000 description 1
- HIFPBFTYXVCJGH-ZHACJKMWSA-N (e)-3-(3-methyl-4-oxo-2-phenylchromen-8-yl)prop-2-enoyl chloride Chemical compound O1C2=C(\C=C\C(Cl)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 HIFPBFTYXVCJGH-ZHACJKMWSA-N 0.000 description 1
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- CFTRKGCBMZSAED-UHFFFAOYSA-N 1-(2,2-diethoxyethylsulfanyl)-2-methylbenzene Chemical compound CCOC(OCC)CSC1=CC=CC=C1C CFTRKGCBMZSAED-UHFFFAOYSA-N 0.000 description 1
- MRBFGEHILMYPTF-UHFFFAOYSA-N 1-(2-Pyrimidyl)piperazine Chemical compound C1CNCCN1C1=NC=CC=N1 MRBFGEHILMYPTF-UHFFFAOYSA-N 0.000 description 1
- ZGFSYINSKCEXHH-UHFFFAOYSA-N 1-(2-chloroethyl)-3-(3-methyl-4-oxo-2-phenylchromen-8-yl)urea Chemical compound O1C2=C(NC(=O)NCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 ZGFSYINSKCEXHH-UHFFFAOYSA-N 0.000 description 1
- YLNQEJCSJJTNQK-UHFFFAOYSA-N 1-(2-chloroethylsulfanyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1SCCCl YLNQEJCSJJTNQK-UHFFFAOYSA-N 0.000 description 1
- GUTWDZXWTKMXPI-UHFFFAOYSA-N 1-(2-chlorophenyl)piperazin-4-ium;chloride Chemical compound Cl.ClC1=CC=CC=C1N1CCNCC1 GUTWDZXWTKMXPI-UHFFFAOYSA-N 0.000 description 1
- DDMVHGULHRJOEC-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazin-1-ium;chloride Chemical compound Cl.COC1=CC=CC=C1N1CCNCC1 DDMVHGULHRJOEC-UHFFFAOYSA-N 0.000 description 1
- WICKLEOONJPMEQ-UHFFFAOYSA-N 1-(2-methylphenyl)piperazine Chemical compound CC1=CC=CC=C1N1CCNCC1 WICKLEOONJPMEQ-UHFFFAOYSA-N 0.000 description 1
- UKIFGNQFSBXGCF-UHFFFAOYSA-N 1-(3-chloropropoxy)-2-methoxybenzene Chemical compound COC1=CC=CC=C1OCCCCl UKIFGNQFSBXGCF-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- WXMQDCRVBPMUBV-UHFFFAOYSA-N 1-anilinopropan-1-ol Chemical class CCC(O)NC1=CC=CC=C1 WXMQDCRVBPMUBV-UHFFFAOYSA-N 0.000 description 1
- NIDSRGCVYOEDFW-UHFFFAOYSA-N 1-bromo-4-chlorobutane Chemical compound ClCCCCBr NIDSRGCVYOEDFW-UHFFFAOYSA-N 0.000 description 1
- BCMYXYHEMGPZJN-UHFFFAOYSA-N 1-chloro-2-isocyanatoethane Chemical compound ClCCN=C=O BCMYXYHEMGPZJN-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- WXOCMYPFQNKWMB-UHFFFAOYSA-N 2,2,2-trifluoro-n-(3-methyl-4-oxo-2-phenylchromen-8-yl)acetamide Chemical compound O1C2=C(NC(=O)C(F)(F)F)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 WXOCMYPFQNKWMB-UHFFFAOYSA-N 0.000 description 1
- DVDHFUKIABYMND-UHFFFAOYSA-N 2,2,2-trifluoro-n-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-n-methylacetamide Chemical compound COC1=CC=CC=C1N1CCN(CCCCN(C)C(=O)C(F)(F)F)CC1 DVDHFUKIABYMND-UHFFFAOYSA-N 0.000 description 1
- QLXMYSVUQIFCJC-UHFFFAOYSA-N 2,2,2-trifluoro-n-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]acetamide Chemical compound COC1=CC=CC=C1N1CCN(CCCCNC(=O)C(F)(F)F)CC1 QLXMYSVUQIFCJC-UHFFFAOYSA-N 0.000 description 1
- NDBBSDFKFGLWIL-UHFFFAOYSA-N 2,2,2-trifluoro-n-methyl-n-(3-methyl-4-oxo-2-phenylchromen-8-yl)acetamide Chemical compound FC(F)(F)C(=O)N(C)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 NDBBSDFKFGLWIL-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 1
- OTGAYUCEDFKLHW-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-3-ylmethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC2=CC=CC=C2OC1 OTGAYUCEDFKLHW-UHFFFAOYSA-N 0.000 description 1
- OOKCBENPEIHOJG-UHFFFAOYSA-N 2-(2-ethoxyphenoxy)ethanamine Chemical compound CCOC1=CC=CC=C1OCCN OOKCBENPEIHOJG-UHFFFAOYSA-N 0.000 description 1
- CKJRKLKVCHMWLV-UHFFFAOYSA-N 2-(2-methoxyphenoxy)ethanamine Chemical compound COC1=CC=CC=C1OCCN CKJRKLKVCHMWLV-UHFFFAOYSA-N 0.000 description 1
- RZNHYZIKLBDXFL-UHFFFAOYSA-N 2-(2-methylphenyl)sulfanylacetaldehyde Chemical compound CC1=CC=CC=C1SCC=O RZNHYZIKLBDXFL-UHFFFAOYSA-N 0.000 description 1
- XKFXYEGHYIEBPG-UHFFFAOYSA-N 2-(2-methylphenyl)sulfanylethanol Chemical compound CC1=CC=CC=C1SCCO XKFXYEGHYIEBPG-UHFFFAOYSA-N 0.000 description 1
- ZBPUNVFDQXYNDY-UHFFFAOYSA-N 2-(3-chloropropyl)-1,3-dioxolane Chemical compound ClCCCC1OCCO1 ZBPUNVFDQXYNDY-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- KYDJUPYKCCFBTB-UHFFFAOYSA-N 2-(3-methyl-4-oxo-2-phenylchromen-8-yl)acetic acid Chemical compound O1C2=C(CC(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 KYDJUPYKCCFBTB-UHFFFAOYSA-N 0.000 description 1
- OLUBPSFSFRZWGK-UHFFFAOYSA-N 2-(4-benzoylphenyl)-3-methyl-4-oxochromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C(C=C1)=CC=C1C(=O)C1=CC=CC=C1 OLUBPSFSFRZWGK-UHFFFAOYSA-N 0.000 description 1
- DCNPRASTLOYJDV-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-methyl-4-oxochromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=C(F)C=C1 DCNPRASTLOYJDV-UHFFFAOYSA-N 0.000 description 1
- RIAFRDBEMVUDGW-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-3-methyl-4-oxochromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=C(O)C=C1 RIAFRDBEMVUDGW-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NDVVQPVEUGLAPX-UHFFFAOYSA-N 2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanamine Chemical compound COC1=CC=CC=C1N1CCN(CCN)CC1 NDVVQPVEUGLAPX-UHFFFAOYSA-N 0.000 description 1
- SZEGYGGEXYACHX-UHFFFAOYSA-N 2-[methyl-(3-methyl-4-oxo-2-phenylchromen-8-yl)sulfonylamino]ethyl 4-methylbenzenesulfonate Chemical compound C=1C=CC(C(C(C)=C(C=2C=CC=CC=2)O2)=O)=C2C=1S(=O)(=O)N(C)CCOS(=O)(=O)C1=CC=C(C)C=C1 SZEGYGGEXYACHX-UHFFFAOYSA-N 0.000 description 1
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 1
- RCZVJASMLCGXQO-UHFFFAOYSA-N 2-chloro-n-methyl-n-[(3-methyl-4-oxo-2-phenylchromen-8-yl)methyl]acetamide Chemical compound ClCC(=O)N(C)CC1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 RCZVJASMLCGXQO-UHFFFAOYSA-N 0.000 description 1
- VHCSBTPOPKFYIU-UHFFFAOYSA-N 2-chloroethanesulfonyl chloride Chemical compound ClCCS(Cl)(=O)=O VHCSBTPOPKFYIU-UHFFFAOYSA-N 0.000 description 1
- NCXQTNBHJRSRJD-UHFFFAOYSA-N 2-hydroxy-5-nitro-3-propanoylbenzoic acid Chemical compound CCC(=O)C1=CC([N+]([O-])=O)=CC(C(O)=O)=C1O NCXQTNBHJRSRJD-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- MDRKZASMSSBJBO-UHFFFAOYSA-N 2-tert-butyl-3-methyl-4-oxochromene-8-carboxylic acid Chemical compound C1=CC=C2C(=O)C(C)=C(C(C)(C)C)OC2=C1C(O)=O MDRKZASMSSBJBO-UHFFFAOYSA-N 0.000 description 1
- HMXJOWDZAJWLTF-UHFFFAOYSA-N 2h-chromene-2-carboxylic acid Chemical class C1=CC=C2C=CC(C(=O)O)OC2=C1 HMXJOWDZAJWLTF-UHFFFAOYSA-N 0.000 description 1
- JGYVHBXLANTDMO-UHFFFAOYSA-N 3-(2-methoxyphenoxy)propan-1-amine Chemical compound COC1=CC=CC=C1OCCCN JGYVHBXLANTDMO-UHFFFAOYSA-N 0.000 description 1
- DKFROYPQEDVABD-UHFFFAOYSA-N 3-(hydroxymethyl)-4-oxo-2-phenylchromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(CO)=C1C1=CC=CC=C1 DKFROYPQEDVABD-UHFFFAOYSA-N 0.000 description 1
- VGZSGNGIFNROHX-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]-2,2-dimethylpropan-1-amine Chemical compound COC1=CC=CC=C1N1CCN(CC(C)(C)CN)CC1 VGZSGNGIFNROHX-UHFFFAOYSA-N 0.000 description 1
- QXCXIRKAOASCBO-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]-2,2-dimethylpropanal Chemical compound COC1=CC=CC=C1N1CCN(CC(C)(C)C=O)CC1 QXCXIRKAOASCBO-UHFFFAOYSA-N 0.000 description 1
- RSRUCDFWUAEYEU-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;dihydrochloride Chemical compound Cl.Cl.COC1=CC=CC=C1N1CCN(CCCOC(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 RSRUCDFWUAEYEU-UHFFFAOYSA-N 0.000 description 1
- TVYRJQXMQNZLNO-UHFFFAOYSA-N 3-acetyl-2-hydroxybenzoic acid Chemical compound CC(=O)C1=CC=CC(C(O)=O)=C1O TVYRJQXMQNZLNO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- PCDJHJZQHWVTQD-UHFFFAOYSA-N 3-methyl-2-(4-methylphenyl)-4-oxochromene-8-carboxylic acid Chemical compound C1=CC(C)=CC=C1C1=C(C)C(=O)C2=CC=CC(C(O)=O)=C2O1 PCDJHJZQHWVTQD-UHFFFAOYSA-N 0.000 description 1
- LEOYTYBMBCHUEH-UHFFFAOYSA-N 3-methyl-2-phenyl-8-sulfanylchromen-4-one Chemical compound O1C2=C(S)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 LEOYTYBMBCHUEH-UHFFFAOYSA-N 0.000 description 1
- GJZUZCGURONHAJ-UHFFFAOYSA-N 3-methyl-4-oxo-2-(4-phenoxyphenyl)chromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C(C=C1)=CC=C1OC1=CC=CC=C1 GJZUZCGURONHAJ-UHFFFAOYSA-N 0.000 description 1
- XIBYEFNFXSXHJP-ZHACJKMWSA-N 3-methyl-4-oxo-2-[(e)-2-phenylethenyl]chromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1\C=C\C1=CC=CC=C1 XIBYEFNFXSXHJP-ZHACJKMWSA-N 0.000 description 1
- MKBUTOMQYDNUON-UHFFFAOYSA-N 3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound O1C2=C(C(N)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 MKBUTOMQYDNUON-UHFFFAOYSA-N 0.000 description 1
- VFGSIUUJUAKBIS-UHFFFAOYSA-N 3-methyl-4-oxo-2-phenylchromene-8-sulfonyl chloride Chemical compound O1C2=C(S(Cl)(=O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 VFGSIUUJUAKBIS-UHFFFAOYSA-N 0.000 description 1
- HNSPZGPQEAIHNV-UHFFFAOYSA-N 3-methyl-4-oxo-2-thiophen-2-ylchromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CS1 HNSPZGPQEAIHNV-UHFFFAOYSA-N 0.000 description 1
- JUXHWXSCFVJNBO-UHFFFAOYSA-N 3-methyl-4-oxo-n-[3-[4-(2-oxo-3h-benzimidazol-1-yl)piperidin-1-yl]propyl]-2-phenylchromene-8-carboxamide Chemical compound O1C2=C(C(=O)NCCCN3CCC(CC3)N3C(NC4=CC=CC=C43)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 JUXHWXSCFVJNBO-UHFFFAOYSA-N 0.000 description 1
- JSTJHPZLFGAHJW-UHFFFAOYSA-N 3-methyl-6-nitro-4-oxo-2-phenylchromene-8-carbonyl chloride Chemical compound O1C2=C(C(Cl)=O)C=C([N+]([O-])=O)C=C2C(=O)C(C)=C1C1=CC=CC=C1 JSTJHPZLFGAHJW-UHFFFAOYSA-N 0.000 description 1
- XZRASZGEMDJHPL-UHFFFAOYSA-N 3-methyl-6-nitro-4-oxo-2-phenylchromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=C([N+]([O-])=O)C=C2C(=O)C(C)=C1C1=CC=CC=C1 XZRASZGEMDJHPL-UHFFFAOYSA-N 0.000 description 1
- VEJXEPSOOWFEQF-UHFFFAOYSA-N 3-methyl-8-(methylamino)-2-phenylchromen-4-one Chemical compound CNC1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 VEJXEPSOOWFEQF-UHFFFAOYSA-N 0.000 description 1
- SCPIAZNQDNSMJP-UHFFFAOYSA-N 3-methyl-8-(methylaminomethyl)-2-phenylchromen-4-one Chemical compound CNCC1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 SCPIAZNQDNSMJP-UHFFFAOYSA-N 0.000 description 1
- CXWSANLKPOWREJ-UHFFFAOYSA-N 3-methyl-8-[2-[4-(2-methylphenyl)piperazin-1-yl]acetyl]-2-phenylchromen-4-one;hydrochloride Chemical compound Cl.CC1=CC=CC=C1N1CCN(CC(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 CXWSANLKPOWREJ-UHFFFAOYSA-N 0.000 description 1
- LGPGLGMTWCKPJJ-UHFFFAOYSA-N 3-methyl-n-[4-[(2-methylpropan-2-yl)oxyamino]-4-oxobutyl]-4-oxo-2-phenylchromene-8-carboxamide Chemical compound O1C2=C(C(=O)NCCCC(=O)NOC(C)(C)C)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 LGPGLGMTWCKPJJ-UHFFFAOYSA-N 0.000 description 1
- BYNBAMHAURJNTR-UHFFFAOYSA-N 3-piperidin-4-yl-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1C1CCNCC1 BYNBAMHAURJNTR-UHFFFAOYSA-N 0.000 description 1
- BTVVEKSXUOEVAY-UHFFFAOYSA-N 4,4-diphenylpiperidine Chemical compound C1CNCCC1(C=1C=CC=CC=1)C1=CC=CC=C1 BTVVEKSXUOEVAY-UHFFFAOYSA-N 0.000 description 1
- LJZBGFOFUHTZMH-UHFFFAOYSA-N 4-(3-methyl-4-oxo-2-phenylchromen-8-yl)-4-oxobutanoic acid Chemical compound O1C2=C(C(=O)CCC(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 LJZBGFOFUHTZMH-UHFFFAOYSA-N 0.000 description 1
- RLPUCOGGXWIZIW-UHFFFAOYSA-N 4-(3-methyl-4-oxo-2-phenylchromen-8-yl)butanal Chemical compound O1C2=C(CCCC=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 RLPUCOGGXWIZIW-UHFFFAOYSA-N 0.000 description 1
- AKDJAYHFVPHPOI-UHFFFAOYSA-N 4-amino-n-[(2-methylpropan-2-yl)oxy]butanamide Chemical compound CC(C)(C)ONC(=O)CCCN AKDJAYHFVPHPOI-UHFFFAOYSA-N 0.000 description 1
- OZCULFZQSHFJNI-UHFFFAOYSA-N 4-benzoylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C(=O)C1=CC=CC=C1 OZCULFZQSHFJNI-UHFFFAOYSA-N 0.000 description 1
- IKTNWWVLKHUQGL-UHFFFAOYSA-N 4-chloro-n-(3-methyl-4-oxo-2-phenylchromen-8-yl)butanamide Chemical compound O1C2=C(NC(=O)CCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 IKTNWWVLKHUQGL-UHFFFAOYSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- UWWFTNNDTBZWRD-UHFFFAOYSA-N 4-oxo-2-phenylthiochromene-8-carboxylic acid Chemical compound OC(=O)C1=CC=CC(C(C=2)=O)=C1SC=2C1=CC=CC=C1 UWWFTNNDTBZWRD-UHFFFAOYSA-N 0.000 description 1
- KTHHDZVGZNVCOE-UHFFFAOYSA-N 4-oxo-3-phenylchromene-8-carbaldehyde Chemical compound O=CC1=CC=CC(C2=O)=C1OC=C2C1=CC=CC=C1 KTHHDZVGZNVCOE-UHFFFAOYSA-N 0.000 description 1
- VZTQNMQYYOIJAB-UHFFFAOYSA-N 4-oxo-3-phenylchromene-8-carbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C2=O)=C1OC=C2C1=CC=CC=C1 VZTQNMQYYOIJAB-UHFFFAOYSA-N 0.000 description 1
- OLJXMAJPVRIDNZ-UHFFFAOYSA-N 4-oxo-3-phenylchromene-8-carboxylic acid Chemical compound OC(=O)C1=CC=CC(C2=O)=C1OC=C2C1=CC=CC=C1 OLJXMAJPVRIDNZ-UHFFFAOYSA-N 0.000 description 1
- SGOLZFYWLCQQEW-UHFFFAOYSA-N 4-oxochromene-8-carboxylic acid Chemical compound O1C=CC(=O)C2=C1C(C(=O)O)=CC=C2 SGOLZFYWLCQQEW-UHFFFAOYSA-N 0.000 description 1
- AOOZVQGGMFGGEE-UHFFFAOYSA-N 4-phenoxybenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1OC1=CC=CC=C1 AOOZVQGGMFGGEE-UHFFFAOYSA-N 0.000 description 1
- JPVUWCPKMYXOKW-UHFFFAOYSA-N 4-phenylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=CC=CC=C1 JPVUWCPKMYXOKW-UHFFFAOYSA-N 0.000 description 1
- UTBULQCHEUWJNV-UHFFFAOYSA-N 4-phenylpiperidine Chemical compound C1CNCCC1C1=CC=CC=C1 UTBULQCHEUWJNV-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- JSNWZIONBZGCQB-UHFFFAOYSA-N 6-hydroxy-3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=C(O)C=C2C(=O)C(C)=C1C1=CC=CC=C1 JSNWZIONBZGCQB-UHFFFAOYSA-N 0.000 description 1
- KLBMQTSRUOUVOW-UHFFFAOYSA-N 6-methoxy-3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid Chemical compound CC=1C(=O)C2=CC(OC)=CC(C(O)=O)=C2OC=1C1=CC=CC=C1 KLBMQTSRUOUVOW-UHFFFAOYSA-N 0.000 description 1
- ZMPRIFFHZKYWRG-UHFFFAOYSA-N 7-methoxy-3-methyl-4-oxo-2-phenylchromene-8-carbaldehyde Chemical compound O=CC=1C(OC)=CC=C(C(C=2C)=O)C=1OC=2C1=CC=CC=C1 ZMPRIFFHZKYWRG-UHFFFAOYSA-N 0.000 description 1
- UTQVGSBXGWOWIE-UHFFFAOYSA-N 7-methoxy-3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid Chemical compound OC(=O)C=1C(OC)=CC=C(C(C=2C)=O)C=1OC=2C1=CC=CC=C1 UTQVGSBXGWOWIE-UHFFFAOYSA-N 0.000 description 1
- QBKAUSMORKYDFO-UHFFFAOYSA-N 8-(1,4-dihydroxybutyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(C(O)CCCO)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 QBKAUSMORKYDFO-UHFFFAOYSA-N 0.000 description 1
- AQANSGZENKMQNT-UHFFFAOYSA-N 8-(2-bromoacetyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(C(=O)CBr)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 AQANSGZENKMQNT-UHFFFAOYSA-N 0.000 description 1
- KEYVDSDWLDIYKS-UHFFFAOYSA-N 8-(2-chloroethoxymethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(COCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 KEYVDSDWLDIYKS-UHFFFAOYSA-N 0.000 description 1
- ZAGRFIUFTGGJIJ-UHFFFAOYSA-N 8-(2-chloroethylsulfanylmethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(CSCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 ZAGRFIUFTGGJIJ-UHFFFAOYSA-N 0.000 description 1
- IDNURRBODMAKDD-UHFFFAOYSA-N 8-(2-chloroethylsulfinylmethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(CS(=O)CCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 IDNURRBODMAKDD-UHFFFAOYSA-N 0.000 description 1
- BYDPDLJDCRXHRI-UHFFFAOYSA-N 8-(2-chloroethylsulfonylmethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(CS(=O)(=O)CCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 BYDPDLJDCRXHRI-UHFFFAOYSA-N 0.000 description 1
- MXEFLTNOJZYEMA-UHFFFAOYSA-N 8-(2-hydroxyethoxymethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(COCCO)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 MXEFLTNOJZYEMA-UHFFFAOYSA-N 0.000 description 1
- RYRQQGXXJHGZAO-UHFFFAOYSA-N 8-(3-chloropropylsulfanyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(SCCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 RYRQQGXXJHGZAO-UHFFFAOYSA-N 0.000 description 1
- ODXHBPOSVIDZLL-UHFFFAOYSA-N 8-(3-chloropropylsulfonyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(S(=O)(=O)CCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 ODXHBPOSVIDZLL-UHFFFAOYSA-N 0.000 description 1
- JRBYQSOISKCWIQ-UHFFFAOYSA-N 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one Chemical compound COC(OC)CCCC1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 JRBYQSOISKCWIQ-UHFFFAOYSA-N 0.000 description 1
- LBFRNMMTAISPJT-UHFFFAOYSA-N 8-(4-chlorobutylsulfinyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(S(=O)CCCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 LBFRNMMTAISPJT-UHFFFAOYSA-N 0.000 description 1
- XEEWBQOUXXOAIX-UHFFFAOYSA-N 8-(4-chlorobutylsulfonyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(S(=O)(=O)CCCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 XEEWBQOUXXOAIX-UHFFFAOYSA-N 0.000 description 1
- PCORNRVEBXHOPW-UHFFFAOYSA-N 8-(4-hydroxybut-1-enyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(C=CCCO)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 PCORNRVEBXHOPW-UHFFFAOYSA-N 0.000 description 1
- FLZSFGAYXHJKQH-UHFFFAOYSA-N 8-(aminomethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(CN)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 FLZSFGAYXHJKQH-UHFFFAOYSA-N 0.000 description 1
- FCAGDICYOQTQNU-UHFFFAOYSA-N 8-(azidomethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(CN=[N+]=[N-])C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 FCAGDICYOQTQNU-UHFFFAOYSA-N 0.000 description 1
- HORAOKMGKDQDED-UHFFFAOYSA-N 8-(chloromethyl)-3-methyl-2-phenylchromen-4-one Chemical compound O1C2=C(CCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 HORAOKMGKDQDED-UHFFFAOYSA-N 0.000 description 1
- BUXSCFIFZNLZAN-NJZRLIGZSA-N 8-[(e)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethoxyiminomethyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCO\N=C\C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 BUXSCFIFZNLZAN-NJZRLIGZSA-N 0.000 description 1
- HCZXHBUUIFTWCE-UHFFFAOYSA-N 8-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylsulfinylmethyl]-3-methyl-2-phenylchromen-4-one;dihydrochloride Chemical compound Cl.Cl.COC1=CC=CC=C1N1CCN(CCS(=O)CC=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 HCZXHBUUIFTWCE-UHFFFAOYSA-N 0.000 description 1
- WZSLGOHWOMQGBJ-UHFFFAOYSA-N 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoyl]-3-methyl-2-phenylchromen-4-one;hydrochloride Chemical compound Cl.COC1=CC=CC=C1N1CCN(CCC(=O)C=2C3=C(C(C(C)=C(C=4C=CC=CC=4)O3)=O)C=CC=2)CC1 WZSLGOHWOMQGBJ-UHFFFAOYSA-N 0.000 description 1
- IAZLNCYRZIIFBH-UHFFFAOYSA-N 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-3-methyl-2-phenylchromen-4-one;hydrochloride Chemical compound Cl.COC1=CC=CC=C1N1CCN(CCCNC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 IAZLNCYRZIIFBH-UHFFFAOYSA-N 0.000 description 1
- FOQUKURSTSTWCQ-UHFFFAOYSA-N 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylsulfonyl]-3-methyl-2-phenylchromen-4-one;hydrochloride Chemical compound Cl.COC1=CC=CC=C1N1CCN(CCCS(=O)(=O)C=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 FOQUKURSTSTWCQ-UHFFFAOYSA-N 0.000 description 1
- QNIPVEFNSOJMJP-UHFFFAOYSA-N 8-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]methyl]-3-methyl-2-phenylchromen-4-one Chemical compound COC1=CC=CC=C1N1CCN(CCNCC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 QNIPVEFNSOJMJP-UHFFFAOYSA-N 0.000 description 1
- VZDFEEUHCAQOBQ-UHFFFAOYSA-N 8-acetyl-3-methyl-2-phenylchromen-4-one Chemical compound CC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 VZDFEEUHCAQOBQ-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 1
- 229910015845 BBr3 Inorganic materials 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FGUUSXIOTUKUDN-IBGZPJMESA-N C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 Chemical compound C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 FGUUSXIOTUKUDN-IBGZPJMESA-N 0.000 description 1
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 1
- 229940127291 Calcium channel antagonist Drugs 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- GKKZMYDNDDMXSE-UHFFFAOYSA-N Ethyl 3-oxo-3-phenylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=C1 GKKZMYDNDDMXSE-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 101150055528 SPAM1 gene Proteins 0.000 description 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 206010046543 Urinary incontinence Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000674 adrenergic antagonist Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000091 aluminium hydride Inorganic materials 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229960003116 amyl nitrite Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000001466 anti-adreneric effect Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 229940000488 arsenic acid Drugs 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- CHQVQXZFZHACQQ-UHFFFAOYSA-M benzyl(triethyl)azanium;bromide Chemical compound [Br-].CC[N+](CC)(CC)CC1=CC=CC=C1 CHQVQXZFZHACQQ-UHFFFAOYSA-M 0.000 description 1
- FKPSBYZGRQJIMO-UHFFFAOYSA-M benzyl(triethyl)azanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC1=CC=CC=C1 FKPSBYZGRQJIMO-UHFFFAOYSA-M 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- AOJDZKCUAATBGE-UHFFFAOYSA-N bromomethane Chemical compound Br[CH2] AOJDZKCUAATBGE-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000000480 calcium channel blocker Substances 0.000 description 1
- 230000002213 calciumantagonistic effect Effects 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000006355 carbonyl methylene group Chemical group [H]C([H])([*:2])C([*:1])=O 0.000 description 1
- 125000006364 carbonyl oxy methylene group Chemical group [H]C([H])([*:2])OC([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 150000001907 coumarones Chemical class 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- UCDHYFZYUGDETN-UHFFFAOYSA-N cyanophosphonic acid Chemical compound OP(O)(=O)C#N UCDHYFZYUGDETN-UHFFFAOYSA-N 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- RAFNCPHFRHZCPS-UHFFFAOYSA-N di(imidazol-1-yl)methanethione Chemical compound C1=CN=CN1C(=S)N1C=CN=C1 RAFNCPHFRHZCPS-UHFFFAOYSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- OAGOUCJGXNLJNL-UHFFFAOYSA-N dimethylcyanamide Chemical compound CN(C)C#N OAGOUCJGXNLJNL-UHFFFAOYSA-N 0.000 description 1
- VDCSGNNYCFPWFK-UHFFFAOYSA-N diphenylsilane Chemical compound C=1C=CC=CC=1[SiH2]C1=CC=CC=C1 VDCSGNNYCFPWFK-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- NYKYMICIVFDUCX-UHFFFAOYSA-N ethyl 2-(2,2-dimethylpropanoyloxy)-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C(C)(C)C NYKYMICIVFDUCX-UHFFFAOYSA-N 0.000 description 1
- VHMNHMSQLODNNN-UHFFFAOYSA-N ethyl 2-(4-benzoylphenyl)-3-methyl-4-oxochromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C(C=C1)=CC=C1C(=O)C1=CC=CC=C1 VHMNHMSQLODNNN-UHFFFAOYSA-N 0.000 description 1
- DIZJTFNWNIBATH-UHFFFAOYSA-N ethyl 2-(4-fluorobenzoyl)oxy-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C1=CC=C(F)C=C1 DIZJTFNWNIBATH-UHFFFAOYSA-N 0.000 description 1
- YFCKNQKBASOTEI-UHFFFAOYSA-N ethyl 2-(4-fluorophenyl)-3-methyl-4-oxochromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=C(F)C=C1 YFCKNQKBASOTEI-UHFFFAOYSA-N 0.000 description 1
- VKLICUYYBFRQCW-UHFFFAOYSA-N ethyl 2-(4-methoxyphenyl)-3-methyl-4-oxochromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=C(OC)C=C1 VKLICUYYBFRQCW-UHFFFAOYSA-N 0.000 description 1
- HPJXFQAHSSRVKS-UHFFFAOYSA-N ethyl 2-(4-nitrobenzoyl)oxy-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C1=CC=C([N+]([O-])=O)C=C1 HPJXFQAHSSRVKS-UHFFFAOYSA-N 0.000 description 1
- CCRWJLKNLBBRSQ-UHFFFAOYSA-N ethyl 2-(4-phenoxybenzoyl)oxy-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C(C=C1)=CC=C1OC1=CC=CC=C1 CCRWJLKNLBBRSQ-UHFFFAOYSA-N 0.000 description 1
- ZVPVIJBSVZSAER-UHFFFAOYSA-N ethyl 2-(cyclohexanecarbonyloxy)-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C1CCCCC1 ZVPVIJBSVZSAER-UHFFFAOYSA-N 0.000 description 1
- OSXMYHFVVNIXNF-UHFFFAOYSA-N ethyl 2-(furan-2-yl)-3-methyl-4-oxochromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CO1 OSXMYHFVVNIXNF-UHFFFAOYSA-N 0.000 description 1
- BAOBBAUWUCLYIS-UHFFFAOYSA-N ethyl 2-cyclohexyl-3-methyl-4-oxochromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1CCCCC1 BAOBBAUWUCLYIS-UHFFFAOYSA-N 0.000 description 1
- DTPKVQWDBBMKSL-UHFFFAOYSA-N ethyl 2-hydroxy-3-(2,4,4-trimethyl-3-oxopentanoyl)benzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)C(C)C(=O)C(C)(C)C)=C1O DTPKVQWDBBMKSL-UHFFFAOYSA-N 0.000 description 1
- KGHJIPKLQZWGQO-OUKQBFOZSA-N ethyl 2-hydroxy-3-[(e)-2-methyl-4-phenylbut-3-enoyl]benzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)C(C)\C=C\C=2C=CC=CC=2)=C1O KGHJIPKLQZWGQO-OUKQBFOZSA-N 0.000 description 1
- OOSORLCIMGRAIS-UHFFFAOYSA-N ethyl 2-hydroxy-5-nitro-3-propanoylbenzoate Chemical compound CCOC(=O)C1=CC([N+]([O-])=O)=CC(C(=O)CC)=C1O OOSORLCIMGRAIS-UHFFFAOYSA-N 0.000 description 1
- NARWPOACABXCRU-UHFFFAOYSA-N ethyl 2-tert-butyl-3-methyl-4-oxochromene-8-carboxylate Chemical compound O1C(C(C)(C)C)=C(C)C(=O)C2=C1C(C(=O)OCC)=CC=C2 NARWPOACABXCRU-UHFFFAOYSA-N 0.000 description 1
- DLQRZZAEFYWOBV-UHFFFAOYSA-N ethyl 3-(3-cyclohexyl-2-methyl-3-oxopropanoyl)-2-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)C(C)C(=O)C2CCCCC2)=C1O DLQRZZAEFYWOBV-UHFFFAOYSA-N 0.000 description 1
- PEOOQFNOLXEBMS-UHFFFAOYSA-N ethyl 3-(bromomethyl)-4-oxo-2-phenylchromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2CBr)=O)=C1OC=2C1=CC=CC=C1 PEOOQFNOLXEBMS-UHFFFAOYSA-N 0.000 description 1
- COUUOUUKFWJVDR-UHFFFAOYSA-N ethyl 3-[4-(furan-2-yl)-4-oxobutanoyl]-2-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CCC(=O)C=2OC=CC=2)=C1O COUUOUUKFWJVDR-UHFFFAOYSA-N 0.000 description 1
- ORMQHFSXUMUIEI-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-2-(4-phenoxyphenyl)chromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C(C=C1)=CC=C1OC1=CC=CC=C1 ORMQHFSXUMUIEI-UHFFFAOYSA-N 0.000 description 1
- PSRHCZBTKVLUPX-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-2-(4-phenylphenyl)chromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C(C=C1)=CC=C1C1=CC=CC=C1 PSRHCZBTKVLUPX-UHFFFAOYSA-N 0.000 description 1
- BZIZZGMWHSCIHW-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-2-(trifluoromethyl)chromene-8-carboxylate Chemical compound O1C(C(F)(F)F)=C(C)C(=O)C2=C1C(C(=O)OCC)=CC=C2 BZIZZGMWHSCIHW-UHFFFAOYSA-N 0.000 description 1
- CUWBHENXTOASMK-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-2-[4-(trifluoromethyl)phenyl]chromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=C(C(F)(F)F)C=C1 CUWBHENXTOASMK-UHFFFAOYSA-N 0.000 description 1
- NFRGNMIIGIZYDL-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 NFRGNMIIGIZYDL-UHFFFAOYSA-N 0.000 description 1
- OFERXBKVJATDJS-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-2-thiophen-2-ylchromene-8-carboxylate Chemical compound CCOC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CS1 OFERXBKVJATDJS-UHFFFAOYSA-N 0.000 description 1
- OSHXZWYLQCCIAS-UHFFFAOYSA-N ethyl 3-methyl-6-nitro-4-oxo-2-phenylchromene-8-carboxylate Chemical compound CCOC(=O)C1=CC([N+]([O-])=O)=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 OSHXZWYLQCCIAS-UHFFFAOYSA-N 0.000 description 1
- QSUCLWHQYBBDMC-UHFFFAOYSA-N ethyl 3-propanoyl-2-[4-(trifluoromethyl)benzoyl]oxybenzoate Chemical compound CCOC(=O)C1=CC=CC(C(=O)CC)=C1OC(=O)C1=CC=C(C(F)(F)F)C=C1 QSUCLWHQYBBDMC-UHFFFAOYSA-N 0.000 description 1
- CBJKVHPSDMKKGL-UHFFFAOYSA-N ethyl 4-oxochromene-8-carboxylate Chemical compound O1C=CC(=O)C2=C1C(C(=O)OCC)=CC=C2 CBJKVHPSDMKKGL-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000036543 hypotension Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 239000003863 metallic catalyst Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- NREJJJFFIZMFGQ-UHFFFAOYSA-N methanesulfonic acid;1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-(3-methyl-4-oxo-2-phenylchromen-8-yl)urea Chemical compound CS(O)(=O)=O.COC1=CC=CC=C1N1CCN(CCNC(=O)NC=2C3=C(C(C(C)=C(O3)C=3C=CC=CC=3)=O)C=CC=2)CC1 NREJJJFFIZMFGQ-UHFFFAOYSA-N 0.000 description 1
- LHRAZWLERDCLKI-UHFFFAOYSA-N methanesulfonic acid;3-methyl-4-oxo-2-phenyl-n-[3-(4-phenylpiperidin-1-yl)propyl]chromene-8-carboxamide Chemical compound CS(O)(=O)=O.C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)NCCCN(CC1)CCC1C1=CC=CC=C1 LHRAZWLERDCLKI-UHFFFAOYSA-N 0.000 description 1
- BDPIZWCNTCVHAJ-UHFFFAOYSA-N methyl 2-(4-methylbenzoyl)oxy-3-propanoylbenzoate Chemical compound CCC(=O)C1=CC=CC(C(=O)OC)=C1OC(=O)C1=CC=C(C)C=C1 BDPIZWCNTCVHAJ-UHFFFAOYSA-N 0.000 description 1
- UFGVWANOISVHGQ-UHFFFAOYSA-N methyl 2-hydroxy-3-propanoylbenzoate Chemical compound CCC(=O)C1=CC=CC(C(=O)OC)=C1O UFGVWANOISVHGQ-UHFFFAOYSA-N 0.000 description 1
- BAQGCWNPCFABAY-UHFFFAOYSA-N methyl 2-sulfanylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S BAQGCWNPCFABAY-UHFFFAOYSA-N 0.000 description 1
- ZTIFDLYMYBXRLT-UHFFFAOYSA-N methyl 3-methyl-2-(4-methylphenyl)-4-oxochromene-8-carboxylate Chemical compound COC(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=C(C)C=C1 ZTIFDLYMYBXRLT-UHFFFAOYSA-N 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical compound C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- QAXZWHGWYSJAEI-UHFFFAOYSA-N n,n-dimethylformamide;ethanol Chemical compound CCO.CN(C)C=O QAXZWHGWYSJAEI-UHFFFAOYSA-N 0.000 description 1
- JHEGXAJWTZBWPX-UHFFFAOYSA-N n-(2-chloroethyl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound O1C2=C(C(=O)NCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 JHEGXAJWTZBWPX-UHFFFAOYSA-N 0.000 description 1
- WMEXLJWQUOXKOU-UHFFFAOYSA-N n-(2-chloroethyl)-n,3-dimethyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound ClCCN(C)C(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 WMEXLJWQUOXKOU-UHFFFAOYSA-N 0.000 description 1
- MHDWZQKAZVCWOS-UHFFFAOYSA-N n-(2-hydroxyethyl)-3-methyl-4-oxo-2-phenylchromene-8-sulfonamide Chemical compound O1C2=C(S(=O)(=O)NCCO)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 MHDWZQKAZVCWOS-UHFFFAOYSA-N 0.000 description 1
- XLZOIXODTOCDJA-UHFFFAOYSA-N n-(2-hydroxyethyl)-n,3-dimethyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound OCCN(C)C(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 XLZOIXODTOCDJA-UHFFFAOYSA-N 0.000 description 1
- MTMHCUYAIGMXDZ-UHFFFAOYSA-N n-(2-hydroxyethyl)-n,3-dimethyl-4-oxo-2-phenylchromene-8-sulfonamide Chemical compound OCCN(C)S(=O)(=O)C1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 MTMHCUYAIGMXDZ-UHFFFAOYSA-N 0.000 description 1
- ZPUWOEPNUWNPHN-UHFFFAOYSA-N n-(2-hydroxyethyl)-n-[(3-methyl-4-oxo-2-phenylchromen-8-yl)methyl]acetamide Chemical compound OCCN(C(=O)C)CC1=CC=CC(C(C=2C)=O)=C1OC=2C1=CC=CC=C1 ZPUWOEPNUWNPHN-UHFFFAOYSA-N 0.000 description 1
- MOOFRIDRSWHYST-UHFFFAOYSA-N n-(3-chloropropyl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide Chemical compound O1C2=C(C(=O)NCCCCl)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 MOOFRIDRSWHYST-UHFFFAOYSA-N 0.000 description 1
- QHADQZZLTAUQAF-UHFFFAOYSA-N n-[(3-methyl-4-oxo-2-phenylchromen-8-yl)methyl]ethenesulfonamide Chemical compound O1C2=C(CNS(=O)(=O)C=C)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 QHADQZZLTAUQAF-UHFFFAOYSA-N 0.000 description 1
- KERBAAIBDHEFDD-UHFFFAOYSA-N n-ethylformamide Chemical compound CCNC=O KERBAAIBDHEFDD-UHFFFAOYSA-N 0.000 description 1
- LKPFBGKZCCBZDK-UHFFFAOYSA-N n-hydroxypiperidine Chemical compound ON1CCCCC1 LKPFBGKZCCBZDK-UHFFFAOYSA-N 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- NLXXVSKHVGDQAT-UHFFFAOYSA-N o-(oxan-2-yl)hydroxylamine Chemical compound NOC1CCCCO1 NLXXVSKHVGDQAT-UHFFFAOYSA-N 0.000 description 1
- WDBXHQTZERVTGM-UHFFFAOYSA-N o-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]hydroxylamine;hydrochloride Chemical compound Cl.COC1=CC=CC=C1N1CCN(CCON)CC1 WDBXHQTZERVTGM-UHFFFAOYSA-N 0.000 description 1
- 230000000414 obstructive effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- MMKQSIQNDMIVIN-UHFFFAOYSA-N oxido-(oxido(dioxo)chromio)oxy-dioxochromium;tetrabutylazanium Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC MMKQSIQNDMIVIN-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000006237 oxymethylenoxy group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 description 1
- 229960001289 prazosin Drugs 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical compound SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 238000007157 ring contraction reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229940071536 silver acetate Drugs 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- VLLATRQRPYHZLR-UHFFFAOYSA-M sodium;3-methyl-4-oxo-2-phenylchromene-8-carboxylate Chemical compound [Na+].O1C2=C(C([O-])=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 VLLATRQRPYHZLR-UHFFFAOYSA-M 0.000 description 1
- GNCGTEQGBYYYBX-UHFFFAOYSA-M sodium;4-methylbenzoate Chemical compound [Na+].CC1=CC=C(C([O-])=O)C=C1 GNCGTEQGBYYYBX-UHFFFAOYSA-M 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 235000010269 sulphur dioxide Nutrition 0.000 description 1
- 239000004291 sulphur dioxide Substances 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 229950003559 terflavoxate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- QIQITDHWZYEEPA-UHFFFAOYSA-N thiophene-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=CS1 QIQITDHWZYEEPA-UHFFFAOYSA-N 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- KPZSTOVTJYRDIO-UHFFFAOYSA-K trichlorocerium;heptahydrate Chemical compound O.O.O.O.O.O.O.Cl[Ce](Cl)Cl KPZSTOVTJYRDIO-UHFFFAOYSA-K 0.000 description 1
- DCFKHNIGBAHNSS-UHFFFAOYSA-N triethylsilyl chloride Natural products CC[Si](Cl)(CC)CC DCFKHNIGBAHNSS-UHFFFAOYSA-N 0.000 description 1
- CPRPKIMXLHBUGA-UHFFFAOYSA-N triethyltin Chemical compound CC[Sn](CC)CC CPRPKIMXLHBUGA-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- SCHZCUMIENIQMY-UHFFFAOYSA-N tris(trimethylsilyl)silicon Chemical compound C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C SCHZCUMIENIQMY-UHFFFAOYSA-N 0.000 description 1
- FUCBQMFTYFQCOB-UHFFFAOYSA-N trityl perchlorate Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OCl(=O)(=O)=O)C1=CC=CC=C1 FUCBQMFTYFQCOB-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/80—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/28—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only
- C07D311/30—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only not hydrogenated in the hetero ring, e.g. flavones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/28—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only
- C07D311/32—2,3-Dihydro derivatives, e.g. flavanones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
- C07D311/60—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4 with aryl radicals attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6558—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system
- C07F9/65586—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system at least one of the hetero rings does not contain nitrogen as ring hetero atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
ITMI920408A IT1254469B (it) | 1992-02-25 | 1992-02-25 | Derivati benzopiranici e benzotiopiranici |
US07/888,775 US5403842A (en) | 1992-02-25 | 1992-05-26 | Benzopyran and benzothiopyran derivatives |
Publications (2)
Publication Number | Publication Date |
---|---|
IL104824A0 IL104824A0 (en) | 1993-06-10 |
IL104824A true IL104824A (en) | 1999-12-22 |
Family
ID=26330842
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
IL10482493A IL104824A (en) | 1992-02-25 | 1993-02-23 | Heterobicyclic compounds and pharmaceutical compositions containing them |
Country Status (25)
Country | Link |
---|---|
EP (1) | EP0558245A1 (sv) |
JP (1) | JPH069606A (sv) |
AU (2) | AU3629693A (sv) |
BG (1) | BG61946B1 (sv) |
CA (1) | CA2090156A1 (sv) |
CZ (1) | CZ205994A3 (sv) |
DZ (1) | DZ1666A1 (sv) |
EE (1) | EE03177B1 (sv) |
EG (1) | EG20333A (sv) |
FI (1) | FI943876A0 (sv) |
HR (1) | HRP930210A2 (sv) |
HU (1) | HUT72448A (sv) |
IL (1) | IL104824A (sv) |
LT (1) | LT3038B (sv) |
LV (1) | LV10099B (sv) |
MX (1) | MX9300977A (sv) |
NO (1) | NO943140L (sv) |
NZ (1) | NZ245995A (sv) |
PL (1) | PL175556B1 (sv) |
SG (1) | SG65570A1 (sv) |
SI (1) | SI9300094A (sv) |
SK (1) | SK280143B6 (sv) |
TW (1) | TW382628B (sv) |
WO (1) | WO1993017007A1 (sv) |
ZA (1) | ZA931278B (sv) |
Families Citing this family (51)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
MX9300312A (es) * | 1992-01-23 | 1993-07-31 | Pfizer | Antagonistas benzopiranicos y relacionado de ltb. |
FR2689127B1 (fr) * | 1992-03-31 | 1994-05-06 | Adir Cie | Nouvelles 3', 5' -ditertbutyl-4'-hydroxy flavones, leur procede de preparation et les compositions pharmaceutiques les renfermant. |
IT1266582B1 (it) * | 1993-07-30 | 1997-01-09 | Recordati Chem Pharm | Derivati (di)azacicloesanici e diazacicloeptanici |
GB9317071D0 (en) * | 1993-08-17 | 1993-09-29 | Univ Strathclyde | Flavonoids |
JP3426242B2 (ja) * | 1994-01-14 | 2003-07-14 | 株式会社アズウェル | ジアザシクロアルカンアルキルスルホンアミド誘導体 |
FR2717175B1 (fr) * | 1994-03-11 | 1996-06-14 | Adir | Nouveaux composés alkylaminoindanes, leurs procédés de préparation et les compositions pharmaceutiques qui les contiennent. |
IL112764A0 (en) * | 1994-03-18 | 1995-05-26 | Ferrer Int | New chromene derivatives |
ES2101620B1 (es) * | 1994-03-18 | 1998-04-01 | Ferrer Int | Nuevo compuesto derivado del cromeno. |
PT753511E (pt) * | 1994-03-30 | 2001-11-30 | Zeria Pharm Co Ltd | Derivados de acido 4-indol-1-butirico, sua preparacao e utilizacao como inibidores dos receptores alfa-1-adrenergicos e das 5-alfa-redutases da testosterona |
US5503843A (en) * | 1994-04-22 | 1996-04-02 | Flora Inc. | Transdermal delivery of alpha adrenoceptor blocking agents |
DE4425146A1 (de) * | 1994-07-15 | 1996-01-18 | Basf Ag | Verwendung heterocyclischer Verbindungen |
GB9417135D0 (en) * | 1994-08-23 | 1994-10-12 | Medinnova S F | Method |
CA2188924C (en) * | 1995-02-28 | 2008-04-08 | Hirokazu Annoura | Arylpiperidine and arylpiperazine derivatives and drugs containing the same |
GB9507288D0 (en) * | 1995-04-07 | 1995-05-31 | Sod Conseils Rech Applic | Phenoxyethylamine derivatives with high affinity for 5-HT1A receptors |
US5859014A (en) * | 1995-06-09 | 1999-01-12 | Syntex (U.S.A.) Inc. | Pyrimidinedione, pyrimidinetrione, triazinedione and tetrahydroquinazolinedione derivatives as α1 -adrenergic receptor antagonists |
ATE201016T1 (de) * | 1995-06-09 | 2001-05-15 | Hoffmann La Roche | Pyrimidindion-, pyrimidintrion-, triazindion- derivate als alpha-1-adrenergische rezeptorantagonisten |
JPH0967367A (ja) * | 1995-06-23 | 1997-03-11 | Suntory Ltd | チオピラン誘導体 |
WO1997014419A1 (en) * | 1995-10-20 | 1997-04-24 | Flora Inc. | Transdermal delivery of alpha adrenoceptor blocking agents |
US5990114A (en) * | 1996-02-28 | 1999-11-23 | Recordati, S.A., Chemical And Pharmaceutical Company | Use of 5-HT1A receptor antagonists for the treatment of urinary incontinence |
IT1282705B1 (it) * | 1996-02-28 | 1998-03-31 | Recordati Chem Pharm | Uso di antagonisti del recettore serotoninergico 5-ht|a per il trattamento dell'incontinenza urinaria |
AU2030197A (en) * | 1996-03-08 | 1997-09-22 | Synthelabo | 2-aminoethyl-benzofuran derivatives, preparation thereof and therapeutical use thereof |
FR2745815B1 (fr) * | 1996-03-08 | 1998-06-26 | Synthelabo | Derives de benzofurane, leur preparations et compositions pharmaceutiques les comprenant |
EP0929537A1 (en) * | 1996-08-22 | 1999-07-21 | Hoechst Marion Roussel, Inc. | Troponyl piperazines as selective dopamine d4 receptor ligands |
AU2002300904B2 (en) * | 1997-05-12 | 2004-12-23 | Ortho-Mcneil Pharmaceutical, Inc. | Arylsubstituted piperazines useful in the treatment of benign prostatic hyperplasia |
EA001904B1 (ru) | 1997-05-12 | 2001-10-22 | ОРТО МакНЕЙЛ ФАРМАСЬЮТИКАЛ, ИНК. | Арилзамещенные пиперазины для лечения доброкачественной гиперплазии простаты |
DE69818079T2 (de) | 1997-06-04 | 2004-06-03 | Azwell Inc. | Verfahren zur herstellung von piperazinsulfonamid-derivaten und ihren salzen |
AU8130298A (en) * | 1997-07-15 | 1999-02-10 | Sankyo Company Limited | Piperazine derivatives |
IT1313581B1 (it) * | 1999-07-30 | 2002-09-09 | Recordati Chem Pharm | Derivati tienopirancarbossamidici. |
US6387909B1 (en) | 1999-07-30 | 2002-05-14 | Recordati S.A. Chemical And Pharmaceutical Company | Thienopyranecarboxamide derivatives |
US6306861B1 (en) | 1999-07-30 | 2001-10-23 | Recordati S.A. Chemical And Pharmaceutical Company | Thienopyrancecarboxamide derivatives |
DE19941657A1 (de) * | 1999-09-01 | 2001-03-08 | Schwabe Willmar Gmbh & Co | Zimtsäurenitrile, Verfahren zu ihrer Herstellung und Verwendung |
US6403594B1 (en) | 1999-10-18 | 2002-06-11 | Recordati, S.A. Chemical And Pharmaceutical Company | Benzopyran derivatives |
IT1314192B1 (it) * | 1999-10-18 | 2002-12-06 | Recordati Chem Pharm | Derivati benzopiranici |
JP2002113006A (ja) | 2000-10-10 | 2002-04-16 | Toshiba Medical System Co Ltd | 診断機器設定方法および診断装置 |
CN1150176C (zh) * | 2002-05-22 | 2004-05-19 | 上海医药工业研究院 | 芳烷酮哌嗪衍生物及其应用 |
JP2006511500A (ja) * | 2002-10-30 | 2006-04-06 | メルク エンド カムパニー インコーポレーテッド | γ−アミノアミド系のケモカイン受容体活性調節剤 |
AU2005275181A1 (en) | 2004-07-14 | 2006-02-23 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US7868037B2 (en) | 2004-07-14 | 2011-01-11 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US7772271B2 (en) | 2004-07-14 | 2010-08-10 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US7781478B2 (en) | 2004-07-14 | 2010-08-24 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US7645881B2 (en) | 2004-07-22 | 2010-01-12 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
CA2597616A1 (en) | 2005-02-17 | 2006-08-24 | Wyeth | Cycloalkylfused indole, benzothiophene, benzofuran and indene derivatives |
CA2738809C (en) * | 2008-09-29 | 2015-11-24 | Sirtris Pharmaceuticals, Inc. | Quinazolinone, quinolone and related analogs as sirtuin modulators |
CZ304045B6 (cs) | 2012-04-10 | 2013-09-04 | Univerzita Palackého | Pouzití komplexu medi obsahujících 2-fenyl-3-hydroxychinolin-4(1H)-on a deriváty 1,10-fenanthrolinu pro prípravu léciv pro lécbu nádorových onemocnení |
JP2019508400A (ja) | 2016-02-09 | 2019-03-28 | ファーマケア,インク. | キノリノンリシルオキシダーゼ様2阻害剤とその使用 |
WO2020095912A1 (ja) * | 2018-11-06 | 2020-05-14 | 第一三共株式会社 | ベンズイミダゾール誘導体 |
EP4058425A4 (en) | 2019-11-11 | 2023-11-22 | Southwest Research Institute | RECRYSTALLIZED HI-6 DIMETHYL SULFATE |
AR120680A1 (es) | 2019-12-06 | 2022-03-09 | Vertex Pharma | Tetrahidrofuranos sustituidos como moduladores de canales de sodio |
AR126073A1 (es) | 2021-06-04 | 2023-09-06 | Vertex Pharma | N-(hidroxialquil(hetero)aril)tetrahidrofuran carboxamidas como moduladores de canales de sodio |
EP4426434A1 (en) | 2021-11-02 | 2024-09-11 | Flare Therapeutics, Inc. | Pparg inverse agonists and uses thereof |
CN115160279B (zh) * | 2022-07-27 | 2023-11-24 | 中国药科大学 | 苯并吡喃酮类化合物、药物组合物和应用 |
Family Cites Families (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2921070A (en) * | 1957-11-05 | 1960-01-12 | Recordati Lab Farmacologico S | Basic esters of 3-methylflavone-8-carboxylic acid |
GB1156973A (en) | 1965-07-06 | 1969-07-02 | Quinazoline Derivatives | |
DE2123923A1 (de) * | 1971-05-14 | 1972-11-23 | Boehringer Mannheim Gmbh, 6800 Mannheim | 4-eckige Klammer auf omega- (Flavon-7yl-oxy) -alkyl eckige Klammer zu -pigerazin-Derivate und Verfahren zu ihrer Herstellung |
NZ200981A (en) | 1981-07-17 | 1984-10-19 | Recordati Chem Pharm | 3-methylflavone-8-carboxylic acid derivatives and pharmaceutical compositions |
JPS60202872A (ja) * | 1984-03-27 | 1985-10-14 | Kaken Pharmaceut Co Ltd | ベンゾフラン誘導体、その製法およびそれを有効成分とする降圧剤 |
US4678787A (en) * | 1985-01-30 | 1987-07-07 | Warner-Lambert Company | 4H-1-benzopyran-4-ones and their sulfur containing analogs |
JPS63139180A (ja) * | 1986-12-02 | 1988-06-10 | Tanabe Seiyaku Co Ltd | カルボン酸誘導体 |
IL87451A0 (en) * | 1987-09-04 | 1989-01-31 | Tanabe Seiyaku Co | Benzofuran derivatives,their preparation and pharmaceutical compositions containing them |
US5278174A (en) * | 1990-06-04 | 1994-01-11 | Scios Nova, Inc. | Sigma binding site agents |
-
1993
- 1993-02-22 SG SG1996004802A patent/SG65570A1/en unknown
- 1993-02-22 EP EP93301264A patent/EP0558245A1/en not_active Withdrawn
- 1993-02-22 HR HR930210A patent/HRP930210A2/hr not_active Application Discontinuation
- 1993-02-23 CZ CZ942059A patent/CZ205994A3/cs unknown
- 1993-02-23 SK SK1007-94A patent/SK280143B6/sk unknown
- 1993-02-23 HU HU9402443A patent/HUT72448A/hu unknown
- 1993-02-23 AU AU36296/93A patent/AU3629693A/en not_active Abandoned
- 1993-02-23 IL IL10482493A patent/IL104824A/en not_active IP Right Cessation
- 1993-02-23 PL PL93304889A patent/PL175556B1/pl unknown
- 1993-02-23 MX MX9300977A patent/MX9300977A/es not_active IP Right Cessation
- 1993-02-23 WO PCT/EP1993/000420 patent/WO1993017007A1/en not_active Application Discontinuation
- 1993-02-23 CA CA002090156A patent/CA2090156A1/en not_active Abandoned
- 1993-02-24 ZA ZA931278A patent/ZA931278B/xx unknown
- 1993-02-24 DZ DZ930019A patent/DZ1666A1/fr active
- 1993-02-24 LV LVP-93-136A patent/LV10099B/en unknown
- 1993-02-24 AU AU33773/93A patent/AU660067B2/en not_active Ceased
- 1993-02-24 LT LTIP354A patent/LT3038B/lt not_active IP Right Cessation
- 1993-02-25 SI SI19939300094A patent/SI9300094A/sl unknown
- 1993-02-25 EG EG1193A patent/EG20333A/xx active
- 1993-02-25 NZ NZ245995A patent/NZ245995A/en unknown
- 1993-02-25 JP JP5036605A patent/JPH069606A/ja active Pending
- 1993-05-20 TW TW082103988A patent/TW382628B/zh active
-
1994
- 1994-08-19 BG BG98990A patent/BG61946B1/bg unknown
- 1994-08-23 FI FI943876A patent/FI943876A0/sv unknown
- 1994-08-25 NO NO943140A patent/NO943140L/no unknown
- 1994-11-10 EE EE9400374A patent/EE03177B1/xx unknown
Also Published As
Publication number | Publication date |
---|---|
LV10099A (lv) | 1994-05-10 |
AU3629693A (en) | 1993-09-13 |
PL175556B1 (pl) | 1999-01-29 |
NO943140D0 (no) | 1994-08-25 |
WO1993017007A1 (en) | 1993-09-02 |
HUT72448A (en) | 1996-04-29 |
AU660067B2 (en) | 1995-06-08 |
BG98990A (bg) | 1995-05-31 |
LV10099B (en) | 1995-02-20 |
BG61946B1 (bg) | 1998-10-30 |
CZ205994A3 (en) | 1995-02-15 |
IL104824A0 (en) | 1993-06-10 |
TW382628B (en) | 2000-02-21 |
NO943140L (no) | 1994-08-25 |
SI9300094A (en) | 1993-09-30 |
HRP930210A2 (en) | 1995-06-30 |
FI943876A (sv) | 1994-08-23 |
JPH069606A (ja) | 1994-01-18 |
LTIP354A (lt) | 1994-04-25 |
ZA931278B (en) | 1993-11-18 |
NZ245995A (en) | 1994-09-27 |
SK280143B6 (sk) | 1999-09-10 |
DZ1666A1 (fr) | 2002-02-17 |
EP0558245A1 (en) | 1993-09-01 |
EG20333A (en) | 1998-10-31 |
SK100794A3 (en) | 1995-04-12 |
AU3377393A (en) | 1993-08-26 |
MX9300977A (es) | 1993-12-01 |
CA2090156A1 (en) | 1993-08-26 |
EE03177B1 (et) | 1999-04-15 |
FI943876A0 (sv) | 1994-08-23 |
HU9402443D0 (en) | 1994-10-28 |
SG65570A1 (en) | 1999-06-22 |
LT3038B (en) | 1994-09-25 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
AU660067B2 (en) | Benzopyranone derivatives and analogues | |
US5474994A (en) | Bicyclic heterocyclic derivatives having α1 -adrenergic and 5HT1A | |
RU2128656C1 (ru) | Гетеробициклическое соединение, фармацевтическая композиция, способы получения гетеробициклического соединения | |
US5605896A (en) | Bicyclic heterocyclic derivatives having α1 adrenergic and 5HT1A activities | |
Fu et al. | New chalcone derivatives: synthesis, antiviral activity and mechanism of action | |
CA2105518C (en) | Condensed heterocyclic compounds, their production and use | |
Buckle et al. | Studies on 1, 2, 3-triazoles. 13.(Piperazinylalkoxy)-[1] benzopyrano [2, 3-d]-1, 2, 3-triazol-9 (1H)-ones with combined H1-antihistamine and mast cell stabilizing properties | |
CA1167036A (en) | Synthesis of acylated benzothiophenes | |
EP0183191B1 (en) | Thienylthiazole compounds | |
US4904666A (en) | Pyrazolo(3,4-d)pyrimidine compounds, compositions and method of use | |
EP0264883A2 (en) | Substituted pyridine derivatives | |
KR970011580B1 (ko) | 항알레르기 활성을 갖는 신규의 벤조티오펜 | |
FI95250B (sv) | Förfarande för framställning av nya, terapeutiskt användbara kromanderivat | |
Kumar et al. | Synthesis and anti-inflammatory, analgesic, ulcerogenic and cyclooxygenase activities of novel quinazolinyl-Δ 2-pyrazolines | |
CS195325B2 (en) | Method of producing 4-aminoalkoxy-2/2h/pyranones 3-substituted and 5,6-condensed | |
EP0153818B1 (en) | 1,3-disubstituted 2-oxindoles as analgesic and anti-inflammatory agents | |
EP0412803B1 (en) | Chalcone derivatives | |
NL8002024A (nl) | 6-gesubstitueerde pyranonverbindingen en hun toepassing in de farmacie. | |
FI71733B (fi) | Foerfarande foer framstaellning av farmaceutiskt aktiva 3,6-substituerade 2-vinyl-kromoner | |
EP0566288B1 (en) | Flavone derivatives | |
JPH0525140A (ja) | ベンズイミダゾール誘導体 | |
Paegle et al. | Selenium analogues of rintodestrant (G1T48) as potent estrogen receptor modulators and downregulators | |
HUT72741A (en) | Method for producing benzopyrane derivatives and pharmaceutical compositions containing them | |
GB2140414A (en) | Condensed benzopyrone derivatives |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FF | Patent granted | ||
RH | Patent void |