DE2458965C3 - 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel - Google Patents
3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende ArzneimittelInfo
- Publication number
- DE2458965C3 DE2458965C3 DE2458965A DE2458965A DE2458965C3 DE 2458965 C3 DE2458965 C3 DE 2458965C3 DE 2458965 A DE2458965 A DE 2458965A DE 2458965 A DE2458965 A DE 2458965A DE 2458965 C3 DE2458965 C3 DE 2458965C3
- Authority
- DE
- Germany
- Prior art keywords
- amino
- indazole
- mol
- carboxylic acid
- melting point
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VALAPLVTFQMOCJ-UHFFFAOYSA-N 3-aminoindazole-1-carboxylic acid Chemical class C1=CC=C2C(N)=NN(C(O)=O)C2=C1 VALAPLVTFQMOCJ-UHFFFAOYSA-N 0.000 title claims description 4
- 238000000034 method Methods 0.000 title description 6
- 239000003814 drug Substances 0.000 title description 2
- 238000002360 preparation method Methods 0.000 title description 2
- 230000008018 melting Effects 0.000 description 45
- 238000002844 melting Methods 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000002253 acid Substances 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 239000000460 chlorine Substances 0.000 description 17
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 230000000694 effects Effects 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- -1 Amino halogen Chemical class 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- 235000019253 formic acid Nutrition 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 7
- BPTYMRSBTUERSW-UHFFFAOYSA-N 6-chloro-1h-indazol-3-amine Chemical compound ClC1=CC=C2C(N)=NNC2=C1 BPTYMRSBTUERSW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Substances N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- FFYPMLJYZAEMQB-UHFFFAOYSA-N diethyl pyrocarbonate Chemical compound CCOC(=O)OC(=O)OCC FFYPMLJYZAEMQB-UHFFFAOYSA-N 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 125000003282 alkyl amino group Chemical group 0.000 description 4
- 230000036760 body temperature Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 4
- 235000005911 diet Nutrition 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 206010030113 Oedema Diseases 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- 229940035676 analgesics Drugs 0.000 description 3
- 239000000730 antalgic agent Substances 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 229920001525 carrageenan Polymers 0.000 description 3
- 235000010418 carrageenan Nutrition 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000004663 dialkyl amino group Chemical group 0.000 description 3
- 230000037213 diet Effects 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 210000002683 foot Anatomy 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- YDTDKKULPWTHRV-UHFFFAOYSA-N 1H-indazol-3-amine Chemical class C1=CC=C2C(N)=NNC2=C1 YDTDKKULPWTHRV-UHFFFAOYSA-N 0.000 description 2
- ZEDPQIJYJCPIRM-UHFFFAOYSA-N 2,3-dimethylbenzonitrile Chemical compound CC1=CC=CC(C#N)=C1C ZEDPQIJYJCPIRM-UHFFFAOYSA-N 0.000 description 2
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 2
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 description 2
- HVSPPLIBICHWSB-UHFFFAOYSA-N 4-(trifluoromethyl)-1h-indazol-3-amine Chemical compound C1=CC(C(F)(F)F)=C2C(N)=NNC2=C1 HVSPPLIBICHWSB-UHFFFAOYSA-N 0.000 description 2
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 2
- ZXZTZRVCWTWKCH-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-indazol-3-amine Chemical compound C1=C(C(F)(F)F)C=C2C(N)=NNC2=C1 ZXZTZRVCWTWKCH-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229920006063 Lamide® Polymers 0.000 description 2
- 244000147568 Laurus nobilis Species 0.000 description 2
- 235000017858 Laurus nobilis Nutrition 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 235000005212 Terminalia tomentosa Nutrition 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000003501 anti-edematous effect Effects 0.000 description 2
- 230000001754 anti-pyretic effect Effects 0.000 description 2
- 239000002221 antipyretic Substances 0.000 description 2
- 230000027455 binding Effects 0.000 description 2
- 238000009739 binding Methods 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- OROGSEYTTFOCAN-DNJOTXNNSA-N codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 238000003682 fluorination reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000005462 imide group Chemical group 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229960005489 paracetamol Drugs 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DFPYRBFQHBGIKI-UHFFFAOYSA-N 2-chloro-6-(trifluoromethyl)benzonitrile Chemical compound FC(F)(F)C1=CC=CC(Cl)=C1C#N DFPYRBFQHBGIKI-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- HTRMRUSPRYJLOW-UHFFFAOYSA-N 3-amino-4-chloroindazole-1-carboxylic acid Chemical compound C1=CC(Cl)=C2C(N)=NN(C(O)=O)C2=C1 HTRMRUSPRYJLOW-UHFFFAOYSA-N 0.000 description 1
- NORAFCGXPPSBTR-UHFFFAOYSA-N 3-amino-6-chloroindazole-1-carboxylic acid Chemical compound ClC1=CC=C2C(N)=NN(C(O)=O)C2=C1 NORAFCGXPPSBTR-UHFFFAOYSA-N 0.000 description 1
- WQSZTNMTDPQSTB-UHFFFAOYSA-N 3-amino-6-chloroindazole-2-carboxylic acid Chemical compound C1=C(Cl)C=CC2=C(N)N(C(O)=O)N=C21 WQSZTNMTDPQSTB-UHFFFAOYSA-N 0.000 description 1
- QPLXQNVPEHUPTR-UHFFFAOYSA-N 4-chloro-1H-indazol-3-amine Chemical compound C1=CC(Cl)=C2C(N)=NNC2=C1 QPLXQNVPEHUPTR-UHFFFAOYSA-N 0.000 description 1
- WBHMPANPIGWXQV-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-indazole Chemical compound FC(F)(F)C1=CC=C2NN=CC2=C1 WBHMPANPIGWXQV-UHFFFAOYSA-N 0.000 description 1
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 1
- WSGURAYTCUVDQL-UHFFFAOYSA-N 5-nitro-1h-indazole Chemical compound [O-][N+](=O)C1=CC=C2NN=CC2=C1 WSGURAYTCUVDQL-UHFFFAOYSA-N 0.000 description 1
- VUZQHUVRBPILAX-UHFFFAOYSA-N 6-chloro-1h-indazole Chemical compound ClC1=CC=C2C=NNC2=C1 VUZQHUVRBPILAX-UHFFFAOYSA-N 0.000 description 1
- RLNKCXFTRPDGAP-UHFFFAOYSA-N 7-(trifluoromethyl)-1h-indazol-3-amine Chemical compound C1=CC=C2C(N)=NNC2=C1C(F)(F)F RLNKCXFTRPDGAP-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- 239000004097 EU approved flavor enhancer Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 101150086776 FAM3C gene Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 210000003489 abdominal muscle Anatomy 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229960004126 codeine Drugs 0.000 description 1
- 239000006258 conductive agent Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- DPFWTFXVPSKDLU-UHFFFAOYSA-N ethyl 3-amino-4-chloroindazole-1-carboxylate Chemical compound C1=CC=C2N(C(=O)OCC)N=C(N)C2=C1Cl DPFWTFXVPSKDLU-UHFFFAOYSA-N 0.000 description 1
- UGXOEWBGAICBHP-UHFFFAOYSA-N ethyl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate Chemical compound FC(F)(F)C1=CC=C2N(C(=O)OCC)N=C(N)C2=C1 UGXOEWBGAICBHP-UHFFFAOYSA-N 0.000 description 1
- ANLRNJHEAMEEHZ-UHFFFAOYSA-N ethyl 3-aminoindazole-1-carboxylate Chemical compound C1=CC=C2N(C(=O)OCC)N=C(N)C2=C1 ANLRNJHEAMEEHZ-UHFFFAOYSA-N 0.000 description 1
- KDULBIKTMNESKV-UHFFFAOYSA-N ethyl 4-chloro-3-(dimethylamino)indazole-1-carboxylate Chemical compound C1=CC=C2N(C(=O)OCC)N=C(N(C)C)C2=C1Cl KDULBIKTMNESKV-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019264 food flavour enhancer Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- OROGSEYTTFOCAN-UHFFFAOYSA-N hydrocodone Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OC OROGSEYTTFOCAN-UHFFFAOYSA-N 0.000 description 1
- DIDJZJDDXQPTLN-UHFFFAOYSA-N indazole-1-carboxylic acid Chemical compound C1=CC=C2N(C(=O)O)N=CC2=C1 DIDJZJDDXQPTLN-UHFFFAOYSA-N 0.000 description 1
- OZBWQGNTZCKOEG-UHFFFAOYSA-N indazole-2-carboxylic acid Chemical compound C1=CC=CC2=NN(C(=O)O)C=C21 OZBWQGNTZCKOEG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- FCVFXSHIKIITAJ-UHFFFAOYSA-N methyl 3-amino-5-(trifluoromethyl)indazole-2-carboxylate Chemical compound C1=CC(C(F)(F)F)=CC2=C(N)N(C(=O)OC)N=C21 FCVFXSHIKIITAJ-UHFFFAOYSA-N 0.000 description 1
- RCVKOTDDPFBOOM-UHFFFAOYSA-N methyl 3-amino-6-chloroindazole-1-carboxylate Chemical compound C1=C(Cl)C=C2N(C(=O)OC)N=C(N)C2=C1 RCVKOTDDPFBOOM-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene chloride Substances ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 1
- 229940073584 methylene chloride Drugs 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229940127240 opiate Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- VFNMMLCUAXGPPH-UHFFFAOYSA-N propan-2-yl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate Chemical compound FC(F)(F)C1=CC=C2N(C(=O)OC(C)C)N=C(N)C2=C1 VFNMMLCUAXGPPH-UHFFFAOYSA-N 0.000 description 1
- PBHKWJXDCQXJEB-UHFFFAOYSA-N propan-2-yl 3-amino-5-(trifluoromethyl)indazole-2-carboxylate Chemical compound C1=CC(C(F)(F)F)=CC2=C(N)N(C(=O)OC(C)C)N=C21 PBHKWJXDCQXJEB-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000012749 thinning agent Substances 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (28)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2458965A DE2458965C3 (de) | 1974-12-13 | 1974-12-13 | 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
| GB44299/75A GB1490306A (en) | 1974-12-13 | 1975-10-28 | 3-amino-indazolecarboxylic acid derivatives process for their preparation and their use as medicaments |
| US05/634,914 US4051252A (en) | 1974-12-13 | 1975-11-24 | 3-aminoindazole-1 and 2-carboxylic acid derivatives |
| CA240,662A CA1059523A (en) | 1974-12-13 | 1975-11-27 | 3-aminoindazole-1 and 2-carboxylic acid derivatives |
| NO754024A NO145382C (no) | 1974-12-13 | 1975-11-28 | Analogifremgangsmaate til fremstilling av terapeutisk aktive 3-amino-indazolkarboksylsyrederivater. |
| CS758165A CS189731B2 (en) | 1974-12-13 | 1975-12-02 | Method of producing new derivatives of 3-aminoindazolcarboxylic acid |
| AU87170/75A AU493473B2 (en) | 1975-12-02 | 3-amino-indazolecarboxylic acid derivatives, process for their preparation and their use as medicaments | |
| SU752195302A SU604487A3 (ru) | 1974-12-13 | 1975-12-08 | Способ получени производных 3-аминоиндазолкарбоновой кислоты |
| CH1599575A CH622250A5 (enExample) | 1974-12-13 | 1975-12-09 | |
| IL48642A IL48642A (en) | 1974-12-13 | 1975-12-10 | 3-amino-indazolecarboxylic acid derivatives,ther preparation and pharmaceutical compositions containing them |
| BE162651A BE836528A (fr) | 1974-12-13 | 1975-12-11 | Nouveaux derives d'acide 3-amino- indazolecarboxylique |
| LU73993A LU73993A1 (enExample) | 1974-12-13 | 1975-12-11 | |
| DD190061A DD125484A5 (enExample) | 1974-12-13 | 1975-12-11 | |
| SE7513990A SE419645B (sv) | 1974-12-13 | 1975-12-11 | Sett att framstella 3-amino-indazolkarbonylsyra derivat |
| JP50146940A JPS5182266A (en) | 1974-12-13 | 1975-12-11 | 33 aminooindazoorukarubonsanjudotaino seizohoho |
| HU75BA3349A HU173557B (hu) | 1974-12-13 | 1975-12-11 | Sposob poluchenija 3-amino-indazol-karbonovojj kisloty i farmacevticheskikh kompozicijj soderzhahhikh ikh aktivnymi agentami |
| PL1975185475A PL99858B1 (pl) | 1974-12-13 | 1975-12-11 | Sposob wytwarzania nowych pochodnych kwasu 3-aminoindazolokarboksylowego |
| FI753493A FI753493A7 (enExample) | 1974-12-13 | 1975-12-11 | |
| AT939775A AT343653B (de) | 1974-12-13 | 1975-12-11 | Verfahren zur herstellung von neuen 3-amino-indazolcarbonsaure- derivaten |
| NL7514521A NL7514521A (nl) | 1974-12-13 | 1975-12-12 | Werkwijze voor het bereiden van 3-amino-indazool- carbonzuurderivaten, werkwijze voor het bereiden van een farmaceutisch preparaat met toepassing daarvan alsmede zo gevormd preparaat. |
| DK567275A DK137082C (da) | 1974-12-13 | 1975-12-12 | Analogifremgangsmaade til fremstilling af 3-aminoindazolcarboxylsyrederivater |
| IE2714/75A IE42208B1 (en) | 1974-12-13 | 1975-12-12 | 3-amino-indazlecarboxylic acid derivatives,process for their preparation and their use as medicaments |
| ES443429A ES443429A1 (es) | 1974-12-13 | 1975-12-12 | Procedimiento para preparar derivados de acido 3-amino-inda-zolcarboxilico. |
| YU03152/75A YU315275A (en) | 1974-12-13 | 1975-12-12 | Process for preparing 3-amino-indazole carboxylic acid derivatives |
| FR7538124A FR2293928A1 (fr) | 1974-12-13 | 1975-12-12 | Nouveaux derives d'acide 3-amino-indazolecarboxylique, leur procede de preparation et medicament les contenant |
| ZA757777A ZA757777B (en) | 1974-12-13 | 1975-12-12 | 3-amino-indazolecarboxylic acid derivatives,process for their preparation and their use as medicaments |
| KE3078A KE3078A (en) | 1974-12-13 | 1980-08-29 | 3-amino-indazoecarboxylic acid derivatives,process for their preparation and their use as medicaments |
| HK525/80A HK52580A (en) | 1974-12-13 | 1980-09-18 | 3-amino-indazolecarboxylic acid derivatives,process for their preparation and their use as medicaments |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2458965A DE2458965C3 (de) | 1974-12-13 | 1974-12-13 | 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2458965A1 DE2458965A1 (de) | 1976-06-16 |
| DE2458965B2 DE2458965B2 (de) | 1979-02-22 |
| DE2458965C3 true DE2458965C3 (de) | 1979-10-11 |
Family
ID=5933305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2458965A Expired DE2458965C3 (de) | 1974-12-13 | 1974-12-13 | 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4051252A (enExample) |
| JP (1) | JPS5182266A (enExample) |
| AT (1) | AT343653B (enExample) |
| BE (1) | BE836528A (enExample) |
| CA (1) | CA1059523A (enExample) |
| CH (1) | CH622250A5 (enExample) |
| CS (1) | CS189731B2 (enExample) |
| DD (1) | DD125484A5 (enExample) |
| DE (1) | DE2458965C3 (enExample) |
| DK (1) | DK137082C (enExample) |
| ES (1) | ES443429A1 (enExample) |
| FI (1) | FI753493A7 (enExample) |
| FR (1) | FR2293928A1 (enExample) |
| GB (1) | GB1490306A (enExample) |
| HK (1) | HK52580A (enExample) |
| HU (1) | HU173557B (enExample) |
| IE (1) | IE42208B1 (enExample) |
| IL (1) | IL48642A (enExample) |
| KE (1) | KE3078A (enExample) |
| LU (1) | LU73993A1 (enExample) |
| NL (1) | NL7514521A (enExample) |
| NO (1) | NO145382C (enExample) |
| PL (1) | PL99858B1 (enExample) |
| SE (1) | SE419645B (enExample) |
| SU (1) | SU604487A3 (enExample) |
| YU (1) | YU315275A (enExample) |
| ZA (1) | ZA757777B (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8372850B2 (en) | 2006-11-02 | 2013-02-12 | Vertex Pharmaceuticals Incorporated | Aminopyridines and aminopyrimidines useful as inhibitors of protein kinases |
| US8383633B2 (en) | 2007-05-02 | 2013-02-26 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8410133B2 (en) | 2007-03-09 | 2013-04-02 | Vertex Pharmaceuticals Incorporated | Aminopyridines useful as inhibitors of protein kinases |
| US8426425B2 (en) | 2006-12-19 | 2013-04-23 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as inhibitors of protein kinases |
| US8455507B2 (en) | 2007-04-13 | 2013-06-04 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8518953B2 (en) | 2007-03-09 | 2013-08-27 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as inhibitors of protein kinases |
| US8524720B2 (en) | 2000-09-15 | 2013-09-03 | Vertex Pharmaceuticals Incorporated | Substituted N-(pyrazol-5-yl)-pyrrolo[3,2-D]pyrimidin-4-amine useful as protein kinase inhibitors |
| US8557833B2 (en) | 2005-11-03 | 2013-10-15 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8633210B2 (en) | 2000-09-15 | 2014-01-21 | Vertex Pharmaceuticals Incorporated | Triazole compounds useful as protein kinase inhibitors |
| US8653088B2 (en) | 2003-02-06 | 2014-02-18 | Vertex Pharmaceuticals Incorporated | Compositions useful as inhibitors of protein kinases |
| US8664219B2 (en) | 2007-03-09 | 2014-03-04 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as inhibitors of protein kinases |
| US8785444B2 (en) | 2007-05-02 | 2014-07-22 | Vertex Pharmaceuticals Incorporated | Thiazoles and pyrazoles useful as kinase inhibitors |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4431657A (en) * | 1982-05-24 | 1984-02-14 | Ayerst, Mckenna & Harrison Inc. | Analgesic compositions consisting of 2H-benzothieno[3,2-c]pyrazol-3-amine derivatives |
| KR20010086657A (ko) * | 2000-03-02 | 2001-09-15 | 성재갑 | 아미노인다졸 유도체 및 이를 함유하는 싸이클린 의존키나아제 저해제 조성물 |
| CN1926132B (zh) * | 2000-09-15 | 2010-12-29 | 沃泰克斯药物股份有限公司 | 可用作蛋白激酶抑制剂的吡唑化合物 |
| US7473691B2 (en) * | 2000-09-15 | 2009-01-06 | Vertex Pharmaceuticals Incorporated | Pyrazole compounds useful as protein kinase inhibitors |
| EP1698627A1 (en) * | 2000-09-15 | 2006-09-06 | Vertex Pharmaceuticals Incorporated | Pyrazole compounds useful as protein kinase inhibitors |
| HUP0400639A3 (en) | 2000-12-21 | 2010-03-29 | Vertex Pharma | Pyrazole compounds useful as protein kinase inhibitors and pharmaceutical compositions containing them |
| KR100406634B1 (ko) * | 2001-03-12 | 2003-11-20 | 주식회사 엘지생명과학 | 3,5-디아미노인다졸 유도체, 그의 제조방법 및 사이클린의존성 키나아제 저해제로서의 그의 용도 |
| ES2357502T3 (es) | 2001-09-26 | 2011-04-27 | Pfizer Italia S.R.L. | Derivados de aminoindazol activos como inhibidores de quinasa, procedimiento para su preparación y composiciones farmaceuticas que los contienen. |
| KR20040084896A (ko) * | 2002-02-06 | 2004-10-06 | 버텍스 파마슈티칼스 인코포레이티드 | Gsk-3의 억제제로서 유용한 헤테로아릴 화합물 |
| FR2836915B1 (fr) * | 2002-03-11 | 2008-01-11 | Aventis Pharma Sa | Derives d'aminoindazoles, procede de preparation et intermediaires de ce procede a titre de medicaments et compositions pharmaceutiques les renfermant |
| ATE468336T1 (de) | 2002-03-15 | 2010-06-15 | Vertex Pharma | Azolylaminoazine als proteinkinasehemmer |
| EP1506176B1 (en) | 2002-05-17 | 2013-04-24 | Pfizer Italia S.r.l. | Aminoindazole derivatives active as kinase inhibitors, process for their preparation and pharmaceutical compositions comprising them |
| MY141867A (en) | 2002-06-20 | 2010-07-16 | Vertex Pharma | Substituted pyrimidines useful as protein kinase inhibitors |
| DE60308387T2 (de) | 2002-08-02 | 2007-09-20 | Vertex Pharmaceuticals Inc., Cambridge | Pyrazolenthaltende zusammensetzungen und ihre verwendung als gsk-3 inhibitoren |
| JP2006512313A (ja) * | 2002-10-31 | 2006-04-13 | アムジェン インコーポレイテッド | 抗炎症剤 |
| JP2007513184A (ja) * | 2003-12-04 | 2007-05-24 | バーテックス ファーマシューティカルズ インコーポレイテッド | プロテインキナーゼのインヒビターとして有用なキノキサリン |
| DE102004005172A1 (de) | 2004-02-02 | 2005-08-18 | Aventis Pharma Deutschland Gmbh | Indazolderivate als Inhibitoren der Hormon Sensitiven Lipase |
| AU2006279376B2 (en) | 2005-08-18 | 2011-04-14 | Vertex Pharmaceuticals Incoporated | Pyrazine kinase inhibitors |
| JP2009533474A (ja) * | 2006-04-14 | 2009-09-17 | アボット・ラボラトリーズ | バニロイドサブタイプ1(vr1)受容体を阻害するインダゾリルウレアの製造方法 |
| AU2008247595A1 (en) * | 2007-05-02 | 2008-11-13 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| AU2008257044A1 (en) * | 2007-05-24 | 2008-12-04 | Vertex Pharmaceuticals Incorporated | Thiazoles and pyrazoles useful as kinase inhibitors |
| AR067762A1 (es) | 2007-07-31 | 2009-10-21 | Vertex Pharma | Proceso para preparar 5-fluoro-1h-pirazolo (3,4-b) piridin-3-amina y derivados de la misma |
| AU2009288200A1 (en) * | 2008-09-03 | 2010-03-11 | Vertex Pharmaceuticals Incorporated | Co-crystals and pharmaceutical formulations comprising the same |
| DE102009004245A1 (de) | 2009-01-09 | 2010-07-15 | Bayer Schering Pharma Aktiengesellschaft | Neue anellierte, Heteroatom-verbrückte Pyrazol- und Imidazol-Derivate und ihre Verwendung |
| KR102137714B1 (ko) | 2012-07-24 | 2020-07-27 | 바이알 - 포르텔라 앤드 씨에이 에스에이 | 요소 화합물 및 효소 억제제로서 이들의 용도 |
| EP2882712A2 (en) * | 2012-07-27 | 2015-06-17 | BIAL - Portela & Cª S.A. | Process for the synthesis of substituted urea compounds |
| AU2014293731B2 (en) | 2013-07-24 | 2018-03-08 | Bial - Portela & Ca, S.A. | Imidazolecarboxamides and their use as FAAH inhibitors |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3133081A (en) * | 1964-05-12 | J-aminoindazole derivatives | ||
| CH397698A (de) * | 1961-09-08 | 1965-08-31 | Siegfried Ag | Verfahren zur Herstellung neuer 1-Carbamyl-indazole |
| US3277100A (en) * | 1963-05-31 | 1966-10-04 | Du Pont | Novel substituted pyrazoles |
| NL6707299A (enExample) * | 1966-07-16 | 1968-01-17 | ||
| DE1770649A1 (de) * | 1968-06-15 | 1971-11-11 | Bayer Ag | Substituierte 3-Amino-indazole |
-
1974
- 1974-12-13 DE DE2458965A patent/DE2458965C3/de not_active Expired
-
1975
- 1975-10-28 GB GB44299/75A patent/GB1490306A/en not_active Expired
- 1975-11-24 US US05/634,914 patent/US4051252A/en not_active Expired - Lifetime
- 1975-11-27 CA CA240,662A patent/CA1059523A/en not_active Expired
- 1975-11-28 NO NO754024A patent/NO145382C/no unknown
- 1975-12-02 CS CS758165A patent/CS189731B2/cs unknown
- 1975-12-08 SU SU752195302A patent/SU604487A3/ru active
- 1975-12-09 CH CH1599575A patent/CH622250A5/de not_active IP Right Cessation
- 1975-12-10 IL IL48642A patent/IL48642A/xx unknown
- 1975-12-11 LU LU73993A patent/LU73993A1/xx unknown
- 1975-12-11 DD DD190061A patent/DD125484A5/xx unknown
- 1975-12-11 PL PL1975185475A patent/PL99858B1/pl unknown
- 1975-12-11 HU HU75BA3349A patent/HU173557B/hu unknown
- 1975-12-11 BE BE162651A patent/BE836528A/xx unknown
- 1975-12-11 SE SE7513990A patent/SE419645B/xx unknown
- 1975-12-11 AT AT939775A patent/AT343653B/de not_active IP Right Cessation
- 1975-12-11 JP JP50146940A patent/JPS5182266A/ja active Pending
- 1975-12-11 FI FI753493A patent/FI753493A7/fi not_active Application Discontinuation
- 1975-12-12 YU YU03152/75A patent/YU315275A/xx unknown
- 1975-12-12 ZA ZA757777A patent/ZA757777B/xx unknown
- 1975-12-12 NL NL7514521A patent/NL7514521A/xx not_active Application Discontinuation
- 1975-12-12 DK DK567275A patent/DK137082C/da active
- 1975-12-12 IE IE2714/75A patent/IE42208B1/en unknown
- 1975-12-12 FR FR7538124A patent/FR2293928A1/fr active Granted
- 1975-12-12 ES ES443429A patent/ES443429A1/es not_active Expired
-
1980
- 1980-08-29 KE KE3078A patent/KE3078A/xx unknown
- 1980-09-18 HK HK525/80A patent/HK52580A/xx unknown
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8524720B2 (en) | 2000-09-15 | 2013-09-03 | Vertex Pharmaceuticals Incorporated | Substituted N-(pyrazol-5-yl)-pyrrolo[3,2-D]pyrimidin-4-amine useful as protein kinase inhibitors |
| US8633210B2 (en) | 2000-09-15 | 2014-01-21 | Vertex Pharmaceuticals Incorporated | Triazole compounds useful as protein kinase inhibitors |
| US8653088B2 (en) | 2003-02-06 | 2014-02-18 | Vertex Pharmaceuticals Incorporated | Compositions useful as inhibitors of protein kinases |
| US8637511B2 (en) | 2005-11-03 | 2014-01-28 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8557833B2 (en) | 2005-11-03 | 2013-10-15 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8372850B2 (en) | 2006-11-02 | 2013-02-12 | Vertex Pharmaceuticals Incorporated | Aminopyridines and aminopyrimidines useful as inhibitors of protein kinases |
| US8426425B2 (en) | 2006-12-19 | 2013-04-23 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as inhibitors of protein kinases |
| US8518953B2 (en) | 2007-03-09 | 2013-08-27 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as inhibitors of protein kinases |
| US8410133B2 (en) | 2007-03-09 | 2013-04-02 | Vertex Pharmaceuticals Incorporated | Aminopyridines useful as inhibitors of protein kinases |
| US8664219B2 (en) | 2007-03-09 | 2014-03-04 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as inhibitors of protein kinases |
| US8735593B2 (en) | 2007-03-09 | 2014-05-27 | Vertex Pharmaceuticals Incorporated | Aminopyridines useful as inhibitors of protein kinases |
| US8455507B2 (en) | 2007-04-13 | 2013-06-04 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8383633B2 (en) | 2007-05-02 | 2013-02-26 | Vertex Pharmaceuticals Incorporated | Aminopyrimidines useful as kinase inhibitors |
| US8785444B2 (en) | 2007-05-02 | 2014-07-22 | Vertex Pharmaceuticals Incorporated | Thiazoles and pyrazoles useful as kinase inhibitors |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2458965C3 (de) | 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel | |
| DE1543715A1 (de) | Verfahren zur Herstellung von basischen Derivaten von Phthalanen und Isochromanen | |
| DE2446010A1 (de) | 4-(monoalkylamino)benzoesaeurederivate und verfahren zu ihrer herstellung | |
| DE29724281U1 (de) | 4-Phenylpiperidin-Verbindungen | |
| DE2543252A1 (de) | Phenylsulfinylalkylamidine, verfahren zu ihrer herstellung und diese enthaltende heilmittel | |
| DE2457305A1 (de) | Pyridoindole, verfahren zu deren herstellung und ihre verwendung | |
| DE2846946A1 (de) | Imidazolidinderivate | |
| DE2311570C2 (de) | 4-Aminochinoline, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2846945A1 (de) | Pharmazeutische praeparate | |
| CH500987A (de) | Neues Verfahren zur Herstellung von 2-Arylamino-1,3-diazacycloalkenen-(2) | |
| DE1445603A1 (de) | Verfahren zur Herstellung von neuen Oxadiazolderivaten | |
| DE2727047A1 (de) | Indol-derivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische praeparate | |
| DE2426149A1 (de) | Fluor-substituierte phenthiazine | |
| DE2446100C3 (de) | Phenoxyalkancarbonsäureamide von Thiazolidincarbonsäuren, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE1926359A1 (de) | oxylkansaeuren | |
| DE2635854A1 (de) | Pyrrolin-2-on-derivate, verfahren zu ihrer herstellung und sie enthaltendes arzneimittel | |
| DE2166662C3 (de) | Dibenzothiazepinderivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2059949B2 (de) | Thienyl-fettsäurederivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2035797A1 (de) | Neue Nitrofurandenvate , ein Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE1695790C3 (de) | S-Phenoxythionocarbonylderivate des Vitamins B tief 1 | |
| DE2511802A1 (de) | Alkoxyanilide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2756852A1 (de) | 1-amino-niedrig-alkyl-3,4-diphenyl- 1h-pyrazole | |
| DE3245950A1 (de) | Verfahren zur herstellung substituierter pyridine | |
| DE1768818C3 (de) | Anthranilsäureamide und Verfahren zu deren Herstellung | |
| DE1770177A1 (de) | Monoaryl-substituierte Oxazole |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |