DE2029992A1 - - Google Patents
Info
- Publication number
- DE2029992A1 DE2029992A1 DE19702029992 DE2029992A DE2029992A1 DE 2029992 A1 DE2029992 A1 DE 2029992A1 DE 19702029992 DE19702029992 DE 19702029992 DE 2029992 A DE2029992 A DE 2029992A DE 2029992 A1 DE2029992 A1 DE 2029992A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- titanium
- magnesium halide
- electron donor
- catalysts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 magnesium halide Chemical class 0.000 claims description 56
- 239000010936 titanium Substances 0.000 claims description 55
- 150000001875 compounds Chemical class 0.000 claims description 38
- 229920000642 polymer Polymers 0.000 claims description 31
- 239000011777 magnesium Substances 0.000 claims description 27
- 229910052749 magnesium Inorganic materials 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 25
- 238000006116 polymerization reaction Methods 0.000 claims description 22
- 229910052719 titanium Inorganic materials 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 20
- 150000003609 titanium compounds Chemical class 0.000 claims description 19
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 15
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 12
- 239000005977 Ethylene Substances 0.000 claims description 12
- 150000002902 organometallic compounds Chemical class 0.000 claims description 11
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 8
- 230000000737 periodic effect Effects 0.000 claims description 8
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 claims description 7
- 150000004678 hydrides Chemical class 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 150000002739 metals Chemical class 0.000 claims description 7
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- 238000010586 diagram Methods 0.000 claims description 5
- 238000001228 spectrum Methods 0.000 claims description 5
- 229930192474 thiophene Natural products 0.000 claims description 5
- 238000000227 grinding Methods 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 238000002156 mixing Methods 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 230000004913 activation Effects 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 3
- 239000002685 polymerization catalyst Substances 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 239000002879 Lewis base Substances 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- 229910052785 arsenic Inorganic materials 0.000 claims description 2
- 238000000354 decomposition reaction Methods 0.000 claims description 2
- 150000001993 dienes Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000007527 lewis bases Chemical class 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 2
- 239000004711 α-olefin Substances 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 239000000047 product Substances 0.000 claims 2
- XIEQDDLBXUOZOD-UHFFFAOYSA-N 2,3,4a,6,7,8a-hexahydro-[1,4]dioxino[2,3-b][1,4]dioxine Chemical compound O1CCOC2OCCOC21 XIEQDDLBXUOZOD-UHFFFAOYSA-N 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 239000013078 crystal Substances 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- 239000004698 Polyethylene Substances 0.000 description 23
- 229920000573 polyethylene Polymers 0.000 description 23
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 10
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 230000000379 polymerizing effect Effects 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000008139 complexing agent Substances 0.000 description 3
- 238000007334 copolymerization reaction Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910001629 magnesium chloride Inorganic materials 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- KCXZNSGUUQJJTR-UHFFFAOYSA-N Di-n-hexyl phthalate Chemical compound CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC KCXZNSGUUQJJTR-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910001623 magnesium bromide Inorganic materials 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- 238000002083 X-ray spectrum Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- IEPRKVQEAMIZSS-AATRIKPKSA-N diethyl fumarate Chemical compound CCOC(=O)\C=C\C(=O)OCC IEPRKVQEAMIZSS-AATRIKPKSA-N 0.000 description 1
- 238000007323 disproportionation reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002483 hydrogen compounds Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical class [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- 150000003682 vanadium compounds Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/02—Carriers therefor
- C08F4/022—Magnesium halide as support anhydrous or hydrated or complexed by means of a Lewis base for Ziegler-type catalysts
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S526/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S526/906—Comminution of transition metal containing catalyst
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1846269 | 1969-06-20 | ||
| IT1882369 | 1969-06-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2029992A1 true DE2029992A1 (https=) | 1970-12-23 |
| DE2029992B2 DE2029992B2 (de) | 1974-08-15 |
| DE2029992C3 DE2029992C3 (de) | 1975-04-17 |
Family
ID=26326998
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2029992A Expired DE2029992C3 (de) | 1969-06-20 | 1970-06-18 | Verfahren zur Herstellung von Polymerisationskatalysatoren |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4544717A (https=) |
| JP (1) | JPS5819334B1 (https=) |
| AT (1) | AT302648B (https=) |
| BE (1) | BE752252A (https=) |
| CS (1) | CS153084B2 (https=) |
| DE (1) | DE2029992C3 (https=) |
| DK (1) | DK130744B (https=) |
| ES (1) | ES380918A1 (https=) |
| FR (1) | FR2052706A5 (https=) |
| GB (1) | GB1310547A (https=) |
| IL (1) | IL34739A (https=) |
| NL (1) | NL162664B (https=) |
| PL (1) | PL80715B1 (https=) |
| RO (1) | RO62731A (https=) |
| SE (1) | SE417611B (https=) |
| SU (1) | SU414770A3 (https=) |
| YU (1) | YU36189B (https=) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2230672A1 (de) * | 1971-06-25 | 1972-12-28 | Montedison Spa | Verfahren zur stereoregulären Polymerisation von alpha-Olefinen |
| DE2347577A1 (de) * | 1972-09-26 | 1974-05-02 | Montedison Spa | Verfahren zur stereospezifischen polymerisation von alpha-olefinen |
| DE2515211A1 (de) * | 1974-04-08 | 1975-10-16 | Mitsubishi Chem Ind | Katalysator zur polymerisation von olefinen |
| FR2697526A1 (fr) * | 1992-10-30 | 1994-05-06 | Bp Chemicals Snc | Procédé de préparation d'un catalyseur de type Ziegler-Natta pour la polymérisation des oléfines. |
| US5539067A (en) * | 1980-08-13 | 1996-07-23 | Montedison S.P.A. | Components and catalysts for the polymerization of olefins |
| US6777508B1 (en) | 1980-08-13 | 2004-08-17 | Basell Poliolefine Italia S.P.A. | Catalysts for the polymerization of olefins |
Families Citing this family (101)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL162664B (nl) * | 1969-06-20 | 1980-01-15 | Montedison Spa | Werkwijze om een katalysator te bereiden voor de poly- merisatie van alkenen-1. |
| NL7113778A (https=) * | 1970-10-13 | 1972-04-17 | ||
| NL7114641A (https=) * | 1970-10-29 | 1972-05-03 | ||
| CH543546A (fr) | 1971-03-23 | 1973-10-31 | Solvay | Système catalytique de polymérisation des alpha-oléfines |
| US4226963A (en) | 1971-06-25 | 1980-10-07 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha-olephins |
| US4107413A (en) | 1971-06-25 | 1978-08-15 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha olefins |
| US4187196A (en) | 1971-06-25 | 1980-02-05 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha-olefins |
| US4156063A (en) | 1971-06-25 | 1979-05-22 | Montecanti Edison, S.p.A. | Process for the stereoregular polymerization of alpha olefins |
| US4107414A (en) | 1971-06-25 | 1978-08-15 | Montecatini Edison S.P.A. | Process for the stereoregular polymerization of alpha olefins |
| IT1005486B (it) | 1974-02-15 | 1976-08-20 | Montedison Spa | Gomme termoplastiche e processo per la loro preparazione |
| US4174429A (en) * | 1975-03-28 | 1979-11-13 | Montedison S.P.A. | Process for polymerizing olefins |
| JPS5242584A (en) | 1975-10-02 | 1977-04-02 | Nippon Oil Co Ltd | Process for producing polyolefine |
| IT1054410B (it) * | 1975-11-21 | 1981-11-10 | Mitsui Petrochemical Ind | Catalizzatori per la polimerizzazione delle alfa olefine |
| JPS5952643B2 (ja) * | 1977-01-27 | 1984-12-20 | 三井化学株式会社 | エチレン共重合体 |
| CA1125733A (en) * | 1978-03-27 | 1982-06-15 | Arthur W. Langer, Jr. | T.sub.nmr' in3-n xx cocatalysts |
| CA1142161A (en) * | 1978-03-29 | 1983-03-01 | Exxon Research And Engineering Company | Trialkyl aluminum cocatalyst |
| CA1144300A (en) * | 1978-11-20 | 1983-04-05 | Allen Noshay | Preparation of low density ethylene copolymers in fluid bed reactor |
| US4243552A (en) | 1978-12-11 | 1981-01-06 | Phillips Petroleum Company | Polymerization catalyst and process |
| JPS5923561B2 (ja) * | 1979-02-06 | 1984-06-02 | 三井化学株式会社 | オレフインの重合方法 |
| US4224182A (en) * | 1979-03-07 | 1980-09-23 | Exxon Research & Engineering Co. | Novel hindered alkyl aluminum amide cocatalysts |
| US4308369A (en) * | 1979-09-28 | 1981-12-29 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| US4482687A (en) * | 1979-10-26 | 1984-11-13 | Union Carbide Corporation | Preparation of low-density ethylene copolymers in fluid bed reactor |
| JPS58125706A (ja) * | 1982-01-22 | 1983-07-26 | Mitsubishi Petrochem Co Ltd | エチレンの重合法 |
| US5064795A (en) * | 1982-08-27 | 1991-11-12 | Phillips Petroleum Company | Polymerization of olefins |
| JPS58189189A (ja) * | 1982-09-20 | 1983-11-04 | Mitsubishi Chem Ind Ltd | 塩化マグネシウム・テトラビドロフラン錯体のテトラヒドロフラン溶液の製造方法 |
| US4988656A (en) * | 1984-03-23 | 1991-01-29 | Amoco Corporation | Olefin polymerization catalyst |
| US4866022A (en) * | 1984-03-23 | 1989-09-12 | Amoco Corporation | Olefin polymerization catalyst |
| FI75842C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75841C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75845C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75843C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75844C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| US4829038A (en) * | 1986-06-17 | 1989-05-09 | Amoco Corporation | Alpha-olefin polymerization catalyst system including an advantageous modifier component |
| IT1197320B (it) * | 1986-10-02 | 1988-11-30 | Ausimont Spa | Catalizzatori per la preparazione di copolimeri olefinici elastomerici,saturi ed insaturi,e vopolimeri con essi ottenuti |
| US4810761A (en) * | 1987-03-31 | 1989-03-07 | Union Carbide Corporation | Ethylene polymerization catalyst |
| US4870040A (en) * | 1987-11-24 | 1989-09-26 | Shell Oil Company | Olefin polymerization catalysts from soluble magnesium alkoxides made from alkyl or aryl magnesium mixed with a branched or aromatic aldehyde |
| US4870039A (en) * | 1987-11-24 | 1989-09-26 | Shell Oil Company | Olefin polymerization catalysts from soluble magnesium alkoxides made from mixed magnesium alkyls and aryls |
| FR2639351B1 (https=) * | 1988-11-23 | 1992-12-31 | Atochem | |
| NO176841C (no) * | 1989-04-27 | 1995-06-07 | Sumitomo Chemical Co | Flytende katalysatorkomponent, katalysatorsystem inneholdende denne og fremgangsmåte for fremstilling av etylen - lefin-kopolymerer ved anvendelse av katalysatorsystemet |
| FI85151C (fi) * | 1989-09-06 | 1992-03-10 | Neste Oy | Ny baerarkatalysator foer polymerisation av eten. |
| FR2686608B1 (fr) * | 1992-01-27 | 1994-03-18 | Elf Atochem Sa | Procede d'activation de support a base de chlorure de magnesium entrant dans la fabrication de la composante catalytique de polymerisation de l'ethylene. |
| US5378672A (en) * | 1992-03-04 | 1995-01-03 | Fina Technology, Inc. | Methods and systems for multi-component catalyst formulation |
| EP0585511B1 (en) * | 1992-08-31 | 1997-01-15 | Fina Research S.A. | Magnesium chloride complexes, process and uses |
| IT1255523B (it) * | 1992-09-24 | 1995-11-09 | Himont Inc | Componenti e catalizzatori per la polimerizzazione di olefine |
| JPH09328513A (ja) * | 1996-04-09 | 1997-12-22 | Mitsui Petrochem Ind Ltd | 固体状チタン触媒成分の調製方法、オレフィンの重合用触媒およびオレフィン重合方法 |
| US5807800A (en) * | 1997-02-11 | 1998-09-15 | Fina Technology, Inc. | Process for producing stereospecific polymers |
| TW396168B (en) * | 1997-08-28 | 2000-07-01 | Toho Titanium K K | Solid catalyst component and catalyst for polymerization of olefins |
| US5908594A (en) * | 1997-09-24 | 1999-06-01 | Fina Technology, Inc. | Process of making polypropylene fiber |
| US6090325A (en) * | 1997-09-24 | 2000-07-18 | Fina Technology, Inc. | Biaxially-oriented metallocene-based polypropylene films |
| US5958566A (en) | 1997-10-17 | 1999-09-28 | Fina Technology, Inc. | Metal bond strength in polyolefin films |
| US5997679A (en) * | 1997-10-17 | 1999-12-07 | Fina Technology, Inc. | Heat-seal strength in polyolefin films |
| US6207093B1 (en) | 1998-04-24 | 2001-03-27 | Fina Technology, Inc. | Compositions for improved orientation processing |
| EP1020404A1 (en) * | 1999-01-18 | 2000-07-19 | Fina Research S.A. | Production of powder catalysts |
| US6416699B1 (en) | 1999-06-09 | 2002-07-09 | Fina Technology, Inc. | Reduced shrinkage in metallocene isotactic polypropylene fibers |
| US7235192B2 (en) | 1999-12-01 | 2007-06-26 | General Electric Company | Capped poly(arylene ether) composition and method |
| US6905637B2 (en) | 2001-01-18 | 2005-06-14 | General Electric Company | Electrically conductive thermoset composition, method for the preparation thereof, and articles derived therefrom |
| US6878782B2 (en) * | 1999-12-01 | 2005-04-12 | General Electric | Thermoset composition, method, and article |
| SG95635A1 (en) * | 2000-03-30 | 2003-04-23 | Sumitomo Chemical Co | Process for producing catalyst for ethylene polymerization and process for producing ehtylene polymer |
| US6916892B2 (en) * | 2001-12-03 | 2005-07-12 | Fina Technology, Inc. | Method for transitioning between Ziegler-Natta and metallocene catalysts in a bulk loop reactor for the production of polypropylene |
| US6733719B2 (en) * | 2002-01-14 | 2004-05-11 | Sunoco Inc. (R&M) | Polypropylene biaxially oriented film |
| US6998431B2 (en) | 2002-03-28 | 2006-02-14 | Fina Technology, Inc. | Polymerization process |
| US7025919B2 (en) * | 2002-03-28 | 2006-04-11 | Fina Technology, Inc. | Syndiotactic polypropylene fibers |
| US6824721B2 (en) * | 2002-03-29 | 2004-11-30 | Fina Technology, Inc. | Polypropylene fibers |
| US20030215588A1 (en) * | 2002-04-09 | 2003-11-20 | Yeager Gary William | Thermoset composition, method, and article |
| US6878327B2 (en) * | 2002-04-19 | 2005-04-12 | Fina Technology, Inc. | Process of making polypropylene fibers |
| US6657024B1 (en) * | 2002-09-03 | 2003-12-02 | Fina Technology, Inc. | Polymerization catalyst system using n-butylmethyldimethoxysilane for preparation of polypropylene film grade resins |
| ATE498648T1 (de) * | 2002-10-11 | 2011-03-15 | Univ Connecticut | Mischungen von amorphen und semikristallinen polymeren mit formgedächtniseigenscchaften |
| US7078468B2 (en) * | 2003-06-27 | 2006-07-18 | Fina Technology, Inc. | Polymerization catalyst system using di-sec-butyldimethoxysilane for preparation of polypropylene |
| US20060009603A1 (en) * | 2004-07-09 | 2006-01-12 | David Young | Fibrillation-resistant polypropylene tape |
| CN100338018C (zh) | 2004-10-29 | 2007-09-19 | 中国石油化工股份有限公司 | 一种环戊酯类化合物及其合成方法和应用 |
| US7053163B1 (en) | 2005-02-22 | 2006-05-30 | Fina Technology, Inc. | Controlled comonomer distribution along a reactor for copolymer production |
| US7413812B2 (en) * | 2005-04-26 | 2008-08-19 | Fina Technology, Inc. | Polypropylene article and method of preparing polypropylene article |
| US20060279026A1 (en) * | 2005-06-09 | 2006-12-14 | Fina Technology, Inc. | Polypropylene composition for injection stretch blow molding |
| US20070045894A1 (en) * | 2005-08-31 | 2007-03-01 | Mcleod Michael A | Process for producing polyolefin films |
| US20070110997A1 (en) * | 2005-11-17 | 2007-05-17 | Fina Technology, Inc. | Polymeric film structures and compositions for high surface treatment retention |
| US7446167B2 (en) * | 2006-04-13 | 2008-11-04 | Fina Technology, Inc. | Catalyst deactivation agents and methods for use of same |
| US20080061468A1 (en) * | 2006-09-07 | 2008-03-13 | Frank Li | Fiber processing of high ethylene level propylene-ethylene random copolymers by use of nucleators |
| MX2009003414A (es) | 2006-12-15 | 2009-04-09 | Fina Technology | Pelicula soplada de polipropileno. |
| MX2009003471A (es) * | 2006-12-29 | 2009-04-15 | Fina Technology | Sistema de catalizador de polimerizacion que contiene succinato usando n-butilmetildimeto-xisilano para la preparacion de resinas de grado de pelicula de polipropileno. |
| US7473751B2 (en) * | 2007-01-22 | 2009-01-06 | Fina Technology, Inc. | Biaxially-oriented metallocene-based polypropylene films having reduced thickness |
| US8859084B2 (en) * | 2008-01-29 | 2014-10-14 | Fina Technology, Inc. | Modifiers for oriented polypropylene |
| US20090202770A1 (en) * | 2008-02-08 | 2009-08-13 | Fengkui Li | Polypropylene/polyisobutylene blends and films prepared from same |
| US8759446B2 (en) | 2008-06-30 | 2014-06-24 | Fina Technology, Inc. | Compatibilized polypropylene and polylactic acid blends and methods of making and using same |
| US8268913B2 (en) * | 2008-06-30 | 2012-09-18 | Fina Technology, Inc. | Polymeric blends and methods of using same |
| US8545971B2 (en) * | 2008-06-30 | 2013-10-01 | Fina Technology, Inc. | Polymeric compositions comprising polylactic acid and methods of making and using same |
| US20100087602A1 (en) * | 2008-10-08 | 2010-04-08 | Fina Technology, Inc. | Long chain branched polypropylene for cast film applications |
| CN101735346B (zh) * | 2008-11-07 | 2012-05-30 | 中国石油天然气股份有限公司 | 一种丙烯均聚和共聚的催化剂及其制备方法和应用 |
| US20100125124A1 (en) * | 2008-11-17 | 2010-05-20 | Fina Technology, Inc. | Methods of catalyst activation |
| US9174384B2 (en) * | 2009-09-01 | 2015-11-03 | Fina Technology, Inc. | Multilayer polypropylene films and methods of making and using same |
| CN102666598B (zh) | 2009-12-31 | 2015-08-12 | 晓星株式会社 | 烯烃聚合用齐格勒-纳塔催化剂 |
| RU2458938C1 (ru) * | 2010-12-02 | 2012-08-20 | Закрытое Акционерное Общество "Сибур Холдинг" | Каталитическая система, способ ее получения и полиолефины, полученные на ее основе |
| CA3024108A1 (en) | 2016-05-20 | 2017-11-23 | Equistar Chemicals, Lp | In-line polyolefin based adhesive compositions having graft polyolefin/elastomer copolymers |
| EP3532291A4 (en) | 2016-10-28 | 2020-06-03 | Fina Technology, Inc. | USE OF AGENTS FOR REDUCING CRYSTALLINITY IN POLYPROPYLENE FOR BOPP APPLICATIONS |
| CA3044047C (en) | 2016-11-18 | 2021-03-09 | Equistar Chemicals, Lp | Polyolefin materials for rotational molding applications having improved impact properties and color stability |
| EP3574048B1 (en) | 2017-01-27 | 2023-07-26 | Equistar Chemicals LP | Peroxide-modified polyethylene, compositions, and applications |
| US10654956B2 (en) | 2017-05-03 | 2020-05-19 | Equistar Chemicals, Lp | Ethylene alpha-olefin copolymers and methods |
| WO2019050954A1 (en) | 2017-09-08 | 2019-03-14 | Equistar Chemicals, Lp | POLYOLEFIN ADHESIVE COMPOSITIONS HAVING GRAFT POLYOLEFIN COPOLYMERS AND METHODS OF FORMING |
| US11993699B2 (en) | 2018-09-14 | 2024-05-28 | Fina Technology, Inc. | Polyethylene and controlled rheology polypropylene polymer blends and methods of use |
| EP3927765A1 (en) | 2019-02-20 | 2021-12-29 | Fina Technology, Inc. | Polymer compositions with low warpage |
| EP4172259A1 (en) | 2020-06-30 | 2023-05-03 | Fina Technology, Inc. | Clear polypropylene composition for thermoforming |
| EP4626939A1 (en) | 2022-11-29 | 2025-10-08 | FINA Technology Inc. | Polypropylenes for additive manufacturing |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2981725A (en) * | 1955-11-16 | 1961-04-25 | Shell Oil Co | Process for polymerizing olefins |
| US3008943A (en) * | 1955-12-01 | 1961-11-14 | Exxon Research Engineering Co | Polymerization catalyst |
| BE554242A (https=) * | 1956-01-18 | |||
| BE574129A (https=) * | 1957-12-23 | |||
| BE576984A (https=) * | 1958-03-24 | |||
| BE580006A (https=) * | 1958-06-27 | |||
| BE584091A (https=) * | 1958-10-30 | |||
| US3193545A (en) * | 1958-12-03 | 1965-07-06 | Exxon Research Engineering Co | Catalyst and process for polymerizing alpha-olefins utilizing titanium halide derivatives |
| BE585927A (https=) * | 1958-12-23 | |||
| FR1291788A (fr) * | 1960-03-21 | 1962-04-27 | Shell Int Research | Procédé de préparation de nouveaux catalyseurs de polymérisation |
| US3238146A (en) * | 1960-03-21 | 1966-03-01 | Shell Oil Co | Catalysts and their preparation |
| IT629253A (https=) * | 1960-04-27 | |||
| DE1445225B2 (de) * | 1960-09-24 | 1971-11-18 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Verfahren zur polymerisation von monoalpha olefinen mit drei oder mehr kohlenstoffatomen |
| NL273776A (https=) * | 1961-01-30 | |||
| US3210332A (en) * | 1963-05-03 | 1965-10-05 | Phillips Petroleum Co | Production of solid olefin polymers |
| US3476730A (en) * | 1966-07-22 | 1969-11-04 | Huels Chemische Werke Ag | Process for low-pressure polymerization of alpha-olefines |
| NL137056C (https=) * | 1966-10-21 | |||
| CA920299A (en) * | 1968-08-01 | 1973-01-30 | Mitsui Petrochemical Industries | Process for the polymerization and/or copolymerization of olefins with use of ziegler-type catalytsts supported on carrier |
| YU35844B (en) * | 1968-11-25 | 1981-08-31 | Montedison Spa | Process for obtaining catalysts for the polymerization of olefines |
| SE367327B (https=) * | 1969-03-24 | 1974-05-27 | Montedison Spa | |
| NL162664B (nl) * | 1969-06-20 | 1980-01-15 | Montedison Spa | Werkwijze om een katalysator te bereiden voor de poly- merisatie van alkenen-1. |
-
1970
- 1970-06-15 NL NL7008708.A patent/NL162664B/xx not_active Application Discontinuation
- 1970-06-16 DK DK309870AA patent/DK130744B/da not_active IP Right Cessation
- 1970-06-16 SE SE7008315A patent/SE417611B/sv unknown
- 1970-06-17 GB GB2930170A patent/GB1310547A/en not_active Expired
- 1970-06-17 FR FR7022249A patent/FR2052706A5/fr not_active Expired
- 1970-06-17 YU YU1539/70A patent/YU36189B/xx unknown
- 1970-06-17 PL PL1970141392A patent/PL80715B1/pl unknown
- 1970-06-17 SU SU1444973A patent/SU414770A3/ru active
- 1970-06-17 IL IL34739A patent/IL34739A/xx unknown
- 1970-06-18 DE DE2029992A patent/DE2029992C3/de not_active Expired
- 1970-06-18 JP JP45052439A patent/JPS5819334B1/ja active Granted
- 1970-06-19 CS CS432070A patent/CS153084B2/cs unknown
- 1970-06-19 ES ES380918A patent/ES380918A1/es not_active Expired
- 1970-06-19 BE BE752252D patent/BE752252A/xx not_active IP Right Cessation
- 1970-06-19 AT AT552370A patent/AT302648B/de not_active IP Right Cessation
- 1970-06-20 RO RO7000063695A patent/RO62731A/ro unknown
-
1980
- 1980-05-22 US US06/152,531 patent/US4544717A/en not_active Expired - Lifetime
-
1985
- 1985-07-30 US US06/760,539 patent/US4636486A/en not_active Expired - Lifetime
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2230672A1 (de) * | 1971-06-25 | 1972-12-28 | Montedison Spa | Verfahren zur stereoregulären Polymerisation von alpha-Olefinen |
| DE2230728A1 (de) * | 1971-06-25 | 1972-12-28 | Montedison Spa | Verfahren zur stereoregulären Polymerisation von alpha-Olefinen |
| DE2230752A1 (de) * | 1971-06-25 | 1972-12-28 | Montedison Spa | Verfahren zur stereoregulären Polymerisation von alpha-Olefinen |
| DE2347577A1 (de) * | 1972-09-26 | 1974-05-02 | Montedison Spa | Verfahren zur stereospezifischen polymerisation von alpha-olefinen |
| DE2515211A1 (de) * | 1974-04-08 | 1975-10-16 | Mitsubishi Chem Ind | Katalysator zur polymerisation von olefinen |
| US5539067A (en) * | 1980-08-13 | 1996-07-23 | Montedison S.P.A. | Components and catalysts for the polymerization of olefins |
| US6194342B1 (en) | 1980-08-13 | 2001-02-27 | Montell Technology Company Bv | Components and catalysts for the polymerization of olefins |
| US6515085B1 (en) | 1980-08-13 | 2003-02-04 | Basell Poliolefine Italia S.P.A. | Components and catalysts for the polymerization of olefins |
| US6777508B1 (en) | 1980-08-13 | 2004-08-17 | Basell Poliolefine Italia S.P.A. | Catalysts for the polymerization of olefins |
| FR2697526A1 (fr) * | 1992-10-30 | 1994-05-06 | Bp Chemicals Snc | Procédé de préparation d'un catalyseur de type Ziegler-Natta pour la polymérisation des oléfines. |
Also Published As
| Publication number | Publication date |
|---|---|
| US4636486A (en) | 1987-01-13 |
| SU414770A3 (ru) | 1974-02-05 |
| NL7008708A (https=) | 1970-12-22 |
| DK130744B (da) | 1975-04-07 |
| DE2029992C3 (de) | 1975-04-17 |
| PL80715B1 (https=) | 1975-08-30 |
| US4544717A (en) | 1985-10-01 |
| SE417611B (sv) | 1981-03-30 |
| NL162664B (nl) | 1980-01-15 |
| CS153084B2 (https=) | 1974-02-22 |
| IL34739A0 (en) | 1970-08-19 |
| RO62731A (fr) | 1978-03-15 |
| BE752252A (fr) | 1970-12-21 |
| DE2029992B2 (de) | 1974-08-15 |
| DK130744C (https=) | 1975-09-08 |
| YU153970A (en) | 1981-06-30 |
| JPS5819334B1 (https=) | 1983-04-18 |
| YU36189B (en) | 1982-02-25 |
| GB1310547A (en) | 1973-03-21 |
| ES380918A1 (es) | 1973-04-01 |
| IL34739A (en) | 1973-10-25 |
| FR2052706A5 (https=) | 1971-04-09 |
| AT302648B (de) | 1972-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2029992A1 (https=) | ||
| DE2135884C2 (de) | Verfahren zur Polymerisation von Äthylen oder dessen Gemischen mit α-Olefinen und/oder Diolefinen | |
| DE3228065C2 (https=) | ||
| DE2660216C2 (de) | Feste Katalysatorkomponente zur Polymerisation von α-Olefinen | |
| DE2560501C2 (de) | Magnesiumchlorid-Tetrahydrofuran-Komplexe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1958488A1 (de) | Neue Polymerisationskatalysatoren,ihre Herstellung und Verwendung | |
| DE2013730A1 (de) | Neue Polymerisationskatalysatoren, ihre Herstellung und Verwendung | |
| DE2724974A1 (de) | Katalysatorkomponente, verfahren zu ihrer herstellung und die sie enthaltenden katalysatoren | |
| DE1520721B2 (de) | Verfahren zur polymerisation von propylen in der wirbelschicht | |
| DE1816048B2 (de) | Verfahren zur polymerisation und mischpolymerisation von olefinen | |
| DE2216357C2 (de) | Verfahren zur Herstellung von Katalysatoren für die Polymerisation und Copolymerisation von Olefinen und Verwendung dieser Katalysatoren zur Äthylenpolymerisation | |
| DE2731241A1 (de) | Verfahren zur herstellung von violettem titantrichlorid und dessen verwendung | |
| DE2000586B2 (de) | Verfahren zur Herstellung von Polymerisationskatalysatoren | |
| DE2218692A1 (de) | Verfahren zur Herstellung von Polyme nsationskatalysatoren und deren Verwendung | |
| DE2030753A1 (de) | Neue Polymerisationskatalysatoren, ihre Herstellung und Verwendung | |
| DE1177346B (de) | Verfahren zur Polymerisation von ª‡-olefinischen Kohlenwasserstoffen mit mindestens drei Kohlenstoffatomen | |
| DE2125107C2 (de) | Verfahren zur Herstellung von Polymerisationskatalysatoren und deren Verwendung zur Polymerisation von Äthylen | |
| DE1958585C3 (de) | Verfahren zur Herstellung von Äthylenhomopolymerisaten oder -copolymerisaten mit a-Olefinen | |
| DE2346714C2 (de) | Verfahren zum Polymerisieren von α-Olefinen zu Polyolefinwachsen | |
| DE1957815A1 (de) | Verfahren zur Herstellung von linearem Polyaethylen | |
| DE1442914A1 (de) | Verfahren zur Herstellung von Polymerisationskatalysatoren | |
| DE1645048A1 (de) | Polymere von ungesaettigten tertiaeren Aminen,ihre Herstellung und Verwendung | |
| DE2037603A1 (de) | Neue Polymerisationskatalysatoren, ihre Herstellung und Verwendung | |
| DE2033468A1 (de) | Polymerisationskatalysatoren, ihre Herstellung und Verwendung | |
| DE1645250B2 (de) | Verfahren zur Herstellung von isotaktischen Polyolefinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |