DK152137B - - Google Patents
Download PDFInfo
- Publication number
- DK152137B DK152137B DK252274AA DK252274A DK152137B DK 152137 B DK152137 B DK 152137B DK 252274A A DK252274A A DK 252274AA DK 252274 A DK252274 A DK 252274A DK 152137 B DK152137 B DK 152137B
- Authority
- DK
- Denmark
- Prior art keywords
- approx
- sodium
- weight
- water
- detergent
- Prior art date
Links
- 239000003599 detergent Substances 0.000 claims description 93
- 239000000203 mixture Substances 0.000 claims description 93
- 239000011734 sodium Substances 0.000 claims description 62
- 239000000463 material Substances 0.000 claims description 54
- 238000005342 ion exchange Methods 0.000 claims description 40
- 229910052782 aluminium Inorganic materials 0.000 claims description 39
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- 229910001868 water Inorganic materials 0.000 claims description 27
- 239000002245 particle Substances 0.000 claims description 23
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 claims description 21
- 239000000377 silicon dioxide Substances 0.000 claims description 21
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 17
- 229910052681 coesite Inorganic materials 0.000 claims description 17
- 229910052906 cristobalite Inorganic materials 0.000 claims description 17
- 229910052682 stishovite Inorganic materials 0.000 claims description 17
- 229910052905 tridymite Inorganic materials 0.000 claims description 17
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims description 14
- 229910001424 calcium ion Inorganic materials 0.000 claims description 14
- 235000012239 silicon dioxide Nutrition 0.000 claims description 14
- CSDREXVUYHZDNP-UHFFFAOYSA-N alumanylidynesilicon Chemical group [Al].[Si] CSDREXVUYHZDNP-UHFFFAOYSA-N 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 239000004094 surface-active agent Substances 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 5
- 239000004115 Sodium Silicate Substances 0.000 claims description 5
- 229910021645 metal ion Inorganic materials 0.000 claims description 5
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical group [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 4
- 229910009112 xH2O Inorganic materials 0.000 claims description 3
- 238000004061 bleaching Methods 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 description 55
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 54
- 125000004432 carbon atom Chemical group C* 0.000 description 50
- -1 aluminum silicates Chemical class 0.000 description 46
- 235000019589 hardness Nutrition 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 28
- 238000005406 washing Methods 0.000 description 25
- 238000000034 method Methods 0.000 description 21
- 150000003839 salts Chemical class 0.000 description 20
- 239000007788 liquid Substances 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 17
- 239000011575 calcium Substances 0.000 description 15
- 229910052799 carbon Inorganic materials 0.000 description 14
- 125000000217 alkyl group Chemical group 0.000 description 13
- 150000002500 ions Chemical class 0.000 description 13
- 239000011591 potassium Substances 0.000 description 13
- 229910052700 potassium Inorganic materials 0.000 description 13
- 239000007859 condensation product Substances 0.000 description 12
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 11
- 150000001768 cations Chemical class 0.000 description 11
- 235000013162 Cocos nucifera Nutrition 0.000 description 10
- 244000060011 Cocos nucifera Species 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- 241000282326 Felis catus Species 0.000 description 9
- 150000001721 carbon Chemical group 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 8
- 239000003925 fat Substances 0.000 description 8
- 235000019197 fats Nutrition 0.000 description 8
- 239000011777 magnesium Substances 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000010457 zeolite Substances 0.000 description 8
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 238000007046 ethoxylation reaction Methods 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- 150000002825 nitriles Chemical class 0.000 description 7
- 159000000001 potassium salts Chemical class 0.000 description 7
- 239000000344 soap Substances 0.000 description 7
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 7
- 229910021653 sulphate ion Inorganic materials 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 5
- 125000000129 anionic group Chemical group 0.000 description 5
- 238000010936 aqueous wash Methods 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000004140 cleaning Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 210000002374 sebum Anatomy 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000001509 sodium citrate Substances 0.000 description 5
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 235000019832 sodium triphosphate Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 5
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003240 coconut oil Substances 0.000 description 4
- 235000019864 coconut oil Nutrition 0.000 description 4
- 238000005187 foaming Methods 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000000271 synthetic detergent Substances 0.000 description 4
- 239000003760 tallow Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 229910021536 Zeolite Inorganic materials 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000005341 cation exchange Methods 0.000 description 3
- 239000004665 cationic fabric softener Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940096386 coconut alcohol Drugs 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 3
- 235000011180 diphosphates Nutrition 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229920005646 polycarboxylate Polymers 0.000 description 3
- 150000004760 silicates Chemical class 0.000 description 3
- 229910001388 sodium aluminate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 239000004711 α-olefin Substances 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- QNZARVVKDJJFNL-UHFFFAOYSA-M [O-]C(CCC(O)=O)=O.OC(CCC(O)=O)=O.O.[Na+] Chemical compound [O-]C(CCC(O)=O)=O.OC(CCC(O)=O)=O.O.[Na+] QNZARVVKDJJFNL-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000007824 aliphatic compounds Chemical class 0.000 description 2
- 125000005210 alkyl ammonium group Chemical group 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- OZNFKKCYEUFEDW-UHFFFAOYSA-L disodium;decylbenzene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCC1=CC=CC=C1 OZNFKKCYEUFEDW-UHFFFAOYSA-L 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910001425 magnesium ion Inorganic materials 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- ONLRKTIYOMZEJM-UHFFFAOYSA-N n-methylmethanamine oxide Chemical compound C[NH+](C)[O-] ONLRKTIYOMZEJM-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 230000009919 sequestration Effects 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- 235000019351 sodium silicates Nutrition 0.000 description 2
- KVCGISUBCHHTDD-UHFFFAOYSA-M sodium;4-methylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1 KVCGISUBCHHTDD-UHFFFAOYSA-M 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229960004418 trolamine Drugs 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- GOCCREQJUBABAL-UHFFFAOYSA-N 2,2-dihydroxyacetic acid Chemical compound OC(O)C(O)=O GOCCREQJUBABAL-UHFFFAOYSA-N 0.000 description 1
- VJSWLXWONORKLD-UHFFFAOYSA-N 2,4,6-trihydroxybenzene-1,3,5-trisulfonic acid Chemical compound OC1=C(S(O)(=O)=O)C(O)=C(S(O)(=O)=O)C(O)=C1S(O)(=O)=O VJSWLXWONORKLD-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical class OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- PSZAEHPBBUYICS-UHFFFAOYSA-N 2-methylidenepropanedioic acid Chemical compound OC(=O)C(=C)C(O)=O PSZAEHPBBUYICS-UHFFFAOYSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- 101150020052 AADAT gene Proteins 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 208000002177 Cataract Diseases 0.000 description 1
- RZXLPPRPEOUENN-UHFFFAOYSA-N Chlorfenson Chemical compound C1=CC(Cl)=CC=C1OS(=O)(=O)C1=CC=C(Cl)C=C1 RZXLPPRPEOUENN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical class OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- 229910004742 Na2 O Inorganic materials 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- MJOQJPYNENPSSS-XQHKEYJVSA-N [(3r,4s,5r,6s)-4,5,6-triacetyloxyoxan-3-yl] acetate Chemical compound CC(=O)O[C@@H]1CO[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O MJOQJPYNENPSSS-XQHKEYJVSA-N 0.000 description 1
- HHLMIPMLRQMODA-UHFFFAOYSA-M [Na+].OP(O)(O)=O.OS([O-])(=O)=O Chemical compound [Na+].OP(O)(O)=O.OS([O-])(=O)=O HHLMIPMLRQMODA-UHFFFAOYSA-M 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- 230000003185 calcium uptake Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- PUBNPKMXGRPTQT-UHFFFAOYSA-N decyl benzenesulfonate Chemical compound CCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 PUBNPKMXGRPTQT-UHFFFAOYSA-N 0.000 description 1
- NEXGLIFZDFMSDG-UHFFFAOYSA-N decyl benzenesulfonate;potassium Chemical compound [K].CCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 NEXGLIFZDFMSDG-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- XWENCHGJOCJZQO-UHFFFAOYSA-N ethane-1,1,2,2-tetracarboxylic acid Chemical compound OC(=O)C(C(O)=O)C(C(O)=O)C(O)=O XWENCHGJOCJZQO-UHFFFAOYSA-N 0.000 description 1
- 229940031098 ethanolamine Drugs 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000002366 lipolytic effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- HNEGQIOMVPPMNR-UHFFFAOYSA-N methylfumaric acid Natural products OC(=O)C(C)=CC(O)=O HNEGQIOMVPPMNR-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- FFJMLWSZNCJCSZ-UHFFFAOYSA-N n-methylmethanamine;hydrobromide Chemical compound Br.CNC FFJMLWSZNCJCSZ-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000003703 phosphorus containing inorganic group Chemical group 0.000 description 1
- 238000011020 pilot scale process Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 235000019828 potassium polyphosphate Nutrition 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- BFHVMBPOAYYQFV-UHFFFAOYSA-N potassium;undecyl benzenesulfonate Chemical compound [K].CCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 BFHVMBPOAYYQFV-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229940048084 pyrophosphate Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- CBXWGGFGZDVPNV-UHFFFAOYSA-N so4-so4 Chemical compound OS(O)(=O)=O.OS(O)(=O)=O CBXWGGFGZDVPNV-UHFFFAOYSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000011182 sodium carbonates Nutrition 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 235000019830 sodium polyphosphate Nutrition 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical class [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- 229940080117 triethanolamine sulfate Drugs 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- AISMNBXOJRHCIA-UHFFFAOYSA-N trimethylazanium;bromide Chemical compound Br.CN(C)C AISMNBXOJRHCIA-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- ZXGOACRTCPRVON-UHFFFAOYSA-K trisodium;2-sulfonatobutanedioate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(C([O-])=O)S([O-])(=O)=O ZXGOACRTCPRVON-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J39/00—Cation exchange; Use of material as cation exchangers; Treatment of material for improving the cation exchange properties
- B01J39/08—Use of material as cation exchangers; Treatment of material for improving the cation exchange properties
- B01J39/14—Base exchange silicates, e.g. zeolites
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/001—Softening compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/08—Silicates
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Cleaning Implements For Floors, Carpets, Furniture, Walls, And The Like (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK128181A DK128181A (da) | 1973-05-11 | 1981-03-20 | Tekstilbloedgoeringsmiddel |
| DK128081A DK128081A (da) | 1973-05-11 | 1981-03-20 | Vaskemiddelsammensaetning |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US35929373A | 1973-05-11 | 1973-05-11 | |
| US35929373 | 1973-05-11 | ||
| US45026674 | 1974-03-11 | ||
| US05/450,266 US4605509A (en) | 1973-05-11 | 1974-03-11 | Detergent compositions containing sodium aluminosilicate builders |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK152137B true DK152137B (enExample) | 1988-02-01 |
| DK152137C DK152137C (da) | 1993-03-15 |
Family
ID=27000423
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK252274AA DK152137C (da) | 1973-05-11 | 1974-05-08 | Vaskemiddelblanding, der er i stand til hurtigt at reducere indholdet af frie flervalente metalioner i en vandig opløsning |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4605509A (enExample) |
| JP (1) | JPS6052191B2 (enExample) |
| AT (1) | AT390447B (enExample) |
| AU (1) | AU475759B2 (enExample) |
| BE (1) | BE814874A (enExample) |
| CA (1) | CA1035234A (enExample) |
| CH (4) | CH594729A5 (enExample) |
| DE (4) | DE2462649C3 (enExample) |
| DK (1) | DK152137C (enExample) |
| FR (1) | FR2283220A1 (enExample) |
| GB (1) | GB1429143A (enExample) |
| IE (1) | IE39431B1 (enExample) |
| IT (1) | IT1012262B (enExample) |
| NL (1) | NL170020C (enExample) |
| NO (3) | NO148890B (enExample) |
| PH (1) | PH10666A (enExample) |
| SE (4) | SE419557C (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK151231B (da) * | 1973-04-13 | 1987-11-16 | Henkel Kgaa | Fremgangsmaade til rensning, herunder vask, forvask og blegende vask, affaste materialer, isaer tekstiler, samt middel til udoevelse af fremgangsmaaden og fremgamgsmaade til fremstiling af midlet |
| DK154944B (da) * | 1975-12-15 | 1989-01-09 | Colgate Palmolive Co | Rensemiddel |
Families Citing this family (223)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT330930B (de) * | 1973-04-13 | 1976-07-26 | Henkel & Cie Gmbh | Verfahren zur herstellung von festen, schuttfahigen wasch- oder reinigungsmitteln mit einem gehalt an calcium bindenden substanzen |
| AR208392A1 (es) * | 1973-05-07 | 1976-12-27 | Henkel & Cie Gmbh | Composicion para lavar blanquear o limpiar materiales resistentes especialmente textiles adicional a la patente no 201687 adicional a la no 253286 |
| US4083793A (en) * | 1973-05-23 | 1978-04-11 | Henkel Kommanditgesellschaft Auf Aktien | Washing compositions containing aluminosilicates and nonionics and method of washing textiles |
| CA1037815A (en) * | 1973-06-20 | 1978-09-05 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Process for the production of solid, pourable washing or cleaning agents with a content of a calcium binding silicate |
| US4126574A (en) * | 1973-09-07 | 1978-11-21 | Henkel Kommanditgesellschaft Auf Aktien | Surfactant-containing aluminosilicates and process |
| AT335030B (de) * | 1974-01-14 | 1977-02-25 | Henkel & Cie Gmbh | Verfahren zum waschen von textilien, sowie mittel zur durchfuhrung des verfahrens |
| AT373276B (de) * | 1974-02-25 | 1984-01-10 | Henkel Kgaa | Nichtionische tenside enthaltende schuettfaehige wasch- und reinigungsmittel |
| US4136051A (en) * | 1974-02-25 | 1979-01-23 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Pourable washing compositions containing a luminosilicates and non-ionics and method for their preparation |
| AT397660B (de) * | 1974-05-03 | 1994-06-27 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien, mittel zur durchführung und verfahren zur herstellung |
| ES437284A1 (es) * | 1974-05-07 | 1977-07-01 | Colgate Palmolive Co | Un procedimiento mejorado para preparar composiciones deter-gentes secadas por pulverizacion que contienen silicatos de aluminio. |
| US3985669A (en) | 1974-06-17 | 1976-10-12 | The Procter & Gamble Company | Detergent compositions |
| AT334489B (de) * | 1974-07-04 | 1976-01-25 | Henkel & Cie Gmbh | Verfahren zur herstellung phosphatarmer bzw. phosphatfreier wasch- und reinigungsmittel |
| AT338947B (de) * | 1974-07-29 | 1977-09-26 | Henkel & Cie Gmbh | Verfahren und mittel zum waschen und reinigen der oberflachen von festen werkstoffen, insbesondere von textilien |
| AT335033B (de) * | 1974-08-29 | 1977-02-25 | Henkel & Cie Gmbh | Flussiges bis pastenformiges wasch- und reinigungsmittelkonzentrat und verfahren zu dessen herstellung |
| ZA755347B (en) * | 1974-09-06 | 1977-04-27 | Colgate Palmolive Co | Fabric softening composition containing molecular sieve zeolite |
| CA1058040A (en) * | 1974-09-06 | 1979-07-10 | Colgate-Palmolive Company | Molecular sieve zeolite-built detergent paste |
| DE2463384C3 (de) * | 1974-10-02 | 1987-12-03 | Degussa Ag, 6000 Frankfurt | Verwendung eines kristallinen Zeolithpulvers des Typs A als Phosphatersatz in Wasch- und Reinigungsmitteln |
| AT334491B (de) * | 1974-10-03 | 1976-01-25 | Henkel & Cie Gmbh | Schuttfahiges geruststoff-agglomerat fur wasch- und reinigungsmittel und verfahren zu dessen herstellung |
| US4184975A (en) * | 1974-10-03 | 1980-01-22 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Pourable agglomerated aluminosilicate builder compositions for washing and cleansing agents |
| AT375394B (de) * | 1974-10-04 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| ATA800274A (de) * | 1974-10-04 | 1983-12-15 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| AT338948B (de) * | 1974-10-10 | 1977-09-26 | Henkel & Cie Gmbh | Pulverformige wasch- und reinigungsmittel und verfahren zu ihrer herstellung |
| US4000094A (en) * | 1974-11-08 | 1976-12-28 | The Procter & Gamble Company | Water-insoluble aluminosilicate-containing detergent composition |
| GB1516848A (en) * | 1974-11-13 | 1978-07-05 | Procter & Gamble Ltd | Detergent composition |
| US4066394A (en) | 1974-12-30 | 1978-01-03 | Colgate-Palmolive | Reusable zeolite water softener for clothes washing |
| US4116852A (en) | 1975-02-14 | 1978-09-26 | The Procter & Gamble Company | Builders and built detergent compositions |
| GB1528154A (en) * | 1975-02-14 | 1978-10-11 | Procter & Gamble Ltd | Builders and built detergent compositions |
| US4113644A (en) * | 1975-02-20 | 1978-09-12 | Ashcraft William R | Protected glassy phosphate detergent additive |
| US4088593A (en) * | 1975-03-12 | 1978-05-09 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Ion-exchanging aluminum silicate with hydrophilic surfaces |
| DE2510741C3 (de) * | 1975-03-12 | 1985-05-30 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung eines kristallinen, ionenaustauschenden Alkalialuminiumsilikates mit hydrophiler Oberfläche und dessen Verwendung |
| US4040972A (en) * | 1975-03-12 | 1977-08-09 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Ion-exchanging aluminum silicate with hydrophilic surfaces |
| DE2510742C3 (de) * | 1975-03-12 | 1984-02-16 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung eines kristallinen, ionenaustauschenden Alkalialuminiumsilikates mit hydrophiler Oberfläche und dessen Verwendung |
| US4019999A (en) * | 1975-07-23 | 1977-04-26 | The Procter & Gamble Co. | Spray-dried granular detergent containing aluminosilicate, silicate, and pyrophosphate |
| JPS5347408A (en) * | 1976-10-13 | 1978-04-27 | Mizusawa Industrial Chem | Detergent builder and preparation thereof |
| ZA767282B (en) * | 1975-12-15 | 1978-07-26 | Colgate Palmolive Co | Laundry detergent composition and use |
| ZA767016B (en) * | 1975-12-15 | 1978-06-28 | Colgate Palmolive Co | Non-caking bleach |
| DE2651485A1 (de) * | 1976-11-11 | 1978-05-24 | Degussa | Kristallines zeolithpulver des typs a i |
| DE2651419A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a iv |
| DE2651437A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a vi |
| DE2651420A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a v |
| DE2651445A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a ii |
| DE2651436A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a iii |
| FI66130C (fi) * | 1976-12-30 | 1984-09-10 | Rhone Poulenc Ind | Syntetiskt finfoerdelat kristallint silikonaluminat foerfarande foer dess framstaellning samt dess anvaendning |
| US4397777A (en) * | 1977-02-08 | 1983-08-09 | Colgate Palmolive Company | Heavy duty laundry detergent |
| DE2714954C3 (de) * | 1977-04-02 | 1985-05-09 | Henkel Kgaa, 4000 Duesseldorf | Haarreinigungsmittel zur Verminderung des Nachfettens der Haare |
| JPS5411107A (en) * | 1977-06-27 | 1979-01-27 | Procter & Gamble | Detergent compositions containing low grade orthophosphate pyroo phosphate mixture plus aluminoosilicate or precipitated silica |
| US4094778A (en) | 1977-06-27 | 1978-06-13 | Union Carbide Corporation | Sequestering of CA++ and MG++ in aqueous media using zeolite mixtures |
| NZ188469A (en) * | 1977-10-06 | 1980-12-19 | Colgate Palmolive Co | Detergent composition comprising a univalent cation-exchanging zeolite a nonionic detergent and builder salts |
| US4303556A (en) * | 1977-11-02 | 1981-12-01 | The Procter & Gamble Company | Spray-dried detergent compositions |
| US4180485A (en) * | 1977-11-02 | 1979-12-25 | The Procter & Gamble Company | Spray-dried detergent compositions |
| JPS5483913A (en) * | 1977-12-18 | 1979-07-04 | Agency Of Ind Science & Technol | Detergent composition |
| DE2902236A1 (de) * | 1978-01-25 | 1979-07-26 | Kao Corp | Bleichmittelmischung |
| BE874420A (fr) | 1978-03-02 | 1979-08-23 | Unilever Nv | Procede de production de compositions detergentes |
| EP0015024A1 (en) * | 1979-02-16 | 1980-09-03 | THE PROCTER & GAMBLE COMPANY | Detergent compositions containing binary builder system |
| US4231887A (en) * | 1979-06-26 | 1980-11-04 | Union Carbide Corporation | Zeolite agglomerates for detergent formulations |
| US4261941A (en) * | 1979-06-26 | 1981-04-14 | Union Carbide Corporation | Process for preparing zeolite-containing detergent agglomerates |
| JPS56139597A (en) * | 1980-04-03 | 1981-10-31 | Mitsui Toatsu Chemicals | Detergent composition |
| US4265777A (en) * | 1980-04-17 | 1981-05-05 | The Procter & Gamble Company | Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soap |
| DE3021295C2 (de) * | 1980-06-06 | 1986-10-16 | Basf Ag, 6700 Ludwigshafen | Wäßrige lagerstabile, fließ- und pumpfähige Natriumalumosilikat-Suspensionen |
| DE3045221A1 (de) * | 1980-12-01 | 1982-06-03 | Joh. A. Benckiser Gmbh, 6700 Ludwigshafen | Abriebfestes granulat auf basis alkalialuminiumsilikat mit gutem dispergiervermoegen in waessriger follte |
| US4364909A (en) | 1981-03-16 | 1982-12-21 | The Dow Chemical Company | Removal of Ca++ from MgCl2 |
| DE3261026D1 (en) * | 1981-03-20 | 1984-11-29 | Unilever Plc | Process for the manufacture of detergent compositions containing sodium aluminosilicate |
| DE3120744A1 (de) * | 1981-05-25 | 1982-12-09 | Joh. A. Benckiser Gmbh, 6700 Ludwigshafen | Abriebfestes granulat auf basis alkalialuminiumsilikat mit guter dispergierbarkeit in waessriger flotte |
| NZ201213A (en) * | 1981-07-15 | 1985-07-31 | Unilever Plc | Detergent additives and soap compositions |
| NZ201211A (en) * | 1981-07-15 | 1985-08-16 | Unilever Plc | Detergent additives and compositions |
| DE3132767A1 (de) * | 1981-08-19 | 1983-03-10 | Degussa Ag, 6000 Frankfurt | Phosphatsubstitut fuer waschmittel |
| DE3144298A1 (de) * | 1981-11-07 | 1983-05-19 | Degussa Ag, 6000 Frankfurt | Scheuerpulver |
| FR2528722A1 (fr) * | 1982-06-18 | 1983-12-23 | Rhone Poulenc Chim Base | Zeolite comme auxiliaire de detergence |
| DE3472571D1 (en) * | 1983-08-27 | 1988-08-11 | Procter & Gamble | Detergent compositions |
| GB8328017D0 (en) * | 1983-10-19 | 1983-11-23 | Unilever Plc | Detergent powders |
| DE3504451A1 (de) * | 1985-02-09 | 1986-08-14 | Degussa Ag, 6000 Frankfurt | Waschmittelbuilder |
| EP0197193A3 (en) * | 1985-04-08 | 1987-04-15 | Pennwalt Corporation | Iron-complexing alkaline detergent builder |
| DE3623717A1 (de) * | 1985-07-16 | 1987-01-22 | Lion Corp | Verfahren zur herstellung eines zeoliths und diesen enthaltendes reinigungsmittel |
| DE3621536A1 (de) * | 1986-06-27 | 1988-01-07 | Henkel Kgaa | Fluessiges waschmittel und verfahren zu seiner herstellung |
| US4741862A (en) * | 1986-08-22 | 1988-05-03 | Dow Corning Corporation | Zeolite built detergent compositions |
| DE3818829A1 (de) * | 1988-06-03 | 1989-12-14 | Henkel Kgaa | Koerniges adsorptionsmittel mit verbessertem einspuelverhalten |
| US4965013A (en) * | 1989-05-01 | 1990-10-23 | Miles Inc. | Method of high temperature laundering using sodium citrate and an anionic |
| US5024782A (en) * | 1989-06-16 | 1991-06-18 | The Clorox Company | Zeolite agglomeration process and product |
| US5205958A (en) * | 1989-06-16 | 1993-04-27 | The Clorox Company | Zeolite agglomeration process and product |
| US5041236A (en) | 1989-10-27 | 1991-08-20 | The Procter & Gamble Company | Antimicrobial methods and compositions employing certain lysozymes and endoglycosidases |
| GB9006171D0 (en) * | 1990-03-19 | 1990-05-16 | Unilever Plc | Detergent compositions |
| GB9012613D0 (en) * | 1990-06-06 | 1990-07-25 | Unilever Plc | Soap powder compositions |
| US5104568A (en) * | 1990-06-18 | 1992-04-14 | The Procter & Gamble Company | Granular detergent compositions built with 2,2'-oxodisuccinate and zeolite a, process to make same, and agglomerated detergency builder |
| GB9018157D0 (en) * | 1990-08-17 | 1990-10-03 | Procter & Gamble | Detergent compositions |
| US5174927A (en) * | 1990-09-28 | 1992-12-29 | The Procter & Gamble Company | Process for preparing brightener-containing liquid detergent compositions with polyhydroxy fatty acid amines |
| SK25293A3 (en) * | 1990-09-28 | 1994-01-12 | Procter & Gamble | Polyhydroxy fatty acid amides in soil release agent-containing detergent compositions |
| BR9106922A (pt) * | 1990-09-28 | 1993-08-17 | Procter & Gamble | Tensoativos de amidas de acidos graxos polihidroxi em composicoes de detergente contendo alvejante |
| BR9106920A (pt) * | 1990-09-28 | 1993-08-17 | Procter & Gamble | Composicoes detergentes contendo tensoativos de amida de acido poliidroxi graxo e alquil ester sulfonato |
| US5254281A (en) * | 1991-01-29 | 1993-10-19 | The Procter & Gamble Company | Soap bars with polyhydroxy fatty acid amides |
| GB9104547D0 (en) * | 1991-03-05 | 1991-04-17 | Unilever Plc | Detergent compositions |
| DE69202055T2 (de) | 1991-05-14 | 1995-08-24 | Ecolab Inc., St. Paul, Minn. | Zweiteiliges chemisches konzentrat. |
| GB9216386D0 (en) * | 1992-07-31 | 1992-09-16 | Unilever Plc | Use of aluminosilicates of the zeolite p type as low temperature calcium binders |
| TW239160B (enExample) * | 1992-10-27 | 1995-01-21 | Procter & Gamble | |
| KR950704241A (ko) * | 1992-12-15 | 1995-11-17 | 알베르루스 빌헬무스ㆍ요아네스 쩨스트라텐 | 2차 알킬 설페이트/제올라이트-함유 계면활성제 조성물(secondary alkyl sulphate/zeolite-containing surfactant composition) |
| US5605883A (en) * | 1993-02-24 | 1997-02-25 | Iliff; Robert J. | Agglomerated colorant speckle exhibiting reduced colorant spotting |
| US5378388A (en) * | 1993-06-25 | 1995-01-03 | The Procter & Gamble Company | Granular detergent compositions containing selected builders in optimum ratios |
| GB9313878D0 (en) * | 1993-07-05 | 1993-08-18 | Unilever Plc | Detergent composition or component containing anionic surfactant and process for its preparation |
| WO1995002673A1 (en) * | 1993-07-15 | 1995-01-26 | The Procter & Gamble Company | LOW pH GRANULAR DETERGENT COMPOSITION HAVING IMPROVED BIODEGRADABILITY |
| GB9324129D0 (en) * | 1993-11-24 | 1994-01-12 | Unilever Plc | Detergent compositions and process for preparing them |
| EP0730638B1 (en) * | 1993-11-24 | 1998-01-21 | Unilever Plc | Detergent compositions |
| US5849684A (en) * | 1994-04-14 | 1998-12-15 | The Procter & Gamble Company | Detergent additives comprising dye transfer inhibitors, and process for making them |
| GB9504912D0 (en) * | 1995-03-10 | 1995-04-26 | Ind Zeolite Uk Ltd | Zeolites |
| US5731279A (en) * | 1995-05-31 | 1998-03-24 | The Procter & Gamble Company | Cleaning compositions containing a crystalline builder material having improved performance |
| US5658867A (en) * | 1995-05-31 | 1997-08-19 | The Procter & Gamble Company | Cleaning compositions containing a crystalline builder material in selected particle size ranges for improved performance |
| US5707959A (en) * | 1995-05-31 | 1998-01-13 | The Procter & Gamble Company | Processes for making a granular detergent composition containing a crystalline builder |
| US5733865A (en) * | 1995-05-31 | 1998-03-31 | The Procter & Gamble Company | Processes for making a crystalline builder having improved performance |
| EP0752466A1 (en) | 1995-07-05 | 1997-01-08 | The Procter & Gamble Company | Nonaqueous detergent compositions comprising effervescent systems |
| US5962389A (en) * | 1995-11-17 | 1999-10-05 | The Dial Corporation | Detergent having improved color retention properties |
| GB9525773D0 (en) | 1995-12-16 | 1996-02-14 | Unilever Plc | Detergent composition |
| EP0786516B1 (en) | 1996-01-25 | 2004-04-21 | Unilever N.V. | Liquid detergent |
| TW370561B (en) * | 1996-03-15 | 1999-09-21 | Kao Corp | High-density granular detergent composition for clothes washing |
| US5958865A (en) * | 1996-06-28 | 1999-09-28 | Fmc Corporation | Single pass process for making an increased surfactant loaded detergent using an agglomerator |
| GB9620093D0 (en) * | 1996-09-26 | 1996-11-13 | Unilever Plc | Photofading inhibitor derivatives and their use in fabric treatment compositions |
| CA2276580C (en) * | 1996-12-31 | 2005-04-26 | The Procter & Gamble Company | Laundry detergent compositions comprising dye fixatives |
| JP2001507733A (ja) * | 1996-12-31 | 2001-06-12 | ザ、プロクター、エンド、ギャンブル、カンパニー | 洗濯済みの布地に良好な外観を与えるポリアミド−ポリアミンを含有する洗濯洗剤組成物 |
| US6150324A (en) | 1997-01-13 | 2000-11-21 | Ecolab, Inc. | Alkaline detergent containing mixed organic and inorganic sequestrants resulting in improved soil removal |
| US6156715A (en) | 1997-01-13 | 2000-12-05 | Ecolab Inc. | Stable solid block metal protecting warewashing detergent composition |
| US6177392B1 (en) | 1997-01-13 | 2001-01-23 | Ecolab Inc. | Stable solid block detergent composition |
| US6258765B1 (en) * | 1997-01-13 | 2001-07-10 | Ecolab Inc. | Binding agent for solid block functional material |
| US5948383A (en) * | 1997-03-26 | 1999-09-07 | Engelhard Corporation | Hybrid zeolite-silica compositions |
| GB9711829D0 (en) | 1997-06-06 | 1997-08-06 | Unilever Plc | Detergent compositions |
| KR100638135B1 (ko) | 1998-01-22 | 2006-10-24 | 미즈 가부시키가이샤 | 세정방법 및 세정장치 |
| HUP0100685A3 (en) * | 1998-02-10 | 2003-02-28 | Unilever Nv | Process for the manufacture of tablets, use of an elastomeric layer during said process, and tablets of detergent composition |
| US6610645B2 (en) | 1998-03-06 | 2003-08-26 | Eugene Joseph Pancheri | Selected crystalline calcium carbonate builder for use in detergent compositions |
| TW523547B (en) * | 1998-10-05 | 2003-03-11 | Miz Co Ltd | Method of producing detergent and the apparatus thereof |
| US6362156B1 (en) | 1998-12-16 | 2002-03-26 | Unilever Home & Personal Care, Usa, Division Of Conopco, Inc. | Pourable transparent/translucent liquid detergent composition with suspended particles |
| US6051541A (en) * | 1998-12-16 | 2000-04-18 | Unilever Home & Personal Care, Division Of Conopco, Inc. | Process for preparing pourable, transparent/translucent liquid detergent with continuous suspending system |
| US6630437B1 (en) | 1998-12-16 | 2003-10-07 | Unilever Home & Personal Care Usa , Division Of Conopco, Inc. | Transparent/translucent liquid compositions in clear bottles comprising colorant and fluorescent dye or UV absorber |
| US6258771B1 (en) | 1998-12-16 | 2001-07-10 | Unilever Home & Personal Care, Usa Division Of Conopco | Process for preparing pourable, transparent/translucent liquid detergent with non-continuous suspending system |
| HUP0104854A2 (hu) * | 1998-12-16 | 2002-04-29 | Unilever Nv. | Átlátszó vagy áttetsző, folyékony enzimkészítmény és eljárás enzim lebomlásának meggátlására |
| USD419262S (en) * | 1999-03-12 | 2000-01-18 | Ecolab Inc. | Solid block detergent |
| BR0109300A (pt) | 2000-03-17 | 2002-12-24 | Pq Holding Inc | Processo para a fabricação de um produto de zeólito, produto de zeólito, e, composição detergente |
| US6706931B2 (en) | 2000-12-21 | 2004-03-16 | Shell Oil Company | Branched primary alcohol compositions and derivatives thereof |
| GB0031823D0 (en) | 2000-12-29 | 2001-02-14 | Unilever Plc | Detergent compositions |
| GB0031827D0 (en) | 2000-12-29 | 2001-02-14 | Unilever Plc | Detergent compositions |
| US6638902B2 (en) * | 2001-02-01 | 2003-10-28 | Ecolab Inc. | Stable solid enzyme compositions and methods employing them |
| DE10150724A1 (de) | 2001-03-03 | 2003-04-17 | Clariant Gmbh | Waschmittel und Wäschebehandlungsmittel enthaltend ein oder mehrere farbübertragungsinhibierende Farbfixiermittel |
| EP1239025A3 (de) | 2001-03-03 | 2003-09-03 | Clariant GmbH | Waschmittel und Wäschebehandlungsmittel enthaltend farbübertragungsinhibierend Farbfixiermittel |
| US6632291B2 (en) | 2001-03-23 | 2003-10-14 | Ecolab Inc. | Methods and compositions for cleaning, rinsing, and antimicrobial treatment of medical equipment |
| GB0127036D0 (en) | 2001-11-09 | 2002-01-02 | Unilever Plc | Polymers for laundry applications |
| GB2382342A (en) | 2001-11-27 | 2003-05-28 | Reckitt Benckiser Nv | Water-softening tablet |
| GB2385857B (en) | 2002-02-27 | 2004-04-21 | Reckitt Benckiser Nv | Washing materials |
| GB2386612A (en) | 2002-03-22 | 2003-09-24 | Reckitt Benckiser Nv | Cleaning method |
| WO2004056888A2 (en) | 2002-12-23 | 2004-07-08 | Ciba Specialty Chemicals Holding Inc. | Hydrophobically modified polymers as laundry additives |
| US7125833B2 (en) * | 2003-03-24 | 2006-10-24 | Wacker Chemie Ag | Cyclodextrin laundry detergent additive complexes and compositions containing same |
| GB0313901D0 (en) | 2003-06-16 | 2003-07-23 | Unilever Plc | Detergent composition |
| GB2403719A (en) | 2003-07-07 | 2005-01-12 | Reckitt Benckiser Nv | Water-softening method |
| GB0323754D0 (en) | 2003-10-10 | 2003-11-12 | Reckitt Benckiser Uk Ltd | Article and method |
| EP1733016B1 (en) | 2004-04-09 | 2012-02-01 | Unilever N.V. | Granulate for use in a cleaning product and process for its manufacture |
| DE102004029310A1 (de) * | 2004-06-17 | 2005-12-29 | Clariant Gmbh | Hochkonzentrierte, wässrige Formulierungen von Oligo-und Polyestern |
| US20060019859A1 (en) * | 2004-07-23 | 2006-01-26 | Melani Duran | Powder dilutable multi-surface cleaner |
| EP1669438B1 (en) | 2004-12-08 | 2007-10-17 | Unilever N.V. | Detergent tablet |
| ATE430796T1 (de) | 2005-01-04 | 2009-05-15 | Unilever Nv | Wasch- und reinigungsmittelformkörper |
| US7387992B2 (en) | 2005-03-15 | 2008-06-17 | Unilever Home & Personal Care Usa Division Of Conopco, Inc. | Laundry detergent with polyamine mono-anionic surfactant |
| EP1705241B1 (en) | 2005-03-23 | 2008-08-13 | Unilever N.V. | Detergent compositions in tablet form |
| EP1705240A1 (en) | 2005-03-23 | 2006-09-27 | Unilever N.V. | Detergent tablets |
| EP1746151A1 (en) | 2005-07-20 | 2007-01-24 | Unilever N.V. | Detergent tablet compositions |
| EP1746152A1 (en) | 2005-07-20 | 2007-01-24 | Unilever N.V. | Detergent compositions |
| GB0524659D0 (en) | 2005-12-02 | 2006-01-11 | Unilever Plc | Improvements relating to fabric treatment compositions |
| DE102005061058A1 (de) * | 2005-12-21 | 2007-07-05 | Clariant Produkte (Deutschland) Gmbh | Anionische Soil Release Polymere |
| SK287193B6 (sk) * | 2006-03-03 | 2010-03-08 | Glebus Alloys Europe S.R.O. | Odvzdušňovací ventil do odvzdušňovacích otvorov vulkanizačných foriem |
| EP1832648A1 (en) | 2006-03-08 | 2007-09-12 | Unilever Plc | Laundry detergent composition and process |
| GB0625046D0 (en) | 2006-12-15 | 2007-01-24 | Dow Corning | Granular materials for textile treatment |
| DE102007013217A1 (de) | 2007-03-15 | 2008-09-18 | Clariant International Ltd. | Anionische Soil Release Polymere |
| US20090253612A1 (en) | 2008-04-02 | 2009-10-08 | Symrise Gmbh & Co Kg | Particles having a high load of fragrance or flavor oil |
| DE102008023803A1 (de) | 2008-05-15 | 2009-11-26 | Clariant International Ltd. | Additive für Wasch- und Reinigungsmittel |
| US7790664B2 (en) * | 2008-10-27 | 2010-09-07 | The Procter & Gamble Company | Methods for making a nil-phosphate liquid automatic dishwashing composition |
| GB0904700D0 (en) | 2009-03-19 | 2009-04-29 | Unilever Plc | Improvements relating to benefit agent delivery |
| WO2011063945A1 (de) | 2009-11-27 | 2011-06-03 | Clariant International Ltd | Polyester-konzentrate mit hoher lösestabilität und vergrauungsinhibierender wirkung |
| JP5678084B2 (ja) | 2009-11-27 | 2015-02-25 | クラリアント・ファイナンス・(ビーブイアイ)・リミテッド | 灰色化防止(vergrauungsinhibierender)効果および高い溶液安定性を有するソイルリリースポリマー |
| WO2011072968A1 (en) | 2009-12-14 | 2011-06-23 | Unilever Plc | Measured dosing cap assembly |
| MX2012011475A (es) | 2010-04-01 | 2012-11-16 | Procter & Gamble | Composiciones que comprenden organosiliconas. |
| GB201006076D0 (en) | 2010-04-12 | 2010-05-26 | Xeros Ltd | Novel cleaning apparatus and method |
| GB201005963D0 (en) | 2010-04-12 | 2010-05-26 | Reckitt Benckiser Nv | Device |
| WO2011143322A1 (en) | 2010-05-12 | 2011-11-17 | The Procter & Gamble Company | Fabric and home care product comprising care polymers |
| GB201011905D0 (en) | 2010-07-15 | 2010-09-01 | Unilever Plc | Benefit delivery particle,process for preparing said particle,compositions comprising said particles and a method for treating substrates |
| WO2012084426A1 (en) | 2010-12-22 | 2012-06-28 | Unilever Nv | Enzymatic laundry detergent composition for the promotion of hygiene and the prevention of malodour |
| WO2012117024A1 (de) | 2011-03-01 | 2012-09-07 | Basf Se | Farbübertragungsinhibierend wirkende polymere mit verbesserter lagerstabilität und verarbeitbarkeit für wasch- und reinigungsmittel |
| WO2012117030A1 (de) | 2011-03-01 | 2012-09-07 | Basf Se | Carboxylgruppenhaltige polymere mit verbesserter lagerstabilität und verarbeitbarkeit |
| US9403731B2 (en) | 2011-06-29 | 2016-08-02 | Basf Se | Modified aminocarboxylates with improved storage stability and processability |
| EP2726442B2 (de) | 2011-06-29 | 2019-04-10 | Basf Se | Modifizierte aminocarboxylate mit verbesserter lagerstabilität und verarbeitbarkeit |
| GB201117425D0 (en) | 2011-10-10 | 2011-11-23 | Reckitt & Colman Overseas | Product |
| GB201117421D0 (en) | 2011-10-10 | 2011-11-23 | Reckitt & Colman Overseas | Product |
| US20130118531A1 (en) | 2011-11-11 | 2013-05-16 | The Procter & Gamble Company | Emulsions containing polymeric cationic emulsifiers, substance and process |
| CA2853248A1 (en) | 2011-11-11 | 2013-05-16 | Basf Se | Self-emulsifiable polyolefine compositions |
| EP2791309B1 (en) | 2011-12-16 | 2018-02-07 | Unilever Plc. | Improvements relating to fabric treatment compositions |
| GB201204071D0 (en) | 2012-03-08 | 2012-04-18 | Reckitt & Colman Overseas | Polymer treatment method |
| GB201204074D0 (en) | 2012-03-08 | 2012-04-18 | Reckitt & Colman Overseas | Novel cleaning method |
| GB2500917A (en) | 2012-04-05 | 2013-10-09 | Reckitt & Colman Overseas | Detergent dispensing cartridge |
| GB2501258A (en) | 2012-04-17 | 2013-10-23 | Reckitt & Colman Overseas | A detergent dispensing cartridge unit for use with a washing machine |
| AR092352A1 (es) | 2012-07-20 | 2015-04-15 | Procter & Gamble | Bolsa soluble en agua revestida con una composicion comprendiendo un asistente de flujo de silice |
| WO2014075956A1 (en) | 2012-11-19 | 2014-05-22 | Unilever Plc | Improvements relating to encapsulated benefit agents |
| US20160095496A1 (en) | 2014-10-07 | 2016-04-07 | The Procter & Gamble Company | Method of pre-treating articles to be washed in a dishwashing machine |
| CN107250337A (zh) | 2014-12-23 | 2017-10-13 | 路博润先进材料公司 | 衣物洗涤剂组合物 |
| WO2016106168A1 (en) | 2014-12-23 | 2016-06-30 | Lubrizol Advanced Materials, Inc. | Laundry detergent compositions stabilized with an amphiphilic rheology modifier crosslinked with an amphiphilic crosslinker |
| WO2017105131A1 (ko) | 2015-12-17 | 2017-06-22 | 주식회사 엘지생활건강 | 기능성 과립을 포함하는 세탁용 시트 |
| KR20170072774A (ko) | 2015-12-17 | 2017-06-27 | 주식회사 엘지생활건강 | 기능성 과립을 포함하는 세탁용 시트 |
| KR101772195B1 (ko) | 2015-12-22 | 2017-08-28 | 주식회사 엘지생활건강 | 세탁용 시트 |
| DE102016223590A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymer enthaltende reinigungsmittelzusammensetzungen |
| DE102016223584A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymer enthaltende waschmittelzusammensetzungen |
| DE102016223588A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymere und deren verwendung in reinigungsmittel-zusammensetzungen |
| DE102016223585A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymere und deren verwendung in waschmittel-zusammensetzungen |
| DE102016223586A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymere und deren verwendung in reinigungsmittel-zusammensetzungen |
| US11421048B2 (en) | 2017-05-04 | 2022-08-23 | Lubrizol Advanced Materials, Inc. | Dual activated microgel |
| CN112041418A (zh) | 2018-05-02 | 2020-12-04 | 奈克斯特阿普有限公司 | 洗衣片 |
| CN119119103A (zh) | 2019-08-22 | 2024-12-13 | 艾德凡斯化学公司 | 具有表面活性性质的氨基酸的硅氧烷衍生物 |
| US12460160B2 (en) | 2019-11-19 | 2025-11-04 | Lubrizol Advanced Materials, Inc. | Redeposition inhibiting styrene maleic anhydride copolymers and detergent compositions containing same |
| EP4073215B1 (en) | 2019-12-11 | 2023-08-09 | Unilever IP Holdings B.V. | Detergent composition |
| PH12022551230A1 (en) | 2019-12-11 | 2023-06-14 | Unilever Ip Holdings B V | Detergent composition |
| AU2020408132C1 (en) | 2019-12-19 | 2025-07-24 | Advansix Resins & Chemicals Llc | Surfactants for use in personal care and cosmetic products |
| WO2021126986A1 (en) | 2019-12-19 | 2021-06-24 | Lubrizol Advanced Materials, Inc. | Redeposition inhibiting polymers and detergent compositions containing same |
| WO2021126668A1 (en) | 2019-12-19 | 2021-06-24 | Advansix Resins & Chemicals Llc | Surfactants for agricultural products |
| CA3161386A1 (en) | 2019-12-19 | 2021-06-24 | Advansix Resins & Chemicals Llc | Surfactants for inks, paints, and adhesives |
| MX2022007566A (es) | 2019-12-20 | 2022-09-19 | Advansix Resins & Chemicals Llc | Tensioactivos para productos de limpieza. |
| MX2022007424A (es) | 2019-12-20 | 2022-09-19 | Advansix Resins & Chemicals Llc | Tensioactivos para uso en productos para el cuidado de la salud. |
| JP7451717B2 (ja) | 2019-12-31 | 2024-03-18 | アドバンシックス・レジンズ・アンド・ケミカルズ・リミテッド・ライアビリティ・カンパニー | 油及びガス生産のための界面活性剤 |
| ES2988486T3 (es) | 2020-02-05 | 2024-11-20 | Advansix Resins & Chemicals Llc | Tensioactivos para electrónica |
| MX2022011204A (es) | 2020-03-11 | 2022-09-19 | Advansix Resins & Chemicals Llc | Tensioactivos para productos de limpieza. |
| CN115701982B (zh) * | 2020-06-22 | 2024-07-05 | 联合利华知识产权控股有限公司 | 可生物降解的粘合组合物 |
| US12134748B2 (en) | 2020-07-13 | 2024-11-05 | Advansix Resins & Chemicals Llc | Branched amino acid surfactants for cleaning products |
| KR20240152371A (ko) | 2022-02-23 | 2024-10-21 | 어드밴식스 레진즈 앤드 케미컬즈 엘엘씨 | 표면-활성 특성을 갖는 아미노산의 실록산 유도체 |
| KR102440149B1 (ko) | 2022-06-23 | 2022-09-05 | 애경산업(주) | 시트형 세제 및 이의 제조 방법 |
| WO2025034831A1 (en) | 2023-08-07 | 2025-02-13 | Advansix Resins & Chemicals Llc | Surfactants for cleaning products |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK151231B (da) * | 1973-04-13 | 1987-11-16 | Henkel Kgaa | Fremgangsmaade til rensning, herunder vask, forvask og blegende vask, affaste materialer, isaer tekstiler, samt middel til udoevelse af fremgangsmaaden og fremgamgsmaade til fremstiling af midlet |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US943535A (en) * | 1907-02-18 | 1909-12-14 | Riedel J D Ag | Alumino-silicate or artificial zeolite. |
| GB132511A (enExample) * | 1918-06-24 | 1900-01-01 | ||
| US1642880A (en) * | 1925-08-17 | 1927-09-20 | Permutit Co | Manufacture of precipitated zeolites |
| US1728732A (en) * | 1926-10-19 | 1929-09-17 | Selden Co | Base-exchange body |
| US2264103A (en) * | 1936-06-06 | 1941-11-25 | Procter & Gamble | Process and product for softening hard water |
| US2739073A (en) * | 1950-09-06 | 1956-03-20 | Huber Corp J M | Silicate pigments |
| DE1038016B (de) * | 1953-12-24 | 1958-09-04 | Union Carbide Corp | Verfahren zur Herstellung kristalliner zeolithischer Molekularsiebe |
| US2882243A (en) * | 1953-12-24 | 1959-04-14 | Union Carbide Corp | Molecular sieve adsorbents |
| DE1038017B (de) * | 1953-12-24 | 1958-09-04 | Union Carbide Corp | Verfahren zur Herstellung kristalliner zeolithischer Molekularsiebe |
| US3033641A (en) * | 1956-03-21 | 1962-05-08 | Union Carbide Corp | Process for cation separation using zeolitic materials |
| US3119660A (en) * | 1960-09-26 | 1964-01-28 | Union Carbide Corp | Process for producing molecular sieve bodies |
| US3206408A (en) * | 1961-04-07 | 1965-09-14 | American Cyanamid Co | Aqueous shampoo composition |
| BE612158A (enExample) * | 1961-08-07 | |||
| US3112176A (en) * | 1961-10-04 | 1963-11-26 | Minerals & Chem Philipp Corp | Base-exchange zeolite and method for making the same |
| NL296018A (enExample) * | 1962-08-01 | |||
| ZA670030B (enExample) * | 1966-03-09 | |||
| US3674426A (en) * | 1966-09-28 | 1972-07-04 | Asahi Denka Kogyo Kk | Process for producing crystalline zeolite a |
| US3671439A (en) * | 1969-07-22 | 1972-06-20 | American Home Prod | Oxygen bleach-activator systems stabilized with puffed borax |
| US3650967A (en) * | 1969-09-15 | 1972-03-21 | Colgate Palmolive Co | Enzymatic granules |
| FR2105475A5 (enExample) * | 1970-09-02 | 1972-04-28 | Sifrance | |
| DE2055423A1 (en) * | 1970-11-11 | 1972-05-18 | Chemische Fabrik Budenheim, Rudolf A. Oetker, 6501 Budenheim | Washing compositions - containing water-insoluble crosslinked cation -exchange polymers especially crosslinked polystyrene,polyacrylic acid |
| US3812044A (en) * | 1970-12-28 | 1974-05-21 | Procter & Gamble | Detergent composition containing a polyfunctionally-substituted aromatic acid sequestering agent |
| CA962158A (en) * | 1971-03-11 | 1975-02-04 | Unilever Limited | Detergent compositions |
| BE791754A (fr) * | 1971-11-22 | 1973-05-22 | Procter & Gamble | Procede et dispositif de carbonatation de boissons aqueuses surles lieux memes de la consommation |
| US3755180A (en) * | 1972-02-25 | 1973-08-28 | Colgate Palmolive Co | Means to inhibit overglaze damage by automatic dishwashing detergents |
| US3852211A (en) * | 1972-08-09 | 1974-12-03 | Procter & Gamble | Detergent compositions |
| US3862058A (en) * | 1972-11-10 | 1975-01-21 | Procter & Gamble | Detergent compositions containing a smectite-type clay softening agent |
| AT330930B (de) * | 1973-04-13 | 1976-07-26 | Henkel & Cie Gmbh | Verfahren zur herstellung von festen, schuttfahigen wasch- oder reinigungsmitteln mit einem gehalt an calcium bindenden substanzen |
-
1974
- 1974-03-11 US US05/450,266 patent/US4605509A/en not_active Expired - Lifetime
- 1974-05-06 AU AU68616/74A patent/AU475759B2/en not_active Expired
- 1974-05-06 PH PH15809A patent/PH10666A/en unknown
- 1974-05-08 DK DK252274AA patent/DK152137C/da not_active IP Right Cessation
- 1974-05-09 IE IE978/74A patent/IE39431B1/xx unknown
- 1974-05-10 NL NLAANVRAGE7406306,A patent/NL170020C/xx not_active IP Right Cessation
- 1974-05-10 CH CH46577A patent/CH594729A5/xx not_active IP Right Cessation
- 1974-05-10 DE DE2462649A patent/DE2462649C3/de not_active Expired
- 1974-05-10 CH CH456681A patent/CH628928A5/de not_active IP Right Cessation
- 1974-05-10 DE DE2462647A patent/DE2462647B1/de not_active Withdrawn
- 1974-05-10 JP JP49052141A patent/JPS6052191B2/ja not_active Expired
- 1974-05-10 AT AT0388474A patent/AT390447B/de not_active IP Right Cessation
- 1974-05-10 GB GB2076274A patent/GB1429143A/en not_active Expired
- 1974-05-10 BE BE144195A patent/BE814874A/xx not_active IP Right Cessation
- 1974-05-10 DE DE2422655A patent/DE2422655B2/de not_active Ceased
- 1974-05-10 FR FR7416330A patent/FR2283220A1/fr active Granted
- 1974-05-10 SE SE7406287A patent/SE419557C/xx not_active IP Right Cessation
- 1974-05-10 CH CH46477A patent/CH594730A5/xx not_active IP Right Cessation
- 1974-05-10 CA CA199,507A patent/CA1035234A/en not_active Expired
- 1974-05-10 IT IT22577/74A patent/IT1012262B/it active
- 1974-05-10 DE DE2462648A patent/DE2462648C2/de not_active Expired - Lifetime
- 1974-05-10 NO NO741700A patent/NO148890B/no unknown
- 1974-05-10 CH CH645074A patent/CH591557A5/xx not_active IP Right Cessation
-
1977
- 1977-12-20 SE SE7714495A patent/SE424645B/xx unknown
- 1977-12-20 SE SE7714497A patent/SE424646B/xx not_active Application Discontinuation
- 1977-12-20 SE SE7714496A patent/SE424876B/xx unknown
-
1982
- 1982-12-16 NO NO824243A patent/NO824243L/no unknown
- 1982-12-16 NO NO824244A patent/NO824244L/no unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK151231B (da) * | 1973-04-13 | 1987-11-16 | Henkel Kgaa | Fremgangsmaade til rensning, herunder vask, forvask og blegende vask, affaste materialer, isaer tekstiler, samt middel til udoevelse af fremgangsmaaden og fremgamgsmaade til fremstiling af midlet |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK151231B (da) * | 1973-04-13 | 1987-11-16 | Henkel Kgaa | Fremgangsmaade til rensning, herunder vask, forvask og blegende vask, affaste materialer, isaer tekstiler, samt middel til udoevelse af fremgangsmaaden og fremgamgsmaade til fremstiling af midlet |
| DK154944B (da) * | 1975-12-15 | 1989-01-09 | Colgate Palmolive Co | Rensemiddel |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK152137B (enExample) | ||
| FI59612B (fi) | Detergentkomposition som snabbt reducerar halten av fria polyvalenta metalljoner i en vattenloesning | |
| US4274975A (en) | Detergent composition | |
| CA1036455A (en) | Washing compositions containing inorganic silicates and method of washing textiles | |
| DK164287B (da) | Granulaer detergentsammensaetning med et phosphorindhold paa mindre end 5% | |
| US4083793A (en) | Washing compositions containing aluminosilicates and nonionics and method of washing textiles | |
| JPS6052192B2 (ja) | 洗剤組成物 | |
| CA1101299A (en) | Spray-dried detergent compositions | |
| DK158521B (da) | Detergentsammensaetning indeholdende peroxygenblegeforbindelser og blegeaktivatorer af carboxylsyreestertypen | |
| JPH0635596B2 (ja) | 洗剤組成物 | |
| JP3390127B2 (ja) | 微細孔質結晶性材料、その製造方法、および洗剤組成物におけるその使用 | |
| US4040972A (en) | Ion-exchanging aluminum silicate with hydrophilic surfaces | |
| CA1052658A (en) | Method of washing textiles and composition containing inorganic silicates and polycarboxylates and/or polyphosphonates | |
| DK156175B (da) | Rensemiddel | |
| JPS63282370A (ja) | 布柔軟用組成物 | |
| EP0150613B1 (en) | Detergent compositions | |
| JPH11512777A (ja) | 粒状泡抑制成分 | |
| EP0246896B1 (en) | Detergent compositions | |
| DK162846B (da) | Peroxygenblegemiddelaktivator og blegemiddelsammensaetning | |
| US4088593A (en) | Ion-exchanging aluminum silicate with hydrophilic surfaces | |
| JPH0129839B2 (enExample) | ||
| CA1052221A (en) | Detergent composition | |
| JPH09511269A (ja) | ゼオライトmapビルダーを含有する洗剤組成物 | |
| US5925614A (en) | Process for producing granular detergent components or compositions | |
| FI80068B (fi) | Tvaettmedelskompositioner. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |