DE1941022A1 - Permeabilitaetsselektive Kunststoffmembran und Verfahren zur Herstellung derselben - Google Patents
Permeabilitaetsselektive Kunststoffmembran und Verfahren zur Herstellung derselbenInfo
- Publication number
- DE1941022A1 DE1941022A1 DE19691941022 DE1941022A DE1941022A1 DE 1941022 A1 DE1941022 A1 DE 1941022A1 DE 19691941022 DE19691941022 DE 19691941022 DE 1941022 A DE1941022 A DE 1941022A DE 1941022 A1 DE1941022 A1 DE 1941022A1
- Authority
- DE
- Germany
- Prior art keywords
- membrane
- liquid
- groups
- permeability
- housing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000012528 membrane Substances 0.000 title claims description 185
- 230000035699 permeability Effects 0.000 title claims description 91
- 238000004519 manufacturing process Methods 0.000 title claims description 20
- 239000004033 plastic Substances 0.000 title description 8
- 229920003023 plastic Polymers 0.000 title description 8
- 238000006068 polycondensation reaction Methods 0.000 claims description 117
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 83
- 239000007788 liquid Substances 0.000 claims description 58
- 150000003839 salts Chemical class 0.000 claims description 46
- 239000000203 mixture Substances 0.000 claims description 41
- 239000012510 hollow fiber Substances 0.000 claims description 37
- 239000002904 solvent Substances 0.000 claims description 31
- 125000004429 atom Chemical group 0.000 claims description 27
- 125000003118 aryl group Chemical group 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 18
- 150000002500 ions Chemical group 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 239000003599 detergent Substances 0.000 claims description 10
- 238000000926 separation method Methods 0.000 claims description 10
- 238000000605 extraction Methods 0.000 claims description 9
- 230000002829 reductive effect Effects 0.000 claims description 9
- 230000027455 binding Effects 0.000 claims description 8
- 238000009739 binding Methods 0.000 claims description 8
- 238000001035 drying Methods 0.000 claims description 7
- 210000000056 organ Anatomy 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 239000000470 constituent Substances 0.000 claims description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000002798 polar solvent Substances 0.000 claims description 6
- 239000013078 crystal Substances 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 230000036961 partial effect Effects 0.000 claims description 5
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000000354 decomposition reaction Methods 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 2
- 150000001768 cations Chemical class 0.000 claims 1
- 238000000935 solvent evaporation Methods 0.000 claims 1
- 230000001131 transforming effect Effects 0.000 claims 1
- 239000000047 product Substances 0.000 description 100
- 239000000243 solution Substances 0.000 description 42
- 239000000835 fiber Substances 0.000 description 35
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 27
- -1 polyvinylene carbonate Polymers 0.000 description 26
- 239000010408 film Substances 0.000 description 19
- 150000003254 radicals Chemical class 0.000 description 18
- 238000012360 testing method Methods 0.000 description 16
- 229940081735 acetylcellulose Drugs 0.000 description 13
- 229920002301 cellulose acetate Polymers 0.000 description 12
- 238000010612 desalination reaction Methods 0.000 description 12
- 239000004952 Polyamide Substances 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 11
- 229920002647 polyamide Polymers 0.000 description 11
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 10
- 239000011888 foil Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 230000003204 osmotic effect Effects 0.000 description 10
- 229920000642 polymer Polymers 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000011521 glass Substances 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 230000003287 optical effect Effects 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 238000002156 mixing Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 229910000831 Steel Inorganic materials 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 150000001805 chlorine compounds Chemical class 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 239000013535 sea water Substances 0.000 description 6
- 239000010959 steel Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- 150000004984 aromatic diamines Chemical class 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 238000011068 loading method Methods 0.000 description 5
- 238000009987 spinning Methods 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 229940113088 dimethylacetamide Drugs 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 238000006073 displacement reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 238000001223 reverse osmosis Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000011324 bead Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000004364 calculation method Methods 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 125000001033 ether group Chemical group 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 125000005647 linker group Chemical group 0.000 description 3
- 230000009456 molecular mechanism Effects 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000010409 thin film Substances 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 229920002396 Polyurea Polymers 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000012527 feed solution Substances 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 230000002706 hydrostatic effect Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- IIPYXGDZVMZOAP-UHFFFAOYSA-N lithium nitrate Chemical compound [Li+].[O-][N+]([O-])=O IIPYXGDZVMZOAP-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 230000000149 penetrating effect Effects 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000012827 research and development Methods 0.000 description 2
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical class NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 125000003375 sulfoxide group Chemical group 0.000 description 2
- 238000003809 water extraction Methods 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- YSUQLAYJZDEMOT-UHFFFAOYSA-N 2-(butoxymethyl)oxirane Chemical group CCCCOCC1CO1 YSUQLAYJZDEMOT-UHFFFAOYSA-N 0.000 description 1
- KUBDPQJOLOUJRM-UHFFFAOYSA-N 2-(chloromethyl)oxirane;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound ClCC1CO1.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 KUBDPQJOLOUJRM-UHFFFAOYSA-N 0.000 description 1
- ZAMLGGRVTAXBHI-UHFFFAOYSA-N 3-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(CC(O)=O)C1=CC=C(Br)C=C1 ZAMLGGRVTAXBHI-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- WPBZMCGPFHZRHJ-UHFFFAOYSA-N 4-aminobenzohydrazide Chemical compound NNC(=O)C1=CC=C(N)C=C1 WPBZMCGPFHZRHJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- PLXMOAALOJOTIY-FPTXNFDTSA-N Aesculin Natural products OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1Oc2cc3C=CC(=O)Oc3cc2O PLXMOAALOJOTIY-FPTXNFDTSA-N 0.000 description 1
- 239000004953 Aliphatic polyamide Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 102100033189 Diablo IAP-binding mitochondrial protein Human genes 0.000 description 1
- 101710101225 Diablo IAP-binding mitochondrial protein Proteins 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910013553 LiNO Inorganic materials 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical class NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 240000000220 Panda oleosa Species 0.000 description 1
- 235000016496 Panda oleosa Nutrition 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 239000004783 Serene Substances 0.000 description 1
- 229910020175 SiOH Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 241000130764 Tinea Species 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 229920002522 Wood fibre Polymers 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 229920003231 aliphatic polyamide Polymers 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000004760 aramid Substances 0.000 description 1
- 229920003235 aromatic polyamide Polymers 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- UTTHLMXOSUFZCQ-UHFFFAOYSA-N benzene-1,3-dicarbohydrazide Chemical compound NNC(=O)C1=CC=CC(C(=O)NN)=C1 UTTHLMXOSUFZCQ-UHFFFAOYSA-N 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- XOYLJNJLGBYDTH-UHFFFAOYSA-M chlorogallium Chemical compound [Ga]Cl XOYLJNJLGBYDTH-UHFFFAOYSA-M 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012847 fine chemical Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 230000035929 gnawing Effects 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 239000011796 hollow space material Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 229910001026 inconel Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000009878 intermolecular interaction Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- CNQCVBJFEGMYDW-UHFFFAOYSA-N lawrencium atom Chemical compound [Lr] CNQCVBJFEGMYDW-UHFFFAOYSA-N 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000002175 menstrual effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical group C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000005496 phosphonium group Chemical group 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920003214 poly(methacrylonitrile) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003349 semicarbazides Chemical class 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N serine Chemical compound OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 235000015149 toffees Nutrition 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002025 wood fiber Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/56—Polyamides, e.g. polyester-amides
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/58—Other polymers having nitrogen in the main chain, with or without oxygen or carbon only
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/30—Low-molecular-weight compounds
- C08G18/38—Low-molecular-weight compounds having heteroatoms other than oxygen
- C08G18/3819—Low-molecular-weight compounds having heteroatoms other than oxygen having nitrogen
- C08G18/3823—Low-molecular-weight compounds having heteroatoms other than oxygen having nitrogen containing -N-C=O groups
- C08G18/3834—Low-molecular-weight compounds having heteroatoms other than oxygen having nitrogen containing -N-C=O groups containing hydrazide or semi-carbazide groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/32—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from aromatic diamines and aromatic dicarboxylic acids with both amino and carboxylic groups aromatically bound
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/08—Polyhydrazides; Polytriazoles; Polyaminotriazoles; Polyoxadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75727268A | 1968-09-04 | 1968-09-04 | |
| US84861169A | 1969-08-08 | 1969-08-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1941022A1 true DE1941022A1 (de) | 1970-06-04 |
Family
ID=27116360
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691941022 Pending DE1941022A1 (de) | 1968-09-04 | 1969-08-12 | Permeabilitaetsselektive Kunststoffmembran und Verfahren zur Herstellung derselben |
| DE1941932A Expired DE1941932C3 (de) | 1968-09-04 | 1969-08-18 | Permeabilitätsselektive Kunststoffmembran, aus Stickstoffverbindungen aufweisenden linearen Polykondensationsprodukten, Verfahren zu ihrer Herstellung und ihre Verwendung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1941932A Expired DE1941932C3 (de) | 1968-09-04 | 1969-08-18 | Permeabilitätsselektive Kunststoffmembran, aus Stickstoffverbindungen aufweisenden linearen Polykondensationsprodukten, Verfahren zu ihrer Herstellung und ihre Verwendung |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3567632A (enExample) |
| JP (1) | JPS5343540B1 (enExample) |
| BE (1) | BE737710A (enExample) |
| BR (1) | BR6912111D0 (enExample) |
| CH (1) | CH523702A (enExample) |
| DE (2) | DE1941022A1 (enExample) |
| ES (1) | ES371174A1 (enExample) |
| FR (1) | FR2017387A1 (enExample) |
| GB (1) | GB1259170A (enExample) |
| IL (1) | IL32884A (enExample) |
| NL (1) | NL164208C (enExample) |
| NO (1) | NO129750B (enExample) |
| SE (1) | SE370322B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2704600A1 (de) * | 1977-02-04 | 1978-08-17 | Hoechst Ag | Permselektive, asymmetrische membran mit heteroporoeser struktur auf basis von polyamid |
| EP0002053A3 (en) * | 1977-11-21 | 1979-06-13 | Hoechst Aktiengesellschaft | Polyamide based membrane for hemofiltration, method for its preparation, and its use |
| US7033668B2 (en) | 2001-08-23 | 2006-04-25 | Tesa Ag | Electrically conductive, preferably unbacked adhesive tape with permanent full-area pressure sensitive adhesion, composed of a film of a pressure sensitive adhesive which is preferably coated onto an antiadhesive medium and has an alkaline surface |
Families Citing this family (130)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3710945A (en) * | 1969-11-26 | 1973-01-16 | Du Pont | Preservation of polyamidic membranes |
| US3720607A (en) * | 1970-04-15 | 1973-03-13 | Celanese Corp | Reverse osmosis process employing polybenzimidazole membranes |
| US3760949A (en) * | 1971-08-13 | 1973-09-25 | Us Interior | Sealing means for hollow fiber bundles |
| US3904519A (en) * | 1971-10-19 | 1975-09-09 | Us Interior | Reverse osmosis process using crosslinked aromatic polyamide membranes |
| DE2208811C2 (de) * | 1972-02-24 | 1982-05-19 | Vsesojuznyj naučno-issledovatel'skij institut iskusstvennogo volokna, Mytišči, Moskovskaja oblast' | Aromatische Polyamide |
| US3954607A (en) * | 1972-05-01 | 1976-05-04 | E. I. Du Pont De Nemours And Company | Permselective membranes of diacyl hydrazide-containing aromatic polymers having selected metals complexed therewith |
| US3817386A (en) * | 1972-05-03 | 1974-06-18 | Westinghouse Electric Corp | Reverse osmosis membranes from pyrrone polymer precursors |
| US3822202A (en) * | 1972-07-20 | 1974-07-02 | Du Pont | Heat treatment of membranes of selected polyimides,polyesters and polyamides |
| US3853754A (en) * | 1972-07-20 | 1974-12-10 | Du Pont | Membrane separation of homogeneous catalysts from nitrile solutions |
| US3966595A (en) * | 1972-07-20 | 1976-06-29 | E. I. Du Pont De Nemours And Company | Method of making group VIII metal complex compounds |
| FR2193634A1 (en) * | 1972-07-20 | 1974-02-22 | Du Pont | Polyimide semi-permeable membranes |
| JPS5223346B2 (enExample) * | 1972-08-30 | 1977-06-23 | ||
| US3886066A (en) * | 1972-11-06 | 1975-05-27 | Du Pont | Tannin treatment for non-porous semipermeable membranes |
| GB1462171A (en) * | 1972-12-21 | 1977-01-19 | Nederlandse Appl Scient Res | Process for making thin polymer foils and their use in a dynamic membrane |
| US3993625A (en) * | 1973-05-28 | 1976-11-23 | Toray Industries, Inc. | Permselective polymeric membranes of organic polyamide or polyhydrazide |
| JPS5537282B2 (enExample) * | 1974-03-11 | 1980-09-26 | ||
| US4082668A (en) * | 1973-09-04 | 1978-04-04 | Rashid Ayoub Zeineh | Ultra filtration apparatus and method |
| US3951789A (en) * | 1973-10-11 | 1976-04-20 | Allied Chemical Corporation | Novel high diffusivity membranes |
| JPS5633961B2 (enExample) * | 1974-12-19 | 1981-08-07 | ||
| DE2602493A1 (de) * | 1975-01-27 | 1976-07-29 | Ramot Plastics | Verfahren zur entfernung von harnstoff aus waessrigen loesungen |
| JPS5193786A (en) * | 1975-02-15 | 1976-08-17 | Makurokagatano chukuseni | |
| IT1040274B (it) * | 1975-07-30 | 1979-12-20 | Consiglio Nazionale Ricerche | Procedimento di preparazione di membrane anisotrope supportate per osmosi inversa a base di poliammidi sintetiche |
| JPS5245591A (en) * | 1975-10-08 | 1977-04-11 | Toyobo Co Ltd | Reverse osmotic membrane |
| DE2554932A1 (de) * | 1975-12-06 | 1977-06-08 | Bayer Ag | Semipermeable membranen aus copolyamiden |
| US4217227A (en) * | 1975-12-06 | 1980-08-12 | Bayer Aktiengesellschaft | Semipermeable membranes of copolyamides |
| DE2554922A1 (de) * | 1975-12-06 | 1977-06-16 | Bayer Ag | Semipermeable membranen aus copolyamiden |
| JPS5814242B2 (ja) * | 1976-04-06 | 1983-03-18 | 東レ株式会社 | 高性能逆浸透用薄膜 |
| JPS52152879A (en) * | 1976-06-16 | 1977-12-19 | Toray Ind Inc | Thin membrane for reverse osmosis of high capacity |
| US4159251A (en) * | 1976-09-29 | 1979-06-26 | Pharmaco, Inc. | Ultrafiltration membranes based on heteroaromatic polymers |
| US4087388A (en) * | 1976-10-21 | 1978-05-02 | E. I. Du Pont De Nemours And Company | Process of preparing a permselective membrane |
| CA1107424A (en) * | 1976-10-21 | 1981-08-18 | E. I. Du Pont De Nemours And Company | Permselective membranes and polymeric solution for making same |
| JPS54107882A (en) * | 1978-02-13 | 1979-08-24 | Toray Ind Inc | Semipermeable membrane |
| US4259183A (en) * | 1978-11-07 | 1981-03-31 | Midwest Research Institute | Reverse osmosis membrane |
| US4277344A (en) * | 1979-02-22 | 1981-07-07 | Filmtec Corporation | Interfacially synthesized reverse osmosis membrane |
| JPS587324B2 (ja) * | 1979-06-04 | 1983-02-09 | 日東電工株式会社 | 選択性透過膜の製造方法 |
| US4278548A (en) * | 1979-08-20 | 1981-07-14 | E. I. Du Pont De Nemours And Company | Control of biological growth in reverse osmosis permeators |
| JPS5695304A (en) * | 1979-12-28 | 1981-08-01 | Teijin Ltd | Perm selective composite membrane and its production |
| US4900443A (en) * | 1980-03-14 | 1990-02-13 | Memtec North America Corporation | Porous aramid membranes and emulsions useful for the casting thereof |
| US4293420A (en) * | 1980-04-18 | 1981-10-06 | E. I. Du Pont De Nemours And Company | Treatment of reverse osmosis membranes |
| US4385148A (en) * | 1981-06-25 | 1983-05-24 | E. I. Du Pont De Nemours And Company | Reverse osmosis membrane preparation |
| US4454176A (en) * | 1981-10-21 | 1984-06-12 | E. I. Du Pont De Nemours And Company | Supported reverse osmosis membranes |
| DE3220376A1 (de) * | 1982-05-29 | 1983-12-01 | Seitz-Filter-Werke Theo & Geo Seitz GmbH und Co, 6550 Bad Kreuznach | Membranfilter fuer mikrofiltration und verfahren zu seiner herstellung |
| US4471110A (en) * | 1982-08-02 | 1984-09-11 | E. I. Dupont De Nemours And Company | Polyamide of disulfonated diamine and permselective membrane thereof |
| US4448687A (en) * | 1982-12-17 | 1984-05-15 | Celanese Corporation | Process for the production of semipermeable polybenzimidazole membranes with low temperature annealing |
| US4544484A (en) * | 1983-06-24 | 1985-10-01 | E. I. Du Pont De Nemours And Company | Reverse osmosis membrane quenching |
| US4659475A (en) * | 1984-03-19 | 1987-04-21 | Midwest Research Institute | Composite reverse osmosis membrane comprising crosslinked poly(amine-epihalohydrin adduct) |
| US4643829A (en) * | 1984-07-30 | 1987-02-17 | E. I. Du Pont De Nemours And Company | Multilayer reverse osmosis membrane in which one layer is poly-meta-phenylene cyclohexane-1,3,5-tricarboxamide |
| AU4787685A (en) * | 1984-09-27 | 1986-04-10 | E.I. Du Pont De Nemours And Company | Aromatic polyamide membrane for reverse osmosis |
| US4601827A (en) * | 1984-09-27 | 1986-07-22 | E. I. Du Pont De Nemours And Company | Multistage annealing of aramide reverse osmosis membranes |
| EP0179474A3 (en) * | 1984-10-24 | 1988-07-13 | E.I. Du Pont De Nemours And Company | Gas separation membrane and process for preparing it |
| US4772394A (en) * | 1984-12-26 | 1988-09-20 | Uop Inc. | Chlorine-resistant semipermeable membranes |
| US4758348A (en) * | 1985-02-01 | 1988-07-19 | Sagami Chemical Research Center | Copolymer, separating membrane made thereof and method for separating charge transfer interactive substance from a liquid mixture containing the same |
| US4824916A (en) * | 1985-03-15 | 1989-04-25 | The Dow Chemical Company | Water-insoluble, crosslinked, sulfonated aromatic polyamide |
| US4704324A (en) * | 1985-04-03 | 1987-11-03 | The Dow Chemical Company | Semi-permeable membranes prepared via reaction of cationic groups with nucleophilic groups |
| US4661254A (en) * | 1985-05-23 | 1987-04-28 | Uop Inc. | Chlorine-resistant semipermeable membranes |
| US4761234A (en) * | 1985-08-05 | 1988-08-02 | Toray Industries, Inc. | Interfacially synthesized reverse osmosis membrane |
| US4758343A (en) * | 1985-09-20 | 1988-07-19 | Toray Industries, Inc. | Interfacially synthesized reverse osmosis membrane |
| US4919808A (en) * | 1985-10-21 | 1990-04-24 | Allied-Signal Inc. | Semipermeable membrane compositions |
| US4626468A (en) * | 1986-04-23 | 1986-12-02 | E. I. Du Pont De Nemours And Company | Microporous support layer with interfacially polymerized copolyamide thereon |
| US4855058A (en) * | 1986-06-24 | 1989-08-08 | Hydranautics | High recovery spiral wound membrane element |
| US4895660A (en) * | 1986-07-14 | 1990-01-23 | The Dow Chemical Company | Water-soluble aromatic polyamides and polyureas |
| US4830885A (en) * | 1987-06-08 | 1989-05-16 | Allied-Signal Inc. | Chlorine-resistant semipermeable membranes |
| US4909943A (en) * | 1987-07-20 | 1990-03-20 | The Dow Chemical Company | Rejection enhancing coatings for reverse osmosis membranes |
| US4894165A (en) * | 1987-07-20 | 1990-01-16 | The Dow Chemical Company | Rejection enhancing coatings for reverse osmosis membranes |
| US4749488A (en) * | 1987-10-08 | 1988-06-07 | E. I. Du Pont De Nemours And Company | Multilayer reverse osmosis membrane in which one layer is poly-meta-phenylene tetrahydrofuran-2,3,4,5-tetracarboxamide |
| US4859384A (en) * | 1987-11-18 | 1989-08-22 | Filmtec Corp. | Novel polyamide reverse osmosis membranes |
| US4769148A (en) * | 1987-11-18 | 1988-09-06 | The Dow Chemical Company | Novel polyamide reverse osmosis membranes |
| US4783346A (en) * | 1987-12-10 | 1988-11-08 | E. I. Du Pont De Nemours And Company | Process for preparing composite membranes |
| US4792404A (en) * | 1988-03-28 | 1988-12-20 | Allied-Signal Inc. | Desalination of saline water |
| US4959237A (en) * | 1989-06-07 | 1990-09-25 | E. I. Du Pont De Nemours And Company | Reverse osmosis concentration of juice products with improved flavor |
| US5098573A (en) * | 1990-09-12 | 1992-03-24 | The United States Of America As Represented By The Secretary Of The Interior | Binary concentration and recovery process |
| US5076817A (en) * | 1990-11-30 | 1991-12-31 | E. I. Du Pont De Nemours And Company | Polyamide gas separation membranes and process of using same |
| US5039417A (en) * | 1990-12-06 | 1991-08-13 | Exxon Research And Engineering Company | Membrane made from a multi-block polymer comprising an imide or amide-acid prepolymer chain extended with a compatible second prepolymer and its use in separations |
| US5096592A (en) * | 1990-12-06 | 1992-03-17 | Exxon Research And Engineering Company | Multi-block polymer comprising an ester prepolymer, chain extended with a compatible second prepolymer, the membrane made therefrom and its use in separations |
| US5221481A (en) * | 1990-12-06 | 1993-06-22 | Exxon Research And Engineering Company | Multi-block polymer comprising an ester prepolymer, made by combining epoxy with polyester, chain extended with a compatible second prepolymer, the membrane made therefrom and its use for separations |
| US5130017A (en) * | 1990-12-06 | 1992-07-14 | Exxon Research And Engineering Company | Multi-block polymer comprising a first amide acid prepolymer, chain extended with a compatible second prepolymer, the membrane made therefrom and its use in separations |
| US5562826A (en) * | 1991-10-26 | 1996-10-08 | Hoechst Aktiengesellschaft | Semipermeable, porous, asymmetric polyether amide membranes |
| KR0183370B1 (ko) * | 1995-07-07 | 1999-04-15 | 김은영 | 방향족 폴리에스테르 또는 방향족 폴리에스테르와 폴리아미드 공중합체의 활성층을 갖는 역삼투용 복합막 |
| US5985146A (en) * | 1997-07-23 | 1999-11-16 | Trisep Corporation | Sanitary rigid shell spiral wound element |
| US6011192A (en) * | 1998-05-22 | 2000-01-04 | Membrane Technology And Research, Inc. | Membrane-based conditioning for adsorption system feed gases |
| US6346192B2 (en) * | 1999-05-14 | 2002-02-12 | Therox, Inc. | Apparatus for high pressure fluid filtration |
| US6503295B1 (en) | 2000-09-20 | 2003-01-07 | Chevron U.S.A. Inc. | Gas separations using mixed matrix membranes |
| US20030131731A1 (en) * | 2001-12-20 | 2003-07-17 | Koros William J. | Crosslinked and crosslinkable hollow fiber mixed matrix membrane and method of making same |
| US20030126990A1 (en) | 2001-12-20 | 2003-07-10 | Koros William J. | Crosslinked and crosslinkable hollow fiber membrane and method of making same |
| US7381715B2 (en) * | 2001-12-21 | 2008-06-03 | E.I. Du Pont De Nemours And Company | Antimicrobial solid surface materials containing chitosan-metal complexes |
| EP1639898A4 (en) * | 2003-06-20 | 2008-05-07 | Maekawa Seisakusho Kk | METHOD FOR DISCONNECTING OUTSIDE MEAT FROM THE HANDLE AND DEVICE THEREFOR |
| US7268094B2 (en) * | 2003-08-18 | 2007-09-11 | Chevron U.S.A. Inc. | Mixed matrix membrane with super water washed silica containing molecular sieves and methods for making and using the same |
| US7138006B2 (en) * | 2003-12-24 | 2006-11-21 | Chevron U.S.A. Inc. | Mixed matrix membranes with low silica-to-alumina ratio molecular sieves and methods for making and using the membranes |
| US7166146B2 (en) * | 2003-12-24 | 2007-01-23 | Chevron U.S.A. Inc. | Mixed matrix membranes with small pore molecular sieves and methods for making and using the membranes |
| JP4656502B2 (ja) * | 2004-10-01 | 2011-03-23 | 日東電工株式会社 | 複合半透膜及びその製造方法 |
| JP4656503B2 (ja) * | 2004-10-01 | 2011-03-23 | 日東電工株式会社 | 複合半透膜及びその製造方法 |
| JP2006102594A (ja) * | 2004-10-01 | 2006-04-20 | Nitto Denko Corp | 複合半透膜の製造方法 |
| JP4656511B2 (ja) * | 2004-10-04 | 2011-03-23 | 日東電工株式会社 | 複合逆浸透膜の製造方法 |
| US7306647B2 (en) * | 2004-11-19 | 2007-12-11 | Chevron U.S.A. Inc. | Mixed matrix membrane with mesoporous particles and methods for making and using the same |
| US7727434B2 (en) * | 2005-08-16 | 2010-06-01 | General Electric Company | Membranes and methods of treating membranes |
| JP3995695B2 (ja) * | 2005-12-15 | 2007-10-24 | シャープ株式会社 | フィルタユニット |
| US7485173B1 (en) | 2005-12-15 | 2009-02-03 | Uop Llc | Cross-linkable and cross-linked mixed matrix membranes and methods of making the same |
| US7846496B2 (en) * | 2006-03-10 | 2010-12-07 | Uop Llc | Mixed matrix membranes incorporating surface-functionalized molecular sieve nanoparticles and methods for making the same |
| US8083833B2 (en) * | 2006-03-10 | 2011-12-27 | Uop Llc | Flexible template-directed microporous partially pyrolyzed polymeric membranes |
| US20070209505A1 (en) * | 2006-03-10 | 2007-09-13 | Chunqing Liu | High Flux Mixed Matrix Membranes for Separations |
| US7897207B2 (en) * | 2006-03-10 | 2011-03-01 | Uop Llc | Nano-molecular sieve-polymer mixed matrix membranes with significantly improved gas separation performance |
| US20070227966A1 (en) * | 2006-03-31 | 2007-10-04 | Koo Ja-Young | Composite polyamide reverse osmosis membrane showing high boron rejection and method of producing the same |
| US7637983B1 (en) | 2006-06-30 | 2009-12-29 | Uop Llc | Metal organic framework—polymer mixed matrix membranes |
| JP2008093544A (ja) * | 2006-10-10 | 2008-04-24 | Nitto Denko Corp | 複合半透膜及びその製造方法 |
| JP4936438B2 (ja) * | 2006-10-10 | 2012-05-23 | 日東電工株式会社 | 乾燥複合半透膜の製造方法 |
| US7758751B1 (en) | 2006-11-29 | 2010-07-20 | Uop Llc | UV-cross-linked membranes from polymers of intrinsic microporosity for liquid separations |
| US7935647B2 (en) * | 2006-12-15 | 2011-05-03 | E. I. Du Pont De Nemours And Company | Laminates of acid polysaccharide films |
| US7815712B2 (en) * | 2006-12-18 | 2010-10-19 | Uop Llc | Method of making high performance mixed matrix membranes using suspensions containing polymers and polymer stabilized molecular sieves |
| US20080142440A1 (en) * | 2006-12-18 | 2008-06-19 | Chunqing Liu | Liquid Separations Using High Performance Mixed Matrix Membranes |
| US20080143014A1 (en) * | 2006-12-18 | 2008-06-19 | Man-Wing Tang | Asymmetric Gas Separation Membranes with Superior Capabilities for Gas Separation |
| US7998246B2 (en) * | 2006-12-18 | 2011-08-16 | Uop Llc | Gas separations using high performance mixed matrix membranes |
| JP2008246419A (ja) * | 2007-03-30 | 2008-10-16 | Nitto Denko Corp | 複合半透膜の製造方法 |
| US8221531B2 (en) * | 2007-12-31 | 2012-07-17 | Chevron U.S.A. Inc. | Crosslinked polyimide membrane, method for making the same using organic titanate catalysts to facilitate crosslinking and method of using the membrane for fluid separation |
| US8177978B2 (en) | 2008-04-15 | 2012-05-15 | Nanoh20, Inc. | Reverse osmosis membranes |
| US7790803B2 (en) * | 2008-06-02 | 2010-09-07 | Uop Llc | Crosslinked organic-inorganic hybrid membranes and their use in gas separation |
| CA2766352C (en) * | 2009-06-29 | 2018-09-18 | NanoH2O Inc. | Improved hybrid tfc ro membranes with nitrogen additives |
| US8307994B2 (en) * | 2009-10-28 | 2012-11-13 | International Business Machines Corporation | Surface charge enabled nanoporous semi-permeable membrane for desalination |
| US20110138999A1 (en) * | 2009-12-15 | 2011-06-16 | Uop Llc | Metal organic framework polymer mixed matrix membranes |
| CA2817570C (en) | 2010-11-10 | 2018-03-06 | Nanoh2O, Inc. | Improved hybrid tfc ro membranes with additives |
| WO2013130923A1 (en) * | 2012-03-02 | 2013-09-06 | Saudi Arabian Oil Company | Facilitated transport membrane for the separation of aromatics from non-aromatics |
| CN104529792B (zh) * | 2014-12-31 | 2016-04-13 | 康乃尔化学工业股份有限公司 | 苯胺生产中液相加氢系统的催化剂除盐装置 |
| US9861940B2 (en) | 2015-08-31 | 2018-01-09 | Lg Baboh2O, Inc. | Additives for salt rejection enhancement of a membrane |
| US9737859B2 (en) | 2016-01-11 | 2017-08-22 | Lg Nanoh2O, Inc. | Process for improved water flux through a TFC membrane |
| US10155203B2 (en) | 2016-03-03 | 2018-12-18 | Lg Nanoh2O, Inc. | Methods of enhancing water flux of a TFC membrane using oxidizing and reducing agents |
| US11097957B2 (en) * | 2018-12-12 | 2021-08-24 | FairCap CIC | Apparatus and method for filtering water |
| US11613477B2 (en) | 2020-11-03 | 2023-03-28 | FairCap CIC | Self-cleaning water filter |
| CN112455870B (zh) * | 2020-11-19 | 2023-10-20 | 衡阳鸿宇化工有限责任公司 | 一种防潮解的三氯化铝收集装置及其使用方法 |
| DE102021133420A1 (de) | 2021-12-16 | 2023-06-22 | UNISOL Membrane Technology GmbH | Spiralwickelelement |
| CN114853626B (zh) * | 2022-05-27 | 2024-07-26 | 超美斯新材料股份有限公司 | 一种芳纶生产副产物中dmac回收方法 |
| CN119264804B (zh) * | 2024-12-12 | 2025-04-25 | 浙江大学 | 一种原位制备共形离子器件的方法 |
-
1969
- 1969-08-08 US US848611A patent/US3567632A/en not_active Expired - Lifetime
- 1969-08-12 DE DE19691941022 patent/DE1941022A1/de active Pending
- 1969-08-18 DE DE1941932A patent/DE1941932C3/de not_active Expired
- 1969-08-20 BE BE737710D patent/BE737710A/xx not_active IP Right Cessation
- 1969-08-24 IL IL32884A patent/IL32884A/en unknown
- 1969-08-27 GB GB1259170D patent/GB1259170A/en not_active Expired
- 1969-09-02 CH CH1328969A patent/CH523702A/de not_active IP Right Cessation
- 1969-09-03 BR BR212111/69A patent/BR6912111D0/pt unknown
- 1969-09-03 SE SE6912183A patent/SE370322B/xx unknown
- 1969-09-03 ES ES371174A patent/ES371174A1/es not_active Expired
- 1969-09-03 JP JP6964069A patent/JPS5343540B1/ja active Pending
- 1969-09-03 NO NO03532/69A patent/NO129750B/no unknown
- 1969-09-04 NL NL6913516.A patent/NL164208C/xx not_active IP Right Cessation
- 1969-09-04 FR FR6930211A patent/FR2017387A1/fr active Pending
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2704600A1 (de) * | 1977-02-04 | 1978-08-17 | Hoechst Ag | Permselektive, asymmetrische membran mit heteroporoeser struktur auf basis von polyamid |
| EP0002053A3 (en) * | 1977-11-21 | 1979-06-13 | Hoechst Aktiengesellschaft | Polyamide based membrane for hemofiltration, method for its preparation, and its use |
| US7033668B2 (en) | 2001-08-23 | 2006-04-25 | Tesa Ag | Electrically conductive, preferably unbacked adhesive tape with permanent full-area pressure sensitive adhesion, composed of a film of a pressure sensitive adhesive which is preferably coated onto an antiadhesive medium and has an alkaline surface |
Also Published As
| Publication number | Publication date |
|---|---|
| NL6913516A (enExample) | 1970-03-06 |
| DE1941932C3 (de) | 1979-10-11 |
| ES371174A1 (es) | 1972-01-16 |
| BR6912111D0 (pt) | 1973-04-10 |
| JPS5343540B1 (enExample) | 1978-11-21 |
| NL164208C (nl) | 1980-12-15 |
| NO129750B (enExample) | 1974-05-20 |
| DE1941932B2 (de) | 1979-02-22 |
| IL32884A (en) | 1972-11-28 |
| NL164208B (nl) | 1980-07-15 |
| BE737710A (enExample) | 1970-02-20 |
| US3567632A (en) | 1971-03-02 |
| FR2017387A1 (enExample) | 1970-05-22 |
| IL32884A0 (en) | 1969-11-30 |
| CH523702A (de) | 1972-06-15 |
| DE1941932A1 (de) | 1970-05-06 |
| GB1259170A (en) | 1972-01-05 |
| SE370322B (enExample) | 1974-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1941022A1 (de) | Permeabilitaetsselektive Kunststoffmembran und Verfahren zur Herstellung derselben | |
| DE2264195C3 (de) | Verfahren zum Verbessern des Abweisungsvermögens semipermeabler Membranen für gelöste Stoffe | |
| DE3247536C2 (enExample) | ||
| DE2606244C3 (enExample) | ||
| DE2849978C3 (de) | Selektivdurchlässige Membran und Verfahren zu deren Herstellung | |
| DE3112937C2 (de) | Verfahren zur Herstellung einer selektiv durchlässigen Polyimidmembran | |
| DE2145183C3 (de) | Verwendung von Mischpolymerisaten auf der Basis von Acrylnitril zur Herstellung von semipermeablen Membranen zur Dialyse oder Ultrafiltration | |
| DE2918027C2 (de) | Ultrafiltrationsmembranen aus linearen Polyurethanen | |
| DE2531159A1 (de) | Semipermeable polymere membran und verfahren zu ihrer herstellung | |
| DE3856177T2 (de) | Verfahren zur Herstellung von stabilen Umkehrosmose-Membranen aus sulfonierten Polyaryläthern | |
| DE2829630B2 (de) | Semipermeable Membran und Verfahren zu ihrer Herstellung | |
| DE1494579B2 (de) | Verfahren zur Herstellung von durchlässigkeitsselektiven Hohlfasern | |
| DE1954505A1 (de) | Poroese Hohlfasern | |
| DE3342823C2 (enExample) | ||
| DE3611410C2 (de) | Im wesentlichen Protein nicht-adsorbierende, semipermeable Filtrationsmembran | |
| DE2747390A1 (de) | Verfahren zur herstellung von permselektiven membranen | |
| DE2558391A1 (de) | Sulfonierte polyarylaethersulfone und ihre anwendung | |
| DE2342226A1 (de) | Integrale, halbdurchlaessige polymere filmmembran und verfahren zu ihrer herstellung | |
| DE2621519C3 (de) | Verfahren zur Herstellung von asymmetrischen permselektiven Zellulosetriacetatmembranen mit Skinschicht | |
| DE3606440A1 (de) | Thromboresistente polyetherurethanverbindung und verfahren zu ihrer herstellung | |
| DE1570233A1 (de) | Verfahren zur Herstellung von Blockmischkondensaten mit Amid- oder Harnstoffgruppen | |
| DE2418996A1 (de) | Asymmetrische, semipermeable membranen aus polybenz-1,3-oxazindionen-2,4 | |
| DE2431071A1 (de) | Asymmetrische, semipermeable membranen aus cyclischen polyharnstoffen | |
| DE2536492A1 (de) | Semipermeable membranen aus sulfonierten polybenz-1,3-oxazindionen- (2,4) | |
| DE2943753A1 (de) | Verfahren zur herstellung von hohlfasermembranen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |