DE2606244C3 - - Google Patents
Info
- Publication number
- DE2606244C3 DE2606244C3 DE2606244A DE2606244A DE2606244C3 DE 2606244 C3 DE2606244 C3 DE 2606244C3 DE 2606244 A DE2606244 A DE 2606244A DE 2606244 A DE2606244 A DE 2606244A DE 2606244 C3 DE2606244 C3 DE 2606244C3
- Authority
- DE
- Germany
- Prior art keywords
- solvent
- polymer
- liquid
- filter
- hollow fiber
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012510 hollow fiber Substances 0.000 claims description 105
- 239000002904 solvent Substances 0.000 claims description 56
- 239000011148 porous material Substances 0.000 claims description 51
- 239000007788 liquid Substances 0.000 claims description 37
- 238000005345 coagulation Methods 0.000 claims description 33
- 230000015271 coagulation Effects 0.000 claims description 33
- 229920000642 polymer Polymers 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 17
- 238000009987 spinning Methods 0.000 claims description 15
- 229920002301 cellulose acetate Polymers 0.000 claims description 14
- 239000012530 fluid Substances 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 claims description 9
- 239000001110 calcium chloride Substances 0.000 claims description 9
- 229910001628 calcium chloride Inorganic materials 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 8
- 238000005374 membrane filtration Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 230000001112 coagulating effect Effects 0.000 claims description 5
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 5
- 238000000605 extraction Methods 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 claims description 2
- 150000002772 monosaccharides Chemical class 0.000 claims description 2
- 239000002667 nucleating agent Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 claims 2
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 230000000737 periodic effect Effects 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- 238000001914 filtration Methods 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 230000000694 effects Effects 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 235000011148 calcium chloride Nutrition 0.000 description 8
- 239000000835 fiber Substances 0.000 description 8
- 239000002245 particle Substances 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000009826 distribution Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- -1 aliphatic alcohols Chemical class 0.000 description 6
- 238000000502 dialysis Methods 0.000 description 6
- 238000000635 electron micrograph Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 102000009027 Albumins Human genes 0.000 description 5
- 108010088751 Albumins Proteins 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 238000007792 addition Methods 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 239000004816 latex Substances 0.000 description 4
- 229920000126 latex Polymers 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- 229920001778 nylon Polymers 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 206010003445 Ascites Diseases 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000004677 Nylon Substances 0.000 description 3
- 230000021736 acetylation Effects 0.000 description 3
- 238000006640 acetylation reaction Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 229920000915 polyvinyl chloride Polymers 0.000 description 3
- 239000004800 polyvinyl chloride Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 238000009395 breeding Methods 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 238000001223 reverse osmosis Methods 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000000108 ultra-filtration Methods 0.000 description 2
- VUFZVGQUAVDKMC-UHFFFAOYSA-N Allyl phenoxyacetate Chemical compound C=CCOC(=O)COC1=CC=CC=C1 VUFZVGQUAVDKMC-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- LLKGPHSBIJYOGM-UHFFFAOYSA-N [ClH]=S Chemical compound [ClH]=S LLKGPHSBIJYOGM-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000019504 cigarettes Nutrition 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- HPXRVTGHNJAIIH-PTQBSOBMSA-N cyclohexanol Chemical group O[13CH]1CCCCC1 HPXRVTGHNJAIIH-PTQBSOBMSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010612 desalination reaction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 208000019423 liver disease Diseases 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000001000 micrograph Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01D—MECHANICAL METHODS OR APPARATUS IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS
- D01D5/00—Formation of filaments, threads, or the like
- D01D5/24—Formation of filaments, threads, or the like with a hollow structure; Spinnerette packs therefor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D69/00—Semi-permeable membranes for separation processes or apparatus characterised by their form, structure or properties; Manufacturing processes specially adapted therefor
- B01D69/08—Hollow fibre membranes
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Artificial Filaments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50018426A JPS5193786A (en) | 1975-02-15 | 1975-02-15 | Makurokagatano chukuseni |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2606244A1 DE2606244A1 (de) | 1976-08-26 |
| DE2606244B2 DE2606244B2 (de) | 1981-09-17 |
| DE2606244C3 true DE2606244C3 (enExample) | 1989-09-21 |
Family
ID=11971310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2606244A Granted DE2606244B2 (de) | 1975-02-15 | 1976-02-13 | Hohlfasern für Membranfiltration und Verfahren zu ihrer Herstellung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4234431A (enExample) |
| JP (1) | JPS5193786A (enExample) |
| DE (1) | DE2606244B2 (enExample) |
| FR (1) | FR2300606A1 (enExample) |
| GB (1) | GB1506785A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10155901A1 (de) * | 2001-11-14 | 2003-05-15 | Mann & Hummel Filter | Verfahren zur Erzeugung von einer Beschichtung auf einer Hohlfaser |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4340481A (en) * | 1975-02-15 | 1982-07-20 | Asahi Kasei Kogyo Kabushiki | Membrane filtration type hollow fibers |
| ZA774635B (en) * | 1976-08-30 | 1978-06-28 | Akzona Inc | Microporous products and methods for making same |
| JPS546916A (en) * | 1977-06-20 | 1979-01-19 | Asahi Chem Ind Co Ltd | Hollow cellulose fibers and their production |
| JPS5411322A (en) * | 1977-06-29 | 1979-01-27 | Asahi Chem Ind Co Ltd | Hollow cellulose fibers and their production |
| US4385017A (en) * | 1977-06-30 | 1983-05-24 | Nippon Zeon Co., Ltd. | Method of manufacturing hollow fiber |
| NZ188666A (en) * | 1977-10-21 | 1980-12-19 | Unisearch Ltd | Anisotropic synthetic membrane |
| DE2751910B2 (de) | 1977-11-21 | 1979-09-20 | Hoechst Ag, 6000 Frankfurt | Permselektive, asymmetrische Hämofiltrationsmembran mit heteroporöser Struktur |
| JPS5562214A (en) * | 1978-11-02 | 1980-05-10 | Toyobo Co Ltd | Production of hollow fiber membrane |
| JPS54145379A (en) * | 1978-05-02 | 1979-11-13 | Asahi Chem Ind Co Ltd | Aromatic polysulfone hollow fiber semipermeable membrane |
| DE2833623A1 (de) * | 1978-07-31 | 1980-03-13 | Akzo Gmbh | Folien |
| DE2967152D1 (en) * | 1978-08-22 | 1984-09-06 | Mitsubishi Rayon Co | Process for manufacturing regenerated cellulose hollow fiber |
| CA1141114A (en) | 1978-11-24 | 1983-02-15 | Masamichi Ishida | Regenerated cellulose hollow fiber and process for manufacturing same |
| JPS5596162A (en) * | 1979-01-18 | 1980-07-22 | Asahi Medical Co | Polycarbonate hollow fiber dialysis film and its preparation |
| GB2047874B (en) * | 1979-03-17 | 1983-12-21 | Akzo Nv | Apparatus in which heat is transferred through hollow threads as well as hollow threads suitable for this purpose |
| JPS55148210A (en) * | 1979-04-30 | 1980-11-18 | Kuraray Co Ltd | Preparation of hollow ethylene-vinyl alcohol membrane |
| EP0023664B1 (en) * | 1979-07-26 | 1985-12-04 | Teijin Limited | Process for producing the same of hollow water-absorbing polyester filaments |
| JPS5642584A (en) | 1979-09-18 | 1981-04-20 | Asahi Chem Ind Co Ltd | Cell cultivation method |
| DE3006880C2 (de) * | 1980-02-23 | 1986-10-09 | Akzo Gmbh, 5600 Wuppertal | Plasmaphoresemembran |
| US4386897A (en) * | 1980-06-05 | 1983-06-07 | Mobil Oil Corporation | System for recovering film from pressurized extrusion zone |
| SE423106B (sv) * | 1980-07-25 | 1982-04-13 | Gambro Dialysatoren | Plasmaferesmembran samt sett att tillverka detta |
| JPS5742919A (en) * | 1980-08-22 | 1982-03-10 | Mitsubishi Rayon Co Ltd | Porous hollow polyethylenic fiber and its preparation |
| DE3042110A1 (de) * | 1980-11-07 | 1982-06-16 | Akzo Gmbh, 5600 Wuppertal | Mikroporoese cellulosemembran |
| DE3276853D1 (en) * | 1981-05-19 | 1987-09-03 | Teijin Ltd | Porous membrane |
| DE3138525A1 (de) * | 1981-09-28 | 1983-04-14 | Akzo Gmbh, 5600 Wuppertal | Verfahren zur herstellung einer asymmetrischen hohlfadenmembran aus polyamid |
| SE429441B (sv) * | 1982-04-30 | 1983-09-05 | Gambro Dialysatoren | Mikroporost halfibermenbran for plasmaferes, samt sett att framstella membranet |
| JPS60188166A (ja) * | 1984-03-07 | 1985-09-25 | 鐘淵化学工業株式会社 | 人工血管の製法 |
| JPS60194957A (ja) * | 1984-03-19 | 1985-10-03 | 鐘淵化学工業株式会社 | 人工血管の製法 |
| NL8401912A (nl) * | 1984-06-15 | 1986-01-02 | Tno | Met aktieve stof beladen biodegradeerbare polymeersubstraten, geschikt voor het gecontroleerd afgeven van de aktieve stof door middel van een membraan. |
| US4744932A (en) * | 1985-05-31 | 1988-05-17 | Celanese Corporation | Process for forming a skinless hollow fiber of a cellulose ester |
| US4681605A (en) | 1985-06-27 | 1987-07-21 | A/G Technology Corporation | Anisotropic membranes for gas separation |
| US4808315A (en) * | 1986-04-28 | 1989-02-28 | Asahi Kasei Kogyo Kabushiki Kaisha | Porous hollow fiber membrane and a method for the removal of a virus by using the same |
| JPH0653164B2 (ja) * | 1986-06-10 | 1994-07-20 | 東洋紡績株式会社 | セルロ−スエステル系中空糸状血漿分離膜 |
| US4857196A (en) * | 1987-08-07 | 1989-08-15 | Asahi Kasei Kogyo Kabushiki Kaisha | Porous hollow fiber membrane and a method for the removal of a virus by using the same |
| JPH01111404A (ja) * | 1987-10-24 | 1989-04-28 | Toyobo Co Ltd | 中空糸型血漿分離膜 |
| US5049276A (en) * | 1988-10-13 | 1991-09-17 | Fuji Photo Film Co., Ltd. | Hollow fiber membrane |
| FR2641709B1 (fr) * | 1988-12-22 | 1992-01-17 | Lyonnaise Eaux | Procede pour la fabrication d'un materiau poreux organique, notamment d'une membrane semi-permeable organique, comportant une pluralite de canaux longitudinaux separes |
| FR2641708B1 (fr) * | 1988-12-22 | 1992-01-17 | Lyonnaise Eaux | Procede pour la fabrication d'un materiau poreux organique, notamment d'une membrane semi-permeable organique, comportant une pluralite de canaux longitudinaux separes |
| EP0547471B1 (de) * | 1991-12-14 | 1997-03-12 | Akzo Nobel N.V. | Polyacrylnitrilmembran |
| EP0574699A2 (de) * | 1992-05-20 | 1993-12-22 | Akzo Nobel N.V. | Dialysemembran aus Celluloseacetat |
| GB2408961A (en) * | 2003-12-12 | 2005-06-15 | Univ Cambridge Tech | Apparatus and method |
| GB2414079A (en) * | 2004-04-02 | 2005-11-16 | Donald Anthony Howard | Sheet feeding device with automatic thickness set-up |
| US20070074733A1 (en) * | 2005-10-04 | 2007-04-05 | Philip Morris Usa Inc. | Cigarettes having hollow fibers |
| US8113215B2 (en) * | 2007-06-21 | 2012-02-14 | Philip Morris Usa Inc. | Smoking article filter having liquid additive containing tubes therein |
| US11092977B1 (en) | 2017-10-30 | 2021-08-17 | Zane Coleman | Fluid transfer component comprising a film with fluid channels |
| US20230028621A1 (en) | 2019-12-23 | 2023-01-26 | Biopsense Oy | Method, automated system and cartridge for extraction of cell-free nucleic acids from a blood sample |
| JPWO2024181277A1 (enExample) * | 2023-02-28 | 2024-09-06 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3423491A (en) * | 1964-09-02 | 1969-01-21 | Dow Chemical Co | Permselective hollow fibers and method of making |
| US3532527A (en) * | 1966-11-04 | 1970-10-06 | Dow Chemical Co | Permeable separatory membranes |
| GB1238180A (enExample) * | 1967-09-21 | 1971-07-07 | ||
| US3592953A (en) * | 1967-10-02 | 1971-07-13 | Gen Electric | Preparation of high flow cellulose derivative reverse osmosis membrane |
| US3567632A (en) * | 1968-09-04 | 1971-03-02 | Du Pont | Permselective,aromatic,nitrogen-containing polymeric membranes |
| FR1587787A (enExample) * | 1968-10-02 | 1970-03-27 | ||
| FR1587422A (enExample) * | 1968-10-07 | 1970-03-20 | ||
| FR1586563A (enExample) * | 1968-10-29 | 1970-02-20 | ||
| US4062782A (en) * | 1970-02-26 | 1977-12-13 | Canadian Patents And Development Ltd | Reverse osmosis membranes |
| CA991776A (en) * | 1971-10-18 | 1976-06-22 | Robert E. Kesting | Integral (unskinned) high void volume polycarbonate membranes and a dry process for forming same |
| US3888771A (en) * | 1972-06-02 | 1975-06-10 | Asahi Chemical Ind | Hollow fibers of cuprammonium cellulose and a process of the manufacture of same |
| DE2228537B2 (de) * | 1972-06-12 | 1974-07-25 | Amicon Corp., Lexington, Mass. (V.St.A.) | Verfahren zur Herstellung einer anisotropen, mikroporösen, polymeren Niederdruckmembran |
| JPS4932919A (enExample) * | 1972-07-27 | 1974-03-26 | ||
| FR2199014B1 (enExample) * | 1972-09-12 | 1975-03-14 | Rhone Poulenc Ind | |
| DE2257697C3 (de) * | 1972-11-21 | 1978-09-28 | Asahi Kasei Kogyo K.K., Osaka (Japan) | Poröser Celluloseacetatsymmetrie-Membranfilter und Verfahren zu seiner Herstellung |
| JPS5434790B2 (enExample) * | 1972-12-20 | 1979-10-29 | ||
| US3975478A (en) * | 1974-08-14 | 1976-08-17 | Monsanto Company | Method for producing highly permeable acrylic hollow fibers |
-
1975
- 1975-02-15 JP JP50018426A patent/JPS5193786A/ja active Granted
-
1976
- 1976-02-13 DE DE2606244A patent/DE2606244B2/de active Granted
- 1976-02-13 FR FR7604072A patent/FR2300606A1/fr active Granted
- 1976-02-16 GB GB6014/76A patent/GB1506785A/en not_active Expired
-
1977
- 1977-09-07 US US05/831,198 patent/US4234431A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10155901A1 (de) * | 2001-11-14 | 2003-05-15 | Mann & Hummel Filter | Verfahren zur Erzeugung von einer Beschichtung auf einer Hohlfaser |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2606244A1 (de) | 1976-08-26 |
| US4234431A (en) | 1980-11-18 |
| JPS5193786A (en) | 1976-08-17 |
| JPS5749248B2 (enExample) | 1982-10-21 |
| GB1506785A (en) | 1978-04-12 |
| DE2606244B2 (de) | 1981-09-17 |
| FR2300606A1 (fr) | 1976-09-10 |
| FR2300606B1 (enExample) | 1980-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2606244C3 (enExample) | ||
| DE2917357C2 (enExample) | ||
| DE2658408C3 (de) | Semipermeable Verbundmembran und Verfahren zu ihrer Herstellung | |
| DE3855721T2 (de) | Poröse polypropylenmembran und verfahren zu deren herstellung | |
| DE69527961T2 (de) | Poröse polysulfonmembrane und verfahren zu deren herstellung | |
| DE3851572T2 (de) | Polysulfon-Hohlfasermembran und Verfahren zu ihrer Herstellung. | |
| DE69305567T2 (de) | Hohlfasermembran auf Polysulfonbasis und Verfahren zu ihrer Herstellung | |
| DE2328853C3 (de) | Hohlfasern aus regenerierter Kupfer-Ammoniak-Cellulose und Verfahren zu ihrer Herstellung | |
| DE2935097C2 (enExample) | ||
| DE69016491T2 (de) | Verfahren zur Herstellung einer mikroporösen Membran und eine solche Membran. | |
| DE69330221T2 (de) | Membran, rektifikationsdialysator, bioreaktor und dessen anwendung | |
| DE2838665C3 (de) | Äthylen/Vinylalkohol-Copolymermembran und Verfahren zu ihrer Herstellung | |
| DE68914149T2 (de) | Poröse membranen. | |
| DE3342823C2 (enExample) | ||
| DE3138525C2 (enExample) | ||
| DE3934267A1 (de) | Hohlfasermembran und verfahren zu ihrer herstellung | |
| DE2321460A1 (de) | Hohlfasern bzw. -faeden aus acrylnitrilpolymeren und verfahren zu ihrer herstellung | |
| DE4421871A1 (de) | Mehrschichtige Mikrofiltrationsmembran mit integrierter Vorfilterschicht und Verfahren zu ihrer Herstellung | |
| DE2321459C3 (de) | Ultrafiltermembran aus Acrylnitrilpolymeren und Verfahren zur ihrer Herstellung | |
| DE3016040A1 (de) | Aethylen/vinylalkohol-copolymerhohlfasermembran und verfahren zu ihrer herstellung | |
| DE68906491T2 (de) | Cellulose-hohlfasern, verfahren zur herstellung und vorrichtung zum behandeln eines fluids mittels dieser hohlfasern. | |
| DE3042110C2 (enExample) | ||
| DE2827100C2 (de) | Celluloseacetat-Hohlfasern und Verfahren zu ihrer Herstellung | |
| EP0570826A1 (de) | Celluloseacetatmembranen | |
| DE3244007A1 (de) | Verfahren zur raffination von pflanzenoelen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8263 | Opposition against grant of a patent | ||
| C3 | Grant after two publication steps (3rd publication) |