EA032056B1 - Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) - Google Patents
Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) Download PDFInfo
- Publication number
- EA032056B1 EA032056B1 EA201390940A EA201390940A EA032056B1 EA 032056 B1 EA032056 B1 EA 032056B1 EA 201390940 A EA201390940 A EA 201390940A EA 201390940 A EA201390940 A EA 201390940A EA 032056 B1 EA032056 B1 EA 032056B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- protein
- growth factor
- factor
- fatty acid
- receptor
- Prior art date
Links
- 108090000623 proteins and genes Proteins 0.000 title claims abstract description 575
- 102000004169 proteins and genes Human genes 0.000 title claims abstract description 564
- 235000014113 dietary fatty acids Nutrition 0.000 title claims abstract description 229
- 229930195729 fatty acid Natural products 0.000 title claims abstract description 229
- 239000000194 fatty acid Substances 0.000 title claims abstract description 229
- 150000004665 fatty acids Chemical class 0.000 title claims abstract description 208
- 230000001225 therapeutic effect Effects 0.000 title claims abstract description 110
- 238000000034 method Methods 0.000 title claims abstract description 79
- 239000003153 chemical reaction reagent Substances 0.000 claims abstract description 14
- 102000005962 receptors Human genes 0.000 claims description 64
- 108020003175 receptors Proteins 0.000 claims description 64
- 239000003102 growth factor Substances 0.000 claims description 57
- -1 fatty acid ester Chemical class 0.000 claims description 51
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 51
- 239000002202 Polyethylene glycol Substances 0.000 claims description 50
- 229920001223 polyethylene glycol Polymers 0.000 claims description 50
- 230000012010 growth Effects 0.000 claims description 48
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 46
- 229920001184 polypeptide Polymers 0.000 claims description 45
- 125000005647 linker group Chemical group 0.000 claims description 42
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 33
- 102000004887 Transforming Growth Factor beta Human genes 0.000 claims description 30
- 108090001012 Transforming Growth Factor beta Proteins 0.000 claims description 30
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 27
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 claims description 25
- 102000013275 Somatomedins Human genes 0.000 claims description 24
- 108060008682 Tumor Necrosis Factor Proteins 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 125000002344 aminooxy group Chemical group [H]N([H])O[*] 0.000 claims description 21
- 108010059616 Activins Proteins 0.000 claims description 20
- 102000004127 Cytokines Human genes 0.000 claims description 20
- 108090000695 Cytokines Proteins 0.000 claims description 20
- 102000036693 Thrombopoietin Human genes 0.000 claims description 20
- 108010041111 Thrombopoietin Proteins 0.000 claims description 20
- 239000000488 activin Substances 0.000 claims description 20
- 102000018233 Fibroblast Growth Factor Human genes 0.000 claims description 19
- 108050007372 Fibroblast Growth Factor Proteins 0.000 claims description 19
- 102000007339 Nerve Growth Factor Receptors Human genes 0.000 claims description 19
- 108010032605 Nerve Growth Factor Receptors Proteins 0.000 claims description 19
- 102000007350 Bone Morphogenetic Proteins Human genes 0.000 claims description 18
- 108010007726 Bone Morphogenetic Proteins Proteins 0.000 claims description 18
- 102000014150 Interferons Human genes 0.000 claims description 18
- 108010050904 Interferons Proteins 0.000 claims description 18
- 108010025020 Nerve Growth Factor Proteins 0.000 claims description 18
- 102000004877 Insulin Human genes 0.000 claims description 17
- 108090001061 Insulin Proteins 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 17
- 229940126864 fibroblast growth factor Drugs 0.000 claims description 16
- 229940125396 insulin Drugs 0.000 claims description 16
- 229940079322 interferon Drugs 0.000 claims description 16
- 230000011242 neutrophil chemotaxis Effects 0.000 claims description 16
- 108090000368 Fibroblast growth factor 8 Proteins 0.000 claims description 15
- 108090000190 Thrombin Proteins 0.000 claims description 15
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 claims description 15
- 102100039037 Vascular endothelial growth factor A Human genes 0.000 claims description 15
- 229960004072 thrombin Drugs 0.000 claims description 15
- 102000003956 Fibroblast growth factor 8 Human genes 0.000 claims description 14
- 101000595923 Homo sapiens Placenta growth factor Proteins 0.000 claims description 14
- 102100035194 Placenta growth factor Human genes 0.000 claims description 14
- 102000046299 Transforming Growth Factor beta1 Human genes 0.000 claims description 14
- 101800002279 Transforming growth factor beta-1 Proteins 0.000 claims description 14
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 claims description 14
- 125000000837 carbohydrate group Chemical group 0.000 claims description 14
- 230000002518 glial effect Effects 0.000 claims description 14
- 229940099456 transforming growth factor beta 1 Drugs 0.000 claims description 14
- 108010047303 von Willebrand Factor Proteins 0.000 claims description 14
- 102100036537 von Willebrand factor Human genes 0.000 claims description 14
- 229960001134 von willebrand factor Drugs 0.000 claims description 14
- 102000003972 Fibroblast growth factor 7 Human genes 0.000 claims description 13
- 108090000385 Fibroblast growth factor 7 Proteins 0.000 claims description 13
- 102000007072 Nerve Growth Factors Human genes 0.000 claims description 13
- 230000001965 increasing effect Effects 0.000 claims description 13
- 239000003900 neurotrophic factor Substances 0.000 claims description 13
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 claims description 12
- 210000000440 neutrophil Anatomy 0.000 claims description 12
- 150000004671 saturated fatty acids Chemical class 0.000 claims description 12
- 102000001893 Bone Morphogenetic Protein Receptors Human genes 0.000 claims description 11
- 108010040422 Bone Morphogenetic Protein Receptors Proteins 0.000 claims description 11
- 108010005939 Ciliary Neurotrophic Factor Proteins 0.000 claims description 11
- 102100031614 Ciliary neurotrophic factor Human genes 0.000 claims description 11
- 102000003886 Glycoproteins Human genes 0.000 claims description 11
- 108090000288 Glycoproteins Proteins 0.000 claims description 11
- 102000035195 Peptidases Human genes 0.000 claims description 11
- 108091005804 Peptidases Proteins 0.000 claims description 11
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims description 11
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims description 11
- 210000002950 fibroblast Anatomy 0.000 claims description 11
- UGAGPNKCDRTDHP-UHFFFAOYSA-N 16-hydroxyhexadecanoic acid Chemical compound OCCCCCCCCCCCCCCCC(O)=O UGAGPNKCDRTDHP-UHFFFAOYSA-N 0.000 claims description 10
- 102000009027 Albumins Human genes 0.000 claims description 10
- 108010088751 Albumins Proteins 0.000 claims description 10
- 102000008100 Human Serum Albumin Human genes 0.000 claims description 10
- 108091006905 Human Serum Albumin Proteins 0.000 claims description 10
- 102000004856 Lectins Human genes 0.000 claims description 10
- 108090001090 Lectins Proteins 0.000 claims description 10
- 108010000499 Thromboplastin Proteins 0.000 claims description 10
- 102000002262 Thromboplastin Human genes 0.000 claims description 10
- 125000003172 aldehyde group Chemical group 0.000 claims description 10
- 229940112869 bone morphogenetic protein Drugs 0.000 claims description 10
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims description 10
- 239000002523 lectin Substances 0.000 claims description 10
- 239000007800 oxidant agent Substances 0.000 claims description 10
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 claims description 10
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 claims description 10
- 108090000654 Bone morphogenetic protein 1 Proteins 0.000 claims description 9
- 102100022641 Coagulation factor IX Human genes 0.000 claims description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 9
- 108010076282 Factor IX Proteins 0.000 claims description 9
- 108010074864 Factor XI Proteins 0.000 claims description 9
- 108010080865 Factor XII Proteins 0.000 claims description 9
- 102000000429 Factor XII Human genes 0.000 claims description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 108090000630 Oncostatin M Proteins 0.000 claims description 9
- 102000004140 Oncostatin M Human genes 0.000 claims description 9
- 239000004365 Protease Substances 0.000 claims description 9
- 102000017975 Protein C Human genes 0.000 claims description 9
- 101800004937 Protein C Proteins 0.000 claims description 9
- 101800001700 Saposin-D Proteins 0.000 claims description 9
- 230000021615 conjugation Effects 0.000 claims description 9
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 claims description 9
- 206010073071 hepatocellular carcinoma Diseases 0.000 claims description 9
- 229960000856 protein c Drugs 0.000 claims description 9
- 210000000130 stem cell Anatomy 0.000 claims description 9
- 235000021122 unsaturated fatty acids Nutrition 0.000 claims description 9
- 150000004670 unsaturated fatty acids Chemical class 0.000 claims description 9
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 claims description 8
- 102100022987 Angiogenin Human genes 0.000 claims description 8
- 108010049976 Bone Morphogenetic Protein 5 Proteins 0.000 claims description 8
- 108010049870 Bone Morphogenetic Protein 7 Proteins 0.000 claims description 8
- 102100028726 Bone morphogenetic protein 10 Human genes 0.000 claims description 8
- 101710118482 Bone morphogenetic protein 10 Proteins 0.000 claims description 8
- 102100022526 Bone morphogenetic protein 5 Human genes 0.000 claims description 8
- 102100022544 Bone morphogenetic protein 7 Human genes 0.000 claims description 8
- 102100028892 Cardiotrophin-1 Human genes 0.000 claims description 8
- 102000011022 Chorionic Gonadotropin Human genes 0.000 claims description 8
- 108010062540 Chorionic Gonadotropin Proteins 0.000 claims description 8
- 108010053770 Deoxyribonucleases Proteins 0.000 claims description 8
- 102000016911 Deoxyribonucleases Human genes 0.000 claims description 8
- 101800003838 Epidermal growth factor Proteins 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 108010014173 Factor X Proteins 0.000 claims description 8
- 102000004864 Fibroblast growth factor 10 Human genes 0.000 claims description 8
- 108090001047 Fibroblast growth factor 10 Proteins 0.000 claims description 8
- 102000012570 Fibroblast growth factor 16 Human genes 0.000 claims description 8
- 108050002072 Fibroblast growth factor 16 Proteins 0.000 claims description 8
- 102000012558 Fibroblast growth factor 20 Human genes 0.000 claims description 8
- 108050002085 Fibroblast growth factor 20 Proteins 0.000 claims description 8
- 102000003973 Fibroblast growth factor 21 Human genes 0.000 claims description 8
- 108090000376 Fibroblast growth factor 21 Proteins 0.000 claims description 8
- 102100025947 Insulin-like growth factor II Human genes 0.000 claims description 8
- 102000016267 Leptin Human genes 0.000 claims description 8
- 108010092277 Leptin Proteins 0.000 claims description 8
- 108010046938 Macrophage Colony-Stimulating Factor Proteins 0.000 claims description 8
- 102100039364 Metalloproteinase inhibitor 1 Human genes 0.000 claims description 8
- 102000003683 Neurotrophin-4 Human genes 0.000 claims description 8
- 108090000099 Neurotrophin-4 Proteins 0.000 claims description 8
- 102100033762 Proheparin-binding EGF-like growth factor Human genes 0.000 claims description 8
- 102000008022 Proto-Oncogene Proteins c-met Human genes 0.000 claims description 8
- 108010089836 Proto-Oncogene Proteins c-met Proteins 0.000 claims description 8
- 108010023082 activin A Proteins 0.000 claims description 8
- 108010072788 angiogenin Proteins 0.000 claims description 8
- 210000004556 brain Anatomy 0.000 claims description 8
- 150000001720 carbohydrates Chemical class 0.000 claims description 8
- 108010041776 cardiotrophin 1 Proteins 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 229940116977 epidermal growth factor Drugs 0.000 claims description 8
- 229940011871 estrogen Drugs 0.000 claims description 8
- 239000000262 estrogen Substances 0.000 claims description 8
- 229960004222 factor ix Drugs 0.000 claims description 8
- 230000002401 inhibitory effect Effects 0.000 claims description 8
- 208000032839 leukemia Diseases 0.000 claims description 8
- 229940097998 neurotrophin 4 Drugs 0.000 claims description 8
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 claims description 8
- NMWKYTGJWUAZPZ-WWHBDHEGSA-N (4S)-4-[[(4R,7S,10S,16S,19S,25S,28S,31R)-31-[[(2S)-2-[[(1R,6R,9S,12S,18S,21S,24S,27S,30S,33S,36S,39S,42R,47R,53S,56S,59S,62S,65S,68S,71S,76S,79S,85S)-47-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-4-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-18-(4-aminobutyl)-27,68-bis(3-amino-3-oxopropyl)-36,71,76-tribenzyl-39-(3-carbamimidamidopropyl)-24-(2-carboxyethyl)-21,56-bis(carboxymethyl)-65,85-bis[(1R)-1-hydroxyethyl]-59-(hydroxymethyl)-62,79-bis(1H-imidazol-4-ylmethyl)-9-methyl-33-(2-methylpropyl)-8,11,17,20,23,26,29,32,35,38,41,48,54,57,60,63,66,69,72,74,77,80,83,86-tetracosaoxo-30-propan-2-yl-3,4,44,45-tetrathia-7,10,16,19,22,25,28,31,34,37,40,49,55,58,61,64,67,70,73,75,78,81,84,87-tetracosazatetracyclo[40.31.14.012,16.049,53]heptaoctacontane-6-carbonyl]amino]-3-methylbutanoyl]amino]-7-(3-carbamimidamidopropyl)-25-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-28-(1H-imidazol-4-ylmethyl)-10-methyl-6,9,12,15,18,21,24,27,30-nonaoxo-16-propan-2-yl-1,2-dithia-5,8,11,14,17,20,23,26,29-nonazacyclodotriacontane-4-carbonyl]amino]-5-[[(2S)-1-[[(2S)-1-[[(2S)-3-carboxy-1-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid Chemical compound CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H]2CSSC[C@@H]3NC(=O)[C@H](Cc4ccccc4)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc4c[nH]cn4)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H]4CCCN4C(=O)[C@H](CSSC[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](Cc4c[nH]cn4)NC(=O)[C@H](Cc4ccccc4)NC3=O)[C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N3CCC[C@H]3C(=O)N[C@@H](C)C(=O)N2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)C(C)C)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1)C(=O)N[C@@H](C)C(O)=O NMWKYTGJWUAZPZ-WWHBDHEGSA-N 0.000 claims description 7
- 102100034613 Annexin A2 Human genes 0.000 claims description 7
- 108090000668 Annexin A2 Proteins 0.000 claims description 7
- 108090000669 Annexin A4 Proteins 0.000 claims description 7
- 102100034612 Annexin A4 Human genes 0.000 claims description 7
- 102100034278 Annexin A6 Human genes 0.000 claims description 7
- 108090000656 Annexin A6 Proteins 0.000 claims description 7
- 108010049955 Bone Morphogenetic Protein 4 Proteins 0.000 claims description 7
- 108010049974 Bone Morphogenetic Protein 6 Proteins 0.000 claims description 7
- 102000003928 Bone morphogenetic protein 15 Human genes 0.000 claims description 7
- 108090000349 Bone morphogenetic protein 15 Proteins 0.000 claims description 7
- 102100024505 Bone morphogenetic protein 4 Human genes 0.000 claims description 7
- 102100022525 Bone morphogenetic protein 6 Human genes 0.000 claims description 7
- 102400000686 Endothelin-1 Human genes 0.000 claims description 7
- 101800004490 Endothelin-1 Proteins 0.000 claims description 7
- 108010016906 Epigen Proteins 0.000 claims description 7
- 102100030323 Epigen Human genes 0.000 claims description 7
- 102000001690 Factor VIII Human genes 0.000 claims description 7
- 108010054218 Factor VIII Proteins 0.000 claims description 7
- 108090000386 Fibroblast Growth Factor 1 Proteins 0.000 claims description 7
- 102000014252 Fibroblast growth factor 11 Human genes 0.000 claims description 7
- 108050003237 Fibroblast growth factor 11 Proteins 0.000 claims description 7
- 102100031734 Fibroblast growth factor 19 Human genes 0.000 claims description 7
- 101710153349 Fibroblast growth factor 19 Proteins 0.000 claims description 7
- 102000003967 Fibroblast growth factor 5 Human genes 0.000 claims description 7
- 108090000380 Fibroblast growth factor 5 Proteins 0.000 claims description 7
- 102000003968 Fibroblast growth factor 6 Human genes 0.000 claims description 7
- 108090000382 Fibroblast growth factor 6 Proteins 0.000 claims description 7
- 102100040898 Growth/differentiation factor 11 Human genes 0.000 claims description 7
- 101710194452 Growth/differentiation factor 11 Proteins 0.000 claims description 7
- 101000871708 Homo sapiens Proheparin-binding EGF-like growth factor Proteins 0.000 claims description 7
- 108090001117 Insulin-Like Growth Factor II Proteins 0.000 claims description 7
- 102000004895 Lipoproteins Human genes 0.000 claims description 7
- 108090001030 Lipoproteins Proteins 0.000 claims description 7
- 108010073521 Luteinizing Hormone Proteins 0.000 claims description 7
- 102000009151 Luteinizing Hormone Human genes 0.000 claims description 7
- 102100025498 Proepiregulin Human genes 0.000 claims description 7
- 108010057464 Prolactin Proteins 0.000 claims description 7
- 102000003946 Prolactin Human genes 0.000 claims description 7
- 101710150593 Protein beta Proteins 0.000 claims description 7
- 101710179016 Protein gamma Proteins 0.000 claims description 7
- 102100032350 Protransforming growth factor alpha Human genes 0.000 claims description 7
- 108010039491 Ricin Proteins 0.000 claims description 7
- 108010061174 Thyrotropin Proteins 0.000 claims description 7
- 102000011923 Thyrotropin Human genes 0.000 claims description 7
- 102000004338 Transferrin Human genes 0.000 claims description 7
- 108090000901 Transferrin Proteins 0.000 claims description 7
- 102000009618 Transforming Growth Factors Human genes 0.000 claims description 7
- 108010009583 Transforming Growth Factors Proteins 0.000 claims description 7
- 101800004564 Transforming growth factor alpha Proteins 0.000 claims description 7
- 108090000097 Transforming growth factor beta-3 Proteins 0.000 claims description 7
- 102000056172 Transforming growth factor beta-3 Human genes 0.000 claims description 7
- 102100035140 Vitronectin Human genes 0.000 claims description 7
- 108010031318 Vitronectin Proteins 0.000 claims description 7
- 108010023079 activin B Proteins 0.000 claims description 7
- 229940050528 albumin Drugs 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 102000013361 fetuin Human genes 0.000 claims description 7
- 108060002885 fetuin Proteins 0.000 claims description 7
- 102000003684 fibroblast growth factor 13 Human genes 0.000 claims description 7
- 108090000047 fibroblast growth factor 13 Proteins 0.000 claims description 7
- 235000019410 glycyrrhizin Nutrition 0.000 claims description 7
- 102000006495 integrins Human genes 0.000 claims description 7
- 108010044426 integrins Proteins 0.000 claims description 7
- 229940039781 leptin Drugs 0.000 claims description 7
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 claims description 7
- 229940040129 luteinizing hormone Drugs 0.000 claims description 7
- 229940097325 prolactin Drugs 0.000 claims description 7
- 108010033898 transforming growth factor beta1.2 Proteins 0.000 claims description 7
- 229960005356 urokinase Drugs 0.000 claims description 7
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 claims description 6
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 claims description 6
- 102100026189 Beta-galactosidase Human genes 0.000 claims description 6
- 108010049931 Bone Morphogenetic Protein 2 Proteins 0.000 claims description 6
- 108010049951 Bone Morphogenetic Protein 3 Proteins 0.000 claims description 6
- 102100024506 Bone morphogenetic protein 2 Human genes 0.000 claims description 6
- 102100024504 Bone morphogenetic protein 3 Human genes 0.000 claims description 6
- 101100322583 Caenorhabditis elegans add-2 gene Proteins 0.000 claims description 6
- 101800000155 Epiregulin Proteins 0.000 claims description 6
- 108010008165 Etanercept Proteins 0.000 claims description 6
- 102000004641 Fetal Proteins Human genes 0.000 claims description 6
- 108010003471 Fetal Proteins Proteins 0.000 claims description 6
- 102000003971 Fibroblast Growth Factor 1 Human genes 0.000 claims description 6
- 102000012565 Fibroblast growth factor 17 Human genes 0.000 claims description 6
- 108050002074 Fibroblast growth factor 17 Proteins 0.000 claims description 6
- 102000003969 Fibroblast growth factor 4 Human genes 0.000 claims description 6
- 108090000381 Fibroblast growth factor 4 Proteins 0.000 claims description 6
- 102000003957 Fibroblast growth factor 9 Human genes 0.000 claims description 6
- 108090000367 Fibroblast growth factor 9 Proteins 0.000 claims description 6
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 claims description 6
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 claims description 6
- 108010090290 Growth Differentiation Factor 2 Proteins 0.000 claims description 6
- 102000009465 Growth Factor Receptors Human genes 0.000 claims description 6
- 108010009202 Growth Factor Receptors Proteins 0.000 claims description 6
- 102100040892 Growth/differentiation factor 2 Human genes 0.000 claims description 6
- 102100035379 Growth/differentiation factor 5 Human genes 0.000 claims description 6
- 101710204282 Growth/differentiation factor 5 Proteins 0.000 claims description 6
- 102100035368 Growth/differentiation factor 6 Human genes 0.000 claims description 6
- 101710204281 Growth/differentiation factor 6 Proteins 0.000 claims description 6
- 102000006992 Interferon-alpha Human genes 0.000 claims description 6
- 108010047761 Interferon-alpha Proteins 0.000 claims description 6
- 108090000742 Neurotrophin 3 Proteins 0.000 claims description 6
- 102000004230 Neurotrophin 3 Human genes 0.000 claims description 6
- 102000004584 Somatomedin Receptors Human genes 0.000 claims description 6
- 108010017622 Somatomedin Receptors Proteins 0.000 claims description 6
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 claims description 6
- 102000011117 Transforming Growth Factor beta2 Human genes 0.000 claims description 6
- 101800000304 Transforming growth factor beta-2 Proteins 0.000 claims description 6
- 102100040247 Tumor necrosis factor Human genes 0.000 claims description 6
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 6
- 239000005667 attractant Substances 0.000 claims description 6
- 210000003719 b-lymphocyte Anatomy 0.000 claims description 6
- 108010005774 beta-Galactosidase Proteins 0.000 claims description 6
- 230000031902 chemoattractant activity Effects 0.000 claims description 6
- 230000001268 conjugating effect Effects 0.000 claims description 6
- 229960001251 denosumab Drugs 0.000 claims description 6
- 229960000301 factor viii Drugs 0.000 claims description 6
- 229940098448 fibroblast growth factor 7 Drugs 0.000 claims description 6
- 229940028334 follicle stimulating hormone Drugs 0.000 claims description 6
- 108010070827 growth differentiation factor 7 Proteins 0.000 claims description 6
- 239000003112 inhibitor Substances 0.000 claims description 6
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 6
- 229940032018 neurotrophin 3 Drugs 0.000 claims description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims description 6
- 239000002243 precursor Substances 0.000 claims description 6
- 239000012581 transferrin Substances 0.000 claims description 6
- 229940072041 transforming growth factor beta 2 Drugs 0.000 claims description 6
- 101100322581 Caenorhabditis elegans add-1 gene Proteins 0.000 claims description 5
- 101800002113 Endothelial cell growth factor beta Proteins 0.000 claims description 5
- 108090000581 Leukemia inhibitory factor Proteins 0.000 claims description 5
- 102000004058 Leukemia inhibitory factor Human genes 0.000 claims description 5
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 claims description 5
- 230000003213 activating effect Effects 0.000 claims description 5
- 229960002964 adalimumab Drugs 0.000 claims description 5
- AGVAZMGAQJOSFJ-WZHZPDAFSA-M cobalt(2+);[(2r,3s,4r,5s)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2r)-1-[3-[(1r,2r,3r,4z,7s,9z,12s,13s,14z,17s,18s,19r)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2 Chemical compound [Co+2].N#[C-].[N-]([C@@H]1[C@H](CC(N)=O)[C@@]2(C)CCC(=O)NC[C@@H](C)OP(O)(=O)O[C@H]3[C@H]([C@H](O[C@@H]3CO)N3C4=CC(C)=C(C)C=C4N=C3)O)\C2=C(C)/C([C@H](C\2(C)C)CCC(N)=O)=N/C/2=C\C([C@H]([C@@]/2(CC(N)=O)C)CCC(N)=O)=N\C\2=C(C)/C2=N[C@]1(C)[C@@](C)(CC(N)=O)[C@@H]2CCC(N)=O AGVAZMGAQJOSFJ-WZHZPDAFSA-M 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 239000012011 nucleophilic catalyst Substances 0.000 claims description 5
- AOTMRIXFFOGWDT-UHFFFAOYSA-N omega-hydroxyhexadecanoic acid methyl ester Natural products COC(=O)CCCCCCCCCCCCCCCO AOTMRIXFFOGWDT-UHFFFAOYSA-N 0.000 claims description 5
- 229960000187 tissue plasminogen activator Drugs 0.000 claims description 5
- 102000003390 tumor necrosis factor Human genes 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- 108090000056 Complement factor B Proteins 0.000 claims description 4
- 102000003712 Complement factor B Human genes 0.000 claims description 4
- 239000012359 Methanesulfonyl chloride Substances 0.000 claims description 4
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 claims description 4
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 claims description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 4
- 239000012346 acetyl chloride Substances 0.000 claims description 4
- 230000004913 activation Effects 0.000 claims description 4
- 210000000988 bone and bone Anatomy 0.000 claims description 4
- 230000035605 chemotaxis Effects 0.000 claims description 4
- 229960000403 etanercept Drugs 0.000 claims description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 4
- 150000004702 methyl esters Chemical group 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 claims description 4
- 230000004936 stimulating effect Effects 0.000 claims description 4
- CPEMIWRXQWEEGD-UHFFFAOYSA-N 16-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxyimino]hexadecanoic acid Chemical compound NOCCOCCOCCOCCON=CCCCCCCCCCCCCCCC(O)=O CPEMIWRXQWEEGD-UHFFFAOYSA-N 0.000 claims description 3
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 claims description 3
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 claims description 3
- 239000012027 Collins reagent Substances 0.000 claims description 3
- 238000006646 Dess-Martin oxidation reaction Methods 0.000 claims description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 108010042352 Urokinase Plasminogen Activator Receptors Proteins 0.000 claims description 3
- 102000004504 Urokinase Plasminogen Activator Receptors Human genes 0.000 claims description 3
- 239000012190 activator Substances 0.000 claims description 3
- 239000000872 buffer Substances 0.000 claims description 3
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical compound [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004494 ethyl ester group Chemical group 0.000 claims description 3
- 238000011534 incubation Methods 0.000 claims description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 3
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 claims description 3
- UIYHCSCDARAPMG-UHFFFAOYSA-N methyl 16-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxyamino]hexadecanoate Chemical compound COC(=O)CCCCCCCCCCCCCCCNOCCOCCOCCOCCON UIYHCSCDARAPMG-UHFFFAOYSA-N 0.000 claims description 3
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000003544 oxime group Chemical group 0.000 claims description 3
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- NPRDHMWYZHSAHR-UHFFFAOYSA-N pyridine;trioxochromium Chemical compound O=[Cr](=O)=O.C1=CC=NC=C1.C1=CC=NC=C1 NPRDHMWYZHSAHR-UHFFFAOYSA-N 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229950000244 sulfanilic acid Drugs 0.000 claims description 3
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 claims description 3
- 230000001131 transforming effect Effects 0.000 claims description 3
- XFDUHJPVQKIXHO-UHFFFAOYSA-N 3-aminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1 XFDUHJPVQKIXHO-UHFFFAOYSA-N 0.000 claims description 2
- 102000013566 Plasminogen Human genes 0.000 claims description 2
- 108010051456 Plasminogen Proteins 0.000 claims description 2
- 102100031294 Thymic stromal lymphopoietin Human genes 0.000 claims description 2
- 101710187743 Tumor necrosis factor receptor superfamily member 1A Proteins 0.000 claims description 2
- 102100033732 Tumor necrosis factor receptor superfamily member 1A Human genes 0.000 claims description 2
- 125000005313 fatty acid group Chemical group 0.000 claims description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 claims description 2
- 210000005036 nerve Anatomy 0.000 claims description 2
- 108010029307 thymic stromal lymphopoietin Proteins 0.000 claims description 2
- 210000001541 thymus gland Anatomy 0.000 claims description 2
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 claims 4
- 102100028728 Bone morphogenetic protein 1 Human genes 0.000 claims 2
- 102400001368 Epidermal growth factor Human genes 0.000 claims 2
- 102100026818 Inhibin beta E chain Human genes 0.000 claims 2
- 102000007651 Macrophage Colony-Stimulating Factor Human genes 0.000 claims 2
- 210000003494 hepatocyte Anatomy 0.000 claims 2
- 108010041308 Endothelial Growth Factors Proteins 0.000 claims 1
- 102100031706 Fibroblast growth factor 1 Human genes 0.000 claims 1
- 101710167839 Morphogenetic protein Proteins 0.000 claims 1
- 238000002512 chemotherapy Methods 0.000 claims 1
- 230000002608 insulinlike Effects 0.000 claims 1
- JEHCHYAKAXDFKV-UHFFFAOYSA-J lead tetraacetate Chemical compound CC(=O)O[Pb](OC(C)=O)(OC(C)=O)OC(C)=O JEHCHYAKAXDFKV-UHFFFAOYSA-J 0.000 claims 1
- 230000001002 morphogenetic effect Effects 0.000 claims 1
- 230000003285 pharmacodynamic effect Effects 0.000 abstract description 4
- 230000036541 health Effects 0.000 abstract description 3
- 235000018102 proteins Nutrition 0.000 description 504
- 108010035532 Collagen Proteins 0.000 description 30
- 102000008186 Collagen Human genes 0.000 description 30
- 229920001436 collagen Polymers 0.000 description 27
- 108091005703 transmembrane proteins Proteins 0.000 description 24
- 102000035160 transmembrane proteins Human genes 0.000 description 23
- 102000019034 Chemokines Human genes 0.000 description 22
- 108010012236 Chemokines Proteins 0.000 description 22
- 229920003169 water-soluble polymer Polymers 0.000 description 22
- 230000000295 complement effect Effects 0.000 description 21
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 19
- 102000036639 antigens Human genes 0.000 description 19
- 108091007433 antigens Proteins 0.000 description 19
- 102000005606 Activins Human genes 0.000 description 18
- 101710159648 Uncharacterized protein Proteins 0.000 description 18
- 239000000427 antigen Substances 0.000 description 18
- 108090000342 C-Type Lectins Proteins 0.000 description 17
- 102000003930 C-Type Lectins Human genes 0.000 description 17
- 108060003951 Immunoglobulin Proteins 0.000 description 16
- 102000018358 immunoglobulin Human genes 0.000 description 16
- 101800001224 Disintegrin Proteins 0.000 description 15
- 102000010780 Platelet-Derived Growth Factor Human genes 0.000 description 15
- 108010038512 Platelet-Derived Growth Factor Proteins 0.000 description 15
- 102000005741 Metalloproteases Human genes 0.000 description 14
- 108010006035 Metalloproteases Proteins 0.000 description 14
- 108060008683 Tumor Necrosis Factor Receptor Proteins 0.000 description 13
- 239000003446 ligand Substances 0.000 description 13
- 102000003298 tumor necrosis factor receptor Human genes 0.000 description 13
- 102000002938 Thrombospondin Human genes 0.000 description 12
- 108060008245 Thrombospondin Proteins 0.000 description 12
- 239000012634 fragment Substances 0.000 description 12
- 210000004901 leucine-rich repeat Anatomy 0.000 description 12
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 11
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 11
- 108010006444 Leucine-Rich Repeat Proteins Proteins 0.000 description 11
- 102000012479 Serine Proteases Human genes 0.000 description 11
- 108010022999 Serine Proteases Proteins 0.000 description 11
- 102000014914 Carrier Proteins Human genes 0.000 description 10
- 230000004069 differentiation Effects 0.000 description 10
- KRJOFJHOZZPBKI-UHFFFAOYSA-N 87-[(2-amino-1-hydroxypropylidene)amino]-76-benzyl-7,22,52-tri(butan-2-yl)-4,34,37,64-tetrakis(3-carbamimidamidopropyl)-31-(2-carboxyethyl)-2,5,14,17,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71,74,77,80,88,91-heptacosahydroxy-46-(1-hydroxyethyl)-58-(3-hydroxy-3-iminopropyl)-40,55,90-tris[(4-hydroxyphenyl)methyl]-70-(1H-indol-3-ylmethyl)-16,25,73-trimethyl-67-(2-methylpropyl)-8-oxo-84,85,94,95,98,99-hexathia-3,6,9,15,18,21,24,27,30,33,36,39,42,45,48,51,54,57,60,63,66,69,72,75,78,81,89,92-octacosazatetracyclo[47.43.4.419,79.09,13]hecta-2,5,14,17,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71,74,77,80,88,91-heptacosaene-82-carboxylic acid Chemical compound CCC(C)C1N=C(O)C2CSSCC3\N=C(O)\C(Cc4ccccc4)\N=C(O)\C(C)\N=C(O)\C(Cc4c[nH]c5ccccc45)\N=C(O)/C(CC(C)C)\N=C(O)\C(CCCNC(N)=N)\N=C(O)\C\N=C(O)\C(CCC(O)=N)\N=C(O)/C(Cc4ccc(O)cc4)\N=C(O)\C(\N=C(O)\C(CSSCC(N=C(O)C(Cc4ccc(O)cc4)N=C(O)C(CSSCC(N=C3O)C(O)=O)\N=C(/O)C(C)N)C(O)=NC(CCCNC(N)=N)C(O)=NC(C(C)CC)C(=O)N3CCCC3C(O)=NC(C)C(O)=N2)N=C(O)C(N=C(O)CN=C(O)C(Cc2ccc(O)cc2)N=C(O)C(CCCNC(N)=N)N=C(O)C(CCCNC(N)=N)N=C(O)C(CCC(O)=O)N=C(O)CN=C(O)C(C)N=C1O)C(C)O)C(C)CC KRJOFJHOZZPBKI-UHFFFAOYSA-N 0.000 description 8
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 description 8
- 102000004316 Oxidoreductases Human genes 0.000 description 8
- 108090000854 Oxidoreductases Proteins 0.000 description 8
- 210000002889 endothelial cell Anatomy 0.000 description 8
- 229940088597 hormone Drugs 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 108010071619 Apolipoproteins Proteins 0.000 description 7
- 102000007592 Apolipoproteins Human genes 0.000 description 7
- 102000004152 Bone morphogenetic protein 1 Human genes 0.000 description 7
- 102000012545 EGF-like domains Human genes 0.000 description 7
- 108050002150 EGF-like domains Proteins 0.000 description 7
- 229920001612 Hydroxyethyl starch Polymers 0.000 description 7
- 102100033237 Pro-epidermal growth factor Human genes 0.000 description 7
- 108091008324 binding proteins Proteins 0.000 description 7
- 239000002299 complementary DNA Substances 0.000 description 7
- 239000005556 hormone Substances 0.000 description 7
- 229940050526 hydroxyethylstarch Drugs 0.000 description 7
- 210000002569 neuron Anatomy 0.000 description 7
- 108010009906 Angiopoietins Proteins 0.000 description 6
- 102000009840 Angiopoietins Human genes 0.000 description 6
- 108010081589 Becaplermin Proteins 0.000 description 6
- 102000003745 Hepatocyte Growth Factor Human genes 0.000 description 6
- 108090000100 Hepatocyte Growth Factor Proteins 0.000 description 6
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 6
- 102100028123 Macrophage colony-stimulating factor 1 Human genes 0.000 description 6
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 6
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 6
- 239000004372 Polyvinyl alcohol Substances 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- 102000004357 Transferases Human genes 0.000 description 6
- 108090000992 Transferases Proteins 0.000 description 6
- 108010046377 Whey Proteins Proteins 0.000 description 6
- 235000014633 carbohydrates Nutrition 0.000 description 6
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 6
- 235000018417 cysteine Nutrition 0.000 description 6
- 239000000122 growth hormone Substances 0.000 description 6
- 229920002674 hyaluronan Polymers 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000002438 mitochondrial effect Effects 0.000 description 6
- 108010000685 platelet-derived growth factor AB Proteins 0.000 description 6
- 229920000765 poly(2-oxazolines) Polymers 0.000 description 6
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 6
- 229920001515 polyalkylene glycol Polymers 0.000 description 6
- 229920002451 polyvinyl alcohol Polymers 0.000 description 6
- OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical compound [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 description 6
- 210000002307 prostate Anatomy 0.000 description 6
- 239000003001 serine protease inhibitor Substances 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 210000001550 testis Anatomy 0.000 description 6
- 102100023995 Beta-nerve growth factor Human genes 0.000 description 5
- 101710117545 C protein Proteins 0.000 description 5
- 108010051696 Growth Hormone Proteins 0.000 description 5
- 108010085895 Laminin Proteins 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 5
- 101710102218 Serine protease inhibitor Proteins 0.000 description 5
- 229940122055 Serine protease inhibitor Drugs 0.000 description 5
- 102100038803 Somatotropin Human genes 0.000 description 5
- 102000007544 Whey Proteins Human genes 0.000 description 5
- 102000005840 alpha-Galactosidase Human genes 0.000 description 5
- 108010030291 alpha-Galactosidase Proteins 0.000 description 5
- SQVRNKJHWKZAKO-UHFFFAOYSA-N beta-N-Acetyl-D-neuraminic acid Natural products CC(=O)NC1C(O)CC(O)(C(O)=O)OC1C(O)C(O)CO SQVRNKJHWKZAKO-UHFFFAOYSA-N 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 210000002510 keratinocyte Anatomy 0.000 description 5
- 201000001441 melanoma Diseases 0.000 description 5
- 229940053128 nerve growth factor Drugs 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 235000019419 proteases Nutrition 0.000 description 5
- SQVRNKJHWKZAKO-OQPLDHBCSA-N sialic acid Chemical compound CC(=O)N[C@@H]1[C@@H](O)C[C@@](O)(C(O)=O)OC1[C@H](O)[C@H](O)CO SQVRNKJHWKZAKO-OQPLDHBCSA-N 0.000 description 5
- SQDAZGGFXASXDW-UHFFFAOYSA-N 5-bromo-2-(trifluoromethoxy)pyridine Chemical compound FC(F)(F)OC1=CC=C(Br)C=N1 SQDAZGGFXASXDW-UHFFFAOYSA-N 0.000 description 4
- 108010006303 Carboxypeptidases Proteins 0.000 description 4
- 102000005367 Carboxypeptidases Human genes 0.000 description 4
- 108010078791 Carrier Proteins Proteins 0.000 description 4
- 229920001287 Chondroitin sulfate Polymers 0.000 description 4
- 108020005199 Dehydrogenases Proteins 0.000 description 4
- 229920002307 Dextran Polymers 0.000 description 4
- 102000014250 Fibroblast growth factor 12 Human genes 0.000 description 4
- 108050003239 Fibroblast growth factor 12 Proteins 0.000 description 4
- 102000016359 Fibronectins Human genes 0.000 description 4
- 108010067306 Fibronectins Proteins 0.000 description 4
- 102000010956 Glypican Human genes 0.000 description 4
- 108050001154 Glypican Proteins 0.000 description 4
- 108010002352 Interleukin-1 Proteins 0.000 description 4
- 102000004882 Lipase Human genes 0.000 description 4
- 108090001060 Lipase Proteins 0.000 description 4
- 239000004367 Lipase Substances 0.000 description 4
- 108010052285 Membrane Proteins Proteins 0.000 description 4
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 4
- 102000016611 Proteoglycans Human genes 0.000 description 4
- 108010067787 Proteoglycans Proteins 0.000 description 4
- 108010009413 Pyrophosphatases Proteins 0.000 description 4
- 102000009609 Pyrophosphatases Human genes 0.000 description 4
- 108091007187 Reductases Proteins 0.000 description 4
- 108010031873 Secretory Phospholipases A2 Proteins 0.000 description 4
- 102000005473 Secretory Phospholipases A2 Human genes 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 102000012265 beta-defensin Human genes 0.000 description 4
- 108050002883 beta-defensin Proteins 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229940059329 chondroitin sulfate Drugs 0.000 description 4
- 238000004891 communication Methods 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 210000000918 epididymis Anatomy 0.000 description 4
- 201000010063 epididymitis Diseases 0.000 description 4
- 150000004676 glycans Chemical class 0.000 description 4
- 229940072221 immunoglobulins Drugs 0.000 description 4
- 102000002467 interleukin receptors Human genes 0.000 description 4
- 108010093036 interleukin receptors Proteins 0.000 description 4
- 229940040461 lipase Drugs 0.000 description 4
- 235000019421 lipase Nutrition 0.000 description 4
- 229940066294 lung surfactant Drugs 0.000 description 4
- 239000003580 lung surfactant Substances 0.000 description 4
- 230000000527 lymphocytic effect Effects 0.000 description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 4
- 229920001282 polysaccharide Polymers 0.000 description 4
- 239000005017 polysaccharide Substances 0.000 description 4
- 230000035935 pregnancy Effects 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 235000021119 whey protein Nutrition 0.000 description 4
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 description 3
- ZIIUUSVHCHPIQD-UHFFFAOYSA-N 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 ZIIUUSVHCHPIQD-UHFFFAOYSA-N 0.000 description 3
- 101710132601 Capsid protein Proteins 0.000 description 3
- 108010080937 Carboxypeptidases A Proteins 0.000 description 3
- 102000000496 Carboxypeptidases A Human genes 0.000 description 3
- 201000009030 Carcinoma Diseases 0.000 description 3
- 108010000063 Ciliary Neurotrophic Factor Receptor Proteins 0.000 description 3
- 102100031615 Ciliary neurotrophic factor receptor subunit alpha Human genes 0.000 description 3
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 3
- 102000003849 Cytochrome P450 Human genes 0.000 description 3
- 229920000045 Dermatan sulfate Polymers 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 102000051366 Glycosyltransferases Human genes 0.000 description 3
- 108700023372 Glycosyltransferases Proteins 0.000 description 3
- 108060003393 Granulin Proteins 0.000 description 3
- 102000000589 Interleukin-1 Human genes 0.000 description 3
- 102000003960 Ligases Human genes 0.000 description 3
- 108090000364 Ligases Proteins 0.000 description 3
- 102000055008 Matrilin Proteins Human genes 0.000 description 3
- 108010072582 Matrilin Proteins Proteins 0.000 description 3
- 102000018697 Membrane Proteins Human genes 0.000 description 3
- 108010083674 Myelin Proteins Proteins 0.000 description 3
- 102000006386 Myelin Proteins Human genes 0.000 description 3
- 102000003797 Neuropeptides Human genes 0.000 description 3
- 108090000189 Neuropeptides Proteins 0.000 description 3
- 102000019280 Pancreatic lipases Human genes 0.000 description 3
- 108050006759 Pancreatic lipases Proteins 0.000 description 3
- 229940122344 Peptidase inhibitor Drugs 0.000 description 3
- 102000015439 Phospholipases Human genes 0.000 description 3
- 108010064785 Phospholipases Proteins 0.000 description 3
- 108091000080 Phosphotransferase Proteins 0.000 description 3
- 102100030485 Platelet-derived growth factor receptor alpha Human genes 0.000 description 3
- 102100029740 Poliovirus receptor Human genes 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- 239000004373 Pullulan Substances 0.000 description 3
- 229920001218 Pullulan Polymers 0.000 description 3
- 102000040739 Secretory proteins Human genes 0.000 description 3
- 108091058545 Secretory proteins Proteins 0.000 description 3
- 102100032491 Serine protease 1 Human genes 0.000 description 3
- 101710151387 Serine protease 1 Proteins 0.000 description 3
- 108010061228 Sialomucins Proteins 0.000 description 3
- 210000001744 T-lymphocyte Anatomy 0.000 description 3
- 102100033733 Tumor necrosis factor receptor superfamily member 1B Human genes 0.000 description 3
- 101710187830 Tumor necrosis factor receptor superfamily member 1B Proteins 0.000 description 3
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 102100021144 Zinc-alpha-2-glycoprotein Human genes 0.000 description 3
- 101710201241 Zinc-alpha-2-glycoprotein Proteins 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- AVJBPWGFOQAPRH-FWMKGIEWSA-N alpha-L-IdopA-(1->3)-beta-D-GalpNAc4S Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@H](OS(O)(=O)=O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](C(O)=O)O1 AVJBPWGFOQAPRH-FWMKGIEWSA-N 0.000 description 3
- 239000003098 androgen Substances 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 230000023555 blood coagulation Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 210000004268 dentin Anatomy 0.000 description 3
- 229940051593 dermatan sulfate Drugs 0.000 description 3
- 230000003511 endothelial effect Effects 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 229940014144 folate Drugs 0.000 description 3
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 3
- 235000019152 folic acid Nutrition 0.000 description 3
- 239000011724 folic acid Substances 0.000 description 3
- 229940099552 hyaluronan Drugs 0.000 description 3
- KIUKXJAPPMFGSW-MNSSHETKSA-N hyaluronan Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)C1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H](C(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-MNSSHETKSA-N 0.000 description 3
- 229960003160 hyaluronic acid Drugs 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 108010093564 inter-alpha-inhibitor Proteins 0.000 description 3
- UGOZVNFCFYTPAZ-IOXYNQHNSA-N levemir Chemical compound CCCCCCCCCCCCCC(=O)NCCCC[C@@H](C(O)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=2N=CNC=2)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=2N=CNC=2)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=2C=CC=CC=2)C(C)C)CSSC[C@@H]2NC(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)C(C)C)CSSC[C@H](NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC2=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H](CSSC1)C(=O)N[C@@H](CC(N)=O)C(O)=O)CC1=CC=C(O)C=C1 UGOZVNFCFYTPAZ-IOXYNQHNSA-N 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 210000004379 membrane Anatomy 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 108020004999 messenger RNA Proteins 0.000 description 3
- 230000000242 pagocytic effect Effects 0.000 description 3
- 210000003254 palate Anatomy 0.000 description 3
- 229940116369 pancreatic lipase Drugs 0.000 description 3
- 230000006320 pegylation Effects 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 102000020233 phosphotransferase Human genes 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 108010048507 poliovirus receptor Proteins 0.000 description 3
- 229920002627 poly(phosphazenes) Polymers 0.000 description 3
- 229920005646 polycarboxylate Polymers 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000019423 pullulan Nutrition 0.000 description 3
- 108010093841 spermadhesin Proteins 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 230000002992 thymic effect Effects 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- KZMAWJRXKGLWGS-UHFFFAOYSA-N 2-chloro-n-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-n-(3-methoxypropyl)acetamide Chemical compound S1C(N(C(=O)CCl)CCCOC)=NC(C=2C=CC(OC)=CC=2)=C1 KZMAWJRXKGLWGS-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- 101800000263 Acidic protein Proteins 0.000 description 2
- 102100033312 Alpha-2-macroglobulin Human genes 0.000 description 2
- 108090000084 Antiporters Proteins 0.000 description 2
- 102000003669 Antiporters Human genes 0.000 description 2
- 108010052412 Apelin Proteins 0.000 description 2
- 102000018746 Apelin Human genes 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 102100039829 Beta-defensin 110 Human genes 0.000 description 2
- 101710187203 Beta-defensin 110 Proteins 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 102000055006 Calcitonin Human genes 0.000 description 2
- 108060001064 Calcitonin Proteins 0.000 description 2
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 2
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 2
- 102100024052 Calcium-binding protein 1 Human genes 0.000 description 2
- 101710161998 Calcium-binding protein 1 Proteins 0.000 description 2
- 108091006146 Channels Proteins 0.000 description 2
- 229920001661 Chitosan Polymers 0.000 description 2
- 102100025566 Chymotrypsin-like protease CTRL-1 Human genes 0.000 description 2
- 102100039501 Chymotrypsinogen B Human genes 0.000 description 2
- 101000573945 Coccidioides posadasii (strain C735) Neutral protease 2 homolog MEP2 Proteins 0.000 description 2
- 102100027593 Cystatin-9 Human genes 0.000 description 2
- 108050004041 Cystatin-9 Proteins 0.000 description 2
- 101710088194 Dehydrogenase Proteins 0.000 description 2
- 108010049959 Discoidins Proteins 0.000 description 2
- 108091008815 Eph receptors Proteins 0.000 description 2
- 108010012820 Follistatin-Related Proteins Proteins 0.000 description 2
- 102100029379 Follistatin-related protein 3 Human genes 0.000 description 2
- 102000013446 GTP Phosphohydrolases Human genes 0.000 description 2
- 108091006109 GTPases Proteins 0.000 description 2
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 2
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 2
- 229920002971 Heparan sulfate Polymers 0.000 description 2
- 102100031415 Hepatic triacylglycerol lipase Human genes 0.000 description 2
- 101100118545 Holotrichia diomphalia EGF-like gene Proteins 0.000 description 2
- 101000856199 Homo sapiens Chymotrypsin-like protease CTRL-1 Proteins 0.000 description 2
- 101000798702 Homo sapiens Transmembrane protease serine 4 Proteins 0.000 description 2
- 101000795074 Homo sapiens Tryptase alpha/beta-1 Proteins 0.000 description 2
- 108010042653 IgA receptor Proteins 0.000 description 2
- 102000016844 Immunoglobulin-like domains Human genes 0.000 description 2
- 108050006430 Immunoglobulin-like domains Proteins 0.000 description 2
- 108010061971 Inhibin-beta Subunits Proteins 0.000 description 2
- 102000012407 Inhibin-beta Subunits Human genes 0.000 description 2
- 102000002746 Inhibins Human genes 0.000 description 2
- 108010004250 Inhibins Proteins 0.000 description 2
- 108010089308 Insulin Detemir Proteins 0.000 description 2
- 102000019223 Interleukin-1 receptor Human genes 0.000 description 2
- 108050006617 Interleukin-1 receptor Proteins 0.000 description 2
- 102000013462 Interleukin-12 Human genes 0.000 description 2
- 108010065805 Interleukin-12 Proteins 0.000 description 2
- 102000013691 Interleukin-17 Human genes 0.000 description 2
- 108050003558 Interleukin-17 Proteins 0.000 description 2
- 102100033096 Interleukin-17D Human genes 0.000 description 2
- 102000000588 Interleukin-2 Human genes 0.000 description 2
- 108010002350 Interleukin-2 Proteins 0.000 description 2
- 108010066979 Interleukin-27 Proteins 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 102000004195 Isomerases Human genes 0.000 description 2
- 108090000769 Isomerases Proteins 0.000 description 2
- 101710172072 Kexin Proteins 0.000 description 2
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 2
- 102100031775 Leptin receptor Human genes 0.000 description 2
- 102100021747 Leukemia inhibitory factor receptor Human genes 0.000 description 2
- 102100030218 Matrix metalloproteinase-19 Human genes 0.000 description 2
- 102000006404 Mitochondrial Proteins Human genes 0.000 description 2
- 108010058682 Mitochondrial Proteins Proteins 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- SQVRNKJHWKZAKO-PFQGKNLYSA-N N-acetyl-beta-neuraminic acid Chemical compound CC(=O)N[C@@H]1[C@@H](O)C[C@@](O)(C(O)=O)O[C@H]1[C@H](O)[C@H](O)CO SQVRNKJHWKZAKO-PFQGKNLYSA-N 0.000 description 2
- 108010064527 OSM-LIF Receptors Proteins 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 102000016387 Pancreatic elastase Human genes 0.000 description 2
- 108010067372 Pancreatic elastase Proteins 0.000 description 2
- 102000003982 Parathyroid hormone Human genes 0.000 description 2
- 108090000445 Parathyroid hormone Proteins 0.000 description 2
- 102100037883 Phospholipase B1, membrane-associated Human genes 0.000 description 2
- 108090000113 Plasma Kallikrein Proteins 0.000 description 2
- 102000003827 Plasma Kallikrein Human genes 0.000 description 2
- 101710148465 Platelet-derived growth factor receptor alpha Proteins 0.000 description 2
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 description 2
- 101710164680 Platelet-derived growth factor receptor beta Proteins 0.000 description 2
- 102100040990 Platelet-derived growth factor subunit B Human genes 0.000 description 2
- 101710103494 Platelet-derived growth factor subunit B Proteins 0.000 description 2
- 108010015078 Pregnancy-Associated alpha 2-Macroglobulins Proteins 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- 101710088675 Proline-rich peptide Proteins 0.000 description 2
- 102100034014 Prolyl 3-hydroxylase 3 Human genes 0.000 description 2
- 108010043005 Prolyl Hydroxylases Proteins 0.000 description 2
- 102000004079 Prolyl Hydroxylases Human genes 0.000 description 2
- 108010003894 Protein-Lysine 6-Oxidase Proteins 0.000 description 2
- 102100026858 Protein-lysine 6-oxidase Human genes 0.000 description 2
- 102000011274 Secretoglobin Human genes 0.000 description 2
- 108050001520 Secretoglobin Proteins 0.000 description 2
- 102000012010 Sialomucins Human genes 0.000 description 2
- 108010061312 Sphingomyelin Phosphodiesterase Proteins 0.000 description 2
- 102100036428 Spondin-1 Human genes 0.000 description 2
- 101710092167 Spondin-1 Proteins 0.000 description 2
- 108090000787 Subtilisin Proteins 0.000 description 2
- 102000011362 Thioredoxin domains Human genes 0.000 description 2
- 108050001669 Thioredoxin domains Proteins 0.000 description 2
- 102100032471 Transmembrane protease serine 4 Human genes 0.000 description 2
- 102100034392 Trypsin-2 Human genes 0.000 description 2
- 102100029639 Tryptase alpha/beta-1 Human genes 0.000 description 2
- 102000010571 Type II Bone Morphogenetic Protein Receptors Human genes 0.000 description 2
- 108010063130 Type II Bone Morphogenetic Protein Receptors Proteins 0.000 description 2
- 239000005862 Whey Substances 0.000 description 2
- 102000010126 acid sphingomyelin phosphodiesterase activity proteins Human genes 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 229960005305 adenosine Drugs 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- 229940053200 antiepileptics fatty acid derivative Drugs 0.000 description 2
- BWVPHIKGXQBZPV-QKFDDRBGSA-N apelin Chemical compound NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N1[C@H](C(=O)N[C@@H](CC(O)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=2NC=NC=2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=2NC=NC=2)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCSC)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(O)=O)CCC1 BWVPHIKGXQBZPV-QKFDDRBGSA-N 0.000 description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 description 2
- 239000003114 blood coagulation factor Substances 0.000 description 2
- 210000004899 c-terminal region Anatomy 0.000 description 2
- 229960004015 calcitonin Drugs 0.000 description 2
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 210000000845 cartilage Anatomy 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 229940045110 chitosan Drugs 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229960002086 dextran Drugs 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 210000000981 epithelium Anatomy 0.000 description 2
- 102000037865 fusion proteins Human genes 0.000 description 2
- 108020001507 fusion proteins Proteins 0.000 description 2
- 102000034356 gene-regulatory proteins Human genes 0.000 description 2
- 108091006104 gene-regulatory proteins Proteins 0.000 description 2
- 108010048607 glycerophosphodiester phosphodiesterase Proteins 0.000 description 2
- 210000002288 golgi apparatus Anatomy 0.000 description 2
- 210000003714 granulocyte Anatomy 0.000 description 2
- 229940048921 humira Drugs 0.000 description 2
- 230000001900 immune effect Effects 0.000 description 2
- 230000002163 immunogen Effects 0.000 description 2
- 229960000367 inositol Drugs 0.000 description 2
- 229960003948 insulin detemir Drugs 0.000 description 2
- 229940117681 interleukin-12 Drugs 0.000 description 2
- 108010001618 interleukin-20 receptor Proteins 0.000 description 2
- 230000037427 ion transport Effects 0.000 description 2
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 2
- 108010019813 leptin receptors Proteins 0.000 description 2
- 210000000265 leukocyte Anatomy 0.000 description 2
- 150000004668 long chain fatty acids Chemical class 0.000 description 2
- 210000004698 lymphocyte Anatomy 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 210000002850 nasal mucosa Anatomy 0.000 description 2
- 102000003819 neurexophilin Human genes 0.000 description 2
- 108090000126 neurexophilin Proteins 0.000 description 2
- 210000004492 nuclear pore Anatomy 0.000 description 2
- 108010000416 ovomacroglobulin Proteins 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229940012957 plasmin Drugs 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 210000003296 saliva Anatomy 0.000 description 2
- 230000003248 secreting effect Effects 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229940032147 starch Drugs 0.000 description 2
- 210000002536 stromal cell Anatomy 0.000 description 2
- 230000002381 testicular Effects 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- RWBLWXCGQLZKLK-USVTTYPOSA-N (2s)-2-[(2-aminoacetyl)amino]-n-[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[2-[[(2s)-1-[[(2s)-1-[[(2s)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxob Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CC(N)=O)NC(=O)CN)C(C)C)C1=CN=CN1 RWBLWXCGQLZKLK-USVTTYPOSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- 102100025573 1-alkyl-2-acetylglycerophosphocholine esterase Human genes 0.000 description 1
- GZCWLCBFPRFLKL-UHFFFAOYSA-N 1-prop-2-ynoxypropan-2-ol Chemical compound CC(O)COCC#C GZCWLCBFPRFLKL-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- 102100037429 17-beta-hydroxysteroid dehydrogenase 13 Human genes 0.000 description 1
- 101710194118 17-beta-hydroxysteroid dehydrogenase 13 Proteins 0.000 description 1
- 102100027962 2-5A-dependent ribonuclease Human genes 0.000 description 1
- 108010000834 2-5A-dependent ribonuclease Proteins 0.000 description 1
- 108010050201 2-hydroxybutyrate dehydrogenase Proteins 0.000 description 1
- 108091071337 20 family Proteins 0.000 description 1
- 108700020831 3-Hydroxyacyl-CoA Dehydrogenase Proteins 0.000 description 1
- DPEUWKZJZIPZKE-OFANTOPUSA-N 330936-69-1 Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)O)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@@H](N)CCSC)C1=CC=CC=C1 DPEUWKZJZIPZKE-OFANTOPUSA-N 0.000 description 1
- 101800001643 6K protein Proteins 0.000 description 1
- 108010019238 ADPribose pyrophosphatase Proteins 0.000 description 1
- 101150079978 AGRN gene Proteins 0.000 description 1
- 102100033618 ATP-binding cassette sub-family A member 2 Human genes 0.000 description 1
- 102100033639 Acetylcholinesterase Human genes 0.000 description 1
- 108010022752 Acetylcholinesterase Proteins 0.000 description 1
- 108010051457 Acid Phosphatase Proteins 0.000 description 1
- 102000013563 Acid Phosphatase Human genes 0.000 description 1
- 102100022907 Acrosin-binding protein Human genes 0.000 description 1
- 101710107749 Acrosin-binding protein Proteins 0.000 description 1
- 102000057234 Acyl transferases Human genes 0.000 description 1
- 108700016155 Acyl transferases Proteins 0.000 description 1
- 102100035785 Acyl-CoA-binding protein Human genes 0.000 description 1
- 102100032605 Adhesion G protein-coupled receptor B1 Human genes 0.000 description 1
- 101710096306 Adhesion G protein-coupled receptor B1 Proteins 0.000 description 1
- 102100024394 Adipocyte enhancer-binding protein 1 Human genes 0.000 description 1
- 101710105604 Adipocyte enhancer-binding protein 1 Proteins 0.000 description 1
- 102100031786 Adiponectin Human genes 0.000 description 1
- 108010076365 Adiponectin Proteins 0.000 description 1
- 102100032358 Adiponectin receptor protein 2 Human genes 0.000 description 1
- 101710160411 Adiponectin receptor protein 2 Proteins 0.000 description 1
- 102100040026 Agrin Human genes 0.000 description 1
- 108700019743 Agrin Proteins 0.000 description 1
- 102100024321 Alkaline phosphatase, placental type Human genes 0.000 description 1
- 108700028369 Alleles Proteins 0.000 description 1
- 102100022524 Alpha-1-antichymotrypsin Human genes 0.000 description 1
- 102100033407 Alpha-amylase 2B Human genes 0.000 description 1
- 101710082073 Alpha-amylase 2B Proteins 0.000 description 1
- 102100034452 Alternative prion protein Human genes 0.000 description 1
- 102100040409 Ameloblastin Human genes 0.000 description 1
- 101710081264 Ameloblastin Proteins 0.000 description 1
- 102100039088 Amelogenin, X isoform Human genes 0.000 description 1
- 101710153359 Amelogenin, X isoform Proteins 0.000 description 1
- 102000052866 Amino Acyl-tRNA Synthetases Human genes 0.000 description 1
- 108700028939 Amino Acyl-tRNA Synthetases Proteins 0.000 description 1
- 102100032126 Aminopeptidase B Human genes 0.000 description 1
- 102000002659 Amyloid Precursor Protein Secretases Human genes 0.000 description 1
- 108010043324 Amyloid Precursor Protein Secretases Proteins 0.000 description 1
- 102000013455 Amyloid beta-Peptides Human genes 0.000 description 1
- 108010090849 Amyloid beta-Peptides Proteins 0.000 description 1
- 108010048112 Amyloidogenic Proteins Proteins 0.000 description 1
- 102000009091 Amyloidogenic Proteins Human genes 0.000 description 1
- 102100034594 Angiopoietin-1 Human genes 0.000 description 1
- 108010048154 Angiopoietin-1 Proteins 0.000 description 1
- 102100034608 Angiopoietin-2 Human genes 0.000 description 1
- 108010048036 Angiopoietin-2 Proteins 0.000 description 1
- 102100033402 Angiopoietin-4 Human genes 0.000 description 1
- 102100030988 Angiotensin-converting enzyme Human genes 0.000 description 1
- 102100035765 Angiotensin-converting enzyme 2 Human genes 0.000 description 1
- 108090000975 Angiotensin-converting enzyme 2 Proteins 0.000 description 1
- 101710199744 Anionic trypsin-2 Proteins 0.000 description 1
- 108010049777 Ankyrins Proteins 0.000 description 1
- 102000008102 Ankyrins Human genes 0.000 description 1
- 101710145634 Antigen 1 Proteins 0.000 description 1
- 102100021253 Antileukoproteinase Human genes 0.000 description 1
- 101710170876 Antileukoproteinase Proteins 0.000 description 1
- 102000044503 Antimicrobial Peptides Human genes 0.000 description 1
- 108700042778 Antimicrobial Peptides Proteins 0.000 description 1
- 102100034156 Apical endosomal glycoprotein Human genes 0.000 description 1
- 101710115984 Apical endosomal glycoprotein Proteins 0.000 description 1
- 108010059886 Apolipoprotein A-I Proteins 0.000 description 1
- 102000005666 Apolipoprotein A-I Human genes 0.000 description 1
- 102100040202 Apolipoprotein B-100 Human genes 0.000 description 1
- 108010008150 Apolipoprotein B-100 Proteins 0.000 description 1
- 108010076807 Apolipoprotein C-I Proteins 0.000 description 1
- 102000011772 Apolipoprotein C-I Human genes 0.000 description 1
- 102100029470 Apolipoprotein E Human genes 0.000 description 1
- 101710095339 Apolipoprotein E Proteins 0.000 description 1
- 102000018623 Apolipoproteins M Human genes 0.000 description 1
- 108010027018 Apolipoproteins M Proteins 0.000 description 1
- 101710111255 Appetite-regulating hormone Proteins 0.000 description 1
- 101100226366 Arabidopsis thaliana EXT3 gene Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 102100024624 Arylacetamide deacetylase Human genes 0.000 description 1
- 101710116704 Arylacetamide deacetylase Proteins 0.000 description 1
- 102100033891 Arylsulfatase I Human genes 0.000 description 1
- 101710115245 Arylsulfatase I Proteins 0.000 description 1
- 102100023944 Arylsulfatase K Human genes 0.000 description 1
- 101710115241 Arylsulfatase K Proteins 0.000 description 1
- 108010024976 Asparaginase Proteins 0.000 description 1
- 102000015827 Asporin Human genes 0.000 description 1
- 108050004044 Asporin Proteins 0.000 description 1
- 102100027936 Attractin Human genes 0.000 description 1
- 101710134735 Attractin Proteins 0.000 description 1
- 102100035526 B melanoma antigen 1 Human genes 0.000 description 1
- 101710131520 B melanoma antigen 1 Proteins 0.000 description 1
- 241000193738 Bacillus anthracis Species 0.000 description 1
- 102100027321 Beta-1,4-galactosyltransferase 7 Human genes 0.000 description 1
- 101710120069 Beta-1,4-galactosyltransferase 7 Proteins 0.000 description 1
- 102100026887 Beta-defensin 103 Human genes 0.000 description 1
- 101710187196 Beta-defensin 103 Proteins 0.000 description 1
- 102100037913 Beta-defensin 106 Human genes 0.000 description 1
- 101710187208 Beta-defensin 106 Proteins 0.000 description 1
- 101710187201 Beta-defensin 109 Proteins 0.000 description 1
- 102100039828 Beta-defensin 112 Human genes 0.000 description 1
- 101710187216 Beta-defensin 112 Proteins 0.000 description 1
- 102100039807 Beta-defensin 113 Human genes 0.000 description 1
- 101710187215 Beta-defensin 113 Proteins 0.000 description 1
- 102100039803 Beta-defensin 114 Human genes 0.000 description 1
- 101710187218 Beta-defensin 114 Proteins 0.000 description 1
- 102100039801 Beta-defensin 115 Human genes 0.000 description 1
- 101710187217 Beta-defensin 115 Proteins 0.000 description 1
- 102100039804 Beta-defensin 116 Human genes 0.000 description 1
- 101710187209 Beta-defensin 116 Proteins 0.000 description 1
- 102100039817 Beta-defensin 118 Human genes 0.000 description 1
- 101710187211 Beta-defensin 118 Proteins 0.000 description 1
- 102100024461 Beta-defensin 121 Human genes 0.000 description 1
- 101710185642 Beta-defensin 121 Proteins 0.000 description 1
- 102100024467 Beta-defensin 123 Human genes 0.000 description 1
- 101710187161 Beta-defensin 123 Proteins 0.000 description 1
- 102100024466 Beta-defensin 124 Human genes 0.000 description 1
- 101710187159 Beta-defensin 124 Proteins 0.000 description 1
- 102100021326 Beta-defensin 125 Human genes 0.000 description 1
- 101710187156 Beta-defensin 125 Proteins 0.000 description 1
- 102100021099 Beta-defensin 126 Human genes 0.000 description 1
- 101710187155 Beta-defensin 126 Proteins 0.000 description 1
- 102100021098 Beta-defensin 128 Human genes 0.000 description 1
- 101710187172 Beta-defensin 128 Proteins 0.000 description 1
- 102100021097 Beta-defensin 129 Human genes 0.000 description 1
- 101710187163 Beta-defensin 129 Proteins 0.000 description 1
- 101710187181 Beta-defensin 130 Proteins 0.000 description 1
- 102100028037 Beta-defensin 130A Human genes 0.000 description 1
- 102100029535 Beta-defensin 132 Human genes 0.000 description 1
- 101710187187 Beta-defensin 132 Proteins 0.000 description 1
- 102100029541 Beta-defensin 133 Human genes 0.000 description 1
- 101710187182 Beta-defensin 133 Proteins 0.000 description 1
- 102100029542 Beta-defensin 134 Human genes 0.000 description 1
- 101710187179 Beta-defensin 134 Proteins 0.000 description 1
- 102100029536 Beta-defensin 135 Human genes 0.000 description 1
- 101710187186 Beta-defensin 135 Proteins 0.000 description 1
- 102100029537 Beta-defensin 136 Human genes 0.000 description 1
- 101710187180 Beta-defensin 136 Proteins 0.000 description 1
- 108010039206 Biotinidase Proteins 0.000 description 1
- 102100026044 Biotinidase Human genes 0.000 description 1
- 102000015081 Blood Coagulation Factors Human genes 0.000 description 1
- 108010039209 Blood Coagulation Factors Proteins 0.000 description 1
- 102100035337 Bone marrow proteoglycan Human genes 0.000 description 1
- 101710134771 Bone marrow proteoglycan Proteins 0.000 description 1
- 102100022546 Bone morphogenetic protein 8A Human genes 0.000 description 1
- 101710117973 Bone morphogenetic protein 8A Proteins 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- 108010074051 C-Reactive Protein Proteins 0.000 description 1
- 102100032752 C-reactive protein Human genes 0.000 description 1
- 102100032528 C-type lectin domain family 11 member A Human genes 0.000 description 1
- 101710167766 C-type lectin domain family 11 member A Proteins 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- 102000002110 C2 domains Human genes 0.000 description 1
- 108050009459 C2 domains Proteins 0.000 description 1
- 102100037084 C4b-binding protein alpha chain Human genes 0.000 description 1
- 101710159767 C4b-binding protein alpha chain Proteins 0.000 description 1
- 102100037080 C4b-binding protein beta chain Human genes 0.000 description 1
- 101710085150 C4b-binding protein beta chain Proteins 0.000 description 1
- 102000001902 CC Chemokines Human genes 0.000 description 1
- 102100031168 CCN family member 2 Human genes 0.000 description 1
- 108010009992 CD163 antigen Proteins 0.000 description 1
- 101150070144 CPK8 gene Proteins 0.000 description 1
- 102100024151 Cadherin-16 Human genes 0.000 description 1
- 101710196874 Cadherin-16 Proteins 0.000 description 1
- 101710196922 Cadherin-19 Proteins 0.000 description 1
- 102100022529 Cadherin-19 Human genes 0.000 description 1
- 102100022509 Cadherin-23 Human genes 0.000 description 1
- 101710196902 Cadherin-23 Proteins 0.000 description 1
- 101710196900 Cadherin-24 Proteins 0.000 description 1
- 102100035356 Cadherin-related family member 5 Human genes 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 102000029728 Calcium binding protein 2 Human genes 0.000 description 1
- 108091016526 Calcium binding protein 2 Proteins 0.000 description 1
- 102100039534 Calcium-activated chloride channel regulator 4 Human genes 0.000 description 1
- 101710186149 Calcium-activated chloride channel regulator 4 Proteins 0.000 description 1
- 102000011398 Calponin homology domains Human genes 0.000 description 1
- 108050001630 Calponin homology domains Proteins 0.000 description 1
- 102100029968 Calreticulin Human genes 0.000 description 1
- 108090000549 Calreticulin Proteins 0.000 description 1
- 101001024441 Candida albicans (strain SC5314 / ATCC MYA-2876) Major facilitator superfamily multidrug transporter NAG3 Proteins 0.000 description 1
- 102100033379 Carbohydrate sulfotransferase 14 Human genes 0.000 description 1
- 101710096627 Carbohydrate sulfotransferase 14 Proteins 0.000 description 1
- 102100031276 Carbohydrate sulfotransferase 8 Human genes 0.000 description 1
- 101710158439 Carbohydrate sulfotransferase 8 Proteins 0.000 description 1
- 102100032144 Carbohydrate sulfotransferase 9 Human genes 0.000 description 1
- 101710158443 Carbohydrate sulfotransferase 9 Proteins 0.000 description 1
- 102100036369 Carbonic anhydrase 6 Human genes 0.000 description 1
- 102000013392 Carboxylesterase Human genes 0.000 description 1
- 108010051152 Carboxylesterase Proteins 0.000 description 1
- 101710117348 Carboxylesterase 1D Proteins 0.000 description 1
- 102100036808 Carboxylesterase 3 Human genes 0.000 description 1
- 101710201072 Carboxylesterase 3 Proteins 0.000 description 1
- 102100036806 Carboxylesterase 5A Human genes 0.000 description 1
- 102100026793 Carboxypeptidase A6 Human genes 0.000 description 1
- 108700001208 Carboxypeptidase A6 Proteins 0.000 description 1
- 108090000201 Carboxypeptidase B2 Proteins 0.000 description 1
- 102000003847 Carboxypeptidase B2 Human genes 0.000 description 1
- 102100032378 Carboxypeptidase E Human genes 0.000 description 1
- 108010058255 Carboxypeptidase H Proteins 0.000 description 1
- 101710161573 Cardiotrophin-2 Proteins 0.000 description 1
- 102100029391 Cardiotrophin-like cytokine factor 1 Human genes 0.000 description 1
- 101710107109 Cardiotrophin-like cytokine factor 1 Proteins 0.000 description 1
- 102100027848 Cartilage-associated protein Human genes 0.000 description 1
- 101710104415 Cartilage-associated protein Proteins 0.000 description 1
- 102100034357 Casein kinase I isoform alpha Human genes 0.000 description 1
- 101710118321 Casein kinase I isoform alpha Proteins 0.000 description 1
- 108010076119 Caseins Proteins 0.000 description 1
- 102000011632 Caseins Human genes 0.000 description 1
- 208000014392 Cat-eye syndrome Diseases 0.000 description 1
- 102100035882 Catalase Human genes 0.000 description 1
- 108010053835 Catalase Proteins 0.000 description 1
- 108010072135 Cell Adhesion Molecule-1 Proteins 0.000 description 1
- 102100024649 Cell adhesion molecule 1 Human genes 0.000 description 1
- 102100037677 Cell surface hyaluronidase Human genes 0.000 description 1
- 101710125063 Cell surface hyaluronidase Proteins 0.000 description 1
- 102100035244 Cerebellin-1 Human genes 0.000 description 1
- 101710135505 Cerebellin-1 Proteins 0.000 description 1
- 102100035245 Cerebellin-2 Human genes 0.000 description 1
- 101710135504 Cerebellin-2 Proteins 0.000 description 1
- 102100035811 Cerebellin-3 Human genes 0.000 description 1
- 101710135501 Cerebellin-3 Proteins 0.000 description 1
- 102100035812 Cerebellin-4 Human genes 0.000 description 1
- 101710135520 Cerebellin-4 Proteins 0.000 description 1
- 102100039550 Chemokine-like factor Human genes 0.000 description 1
- 101710204213 Chemokine-like factor Proteins 0.000 description 1
- 102000012286 Chitinases Human genes 0.000 description 1
- 108010022172 Chitinases Proteins 0.000 description 1
- 239000005714 Chitosan hydrochloride Substances 0.000 description 1
- 102100037328 Chitotriosidase-1 Human genes 0.000 description 1
- 101710132290 Chitotriosidase-1 Proteins 0.000 description 1
- 108010062745 Chloride Channels Proteins 0.000 description 1
- 102000011045 Chloride Channels Human genes 0.000 description 1
- 101100499351 Chlorobaculum tepidum (strain ATCC 49652 / DSM 12025 / NBRC 103806 / TLS) lpd gene Proteins 0.000 description 1
- 101800001982 Cholecystokinin Proteins 0.000 description 1
- 102100025841 Cholecystokinin Human genes 0.000 description 1
- 229920002567 Chondroitin Polymers 0.000 description 1
- 102100029296 Chondroitin sulfate glucuronyltransferase Human genes 0.000 description 1
- 102400000676 Chondromodulin-1 Human genes 0.000 description 1
- 101800004542 Chondromodulin-1 Proteins 0.000 description 1
- 102100032766 Chordin-like protein 2 Human genes 0.000 description 1
- 101710173229 Chordin-like protein 2 Proteins 0.000 description 1
- 108010038447 Chromogranin A Proteins 0.000 description 1
- 102100031186 Chromogranin-A Human genes 0.000 description 1
- 101710147853 Chymotrypsinogen B Proteins 0.000 description 1
- 101710178550 Chymotrypsinogen B2 Proteins 0.000 description 1
- 102000002029 Claudin Human genes 0.000 description 1
- 108050009302 Claudin Proteins 0.000 description 1
- 102100038445 Claudin-2 Human genes 0.000 description 1
- 108090000580 Claudin-2 Proteins 0.000 description 1
- 102000003780 Clusterin Human genes 0.000 description 1
- 108090000197 Clusterin Proteins 0.000 description 1
- 102100037529 Coagulation factor V Human genes 0.000 description 1
- 102100023804 Coagulation factor VII Human genes 0.000 description 1
- 102100030563 Coagulation factor XI Human genes 0.000 description 1
- 102000057710 Coatomer Human genes 0.000 description 1
- 108700022408 Coatomer Proteins 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- ACTIUHUUMQJHFO-UHFFFAOYSA-N Coenzym Q10 Natural products COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UHFFFAOYSA-N 0.000 description 1
- 102000000503 Collagen Type II Human genes 0.000 description 1
- 108010041390 Collagen Type II Proteins 0.000 description 1
- 102000012432 Collagen Type V Human genes 0.000 description 1
- 108010022514 Collagen Type V Proteins 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- 102000017284 Collagenase 3 Human genes 0.000 description 1
- 102100024206 Collectin-10 Human genes 0.000 description 1
- 101710194645 Collectin-10 Proteins 0.000 description 1
- 102000007644 Colony-Stimulating Factors Human genes 0.000 description 1
- 108010071942 Colony-Stimulating Factors Proteins 0.000 description 1
- 102000055157 Complement C1 Inhibitor Human genes 0.000 description 1
- 102100031609 Complement C2 Human genes 0.000 description 1
- 108090000955 Complement C2 Proteins 0.000 description 1
- 108010028773 Complement C5 Proteins 0.000 description 1
- 108010028776 Complement C7 Proteins 0.000 description 1
- 108010053085 Complement Factor H Proteins 0.000 description 1
- 108090000044 Complement Factor I Proteins 0.000 description 1
- 102100024339 Complement component C6 Human genes 0.000 description 1
- 101710203188 Complement component C6 Proteins 0.000 description 1
- 102100035432 Complement factor H Human genes 0.000 description 1
- 102100035431 Complement factor I Human genes 0.000 description 1
- 102100030886 Complement receptor type 1 Human genes 0.000 description 1
- 208000023445 Congenital pulmonary airway malformation Diseases 0.000 description 1
- 108010039419 Connective Tissue Growth Factor Proteins 0.000 description 1
- 102100024340 Contactin-4 Human genes 0.000 description 1
- 101710107714 Contactin-4 Proteins 0.000 description 1
- 102100031673 Corneodesmosin Human genes 0.000 description 1
- 101710139375 Corneodesmosin Proteins 0.000 description 1
- 102100021752 Corticoliberin Human genes 0.000 description 1
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 1
- 108010022152 Corticotropin-Releasing Hormone Proteins 0.000 description 1
- 108010035601 Coxsackie and Adenovirus Receptor Like Membrane Protein Proteins 0.000 description 1
- 102000008198 Coxsackie and Adenovirus Receptor Like Membrane Protein Human genes 0.000 description 1
- 102100024106 Cyclin-Y Human genes 0.000 description 1
- 101710183458 Cyclin-Y Proteins 0.000 description 1
- 102000015833 Cystatin Human genes 0.000 description 1
- 108010061641 Cystatin A Proteins 0.000 description 1
- 108010061617 Cystatin M Proteins 0.000 description 1
- 101710171998 Cystatin-13 Proteins 0.000 description 1
- 102100027598 Cystatin-8 Human genes 0.000 description 1
- 101710187959 Cystatin-8 Proteins 0.000 description 1
- 102100031237 Cystatin-A Human genes 0.000 description 1
- 102100028182 Cystatin-D Human genes 0.000 description 1
- 102100038381 Cystatin-M Human genes 0.000 description 1
- 101710126131 Cysteine-rich secretory protein 1 Proteins 0.000 description 1
- 102100027366 Cysteine-rich secretory protein 1 Human genes 0.000 description 1
- 101710126127 Cysteine-rich secretory protein 2 Proteins 0.000 description 1
- 102100027350 Cysteine-rich secretory protein 2 Human genes 0.000 description 1
- 102100022027 Cytochrome P450 4X1 Human genes 0.000 description 1
- 102100021999 Cytosolic Fe-S cluster assembly factor NUBP2 Human genes 0.000 description 1
- 101710139686 Cytosolic Fe-S cluster assembly factor NUBP2 Proteins 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 101710116895 DNA-binding protein H-NS Proteins 0.000 description 1
- 102000004237 Decorin Human genes 0.000 description 1
- 108090000738 Decorin Proteins 0.000 description 1
- 101710178508 Defensin 3 Proteins 0.000 description 1
- 101710178505 Defensin-1 Proteins 0.000 description 1
- 102100021420 Defensin-5 Human genes 0.000 description 1
- 101710178517 Defensin-5 Proteins 0.000 description 1
- 102100029790 Defensin-6 Human genes 0.000 description 1
- 101710178511 Defensin-6 Proteins 0.000 description 1
- 101710087821 Deformed epidermal autoregulatory factor 1 Proteins 0.000 description 1
- 102100033553 Delta-like protein 4 Human genes 0.000 description 1
- 101710112728 Delta-like protein 4 Proteins 0.000 description 1
- 102100031149 Deoxyribonuclease gamma Human genes 0.000 description 1
- 102100030012 Deoxyribonuclease-1 Human genes 0.000 description 1
- 101710206036 Deoxyribonuclease-1 Proteins 0.000 description 1
- 102100030438 Derlin-1 Human genes 0.000 description 1
- 101710178882 Derlin-1 Proteins 0.000 description 1
- 102100034274 Diamine acetyltransferase 1 Human genes 0.000 description 1
- 108010039287 Diazepam Binding Inhibitor Proteins 0.000 description 1
- 102100029857 Dipeptidase 3 Human genes 0.000 description 1
- 101710117904 Dipeptidase 3 Proteins 0.000 description 1
- 108010067722 Dipeptidyl Peptidase 4 Proteins 0.000 description 1
- 102100025012 Dipeptidyl peptidase 4 Human genes 0.000 description 1
- 102000048188 Dolichol kinases Human genes 0.000 description 1
- 108700023189 Dolichol kinases Proteins 0.000 description 1
- 102100037713 Down syndrome cell adhesion molecule Human genes 0.000 description 1
- 101710199377 Down syndrome cell adhesion molecule Proteins 0.000 description 1
- 206010059866 Drug resistance Diseases 0.000 description 1
- 102000001301 EGF receptor Human genes 0.000 description 1
- 108060006698 EGF receptor Proteins 0.000 description 1
- 102100028067 EGF-containing fibulin-like extracellular matrix protein 2 Human genes 0.000 description 1
- 101710176518 EGF-containing fibulin-like extracellular matrix protein 2 Proteins 0.000 description 1
- 102000039321 EZ family Human genes 0.000 description 1
- 108091068505 EZ family Proteins 0.000 description 1
- 102100023795 Elafin Human genes 0.000 description 1
- 108010015972 Elafin Proteins 0.000 description 1
- 108010014258 Elastin Proteins 0.000 description 1
- 102000016942 Elastin Human genes 0.000 description 1
- 240000000279 Emilia sonchifolia Species 0.000 description 1
- 235000002139 Emilia sonchifolia Nutrition 0.000 description 1
- 108010044063 Endocrine-Gland-Derived Vascular Endothelial Growth Factor Proteins 0.000 description 1
- 102100038566 Endomucin Human genes 0.000 description 1
- 102000004533 Endonucleases Human genes 0.000 description 1
- 108010042407 Endonucleases Proteins 0.000 description 1
- 102100039328 Endoplasmin Human genes 0.000 description 1
- 102100031375 Endothelial lipase Human genes 0.000 description 1
- 101710087274 Endothelial lipase Proteins 0.000 description 1
- 102100029109 Endothelin-3 Human genes 0.000 description 1
- 108010072844 Endothelin-3 Proteins 0.000 description 1
- 108030001679 Endothelin-converting enzyme 1 Proteins 0.000 description 1
- 102000048186 Endothelin-converting enzyme 1 Human genes 0.000 description 1
- 102100029113 Endothelin-converting enzyme 2 Human genes 0.000 description 1
- 102100023688 Eotaxin Human genes 0.000 description 1
- 101710139422 Eotaxin Proteins 0.000 description 1
- 102100034725 Epididymal-specific lipocalin-10 Human genes 0.000 description 1
- 102100034720 Epididymal-specific lipocalin-12 Human genes 0.000 description 1
- 102100038262 Epididymal-specific lipocalin-8 Human genes 0.000 description 1
- 102100038265 Epididymal-specific lipocalin-9 Human genes 0.000 description 1
- 102100023164 Epididymis-specific alpha-mannosidase Human genes 0.000 description 1
- 101710191560 Epididymis-specific alpha-mannosidase Proteins 0.000 description 1
- 102100036823 Erlin-2 Human genes 0.000 description 1
- 101710044846 Erlin-2 Proteins 0.000 description 1
- 102000003951 Erythropoietin Human genes 0.000 description 1
- 108090000394 Erythropoietin Proteins 0.000 description 1
- 102100023400 Estradiol 17-beta-dehydrogenase 11 Human genes 0.000 description 1
- 101710127907 Estradiol 17-beta-dehydrogenase 11 Proteins 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- 102100034719 Extracellular glycoprotein lacritin Human genes 0.000 description 1
- 108091016508 Extracellular glycoprotein lacritin Proteins 0.000 description 1
- 102100031758 Extracellular matrix protein 1 Human genes 0.000 description 1
- 101710127949 Extracellular matrix protein 1 Proteins 0.000 description 1
- 102100023077 Extracellular matrix protein 2 Human genes 0.000 description 1
- 101710127932 Extracellular matrix protein 2 Proteins 0.000 description 1
- 101710127951 Extracellular matrix protein 3 Proteins 0.000 description 1
- 108091008794 FGF receptors Proteins 0.000 description 1
- 108010014172 Factor V Proteins 0.000 description 1
- 108010023321 Factor VII Proteins 0.000 description 1
- 102100031509 Fibrillin-1 Human genes 0.000 description 1
- 108010030229 Fibrillin-1 Proteins 0.000 description 1
- 102100031510 Fibrillin-2 Human genes 0.000 description 1
- 108010030242 Fibrillin-2 Proteins 0.000 description 1
- 102100031387 Fibrillin-3 Human genes 0.000 description 1
- 101710175017 Fibrillin-3 Proteins 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 102100028313 Fibrinogen beta chain Human genes 0.000 description 1
- 101710170765 Fibrinogen beta chain Proteins 0.000 description 1
- 102100024783 Fibrinogen gamma chain Human genes 0.000 description 1
- 102100038664 Fibrinogen-like protein 1 Human genes 0.000 description 1
- 101710197507 Fibrinogen-like protein 1 Proteins 0.000 description 1
- 102000044168 Fibroblast Growth Factor Receptor Human genes 0.000 description 1
- 102000004042 Fibroblast Growth Factor-23 Human genes 0.000 description 1
- 108090000569 Fibroblast Growth Factor-23 Proteins 0.000 description 1
- 102100024785 Fibroblast growth factor 2 Human genes 0.000 description 1
- 108090000379 Fibroblast growth factor 2 Proteins 0.000 description 1
- 102000012548 Fibroblast growth factor 22 Human genes 0.000 description 1
- 108050002062 Fibroblast growth factor 22 Proteins 0.000 description 1
- 102100023600 Fibroblast growth factor receptor 2 Human genes 0.000 description 1
- 101710182389 Fibroblast growth factor receptor 2 Proteins 0.000 description 1
- 102100027842 Fibroblast growth factor receptor 3 Human genes 0.000 description 1
- 101710182396 Fibroblast growth factor receptor 3 Proteins 0.000 description 1
- 102100027844 Fibroblast growth factor receptor 4 Human genes 0.000 description 1
- 101710182387 Fibroblast growth factor receptor 4 Proteins 0.000 description 1
- 102100031812 Fibulin-1 Human genes 0.000 description 1
- 101710170731 Fibulin-1 Proteins 0.000 description 1
- 102100031813 Fibulin-2 Human genes 0.000 description 1
- 102100028065 Fibulin-5 Human genes 0.000 description 1
- 101710170766 Fibulin-5 Proteins 0.000 description 1
- 102100031383 Fibulin-7 Human genes 0.000 description 1
- 101710170768 Fibulin-7 Proteins 0.000 description 1
- 102100024508 Ficolin-1 Human genes 0.000 description 1
- 101710155257 Ficolin-1 Proteins 0.000 description 1
- 102100024521 Ficolin-2 Human genes 0.000 description 1
- 101710155249 Ficolin-2 Proteins 0.000 description 1
- 102100024520 Ficolin-3 Human genes 0.000 description 1
- 101710155250 Ficolin-3 Proteins 0.000 description 1
- 108010014612 Follistatin Proteins 0.000 description 1
- 102000016970 Follistatin Human genes 0.000 description 1
- 102000019203 Follistatin-Related Proteins Human genes 0.000 description 1
- 101710115769 Follistatin-related protein 3 Proteins 0.000 description 1
- 102100020913 Follistatin-related protein 5 Human genes 0.000 description 1
- 101710115774 Follistatin-related protein 5 Proteins 0.000 description 1
- 102100028875 Formylglycine-generating enzyme Human genes 0.000 description 1
- 101710192607 Formylglycine-generating enzyme Proteins 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 102000002464 Galactosidases Human genes 0.000 description 1
- 108010093031 Galactosidases Proteins 0.000 description 1
- 108010081952 Galanin-Like Peptide Proteins 0.000 description 1
- 102100031689 Galanin-like peptide Human genes 0.000 description 1
- 108010001498 Galectin 1 Proteins 0.000 description 1
- 102100021736 Galectin-1 Human genes 0.000 description 1
- 102000044465 Galectin-7 Human genes 0.000 description 1
- 102100035212 Gamma-aminobutyric acid type B receptor subunit 1 Human genes 0.000 description 1
- 101710086268 Gamma-aminobutyric acid type B receptor subunit 1 Proteins 0.000 description 1
- 102100021023 Gamma-glutamyl hydrolase Human genes 0.000 description 1
- 108010004460 Gastric Inhibitory Polypeptide Proteins 0.000 description 1
- 102100039994 Gastric inhibitory polypeptide Human genes 0.000 description 1
- 102000029813 Gastric triacylglycerol lipase Human genes 0.000 description 1
- 102400000921 Gastrin Human genes 0.000 description 1
- 108010052343 Gastrins Proteins 0.000 description 1
- 102000013382 Gelatinases Human genes 0.000 description 1
- 108010026132 Gelatinases Proteins 0.000 description 1
- 102000004878 Gelsolin Human genes 0.000 description 1
- 108090001064 Gelsolin Proteins 0.000 description 1
- 102000012004 Ghrelin Human genes 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- 102100039992 Gliomedin Human genes 0.000 description 1
- 101710177565 Gliomedin Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 102400000321 Glucagon Human genes 0.000 description 1
- 108060003199 Glucagon Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 108010092364 Glucuronosyltransferase Proteins 0.000 description 1
- 102000016354 Glucuronosyltransferase Human genes 0.000 description 1
- 102000006587 Glutathione peroxidase Human genes 0.000 description 1
- 102100036753 Glutathione peroxidase 6 Human genes 0.000 description 1
- 101710119058 Glutathione peroxidase 6 Proteins 0.000 description 1
- 102100036755 Glutathione peroxidase 7 Human genes 0.000 description 1
- 101710119044 Glutathione peroxidase 7 Proteins 0.000 description 1
- 108700016172 Glutathione peroxidases Proteins 0.000 description 1
- 102100025376 Glycerol-3-phosphate acyltransferase 4 Human genes 0.000 description 1
- 101710199766 Glycerol-3-phosphate acyltransferase 4 Proteins 0.000 description 1
- 102000004240 Glycodelin Human genes 0.000 description 1
- 108010081520 Glycodelin Proteins 0.000 description 1
- 102100023849 Glycophorin-C Human genes 0.000 description 1
- 108050007238 Glypican-1 Proteins 0.000 description 1
- 108050009388 Glypican-2 Proteins 0.000 description 1
- 108050007237 Glypican-3 Proteins 0.000 description 1
- 108050009377 Glypican-5 Proteins 0.000 description 1
- 102000001989 Glypican-6 Human genes 0.000 description 1
- 108050009385 Glypican-6 Proteins 0.000 description 1
- 244000060234 Gmelina philippensis Species 0.000 description 1
- 108010054017 Granulocyte Colony-Stimulating Factor Receptors Proteins 0.000 description 1
- 102100039622 Granulocyte colony-stimulating factor receptor Human genes 0.000 description 1
- 108010092372 Granulocyte-Macrophage Colony-Stimulating Factor Receptors Proteins 0.000 description 1
- 102000016355 Granulocyte-Macrophage Colony-Stimulating Factor Receptors Human genes 0.000 description 1
- 102100038367 Gremlin-1 Human genes 0.000 description 1
- 101710169781 Gremlin-1 Proteins 0.000 description 1
- 102100038353 Gremlin-2 Human genes 0.000 description 1
- 101710169778 Gremlin-2 Proteins 0.000 description 1
- 102100037544 Group 10 secretory phospholipase A2 Human genes 0.000 description 1
- 101710126983 Group 10 secretory phospholipase A2 Proteins 0.000 description 1
- 102100020948 Growth hormone receptor Human genes 0.000 description 1
- 102100031547 HLA class II histocompatibility antigen, DO alpha chain Human genes 0.000 description 1
- 102000003693 Hedgehog Proteins Human genes 0.000 description 1
- 108090000031 Hedgehog Proteins Proteins 0.000 description 1
- 102100024025 Heparanase Human genes 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 101800001649 Heparin-binding EGF-like growth factor Proteins 0.000 description 1
- 101710124162 Hepatic triacylglycerol lipase Proteins 0.000 description 1
- 102100032813 Hepatocyte growth factor-like protein Human genes 0.000 description 1
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 description 1
- 102100027619 Histidine-rich glycoprotein Human genes 0.000 description 1
- 102100022374 Homeobox protein DLX-4 Human genes 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000801645 Homo sapiens ATP-binding cassette sub-family A member 2 Proteins 0.000 description 1
- 101000737803 Homo sapiens Cadherin-related family member 5 Proteins 0.000 description 1
- 101000851643 Homo sapiens Carboxylesterase 5A Proteins 0.000 description 1
- 101000727061 Homo sapiens Complement receptor type 1 Proteins 0.000 description 1
- 101000916687 Homo sapiens Cystatin-D Proteins 0.000 description 1
- 101000641077 Homo sapiens Diamine acetyltransferase 1 Proteins 0.000 description 1
- 101000841255 Homo sapiens Endothelin-converting enzyme 2 Proteins 0.000 description 1
- 101000946133 Homo sapiens Epididymal-specific lipocalin-10 Proteins 0.000 description 1
- 101000946137 Homo sapiens Epididymal-specific lipocalin-12 Proteins 0.000 description 1
- 101000605055 Homo sapiens Epididymal-specific lipocalin-8 Proteins 0.000 description 1
- 101000605060 Homo sapiens Epididymal-specific lipocalin-9 Proteins 0.000 description 1
- 101000608772 Homo sapiens Galectin-7 Proteins 0.000 description 1
- 101000905336 Homo sapiens Glycophorin-C Proteins 0.000 description 1
- 101000866278 Homo sapiens HLA class II histocompatibility antigen, DO alpha chain Proteins 0.000 description 1
- 101000901614 Homo sapiens Homeobox protein DLX-4 Proteins 0.000 description 1
- 101000988651 Homo sapiens Humanin-like 1 Proteins 0.000 description 1
- 101001076292 Homo sapiens Insulin-like growth factor II Proteins 0.000 description 1
- 101001043817 Homo sapiens Interleukin-31 receptor subunit alpha Proteins 0.000 description 1
- 101001011896 Homo sapiens Matrix metalloproteinase-19 Proteins 0.000 description 1
- 101000575376 Homo sapiens Microfibrillar-associated protein 1 Proteins 0.000 description 1
- 101000947695 Homo sapiens Microfibrillar-associated protein 5 Proteins 0.000 description 1
- 101001109579 Homo sapiens NPC intracellular cholesterol transporter 2 Proteins 0.000 description 1
- 101001123834 Homo sapiens Neprilysin Proteins 0.000 description 1
- 101000637326 Homo sapiens Neuroguidin Proteins 0.000 description 1
- 101000722006 Homo sapiens Olfactomedin-like protein 2B Proteins 0.000 description 1
- 101000609253 Homo sapiens Phytanoyl-CoA dioxygenase, peroxisomal Proteins 0.000 description 1
- 101000595920 Homo sapiens Plasminogen-like protein A Proteins 0.000 description 1
- 101000887203 Homo sapiens Probable cation-transporting ATPase 13A4 Proteins 0.000 description 1
- 101000917550 Homo sapiens Probable fibrosin-1 Proteins 0.000 description 1
- 101000702285 Homo sapiens Secreted phosphoprotein 24 Proteins 0.000 description 1
- 101000822461 Homo sapiens Secretoglobin family 2B member 2 Proteins 0.000 description 1
- 101001092910 Homo sapiens Serum amyloid P-component Proteins 0.000 description 1
- 101000713305 Homo sapiens Sodium-coupled neutral amino acid transporter 1 Proteins 0.000 description 1
- 101000798942 Homo sapiens Target of Myb protein 1 Proteins 0.000 description 1
- 101000837639 Homo sapiens Thyroxine-binding globulin Proteins 0.000 description 1
- 101000662690 Homo sapiens Trafficking protein particle complex subunit 10 Proteins 0.000 description 1
- 101000798700 Homo sapiens Transmembrane protease serine 3 Proteins 0.000 description 1
- 101000798696 Homo sapiens Transmembrane protease serine 6 Proteins 0.000 description 1
- 101000666896 Homo sapiens V-type immunoglobulin domain-containing suppressor of T-cell activation Proteins 0.000 description 1
- 102100031450 Humanin Human genes 0.000 description 1
- 102100039238 Hyaluronan-binding protein 2 Human genes 0.000 description 1
- 101710163637 Hyaluronan-binding protein 2 Proteins 0.000 description 1
- 102000015860 Hyaluronidase-3 Human genes 0.000 description 1
- 108050004076 Hyaluronidase-3 Proteins 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- 102000000521 Immunophilins Human genes 0.000 description 1
- 108010016648 Immunophilins Proteins 0.000 description 1
- 102100028867 Inactive C-alpha-formylglycine-generating enzyme 2 Human genes 0.000 description 1
- 101710118681 Inactive C-alpha-formylglycine-generating enzyme 2 Proteins 0.000 description 1
- 102100026556 Inactive caspase-12 Human genes 0.000 description 1
- 101710126091 Inactive caspase-12 Proteins 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 108010001127 Insulin Receptor Proteins 0.000 description 1
- 102100036721 Insulin receptor Human genes 0.000 description 1
- 102100037852 Insulin-like growth factor I Human genes 0.000 description 1
- 101710190529 Insulin-like peptide Proteins 0.000 description 1
- 102100023351 Integral membrane protein 2A Human genes 0.000 description 1
- 101710180843 Integral membrane protein 2A Proteins 0.000 description 1
- 102100023350 Integral membrane protein 2B Human genes 0.000 description 1
- 101710180845 Integral membrane protein 2B Proteins 0.000 description 1
- 102100023481 Integrin beta-like protein 1 Human genes 0.000 description 1
- 108050004182 Integrin beta-like protein 1 Proteins 0.000 description 1
- 102100039454 Inter-alpha-trypsin inhibitor heavy chain H5 Human genes 0.000 description 1
- 101710083921 Inter-alpha-trypsin inhibitor heavy chain H5 Proteins 0.000 description 1
- 102100022469 Interferon kappa Human genes 0.000 description 1
- 102000003996 Interferon-beta Human genes 0.000 description 1
- 108090000467 Interferon-beta Proteins 0.000 description 1
- 108010074328 Interferon-gamma Proteins 0.000 description 1
- 102000008070 Interferon-gamma Human genes 0.000 description 1
- 102100039880 Interleukin-1 receptor accessory protein Human genes 0.000 description 1
- 101710180389 Interleukin-1 receptor accessory protein Proteins 0.000 description 1
- 102000051628 Interleukin-1 receptor antagonist Human genes 0.000 description 1
- 101710144554 Interleukin-1 receptor antagonist protein Proteins 0.000 description 1
- 102000003816 Interleukin-13 Human genes 0.000 description 1
- 108090000176 Interleukin-13 Proteins 0.000 description 1
- 102000003812 Interleukin-15 Human genes 0.000 description 1
- 108090000172 Interleukin-15 Proteins 0.000 description 1
- 108010053727 Interleukin-15 Receptor alpha Subunit Proteins 0.000 description 1
- 102000004125 Interleukin-1alpha Human genes 0.000 description 1
- 108010082786 Interleukin-1alpha Proteins 0.000 description 1
- 102000007351 Interleukin-2 Receptor alpha Subunit Human genes 0.000 description 1
- 108010032774 Interleukin-2 Receptor alpha Subunit Proteins 0.000 description 1
- 102100030703 Interleukin-22 Human genes 0.000 description 1
- 102000011718 Interleukin-23 Subunit p19 Human genes 0.000 description 1
- 108010076561 Interleukin-23 Subunit p19 Proteins 0.000 description 1
- 102100021596 Interleukin-31 Human genes 0.000 description 1
- 101710181613 Interleukin-31 Proteins 0.000 description 1
- 102100021594 Interleukin-31 receptor subunit alpha Human genes 0.000 description 1
- 102100033501 Interleukin-32 Human genes 0.000 description 1
- 101710181615 Interleukin-32 Proteins 0.000 description 1
- 102000017761 Interleukin-33 Human genes 0.000 description 1
- 108010067003 Interleukin-33 Proteins 0.000 description 1
- 102000004388 Interleukin-4 Human genes 0.000 description 1
- 108090000978 Interleukin-4 Proteins 0.000 description 1
- 102000012347 Interleukin-4 Receptor alpha Subunit Human genes 0.000 description 1
- 108010061858 Interleukin-4 Receptor alpha Subunit Proteins 0.000 description 1
- 102000000743 Interleukin-5 Human genes 0.000 description 1
- 108010002616 Interleukin-5 Proteins 0.000 description 1
- 102000004889 Interleukin-6 Human genes 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- 108010026928 Interleukin-6 Receptor alpha Subunit Proteins 0.000 description 1
- 108010038501 Interleukin-6 Receptors Proteins 0.000 description 1
- 102100037792 Interleukin-6 receptor subunit alpha Human genes 0.000 description 1
- 102000004890 Interleukin-8 Human genes 0.000 description 1
- 108090001007 Interleukin-8 Proteins 0.000 description 1
- 102000000585 Interleukin-9 Human genes 0.000 description 1
- 108010002335 Interleukin-9 Proteins 0.000 description 1
- 102000015696 Interleukins Human genes 0.000 description 1
- 108010063738 Interleukins Proteins 0.000 description 1
- 102000000993 Interphotoreceptor matrix proteoglycan Human genes 0.000 description 1
- 108050007996 Interphotoreceptor matrix proteoglycan Proteins 0.000 description 1
- 108010041872 Islet Amyloid Polypeptide Proteins 0.000 description 1
- 102100027670 Islet amyloid polypeptide Human genes 0.000 description 1
- 102100037489 KAT8 regulatory NSL complex subunit 3 Human genes 0.000 description 1
- 102100027612 Kallikrein-11 Human genes 0.000 description 1
- 101710115807 Kallikrein-11 Proteins 0.000 description 1
- 102100038298 Kallikrein-14 Human genes 0.000 description 1
- 101710115806 Kallikrein-14 Proteins 0.000 description 1
- 102100038301 Kallikrein-15 Human genes 0.000 description 1
- 101710115873 Kallikrein-15 Proteins 0.000 description 1
- 102100034872 Kallikrein-4 Human genes 0.000 description 1
- 102100034866 Kallikrein-6 Human genes 0.000 description 1
- 101710176224 Kallikrein-6 Proteins 0.000 description 1
- 102100034870 Kallikrein-8 Human genes 0.000 description 1
- 101710176225 Kallikrein-8 Proteins 0.000 description 1
- 108010093811 Kazal Pancreatic Trypsin Inhibitor Proteins 0.000 description 1
- 102000001626 Kazal Pancreatic Trypsin Inhibitor Human genes 0.000 description 1
- 102100040542 Keratinocyte-associated protein 3 Human genes 0.000 description 1
- 101710127499 Keratinocyte-associated protein 3 Proteins 0.000 description 1
- 102100022808 Kielin/chordin-like protein Human genes 0.000 description 1
- 101710154339 Kielin/chordin-like protein Proteins 0.000 description 1
- 102000019293 Kinesin-like proteins Human genes 0.000 description 1
- 108050006659 Kinesin-like proteins Proteins 0.000 description 1
- 102100035792 Kininogen-1 Human genes 0.000 description 1
- 101710111227 Kininogen-1 Proteins 0.000 description 1
- 108010008292 L-Amino Acid Oxidase Proteins 0.000 description 1
- 102000007070 L-amino-acid oxidase Human genes 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- 108010001831 LDL receptors Proteins 0.000 description 1
- 102100025640 Lactase-like protein Human genes 0.000 description 1
- 101710188170 Lactase-like protein Proteins 0.000 description 1
- 102000010445 Lactoferrin Human genes 0.000 description 1
- 108010063045 Lactoferrin Proteins 0.000 description 1
- 102100038609 Lactoperoxidase Human genes 0.000 description 1
- 108010023244 Lactoperoxidase Proteins 0.000 description 1
- 102100030931 Ladinin-1 Human genes 0.000 description 1
- 101710177601 Ladinin-1 Proteins 0.000 description 1
- 102100024621 Layilin Human genes 0.000 description 1
- 101710147757 Layilin Proteins 0.000 description 1
- 101710198418 Lectin 10 Proteins 0.000 description 1
- 101710197066 Lectin 6 Proteins 0.000 description 1
- 101710197064 Lectin 9 Proteins 0.000 description 1
- 101710201625 Leucine-rich protein Proteins 0.000 description 1
- 102100020858 Leukocyte-associated immunoglobulin-like receptor 2 Human genes 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 101710084373 Lipase 1 Proteins 0.000 description 1
- 102100030659 Lipase member I Human genes 0.000 description 1
- 102000019298 Lipocalin Human genes 0.000 description 1
- 108050006654 Lipocalin Proteins 0.000 description 1
- 108010057281 Lipocalin 1 Proteins 0.000 description 1
- 102100034724 Lipocalin-1 Human genes 0.000 description 1
- 102100034721 Lipocalin-15 Human genes 0.000 description 1
- 101710155631 Lipocalin-15 Proteins 0.000 description 1
- 102000052508 Lipopolysaccharide-binding protein Human genes 0.000 description 1
- 108010053632 Lipopolysaccharide-binding protein Proteins 0.000 description 1
- 108010013563 Lipoprotein Lipase Proteins 0.000 description 1
- 101500021084 Locusta migratoria 5 kDa peptide Proteins 0.000 description 1
- 102100024640 Low-density lipoprotein receptor Human genes 0.000 description 1
- 102100033485 Lymphocyte antigen 86 Human genes 0.000 description 1
- 101710158190 Lymphocyte antigen 86 Proteins 0.000 description 1
- 102100026238 Lymphotoxin-alpha Human genes 0.000 description 1
- 108090000542 Lymphotoxin-alpha Proteins 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 108010085169 Lysine carboxypeptidase Proteins 0.000 description 1
- 108020002496 Lysophospholipase Proteins 0.000 description 1
- 102100033468 Lysozyme C Human genes 0.000 description 1
- 102000009073 Macrophage Migration-Inhibitory Factors Human genes 0.000 description 1
- 108010048043 Macrophage Migration-Inhibitory Factors Proteins 0.000 description 1
- 108010087870 Mannose-Binding Lectin Proteins 0.000 description 1
- 102100026553 Mannose-binding protein C Human genes 0.000 description 1
- 102100031826 Marginal zone B- and B1-cell-specific protein Human genes 0.000 description 1
- 101710169164 Marginal zone B- and B1-cell-specific protein Proteins 0.000 description 1
- 102000004318 Matrilysin Human genes 0.000 description 1
- 108090000855 Matrilysin Proteins 0.000 description 1
- 108010076497 Matrix Metalloproteinase 10 Proteins 0.000 description 1
- 108010076503 Matrix Metalloproteinase 13 Proteins 0.000 description 1
- 108010016160 Matrix Metalloproteinase 3 Proteins 0.000 description 1
- 108090000587 Matrix metalloproteinase-19 Proteins 0.000 description 1
- 102000014867 Matrix metalloproteinase-26 Human genes 0.000 description 1
- 108050005195 Matrix metalloproteinase-26 Proteins 0.000 description 1
- 102100026799 Matrix metalloproteinase-28 Human genes 0.000 description 1
- 101710082420 Matrix metalloproteinase-28 Proteins 0.000 description 1
- 108050006599 Metalloproteinase inhibitor 1 Proteins 0.000 description 1
- 229940123643 Metalloproteinase-3 inhibitor Drugs 0.000 description 1
- 102100025695 Meteorin Human genes 0.000 description 1
- 101710204352 Meteorin Proteins 0.000 description 1
- 102100039669 Meteorin-like protein Human genes 0.000 description 1
- 101710146512 Meteorin-like protein Proteins 0.000 description 1
- 108060004795 Methyltransferase Proteins 0.000 description 1
- 101710187427 Methyltransferase-like protein Proteins 0.000 description 1
- 102100036103 Microfibril-associated glycoprotein 4 Human genes 0.000 description 1
- 101710188645 Microfibril-associated glycoprotein 4 Proteins 0.000 description 1
- 102100025602 Microfibrillar-associated protein 1 Human genes 0.000 description 1
- 102100036203 Microfibrillar-associated protein 5 Human genes 0.000 description 1
- 102000014171 Milk Proteins Human genes 0.000 description 1
- 108010011756 Milk Proteins Proteins 0.000 description 1
- 102100031307 Mitochondrial uncoupling protein 4 Human genes 0.000 description 1
- 101710112409 Mitochondrial uncoupling protein 4 Proteins 0.000 description 1
- 108010074633 Mixed Function Oxygenases Proteins 0.000 description 1
- 102000008109 Mixed Function Oxygenases Human genes 0.000 description 1
- 108010006519 Molecular Chaperones Proteins 0.000 description 1
- 102100034256 Mucin-1 Human genes 0.000 description 1
- 108010008707 Mucin-1 Proteins 0.000 description 1
- 102100023125 Mucin-17 Human genes 0.000 description 1
- 101710155095 Mucin-17 Proteins 0.000 description 1
- 102100034257 Mucin-19 Human genes 0.000 description 1
- 101710155103 Mucin-19 Proteins 0.000 description 1
- 102100034263 Mucin-2 Human genes 0.000 description 1
- 108010008705 Mucin-2 Proteins 0.000 description 1
- 102100022693 Mucin-4 Human genes 0.000 description 1
- 108010008699 Mucin-4 Proteins 0.000 description 1
- 102100022493 Mucin-6 Human genes 0.000 description 1
- 108010008692 Mucin-6 Proteins 0.000 description 1
- 102100022492 Mucin-7 Human genes 0.000 description 1
- 101710134550 Mucin-7 Proteins 0.000 description 1
- 102100038565 Mucin-like protein 1 Human genes 0.000 description 1
- 101710133580 Mucin-like protein 1 Proteins 0.000 description 1
- 108010014251 Muramidase Proteins 0.000 description 1
- 102100021272 Myelin protein zero-like protein 2 Human genes 0.000 description 1
- 108050003858 Myelin protein zero-like protein 2 Proteins 0.000 description 1
- 102100035050 Myeloid-associated differentiation marker Human genes 0.000 description 1
- 101710154183 Myeloid-associated differentiation marker Proteins 0.000 description 1
- 108010062010 N-Acetylmuramoyl-L-alanine Amidase Proteins 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 102100022737 NPC intracellular cholesterol transporter 2 Human genes 0.000 description 1
- 108020001621 Natriuretic Peptide Proteins 0.000 description 1
- 102000004571 Natriuretic peptide Human genes 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 102100034595 Nephronectin Human genes 0.000 description 1
- 102100028782 Neprilysin Human genes 0.000 description 1
- 108010030865 Netrin Receptors Proteins 0.000 description 1
- 102000005951 Netrin Receptors Human genes 0.000 description 1
- 102100034388 Netrin-4 Human genes 0.000 description 1
- 101710121532 Netrin-4 Proteins 0.000 description 1
- 102100034387 Netrin-5 Human genes 0.000 description 1
- 101710121535 Netrin-5 Proteins 0.000 description 1
- 102100032139 Neuroguidin Human genes 0.000 description 1
- 102100038842 Neuropeptide B Human genes 0.000 description 1
- 102100028762 Neuropilin-1 Human genes 0.000 description 1
- 108090000772 Neuropilin-1 Proteins 0.000 description 1
- 102100035107 Neurotrimin Human genes 0.000 description 1
- 102000056189 Neutrophil collagenases Human genes 0.000 description 1
- 108030001564 Neutrophil collagenases Proteins 0.000 description 1
- 102100037371 Nidogen-2 Human genes 0.000 description 1
- 101710091705 Nidogen-2 Proteins 0.000 description 1
- 102100023729 Noelin-2 Human genes 0.000 description 1
- 101710116980 Noelin-2 Proteins 0.000 description 1
- 102100037046 Noelin-3 Human genes 0.000 description 1
- 101710116982 Noelin-3 Proteins 0.000 description 1
- 108010041199 Nogo Receptor 1 Proteins 0.000 description 1
- 102100025036 Norrin Human genes 0.000 description 1
- 101710085992 Norrin Proteins 0.000 description 1
- 102100027196 Odorant-binding protein 2a Human genes 0.000 description 1
- 101710157516 Odorant-binding protein 2a Proteins 0.000 description 1
- 102100027202 Odorant-binding protein 2b Human genes 0.000 description 1
- 101710157517 Odorant-binding protein 2b Proteins 0.000 description 1
- 102100025404 Olfactomedin-like protein 2A Human genes 0.000 description 1
- 101710146812 Olfactomedin-like protein 2A Proteins 0.000 description 1
- 102100025388 Olfactomedin-like protein 2B Human genes 0.000 description 1
- 102100032750 Olfactomedin-like protein 3 Human genes 0.000 description 1
- 101710178153 Olfactomedin-like protein 3 Proteins 0.000 description 1
- 102000012547 Olfactory receptors Human genes 0.000 description 1
- 108050002069 Olfactory receptors Proteins 0.000 description 1
- 102100032748 Oncoprotein-induced transcript 3 protein Human genes 0.000 description 1
- 101710127259 Oncoprotein-induced transcript 3 protein Proteins 0.000 description 1
- 102400000925 Opiorphin Human genes 0.000 description 1
- TWWFCOBVAKAKIT-SXYSDOLCSA-N Opiorphin Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)N)CC1=CC=CC=C1 TWWFCOBVAKAKIT-SXYSDOLCSA-N 0.000 description 1
- 102100040123 Opiorphin prepropeptide Human genes 0.000 description 1
- 102100026747 Osteomodulin Human genes 0.000 description 1
- 102000009890 Osteonectin Human genes 0.000 description 1
- 108010077077 Osteonectin Proteins 0.000 description 1
- 102000004264 Osteopontin Human genes 0.000 description 1
- 108010081689 Osteopontin Proteins 0.000 description 1
- 102100034205 Otogelin Human genes 0.000 description 1
- 101710157978 Otogelin Proteins 0.000 description 1
- 102100034208 Otolin-1 Human genes 0.000 description 1
- 101710153883 Otoraplin Proteins 0.000 description 1
- 102100026304 Otoraplin Human genes 0.000 description 1
- 102100026303 Otospiralin Human genes 0.000 description 1
- 101710161544 Otospiralin Proteins 0.000 description 1
- 240000007930 Oxalis acetosella Species 0.000 description 1
- 235000008098 Oxalis acetosella Nutrition 0.000 description 1
- 108020002230 Pancreatic Ribonuclease Proteins 0.000 description 1
- 102000005891 Pancreatic ribonuclease Human genes 0.000 description 1
- 102100033359 Pancreatic triacylglycerol lipase Human genes 0.000 description 1
- 101710162333 Pancreatic triacylglycerol lipase Proteins 0.000 description 1
- 208000027898 Parkinson disease 7 Diseases 0.000 description 1
- 102100035845 Peflin Human genes 0.000 description 1
- 101710131325 Peflin Proteins 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 102100039652 Pepsin A-5 Human genes 0.000 description 1
- 102000005877 Peptide Initiation Factors Human genes 0.000 description 1
- 108010044843 Peptide Initiation Factors Proteins 0.000 description 1
- 102000052544 Peptidoglycan recognition protein Human genes 0.000 description 1
- 108010009051 Peptidoglycan recognition protein Proteins 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- 102100040283 Peptidyl-prolyl cis-trans isomerase B Human genes 0.000 description 1
- 102100037765 Periostin Human genes 0.000 description 1
- 101710199268 Periostin Proteins 0.000 description 1
- 102100035917 Peripheral myelin protein 22 Human genes 0.000 description 1
- 101710199257 Peripheral myelin protein 22 Proteins 0.000 description 1
- 102100037209 Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Human genes 0.000 description 1
- 101710164696 Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Proteins 0.000 description 1
- 102100024617 Phosphatidylethanolamine-binding protein 4 Human genes 0.000 description 1
- 101710204066 Phosphatidylethanolamine-binding protein 4 Proteins 0.000 description 1
- 102100040865 Phospholipase A2 group XV Human genes 0.000 description 1
- 101710127148 Phospholipase A2 group XV Proteins 0.000 description 1
- 108010058864 Phospholipases A2 Proteins 0.000 description 1
- 102000007982 Phosphoproteins Human genes 0.000 description 1
- 108010089430 Phosphoproteins Proteins 0.000 description 1
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- 102100039421 Phytanoyl-CoA dioxygenase, peroxisomal Human genes 0.000 description 1
- 102100033226 Pikachurin Human genes 0.000 description 1
- 101710178799 Pikachurin Proteins 0.000 description 1
- 102000002808 Pituitary adenylate cyclase-activating polypeptide Human genes 0.000 description 1
- 108010004684 Pituitary adenylate cyclase-activating polypeptide Proteins 0.000 description 1
- 102000014721 Placenta-specific protein 1 Human genes 0.000 description 1
- 108050005093 Placenta-specific protein 1 Proteins 0.000 description 1
- 102100026183 Placenta-specific protein 9 Human genes 0.000 description 1
- 101710090431 Placenta-specific protein 9 Proteins 0.000 description 1
- 102000004576 Placental Lactogen Human genes 0.000 description 1
- 108010003044 Placental Lactogen Proteins 0.000 description 1
- 239000000381 Placental Lactogen Substances 0.000 description 1
- 101710158668 Placental protein Proteins 0.000 description 1
- 108010064851 Plant Proteins Proteins 0.000 description 1
- 108050007539 Plasma protease C1 inhibitor Proteins 0.000 description 1
- 108010022233 Plasminogen Activator Inhibitor 1 Proteins 0.000 description 1
- 108090000614 Plasminogen Activator Inhibitor 2 Proteins 0.000 description 1
- 102000001938 Plasminogen Activators Human genes 0.000 description 1
- 108010001014 Plasminogen Activators Proteins 0.000 description 1
- 102100039418 Plasminogen activator inhibitor 1 Human genes 0.000 description 1
- 102100039419 Plasminogen activator inhibitor 2 Human genes 0.000 description 1
- 102100035201 Plasminogen-like protein A Human genes 0.000 description 1
- 102000004211 Platelet factor 4 Human genes 0.000 description 1
- 108090000778 Platelet factor 4 Proteins 0.000 description 1
- 108010068588 Platelet-Derived Growth Factor alpha Receptor Proteins 0.000 description 1
- 102000018967 Platelet-Derived Growth Factor beta Receptor Human genes 0.000 description 1
- 108010051742 Platelet-Derived Growth Factor beta Receptor Proteins 0.000 description 1
- 102100026554 Platelet-derived growth factor receptor-like protein Human genes 0.000 description 1
- 101710165908 Platelet-derived growth factor receptor-like protein Proteins 0.000 description 1
- 102100034381 Plexin-A2 Human genes 0.000 description 1
- 101710100258 Plexin-A2 Proteins 0.000 description 1
- 102100034385 Plexin-A4 Human genes 0.000 description 1
- 101710100264 Plexin-A4 Proteins 0.000 description 1
- 102100034384 Plexin-B1 Human genes 0.000 description 1
- 101710100559 Plexin-B1 Proteins 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 108010076039 Polyproteins Proteins 0.000 description 1
- 102000004257 Potassium Channel Human genes 0.000 description 1
- 108010071690 Prealbumin Proteins 0.000 description 1
- 102000008217 Pregnancy Proteins Human genes 0.000 description 1
- 102000004488 Prenylcysteine oxidase Human genes 0.000 description 1
- 102100041004 Prenylcysteine oxidase 1 Human genes 0.000 description 1
- 101710087494 Prenylcysteine oxidase 1 Proteins 0.000 description 1
- 108091000054 Prion Proteins 0.000 description 1
- 102100022661 Pro-neuregulin-1, membrane-bound isoform Human genes 0.000 description 1
- 101710197695 Pro-neuregulin-1, membrane-bound isoform Proteins 0.000 description 1
- 102100022668 Pro-neuregulin-2, membrane-bound isoform Human genes 0.000 description 1
- 101710114478 Pro-neuregulin-2, membrane-bound isoform Proteins 0.000 description 1
- 102100022658 Pro-neuregulin-4, membrane-bound isoform Human genes 0.000 description 1
- 101710150580 Pro-neuregulin-4, membrane-bound isoform Proteins 0.000 description 1
- 102100039915 Probable cation-transporting ATPase 13A4 Human genes 0.000 description 1
- 102100029532 Probable fibrosin-1 Human genes 0.000 description 1
- 101710181699 Proepiregulin Proteins 0.000 description 1
- 102100040126 Prokineticin-1 Human genes 0.000 description 1
- 102100040125 Prokineticin-2 Human genes 0.000 description 1
- 101710103829 Prokineticin-2 Proteins 0.000 description 1
- 108010002519 Prolactin Receptors Proteins 0.000 description 1
- 102100029000 Prolactin receptor Human genes 0.000 description 1
- 102100030350 Prolactin-inducible protein Human genes 0.000 description 1
- 101710187242 Prolactin-inducible protein homolog Proteins 0.000 description 1
- 102100037034 Proline-rich acidic protein 1 Human genes 0.000 description 1
- 101710115103 Proline-rich acidic protein 1 Proteins 0.000 description 1
- 101710124302 Proline-rich protein 1 Proteins 0.000 description 1
- 102100023398 Promotilin Human genes 0.000 description 1
- 101710125844 Promotilin Proteins 0.000 description 1
- 102100024615 Prosalusin Human genes 0.000 description 1
- 101710202133 Prosalusin Proteins 0.000 description 1
- 101710120463 Prostate stem cell antigen Proteins 0.000 description 1
- 102100036735 Prostate stem cell antigen Human genes 0.000 description 1
- 108010072866 Prostate-Specific Antigen Proteins 0.000 description 1
- 102100038358 Prostate-specific antigen Human genes 0.000 description 1
- 101710132457 Protein A1 Proteins 0.000 description 1
- 101710132455 Protein A2 Proteins 0.000 description 1
- 101710132617 Protein B1 Proteins 0.000 description 1
- 102000006010 Protein Disulfide-Isomerase Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010076504 Protein Sorting Signals Proteins 0.000 description 1
- 101800000442 Protein X2 Proteins 0.000 description 1
- 101710111106 Protein twisted gastrulation Proteins 0.000 description 1
- 102100028964 Proteoglycan 3 Human genes 0.000 description 1
- 101710127914 Proteoglycan 3 Proteins 0.000 description 1
- 102100028965 Proteoglycan 4 Human genes 0.000 description 1
- 101710127913 Proteoglycan 4 Proteins 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 102100024258 Protocadherin alpha-1 Human genes 0.000 description 1
- 101710167976 Protocadherin alpha-1 Proteins 0.000 description 1
- 102100024278 Protocadherin alpha-6 Human genes 0.000 description 1
- 101710167975 Protocadherin alpha-6 Proteins 0.000 description 1
- 102100040143 Protocadherin beta-13 Human genes 0.000 description 1
- 101710159434 Protocadherin beta-13 Proteins 0.000 description 1
- 102100029264 Protocadherin gamma-A12 Human genes 0.000 description 1
- 101710142883 Protocadherin gamma-A12 Proteins 0.000 description 1
- 102100036382 Protocadherin-15 Human genes 0.000 description 1
- 101710157841 Protocadherin-15 Proteins 0.000 description 1
- 102100026322 Proton channel OTOP1 Human genes 0.000 description 1
- 101710157886 Proton channel OTOP1 Proteins 0.000 description 1
- 102100033543 Proton-transporting V-type ATPase complex assembly regulator TMEM9 Human genes 0.000 description 1
- 101710183261 Proton-transporting V-type ATPase complex assembly regulator TMEM9 Proteins 0.000 description 1
- 101100244562 Pseudomonas aeruginosa (strain ATCC 15692 / DSM 22644 / CIP 104116 / JCM 14847 / LMG 12228 / 1C / PRS 101 / PAO1) oprD gene Proteins 0.000 description 1
- 102100034739 Putative lipocalin 1-like protein 1 Human genes 0.000 description 1
- 101710183855 Putative lipocalin 1-like protein 1 Proteins 0.000 description 1
- 102100029923 Putative stereocilin-like protein Human genes 0.000 description 1
- 101710097347 Putative stereocilin-like protein Proteins 0.000 description 1
- 102000015097 RNA Splicing Factors Human genes 0.000 description 1
- 108010039259 RNA Splicing Factors Proteins 0.000 description 1
- 108090000783 Renin Proteins 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 102100025343 Reticulocalbin-3 Human genes 0.000 description 1
- 101710164376 Reticulocalbin-3 Proteins 0.000 description 1
- 102100029826 Reticulon-4 receptor Human genes 0.000 description 1
- 102000012464 Retinol dehydrogenase 10 Human genes 0.000 description 1
- 108050002017 Retinol dehydrogenase 10 Proteins 0.000 description 1
- 102100038058 Retinol dehydrogenase 13 Human genes 0.000 description 1
- 101710178614 Retinol dehydrogenase 13 Proteins 0.000 description 1
- 102100039507 Retinoschisin Human genes 0.000 description 1
- 101710111169 Retinoschisin Proteins 0.000 description 1
- 102100026411 Ribonuclease 4 Human genes 0.000 description 1
- 102100040312 Ribonuclease 7 Human genes 0.000 description 1
- 108010085025 Ribonuclease 7 Proteins 0.000 description 1
- 102100040329 Ribonuclease 8 Human genes 0.000 description 1
- 101710192190 Ribonuclease 8 Proteins 0.000 description 1
- 102000006382 Ribonucleases Human genes 0.000 description 1
- 108010083644 Ribonucleases Proteins 0.000 description 1
- 101710170630 Ribonucleoside-diphosphate reductase 1 subunit alpha Proteins 0.000 description 1
- 108010005173 SERPIN-B5 Proteins 0.000 description 1
- 101150077717 SMIM43 gene Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 102100034201 Sclerostin Human genes 0.000 description 1
- 108050006698 Sclerostin Proteins 0.000 description 1
- 102000007969 Secretagogins Human genes 0.000 description 1
- 108010089384 Secretagogins Proteins 0.000 description 1
- 102100021853 Secreted and transmembrane protein 1 Human genes 0.000 description 1
- 101710126682 Secreted and transmembrane protein 1 Proteins 0.000 description 1
- 102100030277 Secreted phosphoprotein 24 Human genes 0.000 description 1
- 102100022486 Secretoglobin family 2B member 2 Human genes 0.000 description 1
- 102100020867 Secretogranin-1 Human genes 0.000 description 1
- 101710192385 Secretogranin-1 Proteins 0.000 description 1
- 102100035897 Secretogranin-3 Human genes 0.000 description 1
- 102100037550 Semenogelin-1 Human genes 0.000 description 1
- 101710089345 Semenogelin-1 Proteins 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 101710151381 Serine protease 2 Proteins 0.000 description 1
- 102100033835 Serine protease 23 Human genes 0.000 description 1
- 101710197466 Serine protease 23 Proteins 0.000 description 1
- 102100040107 Serine protease 27 Human genes 0.000 description 1
- 101710197422 Serine protease 27 Proteins 0.000 description 1
- 101710197425 Serine protease 29 Proteins 0.000 description 1
- 102100022638 Serine protease 48 Human genes 0.000 description 1
- 101710197541 Serine protease 48 Proteins 0.000 description 1
- 101710107116 Serine protease inhibitor 2 Proteins 0.000 description 1
- 101710107114 Serine protease inhibitor 4 Proteins 0.000 description 1
- 101710106352 Serine protease inhibitor 5 Proteins 0.000 description 1
- 101710106359 Serine protease inhibitor 8 Proteins 0.000 description 1
- 102100028030 Serine/threonine-protein kinase 32B Human genes 0.000 description 1
- 101710107343 Serine/threonine-protein kinase 32B Proteins 0.000 description 1
- 102000008847 Serpin Human genes 0.000 description 1
- 108050000761 Serpin Proteins 0.000 description 1
- 102100030326 Serpin B4 Human genes 0.000 description 1
- 101710156164 Serpin B4 Proteins 0.000 description 1
- 102100030333 Serpin B5 Human genes 0.000 description 1
- 102000007562 Serum Albumin Human genes 0.000 description 1
- 108010071390 Serum Albumin Proteins 0.000 description 1
- 102100036202 Serum amyloid P-component Human genes 0.000 description 1
- 102100035476 Serum paraoxonase/arylesterase 1 Human genes 0.000 description 1
- 101710180981 Serum paraoxonase/arylesterase 1 Proteins 0.000 description 1
- 102100022833 Serum paraoxonase/lactonase 3 Human genes 0.000 description 1
- 101710112260 Serum paraoxonase/lactonase 3 Proteins 0.000 description 1
- 108010089417 Sex Hormone-Binding Globulin Proteins 0.000 description 1
- 102100030758 Sex hormone-binding globulin Human genes 0.000 description 1
- 102100037857 Short-chain dehydrogenase/reductase 3 Human genes 0.000 description 1
- 108050002053 Short-chain dehydrogenase/reductase 3 Proteins 0.000 description 1
- 102100022850 Small integral membrane protein 43 Human genes 0.000 description 1
- 102100024397 Soluble calcium-activated nucleotidase 1 Human genes 0.000 description 1
- 101710143787 Soluble calcium-activated nucleotidase 1 Proteins 0.000 description 1
- 102100023047 Solute carrier family 27 member 3 Human genes 0.000 description 1
- 101710193668 Solute carrier family 27 member 3 Proteins 0.000 description 1
- 108010068542 Somatotropin Receptors Proteins 0.000 description 1
- 102100032800 Spermine oxidase Human genes 0.000 description 1
- 102100036427 Spondin-2 Human genes 0.000 description 1
- 101710092169 Spondin-2 Proteins 0.000 description 1
- 102100024471 Stabilin-1 Human genes 0.000 description 1
- 101710164042 Stabilin-1 Proteins 0.000 description 1
- 102100030510 Stanniocalcin-2 Human genes 0.000 description 1
- 101710142154 Stanniocalcin-2 Proteins 0.000 description 1
- 102000014284 Statherin Human genes 0.000 description 1
- 108050003162 Statherin Proteins 0.000 description 1
- 102100037172 Store-operated calcium entry-associated regulatory factor Human genes 0.000 description 1
- 101710181351 Store-operated calcium entry-associated regulatory factor Proteins 0.000 description 1
- 102100030416 Stromelysin-1 Human genes 0.000 description 1
- 102100028848 Stromelysin-2 Human genes 0.000 description 1
- 102100034371 Sulfhydryl oxidase 1 Human genes 0.000 description 1
- 101710159725 Sulfhydryl oxidase 1 Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 102000019197 Superoxide Dismutase Human genes 0.000 description 1
- 108010012715 Superoxide dismutase Proteins 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- 102100038649 Synaptogyrin-2 Human genes 0.000 description 1
- 101710152289 Synaptogyrin-2 Proteins 0.000 description 1
- 102000013265 Syntaxin 1 Human genes 0.000 description 1
- 108010090618 Syntaxin 1 Proteins 0.000 description 1
- 230000006044 T cell activation Effects 0.000 description 1
- 102100024577 TOMM20-like protein 1 Human genes 0.000 description 1
- 101710169658 TOMM20-like protein 1 Proteins 0.000 description 1
- 102100034024 Target of Myb protein 1 Human genes 0.000 description 1
- 102100030746 Tectonic-1 Human genes 0.000 description 1
- 101710178359 Tectonic-1 Proteins 0.000 description 1
- 102100030785 Tectonic-3 Human genes 0.000 description 1
- 101710178361 Tectonic-3 Proteins 0.000 description 1
- 102100038126 Tenascin Human genes 0.000 description 1
- 108010008125 Tenascin Proteins 0.000 description 1
- 102100033390 Testican-1 Human genes 0.000 description 1
- 101710144222 Testican-1 Proteins 0.000 description 1
- 102100033371 Testican-2 Human genes 0.000 description 1
- 101710144232 Testican-2 Proteins 0.000 description 1
- 102100024554 Tetranectin Human genes 0.000 description 1
- 102100024991 Tetraspanin-12 Human genes 0.000 description 1
- 101710133600 Tetraspanin-12 Proteins 0.000 description 1
- 102100024996 Tetraspanin-13 Human genes 0.000 description 1
- 101710133618 Tetraspanin-13 Proteins 0.000 description 1
- 102100030163 Tetraspanin-15 Human genes 0.000 description 1
- 101710133616 Tetraspanin-15 Proteins 0.000 description 1
- 102100030175 Tetraspanin-18 Human genes 0.000 description 1
- 101710133613 Tetraspanin-18 Proteins 0.000 description 1
- 102100022169 Thioredoxin-related transmembrane protein 1 Human genes 0.000 description 1
- 101710203066 Thioredoxin-related transmembrane protein 1 Proteins 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 102000009843 Thyroglobulin Human genes 0.000 description 1
- 108010034949 Thyroglobulin Proteins 0.000 description 1
- 102100028709 Thyroxine-binding globulin Human genes 0.000 description 1
- 102100030951 Tissue factor pathway inhibitor Human genes 0.000 description 1
- 102000019400 Tissue-type plasminogen activator Human genes 0.000 description 1
- 102100031996 Tolloid-like protein 1 Human genes 0.000 description 1
- 101710118137 Tolloid-like protein 1 Proteins 0.000 description 1
- 102100031997 Tolloid-like protein 2 Human genes 0.000 description 1
- 101710118138 Tolloid-like protein 2 Proteins 0.000 description 1
- 102100026160 Tomoregulin-2 Human genes 0.000 description 1
- 101710175558 Tomoregulin-2 Proteins 0.000 description 1
- 101710124482 Torsin-2A Proteins 0.000 description 1
- 102100037456 Trafficking protein particle complex subunit 10 Human genes 0.000 description 1
- 102100040396 Transcobalamin-1 Human genes 0.000 description 1
- 101710124861 Transcobalamin-1 Proteins 0.000 description 1
- 102000014034 Transcortin Human genes 0.000 description 1
- 108010011095 Transcortin Proteins 0.000 description 1
- 102100033663 Transforming growth factor beta receptor type 3 Human genes 0.000 description 1
- 101710132313 Transforming growth factor beta receptor type 3 Proteins 0.000 description 1
- 102100023935 Transmembrane glycoprotein NMB Human genes 0.000 description 1
- 102100032452 Transmembrane protease serine 6 Human genes 0.000 description 1
- 102100035317 Transmembrane protein 17 Human genes 0.000 description 1
- 101710103132 Transmembrane protein 17 Proteins 0.000 description 1
- 102100024323 Transmembrane protein 182 Human genes 0.000 description 1
- 101710191745 Transmembrane protein 182 Proteins 0.000 description 1
- 102100027027 Transmembrane protein 204 Human genes 0.000 description 1
- 101710170756 Transmembrane protein 204 Proteins 0.000 description 1
- 102100027022 Transmembrane protein 205 Human genes 0.000 description 1
- 101710170752 Transmembrane protein 205 Proteins 0.000 description 1
- 102100033530 Transmembrane protein 43 Human genes 0.000 description 1
- 101710106890 Transmembrane protein 43 Proteins 0.000 description 1
- 102100022246 Transmembrane protein 52 Human genes 0.000 description 1
- 101710106913 Transmembrane protein 52 Proteins 0.000 description 1
- 102100029290 Transthyretin Human genes 0.000 description 1
- 101710119665 Trypsin-1 Proteins 0.000 description 1
- 101710119666 Trypsin-2 Proteins 0.000 description 1
- 101710119641 Trypsin-6 Proteins 0.000 description 1
- 102100029637 Tryptase beta-2 Human genes 0.000 description 1
- 101710134953 Tryptase beta-2 Proteins 0.000 description 1
- 102100032760 Tryptase delta Human genes 0.000 description 1
- 101710136849 Tryptase delta Proteins 0.000 description 1
- 101710185398 Tubulointerstitial nephritis antigen Proteins 0.000 description 1
- 102100033470 Tubulointerstitial nephritis antigen Human genes 0.000 description 1
- 108700006143 UDP acetylglucosamine-2-epimerase Proteins 0.000 description 1
- 108010083111 Ubiquitin-Protein Ligases Proteins 0.000 description 1
- 102100020696 Ubiquitin-conjugating enzyme E2 K Human genes 0.000 description 1
- 102000021911 Ubiquitin-like domains Human genes 0.000 description 1
- 108091012462 Ubiquitin-like domains Proteins 0.000 description 1
- 102100027266 Ubiquitin-like protein ISG15 Human genes 0.000 description 1
- 101710087750 Ubiquitin-like protein ISG15 Proteins 0.000 description 1
- 102000005630 Urocortins Human genes 0.000 description 1
- 108010059705 Urocortins Proteins 0.000 description 1
- 102100040613 Uromodulin Human genes 0.000 description 1
- 108010027007 Uromodulin Proteins 0.000 description 1
- 102100029097 Urotensin-2 Human genes 0.000 description 1
- 101710095163 Urotensin-2 Proteins 0.000 description 1
- 102100037930 Usherin Human genes 0.000 description 1
- 101710138401 Usherin Proteins 0.000 description 1
- 102100038282 V-type immunoglobulin domain-containing suppressor of T-cell activation Human genes 0.000 description 1
- 108010073925 Vascular Endothelial Growth Factor B Proteins 0.000 description 1
- 108010073923 Vascular Endothelial Growth Factor C Proteins 0.000 description 1
- 108010053096 Vascular Endothelial Growth Factor Receptor-1 Proteins 0.000 description 1
- 102100038217 Vascular endothelial growth factor B Human genes 0.000 description 1
- 102100038232 Vascular endothelial growth factor C Human genes 0.000 description 1
- 102100033178 Vascular endothelial growth factor receptor 1 Human genes 0.000 description 1
- 108010004977 Vasopressins Proteins 0.000 description 1
- 102000002852 Vasopressins Human genes 0.000 description 1
- 229930003270 Vitamin B Natural products 0.000 description 1
- 102100038983 Xylosyltransferase 1 Human genes 0.000 description 1
- 108050007995 Xylosyltransferase 1 Proteins 0.000 description 1
- 229940022698 acetylcholinesterase Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- LNQVTSROQXJCDD-UHFFFAOYSA-N adenosine monophosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(CO)C(OP(O)(O)=O)C1O LNQVTSROQXJCDD-UHFFFAOYSA-N 0.000 description 1
- 210000001789 adipocyte Anatomy 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- MOVRNJGDXREIBM-UHFFFAOYSA-N aid-1 Chemical compound O=C1NC(=O)C(C)=CN1C1OC(COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)CO)C(O)C1 MOVRNJGDXREIBM-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000019169 all-trans-retinol Nutrition 0.000 description 1
- 239000011717 all-trans-retinol Substances 0.000 description 1
- 108010042381 alpha 1,3-mannosyltransferase Proteins 0.000 description 1
- 108010091628 alpha 1-Antichymotrypsin Proteins 0.000 description 1
- 102000015395 alpha 1-Antitrypsin Human genes 0.000 description 1
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 description 1
- 229940024142 alpha 1-antitrypsin Drugs 0.000 description 1
- 108010026331 alpha-Fetoproteins Proteins 0.000 description 1
- 102000013529 alpha-Fetoproteins Human genes 0.000 description 1
- 210000001053 ameloblast Anatomy 0.000 description 1
- 230000002862 amidating effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 108090000449 aminopeptidase B Proteins 0.000 description 1
- 239000002870 angiogenesis inducing agent Substances 0.000 description 1
- 108010069801 angiopoietin 4 Proteins 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003272 asparaginase Drugs 0.000 description 1
- 210000001130 astrocyte Anatomy 0.000 description 1
- 230000004900 autophagic degradation Effects 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 108010066058 beta Subunit Luteinizing Hormone Proteins 0.000 description 1
- 108010068678 beta Subunit Thyrotropin Proteins 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- HXNZTJULPKRNPR-UHFFFAOYSA-N borinine Chemical compound B1=CC=CC=C1 HXNZTJULPKRNPR-UHFFFAOYSA-N 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 108010019521 carbonic anhydrase VI Proteins 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- ZGOVYTPSWMLYOF-QEADGSHQSA-N chembl1790180 Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(O)=O)NC(=O)[C@H]1NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CSSC[C@@H](C(N[C@H](CC=3C=CC=CC=3)C(=O)N[C@H](C(=O)N[C@H](CCC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N2)[C@H](C)O)=O)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](N)CSSC1)C1=CNC=N1 ZGOVYTPSWMLYOF-QEADGSHQSA-N 0.000 description 1
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940107137 cholecystokinin Drugs 0.000 description 1
- 150000001840 cholesterol esters Chemical class 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- DLGJWSVWTWEWBJ-HGGSSLSASA-N chondroitin Chemical compound CC(O)=N[C@@H]1[C@H](O)O[C@H](CO)[C@H](O)[C@@H]1OC1[C@H](O)[C@H](O)C=C(C(O)=O)O1 DLGJWSVWTWEWBJ-HGGSSLSASA-N 0.000 description 1
- 108010033338 chondroitin sulfate glucuronyltransferase Proteins 0.000 description 1
- 102000006533 chordin Human genes 0.000 description 1
- 108010008846 chordin Proteins 0.000 description 1
- 229940121538 choriogonadotropin beta Drugs 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 229940105774 coagulation factor ix Drugs 0.000 description 1
- 229940105772 coagulation factor vii Drugs 0.000 description 1
- ACTIUHUUMQJHFO-UPTCCGCDSA-N coenzyme Q10 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UPTCCGCDSA-N 0.000 description 1
- 235000017471 coenzyme Q10 Nutrition 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 229940047120 colony stimulating factors Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 108010047295 complement receptors Proteins 0.000 description 1
- 102000006834 complement receptors Human genes 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- KLVRDXBAMSPYKH-RKYZNNDCSA-N corticotropin-releasing hormone (human) Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(N)=O)[C@@H](C)CC)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H]1N(CCC1)C(=O)[C@H]1N(CCC1)C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](N)CO)[C@@H](C)CC)C(C)C)C(C)C)C1=CNC=N1 KLVRDXBAMSPYKH-RKYZNNDCSA-N 0.000 description 1
- 108050004038 cystatin Proteins 0.000 description 1
- 108010026647 cytochrome P-450 4X1 Proteins 0.000 description 1
- 102000003675 cytokine receptors Human genes 0.000 description 1
- 108010057085 cytokine receptors Proteins 0.000 description 1
- UQHKFADEQIVWID-UHFFFAOYSA-N cytokinin Natural products C1=NC=2C(NCC=C(CO)C)=NC=NC=2N1C1CC(O)C(CO)O1 UQHKFADEQIVWID-UHFFFAOYSA-N 0.000 description 1
- 239000004062 cytokinin Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 108700023159 delta Opioid Receptors Proteins 0.000 description 1
- 102000048124 delta Opioid Receptors Human genes 0.000 description 1
- 108010031616 deoxyribonuclease gamma Proteins 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000002009 diols Chemical group 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- MDCUNMLZLNGCQA-HWOAGHQOSA-N elafin Chemical compound N([C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H]1C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H]2CSSC[C@H]3C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N[C@@H](C)C(=O)N[C@@H](CSSC[C@H]4C(=O)N5CCC[C@H]5C(=O)NCC(=O)N[C@H](C(N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H]5N(CCC5)C(=O)[C@H]5N(CCC5)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC(=O)[C@H](C)NC2=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(O)=O)C(=O)N4)C(=O)N[C@@H](CSSC1)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N3)=O)[C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(O)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)C(C)C)C(C)C)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)N MDCUNMLZLNGCQA-HWOAGHQOSA-N 0.000 description 1
- 229920002549 elastin Polymers 0.000 description 1
- 108700004389 elastin microfibril interface located Proteins 0.000 description 1
- 229940073621 enbrel Drugs 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 210000002472 endoplasmic reticulum Anatomy 0.000 description 1
- 108010022937 endoplasmin Proteins 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000008472 epithelial growth Effects 0.000 description 1
- 229940105423 erythropoietin Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 229940012444 factor xiii Drugs 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 108010048325 fibrinopeptides gamma Proteins 0.000 description 1
- 108010034065 fibulin 2 Proteins 0.000 description 1
- 210000000285 follicular dendritic cell Anatomy 0.000 description 1
- 108010081934 follitropin beta Proteins 0.000 description 1
- 229960002907 follitropin beta Drugs 0.000 description 1
- 108010062699 gamma-Glutamyl Hydrolase Proteins 0.000 description 1
- 108010091264 gastric triacylglycerol lipase Proteins 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 102000034238 globular proteins Human genes 0.000 description 1
- 108091005896 globular proteins Proteins 0.000 description 1
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 1
- 229960004666 glucagon Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 108010074283 glutaminyl-arginyl-phenylalanyl-seryl-arginine Proteins 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 102000017941 granulin Human genes 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- 108010037536 heparanase Proteins 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 108700039582 histidine triad Proteins 0.000 description 1
- 108010044853 histidine-rich proteins Proteins 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 108091008039 hormone receptors Proteins 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 230000005847 immunogenicity Effects 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000000893 inhibin Substances 0.000 description 1
- 108091006086 inhibitor proteins Proteins 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000004026 insulin derivative Substances 0.000 description 1
- 229940068935 insulin-like growth factor 2 Drugs 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229960003130 interferon gamma Drugs 0.000 description 1
- 108010080375 interferon kappa Proteins 0.000 description 1
- 229960001388 interferon-beta Drugs 0.000 description 1
- 229940047124 interferons Drugs 0.000 description 1
- 239000003407 interleukin 1 receptor blocking agent Substances 0.000 description 1
- 108010052839 interleukin 16 precursor Proteins 0.000 description 1
- 229940074383 interleukin-11 Drugs 0.000 description 1
- 108010070145 interleukin-18 binding protein Proteins 0.000 description 1
- 102000044166 interleukin-18 binding protein Human genes 0.000 description 1
- 108010074109 interleukin-22 Proteins 0.000 description 1
- 102000003898 interleukin-24 Human genes 0.000 description 1
- 108090000237 interleukin-24 Proteins 0.000 description 1
- 229940028885 interleukin-4 Drugs 0.000 description 1
- 229940100602 interleukin-5 Drugs 0.000 description 1
- 229940100601 interleukin-6 Drugs 0.000 description 1
- 229940096397 interleukin-8 Drugs 0.000 description 1
- XKTZWUACRZHVAN-VADRZIEHSA-N interleukin-8 Chemical group C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](NC(C)=O)CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N1[C@H](CCC1)C(=O)N1[C@H](CCC1)C(=O)N[C@@H](C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC(O)=CC=1)C(=O)N[C@H](CO)C(=O)N1[C@H](CCC1)C(N)=O)C1=CC=CC=C1 XKTZWUACRZHVAN-VADRZIEHSA-N 0.000 description 1
- 229940118526 interleukin-9 Drugs 0.000 description 1
- 229940029329 intrinsic factor Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 108010024383 kallikrein 4 Proteins 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229940057428 lactoperoxidase Drugs 0.000 description 1
- 229940102988 levemir Drugs 0.000 description 1
- 108010013555 lipoprotein-associated coagulation inhibitor Proteins 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 108010045758 lysosomal proteins Proteins 0.000 description 1
- 210000003712 lysosome Anatomy 0.000 description 1
- 230000001868 lysosomic effect Effects 0.000 description 1
- 229960000274 lysozyme Drugs 0.000 description 1
- 239000004325 lysozyme Substances 0.000 description 1
- 235000010335 lysozyme Nutrition 0.000 description 1
- 230000001806 lysozymelike Effects 0.000 description 1
- 210000002540 macrophage Anatomy 0.000 description 1
- 108010053292 macrophage stimulating protein Proteins 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 210000001259 mesencephalon Anatomy 0.000 description 1
- 210000003716 mesoderm Anatomy 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- 230000008880 microtubule cytoskeleton organization Effects 0.000 description 1
- 235000021239 milk protein Nutrition 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 210000002161 motor neuron Anatomy 0.000 description 1
- 208000034420 multiple type III exostoses Diseases 0.000 description 1
- 210000000066 myeloid cell Anatomy 0.000 description 1
- 239000000692 natriuretic peptide Substances 0.000 description 1
- 108010086803 nephronectin Proteins 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- 230000007514 neuronal growth Effects 0.000 description 1
- 108010085094 neuropeptide B Proteins 0.000 description 1
- 230000000720 neurosecretory effect Effects 0.000 description 1
- 108010042350 neurotrimin Proteins 0.000 description 1
- 230000000508 neurotrophic effect Effects 0.000 description 1
- 108700022821 nicastrin Proteins 0.000 description 1
- 102000046701 nicastrin Human genes 0.000 description 1
- 102000045246 noggin Human genes 0.000 description 1
- 108700007229 noggin Proteins 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000001956 orexigenic effect Effects 0.000 description 1
- 108010078960 osteoadherin Proteins 0.000 description 1
- 108010040377 otolin-1 Proteins 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 101710135378 pH 6 antigen Proteins 0.000 description 1
- 239000000199 parathyroid hormone Substances 0.000 description 1
- 229960001319 parathyroid hormone Drugs 0.000 description 1
- 229940066716 pepsin a Drugs 0.000 description 1
- 125000001151 peptidyl group Chemical group 0.000 description 1
- 108010044156 peptidyl-prolyl cis-trans isomerase b Proteins 0.000 description 1
- 108010007262 peptidylglycine monooxygenase Proteins 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 108010031345 placental alkaline phosphatase Proteins 0.000 description 1
- 235000021118 plant-derived protein Nutrition 0.000 description 1
- 229940127126 plasminogen activator Drugs 0.000 description 1
- 102000005162 pleiotrophin Human genes 0.000 description 1
- 108050009312 plexin Proteins 0.000 description 1
- 102000002022 plexin Human genes 0.000 description 1
- 108010089000 polyamine oxidase Proteins 0.000 description 1
- 208000030761 polycystic kidney disease Diseases 0.000 description 1
- 102000040430 polynucleotide Human genes 0.000 description 1
- 108091033319 polynucleotide Proteins 0.000 description 1
- 239000002157 polynucleotide Substances 0.000 description 1
- 239000003910 polypeptide antibiotic agent Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 230000006267 polysialylation Effects 0.000 description 1
- 108020001213 potassium channel Proteins 0.000 description 1
- 108020001776 prenylcysteine oxidase Proteins 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019833 protease Nutrition 0.000 description 1
- 108020003519 protein disulfide isomerase Proteins 0.000 description 1
- 108020001580 protein domains Proteins 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 108010054067 rab1 GTP-Binding Proteins Proteins 0.000 description 1
- NPCOQXAVBJJZBQ-UHFFFAOYSA-N reduced coenzyme Q9 Natural products COC1=C(O)C(C)=C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(O)=C1OC NPCOQXAVBJJZBQ-UHFFFAOYSA-N 0.000 description 1
- 239000003488 releasing hormone Substances 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 108010066490 ribonuclease 4 Proteins 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 210000000518 sarcolemma Anatomy 0.000 description 1
- 208000008864 scrapie Diseases 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 108010007653 secretogranin III Proteins 0.000 description 1
- WGWPRVFKDLAUQJ-MITYVQBRSA-N sermorelin Chemical class C([C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)C1=CC=C(O)C=C1 WGWPRVFKDLAUQJ-MITYVQBRSA-N 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000021595 spermatogenesis Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000001913 submandibular gland Anatomy 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate group Chemical group S(=O)(=O)([O-])[O-] QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 208000033002 susceptibility to psoriasis 1 Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 108010013645 tetranectin Proteins 0.000 description 1
- 229960002175 thyroglobulin Drugs 0.000 description 1
- 230000008467 tissue growth Effects 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 108091007466 transmembrane glycoproteins Proteins 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 210000003956 transport vesicle Anatomy 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- 108010087967 type I signal peptidase Proteins 0.000 description 1
- 229940035936 ubiquinone Drugs 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 239000000777 urocortin Substances 0.000 description 1
- HFNHAPQMXICKCF-USJMABIRSA-N urotensin-ii Chemical compound N([C@@H](CC(O)=O)C(=O)N[C@H]1CSSC[C@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=2C3=CC=CC=C3NC=2)NC(=O)[C@H](CC=2C=CC=CC=2)NC1=O)C(=O)N[C@@H](C(C)C)C(O)=O)C(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](N)CCC(O)=O)[C@@H](C)O HFNHAPQMXICKCF-USJMABIRSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000028973 vesicle-mediated transport Effects 0.000 description 1
- 235000019156 vitamin B Nutrition 0.000 description 1
- 239000011720 vitamin B Substances 0.000 description 1
- 210000001534 vitelline membrane Anatomy 0.000 description 1
- 230000003462 zymogenic effect Effects 0.000 description 1
- 235000021246 κ-casein Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/50—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/50—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates
- A61K47/51—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent
- A61K47/56—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic macromolecular compound, e.g. an oligomeric, polymeric or dendrimeric molecule
- A61K47/59—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic macromolecular compound, e.g. an oligomeric, polymeric or dendrimeric molecule obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyureas or polyurethanes
- A61K47/60—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic macromolecular compound, e.g. an oligomeric, polymeric or dendrimeric molecule obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyureas or polyurethanes the organic macromolecular compound being a polyoxyalkylene oligomer, polymer or dendrimer, e.g. PEG, PPG, PEO or polyglycerol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/50—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates
- A61K47/51—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent
- A61K47/54—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic compound
- A61K47/542—Carboxylic acids, e.g. a fatty acid or an amino acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/04—Antihaemorrhagics; Procoagulants; Haemostatic agents; Antifibrinolytic agents
Landscapes
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Organic Chemistry (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicinal Preparation (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201061426356P | 2010-12-22 | 2010-12-22 | |
| PCT/US2011/065591 WO2012087838A1 (en) | 2010-12-22 | 2011-12-16 | Materials and methods for conjugating a water soluble fatty acid derivative to a protein |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201390940A1 EA201390940A1 (ru) | 2014-04-30 |
| EA032056B1 true EA032056B1 (ru) | 2019-04-30 |
Family
ID=45464916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201390940A EA032056B1 (ru) | 2010-12-22 | 2011-12-16 | Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US8945897B2 (https=) |
| EP (2) | EP2654794B8 (https=) |
| JP (1) | JP6138052B2 (https=) |
| KR (1) | KR102025442B1 (https=) |
| CN (1) | CN103269723B (https=) |
| AR (1) | AR084576A1 (https=) |
| AU (2) | AU2011349574B9 (https=) |
| BR (1) | BR112013015898A2 (https=) |
| CA (1) | CA2822591C (https=) |
| DK (1) | DK2654794T3 (https=) |
| EA (1) | EA032056B1 (https=) |
| ES (1) | ES2800983T3 (https=) |
| HU (1) | HUE049352T2 (https=) |
| MX (1) | MX345608B (https=) |
| NZ (1) | NZ612320A (https=) |
| PL (1) | PL2654794T3 (https=) |
| PT (1) | PT2654794T (https=) |
| SG (1) | SG191298A1 (https=) |
| TW (1) | TWI546279B (https=) |
| WO (1) | WO2012087838A1 (https=) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20150233903A1 (en) * | 2012-09-10 | 2015-08-20 | The Johns Hopkins University | Solid phase glycan and glycopeptide analysis and microfluidic chip for glycomic extraction, analysis and methods for using same |
| CN103897031A (zh) * | 2012-12-25 | 2014-07-02 | 深圳先进技术研究院 | 化学修饰的胸腺五肽及其合成方法 |
| US20140243220A1 (en) * | 2013-02-25 | 2014-08-28 | J. Craig Venter Institute | Metaproteomic Method to Identify Secreted Pattern Recognition Molecules and Adhesive Antimicrobial Factors for Detection of Microbial Agents Eliciting Inflammation in the Human Host |
| EP2976365A1 (en) * | 2013-03-20 | 2016-01-27 | Fresenius Kabi Deutschland GmbH | Process for the preparation of thiol functionalized hydroxyalkyl starch derivatives |
| CN103636918B (zh) * | 2013-12-13 | 2015-11-04 | 东北农业大学 | 一种富含亚油酸的改性分离蛋白制备方法 |
| WO2015095553A1 (en) * | 2013-12-20 | 2015-06-25 | Nephrogenesis, Llc | Methods and apparatus for kidney dialysis |
| EP2915569A1 (en) * | 2014-03-03 | 2015-09-09 | Cytune Pharma | IL-15/IL-15Ralpha based conjugates purification method |
| KR20180031775A (ko) * | 2015-08-12 | 2018-03-28 | 셀 머신스, 인크. | 긴 반감기 응집 복합체와 관련된 방법 및 조성물 |
| CN106554425B (zh) * | 2015-09-18 | 2018-10-30 | 沈阳药科大学 | 一种聚唾液酸的脂质接枝衍生物及其应用 |
| EP3384935A4 (en) * | 2015-12-02 | 2019-08-21 | Hanmi Pharm. Co., Ltd. | PROTEIN COMPLEX WITH FATTY ACID DERIVATIVE AND MANUFACTURING METHOD THEREFOR |
| CN108147990B (zh) * | 2016-12-02 | 2023-01-24 | 上海中医药大学 | 一种膜锚定元件及其应用 |
| PE20191716A1 (es) | 2017-02-08 | 2019-12-05 | Bristol Myers Squibb Co | Polipeptidos de relaxina modificada que comprenden un mejorador farmacocinetico y sus usos |
| CN107141354A (zh) * | 2017-05-05 | 2017-09-08 | 李斯文 | 一种融合蛋白及光敏剂复合物及其制备方法和应用 |
| US11358994B2 (en) | 2017-07-27 | 2022-06-14 | Saint Louis University | Fatty acid modified human epidermal growth factor |
| KR102396217B1 (ko) * | 2017-09-19 | 2022-05-09 | 임문워크 아이엔씨 | 알부민과의 결합 친화성이 증대된 약학 구조물 |
| US11845989B2 (en) | 2019-01-23 | 2023-12-19 | Regeneron Pharmaceuticals, Inc. | Treatment of ophthalmic conditions with angiopoietin-like 7 (ANGPTL7) inhibitors |
| MX2021008797A (es) | 2019-01-23 | 2022-01-31 | Regeneron Pharma | Tratamiento de afecciones oftalmicas con inhibidores de proteinas relacionadas a angiopoyetina 7 (angptl7). |
| EP3819307A1 (en) * | 2019-11-07 | 2021-05-12 | CytoKi Pharma ApS | Therapeutic derivatives of interleukin-22 |
| TW202128961A (zh) | 2019-11-20 | 2021-08-01 | 美商安維塔生物科學股份有限公司 | 細胞激素融合蛋白及其醫藥組合物及治療應用 |
| WO2021222150A2 (en) | 2020-04-28 | 2021-11-04 | Anwita Biosciences, Inc. | Interleukin-2 polypeptides and fusion proteins thereof, and their pharmaceutical compositions and therapeutic applications |
| CN113967267B (zh) * | 2020-07-21 | 2022-10-25 | 四川大学 | 脂肪酸修饰的白蛋白的内质网靶向作用及其用途 |
| US11865134B2 (en) | 2021-02-26 | 2024-01-09 | Regeneron Pharmaceuticals, Inc. | Treatment of inflammation with glucocorticoids and angiopoietin-like 7 (ANGPTL7) inhibitors |
| EP4089108A1 (en) * | 2021-05-11 | 2022-11-16 | CytoKi Pharma ApS | Therapeutic derivatives of interleukin-22 |
| WO2022238510A1 (en) * | 2021-05-11 | 2022-11-17 | Cytoki Pharma Aps | Therapeutic derivatives of interleukin-22 |
| EP4089107A1 (en) * | 2021-05-11 | 2022-11-16 | CytoKi Pharma ApS | Therapeutic derivatives of interleukin-22 |
| CN114990175B (zh) * | 2021-10-22 | 2023-03-31 | 岩唐生物科技(杭州)有限责任公司 | 一种岩藻糖衍生物的合成方法 |
| WO2024026099A1 (en) * | 2022-07-29 | 2024-02-01 | The Trustees Of The University Of Pennsylvania | Lymphatic targeted anti-coagulant for the prevention of lymphatic thrombosis |
| CN115894719B (zh) * | 2022-11-24 | 2023-10-20 | 武汉禾元生物科技股份有限公司 | 一种人血清白蛋白胰岛素偶联物及其制备方法 |
| WO2025133203A1 (en) * | 2023-12-22 | 2025-06-26 | Pam Theragnostics Gmbh | Compounds and methods for a long-lasting pam |
| CN118209737B (zh) * | 2024-05-22 | 2024-08-09 | 国科大杭州高等研究院 | 一种用于鉴定检测脂肪酸与蛋白质相互作用的方法 |
| CN120801727B (zh) * | 2025-09-15 | 2026-01-06 | 江西本草天工科技有限责任公司 | 系统性红斑狼疮的诊断标志物及其应用 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20030069170A1 (en) * | 2001-09-07 | 2003-04-10 | Richard Soltero | Pharmaceutical compositions of drug-oligomer conjugates and methods of treating diseases therewith |
| WO2005117984A2 (en) * | 2004-06-01 | 2005-12-15 | Celltech R & D Limited | Albumin-binding conjugates comprising a fatty acid and peg |
| WO2008025856A2 (en) * | 2006-09-01 | 2008-03-06 | Novo Nordisk Health Care Ag | Modified glycoproteins |
| WO2011101277A1 (en) * | 2010-02-16 | 2011-08-25 | Novo Nordisk A/S | Conjugated proteins |
Family Cites Families (143)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179337A (en) | 1973-07-20 | 1979-12-18 | Davis Frank F | Non-immunogenic polypeptides |
| JPS54113492A (en) | 1978-02-24 | 1979-09-05 | Sanyo Chem Ind Ltd | Preparation of glucoprotein derivative |
| US4356170A (en) | 1981-05-27 | 1982-10-26 | Canadian Patents & Development Ltd. | Immunogenic polysaccharide-protein conjugates |
| US4757006A (en) | 1983-10-28 | 1988-07-12 | Genetics Institute, Inc. | Human factor VIII:C gene and recombinant methods for production |
| US4970300A (en) | 1985-02-01 | 1990-11-13 | New York University | Modified factor VIII |
| US5250421A (en) | 1986-01-03 | 1993-10-05 | Genetics Institute, Inc. | Method for producing factor VIII:C-type proteins |
| US5198349A (en) | 1986-01-03 | 1993-03-30 | Genetics Institute, Inc. | Method for producing factor VIII:C and analogs |
| JPH0387173A (ja) | 1987-09-10 | 1991-04-11 | Teijin Ltd | ヒト活性化天然型ファクター8cの製造方法及びそれに用いる形質転換体 |
| US5153265A (en) | 1988-01-20 | 1992-10-06 | Cetus Corporation | Conjugation of polymer to colony stimulating factor-1 |
| US4966999A (en) | 1988-06-07 | 1990-10-30 | Cytogen Corporation | Radiohalogenated compounds for site specific labeling |
| US5122614A (en) | 1989-04-19 | 1992-06-16 | Enzon, Inc. | Active carbonates of polyalkylene oxides for modification of polypeptides |
| SE465222C5 (sv) | 1989-12-15 | 1998-02-10 | Pharmacia & Upjohn Ab | Ett rekombinant, humant faktor VIII-derivat och förfarande för dess framställning |
| SE466754B (sv) | 1990-09-13 | 1992-03-30 | Berol Nobel Ab | Saett att kovalent binda biopolymerer till hydrofila ytor |
| EP0513332A4 (en) | 1990-11-14 | 1993-03-17 | Cargill, Incorporated | Conjugates of poly(vinylsaccharide) with proteins for the stabilization of proteins |
| JPH06506217A (ja) | 1991-03-18 | 1994-07-14 | エンゾン,インコーポレーテッド | ポリペプチドまたはグリコポリペプチドとポリマーとのヒドラジン含有結合体 |
| US5846951A (en) | 1991-06-06 | 1998-12-08 | The School Of Pharmacy, University Of London | Pharmaceutical compositions |
| US6037452A (en) | 1992-04-10 | 2000-03-14 | Alpha Therapeutic Corporation | Poly(alkylene oxide)-Factor VIII or Factor IX conjugate |
| WO1994005332A2 (en) | 1992-09-01 | 1994-03-17 | Berlex Laboratories, Inc. | Glycolation of glycosylated macromolecules |
| CA2124690C (en) | 1992-10-02 | 2007-09-11 | Thomas Osterberg | Composition comprising coagulation factor viii formulation, process for its preparation and use of a surfactant as stabilizer |
| NZ250375A (en) | 1992-12-09 | 1995-07-26 | Ortho Pharma Corp | Peg hydrazone and peg oxime linkage forming reagents and protein derivatives |
| US5298643A (en) | 1992-12-22 | 1994-03-29 | Enzon, Inc. | Aryl imidate activated polyalkylene oxides |
| WO1994015625A1 (en) | 1993-01-15 | 1994-07-21 | Enzon, Inc. | Factor viii - polymeric conjugates |
| US5621039A (en) | 1993-06-08 | 1997-04-15 | Hallahan; Terrence W. | Factor IX- polymeric conjugates |
| SE504074C2 (sv) | 1993-07-05 | 1996-11-04 | Pharmacia Ab | Proteinberedning för subkutan, intramuskulär eller intradermal administrering |
| US6869930B1 (en) | 1993-09-17 | 2005-03-22 | Novo Nordisk A/S | Acylated insulin |
| US6011007A (en) | 1993-09-17 | 2000-01-04 | Novo Nordisk A/S | Acylated insulin |
| EP1132404A3 (en) | 1993-09-17 | 2002-03-27 | Novo Nordisk A/S | Acylated insulin |
| CA2204726A1 (en) | 1994-11-09 | 1996-12-27 | Robin E. Offord | Functionalized polymers for site-specific attachment |
| WO1996040731A1 (en) | 1995-06-07 | 1996-12-19 | Mount Sinai School Of Medicine Of The City University Of New York | Pegylated modified proteins |
| WO1996040662A2 (en) | 1995-06-07 | 1996-12-19 | Cellpro, Incorporated | Aminooxy-containing linker compounds and their application in conjugates |
| SE9503380D0 (sv) | 1995-09-29 | 1995-09-29 | Pharmacia Ab | Protein derivatives |
| US5866538A (en) | 1996-06-20 | 1999-02-02 | Novo Nordisk A/S | Insulin preparations containing NaCl |
| EP0979102A4 (en) | 1997-04-30 | 2005-11-23 | Enzon Inc | DETAILED POLYPEPTIDE MODIFIED BY POLYALKYLENE OXIDE |
| US6183738B1 (en) | 1997-05-12 | 2001-02-06 | Phoenix Pharamacologics, Inc. | Modified arginine deiminase |
| US6852703B1 (en) | 1997-06-04 | 2005-02-08 | Oxford Biomedica (Uk) Limited | Tumor targeted vector |
| US6531298B2 (en) | 1997-07-21 | 2003-03-11 | The University Of North Carolina At Chapel Hill | Factor IX antihemophilic factor with increased clotting activity |
| DK1036179T4 (da) | 1997-12-03 | 2014-03-31 | Roche Diagnostics Gmbh | Fremgangsmåde til fremstilling af polypeptider med egnet glycosilering |
| US5985263A (en) | 1997-12-19 | 1999-11-16 | Enzon, Inc. | Substantially pure histidine-linked protein polymer conjugates |
| US6596398B1 (en) | 1998-08-21 | 2003-07-22 | Atofina Chemicals, Inc. | Solar control coated glass |
| EP1107998B1 (en) | 1998-08-28 | 2004-02-04 | Gryphon Sciences | Method for the preparation of polyamide chains of precise length, their conjugates with proteins |
| HU229888B1 (en) | 1998-10-16 | 2014-11-28 | Biogen Idec Ma Inc Cambridge | Polymer conjugates of interferon betha-1a and uses |
| DE19852729A1 (de) | 1998-11-16 | 2000-05-18 | Werner Reutter | Rekombinante Glycoproteine, Verfahren zu ihrer Herstellung, sie enthaltende Arzneimittel und ihre Verwendung |
| DK1820516T3 (da) | 1999-02-22 | 2013-10-28 | Univ Connecticut | Nye albuminfrie faktor VIII-præparater |
| CN1762990A (zh) * | 1999-06-08 | 2006-04-26 | 拉卓拉药物公司 | 包含氨基氧基的化合价平台分子 |
| US6531122B1 (en) | 1999-08-27 | 2003-03-11 | Maxygen Aps | Interferon-β variants and conjugates |
| CN1309423C (zh) | 1999-11-12 | 2007-04-11 | 马克西根控股公司 | 干扰素γ偶联物 |
| US7074878B1 (en) | 1999-12-10 | 2006-07-11 | Harris J Milton | Hydrolytically degradable polymers and hydrogels made therefrom |
| US6413507B1 (en) | 1999-12-23 | 2002-07-02 | Shearwater Corporation | Hydrolytically degradable carbamate derivatives of poly (ethylene glycol) |
| CA2739933A1 (en) | 2000-02-11 | 2001-08-16 | Bayer Healthcare Llc | Factor vii or viia-like molecules |
| JP4455802B2 (ja) | 2000-05-03 | 2010-04-21 | ノボ ノルディスク ヘルス ケア アクチェンゲゼルシャフト | ヒト第vii凝固因子変異型 |
| EP1280548B1 (en) | 2000-05-03 | 2013-12-11 | Novo Nordisk Health Care AG | Subcutaneous administration of coagulation factor VII |
| WO2001093914A2 (en) | 2000-06-08 | 2001-12-13 | La Jolla Pharmaceutical Company | Multivalent platform molecules comprising high molecular weight polyethylene oxide |
| US6423826B1 (en) | 2000-06-30 | 2002-07-23 | Regents Of The University Of Minnesota | High molecular weight derivatives of vitamin K-dependent polypeptides |
| US7118737B2 (en) | 2000-09-08 | 2006-10-10 | Amylin Pharmaceuticals, Inc. | Polymer-modified synthetic proteins |
| WO2002022776A2 (en) | 2000-09-13 | 2002-03-21 | Novo Nordisk A/S | Human coagulation factor vii variants |
| BR0114373A (pt) | 2000-10-02 | 2004-02-17 | Novo Nordisk As | Célula hospedeira eucariótica, métodos para a produção de fvii e de fviia ou de suas variantes, de uma proteìna dependente de vitamina k e de uma célula hospedeira eucariótica produtora de fvii ou de seu análogo, vetor recombinante, fvii e fviia recombinante ou suas variantes, e, proteìna dependente de vitamina k recombinante |
| GB0103877D0 (en) * | 2001-02-16 | 2001-04-04 | King S College London | Novel Drug Delivery system |
| CZ20032454A3 (en) | 2001-03-22 | 2004-03-17 | Novo Nordisk Health Care Ag | Coagulation factor vii derivative |
| US6913915B2 (en) | 2001-08-02 | 2005-07-05 | Phoenix Pharmacologics, Inc. | PEG-modified uricase |
| US7795210B2 (en) | 2001-10-10 | 2010-09-14 | Novo Nordisk A/S | Protein remodeling methods and proteins/peptides produced by the methods |
| US7265084B2 (en) | 2001-10-10 | 2007-09-04 | Neose Technologies, Inc. | Glycopegylation methods and proteins/peptides produced by the methods |
| ES2411007T3 (es) | 2001-10-10 | 2013-07-04 | Novo Nordisk A/S | Remodelación y glicoconjugación de péptidos |
| US7214660B2 (en) | 2001-10-10 | 2007-05-08 | Neose Technologies, Inc. | Erythropoietin: remodeling and glycoconjugation of erythropoietin |
| EP1446438A2 (en) | 2001-11-07 | 2004-08-18 | Nektar Therapeutics Al, Corporation | Branched polymers and their conjugates |
| US7368108B2 (en) | 2001-11-28 | 2008-05-06 | Neose Technologies, Inc. | Glycopeptide remodeling using amidases |
| AU2002351199A1 (en) | 2001-11-28 | 2003-06-10 | Neose Technologies, Inc. | Glycoprotein remodeling using endoglycanases |
| UA86744C2 (en) | 2002-06-21 | 2009-05-25 | Ново Нордиск Хэлс Кеа Аг | Pegylated factor vii glycoforms |
| US7087229B2 (en) | 2003-05-30 | 2006-08-08 | Enzon Pharmaceuticals, Inc. | Releasable polymeric conjugates based on aliphatic biodegradable linkers |
| US7122189B2 (en) | 2002-08-13 | 2006-10-17 | Enzon, Inc. | Releasable polymeric conjugates based on aliphatic biodegradable linkers |
| EP1400533A1 (en) | 2002-09-11 | 2004-03-24 | Fresenius Kabi Deutschland GmbH | HASylated polypeptides, especially HASylated erythropoietin |
| BR0314227A (pt) | 2002-09-11 | 2005-10-25 | Fresenius Kabi De Gmbh | Derivados de amido de hidroxialquila |
| US20040062748A1 (en) | 2002-09-30 | 2004-04-01 | Mountain View Pharmaceuticals, Inc. | Polymer conjugates with decreased antigenicity, methods of preparation and uses thereof |
| JP4490369B2 (ja) | 2002-12-31 | 2010-06-23 | ネクター セラピューティクス アラバマ,コーポレイション | マレアミド酸ポリマー誘導体及びこれらの生物学的複合体 |
| MXPA05007151A (es) | 2002-12-31 | 2005-09-21 | Nektar Therapeutics Al Corp | Polimeros terminados en maleimida hidroliticamente estables. |
| BRPI0407882B1 (pt) | 2003-02-26 | 2021-07-27 | Nektar Therapeutics | Composição compreendendo conjugados de polímero-porção de fator viii e seu método de fabricação |
| US7623892B2 (en) | 2003-04-02 | 2009-11-24 | Palm, Inc. | System and method for enabling a person to switch use of computing devices |
| PL1620118T3 (pl) | 2003-04-08 | 2014-11-28 | Yeda Res & Dev | Leki odwracalnie pegylowane |
| PL1615945T3 (pl) | 2003-04-09 | 2012-03-30 | Ratiopharm Gmbh | Sposoby glikopegylacji i białka/peptydy wytwarzane tymi sposobami |
| WO2005014049A2 (en) | 2003-08-08 | 2005-02-17 | Novo Nordisk A/S | Synthesis and application of new structural well defined branched polymers as conjugating agents for peptides |
| BRPI0412671A (pt) | 2003-08-08 | 2006-10-03 | Fresenius Kabi De Gmbh | conjugados de um polìmero e uma proteìna ligados por um grupo de ligação de oxima |
| WO2005014655A2 (en) | 2003-08-08 | 2005-02-17 | Fresenius Kabi Deutschland Gmbh | Conjugates of hydroxyalkyl starch and a protein |
| CN1863549A (zh) * | 2003-08-08 | 2006-11-15 | 费森尤斯卡比德国有限公司 | 通过肟连接基团进行连接的聚合物和蛋白质的缀合物 |
| EP1654290B1 (en) | 2003-08-12 | 2019-03-13 | Lipoxen Technologies Limited | Sialic acid derivatives for protein derivatisation and conjugation |
| US8633157B2 (en) | 2003-11-24 | 2014-01-21 | Novo Nordisk A/S | Glycopegylated erythropoietin |
| CN1897812B (zh) | 2003-12-03 | 2011-08-17 | 生物种属学股份公司 | 糖聚乙二醇化的粒细胞集落刺激因子 |
| MXPA06006023A (es) | 2003-12-03 | 2006-08-23 | Neose Technologies Inc | Factor ix glicopegilado. |
| US20060040856A1 (en) | 2003-12-03 | 2006-02-23 | Neose Technologies, Inc. | Glycopegylated factor IX |
| NZ548123A (en) | 2004-01-08 | 2010-05-28 | Novo Nordisk As | O-linked glycosylation of peptides |
| WO2005092369A2 (en) | 2004-03-11 | 2005-10-06 | Fresenius Kabi Deutschland Gmbh | Conjugates of hydroxyethyl starch and erythropoietin |
| US20090292110A1 (en) | 2004-07-23 | 2009-11-26 | Defrees Shawn | Enzymatic modification of glycopeptides |
| US20090176967A1 (en) | 2004-08-02 | 2009-07-09 | Novo Nordisk Healthcare A/G | Conjugation of FVII |
| EP3184551A1 (en) | 2004-08-12 | 2017-06-28 | Lipoxen Technologies Limited | Sialic acid derivatives |
| WO2006031811A2 (en) | 2004-09-10 | 2006-03-23 | Neose Technologies, Inc. | Glycopegylated interferon alpha |
| PT2363414T (pt) | 2004-11-12 | 2022-08-04 | Bayer Healthcare Llc | Modificação de fviii direcionada a sítio |
| EP2399893B1 (en) | 2004-12-22 | 2018-08-15 | Ambrx, Inc. | Compositions containing, methods involving, and uses of non-natural amino acids and polypeptides |
| CN101163506B (zh) | 2004-12-27 | 2012-09-26 | 巴克斯特国际公司 | 聚合物-von Willebrand因子偶联物 |
| JP2008526864A (ja) | 2005-01-06 | 2008-07-24 | ネオス テクノロジーズ インコーポレイテッド | 糖断片を用いる糖結合 |
| CN101151280A (zh) * | 2005-02-08 | 2008-03-26 | 昆士兰医学研究学院委员会 | 免疫原性分子 |
| EP2975135A1 (en) | 2005-05-25 | 2016-01-20 | Novo Nordisk A/S | Glycopegylated factor IX |
| HUE025208T2 (en) | 2005-06-16 | 2016-03-29 | Nektar Therapeutics | Conjugates with degradable binding and polymer reagents useful in the preparation of such conjugates |
| ES2553160T3 (es) | 2005-06-17 | 2015-12-04 | Novo Nordisk Health Care Ag | Reducción y derivatización selectivas de proteínas Factor VII transformadas por ingeniería que comprenden al menos una cisteína no nativa |
| US20090017007A1 (en) | 2005-08-26 | 2009-01-15 | Maxygen Holdings Ltd. | Liquid factor vii composition |
| US8293708B2 (en) * | 2005-08-30 | 2012-10-23 | Novo Nordisk Health Care A/G | Liquid formulations N-terminal serine of pegylated growth hormone |
| BRPI0620316A2 (pt) | 2005-12-21 | 2011-11-08 | Wyeth Corp | formulações de proteìnas com viscosidades reduzida e seus usos |
| AU2007215566A1 (en) * | 2006-01-19 | 2007-08-23 | Ambrx, Inc. | Non-natural amino acid polypeptides having modulated immunogenicity |
| AU2007245190B2 (en) | 2006-03-31 | 2011-07-21 | Takeda Pharmaceutical Company Limited | Pegylated factor VIII |
| US7645860B2 (en) | 2006-03-31 | 2010-01-12 | Baxter Healthcare S.A. | Factor VIII polymer conjugates |
| EP2089052A4 (en) | 2006-05-24 | 2011-02-16 | Peg Biosciences | POLYETHYLENE GLYCOL-BASED LINK COMPOUNDS AND BIOLOGICALLY ACTIVE CONJUGATES BASED ON SAID COMPOUNDS |
| US7939632B2 (en) | 2006-06-14 | 2011-05-10 | Csl Behring Gmbh | Proteolytically cleavable fusion proteins with high molar specific activity |
| DK2049692T3 (en) | 2006-07-13 | 2016-04-04 | Serum Inst India Ltd | Process for producing very high purity polysialic acid |
| EP2054521A4 (en) | 2006-10-03 | 2012-12-19 | Novo Nordisk As | PROCESS FOR CLEANING POLYPEPTIDE CONJUGATES |
| WO2008058547A2 (en) * | 2006-11-17 | 2008-05-22 | Nya Hamlet Pharma Ab | Alpha-lactalbumin composition |
| PT2101821E (pt) | 2006-12-15 | 2014-10-03 | Baxter Int | Fator conjugado viia-ácido (poli)siálico com prolongamento do tempo de meia vida in vivo |
| US20100098630A1 (en) | 2006-12-28 | 2010-04-22 | Ambrx, Inc. | Phenazine and Quinoxaline Substituted Amino Acids and Polypeptides |
| US20100143326A1 (en) | 2007-01-03 | 2010-06-10 | Novo Nordisk Healthcare A/G | SUBCUTANEOUS ADMINISTRATION OF COAGULATION FACTOR VIIa-RELATED POLYPEPTIDES |
| WO2008119815A1 (en) | 2007-04-02 | 2008-10-09 | Novo Nordisk A/S | Subcutaneous administration of coagulation factor ix |
| KR101654375B1 (ko) | 2007-06-26 | 2016-09-05 | 박스알타 인코퍼레이티드 | 가수분해성 중합체 fmoc-링커 |
| WO2009006620A1 (en) | 2007-07-03 | 2009-01-08 | Children's Hospital & Research Center At Oakland | Oligosialic acid derivatives, methods of manufacture, and immunological uses |
| CN101820920B (zh) | 2007-10-09 | 2014-08-06 | 宝力泰锐克斯有限公司 | 新的缀合蛋白质和肽 |
| EP2070951A1 (en) | 2007-12-14 | 2009-06-17 | Fresenius Kabi Deutschland GmbH | Method for producing a hydroxyalkyl starch derivatives with two linkers |
| CA2711503A1 (en) | 2008-01-08 | 2009-07-16 | Biogenerix Ag | Glycoconjugation of polypeptides using oligosaccharyltransferases |
| PL2257311T3 (pl) | 2008-02-27 | 2014-09-30 | Novo Nordisk As | Koniugaty cząsteczek czynnika VIII |
| DK2280734T3 (da) | 2008-04-24 | 2014-05-26 | Cantab Biopharmaceuticals Patents Ltd | Faktor-ix-konjugater med forlængede halveringstider |
| WO2009141418A1 (en) | 2008-05-23 | 2009-11-26 | Novo Nordisk A/S | Formulations of peg-functionalised serine proteases with high concentrations of an aromatic preservative |
| EP2285401A1 (en) | 2008-05-23 | 2011-02-23 | Novo Nordisk Health Care AG | Low viscosity compositions comprising a pegylated gla-domain containing protein |
| EP2297330A4 (en) | 2008-06-04 | 2012-03-14 | Bayer Healthcare Llc | FVII MUTINES FOR THE TREATMENT OF MORBUS WILLEBRAND |
| AU2009275358C1 (en) | 2008-07-21 | 2015-09-24 | Polytherics Limited | Novel reagents and method for conjugating biological molecules |
| KR20110093775A (ko) | 2008-11-03 | 2011-08-18 | 바이엘 헬스케어 엘엘씨 | 혈우병 치료 방법 |
| US20120121613A1 (en) | 2009-01-19 | 2012-05-17 | Bayer Healthcare Llc | Protein conjugate having an endopeptidase- cleavable bioprotective moiety |
| ES2401965T3 (es) | 2009-02-19 | 2013-04-25 | Novo Nordisk A/S | Modificación de Factor VIII |
| EP2403538B1 (en) | 2009-03-04 | 2017-10-04 | Polytherics Limited | Conjugated proteins and peptides |
| WO2010120365A2 (en) | 2009-04-16 | 2010-10-21 | Wu Nian | Protein-carrier conjugates |
| EP2437786B1 (en) | 2009-06-01 | 2016-05-18 | Yeda Research and Development Co. Ltd. | Prodrugs containing albumin binding probe |
| JP2013500726A (ja) | 2009-07-31 | 2013-01-10 | バイエル・ヘルスケア・エルエルシー | 改変第ix因子ポリペプチドおよびその使用 |
| DE102009028526A1 (de) | 2009-08-13 | 2011-02-24 | Leibniz-Institut Für Polymerforschung Dresden E.V. | Verfahren zur Modifikation und Funktionalisierung von Sacchariden |
| EP2480578A4 (en) | 2009-09-25 | 2013-04-17 | Vybion Inc | MODIFICATION OF POLYPEPTIDE |
| US8697844B2 (en) | 2009-11-24 | 2014-04-15 | Novo Nordisk A/S | Method of purifying pegylated proteins |
| EP2536753B1 (en) | 2010-02-16 | 2017-12-20 | Novo Nordisk A/S | Factor viii molecules with reduced vwf binding |
| GB201007357D0 (en) | 2010-04-30 | 2010-06-16 | Leverton Licence Holdings Ltd | Conjugated factor VIII |
| GB201007356D0 (en) | 2010-04-30 | 2010-06-16 | Leverton Licence Holdings Ltd | Conjugated factor VIIa |
| TR201908836T4 (tr) | 2010-07-30 | 2019-07-22 | Baxalta GmbH | Oksim bağına yönelik nükleofilik katalizörler. |
| WO2012068134A1 (en) | 2010-11-15 | 2012-05-24 | Biogen Idec Inc. | Enrichment and concentration of select product isoforms by overloaded bind and elute chromatography |
| PT3513804T (pt) | 2011-07-08 | 2022-06-02 | Bioverativ Therapeutics Inc | Polipéptidos fator viii híbridos e quiméricos, e métodos de utilização dos mesmos |
-
2011
- 2011-12-16 BR BR112013015898-0A patent/BR112013015898A2/pt not_active Application Discontinuation
- 2011-12-16 CA CA2822591A patent/CA2822591C/en active Active
- 2011-12-16 JP JP2013546263A patent/JP6138052B2/ja active Active
- 2011-12-16 EP EP11806103.5A patent/EP2654794B8/en active Active
- 2011-12-16 AU AU2011349574A patent/AU2011349574B9/en active Active
- 2011-12-16 US US13/329,002 patent/US8945897B2/en active Active
- 2011-12-16 EA EA201390940A patent/EA032056B1/ru unknown
- 2011-12-16 KR KR1020137019066A patent/KR102025442B1/ko active Active
- 2011-12-16 ES ES11806103T patent/ES2800983T3/es active Active
- 2011-12-16 EP EP19211476.7A patent/EP3673921A1/en not_active Withdrawn
- 2011-12-16 DK DK11806103.5T patent/DK2654794T3/da active
- 2011-12-16 PL PL11806103T patent/PL2654794T3/pl unknown
- 2011-12-16 CN CN201180062472.4A patent/CN103269723B/zh active Active
- 2011-12-16 HU HUE11806103A patent/HUE049352T2/hu unknown
- 2011-12-16 WO PCT/US2011/065591 patent/WO2012087838A1/en not_active Ceased
- 2011-12-16 SG SG2013048194A patent/SG191298A1/en unknown
- 2011-12-16 MX MX2013007369A patent/MX345608B/es active IP Right Grant
- 2011-12-16 NZ NZ612320A patent/NZ612320A/en unknown
- 2011-12-16 PT PT118061035T patent/PT2654794T/pt unknown
- 2011-12-21 TW TW100147675A patent/TWI546279B/zh active
- 2011-12-22 AR ARP110104911A patent/AR084576A1/es active IP Right Grant
-
2017
- 2017-06-14 AU AU2017204019A patent/AU2017204019A1/en not_active Abandoned
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20030069170A1 (en) * | 2001-09-07 | 2003-04-10 | Richard Soltero | Pharmaceutical compositions of drug-oligomer conjugates and methods of treating diseases therewith |
| WO2005117984A2 (en) * | 2004-06-01 | 2005-12-15 | Celltech R & D Limited | Albumin-binding conjugates comprising a fatty acid and peg |
| WO2008025856A2 (en) * | 2006-09-01 | 2008-03-06 | Novo Nordisk Health Care Ag | Modified glycoproteins |
| WO2011101277A1 (en) * | 2010-02-16 | 2011-08-25 | Novo Nordisk A/S | Conjugated proteins |
Non-Patent Citations (1)
| Title |
|---|
| EKRAMI H M, ET AL: "Water-soluble fatty acid derivatives as acylating agents for reversible lipidization of polypeptides", FEBS LETTERS., ELSEVIER, AMSTERDAM., NL, vol. 371, 11 September 1995 (1995-09-11), NL, pages 283 - 286, XP002244694, ISSN: 0014-5793, DOI: 10.1016/0014-5793(95)00910-2 * |
Also Published As
| Publication number | Publication date |
|---|---|
| KR102025442B1 (ko) | 2019-09-25 |
| CA2822591C (en) | 2020-12-29 |
| MX345608B (es) | 2017-02-07 |
| EP2654794A1 (en) | 2013-10-30 |
| CA2822591A1 (en) | 2012-06-28 |
| SG191298A1 (en) | 2013-07-31 |
| CN103269723B (zh) | 2017-04-05 |
| AU2011349574B2 (en) | 2017-06-01 |
| JP6138052B2 (ja) | 2017-05-31 |
| EP2654794B1 (en) | 2020-03-04 |
| DK2654794T3 (da) | 2020-06-08 |
| US20120190096A1 (en) | 2012-07-26 |
| AU2011349574A1 (en) | 2013-07-11 |
| CN103269723A (zh) | 2013-08-28 |
| KR20130129254A (ko) | 2013-11-27 |
| AU2011349574B9 (en) | 2017-06-15 |
| HUE049352T2 (hu) | 2020-09-28 |
| JP2014501262A (ja) | 2014-01-20 |
| NZ612320A (en) | 2015-06-26 |
| ES2800983T3 (es) | 2021-01-07 |
| MX2013007369A (es) | 2013-09-26 |
| TWI546279B (zh) | 2016-08-21 |
| TW201305090A (zh) | 2013-02-01 |
| EA201390940A1 (ru) | 2014-04-30 |
| BR112013015898A2 (pt) | 2018-06-26 |
| PT2654794T (pt) | 2020-06-11 |
| AR084576A1 (es) | 2013-05-29 |
| US8945897B2 (en) | 2015-02-03 |
| AU2017204019A1 (en) | 2017-07-06 |
| PL2654794T3 (pl) | 2020-07-27 |
| WO2012087838A1 (en) | 2012-06-28 |
| EP3673921A1 (en) | 2020-07-01 |
| EP2654794B8 (en) | 2020-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA032056B1 (ru) | Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) | |
| US12516083B2 (en) | Nucleophilic catalysts for oxime linkage | |
| EA025738B1 (ru) | Способ конъюгирования водорастворимого полимера с терапевтическим белком (варианты) и полученный модифицированный белок (варианты) | |
| US11564992B2 (en) | Nucleophilic catalysts for oxime linkage | |
| EA028186B1 (ru) | Способ конъюгации водорастворимого полимера с терапевтическим белком (варианты) и полученный модифицированный белок | |
| US20130310546A1 (en) | Nucleophilic catalysts for oxime linkage and use of nmr analyses of the same | |
| AU2017276255B2 (en) | Nucleophilic Catalysts for Oxime Linkage | |
| HK40076576A (en) | Methods for preparing therapeutic protein-polymer conjugates | |
| HK40077427A (en) | Nucleophilic catalysts for oxime linkage | |
| EA044273B1 (ru) | Способ конъюгирования водорастворимого полимера с терапевтическим белком | |
| HK1191220A (en) | Materials and methods for conjugating a water soluble fatty acid derivative to a protein | |
| HK1191220B (en) | Materials and methods for conjugating a water soluble fatty acid derivative to a protein | |
| HK40009331A (en) | Nucleophilic catalysts for oxime linkage | |
| HK1209024B (en) | Methods for preparing therapeutic protein-polymer conjugates | |
| HK1186115A (en) | Nucleophilic catalysts for oxime linkage | |
| HK1186115B (en) | Nucleophilic catalysts for oxime linkage |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC4A | Registration of transfer of a eurasian patent by assignment |