DE1261397B - Photographisches Verfahren zur Herstellung positiver Bilder - Google Patents
Photographisches Verfahren zur Herstellung positiver BilderInfo
- Publication number
- DE1261397B DE1261397B DEP30721A DEP0030721A DE1261397B DE 1261397 B DE1261397 B DE 1261397B DE P30721 A DEP30721 A DE P30721A DE P0030721 A DEP0030721 A DE P0030721A DE 1261397 B DE1261397 B DE 1261397B
- Authority
- DE
- Germany
- Prior art keywords
- soluble
- silver halide
- silver
- insoluble
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 20
- 230000008569 process Effects 0.000 title claims description 10
- 229910052709 silver Inorganic materials 0.000 claims description 157
- 239000004332 silver Substances 0.000 claims description 157
- -1 silver halide Chemical class 0.000 claims description 134
- 239000000243 solution Substances 0.000 claims description 73
- 239000006185 dispersion Substances 0.000 claims description 41
- 239000000839 emulsion Substances 0.000 claims description 41
- 150000002894 organic compounds Chemical class 0.000 claims description 36
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 35
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 27
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 27
- CYCKHTAVNBPQDB-UHFFFAOYSA-N 4-phenyl-3H-thiazole-2-thione Chemical compound S1C(S)=NC(C=2C=CC=CC=2)=C1 CYCKHTAVNBPQDB-UHFFFAOYSA-N 0.000 claims description 26
- 229920000159 gelatin Polymers 0.000 claims description 24
- 235000019322 gelatine Nutrition 0.000 claims description 24
- 239000013078 crystal Substances 0.000 claims description 23
- 108010010803 Gelatin Proteins 0.000 claims description 21
- 239000008273 gelatin Substances 0.000 claims description 21
- 235000011852 gelatine desserts Nutrition 0.000 claims description 21
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 claims description 16
- 229910021607 Silver chloride Inorganic materials 0.000 claims description 15
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 claims description 15
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 11
- 239000004133 Sodium thiosulphate Substances 0.000 claims description 9
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 5
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 238000004090 dissolution Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 56
- 239000000463 material Substances 0.000 description 31
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 150000001875 compounds Chemical class 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 14
- 238000011282 treatment Methods 0.000 description 14
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 11
- 239000003638 chemical reducing agent Substances 0.000 description 9
- 230000003287 optical effect Effects 0.000 description 9
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 9
- 238000010998 test method Methods 0.000 description 9
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 8
- 239000000523 sample Substances 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 238000001035 drying Methods 0.000 description 5
- 230000001965 increasing effect Effects 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 5
- ZRKMQKLGEQPLNS-UHFFFAOYSA-N 1-Pentanethiol Chemical group CCCCCS ZRKMQKLGEQPLNS-UHFFFAOYSA-N 0.000 description 4
- ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=CC=C1 ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000003287 bathing Methods 0.000 description 4
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 4
- 238000012822 chemical development Methods 0.000 description 4
- 239000013068 control sample Substances 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- LQZPSWMMTICWHD-UHFFFAOYSA-N 1,3-dibenzylthiourea Chemical compound C=1C=CC=CC=1CNC(=S)NCC1=CC=CC=C1 LQZPSWMMTICWHD-UHFFFAOYSA-N 0.000 description 3
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 3
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 239000001828 Gelatine Substances 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- OIPQUBBCOVJSNS-UHFFFAOYSA-L bromo(iodo)silver Chemical compound Br[Ag]I OIPQUBBCOVJSNS-UHFFFAOYSA-L 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 3
- 238000007865 diluting Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 229910001961 silver nitrate Inorganic materials 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 2
- BDFAOUQQXJIZDG-UHFFFAOYSA-N 2-methylpropane-1-thiol Chemical compound CC(C)CS BDFAOUQQXJIZDG-UHFFFAOYSA-N 0.000 description 2
- FYJCQERCPMOXBR-UHFFFAOYSA-N 3-methyl-4-(3-nitrophenyl)-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(C1C1=CC(=CC=C1)[N+](=O)[O-])=O FYJCQERCPMOXBR-UHFFFAOYSA-N 0.000 description 2
- HQXQVKSGCXSRGH-UHFFFAOYSA-N 3h-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine Chemical compound C1=CC=C2SC(=S)NC2=C1.NC(N)=NC(N)=NC1=CC=CC=C1 HQXQVKSGCXSRGH-UHFFFAOYSA-N 0.000 description 2
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 2
- WSGURAYTCUVDQL-UHFFFAOYSA-N 5-nitro-1h-indazole Chemical compound [O-][N+](=O)C1=CC=C2NN=CC2=C1 WSGURAYTCUVDQL-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- ZNWDVQFYQPYNBN-UHFFFAOYSA-N C(C(C)C)(=O)NC1=CC2=C(N=C(S2)S)C=C1 Chemical compound C(C(C)C)(=O)NC1=CC2=C(N=C(S2)S)C=C1 ZNWDVQFYQPYNBN-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 229910021612 Silver iodide Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- ZEUDGVUWMXAXEF-UHFFFAOYSA-L bromo(chloro)silver Chemical compound Cl[Ag]Br ZEUDGVUWMXAXEF-UHFFFAOYSA-L 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- SHLGNFLVXSLLPN-UHFFFAOYSA-N n-(2-sulfanylidene-3h-1,3-benzothiazol-6-yl)octanamide Chemical compound CCCCCCCC(=O)NC1=CC=C2NC(=S)SC2=C1 SHLGNFLVXSLLPN-UHFFFAOYSA-N 0.000 description 2
- 229910017464 nitrogen compound Inorganic materials 0.000 description 2
- 150000002830 nitrogen compounds Chemical class 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000005070 ripening Effects 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 229940045105 silver iodide Drugs 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000005063 solubilization Methods 0.000 description 2
- 230000007928 solubilization Effects 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QTTAKXPPGQAQPS-UHFFFAOYSA-N (2-ethylphenyl)methanethiol Chemical compound CCC1=CC=CC=C1CS QTTAKXPPGQAQPS-UHFFFAOYSA-N 0.000 description 1
- PJUDFYDAJBQPEA-UHFFFAOYSA-N (2-methylphenyl)methanethiol Chemical compound CC1=CC=CC=C1CS PJUDFYDAJBQPEA-UHFFFAOYSA-N 0.000 description 1
- CYXJEHCKVOQFOV-UHFFFAOYSA-N (4-amino-2-methylphenyl) hydrogen sulfate Chemical compound CC1=CC(N)=CC=C1OS(O)(=O)=O CYXJEHCKVOQFOV-UHFFFAOYSA-N 0.000 description 1
- PTDVPWWJRCOIIO-UHFFFAOYSA-N (4-methoxyphenyl)methanethiol Chemical compound COC1=CC=C(CS)C=C1 PTDVPWWJRCOIIO-UHFFFAOYSA-N 0.000 description 1
- AGFYZLVFPSGUIX-UHFFFAOYSA-N (4-methylphenyl)methanethiol Chemical compound CC1=CC=C(CS)C=C1 AGFYZLVFPSGUIX-UHFFFAOYSA-N 0.000 description 1
- BIGYLAKFCGVRAN-UHFFFAOYSA-N 1,3,4-thiadiazolidine-2,5-dithione Chemical compound S=C1NNC(=S)S1 BIGYLAKFCGVRAN-UHFFFAOYSA-N 0.000 description 1
- JYSUYJCLUODSLN-UHFFFAOYSA-N 1,3-benzothiazol-2-ylhydrazine Chemical compound C1=CC=C2SC(NN)=NC2=C1 JYSUYJCLUODSLN-UHFFFAOYSA-N 0.000 description 1
- DZZWKUMHMSNBSG-UHFFFAOYSA-N 1,3-bis(prop-2-enyl)thiourea Chemical compound C=CCNC(=S)NCC=C DZZWKUMHMSNBSG-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- VFCZSWPNOOGGAJ-UHFFFAOYSA-N 1,3-dinaphthalen-1-ylthiourea Chemical compound C1=CC=C2C(NC(NC=3C4=CC=CC=C4C=CC=3)=S)=CC=CC2=C1 VFCZSWPNOOGGAJ-UHFFFAOYSA-N 0.000 description 1
- RNGRBOULPSEYNL-UHFFFAOYSA-N 1,3-dioctylthiourea Chemical compound CCCCCCCCNC(=S)NCCCCCCCC RNGRBOULPSEYNL-UHFFFAOYSA-N 0.000 description 1
- YFBUDXNMBTUSOC-UHFFFAOYSA-N 1,4-dihydroquinoxaline-2,3-dithione Chemical compound C1=CC=C2NC(=S)C(=S)NC2=C1 YFBUDXNMBTUSOC-UHFFFAOYSA-N 0.000 description 1
- DDWXNUFFAFBJDG-UHFFFAOYSA-N 1-acetyl-2-sulfanylideneimidazolidin-4-one Chemical compound CC(=O)N1CC(=O)NC1=S DDWXNUFFAFBJDG-UHFFFAOYSA-N 0.000 description 1
- OROCFDLTBPBLFS-UHFFFAOYSA-N 1-ethyl-3-phenylthiourea Chemical compound CCNC(=S)NC1=CC=CC=C1 OROCFDLTBPBLFS-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- KXZSVYHFYHTNBI-UHFFFAOYSA-N 1h-quinoline-2-thione Chemical compound C1=CC=CC2=NC(S)=CC=C21 KXZSVYHFYHTNBI-UHFFFAOYSA-N 0.000 description 1
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical class SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 description 1
- LLCOQBODWBFTDD-UHFFFAOYSA-N 1h-triazol-1-ium-4-thiolate Chemical class SC1=CNN=N1 LLCOQBODWBFTDD-UHFFFAOYSA-N 0.000 description 1
- GIROESBYMDYHRL-UHFFFAOYSA-N 2,2-dimethyl-n-(4-sulfanylphenyl)propanamide Chemical compound CC(C)(C)C(=O)NC1=CC=C(S)C=C1 GIROESBYMDYHRL-UHFFFAOYSA-N 0.000 description 1
- YAJYJWXEWKRTPO-UHFFFAOYSA-N 2,3,3,4,4,5-hexamethylhexane-2-thiol Chemical compound CC(C)C(C)(C)C(C)(C)C(C)(C)S YAJYJWXEWKRTPO-UHFFFAOYSA-N 0.000 description 1
- PSYGHMBJXWRQFD-UHFFFAOYSA-N 2-(2-sulfanylacetyl)oxyethyl 2-sulfanylacetate Chemical compound SCC(=O)OCCOC(=O)CS PSYGHMBJXWRQFD-UHFFFAOYSA-N 0.000 description 1
- UCJMHYXRQZYNNL-UHFFFAOYSA-N 2-Ethyl-1-hexanethiol Chemical compound CCCCC(CC)CS UCJMHYXRQZYNNL-UHFFFAOYSA-N 0.000 description 1
- RFCQDOVPMUSZMN-UHFFFAOYSA-N 2-Naphthalenethiol Chemical compound C1=CC=CC2=CC(S)=CC=C21 RFCQDOVPMUSZMN-UHFFFAOYSA-N 0.000 description 1
- QUSTYFNPKBDELJ-UHFFFAOYSA-N 2-Pentanethiol Chemical compound CCCC(C)S QUSTYFNPKBDELJ-UHFFFAOYSA-N 0.000 description 1
- VEUMANXWQDHAJV-UHFFFAOYSA-N 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCN=CC1=CC=CC=C1O VEUMANXWQDHAJV-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 1
- BSQLQMLFTHJVKS-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole Chemical compound C1=CC=C2SC(Cl)=NC2=C1 BSQLQMLFTHJVKS-UHFFFAOYSA-N 0.000 description 1
- SHHKMWMIKILKQW-UHFFFAOYSA-N 2-formylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=O SHHKMWMIKILKQW-UHFFFAOYSA-N 0.000 description 1
- LHPMDXNKIJYBKN-UHFFFAOYSA-N 2-isocyanatobenzenethiol Chemical compound SC1=CC=CC=C1N=C=O LHPMDXNKIJYBKN-UHFFFAOYSA-N 0.000 description 1
- VZWOXDYRBDIHMA-UHFFFAOYSA-N 2-methyl-1,3-thiazole Chemical compound CC1=NC=CS1 VZWOXDYRBDIHMA-UHFFFAOYSA-N 0.000 description 1
- CBSLBOWGJCQDRN-UHFFFAOYSA-N 2-methyl-n-(4-sulfanylphenyl)propanamide Chemical compound CC(C)C(=O)NC1=CC=C(S)C=C1 CBSLBOWGJCQDRN-UHFFFAOYSA-N 0.000 description 1
- DYAOREPNYXXCOA-UHFFFAOYSA-N 2-sulfanylundecanoic acid Chemical compound CCCCCCCCCC(S)C(O)=O DYAOREPNYXXCOA-UHFFFAOYSA-N 0.000 description 1
- WRXOZRLZDJAYDR-UHFFFAOYSA-N 3-methylbenzenethiol Chemical compound CC1=CC=CC(S)=C1 WRXOZRLZDJAYDR-UHFFFAOYSA-N 0.000 description 1
- CLEJZSNZYFJMKD-UHFFFAOYSA-N 3h-1,3-oxazole-2-thione Chemical class SC1=NC=CO1 CLEJZSNZYFJMKD-UHFFFAOYSA-N 0.000 description 1
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical class SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 description 1
- WCDSVWRUXWCYFN-UHFFFAOYSA-N 4-aminobenzenethiol Chemical compound NC1=CC=C(S)C=C1 WCDSVWRUXWCYFN-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- ZVNPWFOVUDMGRP-UHFFFAOYSA-N 4-methylaminophenol sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 ZVNPWFOVUDMGRP-UHFFFAOYSA-N 0.000 description 1
- NIAAGQAEVGMHPM-UHFFFAOYSA-N 4-methylbenzene-1,2-dithiol Chemical compound CC1=CC=C(S)C(S)=C1 NIAAGQAEVGMHPM-UHFFFAOYSA-N 0.000 description 1
- OAZWGANOZRJBNF-UHFFFAOYSA-N 4-nitro-n-(4-sulfanylphenyl)benzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)NC1=CC=C(S)C=C1 OAZWGANOZRJBNF-UHFFFAOYSA-N 0.000 description 1
- AXBVSRMHOPMXBA-UHFFFAOYSA-N 4-nitrothiophenol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1 AXBVSRMHOPMXBA-UHFFFAOYSA-N 0.000 description 1
- FZXZNIDUTACSLM-UHFFFAOYSA-N 4-nonylbenzenethiol Chemical compound CCCCCCCCCC1=CC=C(S)C=C1 FZXZNIDUTACSLM-UHFFFAOYSA-N 0.000 description 1
- MKQSUDRDROCFNK-UHFFFAOYSA-N 4-phenyl-1,3,4-thiadiazinane-2-thione Chemical compound C1CSC(=S)NN1C1=CC=CC=C1 MKQSUDRDROCFNK-UHFFFAOYSA-N 0.000 description 1
- KKIGUVBJOHCXSP-UHFFFAOYSA-N 4-phenylthiosemicarbazide Chemical compound NNC(=S)NC1=CC=CC=C1 KKIGUVBJOHCXSP-UHFFFAOYSA-N 0.000 description 1
- DUZJXKYBSMFDIU-UHFFFAOYSA-N 4-tert-butyl-2-methylbenzenethiol Chemical compound CC1=CC(C(C)(C)C)=CC=C1S DUZJXKYBSMFDIU-UHFFFAOYSA-N 0.000 description 1
- GNXBFFHXJDZGEK-UHFFFAOYSA-N 4-tert-butylbenzenethiol Chemical compound CC(C)(C)C1=CC=C(S)C=C1 GNXBFFHXJDZGEK-UHFFFAOYSA-N 0.000 description 1
- YANSPMBIFXPLFE-UHFFFAOYSA-N 5,6-dimethoxy-3h-1,3-benzothiazole-2-thione Chemical compound C1=C(OC)C(OC)=CC2=C1SC(S)=N2 YANSPMBIFXPLFE-UHFFFAOYSA-N 0.000 description 1
- DAJICUYKPNPGQQ-UHFFFAOYSA-N 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one Chemical compound OC1=CC=CC=C1C=C1C(=O)NC(=S)N1 DAJICUYKPNPGQQ-UHFFFAOYSA-N 0.000 description 1
- HOJIICWYDFQRKH-UHFFFAOYSA-N 5-[(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)sulfanyl]-3h-1,3,4-thiadiazole-2-thione Chemical compound S1C(=S)NN=C1SC1=NNC(=S)S1 HOJIICWYDFQRKH-UHFFFAOYSA-N 0.000 description 1
- BXDMTLVCACMNJO-UHFFFAOYSA-N 5-amino-1,3-dihydrobenzimidazole-2-thione Chemical compound NC1=CC=C2NC(S)=NC2=C1 BXDMTLVCACMNJO-UHFFFAOYSA-N 0.000 description 1
- YPXQSGWOGQPLQO-UHFFFAOYSA-N 5-nitro-1,3-dihydrobenzimidazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2N=C(S)NC2=C1 YPXQSGWOGQPLQO-UHFFFAOYSA-N 0.000 description 1
- IDPNFKLUBIKHSW-UHFFFAOYSA-N 6-amino-3h-1,3-benzothiazole-2-thione Chemical compound NC1=CC=C2N=C(S)SC2=C1 IDPNFKLUBIKHSW-UHFFFAOYSA-N 0.000 description 1
- MZZZAWDOYQWKMR-UHFFFAOYSA-N 6-methyl-1h-benzimidazol-2-amine Chemical compound CC1=CC=C2N=C(N)NC2=C1 MZZZAWDOYQWKMR-UHFFFAOYSA-N 0.000 description 1
- ZHUWXKIPGGZNJW-UHFFFAOYSA-N 6-methylheptyl 3-sulfanylpropanoate Chemical compound CC(C)CCCCCOC(=O)CCS ZHUWXKIPGGZNJW-UHFFFAOYSA-N 0.000 description 1
- QPOZGXKWWKLJDK-UHFFFAOYSA-N 6-nitro-3h-1,3-benzothiazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2NC(=S)SC2=C1 QPOZGXKWWKLJDK-UHFFFAOYSA-N 0.000 description 1
- PIVQQUNOTICCSA-UHFFFAOYSA-N ANTU Chemical compound C1=CC=C2C(NC(=S)N)=CC=CC2=C1 PIVQQUNOTICCSA-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- KFFQABQEJATQAT-UHFFFAOYSA-N N,N'-dibutylthiourea Chemical compound CCCCNC(=S)NCCCC KFFQABQEJATQAT-UHFFFAOYSA-N 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 1
- 229910019093 NaOCl Inorganic materials 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- VBIIFPGSPJYLRR-UHFFFAOYSA-M Stearyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)C VBIIFPGSPJYLRR-UHFFFAOYSA-M 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 240000003834 Triticum spelta Species 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000011126 aluminium potassium sulphate Nutrition 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Natural products C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- WDODWFPDZYSKIA-UHFFFAOYSA-N benzeneselenol Chemical compound [SeH]C1=CC=CC=C1 WDODWFPDZYSKIA-UHFFFAOYSA-N 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000005234 chemical deposition Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- VTXVGVNLYGSIAR-UHFFFAOYSA-N decane-1-thiol Chemical compound CCCCCCCCCCS VTXVGVNLYGSIAR-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- WQABCVAJNWAXTE-UHFFFAOYSA-N dimercaprol Chemical compound OCC(S)CS WQABCVAJNWAXTE-UHFFFAOYSA-N 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical compound [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- UAYKGOMDUQLCJS-UHFFFAOYSA-N ethylsulfanyl acetate Chemical compound CCSOC(C)=O UAYKGOMDUQLCJS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ZTPPOODTZGGFIU-UHFFFAOYSA-N n-(2-sulfanylidene-3h-1,3-benzothiazol-6-yl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)NC1=CC=C2NC(=S)SC2=C1 ZTPPOODTZGGFIU-UHFFFAOYSA-N 0.000 description 1
- AYEQJLOHMLYKAV-UHFFFAOYSA-N n-(4-sulfanylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S)C=C1 AYEQJLOHMLYKAV-UHFFFAOYSA-N 0.000 description 1
- DLVKRCGYGJZXFK-UHFFFAOYSA-N n-phenyl-2-sulfanylacetamide Chemical compound SCC(=O)NC1=CC=CC=C1 DLVKRCGYGJZXFK-UHFFFAOYSA-N 0.000 description 1
- BOQKCADLPNLYCZ-UHFFFAOYSA-N n-phenylbenzenecarbothioamide Chemical compound C=1C=CC=CC=1C(=S)NC1=CC=CC=C1 BOQKCADLPNLYCZ-UHFFFAOYSA-N 0.000 description 1
- MWCGLTCRJJFXKR-UHFFFAOYSA-N n-phenylethanethioamide Chemical compound CC(=S)NC1=CC=CC=C1 MWCGLTCRJJFXKR-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- ZVEZMVFBMOOHAT-UHFFFAOYSA-N nonane-1-thiol Chemical compound CCCCCCCCCS ZVEZMVFBMOOHAT-UHFFFAOYSA-N 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 1
- 239000006259 organic additive Substances 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229940050271 potassium alum Drugs 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 229940065287 selenium compound Drugs 0.000 description 1
- IYKVLICPFCEZOF-UHFFFAOYSA-N selenourea Chemical compound NC(N)=[Se] IYKVLICPFCEZOF-UHFFFAOYSA-N 0.000 description 1
- HAAYBYDROVFKPU-UHFFFAOYSA-N silver;azane;nitrate Chemical compound N.N.[Ag+].[O-][N+]([O-])=O HAAYBYDROVFKPU-UHFFFAOYSA-N 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- VPQBLCVGUWPDHV-UHFFFAOYSA-N sodium selenide Chemical compound [Na+].[Na+].[Se-2] VPQBLCVGUWPDHV-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C391/00—Compounds containing selenium
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D293/00—Heterocyclic compounds containing rings having nitrogen and selenium or nitrogen and tellurium, with or without oxygen or sulfur atoms, as the ring hetero atoms
- C07D293/10—Heterocyclic compounds containing rings having nitrogen and selenium or nitrogen and tellurium, with or without oxygen or sulfur atoms, as the ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D293/12—Selenazoles; Hydrogenated selenazoles
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/492—Photosoluble emulsions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US15813261A | 1961-12-08 | 1961-12-08 | |
| US236417A US3155515A (en) | 1961-12-08 | 1962-11-08 | Photographic products |
| US236412A US3155514A (en) | 1961-12-08 | 1962-11-08 | Photographic compositions and elements |
| US236420A US3155507A (en) | 1961-12-08 | 1962-11-08 | Photographic processes |
| US236418A US3155516A (en) | 1961-12-08 | 1962-11-08 | Photographic products |
| US317824A US3155519A (en) | 1961-12-08 | 1963-10-21 | Photographic compositions, layers and elements |
| NL6408533A NL6408533A (index.php) | 1961-12-08 | 1964-07-24 | |
| US388919A US3418124A (en) | 1961-12-08 | 1964-08-11 | High contrast direct positive by using active cations in silver halide solvent |
| US390460A US3384485A (en) | 1961-12-08 | 1964-08-18 | Silver halide emulsions photosolubilized with optical sensitizing dyes and silver mercaptides |
| US403661A US3284206A (en) | 1961-12-08 | 1964-10-13 | Image yielding layers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1261397B true DE1261397B (de) | 1968-02-15 |
Family
ID=27580572
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP30721A Pending DE1261397B (de) | 1961-12-08 | 1962-12-07 | Photographisches Verfahren zur Herstellung positiver Bilder |
| DEP30723A Pending DE1226877B (de) | 1961-12-08 | 1962-12-07 | Photographische Silberhalogenidemulsion |
| DEP37430A Pending DE1294186B (de) | 1961-12-08 | 1965-08-10 | Photographisches Verfahren zur Herstellung positiver Bilder |
| DEP37479A Pending DE1293581B (de) | 1961-12-08 | 1965-08-18 | Photographische Silberhalogenidemulsion |
| DEP37856A Pending DE1293582B (de) | 1961-12-08 | 1965-10-13 | Photographische Silberhalogenidemulsion |
Family Applications After (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP30723A Pending DE1226877B (de) | 1961-12-08 | 1962-12-07 | Photographische Silberhalogenidemulsion |
| DEP37430A Pending DE1294186B (de) | 1961-12-08 | 1965-08-10 | Photographisches Verfahren zur Herstellung positiver Bilder |
| DEP37479A Pending DE1293581B (de) | 1961-12-08 | 1965-08-18 | Photographische Silberhalogenidemulsion |
| DEP37856A Pending DE1293582B (de) | 1961-12-08 | 1965-10-13 | Photographische Silberhalogenidemulsion |
Country Status (5)
| Country | Link |
|---|---|
| US (8) | US3155515A (index.php) |
| BE (1) | BE670823A (index.php) |
| DE (5) | DE1261397B (index.php) |
| FR (1) | FR89467E (index.php) |
| GB (4) | GB1031902A (index.php) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR89467E (index.php) * | 1961-12-08 | |||
| US3379529A (en) * | 1963-02-28 | 1968-04-23 | Eastman Kodak Co | Photographic inhibitor-releasing developers |
| US3368898A (en) * | 1963-10-17 | 1968-02-13 | Gen Aniline & Film Corp | Autopositive film and paper and emulsions therefor |
| DE1281842B (de) * | 1964-06-22 | 1968-10-31 | Du Pont | Fotografisches Aufzeichnungsmaterial mit einer fotoloeslichen Schicht |
| US3341574A (en) * | 1964-09-18 | 1967-09-12 | Celanese Corp | Di-(neopentylglycol mononeoheptanoate)azelate |
| US3407068A (en) * | 1964-10-13 | 1968-10-22 | Du Pont | Photosolubilization |
| US3407067A (en) * | 1964-10-13 | 1968-10-22 | Du Pont | Photosolubilization with mercaptooxazoles |
| US3394005A (en) * | 1964-10-16 | 1968-07-23 | Du Pont | Increased development rate of photosoluble silver halide emulsions by the action of water-soluble iodide |
| US3377169A (en) * | 1965-03-30 | 1968-04-09 | Du Pont | Copper thallium and lead halide and pseudohalides photosoluble crystals |
| US3458318A (en) * | 1965-08-02 | 1969-07-29 | Eastman Kodak Co | Supersensitized silver halide emulsions |
| US3451819A (en) * | 1965-08-09 | 1969-06-24 | Du Pont | Photosoluble silver halide emulsion made spontaneously developable with amine boranes |
| US3464822A (en) * | 1965-09-13 | 1969-09-02 | Du Pont | Process for making electrically conductive images |
| GB1178800A (en) * | 1966-03-01 | 1970-01-21 | Minnesota Mining & Mfg | Improvements in or relating to Copying Materials |
| US3486895A (en) * | 1966-04-29 | 1969-12-30 | Du Pont | Process for obtaining artistic effects in photosoluble direct positive silver halide emulsions |
| US3495982A (en) * | 1967-06-23 | 1970-02-17 | Du Pont | Process for dissolution development using thiourea compounds as dmax maintainers |
| US3628956A (en) * | 1967-12-08 | 1971-12-21 | Du Pont | Process for preparing direct positive images by photosolubilization |
| US3862352A (en) * | 1968-04-16 | 1975-01-21 | Itek Corp | Photographically prepared electrical circuits wherein the photosensitive material is a photoconductor |
| US3647439A (en) * | 1968-10-01 | 1972-03-07 | Eastman Kodak Co | Photographic element, composition and process |
| US3649289A (en) * | 1968-10-21 | 1972-03-14 | Eastman Kodak Co | Photographic materials |
| US3653899A (en) * | 1968-11-12 | 1972-04-04 | Eastman Kodak Co | Photographic materials and processes |
| US3640717A (en) * | 1969-06-05 | 1972-02-08 | Itek Corp | Photographic reversal process employing organic mercaptan compounds |
| US3652279A (en) * | 1969-07-18 | 1972-03-28 | Du Pont | Nitrogen-containing dmax maintainers for use in photosoluble emulsions |
| US4014699A (en) * | 1973-05-17 | 1977-03-29 | Ciba-Geigy Ag | Preparation for the processing of photographic materials |
| GB1548395A (en) * | 1975-05-29 | 1979-07-11 | Eastman Kodak Co | Photographic materials |
| GB1580212A (en) * | 1976-03-29 | 1980-11-26 | Agfa Gevaert | Antifogging and/or stabilizing compounds for silver halide photography |
| JPS53134430A (en) * | 1977-04-27 | 1978-11-24 | Mitsubishi Paper Mills Ltd | Silver halide photosensitive materials for multiilayer color photograph |
| DE2931690A1 (de) * | 1979-08-04 | 1981-02-19 | Agfa Gevaert Ag | Photographische emulsion, verfahren zur herstellung sowie photographische materialien |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE445753C (de) * | 1926-05-21 | 1927-09-24 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von lichtempfindlichen Silbersalzemulsionen |
| DE548323C (de) * | 1929-02-25 | 1932-04-09 | Kodak Akt Ges | Verfahren zum Stabilisieren einer Silberhalogenemulsion |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2025876A (en) * | 1931-04-11 | 1935-12-31 | Du Pont | Preparation of aryl-amines |
| US2131038A (en) * | 1932-05-26 | 1938-09-27 | Eastman Kodak Co | Photographic emulsion containing alkyl quaternary salts of thiazoles and the like asantifoggants |
| GB477628A (en) * | 1936-08-14 | 1938-01-04 | Albert Steigmann | Method of preventing yellow stain in photographs |
| US2214446A (en) * | 1938-05-10 | 1940-09-10 | Gen Aniline & Film Corp | Photographic development of silver halide layers |
| US2195150A (en) * | 1938-06-16 | 1940-03-26 | Ilford Ltd | Stabilization of photographic emulsions |
| US2520358A (en) * | 1948-09-04 | 1950-08-29 | Eastman Kodak Co | Heterocyclic bis acetones, thioacetones, and selenoacetones |
| US2710256A (en) * | 1951-04-25 | 1955-06-07 | Gen Aniline & Film Corp | Photographic print-out process |
| BE511060A (index.php) * | 1951-04-30 | |||
| US2985661A (en) * | 1956-02-06 | 1961-05-23 | American Cyanamid Co | Preparation of 2(omicron-aminophenyl)-benzimidazole |
| BE555103A (index.php) * | 1956-02-18 | |||
| BE557661A (index.php) * | 1956-05-23 | |||
| US3038800A (en) * | 1957-12-19 | 1962-06-12 | Eastman Kodak Co | Photopolymerization of olefinicallyunsaturated monomers by silver halides |
| BE582161A (index.php) * | 1958-08-29 | |||
| BE584391A (index.php) * | 1958-11-07 | |||
| BE602317A (index.php) * | 1960-04-11 | |||
| US3046130A (en) * | 1960-05-12 | 1962-07-24 | Gen Aniline & Film Corp | Photographic materials containing a chemical sensitizer |
| US3155518A (en) * | 1963-10-21 | 1964-11-03 | Du Pont | Silver halide compositions, layers and elements |
| FR89467E (index.php) * | 1961-12-08 |
-
0
- FR FR89467D patent/FR89467E/fr active Active
-
1962
- 1962-11-08 US US236417A patent/US3155515A/en not_active Expired - Lifetime
- 1962-11-08 US US236420A patent/US3155507A/en not_active Expired - Lifetime
- 1962-11-08 US US236412A patent/US3155514A/en not_active Expired - Lifetime
- 1962-11-08 US US236418A patent/US3155516A/en not_active Expired - Lifetime
- 1962-12-07 DE DEP30721A patent/DE1261397B/de active Pending
- 1962-12-07 GB GB46344/62A patent/GB1031902A/en not_active Expired
- 1962-12-07 GB GB46345/62A patent/GB1031903A/en not_active Expired
- 1962-12-07 DE DEP30723A patent/DE1226877B/de active Pending
-
1963
- 1963-10-21 US US317824A patent/US3155519A/en not_active Expired - Lifetime
-
1964
- 1964-08-11 US US388919A patent/US3418124A/en not_active Expired - Lifetime
- 1964-08-18 US US390460A patent/US3384485A/en not_active Expired - Lifetime
- 1964-10-13 US US403661A patent/US3284206A/en not_active Expired - Lifetime
-
1965
- 1965-08-10 DE DEP37430A patent/DE1294186B/de active Pending
- 1965-08-10 GB GB34231/65A patent/GB1111226A/en not_active Expired
- 1965-08-18 DE DEP37479A patent/DE1293581B/de active Pending
- 1965-10-12 BE BE670823D patent/BE670823A/xx unknown
- 1965-10-12 GB GB43289/65A patent/GB1124772A/en not_active Expired
- 1965-10-13 DE DEP37856A patent/DE1293582B/de active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE445753C (de) * | 1926-05-21 | 1927-09-24 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von lichtempfindlichen Silbersalzemulsionen |
| DE473000C (de) * | 1926-05-21 | 1929-03-08 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von lichtempfindlichen Silbersalzemulsionen |
| DE548323C (de) * | 1929-02-25 | 1932-04-09 | Kodak Akt Ges | Verfahren zum Stabilisieren einer Silberhalogenemulsion |
Also Published As
| Publication number | Publication date |
|---|---|
| FR89467E (index.php) | |
| US3155515A (en) | 1964-11-03 |
| GB1031902A (en) | 1966-06-02 |
| US3155516A (en) | 1964-11-03 |
| GB1031903A (en) | 1966-06-02 |
| GB1111226A (en) | 1968-04-24 |
| US3155514A (en) | 1964-11-03 |
| DE1293581B (de) | 1969-04-24 |
| DE1226877B (de) | 1966-10-13 |
| US3155507A (en) | 1964-11-03 |
| DE1294186B (de) | 1969-09-11 |
| US3418124A (en) | 1968-12-24 |
| GB1124772A (en) | 1968-08-21 |
| US3284206A (en) | 1966-11-08 |
| US3155519A (en) | 1964-11-03 |
| BE670823A (index.php) | 1966-04-12 |
| US3384485A (en) | 1968-05-21 |
| DE1293582B (de) | 1969-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1261397B (de) | Photographisches Verfahren zur Herstellung positiver Bilder | |
| DE1522405A1 (de) | Silberhalogenidemulsionen und solche Emulsionen enthaltendes photographisches Material | |
| DE2026252B2 (de) | Schnellverarbeitung von photographischem Material | |
| DE1170778B (de) | Silberhalogenid-Auskopieremulsion mit einem Gehalt an einem Schwermetallsalz | |
| DE884150C (de) | Verfahren zur Erzeugung eines direktpositiven Bildes in einer Silberhalogenid-Emulsion | |
| DE1597541A1 (de) | Verwendung von Alkalisalzen mehrbasischer,mindestens eine Hydroxylgruppe aufweisender,organischer Saeuren als Oxydationsinhibitoren bei der Entwicklung photographischer Materialien | |
| DE2200504A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2040131C2 (de) | Mehrschichtiges direkpositives photographisches Aufzeichnungsmaterial | |
| DE1447629A1 (de) | Photographisches Material | |
| DE3014049A1 (de) | Verfahren zur schaffung eines negativen bildes | |
| DE1064807B (de) | Photographisches Silbersalz-Diffusionsuebertragungsverfahren | |
| DE1175074B (de) | Photographisches Material mit einer Halogen-silberemulsionsschicht, die das Fixierenueberfluessig macht | |
| DE892553C (de) | Verfahren zur photographischen Herstellung von Kontrasten | |
| DE1597540A1 (de) | Verwendung von Oniumhalogeniden als Silberhalogenidkomplexbildner zum Stabilisieren photographischer Silberhalogenidbilder | |
| DE2164275A1 (de) | Photographisches lichtempfindliches direktes Umkehrsilberhalogenidmaterial | |
| DE2112728C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE1923824A1 (de) | Verfahren zum Entwickeln und Stabilisieren von bildgerecht belichteten und gegebenenfalls photoentwickelten Silberhalogenid- Aufzeichnungsmaterialien vom Innenbildtyp | |
| DE1296980B (de) | Verfahren zur Herstellung von negativen Bildern | |
| DE1922240C2 (de) | Verfahren zur Herstellung von photographischen Bildern durch Schnellverarbeitung | |
| CH479898A (de) | Photographisches Verfahren | |
| DE69308016T2 (de) | Photographisches verarbeitungsverfahren und verwendung photographischer produkte mit einer feinkorndeckschicht | |
| DE3123235A1 (de) | Photographisches verfahren zur herstellung eines bildes | |
| DE2607895A1 (de) | Verfahren zum entwickeln eines lichtempfindlichen photographischen silberhalogenidmaterials | |
| DE2163225A1 (de) | Sensibilisierte photographische Silberhalogenidemulsion | |
| DE1772705A1 (de) | Fotoloesliche Schichten und Verfahren zur Herstellung von direkt positiven Silberhalogenidbildern daraus |