SK280940B6 - Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu - Google Patents
Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu Download PDFInfo
- Publication number
- SK280940B6 SK280940B6 SK503-98A SK50398A SK280940B6 SK 280940 B6 SK280940 B6 SK 280940B6 SK 50398 A SK50398 A SK 50398A SK 280940 B6 SK280940 B6 SK 280940B6
- Authority
- SK
- Slovakia
- Prior art keywords
- formula
- acetate
- dioxane
- cis
- dimethylethyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 28
- DPNRMEJBKMQHMC-GHMZBOCLSA-N tert-butyl 2-[(4r,6r)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate Chemical compound CC(C)(C)OC(=O)C[C@H]1C[C@@H](CC#N)OC(C)(C)O1 DPNRMEJBKMQHMC-GHMZBOCLSA-N 0.000 title claims abstract description 16
- 239000000543 intermediate Substances 0.000 title claims abstract description 9
- 230000015572 biosynthetic process Effects 0.000 title claims description 4
- 238000003786 synthesis reaction Methods 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 37
- 239000002904 solvent Substances 0.000 claims abstract description 21
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 8
- 150000002367 halogens Chemical class 0.000 claims abstract description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 125000001424 substituent group Chemical group 0.000 claims abstract description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 5
- 229910052709 silver Inorganic materials 0.000 claims abstract description 4
- 239000004332 silver Substances 0.000 claims abstract description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000011630 iodine Substances 0.000 claims abstract description 3
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 51
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 19
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 10
- 238000010992 reflux Methods 0.000 claims description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 5
- 235000009518 sodium iodide Nutrition 0.000 claims description 5
- -1 sulfonyloxymethyl Chemical group 0.000 claims description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 5
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 4
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 claims description 2
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 claims description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 claims description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 claims description 2
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 claims description 2
- ZRXHLJNBNWVNIM-UHFFFAOYSA-N 3-methyl-1-benzofuran Chemical compound C1=CC=C2C(C)=COC2=C1 ZRXHLJNBNWVNIM-UHFFFAOYSA-N 0.000 claims 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 claims 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 claims 1
- LFAGQMCIGQNPJG-UHFFFAOYSA-N silver cyanide Chemical compound [Ag+].N#[C-] LFAGQMCIGQNPJG-UHFFFAOYSA-N 0.000 claims 1
- 229940098221 silver cyanide Drugs 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 abstract 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 abstract 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 238000002360 preparation method Methods 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000010410 layer Substances 0.000 description 17
- 238000003756 stirring Methods 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N methyl cyanide Natural products CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 5
- HWSHVKNLMBMKSR-GHMZBOCLSA-N tert-butyl 2-[(4r,6r)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate Chemical compound CC(C)(C)OC(=O)C[C@H]1C[C@@H](CCN)OC(C)(C)O1 HWSHVKNLMBMKSR-GHMZBOCLSA-N 0.000 description 5
- CFRUAOXMCVQMFP-ZJUUUORDSA-N tert-butyl 2-[(4r,6s)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate Chemical compound CC(C)(C)OC(=O)C[C@H]1C[C@@H](CO)OC(C)(C)O1 CFRUAOXMCVQMFP-ZJUUUORDSA-N 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 4-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1 ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 238000003822 preparative gas chromatography Methods 0.000 description 4
- WPHUUIODWRNJLO-UHFFFAOYSA-N 2-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1S(Cl)(=O)=O WPHUUIODWRNJLO-UHFFFAOYSA-N 0.000 description 3
- ADHRFDCBLJVNFO-UHFFFAOYSA-N 4-methyl-3-oxo-n-phenylpentanamide Chemical compound CC(C)C(=O)CC(=O)NC1=CC=CC=C1 ADHRFDCBLJVNFO-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 239000003529 anticholesteremic agent Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 150000002596 lactones Chemical group 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical group C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 2
- BBMPIRYEXVCAFU-UHFFFAOYSA-N 1-ethylpyrrole-3-carboxamide Chemical compound CCN1C=CC(C(N)=O)=C1 BBMPIRYEXVCAFU-UHFFFAOYSA-N 0.000 description 2
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 2
- BXCOSWRSIISQSL-UHFFFAOYSA-N 2,5-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 BXCOSWRSIISQSL-UHFFFAOYSA-N 0.000 description 2
- SMUFHBOCNIUNPT-UHFFFAOYSA-N 2-benzylidene-4-methyl-3-oxo-n-phenylpentanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C(C)C)=CC1=CC=CC=C1 SMUFHBOCNIUNPT-UHFFFAOYSA-N 0.000 description 2
- 102100029077 3-hydroxy-3-methylglutaryl-coenzyme A reductase Human genes 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- KMMHZIBWCXYAAH-UHFFFAOYSA-N 4-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=C1 KMMHZIBWCXYAAH-UHFFFAOYSA-N 0.000 description 2
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000003524 antilipemic agent Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000000055 hyoplipidemic effect Effects 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 150000000093 1,3-dioxanes Chemical class 0.000 description 1
- BDQRQMLWZJQQKS-UHFFFAOYSA-M 2-(3-ethyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethanol;bromide Chemical compound [Br-].CC[N+]1=CSC(CCO)=C1C BDQRQMLWZJQQKS-UHFFFAOYSA-M 0.000 description 1
- 101710158485 3-hydroxy-3-methylglutaryl-coenzyme A reductase Proteins 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 108090000895 Hydroxymethylglutaryl CoA Reductases Proteins 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- HPEFKYWMASOUHW-UHFFFAOYSA-N OCOC(CC1OC(OCC1)(C)C)=O Chemical compound OCOC(CC1OC(OCC1)(C)C)=O HPEFKYWMASOUHW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940000635 beta-alanine Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- HVVZWNFILGLKRH-UHFFFAOYSA-N ethyl 2-(2,2-dimethyl-1,3-dioxan-4-yl)acetate Chemical compound CCOC(=O)CC1CCOC(C)(C)O1 HVVZWNFILGLKRH-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- HNNFDXWDCFCVDM-UHFFFAOYSA-N methyl 4-methyl-3-oxopentanoate Chemical compound COC(=O)CC(=O)C(C)C HNNFDXWDCFCVDM-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- XDRYMKDFEDOLFX-UHFFFAOYSA-N pentamidine Chemical compound C1=CC(C(=N)N)=CC=C1OCCCCCOC1=CC=C(C(N)=N)C=C1 XDRYMKDFEDOLFX-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001639 phenylmethylene group Chemical group [H]C(=*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- NPPZOMYSGNZDKY-ROJLCIKYSA-N tert-butyl 2-[(4r,6r)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@H]2OC(C)(C)O[C@@H](CC(=O)OC(C)(C)C)C2)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 NPPZOMYSGNZDKY-ROJLCIKYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/599,521 US5103024A (en) | 1990-10-17 | 1990-10-17 | Process for the synthesis of (4r-cis)-1,1-dimethylethyl 6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate |
| PCT/US1991/006697 WO1992006968A1 (en) | 1990-10-17 | 1991-09-11 | Process for the synthesis of (4r-cis)-1,1-dimethylethyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SK280940B6 true SK280940B6 (sk) | 2000-09-12 |
Family
ID=24399962
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK503-98A SK280940B6 (sk) | 1990-10-17 | 1991-09-11 | Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu |
| SK504-98A SK280941B6 (sk) | 1990-10-17 | 1991-09-11 | (4r-cis)-1,1-dimetyletyl-6-arylsulfonyloxymetyl-2,2-dimetyl- -1,3-dioxán-4-acetáty a spôsob ich syntézy |
| SK505-98A SK280942B6 (sk) | 1990-10-17 | 1991-09-11 | (4r-cis)-1,1-dimetyletyl-6-jódmetyl-2,2-dimetyl-1,3-dioxán-4- -acetát, spôsob jeho syntézy a medziprodukty na túto syntézu |
| SK502-98A SK280939B6 (sk) | 1990-10-17 | 1991-09-11 | Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu |
| SK339-93A SK280938B6 (sk) | 1990-10-17 | 1991-09-11 | Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu |
Family Applications After (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK504-98A SK280941B6 (sk) | 1990-10-17 | 1991-09-11 | (4r-cis)-1,1-dimetyletyl-6-arylsulfonyloxymetyl-2,2-dimetyl- -1,3-dioxán-4-acetáty a spôsob ich syntézy |
| SK505-98A SK280942B6 (sk) | 1990-10-17 | 1991-09-11 | (4r-cis)-1,1-dimetyletyl-6-jódmetyl-2,2-dimetyl-1,3-dioxán-4- -acetát, spôsob jeho syntézy a medziprodukty na túto syntézu |
| SK502-98A SK280939B6 (sk) | 1990-10-17 | 1991-09-11 | Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu |
| SK339-93A SK280938B6 (sk) | 1990-10-17 | 1991-09-11 | Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US5103024A (cs) |
| EP (1) | EP0553213B1 (cs) |
| JP (1) | JP3105923B2 (cs) |
| KR (1) | KR0166385B1 (cs) |
| AT (1) | ATE118772T1 (cs) |
| AU (1) | AU646311B2 (cs) |
| CA (1) | CA2092997C (cs) |
| CZ (5) | CZ124697A3 (cs) |
| DE (1) | DE69107622T2 (cs) |
| DK (1) | DK0553213T3 (cs) |
| ES (1) | ES2070519T3 (cs) |
| FI (1) | FI108539B (cs) |
| HU (2) | HU213731B (cs) |
| IE (1) | IE62940B1 (cs) |
| NO (1) | NO301588B1 (cs) |
| PT (1) | PT99244B (cs) |
| RU (1) | RU2067580C1 (cs) |
| SK (5) | SK280940B6 (cs) |
| WO (1) | WO1992006968A1 (cs) |
Families Citing this family (74)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245047A (en) * | 1988-02-22 | 1993-09-14 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| US5149837A (en) * | 1988-02-22 | 1992-09-22 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| US5298627A (en) * | 1993-03-03 | 1994-03-29 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| HRP960312B1 (en) | 1995-07-17 | 2001-10-31 | Warner Lambert Co | NOVEL PROCESS FOR THE PRODUCTION OF AMORPHOUS /R-(R*, R*)/-2-(4-FLUOROPHENYL)-"beta", "delta"-DIHYDROXY-5-PHENYL-4-/(PHENYLAMINO)CARBONYL/-1H-PYRROLE -1-HEPTANOIC ACID CALCIUM SALT (2 : 1) |
| US6087511A (en) * | 1996-07-16 | 2000-07-11 | Warner-Lambert Company | Process for the production of amorphous [R-(R*,R*)]-2-(4-fluorophenyl)-β,δ-dihydroxy-5-(1-methylethyl )-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoic acid) calcium salt (2:1) |
| WO1999057109A1 (en) * | 1998-04-30 | 1999-11-11 | Kaneka Corporation | Process for producing 6-cyanomethyl-1,3-dioxane-4-acetic acid derivatives |
| HU227840B1 (en) * | 1999-05-06 | 2012-05-02 | Egis Gyogyszergyar Nyilvanosan M Kod Ruszvunytarsasag | Intermediates of atorvastatin synthesis and process for producing them |
| IN191236B (cs) | 1999-05-25 | 2003-10-11 | Ranbaxy Lab Ltd | |
| US20040063969A1 (en) * | 1999-10-18 | 2004-04-01 | Egis Gyogyszergyar Rt. | Process for the preparation of amorphous atorvastatin calcium |
| ATE320415T1 (de) * | 1999-12-17 | 2006-04-15 | Pfizer Science & Tech Ltd | Verfahren zur herstellung von kristallin atorvastin kalcium |
| AU776613B2 (en) | 1999-12-17 | 2004-09-16 | Pfizer Science And Technology Ireland Limited | A factory scale process for producing crystalline atorvastatin trihydrate hemi calcium salt |
| US7608445B1 (en) | 1999-12-29 | 2009-10-27 | Verenium Corporation | Nitrilases, nucleic acids encoding them and methods for making and using them |
| US20040014195A1 (en) * | 1999-12-29 | 2004-01-22 | Diversa Corporation | Nitrilases, nucleic acids encoding them and methods for making and using them |
| US7521216B2 (en) * | 1999-12-29 | 2009-04-21 | Verenium Corporation | Nitrilases and methods for making and using them |
| US7300775B2 (en) | 1999-12-29 | 2007-11-27 | Verenium Corporation | Methods for producing α-substituted carboxylic acids using nitrilases and strecker reagents |
| JP3844112B2 (ja) | 2000-08-23 | 2006-11-08 | 高砂香料工業株式会社 | 3,5,6−トリヒドロキシヘキサン酸アンモニウム塩誘導体、及びその製造方法 |
| EP1728785A1 (en) | 2001-01-09 | 2006-12-06 | Warner-Lambert Company LLC | 7-[(2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-phenylcarbamoyl-pyrrol-1-yl]-heptanoic acid ester 3,5-dioxo-acetal |
| US6476235B2 (en) * | 2001-01-09 | 2002-11-05 | Warner-Lambert Company | Process for the synthesis of 5-(4-fluorophenyl)-1-[2-((2R,4R)-4-hydroxy-6-oxo-tetrahydro-pyran-2-yl)-ethyl]-2-isopropyl-4-phenyl-1H-pyrrole-3-carboxylic acid phenylamide |
| WO2002057229A1 (en) * | 2001-01-19 | 2002-07-25 | Biocon India Limited | FORM V CRYSTALLINE [R-(R*,R*)]-2-(4-FLUOROPHENYL)-ß,$G(D)-DIHYDROXY-5-(1-METHYLETHYL)-3-PHENYL-4-[(PHENYLAMINO)CARBONYL]-1H-PYRROLE-1- HEPTANOIC ACID HEMI CALCIUM SALT. (ATORVASTATIN) |
| SI20814A (sl) | 2001-01-23 | 2002-08-31 | LEK, tovarna farmacevtskih in kemi�nih izdelkov, d.d. | Priprava amorfnega atorvastatina |
| SI20848A (sl) | 2001-03-14 | 2002-10-31 | Lek, Tovarna Farmacevtskih In Kemijskih Izdelkov, D.D. | Farmacevtska formulacija, ki vsebuje atorvastatin kalcij |
| NZ529557A (en) * | 2001-06-29 | 2005-05-27 | Warner Lambert Co | Crystalline forms of `R-(R*,R*)!-2-(4-fluorophenyl)- beta, delta-dihydroxy-5-(1-methylethyl)-3-phenyl-4- 'phenylamino)carbonyl!-1H-pyrrole-1-heptanoic acid calcium salt (2:1) (atorvastatin) |
| GB0116212D0 (en) * | 2001-07-03 | 2001-08-29 | Avecia Ltd | Process |
| RU2304139C2 (ru) | 2001-07-30 | 2007-08-10 | Д-р Редди'с Лабораторис Лтд | Кристаллические формы vi и vii кальциевой соли аторвастатина |
| US20030114497A1 (en) * | 2001-07-31 | 2003-06-19 | Laman Alani | Pharmaceutical compositions of amlodipine and atorvastatin |
| EP1572638A4 (en) * | 2001-08-31 | 2010-05-05 | Morepen Lab Ltd | IMPROVED METHOD FOR THE PRODUCTION OF AMORPHIC ATORVASTATIN CALCIUM SALT (2: 1) |
| HU227124B1 (en) * | 2001-09-14 | 2010-07-28 | Egis Gyogyszergyar Nyilvanosan | Polymorphs of 1-pyrrole derivative, intermediate for the preparation of atorvastatin |
| UA77990C2 (en) * | 2001-12-12 | 2007-02-15 | Crystalline calcium salt of (2:1) [r-(r*,r*)]-2-(4-fluorophenyl)-?,?-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1h-pyrroleheptanic acid | |
| EP1323717A1 (en) * | 2001-12-27 | 2003-07-02 | Dsm N.V. | Process for the preparation of 2-(6-Substituted-1,3-Dioxane-4-yL) acetic acid derivatives |
| CZ296967B6 (cs) | 2002-02-01 | 2006-08-16 | Zentiva, A.S. | Zpusob výroby amorfní formy hemivápenaté soli (3R,5R) 7-[3-fenyl-4-fenylkarbamoyl-2-(4-fluorfenyl)-5-isopropylpyrrol-1-yl]-3,5-dihydroxyheptanové kyseliny (atorvastatinu) |
| DE10212492B4 (de) * | 2002-03-21 | 2012-02-02 | Daimler Ag | Kolbenpumpe |
| AU2003251523A1 (en) * | 2002-06-13 | 2003-12-31 | Diversa Corporation | Processes for making (r)-ethyl 4-cyano-3-hydroxybutyric acid |
| EP1375493A1 (en) * | 2002-06-17 | 2004-01-02 | Dsm N.V. | Process for the preparation of an dioxane acetic acid ester |
| EP1534704B1 (en) * | 2002-08-06 | 2007-08-01 | Warner-Lambert Company LLC | Process for preparing 5-(4-fluorophenyl)-1-¬2-((2r,4r)-4-hydroxy -6-oxo-tetrahydro-pyran-2-yl)ethyl|-2-isopropyl-4-phenyl-1h-pyrrole-3-carboxylic acid phenylamide |
| AU2002330735A1 (en) * | 2002-09-03 | 2004-03-29 | Morepen Laboratories Limited | Atorvastatin calcium form vi or hydrates thereof |
| KR100529703B1 (ko) * | 2002-09-23 | 2005-11-17 | 임광민 | 키랄 중간체의 제조방법 및 그를 이용한 아토바스타틴의제조방법 |
| HRP20020885B1 (en) * | 2002-11-11 | 2007-05-31 | GlaxoSmithKline istra�iva�ki centar Zagreb d.o.o. | SUBSTITUTED 9a-N-{N'-[4-(SULFONYL)PHENYLCARBAMOYL]}DERIVATIVES 9-DEOXO-9-DIHYDRO-9a-AZA-9a-HOMOERITHROMYCIN A AND 5-O-DESOZAMINYL-9-DEOXO-9-DIHYDRO-9a-AZA-9a-HOMOERITHRONOLIDE A |
| EP1615883A1 (en) * | 2003-04-14 | 2006-01-18 | Warner-Lambert Company | Process for preparing 5-(4-fluorophenyl)-1-[2-((2r,4r)-4-hydroxy-6-oxo-tetrahydro-pyran-2-yl)-ethyl]-2-isopropyl-4-phenyl-1h-pyrrole-3-carboxylic acid phenylamide |
| JP2007516227A (ja) * | 2003-05-16 | 2007-06-21 | アンビット バイオサイエンシス コーポレーション | ピロール化合物およびその使用 |
| US20050182125A1 (en) * | 2003-05-16 | 2005-08-18 | Ambit Biosciences Corporation | Pyrrole compounds and uses thereof |
| US20040248972A1 (en) * | 2003-05-16 | 2004-12-09 | Ambit Biosciences Corporation | Compounds and uses thereof |
| US7790197B2 (en) * | 2003-06-09 | 2010-09-07 | Warner-Lambert Company Llc | Pharmaceutical compositions of atorvastatin |
| US20040253305A1 (en) * | 2003-06-12 | 2004-12-16 | Luner Paul E. | Pharmaceutical compositions of atorvastatin |
| US7655692B2 (en) * | 2003-06-12 | 2010-02-02 | Pfizer Inc. | Process for forming amorphous atorvastatin |
| US20050271717A1 (en) * | 2003-06-12 | 2005-12-08 | Alfred Berchielli | Pharmaceutical compositions of atorvastatin |
| GB0317393D0 (en) * | 2003-07-25 | 2003-08-27 | Avecia Ltd | Process and compounds |
| KR101113163B1 (ko) | 2003-07-25 | 2012-02-17 | 브래드포드 파마 리미티드 | 스타틴, 특히 아토르바스타틴의 제조에 유용한 중간체화합물 및 그 제조방법 |
| MXPA06003003A (es) * | 2003-09-17 | 2006-06-23 | Warner Lambert Co | Formas cristalinas de acido [r-(r*, r*)]-2-(4- fluorofenil)-(, (-dihidroxi -5-(1- metiletil)-3 -fenil-4 -[(fenilamino) -carbonil]- 1h-pirrol -1-heptanoico. |
| CA2456430A1 (en) * | 2004-01-28 | 2005-07-28 | Brantford Chemicals Inc. | Improved process for the preparation of amorphous atorvastatin calcium |
| NO330092B1 (no) | 2004-03-17 | 2011-02-14 | Ranbaxy Lab Ltd | Fremgangsmate for fremstilling av atorvastatin-kalsium i amorf form |
| MXPA06011987A (es) * | 2004-04-16 | 2007-01-16 | Pfizer Prod Inc | Procedimiento para formar calcio de atorvastatina amorfa. |
| BRPI0510713A (pt) | 2004-05-05 | 2007-11-20 | Pfizer Prod Inc | formas de sal de ácido [r-(r*,r*)]-2-(4-fluorofenil)-beta, delta-diidróxi-5-(1-metiletil)-3-fenil-4-[(fenilamino)ca rbonil]-1h-pirrol-1- heptanóico |
| JP5000502B2 (ja) * | 2004-07-16 | 2012-08-15 | レツク・フアーマシユーテイカルズ・デー・デー | アトルバスタチンカルシウムの酸化分解生成物 |
| EP1771412A2 (en) * | 2004-07-20 | 2007-04-11 | Warner-Lambert Company LLC | Crystalline forms of [r-(r*)]-2-(4-fluorophenyl)-bet a,gamma-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1h-pyrrole-1-hept anoic acid calcium salt (2:1) |
| WO2006021969A1 (en) * | 2004-08-27 | 2006-03-02 | Biocon Limited | Process for atorvastatin calcium amorphous |
| NZ554541A (en) * | 2004-10-28 | 2011-01-28 | Warner Lambert Co | Process for forming amorphous atorvastatin |
| AU2005305460B2 (en) * | 2004-11-22 | 2011-04-21 | Dexcel Pharma Technologies Ltd. | Stable atorvastatin formulations |
| US20090088465A1 (en) * | 2004-12-02 | 2009-04-02 | Stephen Craig Dyar | Pharmaceutical Compositions of Amorphous Atorvastatin and Process for Preparing Same |
| CA2621507A1 (en) * | 2005-09-09 | 2007-03-15 | Pfizer Science And Technology Ireland Limited | Preparation of an atorvastatin intermediate |
| WO2007029216A1 (en) * | 2005-09-09 | 2007-03-15 | Pfizer Science And Technology Ireland Limited | Preparation of an atorvastatin intermediate |
| US20090216029A1 (en) * | 2005-09-16 | 2009-08-27 | Yatendra Kumar | Process for the production of atorvastatin calcium in amorphous form |
| CA2547216A1 (en) | 2005-09-21 | 2007-03-21 | Renuka D. Reddy | Process for annealing amorphous atorvastatin |
| ES2304335T3 (es) * | 2005-11-21 | 2010-05-19 | Warner-Lambert Company Llc | Formas nuevas del acido (r-(r*,r*))-2-(4-fluorofenil)-b,b-dihidroxi-5-(1-metiletil)-3-fenil-4-((fenilamino)carbonil)1h-pirrol-1-heptanoico, de magnesio. |
| EP1810667A1 (en) | 2006-01-20 | 2007-07-25 | KRKA, tovarna zdravil, d.d., Novo mesto | Pharmaceutical composition comprising amorphous atorvastatin |
| WO2008053312A2 (en) * | 2006-11-02 | 2008-05-08 | Cadila Pharmaceuticals Limited | Process for preparing amorphous atorvastatin hemi calcium salt and its intermediate |
| US7834195B2 (en) * | 2007-01-24 | 2010-11-16 | Apotex Pharmachem Inc. | Atorvastatin calcium propylene glycol solvates |
| WO2008106662A2 (en) | 2007-03-01 | 2008-09-04 | Verenium Corporation | Nitrilases, nucleic acids encoding them and methods for making and using them |
| US20110142883A1 (en) * | 2007-07-20 | 2011-06-16 | Actavis Group Ptc Ehf | Amorphous Coprecipitates of Atorvastatin Pharmaceutically Acceptable Salts |
| EP2075246A1 (en) | 2007-12-27 | 2009-07-01 | M. J. Institute of Research | A process for preparation of amorphous form of atorvastatin hemi-calcium salt |
| US8115015B2 (en) * | 2009-01-26 | 2012-02-14 | Cadila Healthcare Limited | Process for the preparation of amorphous atorvastatin calcium |
| WO2012032035A1 (en) | 2010-09-09 | 2012-03-15 | Dsm Sinochem Pharmaceuticals Netherlands B.V. | Salts of 7-amino-3,5-dihydroxyheptanoic acid esters |
| MX2013015272A (es) | 2011-07-01 | 2014-04-14 | Dsm Sinochem Pharm Nl Bv | Cristales micronizados. |
| WO2016056031A1 (en) | 2014-10-08 | 2016-04-14 | Council Of Scientific & Industrial Research | Novel diol compounds synthesis and its use for formal synthesis of (2r, 3 s)-3-hydroxypipecolic acid |
| CN106008251A (zh) * | 2016-05-19 | 2016-10-12 | 河南豫辰药业股份有限公司 | 一种2-苯甲撑-3-氧代-4-甲基-n-苯基戊酰胺的制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4647576A (en) * | 1984-09-24 | 1987-03-03 | Warner-Lambert Company | Trans-6-[2-(substitutedpyrrol-1-yl)alkyl]-pyran-2-one inhibitors of cholesterol synthesis |
| US4681893A (en) * | 1986-05-30 | 1987-07-21 | Warner-Lambert Company | Trans-6-[2-(3- or 4-carboxamido-substituted pyrrol-1-yl)alkyl]-4-hydroxypyran-2-one inhibitors of cholesterol synthesis |
| US5003080A (en) * | 1988-02-22 | 1991-03-26 | Warner-Lambert Company | Process for trans-6-(2-(substituted-pyrrol-1-yl)alkyl)pryan-2-one inhibitors of cholesterol synthesis |
| US5093363A (en) * | 1989-08-22 | 1992-03-03 | Shionogi & Co., Ltd. | 2,4,6-substituted phenol derivatives |
| DE3929913A1 (de) * | 1989-09-08 | 1991-04-04 | Hoechst Ag | 4-hydroxytetrahydropyran-2-one sowie die entsprechenden dihydroxycarbonsaeurederivate, salze und ester, verfahren zu ihrer herstellung, ihre verwendung als arzneimittel, pharmazeutische praeparate sowie vorprodukte |
-
1990
- 1990-10-17 US US07/599,521 patent/US5103024A/en not_active Expired - Lifetime
-
1991
- 1991-09-11 HU HU9301122A patent/HU213731B/hu not_active IP Right Cessation
- 1991-09-11 AU AU88480/91A patent/AU646311B2/en not_active Ceased
- 1991-09-11 ES ES91919118T patent/ES2070519T3/es not_active Expired - Lifetime
- 1991-09-11 CZ CZ971246A patent/CZ124697A3/cs not_active IP Right Cessation
- 1991-09-11 SK SK503-98A patent/SK280940B6/sk not_active IP Right Cessation
- 1991-09-11 SK SK504-98A patent/SK280941B6/sk not_active IP Right Cessation
- 1991-09-11 CZ CZ93614A patent/CZ282922B6/cs not_active IP Right Cessation
- 1991-09-11 WO PCT/US1991/006697 patent/WO1992006968A1/en not_active Ceased
- 1991-09-11 EP EP91919118A patent/EP0553213B1/en not_active Expired - Lifetime
- 1991-09-11 CZ CZ971247A patent/CZ282994B6/cs not_active IP Right Cessation
- 1991-09-11 CZ CZ952094A patent/CZ209495A3/cs not_active IP Right Cessation
- 1991-09-11 CA CA002092997A patent/CA2092997C/en not_active Expired - Fee Related
- 1991-09-11 RU RU9193032617A patent/RU2067580C1/ru not_active IP Right Cessation
- 1991-09-11 SK SK505-98A patent/SK280942B6/sk not_active IP Right Cessation
- 1991-09-11 HU HU9701183A patent/HU219237B/hu not_active IP Right Cessation
- 1991-09-11 DK DK91919118.9T patent/DK0553213T3/da active
- 1991-09-11 CZ CZ971245A patent/CZ124597A3/cs not_active IP Right Cessation
- 1991-09-11 AT AT91919118T patent/ATE118772T1/de not_active IP Right Cessation
- 1991-09-11 SK SK502-98A patent/SK280939B6/sk not_active IP Right Cessation
- 1991-09-11 SK SK339-93A patent/SK280938B6/sk not_active IP Right Cessation
- 1991-09-11 JP JP03517546A patent/JP3105923B2/ja not_active Expired - Fee Related
- 1991-09-11 DE DE69107622T patent/DE69107622T2/de not_active Expired - Fee Related
- 1991-10-16 PT PT99244A patent/PT99244B/pt not_active IP Right Cessation
-
1993
- 1993-03-30 IE IE362991A patent/IE62940B1/en not_active IP Right Cessation
- 1993-04-14 FI FI931680A patent/FI108539B/fi active
- 1993-04-16 KR KR1019930701130A patent/KR0166385B1/ko not_active Expired - Fee Related
- 1993-04-16 NO NO931421A patent/NO301588B1/no not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK280940B6 (sk) | Spôsob syntézy (4r-cis)-1,1-dimetyletyl-6-kyanometyl-2,2- -dimetyl-1,3-dioxán-4-acetátu a medziprodukty tohto spôsobu | |
| US5248793A (en) | Process for the synthesis of (4R-cis)-1,1-dimethylethyl 6-iodomethyl or 6-(phenyl-substituted)sulfonyloxymethyl-2,2-dimethyl-1,3-dioxane-4-acetate | |
| US5155251A (en) | Process for the synthesis of (5R)-1,1-dimethylethyl-6-cyano-5-hydroxy-3-oxo-hexanoate | |
| EP0330172B1 (en) | Improved process for trans-6-[2-(substituted-pyrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis | |
| CZ285554B6 (cs) | Způsob výroby trans-6-[2-(substituovaný pyrrol-1-yl)alkyl]-pyran-2-onu | |
| US7812179B2 (en) | Process for the preparation of atorvastatin and intermediates | |
| EP2614057B1 (en) | Salts of 7-amino-3,5-dihydroxyheptanoic acid esters | |
| WO2008103016A1 (en) | Atorvastatin intermediates and method for producing the same | |
| KR20090070233A (ko) | 피롤릴헵탄산 화합물의 합성 중간체 및 신규 중간체를이용한 제조방법 | |
| HK1005026B (en) | Process for the synthesis of (4r-cis)-1, 1-dimethylethyl-6-cyanomethyl-2, 2-dimethyl-1, 3-dioxane-4-acetate | |
| NO177423B (no) | Forbedret fremgangsmåte for fremstilling av trans-6-[2-(substituert-pyrrol-yl)alkylÅpyran-2-on-inhibitorer for kolesterolsyntese |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed due to non-payment of maintenance fees |
Effective date: 20090911 |