SE438507B - Nya cefalosporinantibiotika samt forfarande for framstellning derav - Google Patents
Nya cefalosporinantibiotika samt forfarande for framstellning deravInfo
- Publication number
- SE438507B SE438507B SE7904576A SE7904576A SE438507B SE 438507 B SE438507 B SE 438507B SE 7904576 A SE7904576 A SE 7904576A SE 7904576 A SE7904576 A SE 7904576A SE 438507 B SE438507 B SE 438507B
- Authority
- SE
- Sweden
- Prior art keywords
- compound
- formula
- acid
- group
- compounds
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- 239000003242 anti bacterial agent Substances 0.000 title claims description 16
- 229940124587 cephalosporin Drugs 0.000 title description 19
- 229930186147 Cephalosporin Natural products 0.000 title description 18
- 150000001780 cephalosporins Chemical class 0.000 title description 16
- 229940088710 antibiotic agent Drugs 0.000 title description 14
- 150000001875 compounds Chemical class 0.000 claims description 126
- -1 2-aminothiazol-4-yl Chemical group 0.000 claims description 84
- 239000002253 acid Substances 0.000 claims description 46
- 150000003839 salts Chemical class 0.000 claims description 34
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 238000002360 preparation method Methods 0.000 claims description 24
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 23
- 150000002148 esters Chemical class 0.000 claims description 20
- 230000003115 biocidal effect Effects 0.000 claims description 19
- 231100000252 nontoxic Toxicity 0.000 claims description 19
- 230000003000 nontoxic effect Effects 0.000 claims description 19
- 150000007513 acids Chemical class 0.000 claims description 16
- 230000000903 blocking effect Effects 0.000 claims description 16
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 238000001727 in vivo Methods 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 9
- 230000009467 reduction Effects 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000012038 nucleophile Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- 239000000203 mixture Substances 0.000 description 43
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 41
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 25
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000007787 solid Substances 0.000 description 18
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 11
- 238000005917 acylation reaction Methods 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 235000019253 formic acid Nutrition 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 230000010933 acylation Effects 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical group C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- 241000589516 Pseudomonas Species 0.000 description 5
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 5
- 229940126575 aminoglycoside Drugs 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 230000000269 nucleophilic effect Effects 0.000 description 5
- 235000011007 phosphoric acid Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 238000006266 etherification reaction Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- 108020004256 Beta-lactamase Proteins 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000588769 Proteus <enterobacteria> Species 0.000 description 3
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- RRNJROHIFSLGRA-JEDNCBNOSA-N acetic acid;(2s)-2,6-diaminohexanoic acid Chemical compound CC(O)=O.NCCCC[C@H](N)C(O)=O RRNJROHIFSLGRA-JEDNCBNOSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 125000005042 acyloxymethyl group Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 102000006635 beta-lactamase Human genes 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- HJJDBAOLQAWBMH-YCRCPZNHSA-N cefmenoxime Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CSC1=NN=NN1C HJJDBAOLQAWBMH-YCRCPZNHSA-N 0.000 description 3
- 229960003791 cefmenoxime Drugs 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 229960005357 lysine acetate Drugs 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical group NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000588914 Enterobacter Species 0.000 description 2
- 241000588697 Enterobacter cloacae Species 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000588749 Klebsiella oxytoca Species 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 239000004472 Lysine Substances 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 241000588770 Proteus mirabilis Species 0.000 description 2
- 241000588767 Proteus vulgaris Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229960004821 amikacin Drugs 0.000 description 2
- LKCWBDHBTVXHDL-RMDFUYIESA-N amikacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O LKCWBDHBTVXHDL-RMDFUYIESA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 229960004261 cefotaxime Drugs 0.000 description 2
- AZZMGZXNTDTSME-JUZDKLSSSA-M cefotaxime sodium Chemical compound [Na+].N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 AZZMGZXNTDTSME-JUZDKLSSSA-M 0.000 description 2
- 229960000484 ceftazidime Drugs 0.000 description 2
- NMVPEQXCMGEDNH-TZVUEUGBSA-N ceftazidime pentahydrate Chemical compound O.O.O.O.O.S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OC(C)(C)C(O)=O)C=2N=C(N)SC=2)CC=1C[N+]1=CC=CC=C1 NMVPEQXCMGEDNH-TZVUEUGBSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 2
- 229940106681 chloroacetic acid Drugs 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000001332 colony forming effect Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- IACSYDRIOYGJNH-ALCCZGGFSA-N ethyl (2z)-2-hydroxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=N/O)\C(C)=O IACSYDRIOYGJNH-ALCCZGGFSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229960003646 lysine Drugs 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229940007042 proteus vulgaris Drugs 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- RACSQPAUTPPMLG-JYUHDHNASA-N (2z)-2-[2-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CC(C)(C)OC(=O)C(C)(C)O\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 RACSQPAUTPPMLG-JYUHDHNASA-N 0.000 description 1
- HMJIFOAQQRHIOV-SSDOTTSWSA-N (6r)-3-(bromomethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-en-8-one Chemical compound C1C(CBr)=CS[C@@H]2CC(=O)N21 HMJIFOAQQRHIOV-SSDOTTSWSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N 2-Ethylhexanoic acid Chemical compound CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- YHMZKBZQZGAGOE-UHFFFAOYSA-N 2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound OC(=O)CC1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 YHMZKBZQZGAGOE-UHFFFAOYSA-N 0.000 description 1
- GRWKNBPOGBTZMN-UHFFFAOYSA-N 2-benzyl-3-phenylpropane-1,2-diamine Chemical compound C=1C=CC=CC=1CC(N)(CN)CC1=CC=CC=C1 GRWKNBPOGBTZMN-UHFFFAOYSA-N 0.000 description 1
- PKYBZMHFUXKMRC-UHFFFAOYSA-M 2-ethyl-5-phenyl-1,2-oxazol-2-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.O1[N+](CC)=CC=C1C1=CC=CC=C1 PKYBZMHFUXKMRC-UHFFFAOYSA-M 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000004358 Butane-1, 3-diol Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- CEAZRRDELHUEMR-URQXQFDESA-N Gentamicin Chemical compound O1[C@H](C(C)NC)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](NC)[C@@](C)(O)CO2)O)[C@H](N)C[C@@H]1N CEAZRRDELHUEMR-URQXQFDESA-N 0.000 description 1
- 229930182566 Gentamicin Natural products 0.000 description 1
- 241000606768 Haemophilus influenzae Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241000219470 Mirabilis Species 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 208000032536 Pseudomonas Infections Diseases 0.000 description 1
- 241000589774 Pseudomonas sp. Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010057190 Respiratory tract infections Diseases 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000607760 Shigella sonnei Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 231100000215 acute (single dose) toxicity testing Toxicity 0.000 description 1
- 238000011047 acute toxicity test Methods 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229950003476 aminothiazole Drugs 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- SHZIWNPUGXLXDT-UHFFFAOYSA-N caproic acid ethyl ester Natural products CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229920006026 co-polymeric resin Polymers 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002788 crimping Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 239000011928 denatured alcohol Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- BTEPYCPXBCCSDL-YHYXMXQVSA-N ethyl (2z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate Chemical compound CCOC(=O)C(=N/O)\C1=CSC(N)=N1 BTEPYCPXBCCSDL-YHYXMXQVSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229960002518 gentamicin Drugs 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 229940047650 haemophilus influenzae Drugs 0.000 description 1
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 229940006461 iodide ion Drugs 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical class C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- HSZCJVZRHXPCIA-UHFFFAOYSA-N n-benzyl-n-ethylaniline Chemical compound C=1C=CC=CC=1N(CC)CC1=CC=CC=C1 HSZCJVZRHXPCIA-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100001095 no nephrotoxicity Toxicity 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 229920003053 polystyrene-divinylbenzene Polymers 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229940115939 shigella sonnei Drugs 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- AAMCVENDCXWDPJ-UHFFFAOYSA-N sulfanyl acetate Chemical class CC(=O)OS AAMCVENDCXWDPJ-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- SKVHPNQACYIQDC-BXKDBHETSA-N tert-butyl (6r,7r)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(=O)OC(C)(C)C)N2C(=O)[C@@H](N)[C@@H]12 SKVHPNQACYIQDC-BXKDBHETSA-N 0.000 description 1
- IGVNJALYNQVQIT-UHFFFAOYSA-N tert-butyl 2-bromo-2-methylpropanoate Chemical compound CC(C)(C)OC(=O)C(C)(C)Br IGVNJALYNQVQIT-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 238000006276 transfer reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- 238000005866 tritylation reaction Methods 0.000 description 1
- 208000019206 urinary tract infection Diseases 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/587—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with aliphatic hydrocarbon radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms, said aliphatic radicals being substituted in the alpha-position to the ring by a hetero atom, e.g. with m >= 0, Z being a singly or a doubly bound hetero atom
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oncology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2291178 | 1978-05-26 | ||
| GB2291378 | 1978-05-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7904576L SE7904576L (sv) | 1980-02-11 |
| SE438507B true SE438507B (sv) | 1985-04-22 |
Family
ID=26256190
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7904576A SE438507B (sv) | 1978-05-26 | 1979-05-25 | Nya cefalosporinantibiotika samt forfarande for framstellning derav |
| SE8402887A SE8402887D0 (sv) | 1978-05-26 | 1984-05-28 | Cefalosporinantibiotika |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8402887A SE8402887D0 (sv) | 1978-05-26 | 1984-05-28 | Cefalosporinantibiotika |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4258041A (da) |
| AR (2) | AR228726A1 (da) |
| AT (1) | AT370420B (da) |
| AU (1) | AU524671B2 (da) |
| CA (1) | CA1127633A (da) |
| CH (2) | CH649556A5 (da) |
| DE (1) | DE2921316C2 (da) |
| DK (1) | DK157685C (da) |
| ES (2) | ES480915A1 (da) |
| FI (2) | FI67555C (da) |
| FR (2) | FR2426695A1 (da) |
| HK (1) | HK40183A (da) |
| IE (2) | IE49172B1 (da) |
| IL (3) | IL57400A (da) |
| IT (1) | IT1116198B (da) |
| KE (1) | KE3252A (da) |
| LU (1) | LU81319A1 (da) |
| MY (1) | MY8400017A (da) |
| NL (2) | NL176855C (da) |
| NO (2) | NO155347C (da) |
| NZ (2) | NZ190558A (da) |
| PH (1) | PH16961A (da) |
| PT (2) | PT69669A (da) |
| SE (2) | SE438507B (da) |
| SG (1) | SG58382G (da) |
| SI (2) | SI7911231A8 (da) |
| YU (2) | YU41635B (da) |
Families Citing this family (112)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4963542A (en) * | 1976-09-08 | 1990-10-16 | Takeda Chemical Industries, Ltd. | Cephalosporin derivatives |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| AR228726A1 (es) * | 1978-05-26 | 1983-04-15 | Glaxo Group Ltd | Procedimiento para la preparacion del antibiotico(6r,7r)-7-((z)-2-(2-aminotiazol-4-il)-2-(2-carboxiprop-2-oxiimino)acetamido)-3-(1-piridiniometil)cef-3-em-4-carboxilato |
| US4237128A (en) * | 1979-04-12 | 1980-12-02 | E. R. Squibb & Sons, Inc. | 7-[2-(2-Amino-4-thiazolyl)-2-[(1-carboxy-1,1-dialkyl)alkoxyimino]acetamido]cephem sulfoxides |
| NL8003003A (nl) * | 1979-05-25 | 1980-11-27 | Glaxo Group Ltd | Tussenprodukten te gebruiken bij de bereiding van cefalosporine antibiotica. |
| US4329453A (en) * | 1979-10-02 | 1982-05-11 | Glaxo Group Limited | Cephalosporin antibiotic |
| IT1143007B (it) * | 1979-10-02 | 1986-10-22 | Glaxo Group Ltd | Composti cefalosporinici composizioni che li contengono e procedimento per la loro produzione ed applicazione |
| FR2466469A1 (fr) * | 1979-10-02 | 1981-04-10 | Glaxo Group Ltd | Bischlorhydrate de cephalosporine, son procede de preparation et ses applications, notamment en therapeutique |
| US4338313A (en) * | 1979-10-12 | 1982-07-06 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| US4332800A (en) * | 1979-10-12 | 1982-06-01 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| DE3006888A1 (de) * | 1980-02-23 | 1981-09-10 | Hoechst Ag, 6000 Frankfurt | Cephalosporinderivate und verfahren zu ihrer herstellung |
| FR2476647A2 (fr) * | 1980-02-26 | 1981-08-28 | Roussel Uclaf | Procede de preparation de derives de l'acide 2-(2-amino protege 4-thiazolyl) 2-alkoxyimino acetique isomere syn |
| US4252802A (en) * | 1980-03-13 | 1981-02-24 | E. R. Squibb & Sons, Inc. | Hydroxamic acid derivatives of 7-[(2-amino-4-thiazolyl)-oximino] cephalosporins |
| GR75711B (da) * | 1980-06-30 | 1984-08-02 | Sanofi Sa | |
| US4443444A (en) * | 1980-08-11 | 1984-04-17 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| EP0046964B1 (en) * | 1980-08-29 | 1986-08-20 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds and processes for preparation thereof |
| NZ198350A (en) * | 1980-09-25 | 1985-02-28 | Toyama Chemical Co Ltd | Cephalosporins and intermediates;pharmaceutical compositions |
| FR2494276A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles vinyl-3 cephalosporines, et leur preparation |
| US4427677A (en) | 1980-12-31 | 1984-01-24 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| JPS57144291A (en) * | 1981-03-02 | 1982-09-06 | Ajinomoto Co Inc | Preparation of imidazoledicarboxylic acid derivative |
| US4336253A (en) * | 1981-03-11 | 1982-06-22 | Eli Lilly And Company | Cephalosporin antibiotics |
| JPS6011917B2 (ja) * | 1981-04-09 | 1985-03-28 | 山之内製薬株式会社 | 新規なセファロスポリン化合物 |
| DE3118732A1 (de) * | 1981-05-12 | 1982-12-02 | Hoechst Ag, 6000 Frankfurt | Cephalosporinderivate und verfahren zu ihrer herstellung |
| GR75487B (da) * | 1981-06-22 | 1984-07-23 | Fujisawa Pharmaceutical Co | |
| US4430499A (en) | 1981-09-08 | 1984-02-07 | Eli Lilly And Company | 7-[2-(2-Aminooxazol-4-yl)-2-(oximino)acetamido]cephalosporin antibiotics |
| US4382931A (en) * | 1981-09-08 | 1983-05-10 | Eli Lilly And Company | 3'-Substituted quinolinium cephalosporins |
| US4382932A (en) * | 1981-09-08 | 1983-05-10 | Eli Lilly And Company | Isoquinolinium substituted cephalosporins |
| US4577014A (en) * | 1981-09-08 | 1986-03-18 | Eli Lilly And Company | Thieno and furopyridinium-substituted cephalosporins |
| US4436912A (en) | 1981-09-08 | 1984-03-13 | Eli Lilly And Company | 7-[2-(2-Aminooxazol-4-yl)-2-(oximino)acetamido cephalosporin antibiotics and intermediates therefor |
| US4406898A (en) * | 1981-09-08 | 1983-09-27 | Eli Lilly And Company | Oxazole and oxadiazole cephalosporins |
| JPS5859991A (ja) * | 1981-09-14 | 1983-04-09 | Fujisawa Pharmaceut Co Ltd | 新規セフェム化合物 |
| US4401668A (en) * | 1981-10-02 | 1983-08-30 | Eli Lilly And Company | Pyrazinium substituted cephalosporins |
| US4379787A (en) * | 1981-10-02 | 1983-04-12 | Eli Lilly And Company | Oximino-substituted cephalosporin compounds |
| US4388316A (en) * | 1981-10-02 | 1983-06-14 | Eli Lilly And Company | Amino-substituted oxazole, oxadiazole and isoxazole-substituted cephalosporins |
| US4402955A (en) * | 1981-10-02 | 1983-09-06 | Eli Lilly And Company | Dioximino cephalosporin antibiotics |
| US4450270A (en) * | 1981-10-02 | 1984-05-22 | Eli Lilly And Company | Dioximino cephalosporin antibiotics |
| US4406887A (en) * | 1981-10-13 | 1983-09-27 | Bristol-Myers Company | Method for treating resistant bacteria including anaerobes |
| JPS58109477A (ja) * | 1981-11-13 | 1983-06-29 | グラクソ・グル−プ・リミテツド | 新規な化合物 |
| US4510312A (en) * | 1981-11-13 | 1985-04-09 | Glaxo Group Limited | Manufacture of antibiotics |
| US4394503A (en) * | 1981-12-07 | 1983-07-19 | Bristol-Myers Company | Cephalosporin derivatives |
| US4474954A (en) * | 1981-12-07 | 1984-10-02 | Bristol-Myers Company | Intermediates for cephalosporin derivatives |
| US4501739A (en) * | 1982-01-19 | 1985-02-26 | Eli Lilly And Company | Thieno and furopyridinium-substituted cephalosporins |
| CA1213882A (en) * | 1982-03-04 | 1986-11-12 | Jun Okumura | Cephalosporins |
| DE3207840A1 (de) * | 1982-03-04 | 1983-09-15 | Hoechst Ag, 6230 Frankfurt | "cephalosporinderivate und verfahren zu ihrer herstellung" |
| US4552696A (en) * | 1982-04-09 | 1985-11-12 | Bristol-Myers Company | Carbapenem antibiotics |
| EP0101148B1 (en) * | 1982-04-29 | 1987-12-23 | Glaxo Group Limited | Thiazole derivative, process for its preparation and use in the preparation of beta-lactam antibiotics |
| EP0097961B1 (en) | 1982-06-28 | 1987-11-11 | Bristol-Myers Company | Cephalosporin derivatives, a process for the manufacture thereof and pharmaceutical compositions containing said derivatives |
| IL69246A (en) * | 1982-08-07 | 1986-07-31 | Tanabe Seiyaku Co | 7-((2-aminothiazolyl-2-pyrrolidonyl or(piperidonyl)-oxyimino)acetamido)cephem carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them |
| ES525492A0 (es) * | 1982-09-10 | 1985-02-01 | Glaxo Group Ltd | Un procedimiento para la produccion de un recipiente hermeticamente cerrado que contiene al menos un antibiotico de beta-lactama. |
| DE3381408D1 (de) * | 1982-12-27 | 1990-05-10 | Lilly Co Eli | Zwischenverbindungen fuer die herstellung von ceftazidin und verfahren zu ihrer herstellung. |
| EP0115770B2 (en) * | 1983-01-07 | 1996-06-19 | Takeda Chemical Industries, Ltd. | Thiazole Derivatives |
| US4486586A (en) * | 1983-02-10 | 1984-12-04 | Bristol-Myers Company | Cephalosporin derivatives |
| DE3313818A1 (de) * | 1983-04-16 | 1984-10-18 | Hoechst Ag, 6230 Frankfurt | Neue kristallmodifikation von ceftazidim |
| DE3313816A1 (de) * | 1983-04-16 | 1984-10-18 | Hoechst Ag, 6230 Frankfurt | Neue kristallmodifikation von ceftazidim |
| DE3316798A1 (de) * | 1983-05-07 | 1984-11-08 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von cephemverbindungen |
| DE3316797A1 (de) * | 1983-05-07 | 1984-11-08 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von cephemverbindungen |
| US4540779A (en) * | 1983-06-20 | 1985-09-10 | Eli Lilly And Company | Crystalline 7-(R)-amino-3-(1'pyridiniummethyl)-ceph-3-em-4-carboxylate monohydrochloride monohydrate compound |
| US4497811A (en) * | 1983-07-01 | 1985-02-05 | Seiji Shibahara | 1-Oxadethiacephalosporin compound and antibacterial agent containing the _same |
| JPS6061528A (ja) * | 1983-09-09 | 1985-04-09 | ブリストル―マイヤーズ スクイブ カンパニー | 嫌気性菌を包含する耐性バクテリアの処理法 |
| AU566944B2 (en) * | 1983-10-07 | 1987-11-05 | Gist-Brocades N.V. | Preparation of 3-cephem derivatives |
| JPS60178891A (ja) * | 1984-02-24 | 1985-09-12 | Kureha Chem Ind Co Ltd | セファロスポリン誘導体及び該誘導体を含有する医薬 |
| GB8406218D0 (en) * | 1984-03-09 | 1984-04-11 | Glaxo Group Ltd | Process |
| US4537959A (en) * | 1984-03-26 | 1985-08-27 | Eli Lilly And Company | Crystalline cephalosporin antibiotic salt |
| US4788185A (en) * | 1984-04-23 | 1988-11-29 | Takeda Chemical Industries, Ltd. | Cephalosporin compounds |
| PH22107A (en) * | 1984-06-07 | 1988-06-01 | Takeda Chemical Industries Ltd | 3-pyrazolo(1,5-a)pyrdinium cephem compounds |
| EP0166580A3 (en) * | 1984-06-25 | 1987-03-18 | Eli Lilly And Company | Improvements in or relating to ceftazidime |
| US4616080A (en) * | 1984-07-02 | 1986-10-07 | Eli Lilly And Company | Simplified process of forming crystalline ceftazidime pentahydrate |
| US4626534A (en) * | 1984-07-23 | 1986-12-02 | Eli Lilly And Company | Pharmaceutical formulation |
| IL76367A0 (en) * | 1984-09-17 | 1986-01-31 | Lilly Co Eli | Improved process for cephalsporin intermediates |
| US4659813A (en) * | 1984-11-08 | 1987-04-21 | Eli Lilly And Company | Crystallization process for ceftazidime derivative |
| WO1988010263A1 (fr) * | 1987-06-25 | 1988-12-29 | Banyu Pharmaceutical Co., Ltd. | Composes cristallins de cephalosporine, procede de preparation et produits intermediaires pour la preparation de ces composes |
| GB8504072D0 (en) * | 1985-02-18 | 1985-03-20 | Fujisawa Pharmaceutical Co | Cephem compounds |
| ATE89826T1 (de) * | 1985-03-01 | 1993-06-15 | Takeda Chemical Industries Ltd | Antibakterielle verbindungen, ihre herstellung und verwendung. |
| US4703118A (en) * | 1985-04-08 | 1987-10-27 | Eli Lilly And Company | Synthesis of 3-iodomethyl cephalosporins |
| US4692518A (en) * | 1985-11-06 | 1987-09-08 | Eli Lilly And Company | Crystalline (7R)-7-amino-3-(1'-pyridiniummethyl)-3-cephem-4-carboxylate monohydrate compound |
| JPS62175489A (ja) * | 1986-01-29 | 1987-08-01 | Sanwa Kagaku Kenkyusho:Kk | 新規なセフアロスポリン誘導体及びその塩、これらの製法並びに該化合物を有効成分とする感染症治療剤 |
| US5359057A (en) * | 1986-02-07 | 1994-10-25 | Hoffmann-La Roche Inc. | Acylation of amines |
| JPS63107989A (ja) * | 1986-06-04 | 1988-05-12 | Tanabe Seiyaku Co Ltd | セファロスポリン化合物 |
| AT387022B (de) * | 1986-06-04 | 1988-11-25 | Biochemie Gmbh | Verfahren zur herstellung einer neuen kristallinen form eines cefalosporinderivats |
| IL82738A0 (en) * | 1986-06-16 | 1987-12-20 | Tanabe Seiyaku Co | Cephalosporin compounds,their preparation and pharmaceutical compositions containing them |
| WO1988002001A1 (fr) * | 1986-09-10 | 1988-03-24 | Biochemie Gesellschaft M.B.H. | Nouvelle forme cristalline stable d'un produit intermediaire de la cephalosporine |
| US4954624A (en) * | 1986-10-07 | 1990-09-04 | Sandoz Ltd. | Process for the production of cephalosporin derivatives |
| ES2032543T3 (es) * | 1987-02-02 | 1993-02-16 | Eli Lilly And Company | Procedimiento mejorado de preparacion de un antibiotico. |
| US5021564A (en) * | 1987-02-02 | 1991-06-04 | Eli Lilly And Company | Process for preparing ceftazidime pentahydrate |
| GB8802622D0 (en) * | 1988-02-05 | 1988-03-02 | Glaxo Group Ltd | Chemical compound |
| KR0159760B1 (ko) * | 1988-12-27 | 1998-12-01 | 리로이 휘테커 | 아실화 방법 |
| US5194604A (en) * | 1990-06-29 | 1993-03-16 | E. R. Squibb & Sons, Inc. | Process and intermediates for beta-lactams having aminothiazole(iminooxyacetic acid)acetic acid sidechains |
| KR940000112B1 (ko) * | 1990-07-05 | 1994-01-05 | 주식회사 대웅제약 | 신규의 3-치환 세펨화합물 및 그의 제조방법 |
| US5281589A (en) * | 1991-06-15 | 1994-01-25 | Cheil Foods & Chemicals, Inc. | 3-fused pyridiniummethyl cephalosporins |
| KR100194994B1 (ko) * | 1993-06-05 | 1999-06-15 | 손경식 | 새로운 세펨 화합물 |
| US6472383B1 (en) | 1994-04-25 | 2002-10-29 | Smithkline Beecham P.L.C. | Pharmaceutical formulations |
| PL179415B1 (pl) * | 1994-04-25 | 2000-09-29 | Smithkline Beecham Plc | Preparat farmaceutyczny do leczenia zakazen bakteryjnych i sposób wytwarzania preparatu farmaceutycznego do leczenia zakazen bakteryjnych PL PL |
| WO1995032210A1 (en) * | 1994-05-23 | 1995-11-30 | Korea Institute Of Science And Technology | Cephalosporin compounds and processes for the preparation thereof |
| US5831085A (en) * | 1997-01-16 | 1998-11-03 | Lupin Laboratories Limited | Process for manufacture of cephalosporin such as ceftazidime and intermediate thereof |
| IN189047B (da) | 1998-06-01 | 2002-12-14 | Ranbaxy Lab Ltd | |
| US6930983B2 (en) * | 2000-03-15 | 2005-08-16 | Texas Instruments Incorporated | Integrated circuits, systems, apparatus, packets and processes utilizing path diversity for media over packet applications |
| KR100342600B1 (ko) | 2000-03-06 | 2002-07-04 | 한미정밀화학주식회사 | 신규한 티아졸 화합물 및 그의 제조 방법 |
| KR100392409B1 (ko) | 2000-03-20 | 2003-07-22 | 한미정밀화학주식회사 | 신규한 티아졸 화합물을 이용한 세팔로스포린계항생물질의 제조 방법 |
| US6911441B2 (en) * | 2002-12-16 | 2005-06-28 | Akzo Nobel N.V. | Prolonged release pharmaceutical composition |
| CN1312158C (zh) * | 2005-05-20 | 2007-04-25 | 天津市医药集团技术发展有限公司 | 一种头孢克肟的制备方法 |
| US8883772B2 (en) | 2007-10-09 | 2014-11-11 | Sopharmia, Inc. | Broad spectrum beta-lactamase inhibitors |
| CN101293891B (zh) * | 2008-06-12 | 2011-01-12 | 齐鲁安替制药有限公司 | 头孢他啶中间体的制备方法 |
| PT3616695T (pt) | 2011-09-09 | 2024-11-18 | Merck Sharp & Dohme | Ceftolozano/tazobactam para tratar infeções intrapulmonares |
| US8809314B1 (en) | 2012-09-07 | 2014-08-19 | Cubist Pharmacueticals, Inc. | Cephalosporin compound |
| US8476425B1 (en) | 2012-09-27 | 2013-07-02 | Cubist Pharmaceuticals, Inc. | Tazobactam arginine compositions |
| EA027282B1 (ru) | 2013-03-13 | 2017-07-31 | ТЕРЕВАНС БАЙОФАРМА АНТИБАЙОТИКС АйПи, ЭлЭлСи | Гидрохлоридные соли антибиотического соединения |
| US20140274990A1 (en) | 2013-03-15 | 2014-09-18 | Cubist Pharmaceuticals, Inc. | Ceftolozane pharmaceutical compositions |
| US9872906B2 (en) | 2013-03-15 | 2018-01-23 | Merck Sharp & Dohme Corp. | Ceftolozane antibiotic compositions |
| CN110279698B (zh) | 2013-03-15 | 2022-10-28 | 默沙东有限责任公司 | 头孢特咯瓒抗生素组合物 |
| ES2800603T3 (es) | 2013-09-09 | 2021-01-04 | Merck Sharp & Dohme | Tratamiento de infecciones con ceftolozano/tazobactam en sujetos con insuficiencia renal |
| US8906898B1 (en) | 2013-09-27 | 2014-12-09 | Calixa Therapeutics, Inc. | Solid forms of ceftolozane |
| CN106336418B (zh) * | 2016-08-19 | 2019-02-01 | 上海上药新亚药业有限公司 | 一种头孢他啶盐酸盐的固相合成法 |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091209A (en) * | 1971-05-14 | 1978-05-23 | Glaxo Laboratories Limited | 7β-[2-Etherified oximino-2-(phenyl or naphthylacetamido)]cephalosporins having a 2-haloalkylcarbamoyloxymethyl group at the 3-position |
| US4033950A (en) * | 1971-05-14 | 1977-07-05 | Glaxo Laboratories Limited | 3-Hydroxymethyl-7β-(2-alkoxy-or benzyloxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
| US4093803A (en) * | 1971-05-14 | 1978-06-06 | Glaxo Laboratories Limited | 7β-[2-Etherified oximino-2-(thienyl-, furyl- or pyridylacetamido)] cephalosporins |
| US4017515A (en) * | 1971-05-14 | 1977-04-12 | Glaxo Laboratories Limited | α-(Etherified oximino) carboxylic acids and acid chlorides |
| US4079178A (en) * | 1971-05-14 | 1978-03-14 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino) acylamido groups at the 7-position |
| US3971778A (en) * | 1972-05-12 | 1976-07-27 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino)acylamido groups at the 7-position |
| US4064346A (en) * | 1971-05-14 | 1977-12-20 | Glaxo Laboratories Limited | 3-Acetoxymethyl-7β-(2-carboxy-methoxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
| US4024137A (en) * | 1971-05-14 | 1977-05-17 | Glaxo Laboratories Limited | 7β-[2-Etherified oximino-2-(phenyl- or naphthylacetamido)] cephalosporins |
| US4024133A (en) * | 1971-05-14 | 1977-05-17 | Glaxo Laboratories Limited | 7β-[2-Etherified oximino-2-(thienyl-,furyl- or pyridylacetamido)]cephalosporins |
| GB1399086A (en) | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
| US4162360A (en) * | 1973-12-21 | 1979-07-24 | Glaxo Laboratories Limited | 3-Carbamoyloxymethyl-7-substituted oximino acetamido cephalosporanic acid derivatives |
| GB1496757A (en) | 1973-12-21 | 1978-01-05 | Glaxo Lab Ltd | Cephalosporin derivatives |
| US4144392A (en) * | 1973-12-21 | 1979-03-13 | Glaxo Laboratories Limited | Cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyimino-arylacetamido group and at position-3 the residue of a sulphur nucleophile |
| US4144393A (en) * | 1973-12-21 | 1979-03-13 | Glaxo Laboratories Limited | 3-Acetoxymethyl cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyiminoarylacetamido group |
| US4060686A (en) * | 1973-12-21 | 1977-11-29 | Janice Bradshaw | Cephalosporins having a 7-(carboxy substituted α-etherified oximinoarylacetamido) group |
| US4032950A (en) * | 1974-12-06 | 1977-06-28 | Hughes Aircraft Company | Liquid phase epitaxial process for growing semi-insulating gaas layers |
| DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
| DE2760123C2 (de) * | 1976-01-23 | 1986-04-30 | Roussel-Uclaf, Paris | 7-Aminothiazolyl-syn-oxyiminoacetamidocephalosporansäuren, ihre Herstellung und sie enthaltende pharmazeutische Zusammensetzungen |
| US4165430A (en) * | 1976-03-19 | 1979-08-21 | Glaxo Laboratories Limited | Cephalosporins having a 7-carboxy substituted α-etherified oximinoarylacetamido) group |
| US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| JPS52125188A (en) | 1976-04-14 | 1977-10-20 | Takeda Chem Ind Ltd | Cephalosporin derivatives and their preparation |
| AU520269B2 (en) | 1977-03-14 | 1982-01-21 | Fujisawa Pharmaceutical Co., Ltd. | Cephem and cepham compounds |
| FR2384782A1 (fr) | 1977-03-25 | 1978-10-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-acetoxymethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| DE2716677C2 (de) | 1977-04-15 | 1985-10-10 | Hoechst Ag, 6230 Frankfurt | Cephemderivate und Verfahren zu ihrer Herstellung |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| ZA781870B (en) | 1977-04-02 | 1979-03-28 | Hoechst Ag | Cephem derivatives and process for their manufacture |
| GB1602725A (en) | 1977-04-27 | 1981-11-18 | Glaxo Operations Ltd | 7-(a-oxyiminoacetamido)-ceph-3-em-4-carboxylic acid derivatives |
| AR228726A1 (es) * | 1978-05-26 | 1983-04-15 | Glaxo Group Ltd | Procedimiento para la preparacion del antibiotico(6r,7r)-7-((z)-2-(2-aminotiazol-4-il)-2-(2-carboxiprop-2-oxiimino)acetamido)-3-(1-piridiniometil)cef-3-em-4-carboxilato |
| US4237128A (en) * | 1979-04-12 | 1980-12-02 | E. R. Squibb & Sons, Inc. | 7-[2-(2-Amino-4-thiazolyl)-2-[(1-carboxy-1,1-dialkyl)alkoxyimino]acetamido]cephem sulfoxides |
| US4394503A (en) * | 1981-12-07 | 1983-07-19 | Bristol-Myers Company | Cephalosporin derivatives |
-
1979
- 1979-05-24 AR AR276665A patent/AR228726A1/es active
- 1979-05-24 AR AR276664A patent/AR229883A1/es active
- 1979-05-25 DK DK216779A patent/DK157685C/da active
- 1979-05-25 LU LU81319A patent/LU81319A1/xx unknown
- 1979-05-25 SE SE7904576A patent/SE438507B/sv not_active IP Right Cessation
- 1979-05-25 PT PT69669A patent/PT69669A/pt unknown
- 1979-05-25 AU AU47422/79A patent/AU524671B2/en not_active Expired
- 1979-05-25 IL IL57400A patent/IL57400A/xx unknown
- 1979-05-25 ES ES480915A patent/ES480915A1/es not_active Expired
- 1979-05-25 CH CH1707/80A patent/CH649556A5/de not_active IP Right Cessation
- 1979-05-25 NO NO791731A patent/NO155347C/no unknown
- 1979-05-25 FI FI791678A patent/FI67555C/fi not_active IP Right Cessation
- 1979-05-25 DE DE2921316A patent/DE2921316C2/de not_active Expired
- 1979-05-25 NZ NZ190558A patent/NZ190558A/xx unknown
- 1979-05-25 ES ES480914A patent/ES480914A1/es not_active Expired
- 1979-05-25 IT IT7949179A patent/IT1116198B/it active Protection Beyond IP Right Term
- 1979-05-25 IL IL59793A patent/IL59793A/xx unknown
- 1979-05-25 US US06/042,594 patent/US4258041A/en not_active Expired - Lifetime
- 1979-05-25 CA CA328,413A patent/CA1127633A/en not_active Expired
- 1979-05-25 CH CH491579A patent/CH646178A5/de not_active IP Right Cessation
- 1979-05-25 PT PT69670A patent/PT69670A/pt unknown
- 1979-05-25 SI SI7911231A patent/SI7911231A8/sl unknown
- 1979-05-25 YU YU1231/79A patent/YU41635B/xx unknown
- 1979-05-25 PH PH22562A patent/PH16961A/en unknown
- 1979-05-25 NL NLAANVRAGE7904122,A patent/NL176855C/xx not_active IP Right Cessation
- 1979-05-28 FR FR7913531A patent/FR2426695A1/fr active Granted
- 1979-08-08 IE IE1025/79A patent/IE49172B1/en not_active IP Right Cessation
- 1979-08-08 IE IE2453/80A patent/IE49173B1/en unknown
-
1980
- 1980-03-06 NL NL8001348A patent/NL8001348A/nl not_active Application Discontinuation
- 1980-04-01 NZ NZ193326A patent/NZ193326A/xx unknown
- 1980-04-09 FR FR8007929A patent/FR2445835A1/fr active Granted
- 1980-04-09 IL IL59793A patent/IL59793A0/xx unknown
- 1980-05-19 FI FI801609A patent/FI67705C/fi not_active IP Right Cessation
-
1981
- 1981-05-27 AT AT0239281A patent/AT370420B/de not_active IP Right Cessation
-
1982
- 1982-09-13 US US06/417,656 patent/US4600772A/en not_active Expired - Lifetime
- 1982-10-05 SI SI8212234A patent/SI8212234A8/sl unknown
- 1982-10-05 YU YU2234/82A patent/YU43097B/xx unknown
- 1982-11-16 SG SG583/82A patent/SG58382G/en unknown
- 1982-11-26 KE KE3252A patent/KE3252A/xx unknown
-
1983
- 1983-10-13 HK HK401/83A patent/HK40183A/xx not_active IP Right Cessation
-
1984
- 1984-05-28 SE SE8402887A patent/SE8402887D0/xx not_active Application Discontinuation
- 1984-12-30 MY MY17/84A patent/MY8400017A/xx unknown
-
1985
- 1985-01-14 NO NO850153A patent/NO850153L/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE438507B (sv) | Nya cefalosporinantibiotika samt forfarande for framstellning derav | |
| KR830000606B1 (ko) | 세팔로스포린 항생제의 제조방법 | |
| DD202720A5 (de) | Verfahren zur herstellung von cephalosporinderivaten | |
| US4621081A (en) | Cephalosporin antibiotics | |
| US4464368A (en) | Cephalosporin antibiotics | |
| US4315005A (en) | Cephalosporin antibiotics | |
| US4427675A (en) | Cephalosporin antibiotics | |
| EP0181172B1 (en) | Cephalosporin antibiotics | |
| KR830001130B1 (ko) | 세팔로스포린 항생제의 제조방법 | |
| KR830001891B1 (ko) | 세팔로스포린 항생물질의 제조방법 | |
| US4560683A (en) | Cephalosporin antibiotics | |
| US4200746A (en) | Cephalosporins | |
| NL7907881A (nl) | Nieuwe cefalosporine-antibiotica, werkwijze voor de bereiding daarvan en farmaceutische preparaten die deze bevatten. | |
| SE438508B (sv) | Nya cefalosporinantibiotika samt forfarande for framstellning derav | |
| KR830001593B1 (ko) | 세팔로스포린 항생제의 제조방법 | |
| SE438859B (sv) | 7-acylamido-3-karbamoyloximetyl-3-cefem-4-karboxylsyraderivat och forfarande for framstellning derav | |
| GB2183630A (en) | Cephalosporin antibiotics | |
| EP0095329A2 (en) | Cephalosporin antibiotics | |
| GB2183629A (en) | Cephalosporin antibiotics |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7904576-1 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7904576-1 Format of ref document f/p: F |