EA032056B1 - Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) - Google Patents
Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) Download PDFInfo
- Publication number
- EA032056B1 EA032056B1 EA201390940A EA201390940A EA032056B1 EA 032056 B1 EA032056 B1 EA 032056B1 EA 201390940 A EA201390940 A EA 201390940A EA 201390940 A EA201390940 A EA 201390940A EA 032056 B1 EA032056 B1 EA 032056B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- protein
- growth factor
- factor
- fatty acid
- receptor
- Prior art date
Links
- 108090000623 proteins and genes Proteins 0.000 title claims abstract description 575
- 102000004169 proteins and genes Human genes 0.000 title claims abstract description 564
- 235000014113 dietary fatty acids Nutrition 0.000 title claims abstract description 229
- 229930195729 fatty acid Natural products 0.000 title claims abstract description 229
- 239000000194 fatty acid Substances 0.000 title claims abstract description 229
- 150000004665 fatty acids Chemical class 0.000 title claims abstract description 208
- 230000001225 therapeutic effect Effects 0.000 title claims abstract description 110
- 238000000034 method Methods 0.000 title claims abstract description 79
- 239000003153 chemical reaction reagent Substances 0.000 claims abstract description 14
- 102000005962 receptors Human genes 0.000 claims description 64
- 108020003175 receptors Proteins 0.000 claims description 64
- 239000003102 growth factor Substances 0.000 claims description 57
- -1 fatty acid ester Chemical class 0.000 claims description 51
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 51
- 239000002202 Polyethylene glycol Substances 0.000 claims description 50
- 229920001223 polyethylene glycol Polymers 0.000 claims description 50
- 230000012010 growth Effects 0.000 claims description 48
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 46
- 229920001184 polypeptide Polymers 0.000 claims description 45
- 125000005647 linker group Chemical group 0.000 claims description 42
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 33
- 102000004887 Transforming Growth Factor beta Human genes 0.000 claims description 30
- 108090001012 Transforming Growth Factor beta Proteins 0.000 claims description 30
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 27
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 claims description 25
- 102000013275 Somatomedins Human genes 0.000 claims description 24
- 108060008682 Tumor Necrosis Factor Proteins 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 125000002344 aminooxy group Chemical group [H]N([H])O[*] 0.000 claims description 21
- 108010059616 Activins Proteins 0.000 claims description 20
- 102000004127 Cytokines Human genes 0.000 claims description 20
- 108090000695 Cytokines Proteins 0.000 claims description 20
- 102000036693 Thrombopoietin Human genes 0.000 claims description 20
- 108010041111 Thrombopoietin Proteins 0.000 claims description 20
- 239000000488 activin Substances 0.000 claims description 20
- 102000018233 Fibroblast Growth Factor Human genes 0.000 claims description 19
- 108050007372 Fibroblast Growth Factor Proteins 0.000 claims description 19
- 102000007339 Nerve Growth Factor Receptors Human genes 0.000 claims description 19
- 108010032605 Nerve Growth Factor Receptors Proteins 0.000 claims description 19
- 102000007350 Bone Morphogenetic Proteins Human genes 0.000 claims description 18
- 108010007726 Bone Morphogenetic Proteins Proteins 0.000 claims description 18
- 102000014150 Interferons Human genes 0.000 claims description 18
- 108010050904 Interferons Proteins 0.000 claims description 18
- 108010025020 Nerve Growth Factor Proteins 0.000 claims description 18
- 102000004877 Insulin Human genes 0.000 claims description 17
- 108090001061 Insulin Proteins 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 17
- 229940126864 fibroblast growth factor Drugs 0.000 claims description 16
- 229940125396 insulin Drugs 0.000 claims description 16
- 229940079322 interferon Drugs 0.000 claims description 16
- 230000011242 neutrophil chemotaxis Effects 0.000 claims description 16
- 108090000368 Fibroblast growth factor 8 Proteins 0.000 claims description 15
- 108090000190 Thrombin Proteins 0.000 claims description 15
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 claims description 15
- 102100039037 Vascular endothelial growth factor A Human genes 0.000 claims description 15
- 229960004072 thrombin Drugs 0.000 claims description 15
- 102000003956 Fibroblast growth factor 8 Human genes 0.000 claims description 14
- 101000595923 Homo sapiens Placenta growth factor Proteins 0.000 claims description 14
- 102100035194 Placenta growth factor Human genes 0.000 claims description 14
- 102000046299 Transforming Growth Factor beta1 Human genes 0.000 claims description 14
- 101800002279 Transforming growth factor beta-1 Proteins 0.000 claims description 14
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 claims description 14
- 125000000837 carbohydrate group Chemical group 0.000 claims description 14
- 230000002518 glial effect Effects 0.000 claims description 14
- 229940099456 transforming growth factor beta 1 Drugs 0.000 claims description 14
- 108010047303 von Willebrand Factor Proteins 0.000 claims description 14
- 102100036537 von Willebrand factor Human genes 0.000 claims description 14
- 229960001134 von willebrand factor Drugs 0.000 claims description 14
- 102000003972 Fibroblast growth factor 7 Human genes 0.000 claims description 13
- 108090000385 Fibroblast growth factor 7 Proteins 0.000 claims description 13
- 102000007072 Nerve Growth Factors Human genes 0.000 claims description 13
- 230000001965 increasing effect Effects 0.000 claims description 13
- 239000003900 neurotrophic factor Substances 0.000 claims description 13
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 claims description 12
- 210000000440 neutrophil Anatomy 0.000 claims description 12
- 150000004671 saturated fatty acids Chemical class 0.000 claims description 12
- 102000001893 Bone Morphogenetic Protein Receptors Human genes 0.000 claims description 11
- 108010040422 Bone Morphogenetic Protein Receptors Proteins 0.000 claims description 11
- 108010005939 Ciliary Neurotrophic Factor Proteins 0.000 claims description 11
- 102100031614 Ciliary neurotrophic factor Human genes 0.000 claims description 11
- 102000003886 Glycoproteins Human genes 0.000 claims description 11
- 108090000288 Glycoproteins Proteins 0.000 claims description 11
- 102000035195 Peptidases Human genes 0.000 claims description 11
- 108091005804 Peptidases Proteins 0.000 claims description 11
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims description 11
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims description 11
- 210000002950 fibroblast Anatomy 0.000 claims description 11
- UGAGPNKCDRTDHP-UHFFFAOYSA-N 16-hydroxyhexadecanoic acid Chemical compound OCCCCCCCCCCCCCCCC(O)=O UGAGPNKCDRTDHP-UHFFFAOYSA-N 0.000 claims description 10
- 102000009027 Albumins Human genes 0.000 claims description 10
- 108010088751 Albumins Proteins 0.000 claims description 10
- 102000008100 Human Serum Albumin Human genes 0.000 claims description 10
- 108091006905 Human Serum Albumin Proteins 0.000 claims description 10
- 102000004856 Lectins Human genes 0.000 claims description 10
- 108090001090 Lectins Proteins 0.000 claims description 10
- 108010000499 Thromboplastin Proteins 0.000 claims description 10
- 102000002262 Thromboplastin Human genes 0.000 claims description 10
- 125000003172 aldehyde group Chemical group 0.000 claims description 10
- 229940112869 bone morphogenetic protein Drugs 0.000 claims description 10
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims description 10
- 239000002523 lectin Substances 0.000 claims description 10
- 239000007800 oxidant agent Substances 0.000 claims description 10
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 claims description 10
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 claims description 10
- 108090000654 Bone morphogenetic protein 1 Proteins 0.000 claims description 9
- 102100022641 Coagulation factor IX Human genes 0.000 claims description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 9
- 108010076282 Factor IX Proteins 0.000 claims description 9
- 108010074864 Factor XI Proteins 0.000 claims description 9
- 108010080865 Factor XII Proteins 0.000 claims description 9
- 102000000429 Factor XII Human genes 0.000 claims description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 108090000630 Oncostatin M Proteins 0.000 claims description 9
- 102000004140 Oncostatin M Human genes 0.000 claims description 9
- 239000004365 Protease Substances 0.000 claims description 9
- 102000017975 Protein C Human genes 0.000 claims description 9
- 101800004937 Protein C Proteins 0.000 claims description 9
- 101800001700 Saposin-D Proteins 0.000 claims description 9
- 230000021615 conjugation Effects 0.000 claims description 9
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 claims description 9
- 206010073071 hepatocellular carcinoma Diseases 0.000 claims description 9
- 229960000856 protein c Drugs 0.000 claims description 9
- 210000000130 stem cell Anatomy 0.000 claims description 9
- 235000021122 unsaturated fatty acids Nutrition 0.000 claims description 9
- 150000004670 unsaturated fatty acids Chemical class 0.000 claims description 9
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 claims description 8
- 102100022987 Angiogenin Human genes 0.000 claims description 8
- 108010049976 Bone Morphogenetic Protein 5 Proteins 0.000 claims description 8
- 108010049870 Bone Morphogenetic Protein 7 Proteins 0.000 claims description 8
- 102100028726 Bone morphogenetic protein 10 Human genes 0.000 claims description 8
- 101710118482 Bone morphogenetic protein 10 Proteins 0.000 claims description 8
- 102100022526 Bone morphogenetic protein 5 Human genes 0.000 claims description 8
- 102100022544 Bone morphogenetic protein 7 Human genes 0.000 claims description 8
- 102100028892 Cardiotrophin-1 Human genes 0.000 claims description 8
- 102000011022 Chorionic Gonadotropin Human genes 0.000 claims description 8
- 108010062540 Chorionic Gonadotropin Proteins 0.000 claims description 8
- 108010053770 Deoxyribonucleases Proteins 0.000 claims description 8
- 102000016911 Deoxyribonucleases Human genes 0.000 claims description 8
- 101800003838 Epidermal growth factor Proteins 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 108010014173 Factor X Proteins 0.000 claims description 8
- 102000004864 Fibroblast growth factor 10 Human genes 0.000 claims description 8
- 108090001047 Fibroblast growth factor 10 Proteins 0.000 claims description 8
- 102000012570 Fibroblast growth factor 16 Human genes 0.000 claims description 8
- 108050002072 Fibroblast growth factor 16 Proteins 0.000 claims description 8
- 102000012558 Fibroblast growth factor 20 Human genes 0.000 claims description 8
- 108050002085 Fibroblast growth factor 20 Proteins 0.000 claims description 8
- 102000003973 Fibroblast growth factor 21 Human genes 0.000 claims description 8
- 108090000376 Fibroblast growth factor 21 Proteins 0.000 claims description 8
- 102100025947 Insulin-like growth factor II Human genes 0.000 claims description 8
- 102000016267 Leptin Human genes 0.000 claims description 8
- 108010092277 Leptin Proteins 0.000 claims description 8
- 108010046938 Macrophage Colony-Stimulating Factor Proteins 0.000 claims description 8
- 102100039364 Metalloproteinase inhibitor 1 Human genes 0.000 claims description 8
- 102000003683 Neurotrophin-4 Human genes 0.000 claims description 8
- 108090000099 Neurotrophin-4 Proteins 0.000 claims description 8
- 102100033762 Proheparin-binding EGF-like growth factor Human genes 0.000 claims description 8
- 102000008022 Proto-Oncogene Proteins c-met Human genes 0.000 claims description 8
- 108010089836 Proto-Oncogene Proteins c-met Proteins 0.000 claims description 8
- 108010023082 activin A Proteins 0.000 claims description 8
- 108010072788 angiogenin Proteins 0.000 claims description 8
- 210000004556 brain Anatomy 0.000 claims description 8
- 150000001720 carbohydrates Chemical class 0.000 claims description 8
- 108010041776 cardiotrophin 1 Proteins 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 229940116977 epidermal growth factor Drugs 0.000 claims description 8
- 229940011871 estrogen Drugs 0.000 claims description 8
- 239000000262 estrogen Substances 0.000 claims description 8
- 229960004222 factor ix Drugs 0.000 claims description 8
- 230000002401 inhibitory effect Effects 0.000 claims description 8
- 208000032839 leukemia Diseases 0.000 claims description 8
- 229940097998 neurotrophin 4 Drugs 0.000 claims description 8
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 claims description 8
- NMWKYTGJWUAZPZ-WWHBDHEGSA-N (4S)-4-[[(4R,7S,10S,16S,19S,25S,28S,31R)-31-[[(2S)-2-[[(1R,6R,9S,12S,18S,21S,24S,27S,30S,33S,36S,39S,42R,47R,53S,56S,59S,62S,65S,68S,71S,76S,79S,85S)-47-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-4-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-18-(4-aminobutyl)-27,68-bis(3-amino-3-oxopropyl)-36,71,76-tribenzyl-39-(3-carbamimidamidopropyl)-24-(2-carboxyethyl)-21,56-bis(carboxymethyl)-65,85-bis[(1R)-1-hydroxyethyl]-59-(hydroxymethyl)-62,79-bis(1H-imidazol-4-ylmethyl)-9-methyl-33-(2-methylpropyl)-8,11,17,20,23,26,29,32,35,38,41,48,54,57,60,63,66,69,72,74,77,80,83,86-tetracosaoxo-30-propan-2-yl-3,4,44,45-tetrathia-7,10,16,19,22,25,28,31,34,37,40,49,55,58,61,64,67,70,73,75,78,81,84,87-tetracosazatetracyclo[40.31.14.012,16.049,53]heptaoctacontane-6-carbonyl]amino]-3-methylbutanoyl]amino]-7-(3-carbamimidamidopropyl)-25-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-28-(1H-imidazol-4-ylmethyl)-10-methyl-6,9,12,15,18,21,24,27,30-nonaoxo-16-propan-2-yl-1,2-dithia-5,8,11,14,17,20,23,26,29-nonazacyclodotriacontane-4-carbonyl]amino]-5-[[(2S)-1-[[(2S)-1-[[(2S)-3-carboxy-1-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid Chemical compound CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H]2CSSC[C@@H]3NC(=O)[C@H](Cc4ccccc4)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc4c[nH]cn4)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H]4CCCN4C(=O)[C@H](CSSC[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](Cc4c[nH]cn4)NC(=O)[C@H](Cc4ccccc4)NC3=O)[C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N3CCC[C@H]3C(=O)N[C@@H](C)C(=O)N2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)C(C)C)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1)C(=O)N[C@@H](C)C(O)=O NMWKYTGJWUAZPZ-WWHBDHEGSA-N 0.000 claims description 7
- 102100034613 Annexin A2 Human genes 0.000 claims description 7
- 108090000668 Annexin A2 Proteins 0.000 claims description 7
- 108090000669 Annexin A4 Proteins 0.000 claims description 7
- 102100034612 Annexin A4 Human genes 0.000 claims description 7
- 102100034278 Annexin A6 Human genes 0.000 claims description 7
- 108090000656 Annexin A6 Proteins 0.000 claims description 7
- 108010049955 Bone Morphogenetic Protein 4 Proteins 0.000 claims description 7
- 108010049974 Bone Morphogenetic Protein 6 Proteins 0.000 claims description 7
- 102000003928 Bone morphogenetic protein 15 Human genes 0.000 claims description 7
- 108090000349 Bone morphogenetic protein 15 Proteins 0.000 claims description 7
- 102100024505 Bone morphogenetic protein 4 Human genes 0.000 claims description 7
- 102100022525 Bone morphogenetic protein 6 Human genes 0.000 claims description 7
- 102400000686 Endothelin-1 Human genes 0.000 claims description 7
- 101800004490 Endothelin-1 Proteins 0.000 claims description 7
- 108010016906 Epigen Proteins 0.000 claims description 7
- 102100030323 Epigen Human genes 0.000 claims description 7
- 102000001690 Factor VIII Human genes 0.000 claims description 7
- 108010054218 Factor VIII Proteins 0.000 claims description 7
- 108090000386 Fibroblast Growth Factor 1 Proteins 0.000 claims description 7
- 102000014252 Fibroblast growth factor 11 Human genes 0.000 claims description 7
- 108050003237 Fibroblast growth factor 11 Proteins 0.000 claims description 7
- 102100031734 Fibroblast growth factor 19 Human genes 0.000 claims description 7
- 101710153349 Fibroblast growth factor 19 Proteins 0.000 claims description 7
- 102000003967 Fibroblast growth factor 5 Human genes 0.000 claims description 7
- 108090000380 Fibroblast growth factor 5 Proteins 0.000 claims description 7
- 102000003968 Fibroblast growth factor 6 Human genes 0.000 claims description 7
- 108090000382 Fibroblast growth factor 6 Proteins 0.000 claims description 7
- 102100040898 Growth/differentiation factor 11 Human genes 0.000 claims description 7
- 101710194452 Growth/differentiation factor 11 Proteins 0.000 claims description 7
- 101000871708 Homo sapiens Proheparin-binding EGF-like growth factor Proteins 0.000 claims description 7
- 108090001117 Insulin-Like Growth Factor II Proteins 0.000 claims description 7
- 102000004895 Lipoproteins Human genes 0.000 claims description 7
- 108090001030 Lipoproteins Proteins 0.000 claims description 7
- 108010073521 Luteinizing Hormone Proteins 0.000 claims description 7
- 102000009151 Luteinizing Hormone Human genes 0.000 claims description 7
- 102100025498 Proepiregulin Human genes 0.000 claims description 7
- 108010057464 Prolactin Proteins 0.000 claims description 7
- 102000003946 Prolactin Human genes 0.000 claims description 7
- 101710150593 Protein beta Proteins 0.000 claims description 7
- 101710179016 Protein gamma Proteins 0.000 claims description 7
- 102100032350 Protransforming growth factor alpha Human genes 0.000 claims description 7
- 108010039491 Ricin Proteins 0.000 claims description 7
- 108010061174 Thyrotropin Proteins 0.000 claims description 7
- 102000011923 Thyrotropin Human genes 0.000 claims description 7
- 102000004338 Transferrin Human genes 0.000 claims description 7
- 108090000901 Transferrin Proteins 0.000 claims description 7
- 102000009618 Transforming Growth Factors Human genes 0.000 claims description 7
- 108010009583 Transforming Growth Factors Proteins 0.000 claims description 7
- 101800004564 Transforming growth factor alpha Proteins 0.000 claims description 7
- 108090000097 Transforming growth factor beta-3 Proteins 0.000 claims description 7
- 102000056172 Transforming growth factor beta-3 Human genes 0.000 claims description 7
- 102100035140 Vitronectin Human genes 0.000 claims description 7
- 108010031318 Vitronectin Proteins 0.000 claims description 7
- 108010023079 activin B Proteins 0.000 claims description 7
- 229940050528 albumin Drugs 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 102000013361 fetuin Human genes 0.000 claims description 7
- 108060002885 fetuin Proteins 0.000 claims description 7
- 102000003684 fibroblast growth factor 13 Human genes 0.000 claims description 7
- 108090000047 fibroblast growth factor 13 Proteins 0.000 claims description 7
- 235000019410 glycyrrhizin Nutrition 0.000 claims description 7
- 102000006495 integrins Human genes 0.000 claims description 7
- 108010044426 integrins Proteins 0.000 claims description 7
- 229940039781 leptin Drugs 0.000 claims description 7
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 claims description 7
- 229940040129 luteinizing hormone Drugs 0.000 claims description 7
- 229940097325 prolactin Drugs 0.000 claims description 7
- 108010033898 transforming growth factor beta1.2 Proteins 0.000 claims description 7
- 229960005356 urokinase Drugs 0.000 claims description 7
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 claims description 6
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 claims description 6
- 102100026189 Beta-galactosidase Human genes 0.000 claims description 6
- 108010049931 Bone Morphogenetic Protein 2 Proteins 0.000 claims description 6
- 108010049951 Bone Morphogenetic Protein 3 Proteins 0.000 claims description 6
- 102100024506 Bone morphogenetic protein 2 Human genes 0.000 claims description 6
- 102100024504 Bone morphogenetic protein 3 Human genes 0.000 claims description 6
- 101100322583 Caenorhabditis elegans add-2 gene Proteins 0.000 claims description 6
- 101800000155 Epiregulin Proteins 0.000 claims description 6
- 108010008165 Etanercept Proteins 0.000 claims description 6
- 102000004641 Fetal Proteins Human genes 0.000 claims description 6
- 108010003471 Fetal Proteins Proteins 0.000 claims description 6
- 102000003971 Fibroblast Growth Factor 1 Human genes 0.000 claims description 6
- 102000012565 Fibroblast growth factor 17 Human genes 0.000 claims description 6
- 108050002074 Fibroblast growth factor 17 Proteins 0.000 claims description 6
- 102000003969 Fibroblast growth factor 4 Human genes 0.000 claims description 6
- 108090000381 Fibroblast growth factor 4 Proteins 0.000 claims description 6
- 102000003957 Fibroblast growth factor 9 Human genes 0.000 claims description 6
- 108090000367 Fibroblast growth factor 9 Proteins 0.000 claims description 6
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 claims description 6
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 claims description 6
- 108010090290 Growth Differentiation Factor 2 Proteins 0.000 claims description 6
- 102000009465 Growth Factor Receptors Human genes 0.000 claims description 6
- 108010009202 Growth Factor Receptors Proteins 0.000 claims description 6
- 102100040892 Growth/differentiation factor 2 Human genes 0.000 claims description 6
- 102100035379 Growth/differentiation factor 5 Human genes 0.000 claims description 6
- 101710204282 Growth/differentiation factor 5 Proteins 0.000 claims description 6
- 102100035368 Growth/differentiation factor 6 Human genes 0.000 claims description 6
- 101710204281 Growth/differentiation factor 6 Proteins 0.000 claims description 6
- 102000006992 Interferon-alpha Human genes 0.000 claims description 6
- 108010047761 Interferon-alpha Proteins 0.000 claims description 6
- 108090000742 Neurotrophin 3 Proteins 0.000 claims description 6
- 102000004230 Neurotrophin 3 Human genes 0.000 claims description 6
- 102000004584 Somatomedin Receptors Human genes 0.000 claims description 6
- 108010017622 Somatomedin Receptors Proteins 0.000 claims description 6
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 claims description 6
- 102000011117 Transforming Growth Factor beta2 Human genes 0.000 claims description 6
- 101800000304 Transforming growth factor beta-2 Proteins 0.000 claims description 6
- 102100040247 Tumor necrosis factor Human genes 0.000 claims description 6
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 6
- 239000005667 attractant Substances 0.000 claims description 6
- 210000003719 b-lymphocyte Anatomy 0.000 claims description 6
- 108010005774 beta-Galactosidase Proteins 0.000 claims description 6
- 230000031902 chemoattractant activity Effects 0.000 claims description 6
- 230000001268 conjugating effect Effects 0.000 claims description 6
- 229960001251 denosumab Drugs 0.000 claims description 6
- 229960000301 factor viii Drugs 0.000 claims description 6
- 229940098448 fibroblast growth factor 7 Drugs 0.000 claims description 6
- 229940028334 follicle stimulating hormone Drugs 0.000 claims description 6
- 108010070827 growth differentiation factor 7 Proteins 0.000 claims description 6
- 239000003112 inhibitor Substances 0.000 claims description 6
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 6
- 229940032018 neurotrophin 3 Drugs 0.000 claims description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims description 6
- 239000002243 precursor Substances 0.000 claims description 6
- 239000012581 transferrin Substances 0.000 claims description 6
- 229940072041 transforming growth factor beta 2 Drugs 0.000 claims description 6
- 101100322581 Caenorhabditis elegans add-1 gene Proteins 0.000 claims description 5
- 101800002113 Endothelial cell growth factor beta Proteins 0.000 claims description 5
- 108090000581 Leukemia inhibitory factor Proteins 0.000 claims description 5
- 102000004058 Leukemia inhibitory factor Human genes 0.000 claims description 5
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 claims description 5
- 230000003213 activating effect Effects 0.000 claims description 5
- 229960002964 adalimumab Drugs 0.000 claims description 5
- AGVAZMGAQJOSFJ-WZHZPDAFSA-M cobalt(2+);[(2r,3s,4r,5s)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2r)-1-[3-[(1r,2r,3r,4z,7s,9z,12s,13s,14z,17s,18s,19r)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2 Chemical compound [Co+2].N#[C-].[N-]([C@@H]1[C@H](CC(N)=O)[C@@]2(C)CCC(=O)NC[C@@H](C)OP(O)(=O)O[C@H]3[C@H]([C@H](O[C@@H]3CO)N3C4=CC(C)=C(C)C=C4N=C3)O)\C2=C(C)/C([C@H](C\2(C)C)CCC(N)=O)=N/C/2=C\C([C@H]([C@@]/2(CC(N)=O)C)CCC(N)=O)=N\C\2=C(C)/C2=N[C@]1(C)[C@@](C)(CC(N)=O)[C@@H]2CCC(N)=O AGVAZMGAQJOSFJ-WZHZPDAFSA-M 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 239000012011 nucleophilic catalyst Substances 0.000 claims description 5
- AOTMRIXFFOGWDT-UHFFFAOYSA-N omega-hydroxyhexadecanoic acid methyl ester Natural products COC(=O)CCCCCCCCCCCCCCCO AOTMRIXFFOGWDT-UHFFFAOYSA-N 0.000 claims description 5
- 229960000187 tissue plasminogen activator Drugs 0.000 claims description 5
- 102000003390 tumor necrosis factor Human genes 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- 108090000056 Complement factor B Proteins 0.000 claims description 4
- 102000003712 Complement factor B Human genes 0.000 claims description 4
- 239000012359 Methanesulfonyl chloride Substances 0.000 claims description 4
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 claims description 4
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 claims description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 4
- 239000012346 acetyl chloride Substances 0.000 claims description 4
- 230000004913 activation Effects 0.000 claims description 4
- 210000000988 bone and bone Anatomy 0.000 claims description 4
- 230000035605 chemotaxis Effects 0.000 claims description 4
- 229960000403 etanercept Drugs 0.000 claims description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 4
- 150000004702 methyl esters Chemical group 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 claims description 4
- 230000004936 stimulating effect Effects 0.000 claims description 4
- CPEMIWRXQWEEGD-UHFFFAOYSA-N 16-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxyimino]hexadecanoic acid Chemical compound NOCCOCCOCCOCCON=CCCCCCCCCCCCCCCC(O)=O CPEMIWRXQWEEGD-UHFFFAOYSA-N 0.000 claims description 3
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 claims description 3
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 claims description 3
- 239000012027 Collins reagent Substances 0.000 claims description 3
- 238000006646 Dess-Martin oxidation reaction Methods 0.000 claims description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 108010042352 Urokinase Plasminogen Activator Receptors Proteins 0.000 claims description 3
- 102000004504 Urokinase Plasminogen Activator Receptors Human genes 0.000 claims description 3
- 239000012190 activator Substances 0.000 claims description 3
- 239000000872 buffer Substances 0.000 claims description 3
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical compound [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004494 ethyl ester group Chemical group 0.000 claims description 3
- 238000011534 incubation Methods 0.000 claims description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 3
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 claims description 3
- UIYHCSCDARAPMG-UHFFFAOYSA-N methyl 16-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxyamino]hexadecanoate Chemical compound COC(=O)CCCCCCCCCCCCCCCNOCCOCCOCCOCCON UIYHCSCDARAPMG-UHFFFAOYSA-N 0.000 claims description 3
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000003544 oxime group Chemical group 0.000 claims description 3
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- NPRDHMWYZHSAHR-UHFFFAOYSA-N pyridine;trioxochromium Chemical compound O=[Cr](=O)=O.C1=CC=NC=C1.C1=CC=NC=C1 NPRDHMWYZHSAHR-UHFFFAOYSA-N 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229950000244 sulfanilic acid Drugs 0.000 claims description 3
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 claims description 3
- 230000001131 transforming effect Effects 0.000 claims description 3
- XFDUHJPVQKIXHO-UHFFFAOYSA-N 3-aminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1 XFDUHJPVQKIXHO-UHFFFAOYSA-N 0.000 claims description 2
- 102000013566 Plasminogen Human genes 0.000 claims description 2
- 108010051456 Plasminogen Proteins 0.000 claims description 2
- 102100031294 Thymic stromal lymphopoietin Human genes 0.000 claims description 2
- 101710187743 Tumor necrosis factor receptor superfamily member 1A Proteins 0.000 claims description 2
- 102100033732 Tumor necrosis factor receptor superfamily member 1A Human genes 0.000 claims description 2
- 125000005313 fatty acid group Chemical group 0.000 claims description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 claims description 2
- 210000005036 nerve Anatomy 0.000 claims description 2
- 108010029307 thymic stromal lymphopoietin Proteins 0.000 claims description 2
- 210000001541 thymus gland Anatomy 0.000 claims description 2
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 claims 4
- 102100028728 Bone morphogenetic protein 1 Human genes 0.000 claims 2
- 102400001368 Epidermal growth factor Human genes 0.000 claims 2
- 102100026818 Inhibin beta E chain Human genes 0.000 claims 2
- 102000007651 Macrophage Colony-Stimulating Factor Human genes 0.000 claims 2
- 210000003494 hepatocyte Anatomy 0.000 claims 2
- 108010041308 Endothelial Growth Factors Proteins 0.000 claims 1
- 102100031706 Fibroblast growth factor 1 Human genes 0.000 claims 1
- 101710167839 Morphogenetic protein Proteins 0.000 claims 1
- 238000002512 chemotherapy Methods 0.000 claims 1
- 230000002608 insulinlike Effects 0.000 claims 1
- JEHCHYAKAXDFKV-UHFFFAOYSA-J lead tetraacetate Chemical compound CC(=O)O[Pb](OC(C)=O)(OC(C)=O)OC(C)=O JEHCHYAKAXDFKV-UHFFFAOYSA-J 0.000 claims 1
- 230000001002 morphogenetic effect Effects 0.000 claims 1
- 230000003285 pharmacodynamic effect Effects 0.000 abstract description 4
- 230000036541 health Effects 0.000 abstract description 3
- 235000018102 proteins Nutrition 0.000 description 504
- 108010035532 Collagen Proteins 0.000 description 30
- 102000008186 Collagen Human genes 0.000 description 30
- 229920001436 collagen Polymers 0.000 description 27
- 108091005703 transmembrane proteins Proteins 0.000 description 24
- 102000035160 transmembrane proteins Human genes 0.000 description 23
- 102000019034 Chemokines Human genes 0.000 description 22
- 108010012236 Chemokines Proteins 0.000 description 22
- 229920003169 water-soluble polymer Polymers 0.000 description 22
- 230000000295 complement effect Effects 0.000 description 21
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 19
- 102000036639 antigens Human genes 0.000 description 19
- 108091007433 antigens Proteins 0.000 description 19
- 102000005606 Activins Human genes 0.000 description 18
- 101710159648 Uncharacterized protein Proteins 0.000 description 18
- 239000000427 antigen Substances 0.000 description 18
- 108090000342 C-Type Lectins Proteins 0.000 description 17
- 102000003930 C-Type Lectins Human genes 0.000 description 17
- 108060003951 Immunoglobulin Proteins 0.000 description 16
- 102000018358 immunoglobulin Human genes 0.000 description 16
- 101800001224 Disintegrin Proteins 0.000 description 15
- 102000010780 Platelet-Derived Growth Factor Human genes 0.000 description 15
- 108010038512 Platelet-Derived Growth Factor Proteins 0.000 description 15
- 102000005741 Metalloproteases Human genes 0.000 description 14
- 108010006035 Metalloproteases Proteins 0.000 description 14
- 108060008683 Tumor Necrosis Factor Receptor Proteins 0.000 description 13
- 239000003446 ligand Substances 0.000 description 13
- 102000003298 tumor necrosis factor receptor Human genes 0.000 description 13
- 102000002938 Thrombospondin Human genes 0.000 description 12
- 108060008245 Thrombospondin Proteins 0.000 description 12
- 239000012634 fragment Substances 0.000 description 12
- 210000004901 leucine-rich repeat Anatomy 0.000 description 12
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 11
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 11
- 108010006444 Leucine-Rich Repeat Proteins Proteins 0.000 description 11
- 102000012479 Serine Proteases Human genes 0.000 description 11
- 108010022999 Serine Proteases Proteins 0.000 description 11
- 102000014914 Carrier Proteins Human genes 0.000 description 10
- 230000004069 differentiation Effects 0.000 description 10
- KRJOFJHOZZPBKI-UHFFFAOYSA-N 87-[(2-amino-1-hydroxypropylidene)amino]-76-benzyl-7,22,52-tri(butan-2-yl)-4,34,37,64-tetrakis(3-carbamimidamidopropyl)-31-(2-carboxyethyl)-2,5,14,17,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71,74,77,80,88,91-heptacosahydroxy-46-(1-hydroxyethyl)-58-(3-hydroxy-3-iminopropyl)-40,55,90-tris[(4-hydroxyphenyl)methyl]-70-(1H-indol-3-ylmethyl)-16,25,73-trimethyl-67-(2-methylpropyl)-8-oxo-84,85,94,95,98,99-hexathia-3,6,9,15,18,21,24,27,30,33,36,39,42,45,48,51,54,57,60,63,66,69,72,75,78,81,89,92-octacosazatetracyclo[47.43.4.419,79.09,13]hecta-2,5,14,17,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71,74,77,80,88,91-heptacosaene-82-carboxylic acid Chemical compound CCC(C)C1N=C(O)C2CSSCC3\N=C(O)\C(Cc4ccccc4)\N=C(O)\C(C)\N=C(O)\C(Cc4c[nH]c5ccccc45)\N=C(O)/C(CC(C)C)\N=C(O)\C(CCCNC(N)=N)\N=C(O)\C\N=C(O)\C(CCC(O)=N)\N=C(O)/C(Cc4ccc(O)cc4)\N=C(O)\C(\N=C(O)\C(CSSCC(N=C(O)C(Cc4ccc(O)cc4)N=C(O)C(CSSCC(N=C3O)C(O)=O)\N=C(/O)C(C)N)C(O)=NC(CCCNC(N)=N)C(O)=NC(C(C)CC)C(=O)N3CCCC3C(O)=NC(C)C(O)=N2)N=C(O)C(N=C(O)CN=C(O)C(Cc2ccc(O)cc2)N=C(O)C(CCCNC(N)=N)N=C(O)C(CCCNC(N)=N)N=C(O)C(CCC(O)=O)N=C(O)CN=C(O)C(C)N=C1O)C(C)O)C(C)CC KRJOFJHOZZPBKI-UHFFFAOYSA-N 0.000 description 8
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 description 8
- 102000004316 Oxidoreductases Human genes 0.000 description 8
- 108090000854 Oxidoreductases Proteins 0.000 description 8
- 210000002889 endothelial cell Anatomy 0.000 description 8
- 229940088597 hormone Drugs 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 108010071619 Apolipoproteins Proteins 0.000 description 7
- 102000007592 Apolipoproteins Human genes 0.000 description 7
- 102000004152 Bone morphogenetic protein 1 Human genes 0.000 description 7
- 102000012545 EGF-like domains Human genes 0.000 description 7
- 108050002150 EGF-like domains Proteins 0.000 description 7
- 229920001612 Hydroxyethyl starch Polymers 0.000 description 7
- 102100033237 Pro-epidermal growth factor Human genes 0.000 description 7
- 108091008324 binding proteins Proteins 0.000 description 7
- 239000002299 complementary DNA Substances 0.000 description 7
- 239000005556 hormone Substances 0.000 description 7
- 229940050526 hydroxyethylstarch Drugs 0.000 description 7
- 210000002569 neuron Anatomy 0.000 description 7
- 108010009906 Angiopoietins Proteins 0.000 description 6
- 102000009840 Angiopoietins Human genes 0.000 description 6
- 108010081589 Becaplermin Proteins 0.000 description 6
- 102000003745 Hepatocyte Growth Factor Human genes 0.000 description 6
- 108090000100 Hepatocyte Growth Factor Proteins 0.000 description 6
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 6
- 102100028123 Macrophage colony-stimulating factor 1 Human genes 0.000 description 6
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 6
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 6
- 239000004372 Polyvinyl alcohol Substances 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- 102000004357 Transferases Human genes 0.000 description 6
- 108090000992 Transferases Proteins 0.000 description 6
- 108010046377 Whey Proteins Proteins 0.000 description 6
- 235000014633 carbohydrates Nutrition 0.000 description 6
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 6
- 235000018417 cysteine Nutrition 0.000 description 6
- 239000000122 growth hormone Substances 0.000 description 6
- 229920002674 hyaluronan Polymers 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000002438 mitochondrial effect Effects 0.000 description 6
- 108010000685 platelet-derived growth factor AB Proteins 0.000 description 6
- 229920000765 poly(2-oxazolines) Polymers 0.000 description 6
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 6
- 229920001515 polyalkylene glycol Polymers 0.000 description 6
- 229920002451 polyvinyl alcohol Polymers 0.000 description 6
- OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical compound [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 description 6
- 210000002307 prostate Anatomy 0.000 description 6
- 239000003001 serine protease inhibitor Substances 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 210000001550 testis Anatomy 0.000 description 6
- 102100023995 Beta-nerve growth factor Human genes 0.000 description 5
- 101710117545 C protein Proteins 0.000 description 5
- 108010051696 Growth Hormone Proteins 0.000 description 5
- 108010085895 Laminin Proteins 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 5
- 101710102218 Serine protease inhibitor Proteins 0.000 description 5
- 229940122055 Serine protease inhibitor Drugs 0.000 description 5
- 102100038803 Somatotropin Human genes 0.000 description 5
- 102000007544 Whey Proteins Human genes 0.000 description 5
- 102000005840 alpha-Galactosidase Human genes 0.000 description 5
- 108010030291 alpha-Galactosidase Proteins 0.000 description 5
- SQVRNKJHWKZAKO-UHFFFAOYSA-N beta-N-Acetyl-D-neuraminic acid Natural products CC(=O)NC1C(O)CC(O)(C(O)=O)OC1C(O)C(O)CO SQVRNKJHWKZAKO-UHFFFAOYSA-N 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 210000002510 keratinocyte Anatomy 0.000 description 5
- 201000001441 melanoma Diseases 0.000 description 5
- 229940053128 nerve growth factor Drugs 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 235000019419 proteases Nutrition 0.000 description 5
- SQVRNKJHWKZAKO-OQPLDHBCSA-N sialic acid Chemical compound CC(=O)N[C@@H]1[C@@H](O)C[C@@](O)(C(O)=O)OC1[C@H](O)[C@H](O)CO SQVRNKJHWKZAKO-OQPLDHBCSA-N 0.000 description 5
- SQDAZGGFXASXDW-UHFFFAOYSA-N 5-bromo-2-(trifluoromethoxy)pyridine Chemical compound FC(F)(F)OC1=CC=C(Br)C=N1 SQDAZGGFXASXDW-UHFFFAOYSA-N 0.000 description 4
- 108010006303 Carboxypeptidases Proteins 0.000 description 4
- 102000005367 Carboxypeptidases Human genes 0.000 description 4
- 108010078791 Carrier Proteins Proteins 0.000 description 4
- 229920001287 Chondroitin sulfate Polymers 0.000 description 4
- 108020005199 Dehydrogenases Proteins 0.000 description 4
- 229920002307 Dextran Polymers 0.000 description 4
- 102000014250 Fibroblast growth factor 12 Human genes 0.000 description 4
- 108050003239 Fibroblast growth factor 12 Proteins 0.000 description 4
- 102000016359 Fibronectins Human genes 0.000 description 4
- 108010067306 Fibronectins Proteins 0.000 description 4
- 102000010956 Glypican Human genes 0.000 description 4
- 108050001154 Glypican Proteins 0.000 description 4
- 108010002352 Interleukin-1 Proteins 0.000 description 4
- 102000004882 Lipase Human genes 0.000 description 4
- 108090001060 Lipase Proteins 0.000 description 4
- 239000004367 Lipase Substances 0.000 description 4
- 108010052285 Membrane Proteins Proteins 0.000 description 4
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 4
- 102000016611 Proteoglycans Human genes 0.000 description 4
- 108010067787 Proteoglycans Proteins 0.000 description 4
- 108010009413 Pyrophosphatases Proteins 0.000 description 4
- 102000009609 Pyrophosphatases Human genes 0.000 description 4
- 108091007187 Reductases Proteins 0.000 description 4
- 108010031873 Secretory Phospholipases A2 Proteins 0.000 description 4
- 102000005473 Secretory Phospholipases A2 Human genes 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 102000012265 beta-defensin Human genes 0.000 description 4
- 108050002883 beta-defensin Proteins 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229940059329 chondroitin sulfate Drugs 0.000 description 4
- 238000004891 communication Methods 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 210000000918 epididymis Anatomy 0.000 description 4
- 201000010063 epididymitis Diseases 0.000 description 4
- 150000004676 glycans Chemical class 0.000 description 4
- 229940072221 immunoglobulins Drugs 0.000 description 4
- 102000002467 interleukin receptors Human genes 0.000 description 4
- 108010093036 interleukin receptors Proteins 0.000 description 4
- 229940040461 lipase Drugs 0.000 description 4
- 235000019421 lipase Nutrition 0.000 description 4
- 229940066294 lung surfactant Drugs 0.000 description 4
- 239000003580 lung surfactant Substances 0.000 description 4
- 230000000527 lymphocytic effect Effects 0.000 description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 4
- 229920001282 polysaccharide Polymers 0.000 description 4
- 239000005017 polysaccharide Substances 0.000 description 4
- 230000035935 pregnancy Effects 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 235000021119 whey protein Nutrition 0.000 description 4
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 description 3
- ZIIUUSVHCHPIQD-UHFFFAOYSA-N 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 ZIIUUSVHCHPIQD-UHFFFAOYSA-N 0.000 description 3
- 101710132601 Capsid protein Proteins 0.000 description 3
- 108010080937 Carboxypeptidases A Proteins 0.000 description 3
- 102000000496 Carboxypeptidases A Human genes 0.000 description 3
- 201000009030 Carcinoma Diseases 0.000 description 3
- 108010000063 Ciliary Neurotrophic Factor Receptor Proteins 0.000 description 3
- 102100031615 Ciliary neurotrophic factor receptor subunit alpha Human genes 0.000 description 3
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 3
- 102000003849 Cytochrome P450 Human genes 0.000 description 3
- 229920000045 Dermatan sulfate Polymers 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 102000051366 Glycosyltransferases Human genes 0.000 description 3
- 108700023372 Glycosyltransferases Proteins 0.000 description 3
- 108060003393 Granulin Proteins 0.000 description 3
- 102000000589 Interleukin-1 Human genes 0.000 description 3
- 102000003960 Ligases Human genes 0.000 description 3
- 108090000364 Ligases Proteins 0.000 description 3
- 102000055008 Matrilin Proteins Human genes 0.000 description 3
- 108010072582 Matrilin Proteins Proteins 0.000 description 3
- 102000018697 Membrane Proteins Human genes 0.000 description 3
- 108010083674 Myelin Proteins Proteins 0.000 description 3
- 102000006386 Myelin Proteins Human genes 0.000 description 3
- 102000003797 Neuropeptides Human genes 0.000 description 3
- 108090000189 Neuropeptides Proteins 0.000 description 3
- 102000019280 Pancreatic lipases Human genes 0.000 description 3
- 108050006759 Pancreatic lipases Proteins 0.000 description 3
- 229940122344 Peptidase inhibitor Drugs 0.000 description 3
- 102000015439 Phospholipases Human genes 0.000 description 3
- 108010064785 Phospholipases Proteins 0.000 description 3
- 108091000080 Phosphotransferase Proteins 0.000 description 3
- 102100030485 Platelet-derived growth factor receptor alpha Human genes 0.000 description 3
- 102100029740 Poliovirus receptor Human genes 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- 239000004373 Pullulan Substances 0.000 description 3
- 229920001218 Pullulan Polymers 0.000 description 3
- 102000040739 Secretory proteins Human genes 0.000 description 3
- 108091058545 Secretory proteins Proteins 0.000 description 3
- 102100032491 Serine protease 1 Human genes 0.000 description 3
- 101710151387 Serine protease 1 Proteins 0.000 description 3
- 108010061228 Sialomucins Proteins 0.000 description 3
- 210000001744 T-lymphocyte Anatomy 0.000 description 3
- 102100033733 Tumor necrosis factor receptor superfamily member 1B Human genes 0.000 description 3
- 101710187830 Tumor necrosis factor receptor superfamily member 1B Proteins 0.000 description 3
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 102100021144 Zinc-alpha-2-glycoprotein Human genes 0.000 description 3
- 101710201241 Zinc-alpha-2-glycoprotein Proteins 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- AVJBPWGFOQAPRH-FWMKGIEWSA-N alpha-L-IdopA-(1->3)-beta-D-GalpNAc4S Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@H](OS(O)(=O)=O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](C(O)=O)O1 AVJBPWGFOQAPRH-FWMKGIEWSA-N 0.000 description 3
- 239000003098 androgen Substances 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 230000023555 blood coagulation Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 210000004268 dentin Anatomy 0.000 description 3
- 229940051593 dermatan sulfate Drugs 0.000 description 3
- 230000003511 endothelial effect Effects 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 229940014144 folate Drugs 0.000 description 3
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 3
- 235000019152 folic acid Nutrition 0.000 description 3
- 239000011724 folic acid Substances 0.000 description 3
- 229940099552 hyaluronan Drugs 0.000 description 3
- KIUKXJAPPMFGSW-MNSSHETKSA-N hyaluronan Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)C1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H](C(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-MNSSHETKSA-N 0.000 description 3
- 229960003160 hyaluronic acid Drugs 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 108010093564 inter-alpha-inhibitor Proteins 0.000 description 3
- UGOZVNFCFYTPAZ-IOXYNQHNSA-N levemir Chemical compound CCCCCCCCCCCCCC(=O)NCCCC[C@@H](C(O)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=2N=CNC=2)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=2N=CNC=2)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=2C=CC=CC=2)C(C)C)CSSC[C@@H]2NC(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)C(C)C)CSSC[C@H](NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC2=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H](CSSC1)C(=O)N[C@@H](CC(N)=O)C(O)=O)CC1=CC=C(O)C=C1 UGOZVNFCFYTPAZ-IOXYNQHNSA-N 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 210000004379 membrane Anatomy 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 108020004999 messenger RNA Proteins 0.000 description 3
- 230000000242 pagocytic effect Effects 0.000 description 3
- 210000003254 palate Anatomy 0.000 description 3
- 229940116369 pancreatic lipase Drugs 0.000 description 3
- 230000006320 pegylation Effects 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 102000020233 phosphotransferase Human genes 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 108010048507 poliovirus receptor Proteins 0.000 description 3
- 229920002627 poly(phosphazenes) Polymers 0.000 description 3
- 229920005646 polycarboxylate Polymers 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000019423 pullulan Nutrition 0.000 description 3
- 108010093841 spermadhesin Proteins 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 230000002992 thymic effect Effects 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- KZMAWJRXKGLWGS-UHFFFAOYSA-N 2-chloro-n-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-n-(3-methoxypropyl)acetamide Chemical compound S1C(N(C(=O)CCl)CCCOC)=NC(C=2C=CC(OC)=CC=2)=C1 KZMAWJRXKGLWGS-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- 101800000263 Acidic protein Proteins 0.000 description 2
- 102100033312 Alpha-2-macroglobulin Human genes 0.000 description 2
- 108090000084 Antiporters Proteins 0.000 description 2
- 102000003669 Antiporters Human genes 0.000 description 2
- 108010052412 Apelin Proteins 0.000 description 2
- 102000018746 Apelin Human genes 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 102100039829 Beta-defensin 110 Human genes 0.000 description 2
- 101710187203 Beta-defensin 110 Proteins 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 102000055006 Calcitonin Human genes 0.000 description 2
- 108060001064 Calcitonin Proteins 0.000 description 2
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 2
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 2
- 102100024052 Calcium-binding protein 1 Human genes 0.000 description 2
- 101710161998 Calcium-binding protein 1 Proteins 0.000 description 2
- 108091006146 Channels Proteins 0.000 description 2
- 229920001661 Chitosan Polymers 0.000 description 2
- 102100025566 Chymotrypsin-like protease CTRL-1 Human genes 0.000 description 2
- 102100039501 Chymotrypsinogen B Human genes 0.000 description 2
- 101000573945 Coccidioides posadasii (strain C735) Neutral protease 2 homolog MEP2 Proteins 0.000 description 2
- 102100027593 Cystatin-9 Human genes 0.000 description 2
- 108050004041 Cystatin-9 Proteins 0.000 description 2
- 101710088194 Dehydrogenase Proteins 0.000 description 2
- 108010049959 Discoidins Proteins 0.000 description 2
- 108091008815 Eph receptors Proteins 0.000 description 2
- 108010012820 Follistatin-Related Proteins Proteins 0.000 description 2
- 102100029379 Follistatin-related protein 3 Human genes 0.000 description 2
- 102000013446 GTP Phosphohydrolases Human genes 0.000 description 2
- 108091006109 GTPases Proteins 0.000 description 2
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 2
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 2
- 229920002971 Heparan sulfate Polymers 0.000 description 2
- 102100031415 Hepatic triacylglycerol lipase Human genes 0.000 description 2
- 101100118545 Holotrichia diomphalia EGF-like gene Proteins 0.000 description 2
- 101000856199 Homo sapiens Chymotrypsin-like protease CTRL-1 Proteins 0.000 description 2
- 101000798702 Homo sapiens Transmembrane protease serine 4 Proteins 0.000 description 2
- 101000795074 Homo sapiens Tryptase alpha/beta-1 Proteins 0.000 description 2
- 108010042653 IgA receptor Proteins 0.000 description 2
- 102000016844 Immunoglobulin-like domains Human genes 0.000 description 2
- 108050006430 Immunoglobulin-like domains Proteins 0.000 description 2
- 108010061971 Inhibin-beta Subunits Proteins 0.000 description 2
- 102000012407 Inhibin-beta Subunits Human genes 0.000 description 2
- 102000002746 Inhibins Human genes 0.000 description 2
- 108010004250 Inhibins Proteins 0.000 description 2
- 108010089308 Insulin Detemir Proteins 0.000 description 2
- 102000019223 Interleukin-1 receptor Human genes 0.000 description 2
- 108050006617 Interleukin-1 receptor Proteins 0.000 description 2
- 102000013462 Interleukin-12 Human genes 0.000 description 2
- 108010065805 Interleukin-12 Proteins 0.000 description 2
- 102000013691 Interleukin-17 Human genes 0.000 description 2
- 108050003558 Interleukin-17 Proteins 0.000 description 2
- 102100033096 Interleukin-17D Human genes 0.000 description 2
- 102000000588 Interleukin-2 Human genes 0.000 description 2
- 108010002350 Interleukin-2 Proteins 0.000 description 2
- 108010066979 Interleukin-27 Proteins 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 102000004195 Isomerases Human genes 0.000 description 2
- 108090000769 Isomerases Proteins 0.000 description 2
- 101710172072 Kexin Proteins 0.000 description 2
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 2
- 102100031775 Leptin receptor Human genes 0.000 description 2
- 102100021747 Leukemia inhibitory factor receptor Human genes 0.000 description 2
- 102100030218 Matrix metalloproteinase-19 Human genes 0.000 description 2
- 102000006404 Mitochondrial Proteins Human genes 0.000 description 2
- 108010058682 Mitochondrial Proteins Proteins 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- SQVRNKJHWKZAKO-PFQGKNLYSA-N N-acetyl-beta-neuraminic acid Chemical compound CC(=O)N[C@@H]1[C@@H](O)C[C@@](O)(C(O)=O)O[C@H]1[C@H](O)[C@H](O)CO SQVRNKJHWKZAKO-PFQGKNLYSA-N 0.000 description 2
- 108010064527 OSM-LIF Receptors Proteins 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 102000016387 Pancreatic elastase Human genes 0.000 description 2
- 108010067372 Pancreatic elastase Proteins 0.000 description 2
- 102000003982 Parathyroid hormone Human genes 0.000 description 2
- 108090000445 Parathyroid hormone Proteins 0.000 description 2
- 102100037883 Phospholipase B1, membrane-associated Human genes 0.000 description 2
- 108090000113 Plasma Kallikrein Proteins 0.000 description 2
- 102000003827 Plasma Kallikrein Human genes 0.000 description 2
- 101710148465 Platelet-derived growth factor receptor alpha Proteins 0.000 description 2
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 description 2
- 101710164680 Platelet-derived growth factor receptor beta Proteins 0.000 description 2
- 102100040990 Platelet-derived growth factor subunit B Human genes 0.000 description 2
- 101710103494 Platelet-derived growth factor subunit B Proteins 0.000 description 2
- 108010015078 Pregnancy-Associated alpha 2-Macroglobulins Proteins 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- 101710088675 Proline-rich peptide Proteins 0.000 description 2
- 102100034014 Prolyl 3-hydroxylase 3 Human genes 0.000 description 2
- 108010043005 Prolyl Hydroxylases Proteins 0.000 description 2
- 102000004079 Prolyl Hydroxylases Human genes 0.000 description 2
- 108010003894 Protein-Lysine 6-Oxidase Proteins 0.000 description 2
- 102100026858 Protein-lysine 6-oxidase Human genes 0.000 description 2
- 102000011274 Secretoglobin Human genes 0.000 description 2
- 108050001520 Secretoglobin Proteins 0.000 description 2
- 102000012010 Sialomucins Human genes 0.000 description 2
- 108010061312 Sphingomyelin Phosphodiesterase Proteins 0.000 description 2
- 102100036428 Spondin-1 Human genes 0.000 description 2
- 101710092167 Spondin-1 Proteins 0.000 description 2
- 108090000787 Subtilisin Proteins 0.000 description 2
- 102000011362 Thioredoxin domains Human genes 0.000 description 2
- 108050001669 Thioredoxin domains Proteins 0.000 description 2
- 102100032471 Transmembrane protease serine 4 Human genes 0.000 description 2
- 102100034392 Trypsin-2 Human genes 0.000 description 2
- 102100029639 Tryptase alpha/beta-1 Human genes 0.000 description 2
- 102000010571 Type II Bone Morphogenetic Protein Receptors Human genes 0.000 description 2
- 108010063130 Type II Bone Morphogenetic Protein Receptors Proteins 0.000 description 2
- 239000005862 Whey Substances 0.000 description 2
- 102000010126 acid sphingomyelin phosphodiesterase activity proteins Human genes 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 229960005305 adenosine Drugs 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- 229940053200 antiepileptics fatty acid derivative Drugs 0.000 description 2
- BWVPHIKGXQBZPV-QKFDDRBGSA-N apelin Chemical compound NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N1[C@H](C(=O)N[C@@H](CC(O)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=2NC=NC=2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=2NC=NC=2)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCSC)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(O)=O)CCC1 BWVPHIKGXQBZPV-QKFDDRBGSA-N 0.000 description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 description 2
- 239000003114 blood coagulation factor Substances 0.000 description 2
- 210000004899 c-terminal region Anatomy 0.000 description 2
- 229960004015 calcitonin Drugs 0.000 description 2
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 210000000845 cartilage Anatomy 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 229940045110 chitosan Drugs 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229960002086 dextran Drugs 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 210000000981 epithelium Anatomy 0.000 description 2
- 102000037865 fusion proteins Human genes 0.000 description 2
- 108020001507 fusion proteins Proteins 0.000 description 2
- 102000034356 gene-regulatory proteins Human genes 0.000 description 2
- 108091006104 gene-regulatory proteins Proteins 0.000 description 2
- 108010048607 glycerophosphodiester phosphodiesterase Proteins 0.000 description 2
- 210000002288 golgi apparatus Anatomy 0.000 description 2
- 210000003714 granulocyte Anatomy 0.000 description 2
- 229940048921 humira Drugs 0.000 description 2
- 230000001900 immune effect Effects 0.000 description 2
- 230000002163 immunogen Effects 0.000 description 2
- 229960000367 inositol Drugs 0.000 description 2
- 229960003948 insulin detemir Drugs 0.000 description 2
- 229940117681 interleukin-12 Drugs 0.000 description 2
- 108010001618 interleukin-20 receptor Proteins 0.000 description 2
- 230000037427 ion transport Effects 0.000 description 2
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 2
- 108010019813 leptin receptors Proteins 0.000 description 2
- 210000000265 leukocyte Anatomy 0.000 description 2
- 150000004668 long chain fatty acids Chemical class 0.000 description 2
- 210000004698 lymphocyte Anatomy 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 210000002850 nasal mucosa Anatomy 0.000 description 2
- 102000003819 neurexophilin Human genes 0.000 description 2
- 108090000126 neurexophilin Proteins 0.000 description 2
- 210000004492 nuclear pore Anatomy 0.000 description 2
- 108010000416 ovomacroglobulin Proteins 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229940012957 plasmin Drugs 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 210000003296 saliva Anatomy 0.000 description 2
- 230000003248 secreting effect Effects 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229940032147 starch Drugs 0.000 description 2
- 210000002536 stromal cell Anatomy 0.000 description 2
- 230000002381 testicular Effects 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- RWBLWXCGQLZKLK-USVTTYPOSA-N (2s)-2-[(2-aminoacetyl)amino]-n-[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[2-[[(2s)-1-[[(2s)-1-[[(2s)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxob Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CC(N)=O)NC(=O)CN)C(C)C)C1=CN=CN1 RWBLWXCGQLZKLK-USVTTYPOSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- 102100025573 1-alkyl-2-acetylglycerophosphocholine esterase Human genes 0.000 description 1
- GZCWLCBFPRFLKL-UHFFFAOYSA-N 1-prop-2-ynoxypropan-2-ol Chemical compound CC(O)COCC#C GZCWLCBFPRFLKL-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- 102100037429 17-beta-hydroxysteroid dehydrogenase 13 Human genes 0.000 description 1
- 101710194118 17-beta-hydroxysteroid dehydrogenase 13 Proteins 0.000 description 1
- 102100027962 2-5A-dependent ribonuclease Human genes 0.000 description 1
- 108010000834 2-5A-dependent ribonuclease Proteins 0.000 description 1
- 108010050201 2-hydroxybutyrate dehydrogenase Proteins 0.000 description 1
- 108091071337 20 family Proteins 0.000 description 1
- 108700020831 3-Hydroxyacyl-CoA Dehydrogenase Proteins 0.000 description 1
- DPEUWKZJZIPZKE-OFANTOPUSA-N 330936-69-1 Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)O)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@@H](N)CCSC)C1=CC=CC=C1 DPEUWKZJZIPZKE-OFANTOPUSA-N 0.000 description 1
- 101800001643 6K protein Proteins 0.000 description 1
- 108010019238 ADPribose pyrophosphatase Proteins 0.000 description 1
- 101150079978 AGRN gene Proteins 0.000 description 1
- 102100033618 ATP-binding cassette sub-family A member 2 Human genes 0.000 description 1
- 102100033639 Acetylcholinesterase Human genes 0.000 description 1
- 108010022752 Acetylcholinesterase Proteins 0.000 description 1
- 108010051457 Acid Phosphatase Proteins 0.000 description 1
- 102000013563 Acid Phosphatase Human genes 0.000 description 1
- 102100022907 Acrosin-binding protein Human genes 0.000 description 1
- 101710107749 Acrosin-binding protein Proteins 0.000 description 1
- 102000057234 Acyl transferases Human genes 0.000 description 1
- 108700016155 Acyl transferases Proteins 0.000 description 1
- 102100035785 Acyl-CoA-binding protein Human genes 0.000 description 1
- 102100032605 Adhesion G protein-coupled receptor B1 Human genes 0.000 description 1
- 101710096306 Adhesion G protein-coupled receptor B1 Proteins 0.000 description 1
- 102100024394 Adipocyte enhancer-binding protein 1 Human genes 0.000 description 1
- 101710105604 Adipocyte enhancer-binding protein 1 Proteins 0.000 description 1
- 102100031786 Adiponectin Human genes 0.000 description 1
- 108010076365 Adiponectin Proteins 0.000 description 1
- 102100032358 Adiponectin receptor protein 2 Human genes 0.000 description 1
- 101710160411 Adiponectin receptor protein 2 Proteins 0.000 description 1
- 102100040026 Agrin Human genes 0.000 description 1
- 108700019743 Agrin Proteins 0.000 description 1
- 102100024321 Alkaline phosphatase, placental type Human genes 0.000 description 1
- 108700028369 Alleles Proteins 0.000 description 1
- 102100022524 Alpha-1-antichymotrypsin Human genes 0.000 description 1
- 102100033407 Alpha-amylase 2B Human genes 0.000 description 1
- 101710082073 Alpha-amylase 2B Proteins 0.000 description 1
- 102100034452 Alternative prion protein Human genes 0.000 description 1
- 102100040409 Ameloblastin Human genes 0.000 description 1
- 101710081264 Ameloblastin Proteins 0.000 description 1
- 102100039088 Amelogenin, X isoform Human genes 0.000 description 1
- 101710153359 Amelogenin, X isoform Proteins 0.000 description 1
- 102000052866 Amino Acyl-tRNA Synthetases Human genes 0.000 description 1
- 108700028939 Amino Acyl-tRNA Synthetases Proteins 0.000 description 1
- 102100032126 Aminopeptidase B Human genes 0.000 description 1
- 102000002659 Amyloid Precursor Protein Secretases Human genes 0.000 description 1
- 108010043324 Amyloid Precursor Protein Secretases Proteins 0.000 description 1
- 102000013455 Amyloid beta-Peptides Human genes 0.000 description 1
- 108010090849 Amyloid beta-Peptides Proteins 0.000 description 1
- 108010048112 Amyloidogenic Proteins Proteins 0.000 description 1
- 102000009091 Amyloidogenic Proteins Human genes 0.000 description 1
- 102100034594 Angiopoietin-1 Human genes 0.000 description 1
- 108010048154 Angiopoietin-1 Proteins 0.000 description 1
- 102100034608 Angiopoietin-2 Human genes 0.000 description 1
- 108010048036 Angiopoietin-2 Proteins 0.000 description 1
- 102100033402 Angiopoietin-4 Human genes 0.000 description 1
- 102100030988 Angiotensin-converting enzyme Human genes 0.000 description 1
- 102100035765 Angiotensin-converting enzyme 2 Human genes 0.000 description 1
- 108090000975 Angiotensin-converting enzyme 2 Proteins 0.000 description 1
- 101710199744 Anionic trypsin-2 Proteins 0.000 description 1
- 108010049777 Ankyrins Proteins 0.000 description 1
- 102000008102 Ankyrins Human genes 0.000 description 1
- 101710145634 Antigen 1 Proteins 0.000 description 1
- 102100021253 Antileukoproteinase Human genes 0.000 description 1
- 101710170876 Antileukoproteinase Proteins 0.000 description 1
- 102000044503 Antimicrobial Peptides Human genes 0.000 description 1
- 108700042778 Antimicrobial Peptides Proteins 0.000 description 1
- 102100034156 Apical endosomal glycoprotein Human genes 0.000 description 1
- 101710115984 Apical endosomal glycoprotein Proteins 0.000 description 1
- 108010059886 Apolipoprotein A-I Proteins 0.000 description 1
- 102000005666 Apolipoprotein A-I Human genes 0.000 description 1
- 102100040202 Apolipoprotein B-100 Human genes 0.000 description 1
- 108010008150 Apolipoprotein B-100 Proteins 0.000 description 1
- 108010076807 Apolipoprotein C-I Proteins 0.000 description 1
- 102000011772 Apolipoprotein C-I Human genes 0.000 description 1
- 102100029470 Apolipoprotein E Human genes 0.000 description 1
- 101710095339 Apolipoprotein E Proteins 0.000 description 1
- 102000018623 Apolipoproteins M Human genes 0.000 description 1
- 108010027018 Apolipoproteins M Proteins 0.000 description 1
- 101710111255 Appetite-regulating hormone Proteins 0.000 description 1
- 101100226366 Arabidopsis thaliana EXT3 gene Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 102100024624 Arylacetamide deacetylase Human genes 0.000 description 1
- 101710116704 Arylacetamide deacetylase Proteins 0.000 description 1
- 102100033891 Arylsulfatase I Human genes 0.000 description 1
- 101710115245 Arylsulfatase I Proteins 0.000 description 1
- 102100023944 Arylsulfatase K Human genes 0.000 description 1
- 101710115241 Arylsulfatase K Proteins 0.000 description 1
- 108010024976 Asparaginase Proteins 0.000 description 1
- 102000015827 Asporin Human genes 0.000 description 1
- 108050004044 Asporin Proteins 0.000 description 1
- 102100027936 Attractin Human genes 0.000 description 1
- 101710134735 Attractin Proteins 0.000 description 1
- 102100035526 B melanoma antigen 1 Human genes 0.000 description 1
- 101710131520 B melanoma antigen 1 Proteins 0.000 description 1
- 241000193738 Bacillus anthracis Species 0.000 description 1
- 102100027321 Beta-1,4-galactosyltransferase 7 Human genes 0.000 description 1
- 101710120069 Beta-1,4-galactosyltransferase 7 Proteins 0.000 description 1
- 102100026887 Beta-defensin 103 Human genes 0.000 description 1
- 101710187196 Beta-defensin 103 Proteins 0.000 description 1
- 102100037913 Beta-defensin 106 Human genes 0.000 description 1
- 101710187208 Beta-defensin 106 Proteins 0.000 description 1
- 101710187201 Beta-defensin 109 Proteins 0.000 description 1
- 102100039828 Beta-defensin 112 Human genes 0.000 description 1
- 101710187216 Beta-defensin 112 Proteins 0.000 description 1
- 102100039807 Beta-defensin 113 Human genes 0.000 description 1
- 101710187215 Beta-defensin 113 Proteins 0.000 description 1
- 102100039803 Beta-defensin 114 Human genes 0.000 description 1
- 101710187218 Beta-defensin 114 Proteins 0.000 description 1
- 102100039801 Beta-defensin 115 Human genes 0.000 description 1
- 101710187217 Beta-defensin 115 Proteins 0.000 description 1
- 102100039804 Beta-defensin 116 Human genes 0.000 description 1
- 101710187209 Beta-defensin 116 Proteins 0.000 description 1
- 102100039817 Beta-defensin 118 Human genes 0.000 description 1
- 101710187211 Beta-defensin 118 Proteins 0.000 description 1
- 102100024461 Beta-defensin 121 Human genes 0.000 description 1
- 101710185642 Beta-defensin 121 Proteins 0.000 description 1
- 102100024467 Beta-defensin 123 Human genes 0.000 description 1
- 101710187161 Beta-defensin 123 Proteins 0.000 description 1
- 102100024466 Beta-defensin 124 Human genes 0.000 description 1
- 101710187159 Beta-defensin 124 Proteins 0.000 description 1
- 102100021326 Beta-defensin 125 Human genes 0.000 description 1
- 101710187156 Beta-defensin 125 Proteins 0.000 description 1
- 102100021099 Beta-defensin 126 Human genes 0.000 description 1
- 101710187155 Beta-defensin 126 Proteins 0.000 description 1
- 102100021098 Beta-defensin 128 Human genes 0.000 description 1
- 101710187172 Beta-defensin 128 Proteins 0.000 description 1
- 102100021097 Beta-defensin 129 Human genes 0.000 description 1
- 101710187163 Beta-defensin 129 Proteins 0.000 description 1
- 101710187181 Beta-defensin 130 Proteins 0.000 description 1
- 102100028037 Beta-defensin 130A Human genes 0.000 description 1
- 102100029535 Beta-defensin 132 Human genes 0.000 description 1
- 101710187187 Beta-defensin 132 Proteins 0.000 description 1
- 102100029541 Beta-defensin 133 Human genes 0.000 description 1
- 101710187182 Beta-defensin 133 Proteins 0.000 description 1
- 102100029542 Beta-defensin 134 Human genes 0.000 description 1
- 101710187179 Beta-defensin 134 Proteins 0.000 description 1
- 102100029536 Beta-defensin 135 Human genes 0.000 description 1
- 101710187186 Beta-defensin 135 Proteins 0.000 description 1
- 102100029537 Beta-defensin 136 Human genes 0.000 description 1
- 101710187180 Beta-defensin 136 Proteins 0.000 description 1
- 108010039206 Biotinidase Proteins 0.000 description 1
- 102100026044 Biotinidase Human genes 0.000 description 1
- 102000015081 Blood Coagulation Factors Human genes 0.000 description 1
- 108010039209 Blood Coagulation Factors Proteins 0.000 description 1
- 102100035337 Bone marrow proteoglycan Human genes 0.000 description 1
- 101710134771 Bone marrow proteoglycan Proteins 0.000 description 1
- 102100022546 Bone morphogenetic protein 8A Human genes 0.000 description 1
- 101710117973 Bone morphogenetic protein 8A Proteins 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- 108010074051 C-Reactive Protein Proteins 0.000 description 1
- 102100032752 C-reactive protein Human genes 0.000 description 1
- 102100032528 C-type lectin domain family 11 member A Human genes 0.000 description 1
- 101710167766 C-type lectin domain family 11 member A Proteins 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- 102000002110 C2 domains Human genes 0.000 description 1
- 108050009459 C2 domains Proteins 0.000 description 1
- 102100037084 C4b-binding protein alpha chain Human genes 0.000 description 1
- 101710159767 C4b-binding protein alpha chain Proteins 0.000 description 1
- 102100037080 C4b-binding protein beta chain Human genes 0.000 description 1
- 101710085150 C4b-binding protein beta chain Proteins 0.000 description 1
- 102000001902 CC Chemokines Human genes 0.000 description 1
- 102100031168 CCN family member 2 Human genes 0.000 description 1
- 108010009992 CD163 antigen Proteins 0.000 description 1
- 101150070144 CPK8 gene Proteins 0.000 description 1
- 102100024151 Cadherin-16 Human genes 0.000 description 1
- 101710196874 Cadherin-16 Proteins 0.000 description 1
- 101710196922 Cadherin-19 Proteins 0.000 description 1
- 102100022529 Cadherin-19 Human genes 0.000 description 1
- 102100022509 Cadherin-23 Human genes 0.000 description 1
- 101710196902 Cadherin-23 Proteins 0.000 description 1
- 101710196900 Cadherin-24 Proteins 0.000 description 1
- 102100035356 Cadherin-related family member 5 Human genes 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 102000029728 Calcium binding protein 2 Human genes 0.000 description 1
- 108091016526 Calcium binding protein 2 Proteins 0.000 description 1
- 102100039534 Calcium-activated chloride channel regulator 4 Human genes 0.000 description 1
- 101710186149 Calcium-activated chloride channel regulator 4 Proteins 0.000 description 1
- 102000011398 Calponin homology domains Human genes 0.000 description 1
- 108050001630 Calponin homology domains Proteins 0.000 description 1
- 102100029968 Calreticulin Human genes 0.000 description 1
- 108090000549 Calreticulin Proteins 0.000 description 1
- 101001024441 Candida albicans (strain SC5314 / ATCC MYA-2876) Major facilitator superfamily multidrug transporter NAG3 Proteins 0.000 description 1
- 102100033379 Carbohydrate sulfotransferase 14 Human genes 0.000 description 1
- 101710096627 Carbohydrate sulfotransferase 14 Proteins 0.000 description 1
- 102100031276 Carbohydrate sulfotransferase 8 Human genes 0.000 description 1
- 101710158439 Carbohydrate sulfotransferase 8 Proteins 0.000 description 1
- 102100032144 Carbohydrate sulfotransferase 9 Human genes 0.000 description 1
- 101710158443 Carbohydrate sulfotransferase 9 Proteins 0.000 description 1
- 102100036369 Carbonic anhydrase 6 Human genes 0.000 description 1
- 102000013392 Carboxylesterase Human genes 0.000 description 1
- 108010051152 Carboxylesterase Proteins 0.000 description 1
- 101710117348 Carboxylesterase 1D Proteins 0.000 description 1
- 102100036808 Carboxylesterase 3 Human genes 0.000 description 1
- 101710201072 Carboxylesterase 3 Proteins 0.000 description 1
- 102100036806 Carboxylesterase 5A Human genes 0.000 description 1
- 102100026793 Carboxypeptidase A6 Human genes 0.000 description 1
- 108700001208 Carboxypeptidase A6 Proteins 0.000 description 1
- 108090000201 Carboxypeptidase B2 Proteins 0.000 description 1
- 102000003847 Carboxypeptidase B2 Human genes 0.000 description 1
- 102100032378 Carboxypeptidase E Human genes 0.000 description 1
- 108010058255 Carboxypeptidase H Proteins 0.000 description 1
- 101710161573 Cardiotrophin-2 Proteins 0.000 description 1
- 102100029391 Cardiotrophin-like cytokine factor 1 Human genes 0.000 description 1
- 101710107109 Cardiotrophin-like cytokine factor 1 Proteins 0.000 description 1
- 102100027848 Cartilage-associated protein Human genes 0.000 description 1
- 101710104415 Cartilage-associated protein Proteins 0.000 description 1
- 102100034357 Casein kinase I isoform alpha Human genes 0.000 description 1
- 101710118321 Casein kinase I isoform alpha Proteins 0.000 description 1
- 108010076119 Caseins Proteins 0.000 description 1
- 102000011632 Caseins Human genes 0.000 description 1
- 208000014392 Cat-eye syndrome Diseases 0.000 description 1
- 102100035882 Catalase Human genes 0.000 description 1
- 108010053835 Catalase Proteins 0.000 description 1
- 108010072135 Cell Adhesion Molecule-1 Proteins 0.000 description 1
- 102100024649 Cell adhesion molecule 1 Human genes 0.000 description 1
- 102100037677 Cell surface hyaluronidase Human genes 0.000 description 1
- 101710125063 Cell surface hyaluronidase Proteins 0.000 description 1
- 102100035244 Cerebellin-1 Human genes 0.000 description 1
- 101710135505 Cerebellin-1 Proteins 0.000 description 1
- 102100035245 Cerebellin-2 Human genes 0.000 description 1
- 101710135504 Cerebellin-2 Proteins 0.000 description 1
- 102100035811 Cerebellin-3 Human genes 0.000 description 1
- 101710135501 Cerebellin-3 Proteins 0.000 description 1
- 102100035812 Cerebellin-4 Human genes 0.000 description 1
- 101710135520 Cerebellin-4 Proteins 0.000 description 1
- 102100039550 Chemokine-like factor Human genes 0.000 description 1
- 101710204213 Chemokine-like factor Proteins 0.000 description 1
- 102000012286 Chitinases Human genes 0.000 description 1
- 108010022172 Chitinases Proteins 0.000 description 1
- 239000005714 Chitosan hydrochloride Substances 0.000 description 1
- 102100037328 Chitotriosidase-1 Human genes 0.000 description 1
- 101710132290 Chitotriosidase-1 Proteins 0.000 description 1
- 108010062745 Chloride Channels Proteins 0.000 description 1
- 102000011045 Chloride Channels Human genes 0.000 description 1
- 101100499351 Chlorobaculum tepidum (strain ATCC 49652 / DSM 12025 / NBRC 103806 / TLS) lpd gene Proteins 0.000 description 1
- 101800001982 Cholecystokinin Proteins 0.000 description 1
- 102100025841 Cholecystokinin Human genes 0.000 description 1
- 229920002567 Chondroitin Polymers 0.000 description 1
- 102100029296 Chondroitin sulfate glucuronyltransferase Human genes 0.000 description 1
- 102400000676 Chondromodulin-1 Human genes 0.000 description 1
- 101800004542 Chondromodulin-1 Proteins 0.000 description 1
- 102100032766 Chordin-like protein 2 Human genes 0.000 description 1
- 101710173229 Chordin-like protein 2 Proteins 0.000 description 1
- 108010038447 Chromogranin A Proteins 0.000 description 1
- 102100031186 Chromogranin-A Human genes 0.000 description 1
- 101710147853 Chymotrypsinogen B Proteins 0.000 description 1
- 101710178550 Chymotrypsinogen B2 Proteins 0.000 description 1
- 102000002029 Claudin Human genes 0.000 description 1
- 108050009302 Claudin Proteins 0.000 description 1
- 102100038445 Claudin-2 Human genes 0.000 description 1
- 108090000580 Claudin-2 Proteins 0.000 description 1
- 102000003780 Clusterin Human genes 0.000 description 1
- 108090000197 Clusterin Proteins 0.000 description 1
- 102100037529 Coagulation factor V Human genes 0.000 description 1
- 102100023804 Coagulation factor VII Human genes 0.000 description 1
- 102100030563 Coagulation factor XI Human genes 0.000 description 1
- 102000057710 Coatomer Human genes 0.000 description 1
- 108700022408 Coatomer Proteins 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- ACTIUHUUMQJHFO-UHFFFAOYSA-N Coenzym Q10 Natural products COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UHFFFAOYSA-N 0.000 description 1
- 102000000503 Collagen Type II Human genes 0.000 description 1
- 108010041390 Collagen Type II Proteins 0.000 description 1
- 102000012432 Collagen Type V Human genes 0.000 description 1
- 108010022514 Collagen Type V Proteins 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- 102000017284 Collagenase 3 Human genes 0.000 description 1
- 102100024206 Collectin-10 Human genes 0.000 description 1
- 101710194645 Collectin-10 Proteins 0.000 description 1
- 102000007644 Colony-Stimulating Factors Human genes 0.000 description 1
- 108010071942 Colony-Stimulating Factors Proteins 0.000 description 1
- 102000055157 Complement C1 Inhibitor Human genes 0.000 description 1
- 102100031609 Complement C2 Human genes 0.000 description 1
- 108090000955 Complement C2 Proteins 0.000 description 1
- 108010028773 Complement C5 Proteins 0.000 description 1
- 108010028776 Complement C7 Proteins 0.000 description 1
- 108010053085 Complement Factor H Proteins 0.000 description 1
- 108090000044 Complement Factor I Proteins 0.000 description 1
- 102100024339 Complement component C6 Human genes 0.000 description 1
- 101710203188 Complement component C6 Proteins 0.000 description 1
- 102100035432 Complement factor H Human genes 0.000 description 1
- 102100035431 Complement factor I Human genes 0.000 description 1
- 102100030886 Complement receptor type 1 Human genes 0.000 description 1
- 208000023445 Congenital pulmonary airway malformation Diseases 0.000 description 1
- 108010039419 Connective Tissue Growth Factor Proteins 0.000 description 1
- 102100024340 Contactin-4 Human genes 0.000 description 1
- 101710107714 Contactin-4 Proteins 0.000 description 1
- 102100031673 Corneodesmosin Human genes 0.000 description 1
- 101710139375 Corneodesmosin Proteins 0.000 description 1
- 102100021752 Corticoliberin Human genes 0.000 description 1
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 1
- 108010022152 Corticotropin-Releasing Hormone Proteins 0.000 description 1
- 108010035601 Coxsackie and Adenovirus Receptor Like Membrane Protein Proteins 0.000 description 1
- 102000008198 Coxsackie and Adenovirus Receptor Like Membrane Protein Human genes 0.000 description 1
- 102100024106 Cyclin-Y Human genes 0.000 description 1
- 101710183458 Cyclin-Y Proteins 0.000 description 1
- 102000015833 Cystatin Human genes 0.000 description 1
- 108010061641 Cystatin A Proteins 0.000 description 1
- 108010061617 Cystatin M Proteins 0.000 description 1
- 101710171998 Cystatin-13 Proteins 0.000 description 1
- 102100027598 Cystatin-8 Human genes 0.000 description 1
- 101710187959 Cystatin-8 Proteins 0.000 description 1
- 102100031237 Cystatin-A Human genes 0.000 description 1
- 102100028182 Cystatin-D Human genes 0.000 description 1
- 102100038381 Cystatin-M Human genes 0.000 description 1
- 101710126131 Cysteine-rich secretory protein 1 Proteins 0.000 description 1
- 102100027366 Cysteine-rich secretory protein 1 Human genes 0.000 description 1
- 101710126127 Cysteine-rich secretory protein 2 Proteins 0.000 description 1
- 102100027350 Cysteine-rich secretory protein 2 Human genes 0.000 description 1
- 102100022027 Cytochrome P450 4X1 Human genes 0.000 description 1
- 102100021999 Cytosolic Fe-S cluster assembly factor NUBP2 Human genes 0.000 description 1
- 101710139686 Cytosolic Fe-S cluster assembly factor NUBP2 Proteins 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 101710116895 DNA-binding protein H-NS Proteins 0.000 description 1
- 102000004237 Decorin Human genes 0.000 description 1
- 108090000738 Decorin Proteins 0.000 description 1
- 101710178508 Defensin 3 Proteins 0.000 description 1
- 101710178505 Defensin-1 Proteins 0.000 description 1
- 102100021420 Defensin-5 Human genes 0.000 description 1
- 101710178517 Defensin-5 Proteins 0.000 description 1
- 102100029790 Defensin-6 Human genes 0.000 description 1
- 101710178511 Defensin-6 Proteins 0.000 description 1
- 101710087821 Deformed epidermal autoregulatory factor 1 Proteins 0.000 description 1
- 102100033553 Delta-like protein 4 Human genes 0.000 description 1
- 101710112728 Delta-like protein 4 Proteins 0.000 description 1
- 102100031149 Deoxyribonuclease gamma Human genes 0.000 description 1
- 102100030012 Deoxyribonuclease-1 Human genes 0.000 description 1
- 101710206036 Deoxyribonuclease-1 Proteins 0.000 description 1
- 102100030438 Derlin-1 Human genes 0.000 description 1
- 101710178882 Derlin-1 Proteins 0.000 description 1
- 102100034274 Diamine acetyltransferase 1 Human genes 0.000 description 1
- 108010039287 Diazepam Binding Inhibitor Proteins 0.000 description 1
- 102100029857 Dipeptidase 3 Human genes 0.000 description 1
- 101710117904 Dipeptidase 3 Proteins 0.000 description 1
- 108010067722 Dipeptidyl Peptidase 4 Proteins 0.000 description 1
- 102100025012 Dipeptidyl peptidase 4 Human genes 0.000 description 1
- 102000048188 Dolichol kinases Human genes 0.000 description 1
- 108700023189 Dolichol kinases Proteins 0.000 description 1
- 102100037713 Down syndrome cell adhesion molecule Human genes 0.000 description 1
- 101710199377 Down syndrome cell adhesion molecule Proteins 0.000 description 1
- 206010059866 Drug resistance Diseases 0.000 description 1
- 102000001301 EGF receptor Human genes 0.000 description 1
- 108060006698 EGF receptor Proteins 0.000 description 1
- 102100028067 EGF-containing fibulin-like extracellular matrix protein 2 Human genes 0.000 description 1
- 101710176518 EGF-containing fibulin-like extracellular matrix protein 2 Proteins 0.000 description 1
- 102000039321 EZ family Human genes 0.000 description 1
- 108091068505 EZ family Proteins 0.000 description 1
- 102100023795 Elafin Human genes 0.000 description 1
- 108010015972 Elafin Proteins 0.000 description 1
- 108010014258 Elastin Proteins 0.000 description 1
- 102000016942 Elastin Human genes 0.000 description 1
- 240000000279 Emilia sonchifolia Species 0.000 description 1
- 235000002139 Emilia sonchifolia Nutrition 0.000 description 1
- 108010044063 Endocrine-Gland-Derived Vascular Endothelial Growth Factor Proteins 0.000 description 1
- 102100038566 Endomucin Human genes 0.000 description 1
- 102000004533 Endonucleases Human genes 0.000 description 1
- 108010042407 Endonucleases Proteins 0.000 description 1
- 102100039328 Endoplasmin Human genes 0.000 description 1
- 102100031375 Endothelial lipase Human genes 0.000 description 1
- 101710087274 Endothelial lipase Proteins 0.000 description 1
- 102100029109 Endothelin-3 Human genes 0.000 description 1
- 108010072844 Endothelin-3 Proteins 0.000 description 1
- 108030001679 Endothelin-converting enzyme 1 Proteins 0.000 description 1
- 102000048186 Endothelin-converting enzyme 1 Human genes 0.000 description 1
- 102100029113 Endothelin-converting enzyme 2 Human genes 0.000 description 1
- 102100023688 Eotaxin Human genes 0.000 description 1
- 101710139422 Eotaxin Proteins 0.000 description 1
- 102100034725 Epididymal-specific lipocalin-10 Human genes 0.000 description 1
- 102100034720 Epididymal-specific lipocalin-12 Human genes 0.000 description 1
- 102100038262 Epididymal-specific lipocalin-8 Human genes 0.000 description 1
- 102100038265 Epididymal-specific lipocalin-9 Human genes 0.000 description 1
- 102100023164 Epididymis-specific alpha-mannosidase Human genes 0.000 description 1
- 101710191560 Epididymis-specific alpha-mannosidase Proteins 0.000 description 1
- 102100036823 Erlin-2 Human genes 0.000 description 1
- 101710044846 Erlin-2 Proteins 0.000 description 1
- 102000003951 Erythropoietin Human genes 0.000 description 1
- 108090000394 Erythropoietin Proteins 0.000 description 1
- 102100023400 Estradiol 17-beta-dehydrogenase 11 Human genes 0.000 description 1
- 101710127907 Estradiol 17-beta-dehydrogenase 11 Proteins 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- 102100034719 Extracellular glycoprotein lacritin Human genes 0.000 description 1
- 108091016508 Extracellular glycoprotein lacritin Proteins 0.000 description 1
- 102100031758 Extracellular matrix protein 1 Human genes 0.000 description 1
- 101710127949 Extracellular matrix protein 1 Proteins 0.000 description 1
- 102100023077 Extracellular matrix protein 2 Human genes 0.000 description 1
- 101710127932 Extracellular matrix protein 2 Proteins 0.000 description 1
- 101710127951 Extracellular matrix protein 3 Proteins 0.000 description 1
- 108091008794 FGF receptors Proteins 0.000 description 1
- 108010014172 Factor V Proteins 0.000 description 1
- 108010023321 Factor VII Proteins 0.000 description 1
- 102100031509 Fibrillin-1 Human genes 0.000 description 1
- 108010030229 Fibrillin-1 Proteins 0.000 description 1
- 102100031510 Fibrillin-2 Human genes 0.000 description 1
- 108010030242 Fibrillin-2 Proteins 0.000 description 1
- 102100031387 Fibrillin-3 Human genes 0.000 description 1
- 101710175017 Fibrillin-3 Proteins 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 102100028313 Fibrinogen beta chain Human genes 0.000 description 1
- 101710170765 Fibrinogen beta chain Proteins 0.000 description 1
- 102100024783 Fibrinogen gamma chain Human genes 0.000 description 1
- 102100038664 Fibrinogen-like protein 1 Human genes 0.000 description 1
- 101710197507 Fibrinogen-like protein 1 Proteins 0.000 description 1
- 102000044168 Fibroblast Growth Factor Receptor Human genes 0.000 description 1
- 102000004042 Fibroblast Growth Factor-23 Human genes 0.000 description 1
- 108090000569 Fibroblast Growth Factor-23 Proteins 0.000 description 1
- 102100024785 Fibroblast growth factor 2 Human genes 0.000 description 1
- 108090000379 Fibroblast growth factor 2 Proteins 0.000 description 1
- 102000012548 Fibroblast growth factor 22 Human genes 0.000 description 1
- 108050002062 Fibroblast growth factor 22 Proteins 0.000 description 1
- 102100023600 Fibroblast growth factor receptor 2 Human genes 0.000 description 1
- 101710182389 Fibroblast growth factor receptor 2 Proteins 0.000 description 1
- 102100027842 Fibroblast growth factor receptor 3 Human genes 0.000 description 1
- 101710182396 Fibroblast growth factor receptor 3 Proteins 0.000 description 1
- 102100027844 Fibroblast growth factor receptor 4 Human genes 0.000 description 1
- 101710182387 Fibroblast growth factor receptor 4 Proteins 0.000 description 1
- 102100031812 Fibulin-1 Human genes 0.000 description 1
- 101710170731 Fibulin-1 Proteins 0.000 description 1
- 102100031813 Fibulin-2 Human genes 0.000 description 1
- 102100028065 Fibulin-5 Human genes 0.000 description 1
- 101710170766 Fibulin-5 Proteins 0.000 description 1
- 102100031383 Fibulin-7 Human genes 0.000 description 1
- 101710170768 Fibulin-7 Proteins 0.000 description 1
- 102100024508 Ficolin-1 Human genes 0.000 description 1
- 101710155257 Ficolin-1 Proteins 0.000 description 1
- 102100024521 Ficolin-2 Human genes 0.000 description 1
- 101710155249 Ficolin-2 Proteins 0.000 description 1
- 102100024520 Ficolin-3 Human genes 0.000 description 1
- 101710155250 Ficolin-3 Proteins 0.000 description 1
- 108010014612 Follistatin Proteins 0.000 description 1
- 102000016970 Follistatin Human genes 0.000 description 1
- 102000019203 Follistatin-Related Proteins Human genes 0.000 description 1
- 101710115769 Follistatin-related protein 3 Proteins 0.000 description 1
- 102100020913 Follistatin-related protein 5 Human genes 0.000 description 1
- 101710115774 Follistatin-related protein 5 Proteins 0.000 description 1
- 102100028875 Formylglycine-generating enzyme Human genes 0.000 description 1
- 101710192607 Formylglycine-generating enzyme Proteins 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 102000002464 Galactosidases Human genes 0.000 description 1
- 108010093031 Galactosidases Proteins 0.000 description 1
- 108010081952 Galanin-Like Peptide Proteins 0.000 description 1
- 102100031689 Galanin-like peptide Human genes 0.000 description 1
- 108010001498 Galectin 1 Proteins 0.000 description 1
- 102100021736 Galectin-1 Human genes 0.000 description 1
- 102000044465 Galectin-7 Human genes 0.000 description 1
- 102100035212 Gamma-aminobutyric acid type B receptor subunit 1 Human genes 0.000 description 1
- 101710086268 Gamma-aminobutyric acid type B receptor subunit 1 Proteins 0.000 description 1
- 102100021023 Gamma-glutamyl hydrolase Human genes 0.000 description 1
- 108010004460 Gastric Inhibitory Polypeptide Proteins 0.000 description 1
- 102100039994 Gastric inhibitory polypeptide Human genes 0.000 description 1
- 102000029813 Gastric triacylglycerol lipase Human genes 0.000 description 1
- 102400000921 Gastrin Human genes 0.000 description 1
- 108010052343 Gastrins Proteins 0.000 description 1
- 102000013382 Gelatinases Human genes 0.000 description 1
- 108010026132 Gelatinases Proteins 0.000 description 1
- 102000004878 Gelsolin Human genes 0.000 description 1
- 108090001064 Gelsolin Proteins 0.000 description 1
- 102000012004 Ghrelin Human genes 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- 102100039992 Gliomedin Human genes 0.000 description 1
- 101710177565 Gliomedin Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 102400000321 Glucagon Human genes 0.000 description 1
- 108060003199 Glucagon Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 108010092364 Glucuronosyltransferase Proteins 0.000 description 1
- 102000016354 Glucuronosyltransferase Human genes 0.000 description 1
- 102000006587 Glutathione peroxidase Human genes 0.000 description 1
- 102100036753 Glutathione peroxidase 6 Human genes 0.000 description 1
- 101710119058 Glutathione peroxidase 6 Proteins 0.000 description 1
- 102100036755 Glutathione peroxidase 7 Human genes 0.000 description 1
- 101710119044 Glutathione peroxidase 7 Proteins 0.000 description 1
- 108700016172 Glutathione peroxidases Proteins 0.000 description 1
- 102100025376 Glycerol-3-phosphate acyltransferase 4 Human genes 0.000 description 1
- 101710199766 Glycerol-3-phosphate acyltransferase 4 Proteins 0.000 description 1
- 102000004240 Glycodelin Human genes 0.000 description 1
- 108010081520 Glycodelin Proteins 0.000 description 1
- 102100023849 Glycophorin-C Human genes 0.000 description 1
- 108050007238 Glypican-1 Proteins 0.000 description 1
- 108050009388 Glypican-2 Proteins 0.000 description 1
- 108050007237 Glypican-3 Proteins 0.000 description 1
- 108050009377 Glypican-5 Proteins 0.000 description 1
- 102000001989 Glypican-6 Human genes 0.000 description 1
- 108050009385 Glypican-6 Proteins 0.000 description 1
- 244000060234 Gmelina philippensis Species 0.000 description 1
- 108010054017 Granulocyte Colony-Stimulating Factor Receptors Proteins 0.000 description 1
- 102100039622 Granulocyte colony-stimulating factor receptor Human genes 0.000 description 1
- 108010092372 Granulocyte-Macrophage Colony-Stimulating Factor Receptors Proteins 0.000 description 1
- 102000016355 Granulocyte-Macrophage Colony-Stimulating Factor Receptors Human genes 0.000 description 1
- 102100038367 Gremlin-1 Human genes 0.000 description 1
- 101710169781 Gremlin-1 Proteins 0.000 description 1
- 102100038353 Gremlin-2 Human genes 0.000 description 1
- 101710169778 Gremlin-2 Proteins 0.000 description 1
- 102100037544 Group 10 secretory phospholipase A2 Human genes 0.000 description 1
- 101710126983 Group 10 secretory phospholipase A2 Proteins 0.000 description 1
- 102100020948 Growth hormone receptor Human genes 0.000 description 1
- 102100031547 HLA class II histocompatibility antigen, DO alpha chain Human genes 0.000 description 1
- 102000003693 Hedgehog Proteins Human genes 0.000 description 1
- 108090000031 Hedgehog Proteins Proteins 0.000 description 1
- 102100024025 Heparanase Human genes 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 101800001649 Heparin-binding EGF-like growth factor Proteins 0.000 description 1
- 101710124162 Hepatic triacylglycerol lipase Proteins 0.000 description 1
- 102100032813 Hepatocyte growth factor-like protein Human genes 0.000 description 1
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 description 1
- 102100027619 Histidine-rich glycoprotein Human genes 0.000 description 1
- 102100022374 Homeobox protein DLX-4 Human genes 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000801645 Homo sapiens ATP-binding cassette sub-family A member 2 Proteins 0.000 description 1
- 101000737803 Homo sapiens Cadherin-related family member 5 Proteins 0.000 description 1
- 101000851643 Homo sapiens Carboxylesterase 5A Proteins 0.000 description 1
- 101000727061 Homo sapiens Complement receptor type 1 Proteins 0.000 description 1
- 101000916687 Homo sapiens Cystatin-D Proteins 0.000 description 1
- 101000641077 Homo sapiens Diamine acetyltransferase 1 Proteins 0.000 description 1
- 101000841255 Homo sapiens Endothelin-converting enzyme 2 Proteins 0.000 description 1
- 101000946133 Homo sapiens Epididymal-specific lipocalin-10 Proteins 0.000 description 1
- 101000946137 Homo sapiens Epididymal-specific lipocalin-12 Proteins 0.000 description 1
- 101000605055 Homo sapiens Epididymal-specific lipocalin-8 Proteins 0.000 description 1
- 101000605060 Homo sapiens Epididymal-specific lipocalin-9 Proteins 0.000 description 1
- 101000608772 Homo sapiens Galectin-7 Proteins 0.000 description 1
- 101000905336 Homo sapiens Glycophorin-C Proteins 0.000 description 1
- 101000866278 Homo sapiens HLA class II histocompatibility antigen, DO alpha chain Proteins 0.000 description 1
- 101000901614 Homo sapiens Homeobox protein DLX-4 Proteins 0.000 description 1
- 101000988651 Homo sapiens Humanin-like 1 Proteins 0.000 description 1
- 101001076292 Homo sapiens Insulin-like growth factor II Proteins 0.000 description 1
- 101001043817 Homo sapiens Interleukin-31 receptor subunit alpha Proteins 0.000 description 1
- 101001011896 Homo sapiens Matrix metalloproteinase-19 Proteins 0.000 description 1
- 101000575376 Homo sapiens Microfibrillar-associated protein 1 Proteins 0.000 description 1
- 101000947695 Homo sapiens Microfibrillar-associated protein 5 Proteins 0.000 description 1
- 101001109579 Homo sapiens NPC intracellular cholesterol transporter 2 Proteins 0.000 description 1
- 101001123834 Homo sapiens Neprilysin Proteins 0.000 description 1
- 101000637326 Homo sapiens Neuroguidin Proteins 0.000 description 1
- 101000722006 Homo sapiens Olfactomedin-like protein 2B Proteins 0.000 description 1
- 101000609253 Homo sapiens Phytanoyl-CoA dioxygenase, peroxisomal Proteins 0.000 description 1
- 101000595920 Homo sapiens Plasminogen-like protein A Proteins 0.000 description 1
- 101000887203 Homo sapiens Probable cation-transporting ATPase 13A4 Proteins 0.000 description 1
- 101000917550 Homo sapiens Probable fibrosin-1 Proteins 0.000 description 1
- 101000702285 Homo sapiens Secreted phosphoprotein 24 Proteins 0.000 description 1
- 101000822461 Homo sapiens Secretoglobin family 2B member 2 Proteins 0.000 description 1
- 101001092910 Homo sapiens Serum amyloid P-component Proteins 0.000 description 1
- 101000713305 Homo sapiens Sodium-coupled neutral amino acid transporter 1 Proteins 0.000 description 1
- 101000798942 Homo sapiens Target of Myb protein 1 Proteins 0.000 description 1
- 101000837639 Homo sapiens Thyroxine-binding globulin Proteins 0.000 description 1
- 101000662690 Homo sapiens Trafficking protein particle complex subunit 10 Proteins 0.000 description 1
- 101000798700 Homo sapiens Transmembrane protease serine 3 Proteins 0.000 description 1
- 101000798696 Homo sapiens Transmembrane protease serine 6 Proteins 0.000 description 1
- 101000666896 Homo sapiens V-type immunoglobulin domain-containing suppressor of T-cell activation Proteins 0.000 description 1
- 102100031450 Humanin Human genes 0.000 description 1
- 102100039238 Hyaluronan-binding protein 2 Human genes 0.000 description 1
- 101710163637 Hyaluronan-binding protein 2 Proteins 0.000 description 1
- 102000015860 Hyaluronidase-3 Human genes 0.000 description 1
- 108050004076 Hyaluronidase-3 Proteins 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- 102000000521 Immunophilins Human genes 0.000 description 1
- 108010016648 Immunophilins Proteins 0.000 description 1
- 102100028867 Inactive C-alpha-formylglycine-generating enzyme 2 Human genes 0.000 description 1
- 101710118681 Inactive C-alpha-formylglycine-generating enzyme 2 Proteins 0.000 description 1
- 102100026556 Inactive caspase-12 Human genes 0.000 description 1
- 101710126091 Inactive caspase-12 Proteins 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 108010001127 Insulin Receptor Proteins 0.000 description 1
- 102100036721 Insulin receptor Human genes 0.000 description 1
- 102100037852 Insulin-like growth factor I Human genes 0.000 description 1
- 101710190529 Insulin-like peptide Proteins 0.000 description 1
- 102100023351 Integral membrane protein 2A Human genes 0.000 description 1
- 101710180843 Integral membrane protein 2A Proteins 0.000 description 1
- 102100023350 Integral membrane protein 2B Human genes 0.000 description 1
- 101710180845 Integral membrane protein 2B Proteins 0.000 description 1
- 102100023481 Integrin beta-like protein 1 Human genes 0.000 description 1
- 108050004182 Integrin beta-like protein 1 Proteins 0.000 description 1
- 102100039454 Inter-alpha-trypsin inhibitor heavy chain H5 Human genes 0.000 description 1
- 101710083921 Inter-alpha-trypsin inhibitor heavy chain H5 Proteins 0.000 description 1
- 102100022469 Interferon kappa Human genes 0.000 description 1
- 102000003996 Interferon-beta Human genes 0.000 description 1
- 108090000467 Interferon-beta Proteins 0.000 description 1
- 108010074328 Interferon-gamma Proteins 0.000 description 1
- 102000008070 Interferon-gamma Human genes 0.000 description 1
- 102100039880 Interleukin-1 receptor accessory protein Human genes 0.000 description 1
- 101710180389 Interleukin-1 receptor accessory protein Proteins 0.000 description 1
- 102000051628 Interleukin-1 receptor antagonist Human genes 0.000 description 1
- 101710144554 Interleukin-1 receptor antagonist protein Proteins 0.000 description 1
- 102000003816 Interleukin-13 Human genes 0.000 description 1
- 108090000176 Interleukin-13 Proteins 0.000 description 1
- 102000003812 Interleukin-15 Human genes 0.000 description 1
- 108090000172 Interleukin-15 Proteins 0.000 description 1
- 108010053727 Interleukin-15 Receptor alpha Subunit Proteins 0.000 description 1
- 102000004125 Interleukin-1alpha Human genes 0.000 description 1
- 108010082786 Interleukin-1alpha Proteins 0.000 description 1
- 102000007351 Interleukin-2 Receptor alpha Subunit Human genes 0.000 description 1
- 108010032774 Interleukin-2 Receptor alpha Subunit Proteins 0.000 description 1
- 102100030703 Interleukin-22 Human genes 0.000 description 1
- 102000011718 Interleukin-23 Subunit p19 Human genes 0.000 description 1
- 108010076561 Interleukin-23 Subunit p19 Proteins 0.000 description 1
- 102100021596 Interleukin-31 Human genes 0.000 description 1
- 101710181613 Interleukin-31 Proteins 0.000 description 1
- 102100021594 Interleukin-31 receptor subunit alpha Human genes 0.000 description 1
- 102100033501 Interleukin-32 Human genes 0.000 description 1
- 101710181615 Interleukin-32 Proteins 0.000 description 1
- 102000017761 Interleukin-33 Human genes 0.000 description 1
- 108010067003 Interleukin-33 Proteins 0.000 description 1
- 102000004388 Interleukin-4 Human genes 0.000 description 1
- 108090000978 Interleukin-4 Proteins 0.000 description 1
- 102000012347 Interleukin-4 Receptor alpha Subunit Human genes 0.000 description 1
- 108010061858 Interleukin-4 Receptor alpha Subunit Proteins 0.000 description 1
- 102000000743 Interleukin-5 Human genes 0.000 description 1
- 108010002616 Interleukin-5 Proteins 0.000 description 1
- 102000004889 Interleukin-6 Human genes 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- 108010026928 Interleukin-6 Receptor alpha Subunit Proteins 0.000 description 1
- 108010038501 Interleukin-6 Receptors Proteins 0.000 description 1
- 102100037792 Interleukin-6 receptor subunit alpha Human genes 0.000 description 1
- 102000004890 Interleukin-8 Human genes 0.000 description 1
- 108090001007 Interleukin-8 Proteins 0.000 description 1
- 102000000585 Interleukin-9 Human genes 0.000 description 1
- 108010002335 Interleukin-9 Proteins 0.000 description 1
- 102000015696 Interleukins Human genes 0.000 description 1
- 108010063738 Interleukins Proteins 0.000 description 1
- 102000000993 Interphotoreceptor matrix proteoglycan Human genes 0.000 description 1
- 108050007996 Interphotoreceptor matrix proteoglycan Proteins 0.000 description 1
- 108010041872 Islet Amyloid Polypeptide Proteins 0.000 description 1
- 102100027670 Islet amyloid polypeptide Human genes 0.000 description 1
- 102100037489 KAT8 regulatory NSL complex subunit 3 Human genes 0.000 description 1
- 102100027612 Kallikrein-11 Human genes 0.000 description 1
- 101710115807 Kallikrein-11 Proteins 0.000 description 1
- 102100038298 Kallikrein-14 Human genes 0.000 description 1
- 101710115806 Kallikrein-14 Proteins 0.000 description 1
- 102100038301 Kallikrein-15 Human genes 0.000 description 1
- 101710115873 Kallikrein-15 Proteins 0.000 description 1
- 102100034872 Kallikrein-4 Human genes 0.000 description 1
- 102100034866 Kallikrein-6 Human genes 0.000 description 1
- 101710176224 Kallikrein-6 Proteins 0.000 description 1
- 102100034870 Kallikrein-8 Human genes 0.000 description 1
- 101710176225 Kallikrein-8 Proteins 0.000 description 1
- 108010093811 Kazal Pancreatic Trypsin Inhibitor Proteins 0.000 description 1
- 102000001626 Kazal Pancreatic Trypsin Inhibitor Human genes 0.000 description 1
- 102100040542 Keratinocyte-associated protein 3 Human genes 0.000 description 1
- 101710127499 Keratinocyte-associated protein 3 Proteins 0.000 description 1
- 102100022808 Kielin/chordin-like protein Human genes 0.000 description 1
- 101710154339 Kielin/chordin-like protein Proteins 0.000 description 1
- 102000019293 Kinesin-like proteins Human genes 0.000 description 1
- 108050006659 Kinesin-like proteins Proteins 0.000 description 1
- 102100035792 Kininogen-1 Human genes 0.000 description 1
- 101710111227 Kininogen-1 Proteins 0.000 description 1
- 108010008292 L-Amino Acid Oxidase Proteins 0.000 description 1
- 102000007070 L-amino-acid oxidase Human genes 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- 108010001831 LDL receptors Proteins 0.000 description 1
- 102100025640 Lactase-like protein Human genes 0.000 description 1
- 101710188170 Lactase-like protein Proteins 0.000 description 1
- 102000010445 Lactoferrin Human genes 0.000 description 1
- 108010063045 Lactoferrin Proteins 0.000 description 1
- 102100038609 Lactoperoxidase Human genes 0.000 description 1
- 108010023244 Lactoperoxidase Proteins 0.000 description 1
- 102100030931 Ladinin-1 Human genes 0.000 description 1
- 101710177601 Ladinin-1 Proteins 0.000 description 1
- 102100024621 Layilin Human genes 0.000 description 1
- 101710147757 Layilin Proteins 0.000 description 1
- 101710198418 Lectin 10 Proteins 0.000 description 1
- 101710197066 Lectin 6 Proteins 0.000 description 1
- 101710197064 Lectin 9 Proteins 0.000 description 1
- 101710201625 Leucine-rich protein Proteins 0.000 description 1
- 102100020858 Leukocyte-associated immunoglobulin-like receptor 2 Human genes 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 101710084373 Lipase 1 Proteins 0.000 description 1
- 102100030659 Lipase member I Human genes 0.000 description 1
- 102000019298 Lipocalin Human genes 0.000 description 1
- 108050006654 Lipocalin Proteins 0.000 description 1
- 108010057281 Lipocalin 1 Proteins 0.000 description 1
- 102100034724 Lipocalin-1 Human genes 0.000 description 1
- 102100034721 Lipocalin-15 Human genes 0.000 description 1
- 101710155631 Lipocalin-15 Proteins 0.000 description 1
- 102000052508 Lipopolysaccharide-binding protein Human genes 0.000 description 1
- 108010053632 Lipopolysaccharide-binding protein Proteins 0.000 description 1
- 108010013563 Lipoprotein Lipase Proteins 0.000 description 1
- 101500021084 Locusta migratoria 5 kDa peptide Proteins 0.000 description 1
- 102100024640 Low-density lipoprotein receptor Human genes 0.000 description 1
- 102100033485 Lymphocyte antigen 86 Human genes 0.000 description 1
- 101710158190 Lymphocyte antigen 86 Proteins 0.000 description 1
- 102100026238 Lymphotoxin-alpha Human genes 0.000 description 1
- 108090000542 Lymphotoxin-alpha Proteins 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 108010085169 Lysine carboxypeptidase Proteins 0.000 description 1
- 108020002496 Lysophospholipase Proteins 0.000 description 1
- 102100033468 Lysozyme C Human genes 0.000 description 1
- 102000009073 Macrophage Migration-Inhibitory Factors Human genes 0.000 description 1
- 108010048043 Macrophage Migration-Inhibitory Factors Proteins 0.000 description 1
- 108010087870 Mannose-Binding Lectin Proteins 0.000 description 1
- 102100026553 Mannose-binding protein C Human genes 0.000 description 1
- 102100031826 Marginal zone B- and B1-cell-specific protein Human genes 0.000 description 1
- 101710169164 Marginal zone B- and B1-cell-specific protein Proteins 0.000 description 1
- 102000004318 Matrilysin Human genes 0.000 description 1
- 108090000855 Matrilysin Proteins 0.000 description 1
- 108010076497 Matrix Metalloproteinase 10 Proteins 0.000 description 1
- 108010076503 Matrix Metalloproteinase 13 Proteins 0.000 description 1
- 108010016160 Matrix Metalloproteinase 3 Proteins 0.000 description 1
- 108090000587 Matrix metalloproteinase-19 Proteins 0.000 description 1
- 102000014867 Matrix metalloproteinase-26 Human genes 0.000 description 1
- 108050005195 Matrix metalloproteinase-26 Proteins 0.000 description 1
- 102100026799 Matrix metalloproteinase-28 Human genes 0.000 description 1
- 101710082420 Matrix metalloproteinase-28 Proteins 0.000 description 1
- 108050006599 Metalloproteinase inhibitor 1 Proteins 0.000 description 1
- 229940123643 Metalloproteinase-3 inhibitor Drugs 0.000 description 1
- 102100025695 Meteorin Human genes 0.000 description 1
- 101710204352 Meteorin Proteins 0.000 description 1
- 102100039669 Meteorin-like protein Human genes 0.000 description 1
- 101710146512 Meteorin-like protein Proteins 0.000 description 1
- 108060004795 Methyltransferase Proteins 0.000 description 1
- 101710187427 Methyltransferase-like protein Proteins 0.000 description 1
- 102100036103 Microfibril-associated glycoprotein 4 Human genes 0.000 description 1
- 101710188645 Microfibril-associated glycoprotein 4 Proteins 0.000 description 1
- 102100025602 Microfibrillar-associated protein 1 Human genes 0.000 description 1
- 102100036203 Microfibrillar-associated protein 5 Human genes 0.000 description 1
- 102000014171 Milk Proteins Human genes 0.000 description 1
- 108010011756 Milk Proteins Proteins 0.000 description 1
- 102100031307 Mitochondrial uncoupling protein 4 Human genes 0.000 description 1
- 101710112409 Mitochondrial uncoupling protein 4 Proteins 0.000 description 1
- 108010074633 Mixed Function Oxygenases Proteins 0.000 description 1
- 102000008109 Mixed Function Oxygenases Human genes 0.000 description 1
- 108010006519 Molecular Chaperones Proteins 0.000 description 1
- 102100034256 Mucin-1 Human genes 0.000 description 1
- 108010008707 Mucin-1 Proteins 0.000 description 1
- 102100023125 Mucin-17 Human genes 0.000 description 1
- 101710155095 Mucin-17 Proteins 0.000 description 1
- 102100034257 Mucin-19 Human genes 0.000 description 1
- 101710155103 Mucin-19 Proteins 0.000 description 1
- 102100034263 Mucin-2 Human genes 0.000 description 1
- 108010008705 Mucin-2 Proteins 0.000 description 1
- 102100022693 Mucin-4 Human genes 0.000 description 1
- 108010008699 Mucin-4 Proteins 0.000 description 1
- 102100022493 Mucin-6 Human genes 0.000 description 1
- 108010008692 Mucin-6 Proteins 0.000 description 1
- 102100022492 Mucin-7 Human genes 0.000 description 1
- 101710134550 Mucin-7 Proteins 0.000 description 1
- 102100038565 Mucin-like protein 1 Human genes 0.000 description 1
- 101710133580 Mucin-like protein 1 Proteins 0.000 description 1
- 108010014251 Muramidase Proteins 0.000 description 1
- 102100021272 Myelin protein zero-like protein 2 Human genes 0.000 description 1
- 108050003858 Myelin protein zero-like protein 2 Proteins 0.000 description 1
- 102100035050 Myeloid-associated differentiation marker Human genes 0.000 description 1
- 101710154183 Myeloid-associated differentiation marker Proteins 0.000 description 1
- 108010062010 N-Acetylmuramoyl-L-alanine Amidase Proteins 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 102100022737 NPC intracellular cholesterol transporter 2 Human genes 0.000 description 1
- 108020001621 Natriuretic Peptide Proteins 0.000 description 1
- 102000004571 Natriuretic peptide Human genes 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 102100034595 Nephronectin Human genes 0.000 description 1
- 102100028782 Neprilysin Human genes 0.000 description 1
- 108010030865 Netrin Receptors Proteins 0.000 description 1
- 102000005951 Netrin Receptors Human genes 0.000 description 1
- 102100034388 Netrin-4 Human genes 0.000 description 1
- 101710121532 Netrin-4 Proteins 0.000 description 1
- 102100034387 Netrin-5 Human genes 0.000 description 1
- 101710121535 Netrin-5 Proteins 0.000 description 1
- 102100032139 Neuroguidin Human genes 0.000 description 1
- 102100038842 Neuropeptide B Human genes 0.000 description 1
- 102100028762 Neuropilin-1 Human genes 0.000 description 1
- 108090000772 Neuropilin-1 Proteins 0.000 description 1
- 102100035107 Neurotrimin Human genes 0.000 description 1
- 102000056189 Neutrophil collagenases Human genes 0.000 description 1
- 108030001564 Neutrophil collagenases Proteins 0.000 description 1
- 102100037371 Nidogen-2 Human genes 0.000 description 1
- 101710091705 Nidogen-2 Proteins 0.000 description 1
- 102100023729 Noelin-2 Human genes 0.000 description 1
- 101710116980 Noelin-2 Proteins 0.000 description 1
- 102100037046 Noelin-3 Human genes 0.000 description 1
- 101710116982 Noelin-3 Proteins 0.000 description 1
- 108010041199 Nogo Receptor 1 Proteins 0.000 description 1
- 102100025036 Norrin Human genes 0.000 description 1
- 101710085992 Norrin Proteins 0.000 description 1
- 102100027196 Odorant-binding protein 2a Human genes 0.000 description 1
- 101710157516 Odorant-binding protein 2a Proteins 0.000 description 1
- 102100027202 Odorant-binding protein 2b Human genes 0.000 description 1
- 101710157517 Odorant-binding protein 2b Proteins 0.000 description 1
- 102100025404 Olfactomedin-like protein 2A Human genes 0.000 description 1
- 101710146812 Olfactomedin-like protein 2A Proteins 0.000 description 1
- 102100025388 Olfactomedin-like protein 2B Human genes 0.000 description 1
- 102100032750 Olfactomedin-like protein 3 Human genes 0.000 description 1
- 101710178153 Olfactomedin-like protein 3 Proteins 0.000 description 1
- 102000012547 Olfactory receptors Human genes 0.000 description 1
- 108050002069 Olfactory receptors Proteins 0.000 description 1
- 102100032748 Oncoprotein-induced transcript 3 protein Human genes 0.000 description 1
- 101710127259 Oncoprotein-induced transcript 3 protein Proteins 0.000 description 1
- 102400000925 Opiorphin Human genes 0.000 description 1
- TWWFCOBVAKAKIT-SXYSDOLCSA-N Opiorphin Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)N)CC1=CC=CC=C1 TWWFCOBVAKAKIT-SXYSDOLCSA-N 0.000 description 1
- 102100040123 Opiorphin prepropeptide Human genes 0.000 description 1
- 102100026747 Osteomodulin Human genes 0.000 description 1
- 102000009890 Osteonectin Human genes 0.000 description 1
- 108010077077 Osteonectin Proteins 0.000 description 1
- 102000004264 Osteopontin Human genes 0.000 description 1
- 108010081689 Osteopontin Proteins 0.000 description 1
- 102100034205 Otogelin Human genes 0.000 description 1
- 101710157978 Otogelin Proteins 0.000 description 1
- 102100034208 Otolin-1 Human genes 0.000 description 1
- 101710153883 Otoraplin Proteins 0.000 description 1
- 102100026304 Otoraplin Human genes 0.000 description 1
- 102100026303 Otospiralin Human genes 0.000 description 1
- 101710161544 Otospiralin Proteins 0.000 description 1
- 240000007930 Oxalis acetosella Species 0.000 description 1
- 235000008098 Oxalis acetosella Nutrition 0.000 description 1
- 108020002230 Pancreatic Ribonuclease Proteins 0.000 description 1
- 102000005891 Pancreatic ribonuclease Human genes 0.000 description 1
- 102100033359 Pancreatic triacylglycerol lipase Human genes 0.000 description 1
- 101710162333 Pancreatic triacylglycerol lipase Proteins 0.000 description 1
- 208000027898 Parkinson disease 7 Diseases 0.000 description 1
- 102100035845 Peflin Human genes 0.000 description 1
- 101710131325 Peflin Proteins 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 102100039652 Pepsin A-5 Human genes 0.000 description 1
- 102000005877 Peptide Initiation Factors Human genes 0.000 description 1
- 108010044843 Peptide Initiation Factors Proteins 0.000 description 1
- 102000052544 Peptidoglycan recognition protein Human genes 0.000 description 1
- 108010009051 Peptidoglycan recognition protein Proteins 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- 102100040283 Peptidyl-prolyl cis-trans isomerase B Human genes 0.000 description 1
- 102100037765 Periostin Human genes 0.000 description 1
- 101710199268 Periostin Proteins 0.000 description 1
- 102100035917 Peripheral myelin protein 22 Human genes 0.000 description 1
- 101710199257 Peripheral myelin protein 22 Proteins 0.000 description 1
- 102100037209 Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Human genes 0.000 description 1
- 101710164696 Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Proteins 0.000 description 1
- 102100024617 Phosphatidylethanolamine-binding protein 4 Human genes 0.000 description 1
- 101710204066 Phosphatidylethanolamine-binding protein 4 Proteins 0.000 description 1
- 102100040865 Phospholipase A2 group XV Human genes 0.000 description 1
- 101710127148 Phospholipase A2 group XV Proteins 0.000 description 1
- 108010058864 Phospholipases A2 Proteins 0.000 description 1
- 102000007982 Phosphoproteins Human genes 0.000 description 1
- 108010089430 Phosphoproteins Proteins 0.000 description 1
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- 102100039421 Phytanoyl-CoA dioxygenase, peroxisomal Human genes 0.000 description 1
- 102100033226 Pikachurin Human genes 0.000 description 1
- 101710178799 Pikachurin Proteins 0.000 description 1
- 102000002808 Pituitary adenylate cyclase-activating polypeptide Human genes 0.000 description 1
- 108010004684 Pituitary adenylate cyclase-activating polypeptide Proteins 0.000 description 1
- 102000014721 Placenta-specific protein 1 Human genes 0.000 description 1
- 108050005093 Placenta-specific protein 1 Proteins 0.000 description 1
- 102100026183 Placenta-specific protein 9 Human genes 0.000 description 1
- 101710090431 Placenta-specific protein 9 Proteins 0.000 description 1
- 102000004576 Placental Lactogen Human genes 0.000 description 1
- 108010003044 Placental Lactogen Proteins 0.000 description 1
- 239000000381 Placental Lactogen Substances 0.000 description 1
- 101710158668 Placental protein Proteins 0.000 description 1
- 108010064851 Plant Proteins Proteins 0.000 description 1
- 108050007539 Plasma protease C1 inhibitor Proteins 0.000 description 1
- 108010022233 Plasminogen Activator Inhibitor 1 Proteins 0.000 description 1
- 108090000614 Plasminogen Activator Inhibitor 2 Proteins 0.000 description 1
- 102000001938 Plasminogen Activators Human genes 0.000 description 1
- 108010001014 Plasminogen Activators Proteins 0.000 description 1
- 102100039418 Plasminogen activator inhibitor 1 Human genes 0.000 description 1
- 102100039419 Plasminogen activator inhibitor 2 Human genes 0.000 description 1
- 102100035201 Plasminogen-like protein A Human genes 0.000 description 1
- 102000004211 Platelet factor 4 Human genes 0.000 description 1
- 108090000778 Platelet factor 4 Proteins 0.000 description 1
- 108010068588 Platelet-Derived Growth Factor alpha Receptor Proteins 0.000 description 1
- 102000018967 Platelet-Derived Growth Factor beta Receptor Human genes 0.000 description 1
- 108010051742 Platelet-Derived Growth Factor beta Receptor Proteins 0.000 description 1
- 102100026554 Platelet-derived growth factor receptor-like protein Human genes 0.000 description 1
- 101710165908 Platelet-derived growth factor receptor-like protein Proteins 0.000 description 1
- 102100034381 Plexin-A2 Human genes 0.000 description 1
- 101710100258 Plexin-A2 Proteins 0.000 description 1
- 102100034385 Plexin-A4 Human genes 0.000 description 1
- 101710100264 Plexin-A4 Proteins 0.000 description 1
- 102100034384 Plexin-B1 Human genes 0.000 description 1
- 101710100559 Plexin-B1 Proteins 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 108010076039 Polyproteins Proteins 0.000 description 1
- 102000004257 Potassium Channel Human genes 0.000 description 1
- 108010071690 Prealbumin Proteins 0.000 description 1
- 102000008217 Pregnancy Proteins Human genes 0.000 description 1
- 102000004488 Prenylcysteine oxidase Human genes 0.000 description 1
- 102100041004 Prenylcysteine oxidase 1 Human genes 0.000 description 1
- 101710087494 Prenylcysteine oxidase 1 Proteins 0.000 description 1
- 108091000054 Prion Proteins 0.000 description 1
- 102100022661 Pro-neuregulin-1, membrane-bound isoform Human genes 0.000 description 1
- 101710197695 Pro-neuregulin-1, membrane-bound isoform Proteins 0.000 description 1
- 102100022668 Pro-neuregulin-2, membrane-bound isoform Human genes 0.000 description 1
- 101710114478 Pro-neuregulin-2, membrane-bound isoform Proteins 0.000 description 1
- 102100022658 Pro-neuregulin-4, membrane-bound isoform Human genes 0.000 description 1
- 101710150580 Pro-neuregulin-4, membrane-bound isoform Proteins 0.000 description 1
- 102100039915 Probable cation-transporting ATPase 13A4 Human genes 0.000 description 1
- 102100029532 Probable fibrosin-1 Human genes 0.000 description 1
- 101710181699 Proepiregulin Proteins 0.000 description 1
- 102100040126 Prokineticin-1 Human genes 0.000 description 1
- 102100040125 Prokineticin-2 Human genes 0.000 description 1
- 101710103829 Prokineticin-2 Proteins 0.000 description 1
- 108010002519 Prolactin Receptors Proteins 0.000 description 1
- 102100029000 Prolactin receptor Human genes 0.000 description 1
- 102100030350 Prolactin-inducible protein Human genes 0.000 description 1
- 101710187242 Prolactin-inducible protein homolog Proteins 0.000 description 1
- 102100037034 Proline-rich acidic protein 1 Human genes 0.000 description 1
- 101710115103 Proline-rich acidic protein 1 Proteins 0.000 description 1
- 101710124302 Proline-rich protein 1 Proteins 0.000 description 1
- 102100023398 Promotilin Human genes 0.000 description 1
- 101710125844 Promotilin Proteins 0.000 description 1
- 102100024615 Prosalusin Human genes 0.000 description 1
- 101710202133 Prosalusin Proteins 0.000 description 1
- 101710120463 Prostate stem cell antigen Proteins 0.000 description 1
- 102100036735 Prostate stem cell antigen Human genes 0.000 description 1
- 108010072866 Prostate-Specific Antigen Proteins 0.000 description 1
- 102100038358 Prostate-specific antigen Human genes 0.000 description 1
- 101710132457 Protein A1 Proteins 0.000 description 1
- 101710132455 Protein A2 Proteins 0.000 description 1
- 101710132617 Protein B1 Proteins 0.000 description 1
- 102000006010 Protein Disulfide-Isomerase Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010076504 Protein Sorting Signals Proteins 0.000 description 1
- 101800000442 Protein X2 Proteins 0.000 description 1
- 101710111106 Protein twisted gastrulation Proteins 0.000 description 1
- 102100028964 Proteoglycan 3 Human genes 0.000 description 1
- 101710127914 Proteoglycan 3 Proteins 0.000 description 1
- 102100028965 Proteoglycan 4 Human genes 0.000 description 1
- 101710127913 Proteoglycan 4 Proteins 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 102100024258 Protocadherin alpha-1 Human genes 0.000 description 1
- 101710167976 Protocadherin alpha-1 Proteins 0.000 description 1
- 102100024278 Protocadherin alpha-6 Human genes 0.000 description 1
- 101710167975 Protocadherin alpha-6 Proteins 0.000 description 1
- 102100040143 Protocadherin beta-13 Human genes 0.000 description 1
- 101710159434 Protocadherin beta-13 Proteins 0.000 description 1
- 102100029264 Protocadherin gamma-A12 Human genes 0.000 description 1
- 101710142883 Protocadherin gamma-A12 Proteins 0.000 description 1
- 102100036382 Protocadherin-15 Human genes 0.000 description 1
- 101710157841 Protocadherin-15 Proteins 0.000 description 1
- 102100026322 Proton channel OTOP1 Human genes 0.000 description 1
- 101710157886 Proton channel OTOP1 Proteins 0.000 description 1
- 102100033543 Proton-transporting V-type ATPase complex assembly regulator TMEM9 Human genes 0.000 description 1
- 101710183261 Proton-transporting V-type ATPase complex assembly regulator TMEM9 Proteins 0.000 description 1
- 101100244562 Pseudomonas aeruginosa (strain ATCC 15692 / DSM 22644 / CIP 104116 / JCM 14847 / LMG 12228 / 1C / PRS 101 / PAO1) oprD gene Proteins 0.000 description 1
- 102100034739 Putative lipocalin 1-like protein 1 Human genes 0.000 description 1
- 101710183855 Putative lipocalin 1-like protein 1 Proteins 0.000 description 1
- 102100029923 Putative stereocilin-like protein Human genes 0.000 description 1
- 101710097347 Putative stereocilin-like protein Proteins 0.000 description 1
- 102000015097 RNA Splicing Factors Human genes 0.000 description 1
- 108010039259 RNA Splicing Factors Proteins 0.000 description 1
- 108090000783 Renin Proteins 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 102100025343 Reticulocalbin-3 Human genes 0.000 description 1
- 101710164376 Reticulocalbin-3 Proteins 0.000 description 1
- 102100029826 Reticulon-4 receptor Human genes 0.000 description 1
- 102000012464 Retinol dehydrogenase 10 Human genes 0.000 description 1
- 108050002017 Retinol dehydrogenase 10 Proteins 0.000 description 1
- 102100038058 Retinol dehydrogenase 13 Human genes 0.000 description 1
- 101710178614 Retinol dehydrogenase 13 Proteins 0.000 description 1
- 102100039507 Retinoschisin Human genes 0.000 description 1
- 101710111169 Retinoschisin Proteins 0.000 description 1
- 102100026411 Ribonuclease 4 Human genes 0.000 description 1
- 102100040312 Ribonuclease 7 Human genes 0.000 description 1
- 108010085025 Ribonuclease 7 Proteins 0.000 description 1
- 102100040329 Ribonuclease 8 Human genes 0.000 description 1
- 101710192190 Ribonuclease 8 Proteins 0.000 description 1
- 102000006382 Ribonucleases Human genes 0.000 description 1
- 108010083644 Ribonucleases Proteins 0.000 description 1
- 101710170630 Ribonucleoside-diphosphate reductase 1 subunit alpha Proteins 0.000 description 1
- 108010005173 SERPIN-B5 Proteins 0.000 description 1
- 101150077717 SMIM43 gene Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 102100034201 Sclerostin Human genes 0.000 description 1
- 108050006698 Sclerostin Proteins 0.000 description 1
- 102000007969 Secretagogins Human genes 0.000 description 1
- 108010089384 Secretagogins Proteins 0.000 description 1
- 102100021853 Secreted and transmembrane protein 1 Human genes 0.000 description 1
- 101710126682 Secreted and transmembrane protein 1 Proteins 0.000 description 1
- 102100030277 Secreted phosphoprotein 24 Human genes 0.000 description 1
- 102100022486 Secretoglobin family 2B member 2 Human genes 0.000 description 1
- 102100020867 Secretogranin-1 Human genes 0.000 description 1
- 101710192385 Secretogranin-1 Proteins 0.000 description 1
- 102100035897 Secretogranin-3 Human genes 0.000 description 1
- 102100037550 Semenogelin-1 Human genes 0.000 description 1
- 101710089345 Semenogelin-1 Proteins 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 101710151381 Serine protease 2 Proteins 0.000 description 1
- 102100033835 Serine protease 23 Human genes 0.000 description 1
- 101710197466 Serine protease 23 Proteins 0.000 description 1
- 102100040107 Serine protease 27 Human genes 0.000 description 1
- 101710197422 Serine protease 27 Proteins 0.000 description 1
- 101710197425 Serine protease 29 Proteins 0.000 description 1
- 102100022638 Serine protease 48 Human genes 0.000 description 1
- 101710197541 Serine protease 48 Proteins 0.000 description 1
- 101710107116 Serine protease inhibitor 2 Proteins 0.000 description 1
- 101710107114 Serine protease inhibitor 4 Proteins 0.000 description 1
- 101710106352 Serine protease inhibitor 5 Proteins 0.000 description 1
- 101710106359 Serine protease inhibitor 8 Proteins 0.000 description 1
- 102100028030 Serine/threonine-protein kinase 32B Human genes 0.000 description 1
- 101710107343 Serine/threonine-protein kinase 32B Proteins 0.000 description 1
- 102000008847 Serpin Human genes 0.000 description 1
- 108050000761 Serpin Proteins 0.000 description 1
- 102100030326 Serpin B4 Human genes 0.000 description 1
- 101710156164 Serpin B4 Proteins 0.000 description 1
- 102100030333 Serpin B5 Human genes 0.000 description 1
- 102000007562 Serum Albumin Human genes 0.000 description 1
- 108010071390 Serum Albumin Proteins 0.000 description 1
- 102100036202 Serum amyloid P-component Human genes 0.000 description 1
- 102100035476 Serum paraoxonase/arylesterase 1 Human genes 0.000 description 1
- 101710180981 Serum paraoxonase/arylesterase 1 Proteins 0.000 description 1
- 102100022833 Serum paraoxonase/lactonase 3 Human genes 0.000 description 1
- 101710112260 Serum paraoxonase/lactonase 3 Proteins 0.000 description 1
- 108010089417 Sex Hormone-Binding Globulin Proteins 0.000 description 1
- 102100030758 Sex hormone-binding globulin Human genes 0.000 description 1
- 102100037857 Short-chain dehydrogenase/reductase 3 Human genes 0.000 description 1
- 108050002053 Short-chain dehydrogenase/reductase 3 Proteins 0.000 description 1
- 102100022850 Small integral membrane protein 43 Human genes 0.000 description 1
- 102100024397 Soluble calcium-activated nucleotidase 1 Human genes 0.000 description 1
- 101710143787 Soluble calcium-activated nucleotidase 1 Proteins 0.000 description 1
- 102100023047 Solute carrier family 27 member 3 Human genes 0.000 description 1
- 101710193668 Solute carrier family 27 member 3 Proteins 0.000 description 1
- 108010068542 Somatotropin Receptors Proteins 0.000 description 1
- 102100032800 Spermine oxidase Human genes 0.000 description 1
- 102100036427 Spondin-2 Human genes 0.000 description 1
- 101710092169 Spondin-2 Proteins 0.000 description 1
- 102100024471 Stabilin-1 Human genes 0.000 description 1
- 101710164042 Stabilin-1 Proteins 0.000 description 1
- 102100030510 Stanniocalcin-2 Human genes 0.000 description 1
- 101710142154 Stanniocalcin-2 Proteins 0.000 description 1
- 102000014284 Statherin Human genes 0.000 description 1
- 108050003162 Statherin Proteins 0.000 description 1
- 102100037172 Store-operated calcium entry-associated regulatory factor Human genes 0.000 description 1
- 101710181351 Store-operated calcium entry-associated regulatory factor Proteins 0.000 description 1
- 102100030416 Stromelysin-1 Human genes 0.000 description 1
- 102100028848 Stromelysin-2 Human genes 0.000 description 1
- 102100034371 Sulfhydryl oxidase 1 Human genes 0.000 description 1
- 101710159725 Sulfhydryl oxidase 1 Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 102000019197 Superoxide Dismutase Human genes 0.000 description 1
- 108010012715 Superoxide dismutase Proteins 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- 102100038649 Synaptogyrin-2 Human genes 0.000 description 1
- 101710152289 Synaptogyrin-2 Proteins 0.000 description 1
- 102000013265 Syntaxin 1 Human genes 0.000 description 1
- 108010090618 Syntaxin 1 Proteins 0.000 description 1
- 230000006044 T cell activation Effects 0.000 description 1
- 102100024577 TOMM20-like protein 1 Human genes 0.000 description 1
- 101710169658 TOMM20-like protein 1 Proteins 0.000 description 1
- 102100034024 Target of Myb protein 1 Human genes 0.000 description 1
- 102100030746 Tectonic-1 Human genes 0.000 description 1
- 101710178359 Tectonic-1 Proteins 0.000 description 1
- 102100030785 Tectonic-3 Human genes 0.000 description 1
- 101710178361 Tectonic-3 Proteins 0.000 description 1
- 102100038126 Tenascin Human genes 0.000 description 1
- 108010008125 Tenascin Proteins 0.000 description 1
- 102100033390 Testican-1 Human genes 0.000 description 1
- 101710144222 Testican-1 Proteins 0.000 description 1
- 102100033371 Testican-2 Human genes 0.000 description 1
- 101710144232 Testican-2 Proteins 0.000 description 1
- 102100024554 Tetranectin Human genes 0.000 description 1
- 102100024991 Tetraspanin-12 Human genes 0.000 description 1
- 101710133600 Tetraspanin-12 Proteins 0.000 description 1
- 102100024996 Tetraspanin-13 Human genes 0.000 description 1
- 101710133618 Tetraspanin-13 Proteins 0.000 description 1
- 102100030163 Tetraspanin-15 Human genes 0.000 description 1
- 101710133616 Tetraspanin-15 Proteins 0.000 description 1
- 102100030175 Tetraspanin-18 Human genes 0.000 description 1
- 101710133613 Tetraspanin-18 Proteins 0.000 description 1
- 102100022169 Thioredoxin-related transmembrane protein 1 Human genes 0.000 description 1
- 101710203066 Thioredoxin-related transmembrane protein 1 Proteins 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 102000009843 Thyroglobulin Human genes 0.000 description 1
- 108010034949 Thyroglobulin Proteins 0.000 description 1
- 102100028709 Thyroxine-binding globulin Human genes 0.000 description 1
- 102100030951 Tissue factor pathway inhibitor Human genes 0.000 description 1
- 102000019400 Tissue-type plasminogen activator Human genes 0.000 description 1
- 102100031996 Tolloid-like protein 1 Human genes 0.000 description 1
- 101710118137 Tolloid-like protein 1 Proteins 0.000 description 1
- 102100031997 Tolloid-like protein 2 Human genes 0.000 description 1
- 101710118138 Tolloid-like protein 2 Proteins 0.000 description 1
- 102100026160 Tomoregulin-2 Human genes 0.000 description 1
- 101710175558 Tomoregulin-2 Proteins 0.000 description 1
- 101710124482 Torsin-2A Proteins 0.000 description 1
- 102100037456 Trafficking protein particle complex subunit 10 Human genes 0.000 description 1
- 102100040396 Transcobalamin-1 Human genes 0.000 description 1
- 101710124861 Transcobalamin-1 Proteins 0.000 description 1
- 102000014034 Transcortin Human genes 0.000 description 1
- 108010011095 Transcortin Proteins 0.000 description 1
- 102100033663 Transforming growth factor beta receptor type 3 Human genes 0.000 description 1
- 101710132313 Transforming growth factor beta receptor type 3 Proteins 0.000 description 1
- 102100023935 Transmembrane glycoprotein NMB Human genes 0.000 description 1
- 102100032452 Transmembrane protease serine 6 Human genes 0.000 description 1
- 102100035317 Transmembrane protein 17 Human genes 0.000 description 1
- 101710103132 Transmembrane protein 17 Proteins 0.000 description 1
- 102100024323 Transmembrane protein 182 Human genes 0.000 description 1
- 101710191745 Transmembrane protein 182 Proteins 0.000 description 1
- 102100027027 Transmembrane protein 204 Human genes 0.000 description 1
- 101710170756 Transmembrane protein 204 Proteins 0.000 description 1
- 102100027022 Transmembrane protein 205 Human genes 0.000 description 1
- 101710170752 Transmembrane protein 205 Proteins 0.000 description 1
- 102100033530 Transmembrane protein 43 Human genes 0.000 description 1
- 101710106890 Transmembrane protein 43 Proteins 0.000 description 1
- 102100022246 Transmembrane protein 52 Human genes 0.000 description 1
- 101710106913 Transmembrane protein 52 Proteins 0.000 description 1
- 102100029290 Transthyretin Human genes 0.000 description 1
- 101710119665 Trypsin-1 Proteins 0.000 description 1
- 101710119666 Trypsin-2 Proteins 0.000 description 1
- 101710119641 Trypsin-6 Proteins 0.000 description 1
- 102100029637 Tryptase beta-2 Human genes 0.000 description 1
- 101710134953 Tryptase beta-2 Proteins 0.000 description 1
- 102100032760 Tryptase delta Human genes 0.000 description 1
- 101710136849 Tryptase delta Proteins 0.000 description 1
- 101710185398 Tubulointerstitial nephritis antigen Proteins 0.000 description 1
- 102100033470 Tubulointerstitial nephritis antigen Human genes 0.000 description 1
- 108700006143 UDP acetylglucosamine-2-epimerase Proteins 0.000 description 1
- 108010083111 Ubiquitin-Protein Ligases Proteins 0.000 description 1
- 102100020696 Ubiquitin-conjugating enzyme E2 K Human genes 0.000 description 1
- 102000021911 Ubiquitin-like domains Human genes 0.000 description 1
- 108091012462 Ubiquitin-like domains Proteins 0.000 description 1
- 102100027266 Ubiquitin-like protein ISG15 Human genes 0.000 description 1
- 101710087750 Ubiquitin-like protein ISG15 Proteins 0.000 description 1
- 102000005630 Urocortins Human genes 0.000 description 1
- 108010059705 Urocortins Proteins 0.000 description 1
- 102100040613 Uromodulin Human genes 0.000 description 1
- 108010027007 Uromodulin Proteins 0.000 description 1
- 102100029097 Urotensin-2 Human genes 0.000 description 1
- 101710095163 Urotensin-2 Proteins 0.000 description 1
- 102100037930 Usherin Human genes 0.000 description 1
- 101710138401 Usherin Proteins 0.000 description 1
- 102100038282 V-type immunoglobulin domain-containing suppressor of T-cell activation Human genes 0.000 description 1
- 108010073925 Vascular Endothelial Growth Factor B Proteins 0.000 description 1
- 108010073923 Vascular Endothelial Growth Factor C Proteins 0.000 description 1
- 108010053096 Vascular Endothelial Growth Factor Receptor-1 Proteins 0.000 description 1
- 102100038217 Vascular endothelial growth factor B Human genes 0.000 description 1
- 102100038232 Vascular endothelial growth factor C Human genes 0.000 description 1
- 102100033178 Vascular endothelial growth factor receptor 1 Human genes 0.000 description 1
- 108010004977 Vasopressins Proteins 0.000 description 1
- 102000002852 Vasopressins Human genes 0.000 description 1
- 229930003270 Vitamin B Natural products 0.000 description 1
- 102100038983 Xylosyltransferase 1 Human genes 0.000 description 1
- 108050007995 Xylosyltransferase 1 Proteins 0.000 description 1
- 229940022698 acetylcholinesterase Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- LNQVTSROQXJCDD-UHFFFAOYSA-N adenosine monophosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(CO)C(OP(O)(O)=O)C1O LNQVTSROQXJCDD-UHFFFAOYSA-N 0.000 description 1
- 210000001789 adipocyte Anatomy 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- MOVRNJGDXREIBM-UHFFFAOYSA-N aid-1 Chemical compound O=C1NC(=O)C(C)=CN1C1OC(COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=O)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)CO)C(O)C1 MOVRNJGDXREIBM-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000019169 all-trans-retinol Nutrition 0.000 description 1
- 239000011717 all-trans-retinol Substances 0.000 description 1
- 108010042381 alpha 1,3-mannosyltransferase Proteins 0.000 description 1
- 108010091628 alpha 1-Antichymotrypsin Proteins 0.000 description 1
- 102000015395 alpha 1-Antitrypsin Human genes 0.000 description 1
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 description 1
- 229940024142 alpha 1-antitrypsin Drugs 0.000 description 1
- 108010026331 alpha-Fetoproteins Proteins 0.000 description 1
- 102000013529 alpha-Fetoproteins Human genes 0.000 description 1
- 210000001053 ameloblast Anatomy 0.000 description 1
- 230000002862 amidating effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 108090000449 aminopeptidase B Proteins 0.000 description 1
- 239000002870 angiogenesis inducing agent Substances 0.000 description 1
- 108010069801 angiopoietin 4 Proteins 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003272 asparaginase Drugs 0.000 description 1
- 210000001130 astrocyte Anatomy 0.000 description 1
- 230000004900 autophagic degradation Effects 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 108010066058 beta Subunit Luteinizing Hormone Proteins 0.000 description 1
- 108010068678 beta Subunit Thyrotropin Proteins 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- HXNZTJULPKRNPR-UHFFFAOYSA-N borinine Chemical compound B1=CC=CC=C1 HXNZTJULPKRNPR-UHFFFAOYSA-N 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 108010019521 carbonic anhydrase VI Proteins 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- ZGOVYTPSWMLYOF-QEADGSHQSA-N chembl1790180 Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(O)=O)NC(=O)[C@H]1NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CSSC[C@@H](C(N[C@H](CC=3C=CC=CC=3)C(=O)N[C@H](C(=O)N[C@H](CCC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N2)[C@H](C)O)=O)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](N)CSSC1)C1=CNC=N1 ZGOVYTPSWMLYOF-QEADGSHQSA-N 0.000 description 1
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940107137 cholecystokinin Drugs 0.000 description 1
- 150000001840 cholesterol esters Chemical class 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- DLGJWSVWTWEWBJ-HGGSSLSASA-N chondroitin Chemical compound CC(O)=N[C@@H]1[C@H](O)O[C@H](CO)[C@H](O)[C@@H]1OC1[C@H](O)[C@H](O)C=C(C(O)=O)O1 DLGJWSVWTWEWBJ-HGGSSLSASA-N 0.000 description 1
- 108010033338 chondroitin sulfate glucuronyltransferase Proteins 0.000 description 1
- 102000006533 chordin Human genes 0.000 description 1
- 108010008846 chordin Proteins 0.000 description 1
- 229940121538 choriogonadotropin beta Drugs 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 229940105774 coagulation factor ix Drugs 0.000 description 1
- 229940105772 coagulation factor vii Drugs 0.000 description 1
- ACTIUHUUMQJHFO-UPTCCGCDSA-N coenzyme Q10 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UPTCCGCDSA-N 0.000 description 1
- 235000017471 coenzyme Q10 Nutrition 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 229940047120 colony stimulating factors Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 108010047295 complement receptors Proteins 0.000 description 1
- 102000006834 complement receptors Human genes 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- KLVRDXBAMSPYKH-RKYZNNDCSA-N corticotropin-releasing hormone (human) Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(N)=O)[C@@H](C)CC)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H]1N(CCC1)C(=O)[C@H]1N(CCC1)C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](N)CO)[C@@H](C)CC)C(C)C)C(C)C)C1=CNC=N1 KLVRDXBAMSPYKH-RKYZNNDCSA-N 0.000 description 1
- 108050004038 cystatin Proteins 0.000 description 1
- 108010026647 cytochrome P-450 4X1 Proteins 0.000 description 1
- 102000003675 cytokine receptors Human genes 0.000 description 1
- 108010057085 cytokine receptors Proteins 0.000 description 1
- UQHKFADEQIVWID-UHFFFAOYSA-N cytokinin Natural products C1=NC=2C(NCC=C(CO)C)=NC=NC=2N1C1CC(O)C(CO)O1 UQHKFADEQIVWID-UHFFFAOYSA-N 0.000 description 1
- 239000004062 cytokinin Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 108700023159 delta Opioid Receptors Proteins 0.000 description 1
- 102000048124 delta Opioid Receptors Human genes 0.000 description 1
- 108010031616 deoxyribonuclease gamma Proteins 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000002009 diols Chemical group 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- MDCUNMLZLNGCQA-HWOAGHQOSA-N elafin Chemical compound N([C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H]1C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H]2CSSC[C@H]3C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N[C@@H](C)C(=O)N[C@@H](CSSC[C@H]4C(=O)N5CCC[C@H]5C(=O)NCC(=O)N[C@H](C(N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H]5N(CCC5)C(=O)[C@H]5N(CCC5)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC(=O)[C@H](C)NC2=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(O)=O)C(=O)N4)C(=O)N[C@@H](CSSC1)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N3)=O)[C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(O)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)C(C)C)C(C)C)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)N MDCUNMLZLNGCQA-HWOAGHQOSA-N 0.000 description 1
- 229920002549 elastin Polymers 0.000 description 1
- 108700004389 elastin microfibril interface located Proteins 0.000 description 1
- 229940073621 enbrel Drugs 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 210000002472 endoplasmic reticulum Anatomy 0.000 description 1
- 108010022937 endoplasmin Proteins 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000008472 epithelial growth Effects 0.000 description 1
- 229940105423 erythropoietin Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 229940012444 factor xiii Drugs 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 108010048325 fibrinopeptides gamma Proteins 0.000 description 1
- 108010034065 fibulin 2 Proteins 0.000 description 1
- 210000000285 follicular dendritic cell Anatomy 0.000 description 1
- 108010081934 follitropin beta Proteins 0.000 description 1
- 229960002907 follitropin beta Drugs 0.000 description 1
- 108010062699 gamma-Glutamyl Hydrolase Proteins 0.000 description 1
- 108010091264 gastric triacylglycerol lipase Proteins 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 102000034238 globular proteins Human genes 0.000 description 1
- 108091005896 globular proteins Proteins 0.000 description 1
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 1
- 229960004666 glucagon Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 108010074283 glutaminyl-arginyl-phenylalanyl-seryl-arginine Proteins 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 102000017941 granulin Human genes 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- 108010037536 heparanase Proteins 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 108700039582 histidine triad Proteins 0.000 description 1
- 108010044853 histidine-rich proteins Proteins 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 108091008039 hormone receptors Proteins 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 230000005847 immunogenicity Effects 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000000893 inhibin Substances 0.000 description 1
- 108091006086 inhibitor proteins Proteins 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000004026 insulin derivative Substances 0.000 description 1
- 229940068935 insulin-like growth factor 2 Drugs 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229960003130 interferon gamma Drugs 0.000 description 1
- 108010080375 interferon kappa Proteins 0.000 description 1
- 229960001388 interferon-beta Drugs 0.000 description 1
- 229940047124 interferons Drugs 0.000 description 1
- 239000003407 interleukin 1 receptor blocking agent Substances 0.000 description 1
- 108010052839 interleukin 16 precursor Proteins 0.000 description 1
- 229940074383 interleukin-11 Drugs 0.000 description 1
- 108010070145 interleukin-18 binding protein Proteins 0.000 description 1
- 102000044166 interleukin-18 binding protein Human genes 0.000 description 1
- 108010074109 interleukin-22 Proteins 0.000 description 1
- 102000003898 interleukin-24 Human genes 0.000 description 1
- 108090000237 interleukin-24 Proteins 0.000 description 1
- 229940028885 interleukin-4 Drugs 0.000 description 1
- 229940100602 interleukin-5 Drugs 0.000 description 1
- 229940100601 interleukin-6 Drugs 0.000 description 1
- 229940096397 interleukin-8 Drugs 0.000 description 1
- XKTZWUACRZHVAN-VADRZIEHSA-N interleukin-8 Chemical group C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](NC(C)=O)CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N1[C@H](CCC1)C(=O)N1[C@H](CCC1)C(=O)N[C@@H](C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC(O)=CC=1)C(=O)N[C@H](CO)C(=O)N1[C@H](CCC1)C(N)=O)C1=CC=CC=C1 XKTZWUACRZHVAN-VADRZIEHSA-N 0.000 description 1
- 229940118526 interleukin-9 Drugs 0.000 description 1
- 229940029329 intrinsic factor Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 108010024383 kallikrein 4 Proteins 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229940057428 lactoperoxidase Drugs 0.000 description 1
- 229940102988 levemir Drugs 0.000 description 1
- 108010013555 lipoprotein-associated coagulation inhibitor Proteins 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 108010045758 lysosomal proteins Proteins 0.000 description 1
- 210000003712 lysosome Anatomy 0.000 description 1
- 230000001868 lysosomic effect Effects 0.000 description 1
- 229960000274 lysozyme Drugs 0.000 description 1
- 239000004325 lysozyme Substances 0.000 description 1
- 235000010335 lysozyme Nutrition 0.000 description 1
- 230000001806 lysozymelike Effects 0.000 description 1
- 210000002540 macrophage Anatomy 0.000 description 1
- 108010053292 macrophage stimulating protein Proteins 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 210000001259 mesencephalon Anatomy 0.000 description 1
- 210000003716 mesoderm Anatomy 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- 230000008880 microtubule cytoskeleton organization Effects 0.000 description 1
- 235000021239 milk protein Nutrition 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 210000002161 motor neuron Anatomy 0.000 description 1
- 208000034420 multiple type III exostoses Diseases 0.000 description 1
- 210000000066 myeloid cell Anatomy 0.000 description 1
- 239000000692 natriuretic peptide Substances 0.000 description 1
- 108010086803 nephronectin Proteins 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- 230000007514 neuronal growth Effects 0.000 description 1
- 108010085094 neuropeptide B Proteins 0.000 description 1
- 230000000720 neurosecretory effect Effects 0.000 description 1
- 108010042350 neurotrimin Proteins 0.000 description 1
- 230000000508 neurotrophic effect Effects 0.000 description 1
- 108700022821 nicastrin Proteins 0.000 description 1
- 102000046701 nicastrin Human genes 0.000 description 1
- 102000045246 noggin Human genes 0.000 description 1
- 108700007229 noggin Proteins 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000001956 orexigenic effect Effects 0.000 description 1
- 108010078960 osteoadherin Proteins 0.000 description 1
- 108010040377 otolin-1 Proteins 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 101710135378 pH 6 antigen Proteins 0.000 description 1
- 239000000199 parathyroid hormone Substances 0.000 description 1
- 229960001319 parathyroid hormone Drugs 0.000 description 1
- 229940066716 pepsin a Drugs 0.000 description 1
- 125000001151 peptidyl group Chemical group 0.000 description 1
- 108010044156 peptidyl-prolyl cis-trans isomerase b Proteins 0.000 description 1
- 108010007262 peptidylglycine monooxygenase Proteins 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 108010031345 placental alkaline phosphatase Proteins 0.000 description 1
- 235000021118 plant-derived protein Nutrition 0.000 description 1
- 229940127126 plasminogen activator Drugs 0.000 description 1
- 102000005162 pleiotrophin Human genes 0.000 description 1
- 108050009312 plexin Proteins 0.000 description 1
- 102000002022 plexin Human genes 0.000 description 1
- 108010089000 polyamine oxidase Proteins 0.000 description 1
- 208000030761 polycystic kidney disease Diseases 0.000 description 1
- 102000040430 polynucleotide Human genes 0.000 description 1
- 108091033319 polynucleotide Proteins 0.000 description 1
- 239000002157 polynucleotide Substances 0.000 description 1
- 239000003910 polypeptide antibiotic agent Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 230000006267 polysialylation Effects 0.000 description 1
- 108020001213 potassium channel Proteins 0.000 description 1
- 108020001776 prenylcysteine oxidase Proteins 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019833 protease Nutrition 0.000 description 1
- 108020003519 protein disulfide isomerase Proteins 0.000 description 1
- 108020001580 protein domains Proteins 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 108010054067 rab1 GTP-Binding Proteins Proteins 0.000 description 1
- NPCOQXAVBJJZBQ-UHFFFAOYSA-N reduced coenzyme Q9 Natural products COC1=C(O)C(C)=C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(O)=C1OC NPCOQXAVBJJZBQ-UHFFFAOYSA-N 0.000 description 1
- 239000003488 releasing hormone Substances 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 108010066490 ribonuclease 4 Proteins 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 210000000518 sarcolemma Anatomy 0.000 description 1
- 208000008864 scrapie Diseases 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 108010007653 secretogranin III Proteins 0.000 description 1
- WGWPRVFKDLAUQJ-MITYVQBRSA-N sermorelin Chemical class C([C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)C1=CC=C(O)C=C1 WGWPRVFKDLAUQJ-MITYVQBRSA-N 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000021595 spermatogenesis Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000001913 submandibular gland Anatomy 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate group Chemical group S(=O)(=O)([O-])[O-] QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 208000033002 susceptibility to psoriasis 1 Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 108010013645 tetranectin Proteins 0.000 description 1
- 229960002175 thyroglobulin Drugs 0.000 description 1
- 230000008467 tissue growth Effects 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 108091007466 transmembrane glycoproteins Proteins 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 210000003956 transport vesicle Anatomy 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- 108010087967 type I signal peptidase Proteins 0.000 description 1
- 229940035936 ubiquinone Drugs 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 239000000777 urocortin Substances 0.000 description 1
- HFNHAPQMXICKCF-USJMABIRSA-N urotensin-ii Chemical compound N([C@@H](CC(O)=O)C(=O)N[C@H]1CSSC[C@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=2C3=CC=CC=C3NC=2)NC(=O)[C@H](CC=2C=CC=CC=2)NC1=O)C(=O)N[C@@H](C(C)C)C(O)=O)C(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](N)CCC(O)=O)[C@@H](C)O HFNHAPQMXICKCF-USJMABIRSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000028973 vesicle-mediated transport Effects 0.000 description 1
- 235000019156 vitamin B Nutrition 0.000 description 1
- 239000011720 vitamin B Substances 0.000 description 1
- 210000001534 vitelline membrane Anatomy 0.000 description 1
- 230000003462 zymogenic effect Effects 0.000 description 1
- 235000021246 κ-casein Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/50—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/50—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates
- A61K47/51—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent
- A61K47/56—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic macromolecular compound, e.g. an oligomeric, polymeric or dendrimeric molecule
- A61K47/59—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic macromolecular compound, e.g. an oligomeric, polymeric or dendrimeric molecule obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyureas or polyurethanes
- A61K47/60—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic macromolecular compound, e.g. an oligomeric, polymeric or dendrimeric molecule obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyureas or polyurethanes the organic macromolecular compound being a polyoxyalkylene oligomer, polymer or dendrimer, e.g. PEG, PPG, PEO or polyglycerol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/50—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates
- A61K47/51—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent
- A61K47/54—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient the non-active ingredient being chemically bound to the active ingredient, e.g. polymer-drug conjugates the non-active ingredient being a modifying agent the modifying agent being an organic compound
- A61K47/542—Carboxylic acids, e.g. a fatty acid or an amino acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/04—Antihaemorrhagics; Procoagulants; Haemostatic agents; Antifibrinolytic agents
Landscapes
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicinal Preparation (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201061426356P | 2010-12-22 | 2010-12-22 | |
| PCT/US2011/065591 WO2012087838A1 (en) | 2010-12-22 | 2011-12-16 | Materials and methods for conjugating a water soluble fatty acid derivative to a protein |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201390940A1 EA201390940A1 (ru) | 2014-04-30 |
| EA032056B1 true EA032056B1 (ru) | 2019-04-30 |
Family
ID=45464916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201390940A EA032056B1 (ru) | 2010-12-22 | 2011-12-16 | Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US8945897B2 (enExample) |
| EP (2) | EP2654794B8 (enExample) |
| JP (1) | JP6138052B2 (enExample) |
| KR (1) | KR102025442B1 (enExample) |
| CN (1) | CN103269723B (enExample) |
| AR (1) | AR084576A1 (enExample) |
| AU (2) | AU2011349574B9 (enExample) |
| BR (1) | BR112013015898A2 (enExample) |
| CA (1) | CA2822591C (enExample) |
| DK (1) | DK2654794T3 (enExample) |
| EA (1) | EA032056B1 (enExample) |
| ES (1) | ES2800983T3 (enExample) |
| HU (1) | HUE049352T2 (enExample) |
| MX (1) | MX345608B (enExample) |
| NZ (1) | NZ612320A (enExample) |
| PL (1) | PL2654794T3 (enExample) |
| PT (1) | PT2654794T (enExample) |
| SG (1) | SG191298A1 (enExample) |
| TW (1) | TWI546279B (enExample) |
| WO (1) | WO2012087838A1 (enExample) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20150233903A1 (en) * | 2012-09-10 | 2015-08-20 | The Johns Hopkins University | Solid phase glycan and glycopeptide analysis and microfluidic chip for glycomic extraction, analysis and methods for using same |
| CN103897031A (zh) * | 2012-12-25 | 2014-07-02 | 深圳先进技术研究院 | 化学修饰的胸腺五肽及其合成方法 |
| WO2014131011A1 (en) * | 2013-02-25 | 2014-08-28 | J Craig Venter Institute | Metaproteomic method to identify secreted pattern recognition molecules and adhesive antimicrobial factors for detection of microbial agents eliciting inflammation in the human host |
| AU2014234271A1 (en) * | 2013-03-20 | 2015-10-08 | Fresenius Kabi Deutschland Gmbh | Process for the preparation of thiol functionalized hydroxyalkyl starch derivatives |
| CN103636918B (zh) * | 2013-12-13 | 2015-11-04 | 东北农业大学 | 一种富含亚油酸的改性分离蛋白制备方法 |
| EP3102224B1 (en) * | 2013-12-20 | 2019-02-20 | NephroGenesis, LLC. | Apparatuses for kidney dialysis and lipocalin protein for use in the prevention or treatment of uremia by dialysis |
| EP2915569A1 (en) | 2014-03-03 | 2015-09-09 | Cytune Pharma | IL-15/IL-15Ralpha based conjugates purification method |
| KR20180031775A (ko) * | 2015-08-12 | 2018-03-28 | 셀 머신스, 인크. | 긴 반감기 응집 복합체와 관련된 방법 및 조성물 |
| CN106554425B (zh) * | 2015-09-18 | 2018-10-30 | 沈阳药科大学 | 一种聚唾液酸的脂质接枝衍生物及其应用 |
| CN109069569B (zh) * | 2015-12-02 | 2023-02-14 | 韩美药品株式会社 | 使用脂肪酸衍生物的蛋白缀合物及其制备方法 |
| CN108147990B (zh) * | 2016-12-02 | 2023-01-24 | 上海中医药大学 | 一种膜锚定元件及其应用 |
| ES2963839T3 (es) | 2017-02-08 | 2024-04-02 | Bristol Myers Squibb Co | Polipéptidos de relaxina modificados que comprenden un potenciador farmacocinético y usos de los mismos |
| CN107141354A (zh) * | 2017-05-05 | 2017-09-08 | 李斯文 | 一种融合蛋白及光敏剂复合物及其制备方法和应用 |
| WO2019023295A1 (en) | 2017-07-27 | 2019-01-31 | Saint Louis University | Fatty acid modified human epidermal growth factor |
| CA3151394C (en) * | 2017-09-19 | 2023-10-03 | Immunwork Inc. | Pharmaceutical constructs with enhanced binding affinity with albumin |
| US11845989B2 (en) | 2019-01-23 | 2023-12-19 | Regeneron Pharmaceuticals, Inc. | Treatment of ophthalmic conditions with angiopoietin-like 7 (ANGPTL7) inhibitors |
| SG11202107497XA (en) | 2019-01-23 | 2021-08-30 | Regeneron Pharma | Treatment of ophthalmic conditions with angiopoietin-like 7 (angptl7) inhibitors |
| EP3819307A1 (en) * | 2019-11-07 | 2021-05-12 | CytoKi Pharma ApS | Therapeutic derivatives of interleukin-22 |
| US11692020B2 (en) | 2019-11-20 | 2023-07-04 | Anwita Biosciences, Inc. | Cytokine fusion proteins, and their pharmaceutical compositions and therapeutic applications |
| US11897930B2 (en) | 2020-04-28 | 2024-02-13 | Anwita Biosciences, Inc. | Interleukin-2 polypeptides and fusion proteins thereof, and their pharmaceutical compositions and therapeutic applications |
| CN113967267B (zh) * | 2020-07-21 | 2022-10-25 | 四川大学 | 脂肪酸修饰的白蛋白的内质网靶向作用及其用途 |
| EP4298219A1 (en) | 2021-02-26 | 2024-01-03 | Regeneron Pharmaceuticals, Inc. | Treatment of inflammation with glucocorticoids and angiopoietin-like 7 (angptl7) inhibitors |
| EP4337680A1 (en) * | 2021-05-11 | 2024-03-20 | Cytoki Pharma ApS | Therapeutic derivatives of interleukin-22 |
| EP4089107A1 (en) * | 2021-05-11 | 2022-11-16 | CytoKi Pharma ApS | Therapeutic derivatives of interleukin-22 |
| EP4089108A1 (en) * | 2021-05-11 | 2022-11-16 | CytoKi Pharma ApS | Therapeutic derivatives of interleukin-22 |
| CN114990175B (zh) * | 2021-10-22 | 2023-03-31 | 岩唐生物科技(杭州)有限责任公司 | 一种岩藻糖衍生物的合成方法 |
| CA3263628A1 (en) * | 2022-07-29 | 2024-02-01 | The Trustees Of The University Of Pennsylvania | ANTICOAGULANT TARGETING THE LYMPH FOR THE PREVENTION OF LYMPHATOUS THROMBOSIS |
| CN115894719B (zh) * | 2022-11-24 | 2023-10-20 | 武汉禾元生物科技股份有限公司 | 一种人血清白蛋白胰岛素偶联物及其制备方法 |
| WO2025133203A1 (en) * | 2023-12-22 | 2025-06-26 | Pam Theragnostics Gmbh | Compounds and methods for a long-lasting pam |
| CN118209737B (zh) * | 2024-05-22 | 2024-08-09 | 国科大杭州高等研究院 | 一种用于鉴定检测脂肪酸与蛋白质相互作用的方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20030069170A1 (en) * | 2001-09-07 | 2003-04-10 | Richard Soltero | Pharmaceutical compositions of drug-oligomer conjugates and methods of treating diseases therewith |
| WO2005117984A2 (en) * | 2004-06-01 | 2005-12-15 | Celltech R & D Limited | Albumin-binding conjugates comprising a fatty acid and peg |
| WO2008025856A2 (en) * | 2006-09-01 | 2008-03-06 | Novo Nordisk Health Care Ag | Modified glycoproteins |
| WO2011101277A1 (en) * | 2010-02-16 | 2011-08-25 | Novo Nordisk A/S | Conjugated proteins |
Family Cites Families (144)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179337A (en) | 1973-07-20 | 1979-12-18 | Davis Frank F | Non-immunogenic polypeptides |
| JPS54113492A (en) | 1978-02-24 | 1979-09-05 | Sanyo Chem Ind Ltd | Preparation of glucoprotein derivative |
| US4356170A (en) | 1981-05-27 | 1982-10-26 | Canadian Patents & Development Ltd. | Immunogenic polysaccharide-protein conjugates |
| US4757006A (en) | 1983-10-28 | 1988-07-12 | Genetics Institute, Inc. | Human factor VIII:C gene and recombinant methods for production |
| US4970300A (en) | 1985-02-01 | 1990-11-13 | New York University | Modified factor VIII |
| US5198349A (en) | 1986-01-03 | 1993-03-30 | Genetics Institute, Inc. | Method for producing factor VIII:C and analogs |
| US5250421A (en) | 1986-01-03 | 1993-10-05 | Genetics Institute, Inc. | Method for producing factor VIII:C-type proteins |
| JPH0387173A (ja) | 1987-09-10 | 1991-04-11 | Teijin Ltd | ヒト活性化天然型ファクター8cの製造方法及びそれに用いる形質転換体 |
| US5153265A (en) | 1988-01-20 | 1992-10-06 | Cetus Corporation | Conjugation of polymer to colony stimulating factor-1 |
| US4966999A (en) | 1988-06-07 | 1990-10-30 | Cytogen Corporation | Radiohalogenated compounds for site specific labeling |
| US5122614A (en) | 1989-04-19 | 1992-06-16 | Enzon, Inc. | Active carbonates of polyalkylene oxides for modification of polypeptides |
| SE465222C5 (sv) | 1989-12-15 | 1998-02-10 | Pharmacia & Upjohn Ab | Ett rekombinant, humant faktor VIII-derivat och förfarande för dess framställning |
| SE466754B (sv) | 1990-09-13 | 1992-03-30 | Berol Nobel Ab | Saett att kovalent binda biopolymerer till hydrofila ytor |
| CA2073511A1 (en) | 1990-11-14 | 1992-05-29 | Matthew R. Callstrom | Conjugates of poly(vinylsaccharide) with proteins for the stabilization of proteins |
| CA2101918A1 (en) | 1991-03-18 | 1992-09-19 | Samuel Zalipsky | Hydrazine containing conjugates of polypeptides and glycopolypeptides with polymers |
| US5846951A (en) | 1991-06-06 | 1998-12-08 | The School Of Pharmacy, University Of London | Pharmaceutical compositions |
| US6037452A (en) | 1992-04-10 | 2000-03-14 | Alpha Therapeutic Corporation | Poly(alkylene oxide)-Factor VIII or Factor IX conjugate |
| WO1994005332A2 (en) | 1992-09-01 | 1994-03-17 | Berlex Laboratories, Inc. | Glycolation of glycosylated macromolecules |
| NZ256921A (en) | 1992-10-02 | 1996-05-28 | Pharmacia Ab | Formulations of coagulation factor viii and a non-ionic surfactant and their preparation |
| NZ250375A (en) | 1992-12-09 | 1995-07-26 | Ortho Pharma Corp | Peg hydrazone and peg oxime linkage forming reagents and protein derivatives |
| US5298643A (en) | 1992-12-22 | 1994-03-29 | Enzon, Inc. | Aryl imidate activated polyalkylene oxides |
| AU6029594A (en) | 1993-01-15 | 1994-08-15 | Enzon, Inc. | Factor viii - polymeric conjugates |
| US5621039A (en) | 1993-06-08 | 1997-04-15 | Hallahan; Terrence W. | Factor IX- polymeric conjugates |
| SE504074C2 (sv) | 1993-07-05 | 1996-11-04 | Pharmacia Ab | Proteinberedning för subkutan, intramuskulär eller intradermal administrering |
| BR9407508A (pt) | 1993-09-17 | 1997-01-07 | Novo Nordisk As | Derivado de insulina composição farmaceutica e processo para o tratamento de diabete em um paciente com necessidade deste tratamento |
| US6869930B1 (en) | 1993-09-17 | 2005-03-22 | Novo Nordisk A/S | Acylated insulin |
| US6011007A (en) | 1993-09-17 | 2000-01-04 | Novo Nordisk A/S | Acylated insulin |
| WO1996041813A2 (en) | 1994-11-09 | 1996-12-27 | Offord Robin E | Functionalized polymers for site-specific attachment |
| WO1996040731A1 (en) | 1995-06-07 | 1996-12-19 | Mount Sinai School Of Medicine Of The City University Of New York | Pegylated modified proteins |
| WO1996040662A2 (en) | 1995-06-07 | 1996-12-19 | Cellpro, Incorporated | Aminooxy-containing linker compounds and their application in conjugates |
| SE9503380D0 (sv) | 1995-09-29 | 1995-09-29 | Pharmacia Ab | Protein derivatives |
| US5866538A (en) | 1996-06-20 | 1999-02-02 | Novo Nordisk A/S | Insulin preparations containing NaCl |
| US6323322B1 (en) | 1997-04-30 | 2001-11-27 | Enzon, Inc. | Single-chain antigen-binding proteins capable of glycosylation, production and uses thereof |
| US6183738B1 (en) | 1997-05-12 | 2001-02-06 | Phoenix Pharamacologics, Inc. | Modified arginine deiminase |
| WO1998055607A2 (en) | 1997-06-04 | 1998-12-10 | Oxford Biomedica (Uk) Limited | Tumor targeted vector |
| WO1999003496A1 (en) | 1997-07-21 | 1999-01-28 | The University Of North Carolina At Chapel Hill | Factor ix antihemophilic factor with increased clotting activity |
| AU2051899A (en) | 1997-12-03 | 1999-06-16 | Roche Diagnostics Gmbh | Method for preparing polypeptides with appropriate glycosilation |
| US5985263A (en) | 1997-12-19 | 1999-11-16 | Enzon, Inc. | Substantially pure histidine-linked protein polymer conjugates |
| US6596398B1 (en) | 1998-08-21 | 2003-07-22 | Atofina Chemicals, Inc. | Solar control coated glass |
| US6552167B1 (en) | 1998-08-28 | 2003-04-22 | Gryphon Therapeutics, Inc. | Polyamide chains of precise length |
| CA2345138C (en) | 1998-10-16 | 2009-12-15 | Biogen, Inc. | Polymer conjugates of interferon beta-1a and their uses |
| DE19852729A1 (de) | 1998-11-16 | 2000-05-18 | Werner Reutter | Rekombinante Glycoproteine, Verfahren zu ihrer Herstellung, sie enthaltende Arzneimittel und ihre Verwendung |
| ATE365052T1 (de) | 1999-02-22 | 2007-07-15 | Univ Connecticut | Neue albuminfreie faktor viii formulierungen |
| CA2376057A1 (en) * | 1999-06-08 | 2000-12-14 | La Jolla Pharmaceutical Company | Valency platform molecules comprising aminooxy groups |
| US6531122B1 (en) | 1999-08-27 | 2003-03-11 | Maxygen Aps | Interferon-β variants and conjugates |
| US7230081B1 (en) | 1999-11-12 | 2007-06-12 | Maxygen Holdings, Ltd. | Interferon gamma conjugates |
| US7074878B1 (en) | 1999-12-10 | 2006-07-11 | Harris J Milton | Hydrolytically degradable polymers and hydrogels made therefrom |
| US6413507B1 (en) | 1999-12-23 | 2002-07-02 | Shearwater Corporation | Hydrolytically degradable carbamate derivatives of poly (ethylene glycol) |
| RU2278123C2 (ru) | 2000-02-11 | 2006-06-20 | Максиджен Холдингз Лтд. | Молекулы, подобные фактору vii или viia |
| JP5090605B2 (ja) | 2000-05-03 | 2012-12-05 | ノボ ノルディスク ヘルス ケア アクチェンゲゼルシャフト | 凝固因子viiの皮下投与 |
| JP4455802B2 (ja) | 2000-05-03 | 2010-04-21 | ノボ ノルディスク ヘルス ケア アクチェンゲゼルシャフト | ヒト第vii凝固因子変異型 |
| JP2003535208A (ja) | 2000-06-08 | 2003-11-25 | ラ ホヤ ファーマシューティカル カンパニー | 高分子量ポリエチレン・オキシドを含む多価プラットホーム分子 |
| US6423826B1 (en) | 2000-06-30 | 2002-07-23 | Regents Of The University Of Minnesota | High molecular weight derivatives of vitamin K-dependent polypeptides |
| US7118737B2 (en) | 2000-09-08 | 2006-10-10 | Amylin Pharmaceuticals, Inc. | Polymer-modified synthetic proteins |
| WO2002022776A2 (en) | 2000-09-13 | 2002-03-21 | Novo Nordisk A/S | Human coagulation factor vii variants |
| DE60137950D1 (de) | 2000-10-02 | 2009-04-23 | Novo Nordisk Healthcare Ag | Verfahren zur herstellung vitamin-k-abhängiger proteine |
| GB0103877D0 (en) * | 2001-02-16 | 2001-04-04 | King S College London | Novel Drug Delivery system |
| WO2002077218A1 (en) | 2001-03-22 | 2002-10-03 | Novo Nordisk Health Care Ag | Coagulation factor vii derivatives |
| US6913915B2 (en) | 2001-08-02 | 2005-07-05 | Phoenix Pharmacologics, Inc. | PEG-modified uricase |
| US7795210B2 (en) | 2001-10-10 | 2010-09-14 | Novo Nordisk A/S | Protein remodeling methods and proteins/peptides produced by the methods |
| US7265084B2 (en) | 2001-10-10 | 2007-09-04 | Neose Technologies, Inc. | Glycopegylation methods and proteins/peptides produced by the methods |
| US7214660B2 (en) | 2001-10-10 | 2007-05-08 | Neose Technologies, Inc. | Erythropoietin: remodeling and glycoconjugation of erythropoietin |
| DK2322229T3 (en) | 2001-10-10 | 2017-03-27 | Novo Nordisk As | Remodeling and Glycoconjugation of Factor IX |
| KR100948532B1 (ko) | 2001-11-07 | 2010-03-23 | 넥타르 테라퓨틱스 | 분지형 중합체 및 그의 공액체 |
| ATE405669T1 (de) | 2001-11-28 | 2008-09-15 | Neose Technologies Inc | Remodellierung von glycoproteinen unter verwendung von endoglycanasen |
| JP2005510229A (ja) | 2001-11-28 | 2005-04-21 | ネオーズ テクノロジーズ, インコーポレイテッド | アミダーゼを用いる糖タンパク質のリモデリング |
| DK1517710T3 (da) | 2002-06-21 | 2011-07-18 | Novo Nordisk Healthcare Ag | Pegylerede faktor VII-glycoformer |
| US7122189B2 (en) | 2002-08-13 | 2006-10-17 | Enzon, Inc. | Releasable polymeric conjugates based on aliphatic biodegradable linkers |
| US7087229B2 (en) | 2003-05-30 | 2006-08-08 | Enzon Pharmaceuticals, Inc. | Releasable polymeric conjugates based on aliphatic biodegradable linkers |
| EP1681303B1 (en) | 2002-09-11 | 2013-09-04 | Fresenius Kabi Deutschland GmbH | HASylated polypeptides, especially HASylated erythropoietin |
| CA2496317C (en) | 2002-09-11 | 2014-02-18 | Fresenius Kabi Deutschland Gmbh | Method of producing hydroxyalkyl starch derivatives |
| DE02020425T1 (de) | 2002-09-11 | 2004-07-15 | Fresenius Kabi Deutschland Gmbh | Hasylierte Polypeptide, besonders hasyliertes Erythropoietin |
| US20040062748A1 (en) | 2002-09-30 | 2004-04-01 | Mountain View Pharmaceuticals, Inc. | Polymer conjugates with decreased antigenicity, methods of preparation and uses thereof |
| JP4490369B2 (ja) | 2002-12-31 | 2010-06-23 | ネクター セラピューティクス アラバマ,コーポレイション | マレアミド酸ポリマー誘導体及びこれらの生物学的複合体 |
| MXPA05007151A (es) | 2002-12-31 | 2005-09-21 | Nektar Therapeutics Al Corp | Polimeros terminados en maleimida hidroliticamente estables. |
| DK1596887T3 (da) | 2003-02-26 | 2022-06-20 | Nektar Therapeutics | Polymer-Faktor VIII-konjugat |
| US7623892B2 (en) | 2003-04-02 | 2009-11-24 | Palm, Inc. | System and method for enabling a person to switch use of computing devices |
| ES2512499T3 (es) | 2003-04-08 | 2014-10-24 | Yeda Research And Development Co., Ltd. | Fármacos pegilados reversibles |
| US20070026485A1 (en) | 2003-04-09 | 2007-02-01 | Neose Technologies, Inc. | Glycopegylation methods and proteins/peptides produced by the methods |
| TWI356065B (en) * | 2003-08-08 | 2012-01-11 | Fresenius Kabi De Gmbh | Method of producing hydroxyalkyl starch derivative |
| US20080206182A1 (en) | 2003-08-08 | 2008-08-28 | Fresenius Kabi Deutschland Gmbh | Conjugates of a Polymer and a Protein Linked by an Oxime Group |
| WO2005014655A2 (en) | 2003-08-08 | 2005-02-17 | Fresenius Kabi Deutschland Gmbh | Conjugates of hydroxyalkyl starch and a protein |
| WO2005014049A2 (en) | 2003-08-08 | 2005-02-17 | Novo Nordisk A/S | Synthesis and application of new structural well defined branched polymers as conjugating agents for peptides |
| EP1654290B1 (en) | 2003-08-12 | 2019-03-13 | Lipoxen Technologies Limited | Sialic acid derivatives for protein derivatisation and conjugation |
| US8633157B2 (en) | 2003-11-24 | 2014-01-21 | Novo Nordisk A/S | Glycopegylated erythropoietin |
| US20060040856A1 (en) | 2003-12-03 | 2006-02-23 | Neose Technologies, Inc. | Glycopegylated factor IX |
| NZ547554A (en) | 2003-12-03 | 2009-09-25 | Biogenerix Ag | Glycopegylated granulocyte colony stimulating factor |
| BRPI0417341A (pt) | 2003-12-03 | 2007-04-17 | Neose Technologies Inc | fator ix glicopeguilado |
| ES2560657T3 (es) | 2004-01-08 | 2016-02-22 | Ratiopharm Gmbh | Glicosilación con unión en O de péptidos G-CSF |
| AR048918A1 (es) | 2004-03-11 | 2006-06-14 | Fresenius Kabi De Gmbh | Conjugados de almidon de hidroxietilo y eritropoyetina |
| WO2006020372A2 (en) | 2004-07-23 | 2006-02-23 | Neose Technologies, Inc. | Enzymatic modification of glycopeptides |
| JP2008507990A (ja) | 2004-08-02 | 2008-03-21 | ノボ ノルディスク ヘルス ケア アクチェンゲゼルシャフト | Fviiの抱合体 |
| ES2593318T3 (es) | 2004-08-12 | 2016-12-07 | Lipoxen Technologies Limited | Derivados de ácido siálico |
| US8268967B2 (en) | 2004-09-10 | 2012-09-18 | Novo Nordisk A/S | Glycopegylated interferon α |
| NZ555032A (en) | 2004-11-12 | 2010-02-26 | Bayer Healthcare Llc | Site-directed modification of FVIII |
| JP5425398B2 (ja) | 2004-12-22 | 2014-02-26 | アンブレツクス・インコーポレイテツド | 非天然アミノ酸及びポリペプチドを含む組成物、非天然アミノ酸及びポリペプチドに関連する方法並び非天然アミノ酸及びポリペプチドその使用 |
| DK1835938T3 (da) | 2004-12-27 | 2013-11-04 | Baxter Int | Polymer-von Willebrand-faktor-konjugater |
| WO2006074279A1 (en) | 2005-01-06 | 2006-07-13 | Neose Technologies, Inc. | Glycoconjugation using saccharyl fragments |
| CN101151280A (zh) * | 2005-02-08 | 2008-03-26 | 昆士兰医学研究学院委员会 | 免疫原性分子 |
| US20080255026A1 (en) | 2005-05-25 | 2008-10-16 | Glycopegylated Factor 1X | Glycopegylated Factor Ix |
| CN101242858B (zh) | 2005-06-16 | 2012-12-19 | 尼克塔治疗公司 | 具有可降解键的轭合物以及用于制备这种轭合物的聚合物试剂 |
| EP1893632B1 (en) | 2005-06-17 | 2015-08-12 | Novo Nordisk Health Care AG | Selective reduction and derivatization of engineered factor vii proteins comprising at least one non-native cysteine |
| EP1919498A2 (en) | 2005-08-26 | 2008-05-14 | Maxygen Holdings Ltd. | Liquid factor vii composition |
| AU2006286486A1 (en) * | 2005-08-30 | 2007-03-08 | Novo Nordisk Health Care Ag | Liquid formulations of pegylated growth hormone |
| EP1962907A2 (en) | 2005-12-21 | 2008-09-03 | Wyeth a Corporation of the State of Delaware | Protein formulations with reduced viscosity and uses thereof |
| JP2009523815A (ja) * | 2006-01-19 | 2009-06-25 | アンブルックス,インコーポレイテッド | 免疫原性が調節された非天然アミノ酸ポリペプチド |
| US7645860B2 (en) | 2006-03-31 | 2010-01-12 | Baxter Healthcare S.A. | Factor VIII polymer conjugates |
| KR20080108147A (ko) | 2006-03-31 | 2008-12-11 | 백스터 인터내셔널 인코포레이티드 | 페질화된 인자 viii |
| US20090285780A1 (en) | 2006-05-24 | 2009-11-19 | Chyi Lee | Peg linker compounds and biologically active conjugates thereof |
| US7939632B2 (en) | 2006-06-14 | 2011-05-10 | Csl Behring Gmbh | Proteolytically cleavable fusion proteins with high molar specific activity |
| SI2049692T1 (sl) | 2006-07-13 | 2016-04-29 | Serum Institute Of India Ltd | Postopek za pripravo polisialične kisline visoke čistosti |
| EP2054521A4 (en) | 2006-10-03 | 2012-12-19 | Novo Nordisk As | PROCESS FOR CLEANING POLYPEPTIDE CONJUGATES |
| US20100029557A1 (en) * | 2006-11-17 | 2010-02-04 | Jens Sigh | Alpha-lactalbumin composition |
| BRPI0720282B8 (pt) | 2006-12-15 | 2021-05-25 | Baxalta GmbH | construção proteica, composição farmacêutica, e, kit |
| WO2008083346A1 (en) | 2006-12-28 | 2008-07-10 | Ambrx, Inc. | Phenazine and quinoxaline substituted amino acids and polypeptides |
| WO2008081024A1 (en) | 2007-01-03 | 2008-07-10 | Novo Nordisk Health Care Ag | Subcutaneous administration of coagulation factor viia-related popypeptdes |
| WO2008119815A1 (en) | 2007-04-02 | 2008-10-09 | Novo Nordisk A/S | Subcutaneous administration of coagulation factor ix |
| BRPI0813772A2 (pt) | 2007-06-26 | 2014-12-30 | Baxter Int | Composto, processo para a preparação de um composto, e, conjugado |
| US9333247B2 (en) | 2007-07-03 | 2016-05-10 | Children's Hospital & Research Center At Oakland | Oligosialic acid derivatives, methods of manufacture, and immunological uses |
| BRPI0818288A2 (pt) | 2007-10-09 | 2015-04-14 | Polytherics Ltd | Proteínas conjugadas e peptídeos. |
| EP2070951A1 (en) | 2007-12-14 | 2009-06-17 | Fresenius Kabi Deutschland GmbH | Method for producing a hydroxyalkyl starch derivatives with two linkers |
| EP2242505A4 (en) | 2008-01-08 | 2012-03-07 | Biogenerix Ag | GLYCOCONJUGATION OF POLYPEPTIDES USING OLIGOSACCHARYLTRANSFERASES |
| ES2476690T3 (es) | 2008-02-27 | 2014-07-15 | Novo Nordisk A/S | Moléculas conjugadas del Factor VIII |
| WO2009130602A2 (en) | 2008-04-24 | 2009-10-29 | Celtic Pharma Peg Ltd. | Factor ix conjugates with extended half-lives |
| WO2009141418A1 (en) | 2008-05-23 | 2009-11-26 | Novo Nordisk A/S | Formulations of peg-functionalised serine proteases with high concentrations of an aromatic preservative |
| CN102083459A (zh) | 2008-05-23 | 2011-06-01 | 诺沃-诺迪斯克保健股份有限公司 | 包括含有peg化的gla-结构域的蛋白质的低粘度组合物 |
| EP2297330A4 (en) | 2008-06-04 | 2012-03-14 | Bayer Healthcare Llc | FVII MUTINES FOR THE TREATMENT OF MORBUS WILLEBRAND |
| KR101763559B1 (ko) | 2008-07-21 | 2017-08-14 | 폴리테릭스 리미티드 | 생물학적 분자의 컨쥬게이팅을 위한 신규한 시약 및 방법 |
| WO2010062768A1 (en) | 2008-11-03 | 2010-06-03 | Bayer Healthcare Llc | Method for the treatment of hemophilia |
| US20120121613A1 (en) | 2009-01-19 | 2012-05-17 | Bayer Healthcare Llc | Protein conjugate having an endopeptidase- cleavable bioprotective moiety |
| CN102333788A (zh) | 2009-02-19 | 2012-01-25 | 诺沃—诺迪斯克有限公司 | 因子viii的修饰 |
| US9005598B2 (en) | 2009-03-04 | 2015-04-14 | Polytherics Limited | Conjugated proteins and peptides |
| US20100330033A1 (en) | 2009-04-16 | 2010-12-30 | Nian Wu | Protein-carrier conjugates |
| US20120134977A1 (en) | 2009-06-01 | 2012-05-31 | Yeda Research And Development Co. Ltd. | Prodrugs containing albumin binding probe |
| KR20120060209A (ko) | 2009-07-31 | 2012-06-11 | 바이엘 헬스케어 엘엘씨 | 변형된 인자 ix 폴리펩티드 및 그의 용도 |
| DE102009028526A1 (de) | 2009-08-13 | 2011-02-24 | Leibniz-Institut Für Polymerforschung Dresden E.V. | Verfahren zur Modifikation und Funktionalisierung von Sacchariden |
| WO2011037896A2 (en) | 2009-09-25 | 2011-03-31 | Vybion, Inc. | Polypeptide modification |
| CN102639553A (zh) | 2009-11-24 | 2012-08-15 | 诺沃—诺迪斯克保健股份有限公司 | 纯化聚乙二醇化蛋白质的方法 |
| CN102770449B (zh) | 2010-02-16 | 2016-02-24 | 诺沃—诺迪斯克有限公司 | 具有降低的vwf结合的因子viii分子 |
| GB201007356D0 (en) | 2010-04-30 | 2010-06-16 | Leverton Licence Holdings Ltd | Conjugated factor VIIa |
| GB201007357D0 (en) | 2010-04-30 | 2010-06-16 | Leverton Licence Holdings Ltd | Conjugated factor VIII |
| DK2598172T3 (da) | 2010-07-30 | 2019-07-01 | Baxalta GmbH | Nukleofile katalysatorer til oximforbindelse |
| EP2640483A1 (en) | 2010-11-15 | 2013-09-25 | Biogen Idec Inc. | Enrichment and concentration of select product isoforms by overloaded bind and elute chromatography |
| JP2014522838A (ja) | 2011-07-08 | 2014-09-08 | バイオジェン アイデック ヘモフィリア インコーポレイテッド | 第viii因子キメラおよびハイブリッドポリペプチドならびにその使用法 |
-
2011
- 2011-12-16 EP EP11806103.5A patent/EP2654794B8/en active Active
- 2011-12-16 PL PL11806103T patent/PL2654794T3/pl unknown
- 2011-12-16 ES ES11806103T patent/ES2800983T3/es active Active
- 2011-12-16 HU HUE11806103A patent/HUE049352T2/hu unknown
- 2011-12-16 KR KR1020137019066A patent/KR102025442B1/ko active Active
- 2011-12-16 SG SG2013048194A patent/SG191298A1/en unknown
- 2011-12-16 DK DK11806103.5T patent/DK2654794T3/da active
- 2011-12-16 CN CN201180062472.4A patent/CN103269723B/zh active Active
- 2011-12-16 AU AU2011349574A patent/AU2011349574B9/en active Active
- 2011-12-16 CA CA2822591A patent/CA2822591C/en active Active
- 2011-12-16 BR BR112013015898-0A patent/BR112013015898A2/pt not_active Application Discontinuation
- 2011-12-16 US US13/329,002 patent/US8945897B2/en active Active
- 2011-12-16 JP JP2013546263A patent/JP6138052B2/ja active Active
- 2011-12-16 WO PCT/US2011/065591 patent/WO2012087838A1/en not_active Ceased
- 2011-12-16 NZ NZ612320A patent/NZ612320A/en unknown
- 2011-12-16 EP EP19211476.7A patent/EP3673921A1/en not_active Withdrawn
- 2011-12-16 PT PT118061035T patent/PT2654794T/pt unknown
- 2011-12-16 EA EA201390940A patent/EA032056B1/ru unknown
- 2011-12-16 MX MX2013007369A patent/MX345608B/es active IP Right Grant
- 2011-12-21 TW TW100147675A patent/TWI546279B/zh active
- 2011-12-22 AR ARP110104911A patent/AR084576A1/es active IP Right Grant
-
2017
- 2017-06-14 AU AU2017204019A patent/AU2017204019A1/en not_active Abandoned
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20030069170A1 (en) * | 2001-09-07 | 2003-04-10 | Richard Soltero | Pharmaceutical compositions of drug-oligomer conjugates and methods of treating diseases therewith |
| WO2005117984A2 (en) * | 2004-06-01 | 2005-12-15 | Celltech R & D Limited | Albumin-binding conjugates comprising a fatty acid and peg |
| WO2008025856A2 (en) * | 2006-09-01 | 2008-03-06 | Novo Nordisk Health Care Ag | Modified glycoproteins |
| WO2011101277A1 (en) * | 2010-02-16 | 2011-08-25 | Novo Nordisk A/S | Conjugated proteins |
Non-Patent Citations (1)
| Title |
|---|
| EKRAMI H M, ET AL: "Water-soluble fatty acid derivatives as acylating agents for reversible lipidization of polypeptides", FEBS LETTERS., ELSEVIER, AMSTERDAM., NL, vol. 371, 11 September 1995 (1995-09-11), NL, pages 283 - 286, XP002244694, ISSN: 0014-5793, DOI: 10.1016/0014-5793(95)00910-2 * |
Also Published As
| Publication number | Publication date |
|---|---|
| EP2654794B1 (en) | 2020-03-04 |
| CN103269723A (zh) | 2013-08-28 |
| KR20130129254A (ko) | 2013-11-27 |
| AU2011349574B2 (en) | 2017-06-01 |
| EP2654794B8 (en) | 2020-04-22 |
| AU2011349574B9 (en) | 2017-06-15 |
| WO2012087838A1 (en) | 2012-06-28 |
| DK2654794T3 (da) | 2020-06-08 |
| AU2017204019A1 (en) | 2017-07-06 |
| CN103269723B (zh) | 2017-04-05 |
| EA201390940A1 (ru) | 2014-04-30 |
| ES2800983T3 (es) | 2021-01-07 |
| KR102025442B1 (ko) | 2019-09-25 |
| JP2014501262A (ja) | 2014-01-20 |
| BR112013015898A2 (pt) | 2018-06-26 |
| SG191298A1 (en) | 2013-07-31 |
| CA2822591C (en) | 2020-12-29 |
| AR084576A1 (es) | 2013-05-29 |
| US8945897B2 (en) | 2015-02-03 |
| TWI546279B (zh) | 2016-08-21 |
| MX345608B (es) | 2017-02-07 |
| EP3673921A1 (en) | 2020-07-01 |
| PT2654794T (pt) | 2020-06-11 |
| AU2011349574A1 (en) | 2013-07-11 |
| HUE049352T2 (hu) | 2020-09-28 |
| US20120190096A1 (en) | 2012-07-26 |
| EP2654794A1 (en) | 2013-10-30 |
| CA2822591A1 (en) | 2012-06-28 |
| PL2654794T3 (pl) | 2020-07-27 |
| TW201305090A (zh) | 2013-02-01 |
| MX2013007369A (es) | 2013-09-26 |
| JP6138052B2 (ja) | 2017-05-31 |
| NZ612320A (en) | 2015-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA032056B1 (ru) | Конъюгат терапевтического белка и производного жирной кислоты, способы получения конъюгата терапевтического белка и производного жирной кислоты (варианты) | |
| EA025738B1 (ru) | Способ конъюгирования водорастворимого полимера с терапевтическим белком (варианты) и полученный модифицированный белок (варианты) | |
| US20200017543A1 (en) | Nucleophilic catalysts for oxime linkage | |
| US11564992B2 (en) | Nucleophilic catalysts for oxime linkage | |
| EA028186B1 (ru) | Способ конъюгации водорастворимого полимера с терапевтическим белком (варианты) и полученный модифицированный белок | |
| US20130310546A1 (en) | Nucleophilic catalysts for oxime linkage and use of nmr analyses of the same | |
| AU2017276255B2 (en) | Nucleophilic Catalysts for Oxime Linkage | |
| US12516083B2 (en) | Nucleophilic catalysts for oxime linkage | |
| HK40076576A (en) | Methods for preparing therapeutic protein-polymer conjugates | |
| HK40077427A (en) | Nucleophilic catalysts for oxime linkage | |
| EA044273B1 (ru) | Способ конъюгирования водорастворимого полимера с терапевтическим белком | |
| HK1191220B (en) | Materials and methods for conjugating a water soluble fatty acid derivative to a protein | |
| HK1191220A (en) | Materials and methods for conjugating a water soluble fatty acid derivative to a protein | |
| HK40009331A (en) | Nucleophilic catalysts for oxime linkage | |
| HK1209024B (en) | Methods for preparing therapeutic protein-polymer conjugates | |
| HK1186115B (en) | Nucleophilic catalysts for oxime linkage | |
| HK1186115A (en) | Nucleophilic catalysts for oxime linkage |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC4A | Registration of transfer of a eurasian patent by assignment |