DE757355C - Verfahren zur Herstellung von Polymerisationsprodukten - Google Patents
Verfahren zur Herstellung von PolymerisationsproduktenInfo
- Publication number
- DE757355C DE757355C DEI65359D DEI0065359D DE757355C DE 757355 C DE757355 C DE 757355C DE I65359 D DEI65359 D DE I65359D DE I0065359 D DEI0065359 D DE I0065359D DE 757355 C DE757355 C DE 757355C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- vinyl
- preparation
- polymerization products
- heated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000006116 polymerization reaction Methods 0.000 title claims description 7
- 238000000034 method Methods 0.000 title claims 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JWYVGKFDLWWQJX-UHFFFAOYSA-N 1-ethenylazepan-2-one Chemical compound C=CN1CCCCCC1=O JWYVGKFDLWWQJX-UHFFFAOYSA-N 0.000 description 1
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- KBTJYNAFUYTSNN-UHFFFAOYSA-N [Na].OO Chemical compound [Na].OO KBTJYNAFUYTSNN-UHFFFAOYSA-N 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- -1 vinyl methyl ketone Chemical class 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL217723D NL217723A (Direct) | 1939-08-02 | ||
| DEI65359D DE757355C (de) | 1939-08-02 | 1939-08-02 | Verfahren zur Herstellung von Polymerisationsprodukten |
| US352114A US2335454A (en) | 1939-08-02 | 1940-08-10 | Polymerization of n-vinyl lactams |
| FR879293D FR879293A (fr) | 1939-08-02 | 1942-02-13 | Procédé pour préparer des produits de polymérisation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEI65359D DE757355C (de) | 1939-08-02 | 1939-08-02 | Verfahren zur Herstellung von Polymerisationsprodukten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE757355C true DE757355C (de) | 1953-11-02 |
Family
ID=40139117
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI65359D Expired DE757355C (de) | 1939-08-02 | 1939-08-02 | Verfahren zur Herstellung von Polymerisationsprodukten |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US2335454A (Direct) |
| DE (1) | DE757355C (Direct) |
| FR (1) | FR879293A (Direct) |
| NL (1) | NL217723A (Direct) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1008914B (de) * | 1954-11-15 | 1957-05-23 | Gen Aniline & Film Corp | Verfahren zur Herstellung von wasserunloeslichen polymeren Erzeugnissen |
| DE1046316B (de) * | 1954-04-09 | 1958-12-11 | Kreidl Kommanditgesellschaft | Verfahren zur Herstellung von Mischpolymerisaten mit geordneter Struktur |
| DE1081659B (de) * | 1957-07-20 | 1960-05-12 | Basf Ag | Thermoplastische Massen |
| DE973799C (de) * | 1954-08-22 | 1960-06-09 | Basf Ag | Verfahren zum Weissaetzen von Faerbungen mit Kuepenfarbstoffen |
| DE1118971B (de) * | 1958-05-22 | 1961-12-07 | Rohm & Haas | Verfahren zur Herstellung oelloeslicher, dispergierender Mischpolymerer |
| DE1151117B (de) * | 1954-08-19 | 1963-07-04 | Basf Ag | Verfahren zur Herstellung von expandierbaren Perlpolymerisaten in waessriger Suspension |
| DE1154942B (de) * | 1960-12-09 | 1963-09-26 | Gen Aniline & Film Corp | Verfahren zur Herstellung polymerer N-Vinyllactame |
| DE1156556B (de) * | 1954-06-04 | 1963-10-31 | Hoechst Ag | Verfahren zur Herstellung von Mischpolyamiden |
| DE1157397B (de) * | 1961-03-10 | 1963-11-14 | Dow Chemical Co | Verfahren zur Polymerisation von N-Vinyllactamen |
| DE1163026B (de) * | 1957-10-28 | 1964-02-13 | Dow Chemical Co | Verfahren zur Herstellung von N-Vinyllactampolymerisaten |
| DE1236784B (de) * | 1957-08-23 | 1967-03-16 | Gen Aniline & Film Corp | Verfahren zur Herstellung von N-Vinylpyrrolidone enthaltenden Mischpolymerisaten |
| DE1240812B (de) * | 1962-08-21 | 1967-05-24 | Basf Ag | Verwendung von Polymerisaten aus N-Vinylcaprolactam und Vinylmethylaether zum Kleben von Textilgut beim Filmdruck |
| DE1254865B (de) * | 1964-08-14 | 1967-11-23 | Hoechst Ag | Verfahren zur Herstellung von Homo- und Mischpolymerisaten von N-Vinyllactamen |
| DE2265354C2 (de) * | 1971-09-13 | 1982-12-02 | Air Products and Chemicals, Inc., 18105 Allentown, Pa. | Verfahren zur Herstellung eines Zellstabilisators |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2497705A (en) * | 1946-10-16 | 1950-02-14 | Du Pont | Copolymerization product of n-vinyl lactams and polymerizable esters, and process for making same |
| US2541152A (en) * | 1948-12-07 | 1951-02-13 | Du Pont | N-vinyl alkylene ureas and polymers thereof |
| US2658045A (en) * | 1951-03-05 | 1953-11-03 | Gen Aniline & Film Corp | Polyvinyl pyrrolidone gels and process of producing the same |
| US2634259A (en) * | 1951-07-31 | 1953-04-07 | Arnold Hoffman & Co Inc | Polymerization process for n-vinyl pyrrolidone |
| US2676949A (en) * | 1952-02-08 | 1954-04-27 | Monsanto Chemicals | Copolymers of maleic anhydride and nu-vinyl lactams |
| US2667473A (en) * | 1952-02-08 | 1954-01-26 | Monsanto Chemicals | Vinyl acetate-n-vinyl-pyrrolidone copolymers |
| US2798788A (en) * | 1952-06-21 | 1957-07-09 | Celanese Corp | Vat dyeing of cellulose ethers and esters |
| US2776947A (en) * | 1952-10-31 | 1957-01-08 | Celanese Corp | Polymer dispersions |
| US2768148A (en) * | 1952-11-01 | 1956-10-23 | Celanese Corp | Solution polymerization of acrylonitrile |
| GB757770A (en) * | 1953-08-22 | 1956-09-26 | Basf Ag | Improvements in the production of water-soluble polymers |
| US2927913A (en) * | 1954-09-30 | 1960-03-08 | Gen Aniline & Film Corp | Production of uniform gels of water-insoluble polymeric n-vinyl-lactams |
| US2856338A (en) * | 1954-09-30 | 1958-10-14 | Gen Aniline & Film Corp | Polymerization of n-vinyllactams |
| US2762735A (en) * | 1955-06-16 | 1956-09-11 | Gen Aniline & Film Corp | Laminated fibrous glass material |
| US2958614A (en) * | 1955-06-16 | 1960-11-01 | Gen Aniline & Film Corp | Resin coatings for glass materials |
| US3142664A (en) * | 1955-08-19 | 1964-07-28 | Rohm & Haas | Oil soluble copolymer of a nu-vinyl pyrrolidinone and an alkyl ester of an unsaturated monocarboxylic acid |
| US3008867A (en) * | 1957-02-18 | 1961-11-14 | Gen Aniline & Film Corp | Inorganic papers and methods of making same |
| US3005745A (en) * | 1957-03-04 | 1961-10-24 | Gen Aniline & Film Corp | Inorganic papers and methods of making same |
| US2980654A (en) * | 1957-08-23 | 1961-04-18 | Gen Aniline & Film Corp | Copolymers of n-vinylpyrrolidones with dialkyl maleates or fumarates |
| US3044873A (en) * | 1958-12-17 | 1962-07-17 | Polaroid Corp | Photographic products and processes |
| US3036086A (en) * | 1959-05-05 | 1962-05-22 | Adicoff Arnold | Method for the polymerization of vinyltetrazoles monomers |
| US3036950A (en) * | 1959-06-22 | 1962-05-29 | Burgess Cellulose Company | Process for incorporating resins into paper |
| US3081219A (en) * | 1960-02-10 | 1963-03-12 | Rohm & Haas | Prevention of deposition of pitch in papermaking |
| DE1151940B (de) * | 1961-07-13 | 1963-07-25 | Hoechst Ag | Verfahren zur Polymerisation von offenkettigen N-Vinylamiden |
| DE1251025B (de) * | 1963-05-09 | 1967-09-28 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen | Verfahren zur Herstellung von Copolymerisaten des Athvlens mit N-Vmyllactamen |
| DE1230036B (de) * | 1963-11-08 | 1966-12-08 | Hoechst Ag | Verwendung von oelloeslichen Copolymerisaten als Emulgier- und Dispergiermittel |
| US3475386A (en) * | 1964-04-16 | 1969-10-28 | Merck & Co Inc | Polymers of pyroglutamic acid derivatives |
| US3472243A (en) * | 1965-09-27 | 1969-10-14 | Clairol Inc | Treating damaged living human hair with water soluble polymerizable vinyl monomers |
| US3472604A (en) * | 1965-09-27 | 1969-10-14 | Clairol Inc | Retarding damage to hair on the head with polymerizable vinyl monomers in bleaching or dyeing processes |
| US3776310A (en) * | 1971-05-06 | 1973-12-04 | Marathon Oil Co | Polyalkeneoxides and polyvinyl-pyrrolidones mobility control agent and process |
| DE2255263C3 (de) * | 1972-11-11 | 1975-06-05 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von unlöslichen, vernetzten, nur wenig quellbaren Polymerisaten des N-Vinylpyrrolidon-(2) |
| US3948960A (en) * | 1973-05-03 | 1976-04-06 | Burke Oliver W Jun | Processes for preparing polymers |
| DE2514127C3 (de) * | 1975-03-29 | 1981-05-14 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Polymerisaten des N-vinylpyrrolidon-2 |
| US4190718A (en) * | 1975-05-27 | 1980-02-26 | Gaf Corporation | Process for increasing molecular weight of vinylpyrrolidone polymer |
| DE19727476A1 (de) | 1997-06-27 | 1999-01-07 | Basf Ag | Verfahren zur Herstellung von niedermolekularen Homopolymerisaten des N-Vinylpyrrolidons |
| US6132844A (en) * | 1997-12-11 | 2000-10-17 | 3M Innovative Properties Company | Slip resistant articles |
| CN101585893B (zh) * | 2009-06-26 | 2012-02-22 | 博爱新开源制药股份有限公司 | 超低分子量聚乙烯基吡咯烷酮的制备方法 |
| US9260546B2 (en) | 2012-08-08 | 2016-02-16 | Basf Se | Producing aqueous solutions of vinyllactam polymers and powders thereof |
| EP2882783B1 (de) | 2012-08-08 | 2020-01-01 | Basf Se | Verfahren zur herstellung wässriger lösungen von vinyllactam-polymeren und deren pulver |
| WO2023099232A1 (en) | 2021-11-30 | 2023-06-08 | Basf Se | Preparation of n-vinylpyrrolidone polymers, containing less than 0.5 wt% of 2-pyrrolidone |
-
0
- NL NL217723D patent/NL217723A/xx unknown
-
1939
- 1939-08-02 DE DEI65359D patent/DE757355C/de not_active Expired
-
1940
- 1940-08-10 US US352114A patent/US2335454A/en not_active Expired - Lifetime
-
1942
- 1942-02-13 FR FR879293D patent/FR879293A/fr not_active Expired
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1046316B (de) * | 1954-04-09 | 1958-12-11 | Kreidl Kommanditgesellschaft | Verfahren zur Herstellung von Mischpolymerisaten mit geordneter Struktur |
| DE1156556B (de) * | 1954-06-04 | 1963-10-31 | Hoechst Ag | Verfahren zur Herstellung von Mischpolyamiden |
| DE1151117B (de) * | 1954-08-19 | 1963-07-04 | Basf Ag | Verfahren zur Herstellung von expandierbaren Perlpolymerisaten in waessriger Suspension |
| DE973799C (de) * | 1954-08-22 | 1960-06-09 | Basf Ag | Verfahren zum Weissaetzen von Faerbungen mit Kuepenfarbstoffen |
| DE1008914B (de) * | 1954-11-15 | 1957-05-23 | Gen Aniline & Film Corp | Verfahren zur Herstellung von wasserunloeslichen polymeren Erzeugnissen |
| DE1081659B (de) * | 1957-07-20 | 1960-05-12 | Basf Ag | Thermoplastische Massen |
| DE1236784B (de) * | 1957-08-23 | 1967-03-16 | Gen Aniline & Film Corp | Verfahren zur Herstellung von N-Vinylpyrrolidone enthaltenden Mischpolymerisaten |
| DE1163026B (de) * | 1957-10-28 | 1964-02-13 | Dow Chemical Co | Verfahren zur Herstellung von N-Vinyllactampolymerisaten |
| DE1118971B (de) * | 1958-05-22 | 1961-12-07 | Rohm & Haas | Verfahren zur Herstellung oelloeslicher, dispergierender Mischpolymerer |
| DE1154942B (de) * | 1960-12-09 | 1963-09-26 | Gen Aniline & Film Corp | Verfahren zur Herstellung polymerer N-Vinyllactame |
| DE1157397B (de) * | 1961-03-10 | 1963-11-14 | Dow Chemical Co | Verfahren zur Polymerisation von N-Vinyllactamen |
| DE1240812B (de) * | 1962-08-21 | 1967-05-24 | Basf Ag | Verwendung von Polymerisaten aus N-Vinylcaprolactam und Vinylmethylaether zum Kleben von Textilgut beim Filmdruck |
| DE1254865B (de) * | 1964-08-14 | 1967-11-23 | Hoechst Ag | Verfahren zur Herstellung von Homo- und Mischpolymerisaten von N-Vinyllactamen |
| DE2265354C2 (de) * | 1971-09-13 | 1982-12-02 | Air Products and Chemicals, Inc., 18105 Allentown, Pa. | Verfahren zur Herstellung eines Zellstabilisators |
Also Published As
| Publication number | Publication date |
|---|---|
| US2335454A (en) | 1943-11-30 |
| NL217723A (Direct) | |
| FR879293A (fr) | 1943-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE757355C (de) | Verfahren zur Herstellung von Polymerisationsprodukten | |
| US2265450A (en) | Polymeric n-vinyl lactams and process of producing same | |
| DE2357615A1 (de) | Neue polymere | |
| DE1286023B (de) | Verfahren zur Herstellung von Styrol-Maleinsaeureanhydrid-Telomerisaten | |
| DE1520549A1 (de) | Verfahren zur Herstellung von Pfropfpolymerisaten | |
| DE961309C (de) | Verfahren zur Herstellung einheitlicher, transparenter Mischpolymerisate aus Styrol und Acrylnitril | |
| DE1104182B (de) | Polymerisationskatalysator fuer die Block- und Loesungspolymerisation | |
| DE947024C (de) | Verfahren zur Herstellung von Mischpolymerisaten auf Grundlage von Vinylidencyanid | |
| DE861156C (de) | Verfahren zur Herstellung von Polymerisaten oder Mischpolymerisaten ungesaettigter Verbindungen | |
| DE818802C (de) | Verfahren zur Herstellung von polymeren Diestern der Fumarsaeure | |
| DE1745216C2 (de) | Wasser-in-Öl-Emulsionen für kosmetische und pharmazeutische Zwecke | |
| EP0190104A2 (de) | Herstellung von hydrolysiertem Polymaleinsäureanhydrid | |
| DE655570C (de) | Verfahren zur Herstellung von Umwandlungsprodukten der Acrylsaeure oder ihrer Derivate | |
| DE953660C (de) | Verfahren zur Herstellung von Mischpolymerisaten auf Grundlage von Vinylidencyanid | |
| DE1037129B (de) | Verfahren zur Herstellung von wasserloeslichen Mischpolymerisaten | |
| DE855161C (de) | Verfahren zur Herstellung von Mischpolymerisaten aus Acrylsaeurenitril und Vinylpyridinen | |
| DE932699C (de) | Verfahren zur Herstellung von Polymerisaten | |
| DE656134C (de) | Verfahren zum Polymerisieren von Acrylsaeureestern und deren Homologen zu festen Polymerisaten | |
| DE676627C (de) | Verfahren zur Herstellung von Polymerisaten aus monomeren Vinylhalogeniden | |
| DE854850C (de) | Verfahren zum Polymerisieren von AEthylen unter Druck | |
| DE591845C (de) | Verfahren zur Herstellung von Polymerisationsprodukten aus Vinylaethern | |
| DE1266502B (de) | Verfahren zur Herstellung hochmolekularer Polymerisate von Vinylalkylaethern | |
| DE679944C (de) | Verfahren zur Herstellung von polymeren Verbindungen | |
| DE1595322C (de) | Verfahren zur Herstellung von Misch polymerisaten aus Vinylchlorid und Vinyl athern | |
| DE671750C (de) | Verfahren zur Herstellung von Kunstharzen |