DE1929928C3 - Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere - Google Patents
Gegen Photo- und Thermozersetzung stabilisierte synthetische PolymereInfo
- Publication number
- DE1929928C3 DE1929928C3 DE1929928A DE1929928A DE1929928C3 DE 1929928 C3 DE1929928 C3 DE 1929928C3 DE 1929928 A DE1929928 A DE 1929928A DE 1929928 A DE1929928 A DE 1929928A DE 1929928 C3 DE1929928 C3 DE 1929928C3
- Authority
- DE
- Germany
- Prior art keywords
- stabilizer
- radical
- acid
- synthetic polymers
- colorless colorless
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001059 synthetic polymer Polymers 0.000 title claims description 21
- 238000006303 photolysis reaction Methods 0.000 title claims description 6
- 238000005979 thermal decomposition reaction Methods 0.000 title claims description 6
- 150000003053 piperidines Chemical class 0.000 claims description 15
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 239000003381 stabilizer Substances 0.000 description 58
- -1 isonicotinoyl Chemical group 0.000 description 33
- 125000004432 carbon atom Chemical group C* 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 230000014759 maintenance of location Effects 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 15
- 238000012360 testing method Methods 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 11
- 239000004327 boric acid Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- 230000000087 stabilizing effect Effects 0.000 description 9
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-Tetramethylpiperidine Substances CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 7
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 229920000915 polyvinyl chloride Polymers 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- JEHKKBHWRAXMCH-UHFFFAOYSA-N benzenesulfinic acid Chemical compound O[S@@](=O)C1=CC=CC=C1 JEHKKBHWRAXMCH-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 239000011574 phosphorus Substances 0.000 description 5
- 229920002635 polyurethane Polymers 0.000 description 5
- 239000004814 polyurethane Substances 0.000 description 5
- 239000004800 polyvinyl chloride Substances 0.000 description 5
- 239000005033 polyvinylidene chloride Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 150000004715 keto acids Chemical class 0.000 description 4
- 229920000098 polyolefin Polymers 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000004743 Polypropylene Substances 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 229920003225 polyurethane elastomer Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 150000008043 acidic salts Chemical class 0.000 description 2
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 2
- 125000002723 alicyclic group Chemical group 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- MHWVMMHIJHHXQP-UHFFFAOYSA-N benzene-1,2,3-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(S(O)(=O)=O)=C1S(O)(=O)=O MHWVMMHIJHHXQP-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 150000008366 benzophenones Chemical class 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 2
- MCPKSFINULVDNX-UHFFFAOYSA-N drometrizole Chemical compound CC1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 MCPKSFINULVDNX-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- 239000004700 high-density polyethylene Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 125000005936 piperidyl group Chemical group 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000005628 tolylene group Chemical group 0.000 description 2
- MDKXPTZQZUEFJX-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) methanesulfonate Chemical compound CC1(C)CC(OS(C)(=O)=O)CC(C)(C)N1 MDKXPTZQZUEFJX-UHFFFAOYSA-N 0.000 description 1
- MCZHQCYHICIWJK-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) n-ethylcarbamate Chemical compound CCNC(=O)OC1CC(C)(C)NC(C)(C)C1 MCZHQCYHICIWJK-UHFFFAOYSA-N 0.000 description 1
- GSTKDOVQEARANU-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) n-phenylcarbamate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)NC1=CC=CC=C1 GSTKDOVQEARANU-UHFFFAOYSA-N 0.000 description 1
- KKFDJZZADQONDE-UHFFFAOYSA-N (hydridonitrato)hydroxidocarbon(.) Chemical compound O[C]=N KKFDJZZADQONDE-UHFFFAOYSA-N 0.000 description 1
- ZBBLRPRYYSJUCZ-GRHBHMESSA-L (z)-but-2-enedioate;dibutyltin(2+) Chemical compound [O-]C(=O)\C=C/C([O-])=O.CCCC[Sn+2]CCCC ZBBLRPRYYSJUCZ-GRHBHMESSA-L 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- SXVRSCIZJBGJGB-UHFFFAOYSA-N 1-chloropropan-2-ylbenzene Chemical compound ClCC(C)C1=CC=CC=C1 SXVRSCIZJBGJGB-UHFFFAOYSA-N 0.000 description 1
- IUKIOUVQRQCBOX-UHFFFAOYSA-N 2,2,6,6-tetramethyl-4-phenoxypiperidine Chemical compound C1C(C)(C)NC(C)(C)CC1OC1=CC=CC=C1 IUKIOUVQRQCBOX-UHFFFAOYSA-N 0.000 description 1
- NCKMMSIFQUPKCK-UHFFFAOYSA-N 2-benzyl-4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1CC1=CC=CC=C1 NCKMMSIFQUPKCK-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- AMWQSULNPUXOAU-UHFFFAOYSA-N 4-[2,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)phenyl]-2,2,6,6-tetramethylpiperidine Chemical compound C1C(C)(C)NC(C)(C)CC1C1=CC=CC(C2CC(C)(C)NC(C)(C)C2)=C1C1CC(C)(C)NC(C)(C)C1 AMWQSULNPUXOAU-UHFFFAOYSA-N 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- AGXUVMPSUKZYDT-UHFFFAOYSA-L barium(2+);octadecanoate Chemical compound [Ba+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O AGXUVMPSUKZYDT-UHFFFAOYSA-L 0.000 description 1
- MIAUJDCQDVWHEV-UHFFFAOYSA-N benzene-1,2-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O MIAUJDCQDVWHEV-UHFFFAOYSA-N 0.000 description 1
- RBUBFLVZIXNHTE-UHFFFAOYSA-N benzene-1,3,5-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 RBUBFLVZIXNHTE-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GWOWVOYJLHSRJJ-UHFFFAOYSA-L cadmium stearate Chemical compound [Cd+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O GWOWVOYJLHSRJJ-UHFFFAOYSA-L 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- DHZSIQDUYCWNSB-UHFFFAOYSA-N chloroethene;1,1-dichloroethene Chemical compound ClC=C.ClC(Cl)=C DHZSIQDUYCWNSB-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- UQLDLKMNUJERMK-UHFFFAOYSA-L di(octadecanoyloxy)lead Chemical compound [Pb+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O UQLDLKMNUJERMK-UHFFFAOYSA-L 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- SJOCPYUKFOTDAN-ZSOIEALJSA-N methyl (4z)-4-hydroxyimino-6,6-dimethyl-3-methylsulfanyl-5,7-dihydro-2-benzothiophene-1-carboxylate Chemical compound C1C(C)(C)C\C(=N\O)C=2C1=C(C(=O)OC)SC=2SC SJOCPYUKFOTDAN-ZSOIEALJSA-N 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- SCLDCPFXFSGQOV-UHFFFAOYSA-N o-(2,2,6,6-tetramethylpiperidin-4-yl) n-ethylcarbamothioate Chemical compound CCNC(=S)OC1CC(C)(C)NC(C)(C)C1 SCLDCPFXFSGQOV-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004597 plastic additive Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001610 polycaprolactone Polymers 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005749 polyurethane resin Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- QIQCZROILFZKAT-UHFFFAOYSA-N tetracarbon dioxide Chemical group O=C=C=C=C=O QIQCZROILFZKAT-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/576—Six-membered rings
- C07F9/59—Hydrogenated pyridine rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Polymers & Plastics (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Polyurethanes Or Polyureas (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4037768 | 1968-06-12 | ||
| JP1784169 | 1969-03-08 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1929928A1 DE1929928A1 (de) | 1970-01-08 |
| DE1929928B2 DE1929928B2 (de) | 1974-06-20 |
| DE1929928C3 true DE1929928C3 (de) | 1975-02-06 |
Family
ID=26354429
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1929928A Expired DE1929928C3 (de) | 1968-06-12 | 1969-06-11 | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3640928A (enExample) |
| BE (1) | BE734436A (enExample) |
| DE (1) | DE1929928C3 (enExample) |
| FR (1) | FR2010740A1 (enExample) |
| GB (1) | GB1266035A (enExample) |
| MY (1) | MY7500131A (enExample) |
| NL (1) | NL149522B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4225703A (en) | 1978-09-19 | 1980-09-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Process for the production of oxymethylene copolymer molding compositions with a low content of residual formaldehyde |
Families Citing this family (142)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3684765A (en) * | 1970-01-08 | 1972-08-15 | Sankyo Co | Stabilization of synthetic polymers |
| NL154241C (enExample) * | 1971-01-29 | 1900-01-01 | ||
| JPS5632308B1 (enExample) * | 1971-01-29 | 1981-07-27 | ||
| US3839273A (en) * | 1971-11-13 | 1974-10-01 | Sankyo Co | N-substituted piperidine derivatives, process for preparing the same and their use as stabilizers |
| BE792043A (fr) * | 1971-11-30 | 1973-05-29 | Ciba Geigy | Derives de la piperidine utilisables pour stabiliser des matieres organiques |
| US3992390A (en) * | 1971-11-30 | 1976-11-16 | Brian Holt | Esters of piperidinols |
| GB1376438A (en) * | 1971-11-30 | 1974-12-04 | Ciba Geigy Ag | Piperidine derivatives |
| US4046737A (en) * | 1971-11-30 | 1977-09-06 | Ciba-Geigy Corporation | Piperidine derivatives |
| US4049647A (en) * | 1971-11-30 | 1977-09-20 | Ciba-Geigy Corporation | Bis piperidyl carboxylates |
| US4021432A (en) * | 1971-11-30 | 1977-05-03 | Ciba-Geigy Corporation | Piperidine derivatives |
| US4110305A (en) * | 1971-11-30 | 1978-08-29 | Ciba-Geigy Corporation | Polymers stabilized by esters of piperidinols |
| US3862155A (en) * | 1972-01-19 | 1975-01-21 | Sankyo Co | 4,4-di-alkoxy-2,2,6,6-tetramethyl piperidines |
| CA1007642A (en) * | 1972-05-01 | 1977-03-29 | John J. Luzzi | Acylated derivatives of substituted piperazines and polymeric compositions stabilized thereby |
| JPS554133B2 (enExample) * | 1972-07-27 | 1980-01-29 | ||
| GB1398413A (en) * | 1972-07-28 | 1975-06-18 | Ciba Geigy Ag | Piperidine derivatives |
| JPS4962543A (enExample) * | 1972-10-20 | 1974-06-18 | ||
| GB1402888A (en) * | 1972-10-21 | 1975-08-13 | Ciba Geigy Ag | Piperidine derivatives |
| GB1399240A (en) * | 1972-10-21 | 1975-06-25 | Ciba Geigy Ag | Substituted piperidinol derivatives and their use as stabilizers |
| JPS4964634A (enExample) * | 1972-10-25 | 1974-06-22 | ||
| IE39205B1 (en) * | 1973-04-19 | 1978-08-30 | Ciba Geigy Ag | New stabiliser system and its use for stabilising styrene polymers |
| US4061616A (en) * | 1973-06-15 | 1977-12-06 | Sankyo Company Limited | Stabilization of synthetic polymers |
| CH589056A5 (enExample) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag | |
| US3920661A (en) * | 1973-12-28 | 1975-11-18 | Ciba Geigy Corp | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions |
| US4056507A (en) * | 1973-12-28 | 1977-11-01 | Ciba-Geigy Corporation | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions |
| US3991012A (en) * | 1973-12-28 | 1976-11-09 | Ciba-Geigy Corporation | Compositions stabilized with bicyclic hindered amines |
| US3960809A (en) * | 1973-12-28 | 1976-06-01 | Ciba-Geigy Corporation | Compositions stabilized with hindered piperidine carboxylic acids |
| US3939163A (en) * | 1973-12-28 | 1976-02-17 | Ciba-Geigy Corporation | Metal salts of hindered piperidine carboxylic acids and stabilized compositions |
| US4000113A (en) * | 1974-01-14 | 1976-12-28 | Ciba-Geigy Corporation | Acylated derivatives of 2,6-dihydroxy-9-azabicyclo[3.3.1]nonane and stabilized compositions |
| JPS5329182B2 (enExample) * | 1974-02-08 | 1978-08-18 | ||
| JPS51119707A (en) * | 1975-04-14 | 1976-10-20 | Kao Corp | Preparation of pulverized detergent compositions |
| JPS5848580B2 (ja) * | 1975-05-28 | 1983-10-29 | 三共株式会社 | ゴウセイコウブンシザイリヨウヨウアンテイザイ |
| US4141883A (en) * | 1975-05-28 | 1979-02-27 | Sankyo Company, Limited | Stabilization of synthetic polymers by penta-or-hexa-substituted 4-piperidinol derivatives |
| US4202816A (en) * | 1975-06-19 | 1980-05-13 | Ciba-Geigy Corporation | Novel light stabilizers |
| US4052351A (en) * | 1975-08-04 | 1977-10-04 | Phillips Petroleum Company | Stabilization of olefin polymers |
| US4035323A (en) * | 1975-08-06 | 1977-07-12 | Phillips Petroleum Company | Stabilization of olefin polymers |
| DE2545646A1 (de) * | 1975-10-11 | 1977-04-21 | Bayer Ag | Cyanamide |
| JPS5263183A (en) * | 1975-11-19 | 1977-05-25 | Adeka Argus Chem Co Ltd | Stabilizer for organic materials |
| JPS5266551A (en) * | 1975-12-01 | 1977-06-02 | Adeka Argus Chem Co Ltd | Stabilizer for plastics |
| CH601232A5 (enExample) * | 1975-12-08 | 1978-06-30 | Ciba Geigy Ag | |
| US4046728A (en) * | 1975-12-30 | 1977-09-06 | E. I. Du Pont De Nemours And Company | Polyvinyl chloride terpolymer powder coating composition |
| US4069196A (en) * | 1976-04-13 | 1978-01-17 | Ciba-Geigy Corporation | Piperidyl esters of higher di-tri-, and polybasic aliphatic carboxylic acids as stabilizers for polymeric materials |
| US4197236A (en) * | 1976-04-28 | 1980-04-08 | Ciba-Geigy Corporation | Piperidine stabilizers |
| DE2718458A1 (de) * | 1976-05-04 | 1977-11-24 | Ciba Geigy Ag | Neue stabilisatoren |
| CH623066A5 (enExample) * | 1976-05-11 | 1981-05-15 | Ciba Geigy Ag | |
| CH626109A5 (enExample) * | 1976-05-11 | 1981-10-30 | Ciba Geigy Ag | |
| JPS52140555A (en) * | 1976-05-19 | 1977-11-24 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin composition |
| US4118369A (en) * | 1976-07-28 | 1978-10-03 | Argus Chemical Corporation | 2,2,6,6-Tetrasubstituted-4-piperidyl carboxy heterocyclic compounds as stabilizers for synthetic polymers |
| USRE31261E (en) * | 1976-07-28 | 1983-05-31 | Adeka Argus Chemical Co., Ltd. | 2,2,6,6-Tetrasubstituted-4-piperidyl carboxy heterocyclic compounds as stabilizers for synthetic polymers |
| DE2642461A1 (de) * | 1976-09-21 | 1978-03-30 | Bayer Ag | Permanent stabilisierte polymere |
| US4101508A (en) * | 1976-10-26 | 1978-07-18 | Argus Chemical Corporation | 2,2,6,6-Tetramethyl-4-piperidyl bicyclic heptane and octane carboxylic acid esters as stabilizers for synthetic polymers |
| DE2805838A1 (de) * | 1977-02-24 | 1978-08-31 | Ciba Geigy Ag | Neue 4-acyloxypiperidine |
| BE854444A (fr) * | 1977-05-10 | 1977-11-10 | Argus Chem | Stabilisants de resines synthetiques contenant des derives de piperidine |
| US4243792A (en) * | 1977-05-11 | 1981-01-06 | General Motors Corporation | Moisture curing polyurethane topcoat paint with improved gloss stability |
| JPS5429400A (en) * | 1977-08-08 | 1979-03-05 | Sankyo Co Ltd | Polymer comprising polyalkylpiperidine and its use as stabilizers |
| JPS6017299B2 (ja) * | 1977-11-21 | 1985-05-02 | アデカ・ア−ガス化学株式会社 | 合成樹脂用光安定剤 |
| EP0002260B1 (de) * | 1977-12-02 | 1982-07-14 | Ciba-Geigy Ag | Malonsäurederivate von sterisch gehinderten Piperidinen, Verfahren zu ihrer Herstellung und mit ihnen stabilisiertes organisches Material |
| US4182703A (en) * | 1978-01-09 | 1980-01-08 | Eastman Kodak Company | Biheterocyclic ultraviolet stabilizers and their use in organic compositions |
| US4141884A (en) * | 1978-01-09 | 1979-02-27 | Eastman Kodak Company | Heterocyclic ester ultraviolet stabilizers and their use in organic compositions |
| US4185003A (en) * | 1978-02-16 | 1980-01-22 | E. I. Du Pont De Nemours And Company | Stabilized copolyetheresters |
| US4164494A (en) * | 1978-05-16 | 1979-08-14 | Eastman Kodak Company | Piperidinyl phosphate ultraviolet stabilizers for organic compositions |
| US4136083A (en) * | 1978-05-16 | 1979-01-23 | Eastman Kodak Company | Piperidinyl hydrogen alkylene or arylene phosphates and metal salts thereof which compounds are useful as ultraviolet stabilizers for organic compositions |
| EP0006213B1 (de) * | 1978-06-21 | 1982-09-01 | Ciba-Geigy Ag | Lichtstabilisierung von sauerkatalysierten Einbrennlacken |
| US4279720A (en) * | 1978-07-13 | 1981-07-21 | Ciba-Geigy Corporation | Photocurable composition |
| EP0007736B1 (en) * | 1978-07-25 | 1983-10-12 | Imperial Chemical Industries Plc | Polyolefin articles sterilisable by gamma-irradiation |
| US4250268A (en) * | 1978-11-28 | 1981-02-10 | Ciba-Geigy Corporation | Polysilylesters having a polyalkylpiperidine as part of the polymer useful as light stabilizers for plastics |
| US4234699A (en) * | 1978-11-29 | 1980-11-18 | Ciba-Geigy Corporation | Polymeric light stabilizers for plastics |
| US4234700A (en) * | 1978-12-04 | 1980-11-18 | Ciba-Geigy Corporation | Polymeric light stabilizers for plastics |
| JPS5578033A (en) * | 1978-12-08 | 1980-06-12 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin composition |
| IT1110826B (it) * | 1979-02-01 | 1986-01-06 | Montedison Spa | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri |
| US4311820A (en) * | 1979-02-14 | 1982-01-19 | Ciba-Geigy Corporation | Homopolymers and copolymers of vinyl ethers of polyalkylpiperidinols and their use as stabilizers for plastics |
| US4314933A (en) * | 1979-02-15 | 1982-02-09 | Ciba-Geigy Corporation | Method for light stabilization of two-layer uni-lacquer coatings |
| US4315848A (en) * | 1979-05-10 | 1982-02-16 | Ciba-Geigy Corporation | 2-[2-Hydroxy-3,5-di-(α,α-dimethylbenzyl)-phenyl]-2H-benzotriazole and stabilized compositions |
| IT7928324A0 (it) * | 1979-12-21 | 1979-12-21 | Chimosa Chimica Organica Spa | Derivati piperidinici, stabilizzanti per polimeri sintetici. |
| JPS56501881A (enExample) * | 1980-01-14 | 1981-12-24 | ||
| US4322522A (en) * | 1980-07-08 | 1982-03-30 | Akzona Incorporated | Polyester/polyether segmented copolymers stabilized against degradation by UV light via copolymerization with analogs of 2,2,6,6-tetramethylpiperidine derivatives |
| US4382109A (en) * | 1981-08-07 | 1983-05-03 | General Electric Company | Abrasion resistant silicone coated thermoplastic article and method for making |
| JPS5832642A (ja) * | 1981-08-20 | 1983-02-25 | Adeka Argus Chem Co Ltd | 安定化された合成樹脂組成物 |
| CS229069B1 (en) * | 1981-09-23 | 1984-05-14 | Julius Durmis | Composition for stabilizing polymers and method of preparing same |
| US4396769A (en) * | 1982-02-11 | 1983-08-02 | Ciba-Geigy Corporation | Process for preparing crystalline, non-dusting bis(2,2,6,6-tetramethylpiperidin-4-yl) sebacate |
| JPS5962651A (ja) * | 1982-10-02 | 1984-04-10 | Adeka Argus Chem Co Ltd | 高分子材料用光安定剤 |
| US4696959A (en) * | 1983-09-26 | 1987-09-29 | Ppg Industries, Inc. | Modified piperidines as ultraviolet light stabilizers |
| AU573647B2 (en) * | 1984-01-30 | 1988-06-16 | General Electric Company | Uv-stabilised polymer compositions |
| US4691015A (en) * | 1984-07-23 | 1987-09-01 | Ciba-Geigy Corporation | Hydroxylamines derived from hindered amines |
| US4668721A (en) * | 1984-07-23 | 1987-05-26 | Ciba-Geigy Corporation | Polyolefin compositions stabilized against degradation using hydroxylamine derivatives |
| US5191083A (en) * | 1985-05-28 | 1993-03-02 | The Goodyear Tire & Rubber Company | Functionalized monomers from 1-(1-isocyanato-1-methlethyl)-3 or 4-(1-methylethenyl) benzene |
| JPS61274985A (ja) * | 1985-05-31 | 1986-12-05 | Fuji Photo Film Co Ltd | 減感剤組成物 |
| DE3522678A1 (de) * | 1985-06-25 | 1987-01-08 | Basf Ag | Tetrahydrofurancarbonsaeurederivate |
| JPS6250342A (ja) * | 1985-08-30 | 1987-03-05 | Adeka Argus Chem Co Ltd | 安定化された高分子材料組成物 |
| US4785076A (en) * | 1985-09-03 | 1988-11-15 | General Electric Company | Polyphenylene ether resin blends having improved ultraviolet light stability |
| JPS6259078A (ja) * | 1985-09-09 | 1987-03-14 | Fuji Photo Film Co Ltd | 減感剤組成物 |
| EP0233476B1 (en) * | 1986-02-19 | 1992-12-23 | ATOCHEM NORTH AMERICA, INC. (a Pennsylvania corp.) | Peroxide free radical initiators containing hindered amine light stabilizer groups |
| US4822833A (en) * | 1986-03-10 | 1989-04-18 | Ciba-Geigy Corporation | Stabilized rigid polyvinyl chloride compositions |
| US4843116A (en) * | 1986-03-17 | 1989-06-27 | General Electric Company | UV light stabilizer composition comprising cyclic aliphatic epoxy, UV screener, and polyalkyldipiperidine (HALS) compounds |
| US5026751A (en) * | 1986-03-17 | 1991-06-25 | General Electric Company | UV light stabilizer composition comprising cyclic aliphatic epoxy UV screener, and polyalkyldipiperidine (HALS) compounds |
| US4743657A (en) * | 1986-03-17 | 1988-05-10 | Milliken Research Corporation | Method for preparing polymer bound stabilizers made from non-homopolymerizable stabilizers |
| EP0243319A3 (de) * | 1986-04-25 | 1989-02-15 | Ciba-Geigy Ag | Gegen Lichteinwirkung stabilisierte Thermoplasten |
| US4874391A (en) * | 1986-07-29 | 1989-10-17 | Ciba-Geigy Corporation | Process for photochemical stabilization of polyamide fiber material and mixtures thereof with other fibers: water-soluble copper complex dye and light-stabilizer |
| US4775389A (en) * | 1986-12-29 | 1988-10-04 | Texaco Inc. | Exhaust particulate reducing and color stabilizing additives for diesel fuels |
| US4769268A (en) * | 1987-08-19 | 1988-09-06 | Basf Corporation | Thermoplastic compositions containing stabilized antimicrobial agents |
| IT1222647B (it) * | 1987-09-11 | 1990-09-05 | Eniricerche Spa | Composti amminici stericamente impediti e procedimento per la loro preparazione |
| DE3738736A1 (de) * | 1987-11-14 | 1989-05-24 | Basf Ag | 4-formylaminopiperidinderivate und deren verwendung als stabilisatoren |
| ES2050274T3 (es) * | 1988-06-14 | 1994-05-16 | Ciba Geigy Ag | Procedimiento para la estabilizacion fotoquimica de fibras de polipropileno sin teñir y teñidas. |
| IT1226826B (it) * | 1988-07-29 | 1991-02-19 | Eniricerche Spa | Copolimeri dell'etilene e procedimento per la loro preparazione. |
| DE3844356A1 (de) * | 1988-12-30 | 1990-07-05 | Basf Ag | 4-(2'-ethylhexanoyloxy) -2,2,6,6-tetramethyl-piperidin |
| US5030243A (en) * | 1989-01-05 | 1991-07-09 | Ciba-Geigy Corporation | Process for the photochemical stabilization of undyed and dyeable artificial leather with a sterically hindered amine |
| EP0409771A3 (en) * | 1989-06-27 | 1991-06-12 | Ciba-Geigy Ag | Process of photochemical and thermal stabilization of polyamide fibres, dyeable by acid and basic dyes, and of their mixtures amongst themselves and with other fibres |
| US5096948A (en) * | 1989-07-03 | 1992-03-17 | Sankyo Company, Limited | Resistant resin compositions |
| US5204390A (en) * | 1989-09-08 | 1993-04-20 | H.B. Fuller Company | Hot melt adhesive resistant to ultraviolet light-induced degradation and to plasticizer migration |
| DE3934176A1 (de) * | 1989-10-13 | 1991-04-18 | Basf Ag | Cyclische amide |
| IT1247978B (it) * | 1991-06-04 | 1995-01-05 | Ciba Geigy Spa | Composti piperidinici contenenti l'anello tetraidrofuranico atti all'impiego come stabilizzanti per materiali organici |
| IT1247977B (it) * | 1991-06-04 | 1995-01-05 | Ciba Geigy Spa | Stabilizzazione di materiali organici polimerici mediante l`impiego dimiscele sinergiche costituite da ammine cicliche stericamente impeditee derivati del 3-pirazolidinone o del 1,2,4,-triazolidin-3,5,-dione |
| US5342978A (en) * | 1993-05-24 | 1994-08-30 | General Electric Company | Organic phosphite ester compositions containing hindered piperdinyl light stabilizers |
| IT1264946B1 (it) * | 1993-07-16 | 1996-10-17 | Ciba Geigy Spa | Derivati del 2,2,6,6-tetrametil-4-piperidinolo utili come stabilizzanti alla luce ed all'ossidazione per materiali organici. |
| IT1264817B1 (it) * | 1993-07-28 | 1996-10-10 | Ciba Geigy Spa | Derivati di polialchil-4-piperidinoli atti all'impderivati di polialchil-4-piperidinoli atti all'impiego come stabilizzanti per materiali organici iego come stabilizzanti per materiali organici |
| EP0651006B1 (en) * | 1993-10-29 | 1998-03-11 | Montell North America Inc. | Piperidinyl phosphite compositions and polyolefin compositions containing them |
| TW358820B (en) | 1995-04-11 | 1999-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW390897B (en) * | 1995-07-21 | 2000-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW358110B (en) * | 1996-05-28 | 1999-05-11 | Ciba Sc Holding Ag | Mixture of polyalkylpiperidin-4-yl dicarboxylic acid esters as stabilizers for organic materials |
| ES2239348T3 (es) * | 1996-07-17 | 2005-09-16 | Ciba Specialty Chemicals Holding Inc. | Estabilizadores de larga duracion, resistentes al ozono. |
| SG91852A1 (en) * | 1998-12-21 | 2002-10-15 | Toyo Boseki | Hindered amine compound, resin composition, polyurethane fiber and production method and use thereof |
| US6946517B2 (en) * | 1999-08-17 | 2005-09-20 | Ciba Specialty Chemicals Corporation | Stabilizer mixtures |
| DE10004158A1 (de) * | 2000-02-01 | 2001-08-02 | Basf Ag | Stabilisatorzusammensetzung |
| MX283566B (es) * | 2000-05-31 | 2011-02-01 | Ciba Sc Holding Ag | Mezclas estabilizadoras. |
| WO2001092398A2 (en) * | 2000-05-31 | 2001-12-06 | Ciba Specialty Chemicals Holding Inc. | Stabilizer mixtures |
| US6747077B2 (en) | 2000-10-17 | 2004-06-08 | Ciba Specialty Chemicals Corporation | Stabilized metallocene polypropylene |
| US6727300B2 (en) | 2000-11-03 | 2004-04-27 | Cytec Technology Corp. | Polymeric articles containing hindered amine light stabilizers based on multi-functional carbonyl compounds |
| US6492521B2 (en) | 2000-11-03 | 2002-12-10 | Cytec Technology Corp. | Hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6545156B1 (en) | 2000-11-03 | 2003-04-08 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6414155B1 (en) | 2000-11-03 | 2002-07-02 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6525131B1 (en) * | 2001-09-18 | 2003-02-25 | Crompton Corporation | Aromatic diamine polyurethane curatives with improved stability |
| US20030225191A1 (en) | 2002-04-12 | 2003-12-04 | Francois Gugumus | Stabilizer mixtures |
| BR0311387A (pt) * | 2002-05-30 | 2005-03-15 | Ciba Sc Holding Ag | Artigos estabilizados |
| EP1773932B1 (en) * | 2004-06-22 | 2010-04-14 | INVISTA Technologies S.à.r.l. | Solubilized additive composition comprising acidic and basic constituents |
| US7595011B2 (en) | 2004-07-12 | 2009-09-29 | Ciba Specialty Chemicals Corporation | Stabilized electrochromic media |
| JP5194789B2 (ja) * | 2005-04-18 | 2013-05-08 | コニカミノルタアドバンストレイヤー株式会社 | セルロースエステルフィルムの製造方法 |
| US8349066B2 (en) * | 2006-09-21 | 2013-01-08 | Ppg Industries Ohio, Inc. | Low temperature, moisture curable coating compositions and related methods |
| ITMI20080739A1 (it) | 2008-04-23 | 2009-10-24 | 3V Sigma Spa | Ammine stericamente impedite oligomeriche e loro uso come stabilizzanti per polimeri |
| ITMI20080747A1 (it) * | 2008-04-24 | 2009-10-25 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| IT1399477B1 (it) | 2010-03-15 | 2013-04-19 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| ITMI20110802A1 (it) | 2011-05-10 | 2012-11-11 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| IT201700073726A1 (it) | 2017-06-30 | 2018-12-30 | 3V Sigma Spa | Ammine impedite polimeriche |
| IT201700078234A1 (it) | 2017-07-11 | 2019-01-11 | 3V Sigma Spa | Ammine impedite |
-
1969
- 1969-06-05 US US830842A patent/US3640928A/en not_active Expired - Lifetime
- 1969-06-11 FR FR6919305A patent/FR2010740A1/fr active Pending
- 1969-06-11 NL NL696908925A patent/NL149522B/xx not_active IP Right Cessation
- 1969-06-11 DE DE1929928A patent/DE1929928C3/de not_active Expired
- 1969-06-12 BE BE734436D patent/BE734436A/xx not_active IP Right Cessation
- 1969-06-12 GB GB1266035D patent/GB1266035A/en not_active Expired
-
1975
- 1975-12-30 MY MY131/75A patent/MY7500131A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4225703A (en) | 1978-09-19 | 1980-09-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Process for the production of oxymethylene copolymer molding compositions with a low content of residual formaldehyde |
Also Published As
| Publication number | Publication date |
|---|---|
| BE734436A (enExample) | 1969-11-17 |
| GB1266035A (enExample) | 1972-03-08 |
| US3640928A (en) | 1972-02-08 |
| NL149522B (nl) | 1976-05-17 |
| DE1929928A1 (de) | 1970-01-08 |
| FR2010740A1 (enExample) | 1970-02-20 |
| MY7500131A (en) | 1975-12-31 |
| NL6908925A (enExample) | 1969-12-16 |
| DE1929928B2 (de) | 1974-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1929928C3 (de) | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere | |
| DE2040975C3 (de) | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere | |
| DE2338076C3 (de) | Piperidinderivate und ihre Verwendung als Stabilisatoren | |
| DE2733657A1 (de) | Sesshafte sulfonylazid-antioxidationsmittel | |
| DE2203533A1 (de) | 4-piperidonketalderivate, ihre herstellung und ihre verwendung als stabilisatoren | |
| DE1769646A1 (de) | Stabilisierung von synthetischen Polymeren | |
| DE2545292C3 (de) | Azaadamantanverbindungen als Stabilisatoren für organische Polymerisatzusammensetzungen | |
| DE2030908B2 (de) | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere | |
| DE2612314A1 (de) | Piperidinderivate als lichtschutzmittel | |
| DE2233122A1 (de) | Piperidin-spiro-hydantoin-derivate und ihre verwendung als stabilisatoren | |
| DE2043748A1 (de) | Piperidin spiro oxirandenvate, Verfahren zu ihrer Herstellung und ihre Anwendung als Stabilisatoren | |
| DE3012369C2 (de) | Verfahren zur Herstellung von Silanderivaten aus Sepiolith und Alkoxysilanen sowie deren Verwendung zur Härtesteigerung von Polymeren | |
| DE2047846A1 (de) | Pipendonenolather, Verfahren zur Her stellung derselben und ihre Verwendung als Stabilisatoren | |
| DE2310135C3 (de) | 4-Phenylbenzylidenmalonsäurederivate und ihre Verwendung zur Stabilisierung von Polymeren gegen UV-Strahlung | |
| DE2545645C2 (de) | Thiazolinylamino-piperidin-Derivate | |
| DE2545646A1 (de) | Cyanamide | |
| DE2264991C3 (de) | Gegen Photo- und thermische Zersetzung stabilisierte synthetische polymere Komposition | |
| DE2159325C3 (de) | Kunststoffmassen | |
| DE2211177A1 (de) | N-substituierte piperidinderivate, verfahren zur herstellung derselben und ihre verwendung als stabilisatoren | |
| DE1928915C3 (de) | Gegen Zersetzung stabilisierte Polyurethanformmassen | |
| DE1694942C (de) | Stabilisieren von Polymeren | |
| DE1924188C3 (de) | Verwendung von Chlorphenylkohlensäureestern als Termitenmittel in Kunststoffen | |
| DE2321526A1 (de) | Acylderivate substituierter piperazine und deren verwendung zum stabilisieren von polymerisatzusammensetzungen | |
| DE2111159A1 (de) | Polymermasse und ihre Verwendung zur Stabilisierung von Polyurethanelastomeren | |
| DE2253503C3 (de) | Stabilisierung synthetischer Polymerer durch Piperidino-Thiazolin-Verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |