DE1793602C3 - N-O-ChloM-bromphenyO-K-methyl-K-methoxy-harnstoff. Ausscheidung aus: 1542724 - Google Patents
N-O-ChloM-bromphenyO-K-methyl-K-methoxy-harnstoff. Ausscheidung aus: 1542724Info
- Publication number
- DE1793602C3 DE1793602C3 DE1793602A DE1793602A DE1793602C3 DE 1793602 C3 DE1793602 C3 DE 1793602C3 DE 1793602 A DE1793602 A DE 1793602A DE 1793602 A DE1793602 A DE 1793602A DE 1793602 C3 DE1793602 C3 DE 1793602C3
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- bromophenyo
- chlom
- eliminated
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241000196324 Embryophyta Species 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- -1 aliphatic alcohols Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- QGLWBTPVKHMVHM-KTKRTIGZSA-N (z)-octadec-9-en-1-amine Chemical compound CCCCCCCC\C=C/CCCCCCCCN QGLWBTPVKHMVHM-KTKRTIGZSA-N 0.000 description 1
- ICLYJLBTOGPLMC-KVVVOXFISA-N (z)-octadec-9-enoate;tris(2-hydroxyethyl)azanium Chemical compound OCCN(CCO)CCO.CCCCCCCC\C=C/CCCCCCCC(O)=O ICLYJLBTOGPLMC-KVVVOXFISA-N 0.000 description 1
- QAQSNXHKHKONNS-UHFFFAOYSA-N 1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide Chemical compound CCN1C(O)=C(C(N)=O)C(C)=CC1=O QAQSNXHKHKONNS-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- PIGINCCGZHXGRB-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-methoxy-1-methylurea Chemical compound CON(C)C(=O)NC1=CC=CC(Cl)=C1 PIGINCCGZHXGRB-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- AJBZENLMTKDAEK-UHFFFAOYSA-N 3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-4,9-diol Chemical compound CC12CCC(O)C(C)(C)C1CCC(C1(C)CC3O)(C)C2CCC1C1C3(C)CCC1C(=C)C AJBZENLMTKDAEK-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 235000003880 Calendula Nutrition 0.000 description 1
- 240000001432 Calendula officinalis Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- NLYNUTMZTCLNOO-UHFFFAOYSA-N Chlorbromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C(Cl)=C1 NLYNUTMZTCLNOO-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 241000207890 Ipomoea purpurea Species 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical class OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N ethyl butylhexanol Natural products CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- JOHLTMWXHJLNDE-UHFFFAOYSA-N methoxyurea Chemical compound CONC(N)=O JOHLTMWXHJLNDE-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical class C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/38—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by doubly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH533661A CH398543A (de) | 1961-05-06 | 1961-05-06 | Verfahren zur Herstellung von Harnstoffderivaten |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1793602A1 DE1793602A1 (de) | 1972-08-31 |
| DE1793602B2 DE1793602B2 (de) | 1973-07-26 |
| DE1793602C3 true DE1793602C3 (de) | 1974-03-07 |
Family
ID=4291866
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1793602A Expired DE1793602C3 (de) | 1961-05-06 | 1962-05-04 | N-O-ChloM-bromphenyO-K-methyl-K-methoxy-harnstoff. Ausscheidung aus: 1542724 |
| DE1962C0032221 Expired DE1227445C2 (de) | 1961-05-06 | 1962-05-04 | Verfahren zur Herstellung von Harnstoffderivaten |
| DE1962C0026904 Expired DE1210793C2 (de) | 1961-05-06 | 1962-05-04 | Verfahren zur herstellung von harnstoffderivaten |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1962C0032221 Expired DE1227445C2 (de) | 1961-05-06 | 1962-05-04 | Verfahren zur Herstellung von Harnstoffderivaten |
| DE1962C0026904 Expired DE1210793C2 (de) | 1961-05-06 | 1962-05-04 | Verfahren zur herstellung von harnstoffderivaten |
Country Status (7)
| Country | Link |
|---|---|
| US (4) | US3288851A (enExample) |
| BE (1) | BE662268A (enExample) |
| CH (1) | CH398543A (enExample) |
| DE (3) | DE1793602C3 (enExample) |
| FR (1) | FR1325926A (enExample) |
| GB (1) | GB965313A (enExample) |
| OA (1) | OA01202A (enExample) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH398543A (de) * | 1961-05-06 | 1966-03-15 | Ciba Geigy | Verfahren zur Herstellung von Harnstoffderivaten |
| DE1242936B (de) * | 1965-03-12 | 1967-06-22 | Schering Ag | Selektive Herbizide |
| DE1542785A1 (de) * | 1965-07-24 | 1970-05-06 | Bayer Ag | Insekten- und milbenabweisende Mittel |
| US3994714A (en) * | 1965-10-28 | 1976-11-30 | Sandoz Ltd. | Method for selective herbicidal treatment of barley cultures |
| CH466943A (de) * | 1965-10-28 | 1968-12-31 | Sandoz Ag | Unkrautbekämpfung in Kulturen |
| US3507899A (en) * | 1966-03-01 | 1970-04-21 | Basf Ag | Production of n-p-bromophenyl-n'-methyl-n'-methoxyurea |
| US3516986A (en) * | 1966-11-15 | 1970-06-23 | United States Borax Chem | Esters of 2-(omega-alkyleneiminouramido) benzoic acid |
| CH488723A (de) * | 1967-12-27 | 1970-04-15 | Agripat Sa | Verfahren zur Herstellung von Thiadiazolyl-harnstoffen |
| US3982922A (en) * | 1967-12-28 | 1976-09-28 | Velsicol Chemical Corporation | Herbicidal compositions containing furancarboxamides |
| GB1195672A (en) * | 1968-02-01 | 1970-06-17 | Mobil Oil Corp | Novel Urea Derivatives and Herbicides containing the same |
| GB1266172A (enExample) * | 1968-03-13 | 1972-03-08 | ||
| US4686294A (en) * | 1968-12-20 | 1987-08-11 | Ciba-Geigy Corporation | 1,3,4-thiadiazolyl ureas and processes for controlling weeds and wild grasses therewith |
| US3951641A (en) * | 1969-08-05 | 1976-04-20 | Ciba-Geigy Ag | Use of N-(4-isopropoxy-3-chlorophenyl)-N'-methyl-N'-methoxyurea for control of weeds in maize cultures |
| US3806599A (en) * | 1970-04-22 | 1974-04-23 | Roussel Uclaf | Method for treating topical bacterial or fungal infections |
| IL36718A0 (en) * | 1970-04-30 | 1971-06-23 | Ciba Geigy Ag | Herbicidal compositions containing phenylureas,certain new phenylureas and their preparation |
| DE2033908B2 (de) * | 1970-07-08 | 1974-02-28 | Diamond Shamrock Corp., Cleveland, Ohio (V.St.A.) | Harnstoff-Derivate |
| CA920835A (en) * | 1971-02-08 | 1973-02-13 | F. Adams Bobby | Method of regulating plant growth |
| US3771993A (en) * | 1972-05-15 | 1973-11-13 | Chevron Res | N-aryl-n-alkyl-n{40 -arylthio ureas as herbicides |
| US3928600A (en) * | 1972-05-15 | 1975-12-23 | Chevron Res | N-polyhalovinylthiocarboxamides as nematocides |
| FR2187220B1 (enExample) * | 1972-06-09 | 1978-12-08 | Ciba Geigy Ag | |
| US3901687A (en) * | 1973-08-31 | 1975-08-26 | Scott & Sons Co O M | Process for the selective control of weeds in kentucky bluegrass |
| US3988294A (en) * | 1974-03-11 | 1976-10-26 | R. T. Vanderbilt Company, Inc. | Surface coating compositions containing antimicrobic ureas |
| GB1476351A (en) * | 1974-04-17 | 1977-06-10 | Wilkinson Sword Ltd | Compounds having a physiological cooling effect and compo sitions containing them |
| US4242273A (en) * | 1977-09-27 | 1980-12-30 | American Cyanamid Company | 4-(Monoalkylamino)benzoic acid amides and imidates |
| US5003106A (en) * | 1983-07-19 | 1991-03-26 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| FR2669926A1 (fr) * | 1990-11-29 | 1992-06-05 | Medgenix Group Sa | Ligands specifiques des recepteurs aux benzodiazepines peripheriques. |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037621A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| BE1026422B1 (nl) | 2018-07-02 | 2020-02-03 | Belchim Crop Prot N V | Synergetisch werkzame herbicidesamenstelling omvattende metobromuron en clomazon |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2705195A (en) * | 1951-09-27 | 1955-03-29 | Du Pont | Herbicidal compositions and methods employing solutions of substituted ureas in monohydric phenols |
| US2655534A (en) * | 1951-10-25 | 1953-10-13 | Du Pont | Preparation of n-aromatic-n'-aliphatic hydrocarbon ureas |
| US2653864A (en) * | 1951-12-26 | 1953-09-29 | Monsanto Chemicals | Method of destroying plants |
| US2655444A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | 3-(halophenyl)-1, 1-dialkyl ureas and weed control compositions and methods |
| US2655446A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Chemical compositions and methods |
| US2655447A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Composition and method |
| US2663729A (en) * | 1952-11-04 | 1953-12-22 | Du Pont | Haloarylhydroxyalkyl-ureas |
| US2663730A (en) * | 1953-09-16 | 1953-12-22 | Ethyl Corp | N-alkyl-n'-(p-hydroxyphenyl) ureas |
| BE529063A (enExample) * | 1953-10-13 | |||
| US2764478A (en) * | 1954-12-28 | 1956-09-25 | Du Pont | Weed control composition and method |
| US2913322A (en) * | 1955-12-29 | 1959-11-17 | Monsanto Chemicals | Halogen substituted carboxanilides |
| US2960534A (en) * | 1957-06-11 | 1960-11-15 | Hoechst Ag | Nu-(chlorosubstituted aryl)-nu' methoxy-nu' methyl ureas |
| US3079244A (en) * | 1957-06-14 | 1963-02-26 | Hoechst Ag | Herbicidal method |
| BE573402A (enExample) * | 1957-12-05 | |||
| DE1102722B (de) * | 1959-04-18 | 1961-03-23 | Thomae Gmbh Dr K | Verfahren zur Herstellung von substituierten Harnstoffen |
| GB973354A (en) * | 1960-10-31 | 1964-10-21 | Du Pont | Improvements in or relating to herbicidal compositions |
| NL134755C (enExample) * | 1961-01-19 | |||
| CH398543A (de) * | 1961-05-06 | 1966-03-15 | Ciba Geigy | Verfahren zur Herstellung von Harnstoffderivaten |
| US3288586A (en) * | 1963-11-07 | 1966-11-29 | Du Pont | Herbicidal methods employing an addition compound of 3-(3, 4-dichlorophenyl)-1-methyl-1-methoxyurea and dodecylbenzenesulfonic acid |
-
1961
- 1961-05-06 CH CH533661A patent/CH398543A/de unknown
-
1962
- 1962-05-01 US US191442A patent/US3288851A/en not_active Expired - Lifetime
- 1962-05-04 DE DE1793602A patent/DE1793602C3/de not_active Expired
- 1962-05-04 FR FR896446A patent/FR1325926A/fr not_active Expired
- 1962-05-04 DE DE1962C0032221 patent/DE1227445C2/de not_active Expired
- 1962-05-04 DE DE1962C0026904 patent/DE1210793C2/de not_active Expired
- 1962-05-07 GB GB17518/62A patent/GB965313A/en not_active Expired
-
1964
- 1964-12-31 OA OA51383A patent/OA01202A/xx unknown
-
1965
- 1965-02-16 US US433155A patent/US3223721A/en not_active Expired - Lifetime
- 1965-04-08 BE BE662268A patent/BE662268A/fr unknown
-
1966
- 1966-04-19 US US543541A patent/US3497541A/en not_active Expired - Lifetime
-
1970
- 1970-06-22 US US48955A patent/US3692911A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE662268A (enExample) | 1965-08-02 |
| US3692911A (en) | 1972-09-19 |
| DE1227445C2 (de) | 1973-10-04 |
| DE1793602A1 (de) | 1972-08-31 |
| US3288851A (en) | 1966-11-29 |
| DE1227445B (de) | 1966-10-27 |
| FR1325926A (fr) | 1963-05-03 |
| CH398543A (de) | 1966-03-15 |
| DE1210793B (de) | 1966-02-17 |
| OA01202A (fr) | 1969-01-25 |
| DE1793602B2 (de) | 1973-07-26 |
| US3497541A (en) | 1970-02-24 |
| US3223721A (en) | 1965-12-14 |
| DE1210793C2 (de) | 1976-01-29 |
| GB965313A (en) | 1964-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1793602C3 (de) | N-O-ChloM-bromphenyO-K-methyl-K-methoxy-harnstoff. Ausscheidung aus: 1542724 | |
| DE1210241B (de) | Herbizide | |
| DE1284151B (de) | Selektive herbicide Mittel | |
| DE1910895B2 (de) | Heterocyclisch-substituierte 1,3,4-Thiadiazol-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE1542711C3 (de) | N Phenyl N5 oxyalkyl NP alkylharnstof fe, ihre Verwendung als Herbizide und diese enthaltende herbizide Mittel | |
| DE2219802C2 (de) | Oximäther und diese enthaltende Herbizide | |
| DE1287567B (de) | Neue Carbaminsaeurephenylester | |
| CH403391A (de) | Herbicides Mittel, enthaltend neue Harnstoffe | |
| DE1542835A1 (de) | Herbizide Mittel | |
| DE1542817A1 (de) | Herbizid | |
| DE2036968C3 (de) | 3-Chlor-4-n und i-Propoxyphenylharnstoffe, ihre Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| AT233324B (de) | Mittel zur Bekämpfung von pflanzenpathogenen Mikroorganismen | |
| DE1670312C3 (de) | Substituierte 2-Carbamoyloxyphenyl-4-methyl-1,2,4-oxadiazolidin-33-dione | |
| DE2512940C2 (de) | N-Benzoyl-N-halogenphenyl-2-aminopropionsäure-ester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1542702C (de) | Substituierte Säureanilide | |
| DE1932827B2 (de) | Cycloaliphatische imidazolidin-2-on- 1-carbonsaeure-amide, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1542848C3 (de) | N-(4-Chlor-2-methyl-phenyl)-N\ N'dimethylthioharnstoff und diesen enthaltende Schädlingsbekämpfungsmittel | |
| AT277662B (de) | Fungizides mittel | |
| DE1952230A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1642218C (de) | Substituierte Thiocarbamate und deren Verwendung | |
| DE1643798C (de) | 3,4-DibromphenylharnstofTe bzw. -thioharnstoffe und diese als Wirkstoff enthaltende total- oder selektiv-herbizide Mittel | |
| AT345816B (de) | Verfahren zur herstellung von neuen thiadiazolylimidazolinonen | |
| AT231223B (de) | Mittel zur Bekämpfung von unerwünschtem Pflanzenwachstum | |
| DE1542820A1 (de) | Herbizide | |
| AT164830B (de) | Schädlingsbekämpfungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |