CH398543A - Verfahren zur Herstellung von Harnstoffderivaten - Google Patents
Verfahren zur Herstellung von HarnstoffderivatenInfo
- Publication number
- CH398543A CH398543A CH533661A CH533661A CH398543A CH 398543 A CH398543 A CH 398543A CH 533661 A CH533661 A CH 533661A CH 533661 A CH533661 A CH 533661A CH 398543 A CH398543 A CH 398543A
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- treated
- compound
- methyl
- urea derivatives
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 150000003672 ureas Chemical class 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims 4
- 150000001875 compounds Chemical class 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 5
- NNEWRFHYQPTQKR-UHFFFAOYSA-N 1-methoxy-1-methyl-3-phenylurea Chemical compound CON(C)C(=O)NC1=CC=CC=C1 NNEWRFHYQPTQKR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- JUMFQCKSVYYQJC-UHFFFAOYSA-N 1,1-dimethyl-3-(3-methylphenyl)urea Chemical compound CN(C)C(=O)NC1=CC=CC(C)=C1 JUMFQCKSVYYQJC-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- XXOYNJXVWVNOOJ-UHFFFAOYSA-N fenuron Chemical compound CN(C)C(=O)NC1=CC=CC=C1 XXOYNJXVWVNOOJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 description 26
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 14
- 230000031709 bromination Effects 0.000 description 10
- 238000005893 bromination reaction Methods 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 9
- 239000012362 glacial acetic acid Substances 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- 229910052801 chlorine Chemical group 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WLFDQEVORAMCIM-UHFFFAOYSA-N Metobromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C=C1 WLFDQEVORAMCIM-UHFFFAOYSA-N 0.000 description 3
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- MIRQKFUBAFNLEI-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-methylurea Chemical compound CNC(=O)NC1=CC=CC(Cl)=C1 MIRQKFUBAFNLEI-UHFFFAOYSA-N 0.000 description 2
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 2
- ZARXGSLQERUNSR-UHFFFAOYSA-N 1-butyl-3-(3-chlorophenyl)-1-methylurea Chemical compound CCCCN(C)C(=O)NC1=CC=CC(Cl)=C1 ZARXGSLQERUNSR-UHFFFAOYSA-N 0.000 description 2
- QLQDWOFJALEHSP-UHFFFAOYSA-N 3-(3-chlorophenyl)-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(Cl)=C1 QLQDWOFJALEHSP-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZFJBSYYIOPSWAE-UHFFFAOYSA-N 1,1-diethyl-3-phenylurea Chemical compound CCN(CC)C(=O)NC1=CC=CC=C1 ZFJBSYYIOPSWAE-UHFFFAOYSA-N 0.000 description 1
- OKUKWIIEAXKUDI-UHFFFAOYSA-N 1-(4-bromophenyl)-3-methylurea Chemical compound CNC(=O)NC1=CC=C(Br)C=C1 OKUKWIIEAXKUDI-UHFFFAOYSA-N 0.000 description 1
- RTQBQRBTYCSFAR-UHFFFAOYSA-N 1-methoxy-3-phenylurea Chemical compound CONC(=O)NC1=CC=CC=C1 RTQBQRBTYCSFAR-UHFFFAOYSA-N 0.000 description 1
- SQBHGDSDVWCPHN-UHFFFAOYSA-N 1-methyl-3-phenylurea Chemical compound CNC(=O)NC1=CC=CC=C1 SQBHGDSDVWCPHN-UHFFFAOYSA-N 0.000 description 1
- GSNZNZUNAJCHDO-UHFFFAOYSA-N 3-(4-bromophenyl)-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=C(Br)C=C1 GSNZNZUNAJCHDO-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 102100026459 POU domain, class 3, transcription factor 2 Human genes 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- DKSMCEUSSQTGBK-UHFFFAOYSA-N bromous acid Chemical compound OBr=O DKSMCEUSSQTGBK-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XVDWMONETMNKBK-UHFFFAOYSA-N calcium;dihypobromite Chemical compound [Ca+2].Br[O-].Br[O-] XVDWMONETMNKBK-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- WSSOFBRSFAPKKC-UHFFFAOYSA-N n-bromoformamide Chemical class BrNC=O WSSOFBRSFAPKKC-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- UEXZYUUKJQPTCQ-UHFFFAOYSA-N pyridin-1-ium;bromide;hydrobromide Chemical compound Br.Br.C1=CC=NC=C1 UEXZYUUKJQPTCQ-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 108010072897 transcription factor Brn-2 Proteins 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/38—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by doubly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH533661A CH398543A (de) | 1961-05-06 | 1961-05-06 | Verfahren zur Herstellung von Harnstoffderivaten |
| US191442A US3288851A (en) | 1961-05-06 | 1962-05-01 | Process for the bromination of phenylureas |
| DE1962C0032221 DE1227445C2 (de) | 1961-05-06 | 1962-05-04 | Verfahren zur Herstellung von Harnstoffderivaten |
| DE1962C0026904 DE1210793C2 (de) | 1961-05-06 | 1962-05-04 | Verfahren zur herstellung von harnstoffderivaten |
| FR896446A FR1325926A (fr) | 1961-05-06 | 1962-05-04 | Procédé de préparation de dérivés de l'urée utilisables notamment pour lutter contre les mauvaises herbes |
| DE1793602A DE1793602C3 (de) | 1961-05-06 | 1962-05-04 | N-O-ChloM-bromphenyO-K-methyl-K-methoxy-harnstoff. Ausscheidung aus: 1542724 |
| GB17518/62A GB965313A (en) | 1961-05-06 | 1962-05-07 | Process for the manufacture of urea derivatives and pest-combating preparations containing them |
| OA51383A OA01202A (fr) | 1961-05-06 | 1964-12-31 | Procédé de préparation de dérivés de l'urée utilisable notamment pour lutter contre les mauvaises herbes. |
| US433155A US3223721A (en) | 1961-05-06 | 1965-02-16 | 1-(4-bromophenyl), 3-methoxy, 3-methyl-urea |
| BE662268A BE662268A (enExample) | 1961-05-06 | 1965-04-08 | |
| US543541A US3497541A (en) | 1961-05-06 | 1966-04-19 | Urea derivatives |
| US48955A US3692911A (en) | 1961-05-06 | 1970-06-22 | Method for selectively combating fungi and weeds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH533661A CH398543A (de) | 1961-05-06 | 1961-05-06 | Verfahren zur Herstellung von Harnstoffderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH398543A true CH398543A (de) | 1966-03-15 |
Family
ID=4291866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH533661A CH398543A (de) | 1961-05-06 | 1961-05-06 | Verfahren zur Herstellung von Harnstoffderivaten |
Country Status (7)
| Country | Link |
|---|---|
| US (4) | US3288851A (enExample) |
| BE (1) | BE662268A (enExample) |
| CH (1) | CH398543A (enExample) |
| DE (3) | DE1793602C3 (enExample) |
| FR (1) | FR1325926A (enExample) |
| GB (1) | GB965313A (enExample) |
| OA (1) | OA01202A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3507899A (en) * | 1966-03-01 | 1970-04-21 | Basf Ag | Production of n-p-bromophenyl-n'-methyl-n'-methoxyurea |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH398543A (de) * | 1961-05-06 | 1966-03-15 | Ciba Geigy | Verfahren zur Herstellung von Harnstoffderivaten |
| DE1242936B (de) * | 1965-03-12 | 1967-06-22 | Schering Ag | Selektive Herbizide |
| DE1542785A1 (de) * | 1965-07-24 | 1970-05-06 | Bayer Ag | Insekten- und milbenabweisende Mittel |
| US3994714A (en) * | 1965-10-28 | 1976-11-30 | Sandoz Ltd. | Method for selective herbicidal treatment of barley cultures |
| CH466943A (de) * | 1965-10-28 | 1968-12-31 | Sandoz Ag | Unkrautbekämpfung in Kulturen |
| US3497344A (en) * | 1966-11-15 | 1970-02-24 | United States Borax Chem | Herbicidal compositions and methods utilizing uramidobenzoate compounds |
| CH488723A (de) * | 1967-12-27 | 1970-04-15 | Agripat Sa | Verfahren zur Herstellung von Thiadiazolyl-harnstoffen |
| US3982922A (en) * | 1967-12-28 | 1976-09-28 | Velsicol Chemical Corporation | Herbicidal compositions containing furancarboxamides |
| GB1195672A (en) * | 1968-02-01 | 1970-06-17 | Mobil Oil Corp | Novel Urea Derivatives and Herbicides containing the same |
| GB1266172A (enExample) * | 1968-03-13 | 1972-03-08 | ||
| US4686294A (en) * | 1968-12-20 | 1987-08-11 | Ciba-Geigy Corporation | 1,3,4-thiadiazolyl ureas and processes for controlling weeds and wild grasses therewith |
| US3951641A (en) * | 1969-08-05 | 1976-04-20 | Ciba-Geigy Ag | Use of N-(4-isopropoxy-3-chlorophenyl)-N'-methyl-N'-methoxyurea for control of weeds in maize cultures |
| US3806599A (en) * | 1970-04-22 | 1974-04-23 | Roussel Uclaf | Method for treating topical bacterial or fungal infections |
| IL36718A0 (en) * | 1970-04-30 | 1971-06-23 | Ciba Geigy Ag | Herbicidal compositions containing phenylureas,certain new phenylureas and their preparation |
| DE2033908B2 (de) * | 1970-07-08 | 1974-02-28 | Diamond Shamrock Corp., Cleveland, Ohio (V.St.A.) | Harnstoff-Derivate |
| CA920835A (en) * | 1971-02-08 | 1973-02-13 | F. Adams Bobby | Method of regulating plant growth |
| US3928600A (en) * | 1972-05-15 | 1975-12-23 | Chevron Res | N-polyhalovinylthiocarboxamides as nematocides |
| US3771993A (en) * | 1972-05-15 | 1973-11-13 | Chevron Res | N-aryl-n-alkyl-n{40 -arylthio ureas as herbicides |
| FR2187220B1 (enExample) * | 1972-06-09 | 1978-12-08 | Ciba Geigy Ag | |
| US3901687A (en) * | 1973-08-31 | 1975-08-26 | Scott & Sons Co O M | Process for the selective control of weeds in kentucky bluegrass |
| US3988294A (en) * | 1974-03-11 | 1976-10-26 | R. T. Vanderbilt Company, Inc. | Surface coating compositions containing antimicrobic ureas |
| GB1476351A (en) * | 1974-04-17 | 1977-06-10 | Wilkinson Sword Ltd | Compounds having a physiological cooling effect and compo sitions containing them |
| US4242273A (en) * | 1977-09-27 | 1980-12-30 | American Cyanamid Company | 4-(Monoalkylamino)benzoic acid amides and imidates |
| US5003106A (en) * | 1983-07-19 | 1991-03-26 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| FR2669926A1 (fr) * | 1990-11-29 | 1992-06-05 | Medgenix Group Sa | Ligands specifiques des recepteurs aux benzodiazepines peripheriques. |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037621A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| BE1026422B1 (nl) | 2018-07-02 | 2020-02-03 | Belchim Crop Prot N V | Synergetisch werkzame herbicidesamenstelling omvattende metobromuron en clomazon |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2705195A (en) * | 1951-09-27 | 1955-03-29 | Du Pont | Herbicidal compositions and methods employing solutions of substituted ureas in monohydric phenols |
| US2655534A (en) * | 1951-10-25 | 1953-10-13 | Du Pont | Preparation of n-aromatic-n'-aliphatic hydrocarbon ureas |
| US2653864A (en) * | 1951-12-26 | 1953-09-29 | Monsanto Chemicals | Method of destroying plants |
| US2655447A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Composition and method |
| US2655446A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Chemical compositions and methods |
| US2655444A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | 3-(halophenyl)-1, 1-dialkyl ureas and weed control compositions and methods |
| US2663729A (en) * | 1952-11-04 | 1953-12-22 | Du Pont | Haloarylhydroxyalkyl-ureas |
| US2663730A (en) * | 1953-09-16 | 1953-12-22 | Ethyl Corp | N-alkyl-n'-(p-hydroxyphenyl) ureas |
| BE529063A (enExample) * | 1953-10-13 | |||
| US2764478A (en) * | 1954-12-28 | 1956-09-25 | Du Pont | Weed control composition and method |
| US2913322A (en) * | 1955-12-29 | 1959-11-17 | Monsanto Chemicals | Halogen substituted carboxanilides |
| US2960534A (en) * | 1957-06-11 | 1960-11-15 | Hoechst Ag | Nu-(chlorosubstituted aryl)-nu' methoxy-nu' methyl ureas |
| US3079244A (en) * | 1957-06-14 | 1963-02-26 | Hoechst Ag | Herbicidal method |
| NL106906C (enExample) * | 1957-12-05 | |||
| DE1102722B (de) * | 1959-04-18 | 1961-03-23 | Thomae Gmbh Dr K | Verfahren zur Herstellung von substituierten Harnstoffen |
| GB973354A (en) * | 1960-10-31 | 1964-10-21 | Du Pont | Improvements in or relating to herbicidal compositions |
| BE612773A (enExample) * | 1961-01-19 | |||
| CH398543A (de) * | 1961-05-06 | 1966-03-15 | Ciba Geigy | Verfahren zur Herstellung von Harnstoffderivaten |
| US3288586A (en) * | 1963-11-07 | 1966-11-29 | Du Pont | Herbicidal methods employing an addition compound of 3-(3, 4-dichlorophenyl)-1-methyl-1-methoxyurea and dodecylbenzenesulfonic acid |
-
1961
- 1961-05-06 CH CH533661A patent/CH398543A/de unknown
-
1962
- 1962-05-01 US US191442A patent/US3288851A/en not_active Expired - Lifetime
- 1962-05-04 FR FR896446A patent/FR1325926A/fr not_active Expired
- 1962-05-04 DE DE1793602A patent/DE1793602C3/de not_active Expired
- 1962-05-04 DE DE1962C0026904 patent/DE1210793C2/de not_active Expired
- 1962-05-04 DE DE1962C0032221 patent/DE1227445C2/de not_active Expired
- 1962-05-07 GB GB17518/62A patent/GB965313A/en not_active Expired
-
1964
- 1964-12-31 OA OA51383A patent/OA01202A/xx unknown
-
1965
- 1965-02-16 US US433155A patent/US3223721A/en not_active Expired - Lifetime
- 1965-04-08 BE BE662268A patent/BE662268A/fr unknown
-
1966
- 1966-04-19 US US543541A patent/US3497541A/en not_active Expired - Lifetime
-
1970
- 1970-06-22 US US48955A patent/US3692911A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3507899A (en) * | 1966-03-01 | 1970-04-21 | Basf Ag | Production of n-p-bromophenyl-n'-methyl-n'-methoxyurea |
Also Published As
| Publication number | Publication date |
|---|---|
| US3223721A (en) | 1965-12-14 |
| DE1227445C2 (de) | 1973-10-04 |
| US3288851A (en) | 1966-11-29 |
| GB965313A (en) | 1964-07-29 |
| US3692911A (en) | 1972-09-19 |
| BE662268A (enExample) | 1965-08-02 |
| DE1210793C2 (de) | 1976-01-29 |
| DE1793602A1 (de) | 1972-08-31 |
| DE1793602B2 (de) | 1973-07-26 |
| US3497541A (en) | 1970-02-24 |
| DE1227445B (de) | 1966-10-27 |
| DE1793602C3 (de) | 1974-03-07 |
| DE1210793B (de) | 1966-02-17 |
| FR1325926A (fr) | 1963-05-03 |
| OA01202A (fr) | 1969-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH398543A (de) | Verfahren zur Herstellung von Harnstoffderivaten | |
| DE2537681A1 (de) | Verfahren zur herstellung der isomeren 1,4-dibrom-epoxy-cyclohexene | |
| DE2848531A1 (de) | N-phenylharnstoffe, verfahren zu ihrer herstellung, sowie ihre verwendung als herbizide | |
| EP0010715B1 (de) | Neue, eine Oximgruppe enthaltende N-Alkylhalogenacetanilide, Verfahren zu ihrer Herstellung, sie enthaltende herbizide Mittel, ein Verfahren zur Bekämpfung von Unkräutern und ein Verfahren zur Herstellung von herbiziden Mitteln. | |
| US2882140A (en) | Herbicidal compositions and their preparation | |
| EP0037527A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2601399C2 (de) | Cis-β-[Trimethylammonium]-acrylnitriltosylat, Verfahren zu dessen Herstellung und dessen Verwendung zur Herstellung von Cyclocytidintosylat | |
| US2870144A (en) | 3-furfurylidene-aminmo-1, 2, 4-triazole and process for producing same | |
| CH628019A5 (en) | Process for preparing dichloronitroanilines | |
| DE845503C (de) | Verfahren zur Herstellung von Chlormethylgruppen enthaltenden aromatischen Verbindungen | |
| EP0037938A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2150146A1 (de) | Verfahren zur Herstellung von niederen Alkylestern von Flavon-7-oxyessigsaeure | |
| AT305688B (de) | Herbizides und fungizides Mittel | |
| AT212301B (de) | Verfahren zur Herstellung von neuen Anilindisulfonsäurechlorid-Derivaten | |
| AT355552B (de) | Neues verfahren zur herstellung dichlorace- tylierter aliphatischer sec. amin-derivate | |
| AT375360B (de) | Verfahren zur herstellung von neuen 1,3-benzodioxol-derivaten und deren salzen | |
| AT219587B (de) | Verfahren zur Herstellung von α-Ketoaldehyden | |
| DE2636381C3 (de) | Verfahren zur Herstellung von Dichlormaleinsäureanhydrid durch Oxidation von Hexachlorbutadien | |
| AT264917B (de) | Das Pflanzenwachstum beeinflussendes Mittel | |
| DE1953357A1 (de) | Cyclopropan-carbonsaeure-benzthiazylamide,Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| AT340201B (de) | Pestizides fungizides und bakterizides mittel | |
| AT364836B (de) | Verfahren zur herstellung von neuen o-substituierten derivaten des (+)-cyanidan-3-ols und deren salzen | |
| DE2704546A1 (de) | Mercaptoazetidinon-derivate, verfahren zu ihrer herstellung und ihre verwendung | |
| Robinson et al. | The Reaction of Tetramethylthiuramdisulphide with Acetone: I. Reaction Products | |
| DE2426651A1 (de) | (-)-antipoden von 3-aryl-2-halogenpropionsaeure-derivaten, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |