DE1200681B - Durch Waerme entwickelbares Diazo-typiematerial - Google Patents
Durch Waerme entwickelbares Diazo-typiematerialInfo
- Publication number
- DE1200681B DE1200681B DEE20221A DEE0020221A DE1200681B DE 1200681 B DE1200681 B DE 1200681B DE E20221 A DEE20221 A DE E20221A DE E0020221 A DEE0020221 A DE E0020221A DE 1200681 B DE1200681 B DE 1200681B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- stabilizer
- diazotype material
- material according
- acidic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 40
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 30
- 239000003381 stabilizer Substances 0.000 claims description 26
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 26
- 150000008049 diazo compounds Chemical class 0.000 claims description 23
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- 150000007513 acids Chemical class 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000005859 coupling reaction Methods 0.000 claims description 11
- 239000004202 carbamide Substances 0.000 claims description 10
- 230000008878 coupling Effects 0.000 claims description 10
- 238000010168 coupling process Methods 0.000 claims description 10
- -1 keto carboxylic acid Chemical class 0.000 claims description 8
- 150000002923 oximes Chemical class 0.000 claims description 7
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 238000010494 dissociation reaction Methods 0.000 claims description 4
- 230000005593 dissociations Effects 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 150000003672 ureas Chemical class 0.000 claims description 2
- 229930194542 Keto Natural products 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 19
- 239000007788 liquid Substances 0.000 description 14
- 239000011248 coating agent Substances 0.000 description 13
- 238000000576 coating method Methods 0.000 description 13
- DKJVSIITPZVTRO-UHFFFAOYSA-N 6,7-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(O)C(O)=CC2=C1 DKJVSIITPZVTRO-UHFFFAOYSA-N 0.000 description 10
- 235000013877 carbamide Nutrition 0.000 description 10
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- ZMUQGGLSCIDPLS-UHFFFAOYSA-N Saponin 5 Natural products COC(=O)C1(C)CCC2(CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6OC7OC(CO)C(O)C(O)C7OC8OC(C)C(O)C(O)C8O)C(C)(C)C5CCC34C)C2C1)C(=O)O ZMUQGGLSCIDPLS-UHFFFAOYSA-N 0.000 description 8
- RYECOJGRJDOGPP-UHFFFAOYSA-N Ethylurea Chemical compound CCNC(N)=O RYECOJGRJDOGPP-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 4
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical class NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 4
- OIGRHMGALPXFHI-UHFFFAOYSA-N (sulfamoylamino)ethane Chemical class CCNS(N)(=O)=O OIGRHMGALPXFHI-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000002028 premature Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- VTESCYNPUGSWKG-UHFFFAOYSA-N (4-tert-butylphenyl)hydrazine;hydrochloride Chemical compound [Cl-].CC(C)(C)C1=CC=C(N[NH3+])C=C1 VTESCYNPUGSWKG-UHFFFAOYSA-N 0.000 description 2
- WFLZZURFYPMNDF-UHFFFAOYSA-N 2-(3-nitrophenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=CC([N+]([O-])=O)=C1 WFLZZURFYPMNDF-UHFFFAOYSA-N 0.000 description 2
- UASZGGQRDGLTIQ-UHFFFAOYSA-N 2-(4-bromophenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(Br)C=C1 UASZGGQRDGLTIQ-UHFFFAOYSA-N 0.000 description 2
- 241000723346 Cinnamomum camphora Species 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 2
- 229960000846 camphor Drugs 0.000 description 2
- 229930008380 camphor Natural products 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000004715 keto acids Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000003111 oxaloamino group Chemical group C(=O)(C(=O)O)N* 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000004513 sizing Methods 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- YBADLXQNJCMBKR-UHFFFAOYSA-N (4-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C([N+]([O-])=O)C=C1 YBADLXQNJCMBKR-UHFFFAOYSA-N 0.000 description 1
- DEVUYWTZRXOMSI-UHFFFAOYSA-N (sulfamoylamino)benzene Chemical class NS(=O)(=O)NC1=CC=CC=C1 DEVUYWTZRXOMSI-UHFFFAOYSA-N 0.000 description 1
- NOXPGSDFQWSNSW-UHFFFAOYSA-N (sulfamoylamino)methane Chemical class CNS(N)(=O)=O NOXPGSDFQWSNSW-UHFFFAOYSA-N 0.000 description 1
- VKPJOERCBNIOLN-UHFFFAOYSA-N 1,3-benzoxazole-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)=NC2=C1 VKPJOERCBNIOLN-UHFFFAOYSA-N 0.000 description 1
- PDMSYILLGCPHSS-UHFFFAOYSA-N 1-carbamoyl-3-nitrourea Chemical compound NC(=O)NC(=O)N[N+]([O-])=O PDMSYILLGCPHSS-UHFFFAOYSA-N 0.000 description 1
- XPKFTIYOZUJAGA-UHFFFAOYSA-N 2,5-diethoxyaniline Chemical compound CCOC1=CC=C(OCC)C(N)=C1 XPKFTIYOZUJAGA-UHFFFAOYSA-N 0.000 description 1
- KMAMEGWTNNOKOE-UHFFFAOYSA-N 2-cyano-2-cyclohexylideneacetic acid Chemical compound OC(=O)C(C#N)=C1CCCCC1 KMAMEGWTNNOKOE-UHFFFAOYSA-N 0.000 description 1
- PTYVBEKOPJHZLJ-UHFFFAOYSA-N 2-nitropropanoic acid Chemical compound OC(=O)C(C)[N+]([O-])=O PTYVBEKOPJHZLJ-UHFFFAOYSA-N 0.000 description 1
- NSZWLHDBJNFFOF-UHFFFAOYSA-N CC(C)CN(CC(C)C)C(=O)C(N)=O Chemical compound CC(C)CN(CC(C)C)C(=O)C(N)=O NSZWLHDBJNFFOF-UHFFFAOYSA-N 0.000 description 1
- GEXAWIPVLNXYAP-UHFFFAOYSA-N CC1(C)C(C(O)=O)CCC1(CBr)C(O)=O Chemical compound CC1(C)C(C(O)=O)CCC1(CBr)C(O)=O GEXAWIPVLNXYAP-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 1
- VGGLHLAESQEWCR-UHFFFAOYSA-N N-(hydroxymethyl)urea Chemical compound NC(=O)NCO VGGLHLAESQEWCR-UHFFFAOYSA-N 0.000 description 1
- GMEHFXXZSWDEDB-UHFFFAOYSA-N N-ethylthiourea Chemical compound CCNC(N)=S GMEHFXXZSWDEDB-UHFFFAOYSA-N 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000004716 alpha keto acids Chemical class 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical class OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- FFYAVOJIYAAUNX-UHFFFAOYSA-N n,n'-diethyloxamide Chemical compound CCNC(=O)C(=O)NCC FFYAVOJIYAAUNX-UHFFFAOYSA-N 0.000 description 1
- FTWUXYZHDFCGSV-UHFFFAOYSA-N n,n'-diphenyloxamide Chemical compound C=1C=CC=CC=1NC(=O)C(=O)NC1=CC=CC=C1 FTWUXYZHDFCGSV-UHFFFAOYSA-N 0.000 description 1
- JOWMUPQBELRFRZ-UHFFFAOYSA-N n-carbamoylformamide Chemical compound NC(=O)NC=O JOWMUPQBELRFRZ-UHFFFAOYSA-N 0.000 description 1
- CJJXBVHJNDUGDC-UHFFFAOYSA-N n-hydroxy-2-oxo-2-phenylacetamide Chemical compound ONC(=O)C(=O)C1=CC=CC=C1 CJJXBVHJNDUGDC-UHFFFAOYSA-N 0.000 description 1
- GPUMPJNVOBTUFM-UHFFFAOYSA-N naphthalene-1,2,3-trisulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC2=C1 GPUMPJNVOBTUFM-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- RGHXWDVNBYKJQH-UHFFFAOYSA-N nitroacetic acid Chemical compound OC(=O)C[N+]([O-])=O RGHXWDVNBYKJQH-UHFFFAOYSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical class NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- QUBQYFYWUJJAAK-UHFFFAOYSA-N oxymethurea Chemical compound OCNC(=O)NCO QUBQYFYWUJJAAK-UHFFFAOYSA-N 0.000 description 1
- 229950005308 oxymethurea Drugs 0.000 description 1
- ZFLIKDUSUDBGCD-UHFFFAOYSA-N parabanic acid Chemical compound O=C1NC(=O)C(=O)N1 ZFLIKDUSUDBGCD-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- IAAKNVCARVEIFS-UHFFFAOYSA-M sodium;4-hydroxynaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(O)=CC=C(S([O-])(=O)=O)C2=C1 IAAKNVCARVEIFS-UHFFFAOYSA-M 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/61—Compositions containing diazo compounds as photosensitive substances with non-macromolecular additives
- G03C1/615—Substances generating bases
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR811009A FR1249913A (fr) | 1959-11-23 | 1959-11-23 | Produit diazotype développable par la chaleur |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1200681B true DE1200681B (de) | 1965-09-09 |
Family
ID=8721670
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE20221A Pending DE1200681B (de) | 1959-11-23 | 1960-11-22 | Durch Waerme entwickelbares Diazo-typiematerial |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3453112A (enExample) |
| BE (1) | BE597307A (enExample) |
| DE (1) | DE1200681B (enExample) |
| FR (1) | FR1249913A (enExample) |
| GB (1) | GB909491A (enExample) |
| LU (1) | LU39442A1 (enExample) |
| NL (1) | NL258232A (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL261709A (enExample) * | 1960-03-04 | |||
| BE625554A (enExample) * | 1961-12-01 | |||
| DE1251655B (enExample) * | 1961-12-21 | |||
| US3153592A (en) * | 1962-05-15 | 1964-10-20 | Dietzgen Co Eugene | Complex salt diazotype photoprinting materials |
| US3169067A (en) * | 1962-08-28 | 1965-02-09 | Itek Corp | Heat developable diazotype material comprising an unsymmetrical urea as the base release agent |
| US3203797A (en) * | 1962-10-16 | 1965-08-31 | Andrews Paper & Chem Co Inc | Thermal diazotype method and developer sheet for use therein |
| US3203798A (en) * | 1962-11-28 | 1965-08-31 | Andrews Paper & Chem Co Inc | Diazotype transfer developing method |
| NL301316A (enExample) * | 1962-12-27 | |||
| US3157503A (en) * | 1963-03-19 | 1964-11-17 | Keuffel & Esser Co | Diazotype reproduction materials |
| US3199982A (en) * | 1963-03-19 | 1965-08-10 | Keuffel & Esser Co | Diazotype reproduction material |
| GB1070625A (en) * | 1963-04-27 | 1967-06-01 | Konishiroku Photo Ind | Alkali-generating compositions used in developing diazotype materials |
| US3316092A (en) * | 1963-05-09 | 1967-04-25 | Dietzgen Co Eugene | Diazotype material comprising a metal sulfate nitrogenous compound and polymeric anhydride |
| US3326686A (en) * | 1963-05-31 | 1967-06-20 | Gen Aniline & Film Corp | Light-sensitive two-component diazotype materials adapted for heat development |
| DE1447736A1 (de) * | 1964-02-29 | 1969-01-09 | Kalle Ag | Durch Waerme entwickelbares Zweikomponenten-Diazotypie-Kopiermaterial und Verfahren zu dessen Herstellung |
| US3389995A (en) * | 1964-09-15 | 1968-06-25 | Gen Aniline & Film Corp | Two-component heat developable diazotypes containing amidine compounds |
| US3431109A (en) * | 1964-10-16 | 1969-03-04 | Addressograph Multigraph | Heat sensitive diazotype materials |
| US3420665A (en) * | 1965-08-30 | 1969-01-07 | Addressograph Multigraph | Heat-sensitive diazotype materials |
| DE1572048C3 (de) * | 1965-09-10 | 1978-10-26 | Hoechst Ag, 6000 Frankfurt | Wärmeentwickelbares Diazotypiematerial |
| US3529964A (en) * | 1966-01-14 | 1970-09-22 | L L Ridgway Enterprises Inc | Heat developable diazo compositions and diazotype reproduction media |
| US3873316A (en) * | 1970-06-11 | 1975-03-25 | Kalle Ag | Process for the production of a light-sensitive copying material having a copper-containing support, and copying material so produced |
| US3985562A (en) * | 1973-05-18 | 1976-10-12 | Agfa-Gevaert N.V. | Diazo recording process and material |
| US4401744A (en) * | 1977-09-22 | 1983-08-30 | Andrews Paper & Chemical Co., Inc. | Diazotype compositions with improved printing performance |
| FR2470984B1 (fr) * | 1979-11-28 | 1986-06-13 | Schaeffer Andre | Materiau diazotype developpable par la vapeur, l'eau ou la chaleur |
| US4307171A (en) * | 1980-06-18 | 1981-12-22 | James River Graphics, Inc. | Negative-working diazo type photoreproduction having improved D-min and line acuity |
| FR2495343B1 (fr) * | 1980-12-02 | 1987-02-20 | Regma | Materiaux diazotypes thermodeveloppables contenant un precurseur d'activateur liberant lors du chauffage une base forte. procede de diazotypie mettant en oeuvre ces materiaux |
| JPS57125092A (en) * | 1981-01-28 | 1982-08-04 | Ricoh Co Ltd | Diazonium series heat sensitive recording material |
| US4419432A (en) * | 1982-09-22 | 1983-12-06 | Keuffel & Esser Company | Diazotype composition stabilization |
| JPS59180537A (ja) * | 1983-03-31 | 1984-10-13 | Fuji Photo Film Co Ltd | 熱現像感光材料用塩基プレカ−サ− |
| JPS59180549A (ja) * | 1983-03-31 | 1984-10-13 | Fuji Photo Film Co Ltd | 熱現像カラ−感光材料 |
| JPS59195237A (ja) * | 1983-04-20 | 1984-11-06 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6142650A (ja) * | 1984-08-07 | 1986-03-01 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6151140A (ja) * | 1984-08-21 | 1986-03-13 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6152639A (ja) * | 1984-08-22 | 1986-03-15 | Fuji Photo Film Co Ltd | 熱現像写真感光材料 |
| JPS6153635A (ja) * | 1984-08-24 | 1986-03-17 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6153636A (ja) * | 1984-08-24 | 1986-03-17 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6153638A (ja) * | 1984-08-24 | 1986-03-17 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6153640A (ja) * | 1984-08-24 | 1986-03-17 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6153639A (ja) * | 1984-08-24 | 1986-03-17 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6155645A (ja) * | 1984-08-25 | 1986-03-20 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6155644A (ja) * | 1984-08-25 | 1986-03-20 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS6184640A (ja) * | 1984-10-02 | 1986-04-30 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| US20070078190A1 (en) * | 2005-09-30 | 2007-04-05 | Distefano Frank V | Use of 2,3-dihydroxynaphthalene-6-sulfonic acid salts as dispersants |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2653091A (en) * | 1950-01-31 | 1953-09-22 | Rca Corp | Photographic diazotype composition and heat development thereof |
| US2681277A (en) * | 1953-01-28 | 1954-06-15 | Morrison Montford | Heat sensitive recording element |
| US2732299A (en) * | 1952-07-22 | 1956-01-24 | Light sensitive |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US737711A (en) * | 1902-03-24 | 1903-09-01 | William Condon | Anti-induction telephone system. |
| FR959577A (enExample) * | 1943-09-15 | 1950-03-31 | ||
| US2657141A (en) * | 1947-07-14 | 1953-10-27 | Grinten Chem L V D | Diazotype developer composition containing a potassium borate and process of using same |
| US2495827A (en) * | 1947-08-06 | 1950-01-31 | Gen Aniline & Film Corp | Diazotype materials stabilized with an alpha-alkylidene-polymethylene dicarboxylic acid |
| NL71256C (enExample) * | 1948-10-01 | |||
| US2727820A (en) * | 1952-04-29 | 1955-12-20 | Gen Aniline & Film Corp | Light-sensitive diazotype layers containing carboxamides |
| NL94963C (enExample) * | 1952-05-13 | |||
| NL279582A (enExample) * | 1958-07-03 |
-
0
- BE BE597307D patent/BE597307A/xx unknown
- NL NL258232D patent/NL258232A/xx unknown
-
1959
- 1959-11-23 FR FR811009A patent/FR1249913A/fr not_active Expired
-
1960
- 1960-11-21 LU LU39442D patent/LU39442A1/xx unknown
- 1960-11-21 GB GB39902/60A patent/GB909491A/en not_active Expired
- 1960-11-22 DE DEE20221A patent/DE1200681B/de active Pending
- 1960-11-22 US US70918A patent/US3453112A/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2653091A (en) * | 1950-01-31 | 1953-09-22 | Rca Corp | Photographic diazotype composition and heat development thereof |
| US2732299A (en) * | 1952-07-22 | 1956-01-24 | Light sensitive | |
| US2681277A (en) * | 1953-01-28 | 1954-06-15 | Morrison Montford | Heat sensitive recording element |
Also Published As
| Publication number | Publication date |
|---|---|
| LU39442A1 (enExample) | 1961-01-21 |
| US3453112A (en) | 1969-07-01 |
| GB909491A (en) | 1962-10-31 |
| NL258232A (enExample) | |
| FR1249913A (fr) | 1961-01-06 |
| BE597307A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1200681B (de) | Durch Waerme entwickelbares Diazo-typiematerial | |
| DE3134113C2 (de) | Thermisch entwickelbares Diazotypiematerial | |
| DE2020939B2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE1100464B (de) | Kopierschichten zur Herstellung von Bildern durch Einwirkung von Waerme | |
| DE1148072B (de) | Verfahren zum Modifizieren von nitrilgruppenhaltigen hochmolekularen organischen Stoffen durch eine anorganische Stickstoffbase | |
| DE1236331B (de) | Zweikomponenten-Diazotypiematerial | |
| DE1572103C3 (de) | Warmeentwickelbares Diazotypie material | |
| DE1793501A1 (de) | Neue carbonsaeureamidgruppenhaltige Verbindungen,Verfahren zu ihrer Herstellung und Verwendung | |
| DE1671541B2 (de) | Verfahren zur Herstellung von druckempfindlichen Kopierpapieren | |
| DE893143C (de) | Verfahren zur Herstellung von photographischen Farbbildern | |
| DE1195162B (de) | Aufzeichnungsmaterial fuer das Vesikular-verfahren | |
| DE869007C (de) | Stabilisiertes Lichtpausmaterial fuer das Diazotypieverfahren | |
| DE1597520A1 (de) | Waermeentwickelbares Diazotypie-Material | |
| DE1145644B (de) | Thermographisches Kopiermaterial | |
| DE2553136C3 (de) | Zweikomponenten-Diazotypiematerial | |
| DE1572088C3 (de) | Zweikomponenten-Diazotypiematerial für die Herstellung von Zwischenoriginalen | |
| DE1572158A1 (de) | Bilderwiedergabemedium fuer positive Diazotypien | |
| DE1447713C (de) | Verfahren zum Herstellen von Diazo typiekopien | |
| DE2123282A1 (de) | Wärmeempfindliches Kopiermaterial | |
| DE2134087A1 (de) | Neue Derivate des Spiramycins und ein Verfahren zu deren Herstellung | |
| DE1815219C3 (de) | Lichtempfindliche wässrige Lösung und ihre Verwendung zur Herstellung von wärmeentwickelbaren Zweikomponenten-Diazotypiemateri alien | |
| DE1285305B (de) | Zweikomponenten-Diazotypiematerial | |
| DE1597617A1 (de) | Zweikomponenten-Diazotypiematerial | |
| AT138621B (de) | Verfahren zur Herstellung von Diazodrucken. | |
| DE1768667A1 (de) | Verfahren zur Herstellung von aromatischen Nitroverbindungen |