PL220721B1 - Związki będące pochodnymi N-(indolilo-2-etylo) benzyloaminy, kompozycja farmaceutyczna oraz zastosowanie - Google Patents
Związki będące pochodnymi N-(indolilo-2-etylo) benzyloaminy, kompozycja farmaceutyczna oraz zastosowanieInfo
- Publication number
- PL220721B1 PL220721B1 PL364458A PL36445802A PL220721B1 PL 220721 B1 PL220721 B1 PL 220721B1 PL 364458 A PL364458 A PL 364458A PL 36445802 A PL36445802 A PL 36445802A PL 220721 B1 PL220721 B1 PL 220721B1
- Authority
- PL
- Poland
- Prior art keywords
- found
- calcd
- mmol
- anal
- formula
- Prior art date
Links
- 239000005557 antagonist Substances 0.000 title abstract description 3
- 150000003939 benzylamines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 361
- 238000000034 method Methods 0.000 claims description 390
- -1 3,3-difluoropropyl Chemical group 0.000 claims description 225
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 62
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 150000003839 salts Chemical class 0.000 claims description 27
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 claims description 25
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 claims description 24
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical group 0.000 claims description 15
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 14
- 150000002431 hydrogen Chemical group 0.000 claims description 13
- 238000011282 treatment Methods 0.000 claims description 13
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 208000010877 cognitive disease Diseases 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 claims description 7
- YBAWYTYNMZWMMJ-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine Chemical compound FC(F)C(F)(F)COC1=CC=CC(CNCCC=2C3=CC=C(F)C=C3NC=2)=C1 YBAWYTYNMZWMMJ-UHFFFAOYSA-N 0.000 claims description 6
- 208000024827 Alzheimer disease Diseases 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 208000028698 Cognitive impairment Diseases 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 206010012289 Dementia Diseases 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 208000027061 mild cognitive impairment Diseases 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- KXOQNPANAFXKTN-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride Chemical group Cl.FC(F)C(F)(F)COC1=CC=CC(CNCCC=2C3=CC=C(F)C=C3NC=2)=C1 KXOQNPANAFXKTN-UHFFFAOYSA-N 0.000 claims 1
- 108091005435 5-HT6 receptors Proteins 0.000 abstract description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 343
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 297
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 261
- 238000004458 analytical method Methods 0.000 description 199
- 238000005481 NMR spectroscopy Methods 0.000 description 190
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 158
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 155
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 138
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 138
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 127
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 123
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 121
- 238000003756 stirring Methods 0.000 description 119
- 235000019439 ethyl acetate Nutrition 0.000 description 112
- 238000001038 ionspray mass spectrometry Methods 0.000 description 111
- 235000008504 concentrate Nutrition 0.000 description 110
- 239000012141 concentrate Substances 0.000 description 110
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 104
- 239000000243 solution Substances 0.000 description 104
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 102
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 101
- 239000000284 extract Substances 0.000 description 100
- 238000006243 chemical reaction Methods 0.000 description 99
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 97
- 239000007787 solid Substances 0.000 description 87
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 72
- 239000000741 silica gel Substances 0.000 description 72
- 229910002027 silica gel Inorganic materials 0.000 description 72
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 70
- 239000002904 solvent Substances 0.000 description 70
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 68
- 239000000203 mixture Substances 0.000 description 68
- 239000003921 oil Substances 0.000 description 66
- 235000019198 oils Nutrition 0.000 description 66
- 239000012044 organic layer Substances 0.000 description 63
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 60
- 239000012267 brine Substances 0.000 description 57
- 230000002829 reductive effect Effects 0.000 description 55
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 52
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 48
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- 239000011541 reaction mixture Substances 0.000 description 46
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 43
- 238000010992 reflux Methods 0.000 description 42
- 235000011121 sodium hydroxide Nutrition 0.000 description 41
- 229910052938 sodium sulfate Inorganic materials 0.000 description 40
- 235000011152 sodium sulphate Nutrition 0.000 description 40
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 238000001704 evaporation Methods 0.000 description 38
- 230000008020 evaporation Effects 0.000 description 38
- 239000007832 Na2SO4 Substances 0.000 description 37
- 239000010410 layer Substances 0.000 description 37
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 36
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 34
- 235000019341 magnesium sulphate Nutrition 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 31
- 239000002585 base Substances 0.000 description 31
- 239000002253 acid Substances 0.000 description 30
- 238000001914 filtration Methods 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- 239000012279 sodium borohydride Substances 0.000 description 26
- 229910000033 sodium borohydride Inorganic materials 0.000 description 26
- 238000004587 chromatography analysis Methods 0.000 description 25
- 239000003053 toxin Substances 0.000 description 25
- 231100000765 toxin Toxicity 0.000 description 25
- 108700012359 toxins Proteins 0.000 description 25
- 239000000706 filtrate Substances 0.000 description 24
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 150000001412 amines Chemical class 0.000 description 23
- 238000002844 melting Methods 0.000 description 23
- 230000008018 melting Effects 0.000 description 23
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 22
- 238000000605 extraction Methods 0.000 description 22
- 238000001953 recrystallisation Methods 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 20
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 18
- 239000002808 molecular sieve Substances 0.000 description 18
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 18
- 150000001408 amides Chemical class 0.000 description 17
- 239000012467 final product Substances 0.000 description 17
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 17
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 16
- 239000003153 chemical reaction reagent Substances 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- 238000010791 quenching Methods 0.000 description 16
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 15
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 235000011114 ammonium hydroxide Nutrition 0.000 description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 14
- 150000003840 hydrochlorides Chemical class 0.000 description 13
- 238000005192 partition Methods 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 13
- 238000001665 trituration Methods 0.000 description 13
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000012153 distilled water Substances 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 11
- 150000001299 aldehydes Chemical class 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 11
- 239000003638 chemical reducing agent Substances 0.000 description 11
- 230000003920 cognitive function Effects 0.000 description 11
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 11
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 11
- 239000012280 lithium aluminium hydride Substances 0.000 description 11
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 239000000543 intermediate Substances 0.000 description 10
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 10
- 150000003891 oxalate salts Chemical class 0.000 description 10
- 235000011181 potassium carbonates Nutrition 0.000 description 10
- 229940044551 receptor antagonist Drugs 0.000 description 10
- 239000002464 receptor antagonist Substances 0.000 description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 150000008064 anhydrides Chemical class 0.000 description 9
- 239000012458 free base Substances 0.000 description 9
- 150000004820 halides Chemical class 0.000 description 9
- 238000004128 high performance liquid chromatography Methods 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 9
- 235000006408 oxalic acid Nutrition 0.000 description 9
- 230000009467 reduction Effects 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- JNYLMODTPLSLIF-UHFFFAOYSA-N 6-(trifluoromethyl)pyridine-3-carboxylic acid Chemical group OC(=O)C1=CC=C(C(F)(F)F)N=C1 JNYLMODTPLSLIF-UHFFFAOYSA-N 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 238000012546 transfer Methods 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 229910010084 LiAlH4 Inorganic materials 0.000 description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 7
- 230000006399 behavior Effects 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 229960004170 clozapine Drugs 0.000 description 7
- QZUDBNBUXVUHMW-UHFFFAOYSA-N clozapine Chemical compound C1CN(C)CCN1C1=NC2=CC(Cl)=CC=C2NC2=CC=CC=C12 QZUDBNBUXVUHMW-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 238000006268 reductive amination reaction Methods 0.000 description 7
- 229940124530 sulfonamide Drugs 0.000 description 7
- LOCQRDBFWSXQQI-UHFFFAOYSA-N 5-chloro-n-(4-methoxy-3-piperazin-1-ylphenyl)-3-methyl-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C(NS(=O)(=O)C2=C(C3=CC(Cl)=CC=C3S2)C)C=C1N1CCNCC1 LOCQRDBFWSXQQI-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 6
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 6
- 229910000024 caesium carbonate Inorganic materials 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 6
- 238000005984 hydrogenation reaction Methods 0.000 description 6
- 229960005017 olanzapine Drugs 0.000 description 6
- KVWDHTXUZHCGIO-UHFFFAOYSA-N olanzapine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2NC2=C1C=C(C)S2 KVWDHTXUZHCGIO-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 6
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- GFFJBSXKNZDYOJ-UHFFFAOYSA-N 3-propoxybenzaldehyde Chemical compound CCCOC1=CC=CC(C=O)=C1 GFFJBSXKNZDYOJ-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 230000001713 cholinergic effect Effects 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- VMJNTFXCTXAXTC-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-5-carbonitrile Chemical group C1=C(C#N)C=C2OC(F)(F)OC2=C1 VMJNTFXCTXAXTC-UHFFFAOYSA-N 0.000 description 4
- VYPYKCPWNPPBBX-UHFFFAOYSA-N 2-(3-bromophenyl)-1,3-dioxolane Chemical compound BrC1=CC=CC(C2OCCO2)=C1 VYPYKCPWNPPBBX-UHFFFAOYSA-N 0.000 description 4
- BQTOKMYKZPCPRW-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)ethanamine Chemical compound FC1=CC=C2C(CCN)=CNC2=C1 BQTOKMYKZPCPRW-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 4
- 239000005695 Ammonium acetate Substances 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- MPWCLDBDSYCYOE-UHFFFAOYSA-N [3-(1,3-dioxolan-2-yl)phenyl]-phenylmethanol Chemical compound C=1C=CC(C2OCCO2)=CC=1C(O)C1=CC=CC=C1 MPWCLDBDSYCYOE-UHFFFAOYSA-N 0.000 description 4
- 125000003368 amide group Chemical group 0.000 description 4
- 238000010640 amide synthesis reaction Methods 0.000 description 4
- 229940043376 ammonium acetate Drugs 0.000 description 4
- 235000019257 ammonium acetate Nutrition 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000003693 atypical antipsychotic agent Substances 0.000 description 4
- 229940127236 atypical antipsychotics Drugs 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 230000000848 glutamatergic effect Effects 0.000 description 4
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 150000004715 keto acids Chemical class 0.000 description 4
- 150000002688 maleic acid derivatives Chemical class 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 230000000698 schizophrenic effect Effects 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- QQFKXSBDZGBRJZ-UHFFFAOYSA-N 2-(3-phenylsulfanylphenyl)-1,3-dioxolane Chemical compound O1CCOC1C1=CC=CC(SC=2C=CC=CC=2)=C1 QQFKXSBDZGBRJZ-UHFFFAOYSA-N 0.000 description 3
- XOMAPQAXSMLPLK-UHFFFAOYSA-N 2-(4,6-difluoro-5-methoxy-1h-indol-3-yl)ethanamine Chemical compound COC1=C(F)C=C2NC=C(CCN)C2=C1F XOMAPQAXSMLPLK-UHFFFAOYSA-N 0.000 description 3
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 3
- VXWVFZFZYXOBTA-UHFFFAOYSA-N 5-bromo-1h-indole Chemical compound BrC1=CC=C2NC=CC2=C1 VXWVFZFZYXOBTA-UHFFFAOYSA-N 0.000 description 3
- 229930000680 A04AD01 - Scopolamine Natural products 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- STECJAGHUSJQJN-GAUPFVANSA-N Hyoscine Natural products C1([C@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-GAUPFVANSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- STECJAGHUSJQJN-UHFFFAOYSA-N N-Methyl-scopolamin Natural products C1C(C2C3O2)N(C)C3CC1OC(=O)C(CO)C1=CC=CC=C1 STECJAGHUSJQJN-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910000085 borane Inorganic materials 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 3
- 239000000812 cholinergic antagonist Substances 0.000 description 3
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 229960003878 haloperidol Drugs 0.000 description 3
- 238000007871 hydride transfer reaction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- IENZCGNHSIMFJE-UHFFFAOYSA-N indole-5-carboxylic acid Chemical compound OC(=O)C1=CC=C2NC=CC2=C1 IENZCGNHSIMFJE-UHFFFAOYSA-N 0.000 description 3
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 3
- PSQACVVEOFYRSR-UHFFFAOYSA-N methyl 3-(2-nitroethyl)-1h-indole-5-carboxylate Chemical compound COC(=O)C1=CC=C2NC=C(CC[N+]([O-])=O)C2=C1 PSQACVVEOFYRSR-UHFFFAOYSA-N 0.000 description 3
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 235000011118 potassium hydroxide Nutrition 0.000 description 3
- 210000002442 prefrontal cortex Anatomy 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 229960001534 risperidone Drugs 0.000 description 3
- RAPZEAPATHNIPO-UHFFFAOYSA-N risperidone Chemical compound FC1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4CCCCC4=NC=3C)=NOC2=C1 RAPZEAPATHNIPO-UHFFFAOYSA-N 0.000 description 3
- STECJAGHUSJQJN-FWXGHANASA-N scopolamine Chemical compound C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-FWXGHANASA-N 0.000 description 3
- 229960002646 scopolamine Drugs 0.000 description 3
- 239000003751 serotonin 6 antagonist Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- SQNJTVRBGMQSBC-UHFFFAOYSA-N (5-bromoindol-1-yl)-tri(propan-2-yl)silane Chemical compound BrC1=CC=C2N([Si](C(C)C)(C(C)C)C(C)C)C=CC2=C1 SQNJTVRBGMQSBC-UHFFFAOYSA-N 0.000 description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 2
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 2
- JKOVQYWMFZTKMX-ONEGZZNKSA-N (e)-n,n-dimethyl-2-nitroethenamine Chemical group CN(C)\C=C\[N+]([O-])=O JKOVQYWMFZTKMX-ONEGZZNKSA-N 0.000 description 2
- HHWLNWSVKHLZDB-UHFFFAOYSA-N 1,3-difluoro-2-methoxy-5-nitrobenzene Chemical compound COC1=C(F)C=C([N+]([O-])=O)C=C1F HHWLNWSVKHLZDB-UHFFFAOYSA-N 0.000 description 2
- KCQNZMIXFGHJLL-UHFFFAOYSA-N 1-(2-amino-3-chlorophenyl)-2-chloroethanone Chemical compound NC1=C(Cl)C=CC=C1C(=O)CCl KCQNZMIXFGHJLL-UHFFFAOYSA-N 0.000 description 2
- RENGPKSYEWUNJV-UHFFFAOYSA-N 1-(6-amino-5-chloro-6-fluorocyclohexa-2,4-dien-1-yl)-2-chloroethanone Chemical compound NC1(F)C(C(=O)CCl)C=CC=C1Cl RENGPKSYEWUNJV-UHFFFAOYSA-N 0.000 description 2
- UWPUJVOSEQMMQE-UHFFFAOYSA-N 1-bromo-4,5-difluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(F)=C(F)C=C1Br UWPUJVOSEQMMQE-UHFFFAOYSA-N 0.000 description 2
- APZRMJJULAMQAA-UHFFFAOYSA-N 1-bromo-4-fluoro-5-methoxy-2-nitrobenzene Chemical compound COC1=CC(Br)=C([N+]([O-])=O)C=C1F APZRMJJULAMQAA-UHFFFAOYSA-N 0.000 description 2
- QQIQNKQBMWNOQV-UHFFFAOYSA-N 1-methyl-2-nitro-4-(trifluoromethoxy)benzene Chemical compound CC1=CC=C(OC(F)(F)F)C=C1[N+]([O-])=O QQIQNKQBMWNOQV-UHFFFAOYSA-N 0.000 description 2
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- VSPBWOAEHQDXRD-UHFFFAOYSA-N 1h-indole-6-carbaldehyde Chemical compound O=CC1=CC=C2C=CNC2=C1 VSPBWOAEHQDXRD-UHFFFAOYSA-N 0.000 description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical compound CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- BFAZZMBRSNHKTJ-UHFFFAOYSA-N 2-(2,4-difluoro-3-methoxy-6-nitrophenyl)acetonitrile Chemical compound COC1=C(F)C=C([N+]([O-])=O)C(CC#N)=C1F BFAZZMBRSNHKTJ-UHFFFAOYSA-N 0.000 description 2
- NRHVNPYOTNGECT-UHFFFAOYSA-N 2-(3-chlorophenyl)ethanamine Chemical compound NCCC1=CC=CC(Cl)=C1 NRHVNPYOTNGECT-UHFFFAOYSA-N 0.000 description 2
- CFUNIAJICOWYAK-UHFFFAOYSA-N 2-(4,6-difluoro-5-methoxy-1-methylindol-3-yl)ethanamine Chemical compound COC1=C(F)C=C2N(C)C=C(CCN)C2=C1F CFUNIAJICOWYAK-UHFFFAOYSA-N 0.000 description 2
- QTNVDKAISCZLHR-UHFFFAOYSA-N 2-(4-fluoro-1h-indol-3-yl)ethanamine Chemical compound C1=CC(F)=C2C(CCN)=CNC2=C1 QTNVDKAISCZLHR-UHFFFAOYSA-N 0.000 description 2
- WMBARRJMPVVQEZ-UHFFFAOYSA-N 2-(4-methoxy-1h-indol-3-yl)ethanamine Chemical compound COC1=CC=CC2=C1C(CCN)=CN2 WMBARRJMPVVQEZ-UHFFFAOYSA-N 0.000 description 2
- PXSTUZGQOUDZBA-UHFFFAOYSA-N 2-(4-phenyl-1h-indol-3-yl)ethanamine Chemical compound C=12C(CCN)=CNC2=CC=CC=1C1=CC=CC=C1 PXSTUZGQOUDZBA-UHFFFAOYSA-N 0.000 description 2
- PPVUAHKEWMZGKP-UHFFFAOYSA-N 2-(5-methoxy-1h-indol-3-yl)-n-[(3-phenoxyphenyl)methyl]ethanamine Chemical compound C12=CC(OC)=CC=C2NC=C1CCNCC(C=1)=CC=CC=1OC1=CC=CC=C1 PPVUAHKEWMZGKP-UHFFFAOYSA-N 0.000 description 2
- BAYBZUUQTBZGPJ-UHFFFAOYSA-N 2-(5-nitro-1h-indol-3-yl)acetonitrile Chemical compound [O-][N+](=O)C1=CC=C2NC=C(CC#N)C2=C1 BAYBZUUQTBZGPJ-UHFFFAOYSA-N 0.000 description 2
- QRRCPNVCYNCBOA-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)-n-methylethanamine Chemical compound ClC1=CC=C2C(CCNC)=CNC2=C1 QRRCPNVCYNCBOA-UHFFFAOYSA-N 0.000 description 2
- LFASSSGQIDKFOU-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)ethanamine Chemical compound ClC1=CC=C2C(CCN)=CNC2=C1 LFASSSGQIDKFOU-UHFFFAOYSA-N 0.000 description 2
- CCTPUEOJGKAFCF-UHFFFAOYSA-N 2-(6-chloro-5-methoxy-1h-indol-3-yl)ethanamine Chemical compound C1=C(Cl)C(OC)=CC2=C1NC=C2CCN CCTPUEOJGKAFCF-UHFFFAOYSA-N 0.000 description 2
- BXNWEGDYEWCXEC-UHFFFAOYSA-N 2-(6-fluoro-5-methoxy-1h-indol-3-yl)ethanamine Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2CCN BXNWEGDYEWCXEC-UHFFFAOYSA-N 0.000 description 2
- RYEPBCIFDBYASK-UHFFFAOYSA-N 2-(7-fluoro-1h-indol-3-yl)-n-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine Chemical compound C=1NC=2C(F)=CC=CC=2C=1CCNCC1=CC=CC(OCC(F)(F)F)=C1 RYEPBCIFDBYASK-UHFFFAOYSA-N 0.000 description 2
- WOGLSXHEMAVOPJ-UHFFFAOYSA-N 2-(7-fluoro-1h-indol-3-yl)-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine Chemical compound FC(F)C(F)(F)COC1=CC=CC(CNCCC=2C3=CC=CC(F)=C3NC=2)=C1 WOGLSXHEMAVOPJ-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- ZTZNMQKDNNKJNH-UHFFFAOYSA-N 2-[2-(5-amino-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(N)C=C21 ZTZNMQKDNNKJNH-UHFFFAOYSA-N 0.000 description 2
- QXPSOWPOHSZKEK-UHFFFAOYSA-N 2-[2-(5-hydroxy-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(O)C=C21 QXPSOWPOHSZKEK-UHFFFAOYSA-N 0.000 description 2
- WWHZNYPUDWFMNV-UHFFFAOYSA-N 2-[2-(5-nitro-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C([N+](=O)[O-])C=C21 WWHZNYPUDWFMNV-UHFFFAOYSA-N 0.000 description 2
- DWNQRWHWCUVEOV-UHFFFAOYSA-N 2-[2-(5-phenylmethoxy-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC(C1=C2)=CNC1=CC=C2OCC1=CC=CC=C1 DWNQRWHWCUVEOV-UHFFFAOYSA-N 0.000 description 2
- DOXDIULBMDJGTH-UHFFFAOYSA-N 2-[2-[5-hydroxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]isoindole-1,3-dione Chemical compound C12=CC(O)=CC=C2N([Si](C(C)C)(C(C)C)C(C)C)C=C1CCN1C(=O)C2=CC=CC=C2C1=O DOXDIULBMDJGTH-UHFFFAOYSA-N 0.000 description 2
- DMYIBYJYWHZYKT-UHFFFAOYSA-N 2-[2-[5-phenylmethoxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]isoindole-1,3-dione Chemical compound C=1C=C2N([Si](C(C)C)(C(C)C)C(C)C)C=C(CCN3C(C4=CC=CC=C4C3=O)=O)C2=CC=1OCC1=CC=CC=C1 DMYIBYJYWHZYKT-UHFFFAOYSA-N 0.000 description 2
- LRLZGDGMINMYKD-UHFFFAOYSA-N 2-[2-[5-propoxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CN([Si](C(C)C)(C(C)C)C(C)C)C2=CC=C(OCCC)C=C21 LRLZGDGMINMYKD-UHFFFAOYSA-N 0.000 description 2
- GPUGPVYYTZOIOC-UHFFFAOYSA-N 2-[2-nitro-5-(trifluoromethyl)phenyl]acetonitrile Chemical compound [O-][N+](=O)C1=CC=C(C(F)(F)F)C=C1CC#N GPUGPVYYTZOIOC-UHFFFAOYSA-N 0.000 description 2
- OMDUIRZSXDJSEX-UHFFFAOYSA-N 2-[5-(trifluoromethoxy)-1h-indol-3-yl]ethanamine Chemical compound C1=C(OC(F)(F)F)C=C2C(CCN)=CNC2=C1 OMDUIRZSXDJSEX-UHFFFAOYSA-N 0.000 description 2
- SSZQGYKPMCRTCS-UHFFFAOYSA-N 2-[6-(trifluoromethyl)-1h-indol-3-yl]ethanamine Chemical compound FC(F)(F)C1=CC=C2C(CCN)=CNC2=C1 SSZQGYKPMCRTCS-UHFFFAOYSA-N 0.000 description 2
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 2
- SVYWEZZHXINQHC-UHFFFAOYSA-N 2-bromo-5-fluoro-4-methoxyaniline Chemical compound COC1=CC(Br)=C(N)C=C1F SVYWEZZHXINQHC-UHFFFAOYSA-N 0.000 description 2
- YGNRDKOTFCNFSP-UHFFFAOYSA-N 2-fluoro-3-phenoxybenzaldehyde Chemical compound C1=CC=C(C=O)C(F)=C1OC1=CC=CC=C1 YGNRDKOTFCNFSP-UHFFFAOYSA-N 0.000 description 2
- COHVZTXZLIRSTM-UHFFFAOYSA-N 2-methyl-1-nitro-4-phenoxybenzene Chemical compound C1=C([N+]([O-])=O)C(C)=CC(OC=2C=CC=CC=2)=C1 COHVZTXZLIRSTM-UHFFFAOYSA-N 0.000 description 2
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 2
- DQSUFSXLMNHWJC-UHFFFAOYSA-N 2-oxo-2-(5-phenoxy-1h-indol-3-yl)acetamide Chemical compound C1=C2C(C(=O)C(=O)N)=CNC2=CC=C1OC1=CC=CC=C1 DQSUFSXLMNHWJC-UHFFFAOYSA-N 0.000 description 2
- NTFSFVGWZXQBIC-UHFFFAOYSA-N 2-oxo-2-(5-phenoxy-1h-indol-3-yl)acetyl chloride Chemical compound C1=C2C(C(=O)C(=O)Cl)=CNC2=CC=C1OC1=CC=CC=C1 NTFSFVGWZXQBIC-UHFFFAOYSA-N 0.000 description 2
- XQTHZBKUIVFAST-UHFFFAOYSA-N 3,3,3-trifluoropropyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCC(F)(F)F)C=C1 XQTHZBKUIVFAST-UHFFFAOYSA-N 0.000 description 2
- NXXGZNXPUZNCGV-UHFFFAOYSA-N 3-(2,2,3,3-tetrafluoropropoxy)benzaldehyde Chemical compound FC(F)C(F)(F)COC1=CC=CC(C=O)=C1 NXXGZNXPUZNCGV-UHFFFAOYSA-N 0.000 description 2
- NYEZIGVQPDFDQF-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCN)=CNC2=C1 NYEZIGVQPDFDQF-UHFFFAOYSA-N 0.000 description 2
- CQDDYYRKWJNSCZ-UHFFFAOYSA-N 3-(2-nitroethenyl)-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(C=C[N+](=O)[O-])=CNC2=C1 CQDDYYRKWJNSCZ-UHFFFAOYSA-N 0.000 description 2
- CNEFAFFOYZAVCK-UHFFFAOYSA-N 3-(2-nitroethenyl)-6-phenylmethoxy-1h-indole Chemical compound C=1C=C2C(C=C[N+](=O)[O-])=CNC2=CC=1OCC1=CC=CC=C1 CNEFAFFOYZAVCK-UHFFFAOYSA-N 0.000 description 2
- TXAMZNCSZNYRCY-UHFFFAOYSA-N 3-(2-nitroethyl)-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CC[N+](=O)[O-])=CNC2=C1 TXAMZNCSZNYRCY-UHFFFAOYSA-N 0.000 description 2
- BGVVKEHXDLBHMD-UHFFFAOYSA-N 3-(3,3,3-trifluoropropoxy)benzaldehyde Chemical compound FC(F)(F)CCOC1=CC=CC(C=O)=C1 BGVVKEHXDLBHMD-UHFFFAOYSA-N 0.000 description 2
- VHDJPLLXCUHWGK-UHFFFAOYSA-N 3-(3-fluoropropoxy)benzaldehyde Chemical compound FCCCOC1=CC=CC(C=O)=C1 VHDJPLLXCUHWGK-UHFFFAOYSA-N 0.000 description 2
- LWGWGLXRUPVUGA-UHFFFAOYSA-N 3-(trifluoromethyl)-n-(2-trimethylsilylethynyl)aniline Chemical compound C[Si](C)(C)C#CNC1=CC=CC(C(F)(F)F)=C1 LWGWGLXRUPVUGA-UHFFFAOYSA-N 0.000 description 2
- SMCXLAQBECHAQV-UHFFFAOYSA-N 3-[[2-(3-chlorophenyl)ethylamino]methyl]phenol Chemical compound OC1=CC=CC(CNCCC=2C=C(Cl)C=CC=2)=C1 SMCXLAQBECHAQV-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- RBBOPKWXELESAN-UHFFFAOYSA-N 3-benzoylbenzaldehyde Chemical compound O=CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 RBBOPKWXELESAN-UHFFFAOYSA-N 0.000 description 2
- AZFABGHLDGJASW-UHFFFAOYSA-N 3-bromodibenzofuran Chemical compound C1=CC=C2C3=CC=C(Br)C=C3OC2=C1 AZFABGHLDGJASW-UHFFFAOYSA-N 0.000 description 2
- QZMGMXBYJZVAJN-UHFFFAOYSA-N 3-ethoxybenzaldehyde Chemical compound CCOC1=CC=CC(C=O)=C1 QZMGMXBYJZVAJN-UHFFFAOYSA-N 0.000 description 2
- NVBCFOQYDFKXJJ-UHFFFAOYSA-N 3-formyl-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(C=O)=CNC2=C1 NVBCFOQYDFKXJJ-UHFFFAOYSA-N 0.000 description 2
- UVFAHDAUVZRVCC-UHFFFAOYSA-N 3-nitrodibenzofuran Chemical compound C1=CC=C2C3=CC=C([N+](=O)[O-])C=C3OC2=C1 UVFAHDAUVZRVCC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- GDVCEQRAPMIJBG-UHFFFAOYSA-N 4-Methoxy-1H-indole-3-carbaldehyde Chemical compound COC1=CC=CC2=C1C(C=O)=CN2 GDVCEQRAPMIJBG-UHFFFAOYSA-N 0.000 description 2
- GRJZJFUBQYULKL-UHFFFAOYSA-N 4-bromo-1h-indole Chemical compound BrC1=CC=CC2=C1C=CN2 GRJZJFUBQYULKL-UHFFFAOYSA-N 0.000 description 2
- LDNDHEQQVINAHV-UHFFFAOYSA-N 4-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound COC1=CC=CC2=C1C(C=C[N+]([O-])=O)=CN2 LDNDHEQQVINAHV-UHFFFAOYSA-N 0.000 description 2
- BXWPKNXIZQJVEX-UHFFFAOYSA-N 5-(4-fluorophenyl)-3-(2-nitroethenyl)-1h-indole Chemical compound C1=C2C(C=C[N+](=O)[O-])=CNC2=CC=C1C1=CC=C(F)C=C1 BXWPKNXIZQJVEX-UHFFFAOYSA-N 0.000 description 2
- ZSOCQTZLGYVLKL-UHFFFAOYSA-N 5-(4-methylphenoxy)-1h-indole Chemical compound C1=CC(C)=CC=C1OC1=CC=C(NC=C2)C2=C1 ZSOCQTZLGYVLKL-UHFFFAOYSA-N 0.000 description 2
- JTEJPPKMYBDEMY-UHFFFAOYSA-N 5-methoxytryptamine Chemical compound COC1=CC=C2NC=C(CCN)C2=C1 JTEJPPKMYBDEMY-UHFFFAOYSA-N 0.000 description 2
- YJBIMZVVUOJZSS-UHFFFAOYSA-N 5-phenoxy-1h-indole Chemical compound C=1C=C2NC=CC2=CC=1OC1=CC=CC=C1 YJBIMZVVUOJZSS-UHFFFAOYSA-N 0.000 description 2
- MAWGHOPSCKCTPA-UHFFFAOYSA-N 6-bromo-1h-indole Chemical compound BrC1=CC=C2C=CNC2=C1 MAWGHOPSCKCTPA-UHFFFAOYSA-N 0.000 description 2
- OPEAQMMQYFSXKX-UHFFFAOYSA-N 6-chloro-7-fluoro-1h-indole Chemical compound FC1=C(Cl)C=CC2=C1NC=C2 OPEAQMMQYFSXKX-UHFFFAOYSA-N 0.000 description 2
- HVUDTQDOEZEEQL-UHFFFAOYSA-N 6-chloro-7-fluoro-1h-indole-3-carbaldehyde Chemical compound FC1=C(Cl)C=CC2=C1NC=C2C=O HVUDTQDOEZEEQL-UHFFFAOYSA-N 0.000 description 2
- MZGXOXLBLFRUPL-UHFFFAOYSA-N 6-chloro-7-fluoro-3-(2-nitroethenyl)-1h-indole Chemical compound ClC1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1F MZGXOXLBLFRUPL-UHFFFAOYSA-N 0.000 description 2
- STYSDPNMNYBCOU-UHFFFAOYSA-N 6-fluoro-3-(2-nitroethenyl)-1h-indole Chemical compound FC1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 STYSDPNMNYBCOU-UHFFFAOYSA-N 0.000 description 2
- UNQYAAAWKOOBFQ-UHFFFAOYSA-N 7-[(4-chlorophenyl)methyl]-8-[4-chloro-3-(trifluoromethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione Chemical compound C=1C=C(Cl)C=CC=1CN1C=2C(=O)N(CCCO)C(=O)N(C)C=2N=C1OC1=CC=C(Cl)C(OC(F)(F)F)=C1 UNQYAAAWKOOBFQ-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 108020000948 Antisense Oligonucleotides Proteins 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 229930003347 Atropine Natural products 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 2
- 239000001358 L(+)-tartaric acid Substances 0.000 description 2
- 235000011002 L(+)-tartaric acid Nutrition 0.000 description 2
- FEWJPZIEWOKRBE-LWMBPPNESA-N L-(+)-Tartaric acid Natural products OC(=O)[C@@H](O)[C@H](O)C(O)=O FEWJPZIEWOKRBE-LWMBPPNESA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241001282135 Poromitra oscitans Species 0.000 description 2
- 229910019020 PtO2 Inorganic materials 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 206010048232 Yawning Diseases 0.000 description 2
- IMSWSDCYNJTUIM-UHFFFAOYSA-N [4-(4-cyanophenoxy)carbonylphenyl] 4-hexoxybenzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C(=O)OC1=CC=C(C(=O)OC=2C=CC(=CC=2)C#N)C=C1 IMSWSDCYNJTUIM-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000000074 antisense oligonucleotide Substances 0.000 description 2
- 238000012230 antisense oligonucleotides Methods 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 2
- 229960000396 atropine Drugs 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 239000000544 cholinesterase inhibitor Substances 0.000 description 2
- 230000001149 cognitive effect Effects 0.000 description 2
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical compound C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 description 2
- GHQCIALFYKYZGS-UHFFFAOYSA-N dibenzofuran-3-amine Chemical compound C1=CC=C2C3=CC=C(N)C=C3OC2=C1 GHQCIALFYKYZGS-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- ADEBPBSSDYVVLD-UHFFFAOYSA-N donepezil Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 description 2
- MHAKZTRHBLCYKV-UHFFFAOYSA-N ethyl 1h-indole-6-carboxylate Chemical compound CCOC(=O)C1=CC=C2C=CNC2=C1 MHAKZTRHBLCYKV-UHFFFAOYSA-N 0.000 description 2
- IPNWSOFHXKQISU-UHFFFAOYSA-N ethyl 3-(2-nitroethenyl)-1h-indole-6-carboxylate Chemical compound CCOC(=O)C1=CC=C2C(C=C[N+]([O-])=O)=CNC2=C1 IPNWSOFHXKQISU-UHFFFAOYSA-N 0.000 description 2
- CAXGFIUOLLPABZ-UHFFFAOYSA-N ethyl 3-(2-nitroethyl)-1h-indole-6-carboxylate Chemical compound CCOC(=O)C1=CC=C2C(CC[N+]([O-])=O)=CNC2=C1 CAXGFIUOLLPABZ-UHFFFAOYSA-N 0.000 description 2
- OIBVOKWWUPSHBU-UHFFFAOYSA-N ethyl n-[2-bromo-5-(trifluoromethyl)phenyl]carbamate Chemical compound CCOC(=O)NC1=CC(C(F)(F)F)=CC=C1Br OIBVOKWWUPSHBU-UHFFFAOYSA-N 0.000 description 2
- 238000000434 field desorption mass spectrometry Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- DRYBMFJLYYEOBZ-UHFFFAOYSA-N methyl 1h-indole-5-carboxylate Chemical compound COC(=O)C1=CC=C2NC=CC2=C1 DRYBMFJLYYEOBZ-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- BIHGPQLMMWEPBO-UHFFFAOYSA-N n,n-dimethyl-2-[2-nitro-4-(trifluoromethoxy)phenyl]ethenamine Chemical compound CN(C)C=CC1=CC=C(OC(F)(F)F)C=C1[N+]([O-])=O BIHGPQLMMWEPBO-UHFFFAOYSA-N 0.000 description 2
- WNAXXOOIDCPHIB-UHFFFAOYSA-N n,n-dimethyl-5-nitrotryptamine Chemical compound C1=C([N+]([O-])=O)C=C2C(CCN(C)C)=CNC2=C1 WNAXXOOIDCPHIB-UHFFFAOYSA-N 0.000 description 2
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 2
- 230000003955 neuronal function Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Chemical group 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 239000002287 radioligand Substances 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 229910052717 sulfur Chemical group 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 230000008685 targeting Effects 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- ZQPAILDMANGQJU-UHFFFAOYSA-N tert-butyl n-[2-(5-cyano-1h-indol-3-yl)ethyl]carbamate Chemical compound C1=C(C#N)C=C2C(CCNC(=O)OC(C)(C)C)=CNC2=C1 ZQPAILDMANGQJU-UHFFFAOYSA-N 0.000 description 2
- PIUDLFKYZBSNRT-UHFFFAOYSA-N tert-butyl n-[2-(6-butoxy-1h-indol-3-yl)ethyl]carbamate Chemical compound CCCCOC1=CC=C2C(CCNC(=O)OC(C)(C)C)=CNC2=C1 PIUDLFKYZBSNRT-UHFFFAOYSA-N 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- LHJCZOXMCGQVDQ-UHFFFAOYSA-N tri(propan-2-yl)silyl trifluoromethanesulfonate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OS(=O)(=O)C(F)(F)F LHJCZOXMCGQVDQ-UHFFFAOYSA-N 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 1
- JKCDPULLDPELPY-LREBCSMRSA-N (2r,3r)-2,3-dihydroxybutanedioic acid;2-(7-fluoro-1h-indol-3-yl)-n-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.C=1NC=2C(F)=CC=CC=2C=1CCNCC1=CC=CC(OCC(F)(F)F)=C1 JKCDPULLDPELPY-LREBCSMRSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- QVCMFSJTNVQJFG-UHFFFAOYSA-N (4-methylsulfonylphenyl)hydrazine;hydrochloride Chemical compound Cl.CS(=O)(=O)C1=CC=C(NN)C=C1 QVCMFSJTNVQJFG-UHFFFAOYSA-N 0.000 description 1
- WMKGGPCROCCUDY-AOGCGKDYSA-N (4e)-1,5-diphenylpenta-1,4-dien-3-one Chemical compound C=1C=CC=CC=1/C=C/C(=O)C=CC1=CC=CC=C1 WMKGGPCROCCUDY-AOGCGKDYSA-N 0.000 description 1
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (e)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- LCJCPSYWQVRWOV-BTJKTKAUSA-N (z)-but-2-enedioic acid;2-(6-chloro-1h-indol-3-yl)-n-methyl-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine Chemical compound OC(=O)\C=C/C(O)=O.C=1NC2=CC(Cl)=CC=C2C=1CCN(C)CC1=CC=CC(OCC(F)(F)C(F)F)=C1 LCJCPSYWQVRWOV-BTJKTKAUSA-N 0.000 description 1
- JKOVQYWMFZTKMX-ARJAWSKDSA-N (z)-n,n-dimethyl-2-nitroethenamine Chemical group CN(C)\C=C/[N+]([O-])=O JKOVQYWMFZTKMX-ARJAWSKDSA-N 0.000 description 1
- PCTZLSCYMRXUGW-UHFFFAOYSA-N 1,1,1,2,2-pentafluorobutane Chemical group [CH2]CC(F)(F)C(F)(F)F PCTZLSCYMRXUGW-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- MJUVRTYWUMPBTR-MRXNPFEDSA-N 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-n-[1-[(2r)-2,3-dihydroxypropyl]-6-fluoro-2-(1-hydroxy-2-methylpropan-2-yl)indol-5-yl]cyclopropane-1-carboxamide Chemical compound FC=1C=C2N(C[C@@H](O)CO)C(C(C)(CO)C)=CC2=CC=1NC(=O)C1(C=2C=C3OC(F)(F)OC3=CC=2)CC1 MJUVRTYWUMPBTR-MRXNPFEDSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- JTLAIKFGRHDNQM-UHFFFAOYSA-N 1-bromo-2-fluoroethane Chemical compound FCCBr JTLAIKFGRHDNQM-UHFFFAOYSA-N 0.000 description 1
- VNHWPVLQRKKKRY-UHFFFAOYSA-N 1-bromo-3-fluoropropane Chemical compound FCCCBr VNHWPVLQRKKKRY-UHFFFAOYSA-N 0.000 description 1
- PVFAQWWQJZQMBN-UHFFFAOYSA-N 1-fluoro-2-phenoxybenzene Chemical compound FC1=CC=CC=C1OC1=CC=CC=C1 PVFAQWWQJZQMBN-UHFFFAOYSA-N 0.000 description 1
- JUXFXYQUXNXVAA-UHFFFAOYSA-N 1-methyl-4-(trifluoromethoxy)benzene Chemical compound CC1=CC=C(OC(F)(F)F)C=C1 JUXFXYQUXNXVAA-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- XKYLCLMYQDFGKO-UHFFFAOYSA-N 1-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(C(F)(F)F)C=C1 XKYLCLMYQDFGKO-UHFFFAOYSA-N 0.000 description 1
- BASOIJCGJUGIKG-UHFFFAOYSA-N 1-phenylindole-4-carbaldehyde Chemical compound C1=CC=2C(C=O)=CC=CC=2N1C1=CC=CC=C1 BASOIJCGJUGIKG-UHFFFAOYSA-N 0.000 description 1
- MVXOHVCBMHBQDO-UHFFFAOYSA-N 1-phenylindole-6-carbaldehyde Chemical compound C12=CC(C=O)=CC=C2C=CN1C1=CC=CC=C1 MVXOHVCBMHBQDO-UHFFFAOYSA-N 0.000 description 1
- YHYLDEVWYOFIJK-UHFFFAOYSA-N 1h-indole-5-carbonitrile Chemical compound N#CC1=CC=C2NC=CC2=C1 YHYLDEVWYOFIJK-UHFFFAOYSA-N 0.000 description 1
- GHTDODSYDCPOCW-UHFFFAOYSA-N 1h-indole-6-carboxylic acid Chemical compound OC(=O)C1=CC=C2C=CNC2=C1 GHTDODSYDCPOCW-UHFFFAOYSA-N 0.000 description 1
- NTUHBYLZRBVHRS-UHFFFAOYSA-N 1h-indole-7-carbonitrile Chemical compound N#CC1=CC=CC2=C1NC=C2 NTUHBYLZRBVHRS-UHFFFAOYSA-N 0.000 description 1
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- NBUKAOOFKZFCGD-UHFFFAOYSA-N 2,2,3,3-tetrafluoropropan-1-ol Chemical compound OCC(F)(F)C(F)F NBUKAOOFKZFCGD-UHFFFAOYSA-N 0.000 description 1
- VOGSDFLJZPNWHY-UHFFFAOYSA-N 2,2-difluoroethanol Chemical compound OCC(F)F VOGSDFLJZPNWHY-UHFFFAOYSA-N 0.000 description 1
- ZUBSOOAAXYCXMN-UHFFFAOYSA-N 2,2-difluoroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCC(F)F)C=C1 ZUBSOOAAXYCXMN-UHFFFAOYSA-N 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- KVVXRISUSPIMLJ-UHFFFAOYSA-N 2,6-difluoro-4-nitrophenol Chemical compound OC1=C(F)C=C([N+]([O-])=O)C=C1F KVVXRISUSPIMLJ-UHFFFAOYSA-N 0.000 description 1
- ZEAIKXJENWHYTL-UHFFFAOYSA-N 2-(2,2,3,3-tetrafluoropropyl)benzaldehyde Chemical compound FC(F)C(F)(F)CC1=CC=CC=C1C=O ZEAIKXJENWHYTL-UHFFFAOYSA-N 0.000 description 1
- ZEYRDXUWJDGTLD-UHFFFAOYSA-N 2-(2-ethyl-5-methoxy-1h-indol-3-yl)-n,n-dimethylethanamine Chemical compound C1=C(OC)C=C2C(CCN(C)C)=C(CC)NC2=C1 ZEYRDXUWJDGTLD-UHFFFAOYSA-N 0.000 description 1
- WVYPDPJNPRIPPW-UHFFFAOYSA-N 2-(2-phenylphenyl)acetonitrile Chemical compound N#CCC1=CC=CC=C1C1=CC=CC=C1 WVYPDPJNPRIPPW-UHFFFAOYSA-N 0.000 description 1
- HPFWDCIEYLFOTN-UHFFFAOYSA-N 2-(2-phenylphenyl)ethanamine Chemical compound NCCC1=CC=CC=C1C1=CC=CC=C1 HPFWDCIEYLFOTN-UHFFFAOYSA-N 0.000 description 1
- XALQLZNHMIIJKC-UHFFFAOYSA-N 2-(3-chlorophenyl)-n-[(3-ethoxyphenyl)methyl]ethanamine Chemical compound CCOC1=CC=CC(CNCCC=2C=C(Cl)C=CC=2)=C1 XALQLZNHMIIJKC-UHFFFAOYSA-N 0.000 description 1
- AUJQHBITFCTYCM-UHFFFAOYSA-N 2-(3-chlorophenyl)-n-[(3-propoxyphenyl)methyl]ethanamine Chemical compound CCCOC1=CC=CC(CNCCC=2C=C(Cl)C=CC=2)=C1 AUJQHBITFCTYCM-UHFFFAOYSA-N 0.000 description 1
- ZBPUNVFDQXYNDY-UHFFFAOYSA-N 2-(3-chloropropyl)-1,3-dioxolane Chemical compound ClCCCC1OCCO1 ZBPUNVFDQXYNDY-UHFFFAOYSA-N 0.000 description 1
- BXBISOJVTYHQSE-UHFFFAOYSA-N 2-(3-naphthalen-1-yloxyphenyl)-1,3-dioxolane Chemical compound O1CCOC1C1=CC=CC(OC=2C3=CC=CC=C3C=CC=2)=C1 BXBISOJVTYHQSE-UHFFFAOYSA-N 0.000 description 1
- DKWLESXSFFQEQW-UHFFFAOYSA-N 2-(3-naphthalen-2-yloxyphenyl)-1,3-dioxolane Chemical compound O1CCOC1C1=CC=CC(OC=2C=C3C=CC=CC3=CC=2)=C1 DKWLESXSFFQEQW-UHFFFAOYSA-N 0.000 description 1
- NMOCOWABJRWQGY-UHFFFAOYSA-N 2-(4,4-diethoxybutyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCC(OCC)OCC)C(=O)C2=C1 NMOCOWABJRWQGY-UHFFFAOYSA-N 0.000 description 1
- XBGZZDHALNZOLW-UHFFFAOYSA-N 2-(4-chloro-1h-indol-3-yl)ethanamine Chemical compound C1=CC(Cl)=C2C(CCN)=CNC2=C1 XBGZZDHALNZOLW-UHFFFAOYSA-N 0.000 description 1
- LKYORSNBTDEUNM-UHFFFAOYSA-N 2-(4-chloro-1h-indol-3-yl)ethanamine;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC(Cl)=C2C(CCN)=CNC2=C1 LKYORSNBTDEUNM-UHFFFAOYSA-N 0.000 description 1
- BASMNQMNDMEWCS-UHFFFAOYSA-N 2-(4-chloro-5-methoxy-1h-indol-3-yl)ethanamine Chemical compound COC1=CC=C2NC=C(CCN)C2=C1Cl BASMNQMNDMEWCS-UHFFFAOYSA-N 0.000 description 1
- YUGDKEWUYZXXRU-UHFFFAOYSA-N 2-(4-chlorophenoxy)acetonitrile Chemical compound ClC1=CC=C(OCC#N)C=C1 YUGDKEWUYZXXRU-UHFFFAOYSA-N 0.000 description 1
- LUZQWHJFVODEHM-UHFFFAOYSA-N 2-(4-fluoro-1h-indol-3-yl)ethanamine;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC(F)=C2C(CCN)=CNC2=C1 LUZQWHJFVODEHM-UHFFFAOYSA-N 0.000 description 1
- ITEWSUFLHSFXSI-UHFFFAOYSA-N 2-(4-methoxy-1h-indol-3-yl)ethanamine;hydrochloride Chemical compound [Cl-].COC1=CC=CC2=C1C(CC[NH3+])=CN2 ITEWSUFLHSFXSI-UHFFFAOYSA-N 0.000 description 1
- KPGVBKXJPREAJZ-UHFFFAOYSA-N 2-(4-phenyl-1h-indol-3-yl)ethanamine;hydrochloride Chemical compound Cl.C=12C(CCN)=CNC2=CC=CC=1C1=CC=CC=C1 KPGVBKXJPREAJZ-UHFFFAOYSA-N 0.000 description 1
- ITWAKNWMCINLDZ-UHFFFAOYSA-N 2-(4-phenylphenyl)ethanamine;hydrochloride Chemical compound [Cl-].C1=CC(CC[NH3+])=CC=C1C1=CC=CC=C1 ITWAKNWMCINLDZ-UHFFFAOYSA-N 0.000 description 1
- OAGWCIZEECVHRW-UHFFFAOYSA-N 2-(5,6-difluoro-1h-indol-3-yl)ethanamine Chemical compound FC1=C(F)C=C2C(CCN)=CNC2=C1 OAGWCIZEECVHRW-UHFFFAOYSA-N 0.000 description 1
- YSVNVDVGTVGPAR-UHFFFAOYSA-N 2-(5,6-difluoro-1h-indol-3-yl)ethanamine;hydrochloride Chemical compound Cl.FC1=C(F)C=C2C(CCN)=CNC2=C1 YSVNVDVGTVGPAR-UHFFFAOYSA-N 0.000 description 1
- QPEAZVAMEMXQHF-UHFFFAOYSA-N 2-(5-bromo-1h-indol-3-yl)acetonitrile Chemical compound BrC1=CC=C2NC=C(CC#N)C2=C1 QPEAZVAMEMXQHF-UHFFFAOYSA-N 0.000 description 1
- CGHUQJRRADEHTQ-UHFFFAOYSA-N 2-(5-bromo-1h-indol-3-yl)ethanamine Chemical compound C1=C(Br)C=C2C(CCN)=CNC2=C1 CGHUQJRRADEHTQ-UHFFFAOYSA-N 0.000 description 1
- AOCZLEVTJHBTNC-UHFFFAOYSA-N 2-(5-chloro-6-fluoro-1h-indol-3-yl)ethanamine;hydrochloride Chemical compound Cl.FC1=C(Cl)C=C2C(CCN)=CNC2=C1 AOCZLEVTJHBTNC-UHFFFAOYSA-N 0.000 description 1
- HWNPGCPKNYFXMA-UHFFFAOYSA-N 2-(5-ethoxy-1h-indol-3-yl)ethanamine Chemical compound CCOC1=CC=C2NC=C(CCN)C2=C1 HWNPGCPKNYFXMA-UHFFFAOYSA-N 0.000 description 1
- TVDIYQFJZIWHLZ-UHFFFAOYSA-N 2-(5-fluoro-1h-indol-3-yl)-n-[(3-propoxyphenyl)methyl]ethanamine Chemical compound CCCOC1=CC=CC(CNCCC=2C3=CC(F)=CC=C3NC=2)=C1 TVDIYQFJZIWHLZ-UHFFFAOYSA-N 0.000 description 1
- YEUPNFLJKVVIFC-UHFFFAOYSA-N 2-(5-fluoro-1h-indol-3-yl)-n-[(3-propoxyphenyl)methyl]ethanamine;hydrochloride Chemical compound Cl.CCCOC1=CC=CC(CNCCC=2C3=CC(F)=CC=C3NC=2)=C1 YEUPNFLJKVVIFC-UHFFFAOYSA-N 0.000 description 1
- ZKIORVIXEWIOGB-UHFFFAOYSA-N 2-(5-fluoro-1h-indol-3-yl)ethanamine Chemical compound C1=C(F)C=C2C(CCN)=CNC2=C1 ZKIORVIXEWIOGB-UHFFFAOYSA-N 0.000 description 1
- YZAWADGJXKCLTI-UHFFFAOYSA-N 2-(5-fluoro-1h-indol-3-yl)ethanamine;hydrochloride Chemical compound Cl.C1=C(F)C=C2C(CCN)=CNC2=C1 YZAWADGJXKCLTI-UHFFFAOYSA-N 0.000 description 1
- MHECHLAHIWWHNJ-UHFFFAOYSA-N 2-(5-methoxy-1h-indol-3-yl)-n-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]ethanamine Chemical compound C12=CC(OC)=CC=C2NC=C1CCNCC1=CC=CC(OCC(F)(F)C(F)(F)F)=C1 MHECHLAHIWWHNJ-UHFFFAOYSA-N 0.000 description 1
- TYAPSMFCSAKSOR-UHFFFAOYSA-N 2-(5-methoxy-2-methyl-1h-indol-3-yl)ethanamine Chemical compound COC1=CC=C2NC(C)=C(CCN)C2=C1 TYAPSMFCSAKSOR-UHFFFAOYSA-N 0.000 description 1
- VBRYZFMXLYMOQN-UHFFFAOYSA-N 2-(5-methylsulfonyl-1h-indol-3-yl)ethanamine Chemical compound CS(=O)(=O)C1=CC=C2NC=C(CCN)C2=C1 VBRYZFMXLYMOQN-UHFFFAOYSA-N 0.000 description 1
- HTORIMISYWUCOH-UHFFFAOYSA-N 2-(5-nitro-1h-indol-3-yl)-n-[(3-phenoxyphenyl)methyl]ethanamine Chemical compound C12=CC([N+](=O)[O-])=CC=C2NC=C1CCNCC(C=1)=CC=CC=1OC1=CC=CC=C1 HTORIMISYWUCOH-UHFFFAOYSA-N 0.000 description 1
- KQFKYVGWMQFFSW-UHFFFAOYSA-N 2-(5-nitro-1h-indol-3-yl)-n-[(3-phenoxyphenyl)methyl]ethanamine;hydrochloride Chemical compound Cl.C12=CC([N+](=O)[O-])=CC=C2NC=C1CCNCC(C=1)=CC=CC=1OC1=CC=CC=C1 KQFKYVGWMQFFSW-UHFFFAOYSA-N 0.000 description 1
- RQZFGUPEKVIWBR-UHFFFAOYSA-N 2-(5-phenoxy-1h-indol-3-yl)-n-[(3-phenoxyphenyl)methyl]ethanamine Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1CNCCC(C1=C2)=CNC1=CC=C2OC1=CC=CC=C1 RQZFGUPEKVIWBR-UHFFFAOYSA-N 0.000 description 1
- ZURXROHPCVOMGH-UHFFFAOYSA-N 2-(5-phenoxy-1h-indol-3-yl)ethanamine Chemical compound C1=C2C(CCN)=CNC2=CC=C1OC1=CC=CC=C1 ZURXROHPCVOMGH-UHFFFAOYSA-N 0.000 description 1
- IIQKPMLOXZYBBX-UHFFFAOYSA-N 2-(5-phenyl-1h-indol-3-yl)ethanamine Chemical compound C1=C2C(CCN)=CNC2=CC=C1C1=CC=CC=C1 IIQKPMLOXZYBBX-UHFFFAOYSA-N 0.000 description 1
- WGJSWJACQFQHDW-UHFFFAOYSA-N 2-(5-phenylmethoxy-1h-indol-3-yl)-n-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine;hydrochloride Chemical compound Cl.FC(F)(F)COC1=CC=CC(CNCCC=2C3=CC(OCC=4C=CC=CC=4)=CC=C3NC=2)=C1 WGJSWJACQFQHDW-UHFFFAOYSA-N 0.000 description 1
- IUWVJCIEWSQGHH-UHFFFAOYSA-N 2-(5-phenylmethoxy-1h-indol-3-yl)ethylazanium;chloride Chemical compound Cl.C1=C2C(CCN)=CNC2=CC=C1OCC1=CC=CC=C1 IUWVJCIEWSQGHH-UHFFFAOYSA-N 0.000 description 1
- YKOUFPQHZNOHEZ-UHFFFAOYSA-N 2-(5-propan-2-yl-1h-indol-3-yl)ethanamine Chemical compound CC(C)C1=CC=C2NC=C(CCN)C2=C1 YKOUFPQHZNOHEZ-UHFFFAOYSA-N 0.000 description 1
- IDOVDUDFEFJDPP-UHFFFAOYSA-N 2-(5-propan-2-yloxy-1h-indol-3-yl)ethanamine Chemical compound CC(C)OC1=CC=C2NC=C(CCN)C2=C1 IDOVDUDFEFJDPP-UHFFFAOYSA-N 0.000 description 1
- DXFMDTBVQZHEBA-UHFFFAOYSA-N 2-(5-propoxy-1h-indol-3-yl)-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine Chemical compound C12=CC(OCCC)=CC=C2NC=C1CCNCC1=CC=CC(OCC(F)(F)C(F)F)=C1 DXFMDTBVQZHEBA-UHFFFAOYSA-N 0.000 description 1
- LNCFSRDUYSAHQU-UHFFFAOYSA-N 2-(6-butoxy-1h-indol-3-yl)ethanamine Chemical compound CCCCOC1=CC=C2C(CCN)=CNC2=C1 LNCFSRDUYSAHQU-UHFFFAOYSA-N 0.000 description 1
- ONUZGQFXGRJRIP-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)-n-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]ethanamine Chemical compound FC(F)(F)C(F)(F)COC1=CC=CC(CNCCC=2C3=CC=C(Cl)C=C3NC=2)=C1 ONUZGQFXGRJRIP-UHFFFAOYSA-N 0.000 description 1
- WQKZTDVOIZVGDF-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)-n-[[3-(2,2-difluoroethoxy)phenyl]methyl]-n-methylethanamine Chemical compound C=1NC2=CC(Cl)=CC=C2C=1CCN(C)CC1=CC=CC(OCC(F)F)=C1 WQKZTDVOIZVGDF-UHFFFAOYSA-N 0.000 description 1
- ZZUKVCAKCJAOMM-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)-n-[[3-(2,2-difluoroethoxy)phenyl]methyl]ethanamine Chemical compound FC(F)COC1=CC=CC(CNCCC=2C3=CC=C(Cl)C=C3NC=2)=C1 ZZUKVCAKCJAOMM-UHFFFAOYSA-N 0.000 description 1
- PCIXFQGFVXSYJM-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)-n-[[3-(3-fluoropropoxy)phenyl]methyl]ethanamine Chemical compound FCCCOC1=CC=CC(CNCCC=2C3=CC=C(Cl)C=C3NC=2)=C1 PCIXFQGFVXSYJM-UHFFFAOYSA-N 0.000 description 1
- JBZFTKREFKPKPD-UHFFFAOYSA-N 2-(6-chloro-5-fluoro-1h-indol-3-yl)ethanamine Chemical compound ClC1=C(F)C=C2C(CCN)=CNC2=C1 JBZFTKREFKPKPD-UHFFFAOYSA-N 0.000 description 1
- VBOQJBVRQUSWDB-UHFFFAOYSA-N 2-(6-chloro-5-methoxy-1h-indol-3-yl)-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine Chemical compound C=1NC=2C=C(Cl)C(OC)=CC=2C=1CCNCC1=CC=CC(OCC(F)(F)C(F)F)=C1 VBOQJBVRQUSWDB-UHFFFAOYSA-N 0.000 description 1
- SPPWYFHCZJIRAS-UHFFFAOYSA-N 2-(6-chloro-7-fluoro-1h-indol-3-yl)ethanamine Chemical compound ClC1=CC=C2C(CCN)=CNC2=C1F SPPWYFHCZJIRAS-UHFFFAOYSA-N 0.000 description 1
- CVIGKPYYBMNRLO-UHFFFAOYSA-N 2-(6-ethoxy-1h-indol-3-yl)ethanamine Chemical compound CCOC1=CC=C2C(CCN)=CNC2=C1 CVIGKPYYBMNRLO-UHFFFAOYSA-N 0.000 description 1
- ONORALOWTYGZRW-UHFFFAOYSA-N 2-(6-fluoro-1-methylindol-3-yl)-n-methyl-n-[(3-propoxyphenyl)methyl]ethanamine Chemical compound CCCOC1=CC=CC(CN(C)CCC=2C3=CC=C(F)C=C3N(C)C=2)=C1 ONORALOWTYGZRW-UHFFFAOYSA-N 0.000 description 1
- QAGABUCNXSEZHV-UHFFFAOYSA-N 2-(6-fluoro-1-methylindol-3-yl)ethanamine Chemical compound C1=C(F)C=C2N(C)C=C(CCN)C2=C1 QAGABUCNXSEZHV-UHFFFAOYSA-N 0.000 description 1
- KFVBJQYTLHYYAQ-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)-n-[(2-fluoro-3-phenoxyphenyl)methyl]ethanamine Chemical compound C=1NC2=CC(F)=CC=C2C=1CCNCC(C=1F)=CC=CC=1OC1=CC=CC=C1 KFVBJQYTLHYYAQ-UHFFFAOYSA-N 0.000 description 1
- BMZNPJSRBTVUSO-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)-n-[(2-fluoro-5-phenoxyphenyl)methyl]ethanamine Chemical compound C=1NC2=CC(F)=CC=C2C=1CCNCC(C(=CC=1)F)=CC=1OC1=CC=CC=C1 BMZNPJSRBTVUSO-UHFFFAOYSA-N 0.000 description 1
- ODVDIBHWTMTHOS-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)ethanamine;hydron;chloride Chemical compound Cl.FC1=CC=C2C(CCN)=CNC2=C1 ODVDIBHWTMTHOS-UHFFFAOYSA-N 0.000 description 1
- VXZGQUZCKGYSHP-UHFFFAOYSA-N 2-(6-fluoro-1h-indol-3-yl)ethanamine;oxalic acid Chemical compound OC(=O)C(O)=O.FC1=CC=C2C(CCN)=CNC2=C1 VXZGQUZCKGYSHP-UHFFFAOYSA-N 0.000 description 1
- WJMBPUARQLZWNV-UHFFFAOYSA-N 2-(6-fluoro-5-methoxy-1h-indol-3-yl)ethanamine;oxalic acid Chemical compound OC(=O)C(O)=O.C1=C(F)C(OC)=CC2=C1NC=C2CCN WJMBPUARQLZWNV-UHFFFAOYSA-N 0.000 description 1
- PCUBQWZVTXAWSR-UHFFFAOYSA-N 2-(6-methoxy-1h-indol-3-yl)-n-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]ethanamine Chemical compound C=1NC2=CC(OC)=CC=C2C=1CCNCC1=CC=CC(OCC(F)(F)C(F)(F)F)=C1 PCUBQWZVTXAWSR-UHFFFAOYSA-N 0.000 description 1
- VOCGEKMEZOPDFP-UHFFFAOYSA-N 2-(6-methoxy-1h-indol-3-yl)ethanamine Chemical compound COC1=CC=C2C(CCN)=CNC2=C1 VOCGEKMEZOPDFP-UHFFFAOYSA-N 0.000 description 1
- GEVXFHYJXGYXJP-UHFFFAOYSA-N 2-(6-methyl-1H-indol-3-yl)ethanamine Chemical compound CC1=CC=C2C(CCN)=CNC2=C1 GEVXFHYJXGYXJP-UHFFFAOYSA-N 0.000 description 1
- DFCMPWKXYSQQDE-UHFFFAOYSA-N 2-(6-methylsulfonyl-1h-indol-3-yl)ethanamine Chemical compound CS(=O)(=O)C1=CC=C2C(CCN)=CNC2=C1 DFCMPWKXYSQQDE-UHFFFAOYSA-N 0.000 description 1
- GLEFBYIVFCNNOK-UHFFFAOYSA-N 2-(6-nitro-1h-indol-3-yl)acetonitrile Chemical compound [O-][N+](=O)C1=CC=C2C(CC#N)=CNC2=C1 GLEFBYIVFCNNOK-UHFFFAOYSA-N 0.000 description 1
- MOWZUTXLDZXSPY-UHFFFAOYSA-N 2-(6-nitro-1h-indol-3-yl)ethanamine Chemical compound [O-][N+](=O)C1=CC=C2C(CCN)=CNC2=C1 MOWZUTXLDZXSPY-UHFFFAOYSA-N 0.000 description 1
- XZCPXAOXTQVFNJ-UHFFFAOYSA-N 2-(6-phenyl-1h-indol-3-yl)ethanamine Chemical compound C=1C=C2C(CCN)=CNC2=CC=1C1=CC=CC=C1 XZCPXAOXTQVFNJ-UHFFFAOYSA-N 0.000 description 1
- OCEJGMFMSWRFSU-UHFFFAOYSA-N 2-(6-phenylmethoxy-1h-indol-3-yl)ethanamine Chemical compound C=1C=C2C(CCN)=CNC2=CC=1OCC1=CC=CC=C1 OCEJGMFMSWRFSU-UHFFFAOYSA-N 0.000 description 1
- XREDCAGLMSYYQI-UHFFFAOYSA-N 2-(7-fluoro-1h-indol-3-yl)-n-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine;hydrochloride Chemical compound Cl.C=1NC=2C(F)=CC=CC=2C=1CCNCC1=CC=CC(OCC(F)(F)F)=C1 XREDCAGLMSYYQI-UHFFFAOYSA-N 0.000 description 1
- SRCDORKNIWHXFW-UHFFFAOYSA-N 2-(7-fluoro-1h-indol-3-yl)-n-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride Chemical compound Cl.FC(F)C(F)(F)COC1=CC=CC(CNCCC=2C3=CC=CC(F)=C3NC=2)=C1 SRCDORKNIWHXFW-UHFFFAOYSA-N 0.000 description 1
- QRAWNNQNLQPNIZ-UHFFFAOYSA-N 2-(7-fluoro-1h-indol-3-yl)ethanamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1F QRAWNNQNLQPNIZ-UHFFFAOYSA-N 0.000 description 1
- SIMRWPJXWGIZLC-UHFFFAOYSA-N 2-(7-fluoro-1h-indol-3-yl)ethanamine;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC=C2C(CCN)=CNC2=C1F SIMRWPJXWGIZLC-UHFFFAOYSA-N 0.000 description 1
- ZUJIGHUQQNOCAM-UHFFFAOYSA-N 2-(7-methoxy-1h-indol-3-yl)ethanamine Chemical compound COC1=CC=CC2=C1NC=C2CCN ZUJIGHUQQNOCAM-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- WBUVFDFTUTYHCU-MDZDMXLPSA-N 2-[(e)-2-(furan-2-yl)ethenyl]quinoline Chemical compound C=1C=C2C=CC=CC2=NC=1\C=C\C1=CC=CO1 WBUVFDFTUTYHCU-MDZDMXLPSA-N 0.000 description 1
- JYZIVNAOHVCJAF-UHFFFAOYSA-N 2-[1-(4-fluorophenoxy)indol-3-yl]-2-oxoacetyl chloride Chemical compound C1=CC(F)=CC=C1ON1C2=CC=CC=C2C(C(=O)C(Cl)=O)=C1 JYZIVNAOHVCJAF-UHFFFAOYSA-N 0.000 description 1
- CMDXYMWHNSPJCH-UHFFFAOYSA-N 2-[2-(5-butoxy-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(OCCCC)C=C21 CMDXYMWHNSPJCH-UHFFFAOYSA-N 0.000 description 1
- LDWJUOXAJIKHLQ-UHFFFAOYSA-N 2-[2-(5-ethoxy-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(OCC)C=C21 LDWJUOXAJIKHLQ-UHFFFAOYSA-N 0.000 description 1
- RFCCMVBXKYUGGH-UHFFFAOYSA-N 2-[2-(5-propan-2-yloxy-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(OC(C)C)C=C21 RFCCMVBXKYUGGH-UHFFFAOYSA-N 0.000 description 1
- MSJCUFKCOXUDOF-UHFFFAOYSA-N 2-[2-(7-fluoro-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=C1C=CC=C2F MSJCUFKCOXUDOF-UHFFFAOYSA-N 0.000 description 1
- SVVHZCFWADVSSY-UHFFFAOYSA-N 2-[2-[5-(2,2,2-trifluoroethoxy)-1h-indol-3-yl]ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(OCC(F)(F)F)C=C21 SVVHZCFWADVSSY-UHFFFAOYSA-N 0.000 description 1
- WIYFLWIMBHQSRO-UHFFFAOYSA-N 2-[3-(2-fluorophenoxy)phenyl]-1,3-dioxolane Chemical compound FC1=CC=CC=C1OC1=CC=CC(C2OCCO2)=C1 WIYFLWIMBHQSRO-UHFFFAOYSA-N 0.000 description 1
- JZCBORZPOSQFMB-UHFFFAOYSA-N 2-[3-(3-fluorophenoxy)phenyl]-1,3-dioxolane Chemical compound FC1=CC=CC(OC=2C=C(C=CC=2)C2OCCO2)=C1 JZCBORZPOSQFMB-UHFFFAOYSA-N 0.000 description 1
- QQEIXJHSAOUQGV-UHFFFAOYSA-N 2-[3-(4-fluorophenoxy)phenyl]-1,3-dioxolane Chemical compound C1=CC(F)=CC=C1OC1=CC=CC(C2OCCO2)=C1 QQEIXJHSAOUQGV-UHFFFAOYSA-N 0.000 description 1
- VJMYMDZYRCECIZ-UHFFFAOYSA-N 2-[3-(4-methylphenyl)sulfanylphenyl]-1,3-dioxolane Chemical compound C1=CC(C)=CC=C1SC1=CC=CC(C2OCCO2)=C1 VJMYMDZYRCECIZ-UHFFFAOYSA-N 0.000 description 1
- BFXAEXLEZZNUAR-UHFFFAOYSA-N 2-[3-(4-methylphenyl)sulfonylphenyl]-1,3-dioxolane Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C1=CC=CC(C2OCCO2)=C1 BFXAEXLEZZNUAR-UHFFFAOYSA-N 0.000 description 1
- FPUBVOFZFTVMSH-UHFFFAOYSA-N 2-[3-(benzenesulfonyl)phenyl]-1,3-dioxolane Chemical compound C=1C=CC(C2OCCO2)=CC=1S(=O)(=O)C1=CC=CC=C1 FPUBVOFZFTVMSH-UHFFFAOYSA-N 0.000 description 1
- ZAYVELUJSVRKQK-UHFFFAOYSA-N 2-[3-[fluoro(phenyl)methyl]phenyl]-1,3-dioxolane Chemical compound C=1C=CC(C2OCCO2)=CC=1C(F)C1=CC=CC=C1 ZAYVELUJSVRKQK-UHFFFAOYSA-N 0.000 description 1
- HULHFLDUQALHKG-UHFFFAOYSA-N 2-[5-(2-methylphenoxy)-1h-indol-3-yl]ethanamine Chemical compound CC1=CC=CC=C1OC1=CC=C(NC=C2CCN)C2=C1 HULHFLDUQALHKG-UHFFFAOYSA-N 0.000 description 1
- FXUOYYTWUWUGBC-UHFFFAOYSA-N 2-[5-(3-methylphenoxy)-1h-indol-3-yl]-2-oxoacetyl chloride Chemical compound CC1=CC=CC(OC=2C=C3C(C(=O)C(Cl)=O)=CNC3=CC=2)=C1 FXUOYYTWUWUGBC-UHFFFAOYSA-N 0.000 description 1
- SNYDVSKVGIUVCD-UHFFFAOYSA-N 2-[5-(3-methylphenoxy)-1h-indol-3-yl]ethanamine Chemical compound CC1=CC=CC(OC=2C=C3C(CCN)=CNC3=CC=2)=C1 SNYDVSKVGIUVCD-UHFFFAOYSA-N 0.000 description 1
- BNJZHIVPOUJQHP-UHFFFAOYSA-N 2-[5-(4-fluorophenyl)-1h-indol-3-yl]ethanamine Chemical compound C1=C2C(CCN)=CNC2=CC=C1C1=CC=C(F)C=C1 BNJZHIVPOUJQHP-UHFFFAOYSA-N 0.000 description 1
- OKZZWRGDRNDJTC-UHFFFAOYSA-N 2-[5-(4-methylphenoxy)-1h-indol-3-yl]-2-oxoacetyl chloride Chemical compound C1=CC(C)=CC=C1OC1=CC=C(NC=C2C(=O)C(Cl)=O)C2=C1 OKZZWRGDRNDJTC-UHFFFAOYSA-N 0.000 description 1
- JFISZRVUOOQUDE-UHFFFAOYSA-N 2-[5-(4-methylphenoxy)-1h-indol-3-yl]ethanamine Chemical compound C1=CC(C)=CC=C1OC1=CC=C(NC=C2CCN)C2=C1 JFISZRVUOOQUDE-UHFFFAOYSA-N 0.000 description 1
- XRJTXMUXFPOSCS-UHFFFAOYSA-N 2-[5-(benzenesulfonyl)-1h-indol-3-yl]ethanamine Chemical compound C1=C2C(CCN)=CNC2=CC=C1S(=O)(=O)C1=CC=CC=C1 XRJTXMUXFPOSCS-UHFFFAOYSA-N 0.000 description 1
- DVJKZOMKVLFUDW-UHFFFAOYSA-N 2-[5-(trifluoromethyl)-1h-indol-3-yl]ethanamine Chemical compound C1=C(C(F)(F)F)C=C2C(CCN)=CNC2=C1 DVJKZOMKVLFUDW-UHFFFAOYSA-N 0.000 description 1
- AVTXAQJOMXFACQ-UHFFFAOYSA-N 2-[5-methoxy-6-(trifluoromethyl)-1h-indol-3-yl]ethanamine Chemical compound C1=C(C(F)(F)F)C(OC)=CC2=C1NC=C2CCN AVTXAQJOMXFACQ-UHFFFAOYSA-N 0.000 description 1
- SXTYURSOGXTQGK-UHFFFAOYSA-N 2-[6-(benzenesulfonyl)-1h-indol-3-yl]ethanamine Chemical compound C=1C=C2C(CCN)=CNC2=CC=1S(=O)(=O)C1=CC=CC=C1 SXTYURSOGXTQGK-UHFFFAOYSA-N 0.000 description 1
- UFWYMYNPQBBVRL-UHFFFAOYSA-N 2-[6-(trifluoromethoxy)-1h-indol-3-yl]ethanamine Chemical compound FC(F)(F)OC1=CC=C2C(CCN)=CNC2=C1 UFWYMYNPQBBVRL-UHFFFAOYSA-N 0.000 description 1
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 1
- BUTIDJREEDINSI-UHFFFAOYSA-N 2-bromo-4,5-difluoroaniline Chemical compound NC1=CC(F)=C(F)C=C1Br BUTIDJREEDINSI-UHFFFAOYSA-N 0.000 description 1
- ROSTYHNIIDIBEG-UHFFFAOYSA-N 2-bromo-4-(trifluoromethoxy)aniline Chemical compound NC1=CC=C(OC(F)(F)F)C=C1Br ROSTYHNIIDIBEG-UHFFFAOYSA-N 0.000 description 1
- PZDVFXUBTKPFSG-UHFFFAOYSA-N 2-bromo-5-(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC=C1Br PZDVFXUBTKPFSG-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- ANTYKYLXGOYFGZ-UHFFFAOYSA-N 2-fluoro-5-phenoxybenzaldehyde Chemical compound C1=C(C=O)C(F)=CC=C1OC1=CC=CC=C1 ANTYKYLXGOYFGZ-UHFFFAOYSA-N 0.000 description 1
- IVHKZCSZELZKSJ-UHFFFAOYSA-N 2-hydroxyethyl sulfonate Chemical compound OCCOS(=O)=O IVHKZCSZELZKSJ-UHFFFAOYSA-N 0.000 description 1
- ANZOSIRAKPHZBR-UHFFFAOYSA-N 2-methyl-4-(2-methylphenoxy)-1-nitrobenzene Chemical compound CC1=CC=CC=C1OC1=CC=C([N+]([O-])=O)C(C)=C1 ANZOSIRAKPHZBR-UHFFFAOYSA-N 0.000 description 1
- PKTIYDXFDRXCGI-UHFFFAOYSA-N 2-methyl-4-(3-methylphenoxy)-1-nitrobenzene Chemical compound CC1=CC=CC(OC=2C=C(C)C(=CC=2)[N+]([O-])=O)=C1 PKTIYDXFDRXCGI-UHFFFAOYSA-N 0.000 description 1
- AGCNCURAHXMWOO-UHFFFAOYSA-N 2-methyl-4-(4-methylphenoxy)-1-nitrobenzene Chemical compound C1=CC(C)=CC=C1OC1=CC=C([N+]([O-])=O)C(C)=C1 AGCNCURAHXMWOO-UHFFFAOYSA-N 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- RUJHATQMIMUYKD-UHFFFAOYSA-N 2-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C(CCN)=CC=CC2=C1 RUJHATQMIMUYKD-UHFFFAOYSA-N 0.000 description 1
- ZOBYXAWBGJRPRG-UHFFFAOYSA-N 2-naphthalen-2-ylethanamine Chemical compound C1=CC=CC2=CC(CCN)=CC=C21 ZOBYXAWBGJRPRG-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 102220512252 26S proteasome non-ATPase regulatory subunit 4_H17L_mutation Human genes 0.000 description 1
- HDBGBTNNPRCVND-UHFFFAOYSA-N 3,3,3-trifluoropropan-1-ol Chemical compound OCCC(F)(F)F HDBGBTNNPRCVND-UHFFFAOYSA-N 0.000 description 1
- CPJXBYDDVGCLEI-UHFFFAOYSA-N 3,3,3-trifluoropropoxy 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OOCCC(F)(F)F)C=C1 CPJXBYDDVGCLEI-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- ASWJCMBBCJWYJI-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-N-phenylaniline Chemical compound O1C(OCC1)C=1C=C(C=CC=1)NC1=CC=CC=C1 ASWJCMBBCJWYJI-UHFFFAOYSA-N 0.000 description 1
- PXZVFDQJUMNBSD-UHFFFAOYSA-N 3-(1,3-thiazol-2-yloxy)benzaldehyde Chemical compound O=CC1=CC=CC(OC=2SC=CN=2)=C1 PXZVFDQJUMNBSD-UHFFFAOYSA-N 0.000 description 1
- ZMWPLPVGHOWDIM-UHFFFAOYSA-N 3-(1-fluoro-2,2,3,3-tetrapropylhexoxy)benzaldehyde Chemical compound C(CC)C(C(OC=1C=C(C=O)C=CC=1)F)(C(CCC)(CCC)CCC)CCC ZMWPLPVGHOWDIM-UHFFFAOYSA-N 0.000 description 1
- VXNUKVSIHDRZRA-UHFFFAOYSA-N 3-(2,2,2-trifluoroethoxy)benzaldehyde Chemical compound FC(F)(F)COC1=CC=CC(C=O)=C1 VXNUKVSIHDRZRA-UHFFFAOYSA-N 0.000 description 1
- WJHUZESAGHAKEP-UHFFFAOYSA-N 3-(2,2,3,3,3-pentafluoropropoxy)benzaldehyde Chemical compound FC(F)(F)C(F)(F)COC1=CC=CC(C=O)=C1 WJHUZESAGHAKEP-UHFFFAOYSA-N 0.000 description 1
- MBMWQKCLNFZJSF-UHFFFAOYSA-N 3-(2,2-difluoroethoxy)benzaldehyde Chemical compound FC(F)COC1=CC=CC(C=O)=C1 MBMWQKCLNFZJSF-UHFFFAOYSA-N 0.000 description 1
- UZXBHUHYYSAFKG-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-6-carbonitrile Chemical compound N#CC1=CC=C2C(CCN)=CNC2=C1 UZXBHUHYYSAFKG-UHFFFAOYSA-N 0.000 description 1
- IKBSZCXVHMPBCJ-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-7-carbonitrile Chemical compound C1=CC=C2C(CCN)=CNC2=C1C#N IKBSZCXVHMPBCJ-UHFFFAOYSA-N 0.000 description 1
- ORKKYXXBMDAIFN-UHFFFAOYSA-N 3-(2-fluoroethoxy)benzaldehyde Chemical compound FCCOC1=CC=CC(C=O)=C1 ORKKYXXBMDAIFN-UHFFFAOYSA-N 0.000 description 1
- HDSZSLUYVMMCCI-UHFFFAOYSA-N 3-(2-fluorophenoxy)benzaldehyde Chemical compound FC1=CC=CC=C1OC1=CC=CC(C=O)=C1 HDSZSLUYVMMCCI-UHFFFAOYSA-N 0.000 description 1
- ZOGYBOFLODSLAQ-UHFFFAOYSA-N 3-(2-nitroethenyl)-1h-indole-6-carbonitrile Chemical compound N#CC1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 ZOGYBOFLODSLAQ-UHFFFAOYSA-N 0.000 description 1
- AFYKUCNIRAIPNW-UHFFFAOYSA-N 3-(2-nitroethenyl)-1h-indole-7-carbonitrile Chemical compound C1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1C#N AFYKUCNIRAIPNW-UHFFFAOYSA-N 0.000 description 1
- YBAOSAULRVXNSG-UHFFFAOYSA-N 3-(2-nitroethenyl)-4-phenyl-1h-indole Chemical compound C=12C(C=C[N+](=O)[O-])=CNC2=CC=CC=1C1=CC=CC=C1 YBAOSAULRVXNSG-UHFFFAOYSA-N 0.000 description 1
- QSLHGAFVEFSQTM-UHFFFAOYSA-N 3-(2-nitroethenyl)-5-(trifluoromethoxy)-1h-indole Chemical compound C1=C(OC(F)(F)F)C=C2C(C=C[N+](=O)[O-])=CNC2=C1 QSLHGAFVEFSQTM-UHFFFAOYSA-N 0.000 description 1
- VFFPTFSTAVEHQO-UHFFFAOYSA-N 3-(2-nitroethenyl)-5-phenyl-1h-indole Chemical compound C1=C2C(C=C[N+](=O)[O-])=CNC2=CC=C1C1=CC=CC=C1 VFFPTFSTAVEHQO-UHFFFAOYSA-N 0.000 description 1
- VPRPTRSSQMYGLF-UHFFFAOYSA-N 3-(2-nitroethenyl)-5-propan-2-yl-1h-indole Chemical compound CC(C)C1=CC=C2NC=C(C=C[N+]([O-])=O)C2=C1 VPRPTRSSQMYGLF-UHFFFAOYSA-N 0.000 description 1
- IZRFWYJTQBGKNR-UHFFFAOYSA-N 3-(2-nitroethenyl)-5-pyridin-3-yloxy-1h-indole Chemical compound C1=C2C(C=C[N+](=O)[O-])=CNC2=CC=C1OC1=CC=CN=C1 IZRFWYJTQBGKNR-UHFFFAOYSA-N 0.000 description 1
- JSYOPQFGBZWJRT-UHFFFAOYSA-N 3-(2-nitroethenyl)-6-(trifluoromethoxy)-1H-indole Chemical compound [N+](=O)([O-])C=CC1=CNC2=CC(=CC=C12)OC(F)(F)F JSYOPQFGBZWJRT-UHFFFAOYSA-N 0.000 description 1
- POCNTTLOEKRKNC-UHFFFAOYSA-N 3-(2-nitroethenyl)-6-(trifluoromethyl)-1h-indole Chemical compound FC(F)(F)C1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 POCNTTLOEKRKNC-UHFFFAOYSA-N 0.000 description 1
- IUQKUXJTNUHSOD-UHFFFAOYSA-N 3-(2-nitroethenyl)-6-phenoxy-1h-indole Chemical compound C=1C=C2C(C=C[N+](=O)[O-])=CNC2=CC=1OC1=CC=CC=C1 IUQKUXJTNUHSOD-UHFFFAOYSA-N 0.000 description 1
- ZGGGHABKZWWEMT-UHFFFAOYSA-N 3-(2-nitroethenyl)-6-phenyl-1h-indole Chemical compound C=1C=C2C(C=C[N+](=O)[O-])=CNC2=CC=1C1=CC=CC=C1 ZGGGHABKZWWEMT-UHFFFAOYSA-N 0.000 description 1
- VCRFLLTUEQDZAA-UHFFFAOYSA-N 3-(2-nitroethyl)-1h-indole-6-carbonitrile Chemical compound N#CC1=CC=C2C(CC[N+](=O)[O-])=CNC2=C1 VCRFLLTUEQDZAA-UHFFFAOYSA-N 0.000 description 1
- QGEHTHJCIUFTOU-UHFFFAOYSA-N 3-(2-nitroethyl)-1h-indole-7-carbonitrile Chemical compound C1=CC=C2C(CC[N+](=O)[O-])=CNC2=C1C#N QGEHTHJCIUFTOU-UHFFFAOYSA-N 0.000 description 1
- WFJCANPJJSXSAA-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-8-[(4-ethylpiperazin-1-ium-1-yl)methyl]-4-oxo-2-(trifluoromethyl)chromen-7-olate Chemical compound C1CN(CC)CCN1CC1=C(O)C=CC(C2=O)=C1OC(C(F)(F)F)=C2C1=CC=C(OC)C(OC)=C1 WFJCANPJJSXSAA-UHFFFAOYSA-N 0.000 description 1
- BNBMWISQEXSNHT-UHFFFAOYSA-N 3-(3-fluoro-2,2,3-tripropylhexoxy)benzaldehyde Chemical compound C(CC)C(COC=1C=C(C=O)C=CC=1)(C(CCC)(CCC)F)CCC BNBMWISQEXSNHT-UHFFFAOYSA-N 0.000 description 1
- NLGIGFKKNPDYQL-UHFFFAOYSA-N 3-(3-fluorophenoxy)benzaldehyde Chemical compound FC1=CC=CC(OC=2C=C(C=O)C=CC=2)=C1 NLGIGFKKNPDYQL-UHFFFAOYSA-N 0.000 description 1
- HTBZPEDBMOXWID-UHFFFAOYSA-N 3-(4-fluorophenoxy)benzaldehyde Chemical compound C1=CC(F)=CC=C1OC1=CC=CC(C=O)=C1 HTBZPEDBMOXWID-UHFFFAOYSA-N 0.000 description 1
- WYGHUWSNDGHAPO-UHFFFAOYSA-N 3-(4-methylphenyl)sulfanylbenzaldehyde Chemical compound C1=CC(C)=CC=C1SC1=CC=CC(C=O)=C1 WYGHUWSNDGHAPO-UHFFFAOYSA-N 0.000 description 1
- KFKXYUCXUDZADN-UHFFFAOYSA-N 3-(benzenesulfonyl)benzaldehyde Chemical compound O=CC1=CC=CC(S(=O)(=O)C=2C=CC=CC=2)=C1 KFKXYUCXUDZADN-UHFFFAOYSA-N 0.000 description 1
- REWHYFNRHOLFMU-UHFFFAOYSA-N 3-(benzylamino)benzaldehyde Chemical compound O=CC1=CC=CC(NCC=2C=CC=CC=2)=C1 REWHYFNRHOLFMU-UHFFFAOYSA-N 0.000 description 1
- SRNFVFBJQFMBCO-UHFFFAOYSA-N 3-(pyridin-2-ylamino)benzaldehyde Chemical compound O=CC1=CC=CC(NC=2N=CC=CC=2)=C1 SRNFVFBJQFMBCO-UHFFFAOYSA-N 0.000 description 1
- UNEFTLSTTUCJQR-UHFFFAOYSA-N 3-(pyridin-3-ylamino)benzaldehyde Chemical compound O=CC1=CC=CC(NC=2C=NC=CC=2)=C1 UNEFTLSTTUCJQR-UHFFFAOYSA-N 0.000 description 1
- YGCMXTWWQIOAPN-UHFFFAOYSA-N 3-(pyridin-4-ylamino)benzaldehyde Chemical compound O=CC1=CC=CC(NC=2C=CN=CC=2)=C1 YGCMXTWWQIOAPN-UHFFFAOYSA-N 0.000 description 1
- UCRJDPSSCRKWEL-UHFFFAOYSA-N 3-[2-[(3-phenoxyphenyl)methylamino]ethyl]-1h-indol-5-amine Chemical compound C12=CC(N)=CC=C2NC=C1CCNCC(C=1)=CC=CC=1OC1=CC=CC=C1 UCRJDPSSCRKWEL-UHFFFAOYSA-N 0.000 description 1
- IILSNNOPZYJHNJ-UHFFFAOYSA-N 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1h-indol-5-ol Chemical compound C12=CC(O)=CC=C2NC=C1CCNCC1=CC=CC(OCC(F)(F)F)=C1 IILSNNOPZYJHNJ-UHFFFAOYSA-N 0.000 description 1
- BGIKORIGUQFKIA-UHFFFAOYSA-N 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1h-indole-5-carboxylic acid Chemical compound C12=CC(C(=O)O)=CC=C2NC=C1CCNCC1=CC=CC(OCC(F)(F)F)=C1 BGIKORIGUQFKIA-UHFFFAOYSA-N 0.000 description 1
- VHAQRNICMQDRDX-UHFFFAOYSA-N 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1h-indole-6-carboxylic acid Chemical compound C=1NC2=CC(C(=O)O)=CC=C2C=1CCNCC1=CC=CC(OCC(F)(F)F)=C1 VHAQRNICMQDRDX-UHFFFAOYSA-N 0.000 description 1
- MQLHLJWYAMFAPT-UHFFFAOYSA-N 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1h-indole-6-carboxylic acid Chemical compound C=1NC2=CC(C(=O)O)=CC=C2C=1CCNCC1=CC=CC(OCC(F)(F)C(F)F)=C1 MQLHLJWYAMFAPT-UHFFFAOYSA-N 0.000 description 1
- NMGOMUDBTCZUML-UHFFFAOYSA-N 3-[3-(1,3-dioxolan-2-yl)phenoxy]pyridine Chemical compound O1CCOC1C1=CC=CC(OC=2C=NC=CC=2)=C1 NMGOMUDBTCZUML-UHFFFAOYSA-N 0.000 description 1
- LLRMZOZHILMFJU-UHFFFAOYSA-N 3-[fluoro(phenyl)methyl]benzaldehyde Chemical compound C=1C=CC(C=O)=CC=1C(F)C1=CC=CC=C1 LLRMZOZHILMFJU-UHFFFAOYSA-N 0.000 description 1
- GUJWJEWMDDPVSV-UHFFFAOYSA-N 3-anilinobenzaldehyde Chemical compound O=CC1=CC=CC(NC=2C=CC=CC=2)=C1 GUJWJEWMDDPVSV-UHFFFAOYSA-N 0.000 description 1
- RMOKWSUUUYFPRQ-UHFFFAOYSA-N 3-benzylbenzaldehyde Chemical compound O=CC1=CC=CC(CC=2C=CC=CC=2)=C1 RMOKWSUUUYFPRQ-UHFFFAOYSA-N 0.000 description 1
- XWBTZHDDWRNOQH-UHFFFAOYSA-N 3-chloro-2-fluoroaniline Chemical compound NC1=CC=CC(Cl)=C1F XWBTZHDDWRNOQH-UHFFFAOYSA-N 0.000 description 1
- LUNFYXBUYWMPBY-UHFFFAOYSA-N 3-chloro-n-ethylaniline Chemical compound CCNC1=CC=CC(Cl)=C1 LUNFYXBUYWMPBY-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- KCNWLZZKKCXGOC-UHFFFAOYSA-N 3-formyl-1h-indole-6-carbonitrile Chemical compound N#CC1=CC=C2C(C=O)=CNC2=C1 KCNWLZZKKCXGOC-UHFFFAOYSA-N 0.000 description 1
- WFXZKENGRJYLOG-UHFFFAOYSA-N 3-formyl-1h-indole-7-carbonitrile Chemical compound C1=CC=C2C(C=O)=CNC2=C1C#N WFXZKENGRJYLOG-UHFFFAOYSA-N 0.000 description 1
- OSJIANKQQRLVNI-UHFFFAOYSA-N 3-naphthalen-1-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C3=CC=CC=C3C=CC=2)=C1 OSJIANKQQRLVNI-UHFFFAOYSA-N 0.000 description 1
- MHXNRKXYXQSBQM-UHFFFAOYSA-N 3-naphthalen-2-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=C3C=CC=CC3=CC=2)=C1 MHXNRKXYXQSBQM-UHFFFAOYSA-N 0.000 description 1
- MYSAHWZPLQBZMP-UHFFFAOYSA-N 3-phenylsulfanylbenzaldehyde Chemical compound O=CC1=CC=CC(SC=2C=CC=CC=2)=C1 MYSAHWZPLQBZMP-UHFFFAOYSA-N 0.000 description 1
- YGXYNKLOBXMTGL-UHFFFAOYSA-N 3-pyridin-2-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2N=CC=CC=2)=C1 YGXYNKLOBXMTGL-UHFFFAOYSA-N 0.000 description 1
- ZBPDQLHJZVHRFD-UHFFFAOYSA-N 3-pyridin-3-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=NC=CC=2)=C1 ZBPDQLHJZVHRFD-UHFFFAOYSA-N 0.000 description 1
- WNMYKQKINIVSLQ-UHFFFAOYSA-N 3-pyridin-4-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CN=CC=2)=C1 WNMYKQKINIVSLQ-UHFFFAOYSA-N 0.000 description 1
- GZMLYUZTNUHBDQ-UHFFFAOYSA-N 3-pyrimidin-5-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=NC=NC=2)=C1 GZMLYUZTNUHBDQ-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- BHGCCJJOMNIVOA-UHFFFAOYSA-N 4,5,6,7-tetrafluoro-1h-indole-3-carbaldehyde Chemical compound FC1=C(F)C(F)=C2C(C=O)=CNC2=C1F BHGCCJJOMNIVOA-UHFFFAOYSA-N 0.000 description 1
- NEKMJHUYNMNZKC-UHFFFAOYSA-N 4,5,6,7-tetrafluoro-3-(2-nitroethenyl)-1h-indole Chemical compound FC1=C(F)C(F)=C2C(C=C[N+](=O)[O-])=CNC2=C1F NEKMJHUYNMNZKC-UHFFFAOYSA-N 0.000 description 1
- FOXAGBANGCULNS-UHFFFAOYSA-N 4,5,7-trifluoro-1h-indole Chemical compound FC1=CC(F)=C2NC=CC2=C1F FOXAGBANGCULNS-UHFFFAOYSA-N 0.000 description 1
- HLQHYSGZOYYOGY-UHFFFAOYSA-N 4,5,7-trifluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC(F)=C2NC=C(C=O)C2=C1F HLQHYSGZOYYOGY-UHFFFAOYSA-N 0.000 description 1
- MRJVZXJPQHBEHI-UHFFFAOYSA-N 4,5,7-trifluoro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=C(F)C(F)=C2C(C=C[N+](=O)[O-])=CNC2=C1F MRJVZXJPQHBEHI-UHFFFAOYSA-N 0.000 description 1
- HPTKNPZQVFVULT-UHFFFAOYSA-N 4,6-difluoro-1-methyl-3-(2-nitroethenyl)indole Chemical compound C1=C(F)C=C2N(C)C=C(C=C[N+]([O-])=O)C2=C1F HPTKNPZQVFVULT-UHFFFAOYSA-N 0.000 description 1
- DVCZTCVQOFJTJQ-UHFFFAOYSA-N 4,6-difluoro-1-methylindole Chemical compound C1=C(F)C=C2N(C)C=CC2=C1F DVCZTCVQOFJTJQ-UHFFFAOYSA-N 0.000 description 1
- UVFYDUVPIIPLMT-UHFFFAOYSA-N 4,6-difluoro-1-methylindole-3-carbaldehyde Chemical compound C1=C(F)C=C2N(C)C=C(C=O)C2=C1F UVFYDUVPIIPLMT-UHFFFAOYSA-N 0.000 description 1
- MHICCULQVCEWFH-UHFFFAOYSA-N 4,6-difluoro-1h-indole Chemical compound FC1=CC(F)=C2C=CNC2=C1 MHICCULQVCEWFH-UHFFFAOYSA-N 0.000 description 1
- IWRRYXZHDDCDRW-UHFFFAOYSA-N 4,6-difluoro-5-methoxy-1-methyl-3-(2-nitroethenyl)indole Chemical compound COC1=C(F)C=C2N(C)C=C(C=C[N+]([O-])=O)C2=C1F IWRRYXZHDDCDRW-UHFFFAOYSA-N 0.000 description 1
- WWALTVLHGRNEOC-UHFFFAOYSA-N 4,6-difluoro-5-methoxy-1-methylindole-3-carbaldehyde Chemical compound COC1=C(F)C=C2N(C)C=C(C=O)C2=C1F WWALTVLHGRNEOC-UHFFFAOYSA-N 0.000 description 1
- NIWNJNUVNDEHOH-UHFFFAOYSA-N 4,6-difluoro-5-methoxy-1h-indole Chemical compound COC1=C(F)C=C2NC=CC2=C1F NIWNJNUVNDEHOH-UHFFFAOYSA-N 0.000 description 1
- VSEZCPUOXLITPT-UHFFFAOYSA-N 4,6-difluoro-5-methoxy-1h-indole-3-carbaldehyde Chemical compound COC1=C(F)C=C2NC=C(C=O)C2=C1F VSEZCPUOXLITPT-UHFFFAOYSA-N 0.000 description 1
- QONILRVHCQLIDB-UHFFFAOYSA-N 4,6-difluoro-5-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound COC1=C(F)C=C2NC=C(C=C[N+]([O-])=O)C2=C1F QONILRVHCQLIDB-UHFFFAOYSA-N 0.000 description 1
- WXDUAQYBARJXOQ-UHFFFAOYSA-N 4,7-difluoro-1h-indole Chemical compound FC1=CC=C(F)C2=C1C=CN2 WXDUAQYBARJXOQ-UHFFFAOYSA-N 0.000 description 1
- PSSJOLWTOHSGJU-UHFFFAOYSA-N 4,7-difluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC=C(F)C2=C1NC=C2C=O PSSJOLWTOHSGJU-UHFFFAOYSA-N 0.000 description 1
- JDAPUPJTOOIQJM-UHFFFAOYSA-N 4,7-difluoro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC(F)=C2C(C=C[N+](=O)[O-])=CNC2=C1F JDAPUPJTOOIQJM-UHFFFAOYSA-N 0.000 description 1
- IRUQIIGSBGKMQE-UHFFFAOYSA-N 4-(4-fluorophenoxy)-2-methyl-1-nitrobenzene Chemical compound C1=C([N+]([O-])=O)C(C)=CC(OC=2C=CC(F)=CC=2)=C1 IRUQIIGSBGKMQE-UHFFFAOYSA-N 0.000 description 1
- YMQPKONILWWJQG-UHFFFAOYSA-N 4-bromo-1,2-difluorobenzene Chemical compound FC1=CC=C(Br)C=C1F YMQPKONILWWJQG-UHFFFAOYSA-N 0.000 description 1
- KZNXALJXBRSMFL-UHFFFAOYSA-N 4-bromo-1-methyl-2-nitrobenzene Chemical compound CC1=CC=C(Br)C=C1[N+]([O-])=O KZNXALJXBRSMFL-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- MSYJFNQAVTYKOP-UHFFFAOYSA-N 4-chloro-1h-indole-3-carbaldehyde Chemical compound ClC1=CC=CC2=C1C(C=O)=CN2 MSYJFNQAVTYKOP-UHFFFAOYSA-N 0.000 description 1
- RUQNVWBRXQDNGP-UHFFFAOYSA-N 4-chloro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC(Cl)=C2C(C=C[N+](=O)[O-])=CNC2=C1 RUQNVWBRXQDNGP-UHFFFAOYSA-N 0.000 description 1
- HQOCPGOGWXFIHG-UHFFFAOYSA-N 4-chloro-5-methoxy-1h-indole-3-carbaldehyde Chemical compound COC1=CC=C2NC=C(C=O)C2=C1Cl HQOCPGOGWXFIHG-UHFFFAOYSA-N 0.000 description 1
- SWOQHISMICTQFR-UHFFFAOYSA-N 4-chloro-5-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound COC1=CC=C2NC=C(C=C[N+]([O-])=O)C2=C1Cl SWOQHISMICTQFR-UHFFFAOYSA-N 0.000 description 1
- BTOJSYRZQZOMOK-UHFFFAOYSA-N 4-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1C2=NC=NC(Cl)=C2C=C1 BTOJSYRZQZOMOK-UHFFFAOYSA-N 0.000 description 1
- CMNRHJOJYQIGDD-UHFFFAOYSA-N 4-fluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC=CC2=C1C(C=O)=CN2 CMNRHJOJYQIGDD-UHFFFAOYSA-N 0.000 description 1
- JHFOWEGCZWLHNW-UHFFFAOYSA-N 4-fluoro-2-methyl-1-nitrobenzene Chemical compound CC1=CC(F)=CC=C1[N+]([O-])=O JHFOWEGCZWLHNW-UHFFFAOYSA-N 0.000 description 1
- BZSCCMMIVJZWNW-UHFFFAOYSA-N 4-fluoro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC(F)=C2C(C=C[N+](=O)[O-])=CNC2=C1 BZSCCMMIVJZWNW-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- LBUNNMJLXWQQBY-UHFFFAOYSA-N 4-fluorophenylboronic acid Chemical compound OB(O)C1=CC=C(F)C=C1 LBUNNMJLXWQQBY-UHFFFAOYSA-N 0.000 description 1
- LUNOXNMCFPFPMO-UHFFFAOYSA-N 4-methoxy-1h-indole Chemical compound COC1=CC=CC2=C1C=CN2 LUNOXNMCFPFPMO-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- DNGJVDGPCGXBFF-UHFFFAOYSA-N 4-methyl-n-(methyldiazenyl)aniline Chemical compound CN=NNC1=CC=C(C)C=C1 DNGJVDGPCGXBFF-UHFFFAOYSA-N 0.000 description 1
- LCTDIQQSJICLJM-UHFFFAOYSA-N 4-phenyl-1h-indole Chemical compound C1=CC=C2NC=CC2=C1C1=CC=CC=C1 LCTDIQQSJICLJM-UHFFFAOYSA-N 0.000 description 1
- WIORMEXVAISGBH-UHFFFAOYSA-N 4-phenyl-1h-indole-3-carbaldehyde Chemical compound C=12C(C=O)=CNC2=CC=CC=1C1=CC=CC=C1 WIORMEXVAISGBH-UHFFFAOYSA-N 0.000 description 1
- QSMSVCBDSJEBFM-UHFFFAOYSA-N 5,6,7-trifluoro-1h-indole Chemical compound FC1=C(F)C(F)=CC2=C1NC=C2 QSMSVCBDSJEBFM-UHFFFAOYSA-N 0.000 description 1
- UVMGODGPNAUNJI-UHFFFAOYSA-N 5,6,7-trifluoro-1h-indole-3-carbaldehyde Chemical compound FC1=C(F)C(F)=CC2=C1NC=C2C=O UVMGODGPNAUNJI-UHFFFAOYSA-N 0.000 description 1
- MAOGTJOHRKYWIU-UHFFFAOYSA-N 5,6,7-trifluoro-3-(2-nitroethenyl)-1h-indole Chemical compound FC1=C(F)C=C2C(C=C[N+](=O)[O-])=CNC2=C1F MAOGTJOHRKYWIU-UHFFFAOYSA-N 0.000 description 1
- YCVSNMPGFSFANR-UHFFFAOYSA-N 5,6-difluoro-1h-indole Chemical compound C1=C(F)C(F)=CC2=C1NC=C2 YCVSNMPGFSFANR-UHFFFAOYSA-N 0.000 description 1
- JVFNNILBFBSJLA-UHFFFAOYSA-N 5,6-difluoro-1h-indole-3-carbaldehyde Chemical compound C1=C(F)C(F)=CC2=C1C(C=O)=CN2 JVFNNILBFBSJLA-UHFFFAOYSA-N 0.000 description 1
- DRBWDROVHLINEN-UHFFFAOYSA-N 5,6-difluoro-3-(2-nitroethenyl)-1h-indole Chemical compound FC1=C(F)C=C2C(C=C[N+](=O)[O-])=CNC2=C1 DRBWDROVHLINEN-UHFFFAOYSA-N 0.000 description 1
- WZPOGQRJXZGSMH-UHFFFAOYSA-N 5,7-difluoro-1h-indole Chemical compound FC1=CC(F)=C2NC=CC2=C1 WZPOGQRJXZGSMH-UHFFFAOYSA-N 0.000 description 1
- PPTOWNFNQOQDSL-UHFFFAOYSA-N 5,7-difluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC(F)=C2NC=C(C=O)C2=C1 PPTOWNFNQOQDSL-UHFFFAOYSA-N 0.000 description 1
- BLMBNIGXSZBUAA-UHFFFAOYSA-N 5,7-difluoro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=C(F)C=C2C(C=C[N+](=O)[O-])=CNC2=C1F BLMBNIGXSZBUAA-UHFFFAOYSA-N 0.000 description 1
- HPCRIHXNUIVSEF-UHFFFAOYSA-N 5-(2-methylphenoxy)-1h-indole Chemical compound CC1=CC=CC=C1OC1=CC=C(NC=C2)C2=C1 HPCRIHXNUIVSEF-UHFFFAOYSA-N 0.000 description 1
- IWQBBMSKQRDCEY-UHFFFAOYSA-N 5-(3-methylphenoxy)-1h-indole Chemical compound CC1=CC=CC(OC=2C=C3C=CNC3=CC=2)=C1 IWQBBMSKQRDCEY-UHFFFAOYSA-N 0.000 description 1
- FEXFHSSHKADPDJ-UHFFFAOYSA-N 5-(4-fluorophenoxy)-1h-indole Chemical compound C1=CC(F)=CC=C1OC1=CC=C(NC=C2)C2=C1 FEXFHSSHKADPDJ-UHFFFAOYSA-N 0.000 description 1
- FZEPXXHITBIOIY-UHFFFAOYSA-N 5-(4-fluorophenyl)-1h-indole Chemical compound C1=CC(F)=CC=C1C1=CC=C(NC=C2)C2=C1 FZEPXXHITBIOIY-UHFFFAOYSA-N 0.000 description 1
- LCQGMNFFFDJUQW-UHFFFAOYSA-N 5-(4-fluorophenyl)-1h-indole-3-carbaldehyde Chemical compound C1=CC(F)=CC=C1C1=CC=C(NC=C2C=O)C2=C1 LCQGMNFFFDJUQW-UHFFFAOYSA-N 0.000 description 1
- WEBJEMXNEFSMIW-UHFFFAOYSA-N 5-(benzenesulfonyl)-1h-indole Chemical compound C=1C=C2NC=CC2=CC=1S(=O)(=O)C1=CC=CC=C1 WEBJEMXNEFSMIW-UHFFFAOYSA-N 0.000 description 1
- KBVRGMIEJXJRPL-UHFFFAOYSA-N 5-(benzenesulfonyl)-1h-indole-3-carbaldehyde Chemical compound C1=C2C(C=O)=CNC2=CC=C1S(=O)(=O)C1=CC=CC=C1 KBVRGMIEJXJRPL-UHFFFAOYSA-N 0.000 description 1
- NHAMTTUYEBGZAG-UHFFFAOYSA-N 5-(benzenesulfonyl)-3-(2-nitroethenyl)-1h-indole Chemical compound C1=C2C(C=C[N+](=O)[O-])=CNC2=CC=C1S(=O)(=O)C1=CC=CC=C1 NHAMTTUYEBGZAG-UHFFFAOYSA-N 0.000 description 1
- FSCREPIMFJLPDK-UHFFFAOYSA-N 5-(benzenesulfonyl)-3-(2-nitroethyl)-1h-indole Chemical compound C1=C2C(CC[N+](=O)[O-])=CNC2=CC=C1S(=O)(=O)C1=CC=CC=C1 FSCREPIMFJLPDK-UHFFFAOYSA-N 0.000 description 1
- XVYXWSODSCHHHB-UHFFFAOYSA-N 5-(trifluoromethoxy)-1h-indole Chemical compound FC(F)(F)OC1=CC=C2NC=CC2=C1 XVYXWSODSCHHHB-UHFFFAOYSA-N 0.000 description 1
- ARTKLTJGFSFCIC-UHFFFAOYSA-N 5-(trifluoromethoxy)-1h-indole-3-carbaldehyde Chemical compound FC(F)(F)OC1=CC=C2NC=C(C=O)C2=C1 ARTKLTJGFSFCIC-UHFFFAOYSA-N 0.000 description 1
- LCFDJWUYKUPBJM-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-indole Chemical compound FC(F)(F)C1=CC=C2NC=CC2=C1 LCFDJWUYKUPBJM-UHFFFAOYSA-N 0.000 description 1
- 102000049773 5-HT2A Serotonin Receptor Human genes 0.000 description 1
- 108010072564 5-HT2A Serotonin Receptor Proteins 0.000 description 1
- 108091005482 5-HT4 receptors Proteins 0.000 description 1
- 229940124801 5-HT6 antagonist Drugs 0.000 description 1
- 108091005436 5-HT7 receptors Proteins 0.000 description 1
- ZPUQCVKBNRGSAP-UHFFFAOYSA-N 5-bromo-1h-indole-3-carbonitrile Chemical compound BrC1=CC=C2NC=C(C#N)C2=C1 ZPUQCVKBNRGSAP-UHFFFAOYSA-N 0.000 description 1
- SJJDMAUWJKZIJL-UHFFFAOYSA-N 5-bromo-7-ethyl-1h-indole Chemical compound CCC1=CC(Br)=CC2=C1NC=C2 SJJDMAUWJKZIJL-UHFFFAOYSA-N 0.000 description 1
- YUAJKGBLPVLADK-UHFFFAOYSA-N 5-fluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC=C2NC=C(C=O)C2=C1 YUAJKGBLPVLADK-UHFFFAOYSA-N 0.000 description 1
- 101710150235 5-hydroxytryptamine receptor 6 Proteins 0.000 description 1
- 102100040368 5-hydroxytryptamine receptor 6 Human genes 0.000 description 1
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 1
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 1
- KDXXXECBTWLZSQ-UHFFFAOYSA-N 5-methoxy-2-methyl-1h-indole-3-carbaldehyde Chemical compound COC1=CC=C2NC(C)=C(C=O)C2=C1 KDXXXECBTWLZSQ-UHFFFAOYSA-N 0.000 description 1
- OABIVZFGDVYATG-UHFFFAOYSA-N 5-methoxy-2-methyl-3-(2-nitroethenyl)-1h-indole Chemical compound COC1=CC=C2NC(C)=C(C=C[N+]([O-])=O)C2=C1 OABIVZFGDVYATG-UHFFFAOYSA-N 0.000 description 1
- VEHBDILKNMMKNS-UHFFFAOYSA-N 5-methoxy-3-(2-nitroethenyl)-6-(trifluoromethyl)-1h-indole Chemical compound C1=C(C(F)(F)F)C(OC)=CC2=C1NC=C2C=C[N+]([O-])=O VEHBDILKNMMKNS-UHFFFAOYSA-N 0.000 description 1
- HMXMIYGLVJMKTC-UHFFFAOYSA-N 5-methoxy-6-(trifluoromethyl)-1h-indole-3-carbaldehyde Chemical compound C1=C(C(F)(F)F)C(OC)=CC2=C1NC=C2C=O HMXMIYGLVJMKTC-UHFFFAOYSA-N 0.000 description 1
- 229940097276 5-methoxytryptamine Drugs 0.000 description 1
- OZFPSOBLQZPIAV-UHFFFAOYSA-N 5-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2NC=CC2=C1 OZFPSOBLQZPIAV-UHFFFAOYSA-N 0.000 description 1
- LPYXADUZSWBHCT-UHFFFAOYSA-N 5-phenyl-1h-indole Chemical compound C=1C=C2NC=CC2=CC=1C1=CC=CC=C1 LPYXADUZSWBHCT-UHFFFAOYSA-N 0.000 description 1
- PCRRCKNLNAJPHQ-UHFFFAOYSA-N 5-phenyl-1h-indole-3-carbaldehyde Chemical compound C1=C2C(C=O)=CNC2=CC=C1C1=CC=CC=C1 PCRRCKNLNAJPHQ-UHFFFAOYSA-N 0.000 description 1
- LBVLQBYXKBTHJA-UHFFFAOYSA-N 5-propan-2-yl-1h-indole Chemical compound CC(C)C1=CC=C2NC=CC2=C1 LBVLQBYXKBTHJA-UHFFFAOYSA-N 0.000 description 1
- UUSPREYLUMGLEJ-UHFFFAOYSA-N 5-propan-2-yl-1h-indole-3-carbaldehyde Chemical compound CC(C)C1=CC=C2NC=C(C=O)C2=C1 UUSPREYLUMGLEJ-UHFFFAOYSA-N 0.000 description 1
- GPZRBKWRRKBOAC-UHFFFAOYSA-N 55747-72-3 Chemical compound C1=C([N+]([O-])=O)C=C2C(CCN)=CNC2=C1 GPZRBKWRRKBOAC-UHFFFAOYSA-N 0.000 description 1
- SEHXAAULCXHFQO-UHFFFAOYSA-N 6,7-difluoro-1h-indole Chemical compound FC1=CC=C2C=CNC2=C1F SEHXAAULCXHFQO-UHFFFAOYSA-N 0.000 description 1
- OGUSOKHBEPYSJX-UHFFFAOYSA-N 6,7-difluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC=C2C(C=O)=CNC2=C1F OGUSOKHBEPYSJX-UHFFFAOYSA-N 0.000 description 1
- WRJHVDKHUZFODY-UHFFFAOYSA-N 6,7-difluoro-3-(2-nitroethenyl)-1h-indole Chemical compound FC1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1F WRJHVDKHUZFODY-UHFFFAOYSA-N 0.000 description 1
- VAJNOCXPXNUTBB-UHFFFAOYSA-N 6-(4-fluorophenyl)-1,5-diazabicyclo[3.1.0]hexane Chemical compound C1=CC(F)=CC=C1C1N2CCCN21 VAJNOCXPXNUTBB-UHFFFAOYSA-N 0.000 description 1
- CXZUQPQWARYLIO-UHFFFAOYSA-N 6-(benzenesulfonyl)-3-(2-nitroethyl)-1h-indole Chemical compound C=1C=C2C(CC[N+](=O)[O-])=CNC2=CC=1S(=O)(=O)C1=CC=CC=C1 CXZUQPQWARYLIO-UHFFFAOYSA-N 0.000 description 1
- DODJNBPQUZSJKO-UHFFFAOYSA-N 6-(trifluoromethoxy)-1h-indole Chemical compound FC(F)(F)OC1=CC=C2C=CNC2=C1 DODJNBPQUZSJKO-UHFFFAOYSA-N 0.000 description 1
- SYHWDFUXSQIWHE-UHFFFAOYSA-N 6-(trifluoromethoxy)-1h-indole-3-carbaldehyde Chemical compound FC(F)(F)OC1=CC=C2C(C=O)=CNC2=C1 SYHWDFUXSQIWHE-UHFFFAOYSA-N 0.000 description 1
- BPYBYPREOVLFED-UHFFFAOYSA-N 6-(trifluoromethyl)-1h-indole Chemical compound FC(F)(F)C1=CC=C2C=CNC2=C1 BPYBYPREOVLFED-UHFFFAOYSA-N 0.000 description 1
- BOCHZCCEJLKHMZ-UHFFFAOYSA-N 6-(trifluoromethyl)-1h-indole-3-carbaldehyde Chemical compound FC(F)(F)C1=CC=C2C(C=O)=CNC2=C1 BOCHZCCEJLKHMZ-UHFFFAOYSA-N 0.000 description 1
- WCCLQCBKBPTODV-UHFFFAOYSA-N 6-bromo-1h-indole-3-carbaldehyde Chemical compound BrC1=CC=C2C(C=O)=CNC2=C1 WCCLQCBKBPTODV-UHFFFAOYSA-N 0.000 description 1
- UVNXVMQPLCESSJ-UHFFFAOYSA-N 6-bromo-3-(2-nitroethenyl)-1h-indole Chemical compound BrC1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 UVNXVMQPLCESSJ-UHFFFAOYSA-N 0.000 description 1
- IHFDNZDKJGBIHK-UHFFFAOYSA-N 6-bromo-3-(2-nitroethyl)-1h-indole Chemical compound BrC1=CC=C2C(CC[N+](=O)[O-])=CNC2=C1 IHFDNZDKJGBIHK-UHFFFAOYSA-N 0.000 description 1
- CTNIXLBHXMSZKL-UHFFFAOYSA-N 6-chloro-1h-indole-3-carbaldehyde Chemical compound ClC1=CC=C2C(C=O)=CNC2=C1 CTNIXLBHXMSZKL-UHFFFAOYSA-N 0.000 description 1
- AJSOAMODRCFPIG-UHFFFAOYSA-N 6-chloro-3-(2-nitroethenyl)-1h-indole Chemical compound ClC1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 AJSOAMODRCFPIG-UHFFFAOYSA-N 0.000 description 1
- DSMXRCUWBYQGKP-UHFFFAOYSA-N 6-chloro-5-fluoro-1h-indole-3-carbaldehyde Chemical compound C1=C(Cl)C(F)=CC2=C1NC=C2C=O DSMXRCUWBYQGKP-UHFFFAOYSA-N 0.000 description 1
- PMRYTWPARYROBF-UHFFFAOYSA-N 6-chloro-5-fluoro-3-(2-nitroethenyl)-1h-indole Chemical compound ClC1=C(F)C=C2C(C=C[N+](=O)[O-])=CNC2=C1 PMRYTWPARYROBF-UHFFFAOYSA-N 0.000 description 1
- SHXXLOIGTOKQAY-UHFFFAOYSA-N 6-chloro-5-methoxy-1h-indole-3-carbaldehyde Chemical compound C1=C(Cl)C(OC)=CC2=C1NC=C2C=O SHXXLOIGTOKQAY-UHFFFAOYSA-N 0.000 description 1
- FLFWYXYZSTVRHE-UHFFFAOYSA-N 6-chloro-5-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound C1=C(Cl)C(OC)=CC2=C1NC=C2C=C[N+]([O-])=O FLFWYXYZSTVRHE-UHFFFAOYSA-N 0.000 description 1
- YYFFEPUCAKVRJX-UHFFFAOYSA-N 6-fluoro-1h-indole Chemical compound FC1=CC=C2C=CNC2=C1 YYFFEPUCAKVRJX-UHFFFAOYSA-N 0.000 description 1
- DANYGEQACAPBOK-UHFFFAOYSA-N 6-fluoro-5-methoxy-1h-indole Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2 DANYGEQACAPBOK-UHFFFAOYSA-N 0.000 description 1
- YYSAJGDHZRLRCQ-UHFFFAOYSA-N 6-fluoro-5-methoxy-1h-indole-3-carbaldehyde Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2C=O YYSAJGDHZRLRCQ-UHFFFAOYSA-N 0.000 description 1
- MFHFEEKZGIACMP-UHFFFAOYSA-N 6-fluoro-5-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2C=C[N+]([O-])=O MFHFEEKZGIACMP-UHFFFAOYSA-N 0.000 description 1
- JTEFJNIWWXTBMP-UHFFFAOYSA-N 6-methoxy-1h-indole-3-carbaldehyde Chemical compound COC1=CC=C2C(C=O)=CNC2=C1 JTEFJNIWWXTBMP-UHFFFAOYSA-N 0.000 description 1
- AAUZVZFPNRESPR-UHFFFAOYSA-N 6-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound COC1=CC=C2C(C=C[N+]([O-])=O)=CNC2=C1 AAUZVZFPNRESPR-UHFFFAOYSA-N 0.000 description 1
- LZERQSJGPXFAKB-UHFFFAOYSA-N 6-methyl-1h-indole-3-carbaldehyde Chemical compound CC1=CC=C2C(C=O)=CNC2=C1 LZERQSJGPXFAKB-UHFFFAOYSA-N 0.000 description 1
- ZXMNOMNFTHGLCF-UHFFFAOYSA-N 6-methyl-3-(2-nitroethenyl)-1h-indole Chemical compound CC1=CC=C2C(C=C[N+]([O-])=O)=CNC2=C1 ZXMNOMNFTHGLCF-UHFFFAOYSA-N 0.000 description 1
- JWTQNTZIBMCANV-UHFFFAOYSA-N 6-methylsulfonyl-3-(2-nitroethyl)-1h-indole Chemical compound CS(=O)(=O)C1=CC=C2C(CC[N+]([O-])=O)=CNC2=C1 JWTQNTZIBMCANV-UHFFFAOYSA-N 0.000 description 1
- ZGUVWRGGPVNMEK-UHFFFAOYSA-N 6-phenyl-1h-indole-3-carbaldehyde Chemical compound C=1C=C2C(C=O)=CNC2=CC=1C1=CC=CC=C1 ZGUVWRGGPVNMEK-UHFFFAOYSA-N 0.000 description 1
- UUKFCVCTRWNXBI-UHFFFAOYSA-N 6-phenylmethoxy-1h-indole-3-carbaldehyde Chemical compound C=1C=C2C(C=O)=CNC2=CC=1OCC1=CC=CC=C1 UUKFCVCTRWNXBI-UHFFFAOYSA-N 0.000 description 1
- RDSVSEFWZUWZHW-UHFFFAOYSA-N 7-bromo-1h-indole Chemical compound BrC1=CC=CC2=C1NC=C2 RDSVSEFWZUWZHW-UHFFFAOYSA-N 0.000 description 1
- WMYQAKANKREQLM-UHFFFAOYSA-N 7-chloro-1h-indole Chemical compound ClC1=CC=CC2=C1NC=C2 WMYQAKANKREQLM-UHFFFAOYSA-N 0.000 description 1
- NHJNOJSRXQVQRT-UHFFFAOYSA-N 7-chloro-1h-indole-3-carbaldehyde Chemical compound ClC1=CC=CC2=C1NC=C2C=O NHJNOJSRXQVQRT-UHFFFAOYSA-N 0.000 description 1
- JMBVHPBSXMERFG-UHFFFAOYSA-N 7-chloro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1Cl JMBVHPBSXMERFG-UHFFFAOYSA-N 0.000 description 1
- AHVRLLVALCYEEP-UHFFFAOYSA-N 7-fluoro-1h-indole-3-carbaldehyde Chemical compound FC1=CC=CC2=C1NC=C2C=O AHVRLLVALCYEEP-UHFFFAOYSA-N 0.000 description 1
- YSKIUAGURHCVKZ-UHFFFAOYSA-N 7-fluoro-3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1F YSKIUAGURHCVKZ-UHFFFAOYSA-N 0.000 description 1
- ATFRUNSOMCCJDJ-UHFFFAOYSA-N 7-methoxy-1h-indole-3-carbaldehyde Chemical compound COC1=CC=CC2=C1NC=C2C=O ATFRUNSOMCCJDJ-UHFFFAOYSA-N 0.000 description 1
- CFCPKVSVKNRBGN-UHFFFAOYSA-N 7-methoxy-3-(2-nitroethenyl)-1h-indole Chemical compound COC1=CC=CC2=C1NC=C2C=C[N+]([O-])=O CFCPKVSVKNRBGN-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229910015844 BCl3 Inorganic materials 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FGUUSXIOTUKUDN-IBGZPJMESA-N C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 Chemical compound C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 FGUUSXIOTUKUDN-IBGZPJMESA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000191368 Chlorobi Species 0.000 description 1
- 229940122041 Cholinesterase inhibitor Drugs 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- PSCXEUSWZWRCMQ-UHFFFAOYSA-N F[S](F)F Chemical compound F[S](F)F PSCXEUSWZWRCMQ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108091006027 G proteins Proteins 0.000 description 1
- 102000030782 GTP binding Human genes 0.000 description 1
- 108091000058 GTP-Binding Proteins 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- 101000964051 Homo sapiens 5-hydroxytryptamine receptor 6 Proteins 0.000 description 1
- 102000004310 Ion Channels Human genes 0.000 description 1
- 108090000862 Ion Channels Proteins 0.000 description 1
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 description 1
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 1
- FIIYZDPMGPSKLS-UHFFFAOYSA-N N-ethyl-2-(1-ethyl-5-methoxyindol-3-yl)-N-[(3-phenoxyphenyl)methyl]ethanamine Chemical compound COC=1C=C2C(=CN(C2=CC=1)CC)CCN(CC)CC1=CC(=CC=C1)OC1=CC=CC=C1 FIIYZDPMGPSKLS-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- PIJVFDBKTWXHHD-UHFFFAOYSA-N Physostigmine Natural products C12=CC(OC(=O)NC)=CC=C2N(C)C2C1(C)CCN2C PIJVFDBKTWXHHD-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 101000964045 Rattus norvegicus 5-hydroxytryptamine receptor 6 Proteins 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- NZPRGYBCSLSUOM-UHFFFAOYSA-N [3-(1,3-dioxolan-2-yl)phenyl]-phenylmethanone Chemical compound C=1C=CC(C2OCCO2)=CC=1C(=O)C1=CC=CC=C1 NZPRGYBCSLSUOM-UHFFFAOYSA-N 0.000 description 1
- CKBKXJPHMFIFEA-UHFFFAOYSA-N [3-[[2-(3-chlorophenyl)ethylamino]methyl]phenyl]-phenylmethanone Chemical compound ClC1=CC=CC(CCNCC=2C=C(C=CC=2)C(=O)C=2C=CC=CC=2)=C1 CKBKXJPHMFIFEA-UHFFFAOYSA-N 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 229960000836 amitriptyline Drugs 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940025084 amphetamine Drugs 0.000 description 1
- 230000000561 anti-psychotic effect Effects 0.000 description 1
- 229940065524 anticholinergics inhalants for obstructive airway diseases Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000000376 autoradiography Methods 0.000 description 1
- DCBDOYDVQJVXOH-UHFFFAOYSA-N azane;1h-indole Chemical compound N.C1=CC=C2NC=CC2=C1 DCBDOYDVQJVXOH-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- IDIPWEYIBKUDNY-UHFFFAOYSA-N benzenesulfonyl fluoride Chemical compound FS(=O)(=O)C1=CC=CC=C1 IDIPWEYIBKUDNY-UHFFFAOYSA-N 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 210000003710 cerebral cortex Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- JOYKCMAPFCSKNO-UHFFFAOYSA-N chloro benzenesulfonate Chemical compound ClOS(=O)(=O)C1=CC=CC=C1 JOYKCMAPFCSKNO-UHFFFAOYSA-N 0.000 description 1
- KVSASDOGYIBWTA-UHFFFAOYSA-N chloro benzoate Chemical compound ClOC(=O)C1=CC=CC=C1 KVSASDOGYIBWTA-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 230000006949 cholinergic function Effects 0.000 description 1
- 210000002932 cholinergic neuron Anatomy 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 230000019771 cognition Effects 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000007596 consolidation process Methods 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- LNZMEOLVTKHUAS-UHFFFAOYSA-N cyclohexane;dichloromethane Chemical compound ClCCl.C1CCCCC1 LNZMEOLVTKHUAS-UHFFFAOYSA-N 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-M decanoate Chemical compound CCCCCCCCCC([O-])=O GHVNFZFCNZKVNT-UHFFFAOYSA-M 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- KNGNDRNAPDAOJU-UHFFFAOYSA-N dibenzofuran-3-carbaldehyde Chemical compound C1=CC=C2C3=CC=C(C=O)C=C3OC2=C1 KNGNDRNAPDAOJU-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- UWGIJJRGSGDBFJ-UHFFFAOYSA-N dichloromethylsilane Chemical compound [SiH3]C(Cl)Cl UWGIJJRGSGDBFJ-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229960003530 donepezil Drugs 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- VVDUZZGYBOWDSQ-UHFFFAOYSA-M eschenmoser's salt Chemical compound [I-].C[N+](C)=C VVDUZZGYBOWDSQ-UHFFFAOYSA-M 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- PDXPRWCJESNIIT-UHFFFAOYSA-N ethyl 1h-indole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2NC=CC2=C1 PDXPRWCJESNIIT-UHFFFAOYSA-N 0.000 description 1
- MEKNJNYVMBSRQJ-UHFFFAOYSA-N ethyl 3,3,3-trifluoro-2-hydroxy-2-[3-methoxy-4-(naphthalen-2-ylcarbamoylamino)phenyl]propanoate Chemical compound COC1=CC(C(O)(C(=O)OCC)C(F)(F)F)=CC=C1NC(=O)NC1=CC=C(C=CC=C2)C2=C1 MEKNJNYVMBSRQJ-UHFFFAOYSA-N 0.000 description 1
- RBDUKSUSBFEYSI-UHFFFAOYSA-N ethyl 3-(2-nitroethenyl)-1h-indole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2NC=C(C=C[N+]([O-])=O)C2=C1 RBDUKSUSBFEYSI-UHFFFAOYSA-N 0.000 description 1
- YUWKQFAROCKHLZ-UHFFFAOYSA-N ethyl 3-(2-nitroethyl)-1h-indole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2NC=C(CC[N+]([O-])=O)C2=C1 YUWKQFAROCKHLZ-UHFFFAOYSA-N 0.000 description 1
- XMCFLTQKFKSXLX-UHFFFAOYSA-N ethyl 3-formyl-1h-indole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2NC=C(C=O)C2=C1 XMCFLTQKFKSXLX-UHFFFAOYSA-N 0.000 description 1
- MHYCRLGKOZWVEF-UHFFFAOYSA-N ethyl acetate;hydrate Chemical compound O.CCOC(C)=O MHYCRLGKOZWVEF-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- ZTPDKYAWOAYMNF-UHFFFAOYSA-N ethyl n-(2-bromo-4,5-difluorophenyl)carbamate Chemical compound CCOC(=O)NC1=CC(F)=C(F)C=C1Br ZTPDKYAWOAYMNF-UHFFFAOYSA-N 0.000 description 1
- GOPFQTJVFXDNHN-UHFFFAOYSA-N ethyl n-[4-(trifluoromethoxy)-2-(2-trimethylsilylethynyl)phenyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(OC(F)(F)F)C=C1C#C[Si](C)(C)C GOPFQTJVFXDNHN-UHFFFAOYSA-N 0.000 description 1
- DENJGVOANBFJAW-UHFFFAOYSA-N ethyl n-[5-fluoro-4-methoxy-2-(2-trimethylsilylethynyl)phenyl]carbamate Chemical compound CCOC(=O)NC1=CC(F)=C(OC)C=C1C#C[Si](C)(C)C DENJGVOANBFJAW-UHFFFAOYSA-N 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- ZYEBOCLYTNOOMN-UHFFFAOYSA-N fluorohydrazine;hydrochloride Chemical compound Cl.NNF ZYEBOCLYTNOOMN-UHFFFAOYSA-N 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 238000011990 functional testing Methods 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000005748 halopyridines Chemical class 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000001320 hippocampus Anatomy 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000003364 immunohistochemistry Methods 0.000 description 1
- JFDDFGLNZWNJTK-UHFFFAOYSA-N indole-4-carbaldehyde Chemical compound O=CC1=CC=CC2=C1C=CN2 JFDDFGLNZWNJTK-UHFFFAOYSA-N 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000000185 intracerebroventricular administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- TWBYWOBDOCUKOW-UHFFFAOYSA-M isonicotinate Chemical compound [O-]C(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-M 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 230000004807 localization Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 230000015654 memory Effects 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000006263 metalation reaction Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- LXFBURUWPLEQEV-UHFFFAOYSA-N methyl 3-(2-nitroethenyl)-1h-indole-5-carboxylate Chemical compound COC(=O)C1=CC=C2NC=C(C=C[N+]([O-])=O)C2=C1 LXFBURUWPLEQEV-UHFFFAOYSA-N 0.000 description 1
- BYTNHQHZICRIEF-UHFFFAOYSA-N methyl 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1h-indole-5-carboxylate Chemical compound C12=CC(C(=O)OC)=CC=C2NC=C1CCNCC1=CC=CC(OCC(F)(F)F)=C1 BYTNHQHZICRIEF-UHFFFAOYSA-N 0.000 description 1
- UGLRSYDAOVKFIJ-UHFFFAOYSA-N methyl 3-formyl-1h-indole-5-carboxylate Chemical compound COC(=O)C1=CC=C2NC=C(C=O)C2=C1 UGLRSYDAOVKFIJ-UHFFFAOYSA-N 0.000 description 1
- IZYBEMGNIUSSAX-UHFFFAOYSA-N methyl benzenecarboperoxoate Chemical compound COOC(=O)C1=CC=CC=C1 IZYBEMGNIUSSAX-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 238000001690 micro-dialysis Methods 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- MUMVIYLVHVCYGI-UHFFFAOYSA-N n,n,n',n',n",n"-hexamethylmethanetriamine Chemical compound CN(C)C(N(C)C)N(C)C MUMVIYLVHVCYGI-UHFFFAOYSA-N 0.000 description 1
- OJHGGVYPLMAQCE-UHFFFAOYSA-N n-(3-chlorophenyl)-2,2,4,6-tetramethyl-4-phenyl-3h-quinoline-1-carboxamide Chemical compound CC1(C)CC(C)(C=2C=CC=CC=2)C2=CC(C)=CC=C2N1C(=O)NC1=CC=CC(Cl)=C1 OJHGGVYPLMAQCE-UHFFFAOYSA-N 0.000 description 1
- CDEHAAWIXJLNKJ-UHFFFAOYSA-N n-[(3-phenoxyphenyl)methyl]-2-[6-(trifluoromethyl)-1h-indol-3-yl]ethanamine Chemical compound C=1NC2=CC(C(F)(F)F)=CC=C2C=1CCNCC(C=1)=CC=CC=1OC1=CC=CC=C1 CDEHAAWIXJLNKJ-UHFFFAOYSA-N 0.000 description 1
- VRHILMAMGSKLGX-UHFFFAOYSA-N n-[2-(3,4-dihydro-1h-isoquinolin-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide Chemical compound C1CC2=CC=CC=C2CN1C(C(F)(F)F)(C(F)(F)F)NC(=O)C1=CC=CC=C1 VRHILMAMGSKLGX-UHFFFAOYSA-N 0.000 description 1
- UZFIUDUWRYQMNT-UHFFFAOYSA-N n-[2-(4-acetylpiperazin-1-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide Chemical compound FC1=C(F)C(OC)=C(F)C(F)=C1C(=O)NC1=CC=CC=C1N1CCN(C(C)=O)CC1 UZFIUDUWRYQMNT-UHFFFAOYSA-N 0.000 description 1
- SQFUMZKYHPPYCH-UHFFFAOYSA-N n-[2-(6-chloro-1h-indol-3-yl)ethyl]-n-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]propan-2-amine Chemical compound C=1NC2=CC(Cl)=CC=C2C=1CCN(C(C)C)CC1=CC=CC(OCC(F)(F)C(F)(F)F)=C1 SQFUMZKYHPPYCH-UHFFFAOYSA-N 0.000 description 1
- WNCVWYATUILLHW-UHFFFAOYSA-N n-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine Chemical compound O1CCOC1C1=CC=CC(NC=2N=CC=CC=2)=C1 WNCVWYATUILLHW-UHFFFAOYSA-N 0.000 description 1
- MDXXXBXWYSYQEA-UHFFFAOYSA-N n-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-3-amine Chemical compound O1CCOC1C1=CC=CC(NC=2C=NC=CC=2)=C1 MDXXXBXWYSYQEA-UHFFFAOYSA-N 0.000 description 1
- AADNBNFGMAKPBL-UHFFFAOYSA-N n-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-4-amine Chemical compound O1CCOC1C1=CC=CC(NC=2C=CN=CC=2)=C1 AADNBNFGMAKPBL-UHFFFAOYSA-N 0.000 description 1
- BMSSVXMMUBSHLU-UHFFFAOYSA-N n-[3-(2-aminoethyl)-1h-indol-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C2NC=C(CCN)C2=C1 BMSSVXMMUBSHLU-UHFFFAOYSA-N 0.000 description 1
- NPLMZWZGCQZZCT-UHFFFAOYSA-N n-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1h-indol-5-yl]benzamide Chemical compound C=1C=C2NC=C(CCN3C(C4=CC=CC=C4C3=O)=O)C2=CC=1NC(=O)C1=CC=CC=C1 NPLMZWZGCQZZCT-UHFFFAOYSA-N 0.000 description 1
- NMLQVRVOHVDXAO-UHFFFAOYSA-N n-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1h-indol-5-yl]methanesulfonamide Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(NS(=O)(=O)C)C=C21 NMLQVRVOHVDXAO-UHFFFAOYSA-N 0.000 description 1
- GSMPSKWDIFSIAR-UHFFFAOYSA-N n-cyclohexyl-1-(4-nitrophenyl)methanimine Chemical compound C1=CC([N+](=O)[O-])=CC=C1C=NC1CCCCC1 GSMPSKWDIFSIAR-UHFFFAOYSA-N 0.000 description 1
- WTBAPKYPZCDGEA-UHFFFAOYSA-N n-methyl-2-[5-(3-methylphenoxy)-1h-indol-3-yl]-n-[(3-phenoxyphenyl)methyl]ethanamine Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1CN(C)CCC(C1=C2)=CNC1=CC=C2OC1=CC=CC(C)=C1 WTBAPKYPZCDGEA-UHFFFAOYSA-N 0.000 description 1
- YNPLWMRRAUGWFF-UHFFFAOYSA-N n-propan-2-ylacridin-9-amine;hydrochloride Chemical compound Cl.C1=CC=C2C(NC(C)C)=C(C=CC=C3)C3=NC2=C1 YNPLWMRRAUGWFF-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000001577 neostriatum Anatomy 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 230000007230 neural mechanism Effects 0.000 description 1
- 210000000118 neural pathway Anatomy 0.000 description 1
- 230000010004 neural pathway Effects 0.000 description 1
- 230000007979 neuropsychological functioning Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- LAIZPRYFQUWUBN-UHFFFAOYSA-L nickel chloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Ni+2] LAIZPRYFQUWUBN-UHFFFAOYSA-L 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 210000001009 nucleus accumben Anatomy 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- BUYQCPUYQMOFQQ-UHFFFAOYSA-N oxalic acid;2-(5-phenoxy-1h-indol-3-yl)ethanamine Chemical compound OC(=O)C(O)=O.C1=C2C(CCN)=CNC2=CC=C1OC1=CC=CC=C1 BUYQCPUYQMOFQQ-UHFFFAOYSA-N 0.000 description 1
- VVMZTHXBEUODHD-UHFFFAOYSA-N oxalic acid;2-(5-propan-2-yl-1h-indol-3-yl)ethanamine Chemical compound OC(=O)C(O)=O.CC(C)C1=CC=C2NC=C(CCN)C2=C1 VVMZTHXBEUODHD-UHFFFAOYSA-N 0.000 description 1
- RWRGGAKXMVPJRV-UHFFFAOYSA-N oxalic acid;2-(6-phenyl-1h-indol-3-yl)ethanamine Chemical compound OC(=O)C(O)=O.C=1C=C2C(CCN)=CNC2=CC=1C1=CC=CC=C1 RWRGGAKXMVPJRV-UHFFFAOYSA-N 0.000 description 1
- JEKMBZFXFWGQNJ-UHFFFAOYSA-N oxalic acid;2-[5-(trifluoromethoxy)-1h-indol-3-yl]ethanamine Chemical compound OC(=O)C(O)=O.C1=C(OC(F)(F)F)C=C2C(CCN)=CNC2=C1 JEKMBZFXFWGQNJ-UHFFFAOYSA-N 0.000 description 1
- YYFZIUXYNDINQH-UHFFFAOYSA-N oxalic acid;2-[6-(trifluoromethyl)-1h-indol-3-yl]ethanamine Chemical compound OC(=O)C(O)=O.FC(F)(F)C1=CC=C2C(CCN)=CNC2=C1 YYFZIUXYNDINQH-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 230000008447 perception Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical compound CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 229960001697 physostigmine Drugs 0.000 description 1
- PIJVFDBKTWXHHD-HIFRSBDPSA-N physostigmine Chemical compound C12=CC(OC(=O)NC)=CC=C2N(C)[C@@H]2[C@@]1(C)CCN2C PIJVFDBKTWXHHD-HIFRSBDPSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000000902 placebo Substances 0.000 description 1
- 229940068196 placebo Drugs 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000037452 priming Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-M propynoate Chemical compound [O-]C(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-M 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 229960004431 quetiapine Drugs 0.000 description 1
- URKOMYMAXPYINW-UHFFFAOYSA-N quetiapine Chemical compound C1CN(CCOCCO)CCN1C1=NC2=CC=CC=C2SC2=CC=CC=C12 URKOMYMAXPYINW-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000003757 reverse transcription PCR Methods 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 230000016978 synaptic transmission, cholinergic Effects 0.000 description 1
- 229960001685 tacrine Drugs 0.000 description 1
- YLJREFDVOIBQDA-UHFFFAOYSA-N tacrine Chemical compound C1=CC=C2C(N)=C(CCCC3)C3=NC2=C1 YLJREFDVOIBQDA-UHFFFAOYSA-N 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- DBKQEGJJLROJDQ-UHFFFAOYSA-N tert-butyl n-[2-(3-chlorophenyl)ethyl]-n-[(3-hydroxyphenyl)methyl]carbamate Chemical compound C=1C=CC(O)=CC=1CN(C(=O)OC(C)(C)C)CCC1=CC=CC(Cl)=C1 DBKQEGJJLROJDQ-UHFFFAOYSA-N 0.000 description 1
- TWQXTXFYAVCIDR-UHFFFAOYSA-N tert-butyl n-[2-(3-chlorophenyl)ethyl]-n-[(3-propoxyphenyl)methyl]carbamate Chemical compound CCCOC1=CC=CC(CN(CCC=2C=C(Cl)C=CC=2)C(=O)OC(C)(C)C)=C1 TWQXTXFYAVCIDR-UHFFFAOYSA-N 0.000 description 1
- JELDTCPYKPSLIG-UHFFFAOYSA-N tert-butyl n-[2-(6-chloro-1h-indol-3-yl)ethyl]carbamate Chemical compound ClC1=CC=C2C(CCNC(=O)OC(C)(C)C)=CNC2=C1 JELDTCPYKPSLIG-UHFFFAOYSA-N 0.000 description 1
- GPTSFSZPSWGVSY-UHFFFAOYSA-N tert-butyl n-[2-(6-cyano-1h-indol-3-yl)ethyl]carbamate Chemical compound N#CC1=CC=C2C(CCNC(=O)OC(C)(C)C)=CNC2=C1 GPTSFSZPSWGVSY-UHFFFAOYSA-N 0.000 description 1
- HRBZADLOFNUCJI-UHFFFAOYSA-N tert-butyl n-[2-(6-ethoxy-1h-indol-3-yl)ethyl]carbamate Chemical compound CCOC1=CC=C2C(CCNC(=O)OC(C)(C)C)=CNC2=C1 HRBZADLOFNUCJI-UHFFFAOYSA-N 0.000 description 1
- TVNMKNVHVRTJRO-UHFFFAOYSA-N tert-butyl n-[2-(6-hydroxy-1h-indol-3-yl)ethyl]carbamate Chemical compound OC1=CC=C2C(CCNC(=O)OC(C)(C)C)=CNC2=C1 TVNMKNVHVRTJRO-UHFFFAOYSA-N 0.000 description 1
- BXEGIFOAVKSFIQ-UHFFFAOYSA-N tert-butyl n-[2-(6-phenylmethoxy-1h-indol-3-yl)ethyl]carbamate Chemical compound C=1C=C2C(CCNC(=O)OC(C)(C)C)=CNC2=CC=1OCC1=CC=CC=C1 BXEGIFOAVKSFIQ-UHFFFAOYSA-N 0.000 description 1
- QBCOAIULZRPPPW-UHFFFAOYSA-N tert-butyl n-[2-[5-(3-methylphenoxy)-1h-indol-3-yl]ethyl]carbamate Chemical compound CC1=CC=CC(OC=2C=C3C(CCNC(=O)OC(C)(C)C)=CNC3=CC=2)=C1 QBCOAIULZRPPPW-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- PPPHYGCRGMTZNA-UHFFFAOYSA-M trifluoromethyl sulfate Chemical compound [O-]S(=O)(=O)OC(F)(F)F PPPHYGCRGMTZNA-UHFFFAOYSA-M 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229940071104 xylenesulfonate Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/22—Anxiolytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/52—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/54—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to two or three six-membered aromatic rings
- C07C211/56—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to two or three six-membered aromatic rings the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/58—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms with amino groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/60—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms linked by carbon chains having two carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/37—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/32—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to an acyclic carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
- C07D209/16—Tryptamines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
- C07D209/86—Carbazoles; Hydrogenated carbazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/24—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/34—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0803—Compounds with Si-C or Si-Si linkages
- C07F7/081—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te
- C07F7/0812—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te comprising a heterocyclic ring
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Veterinary Medicine (AREA)
- Neurology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Biomedical Technology (AREA)
- Medicinal Chemistry (AREA)
- Neurosurgery (AREA)
- Psychiatry (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27992801P | 2001-03-29 | 2001-03-29 | |
| US32944901P | 2001-10-15 | 2001-10-15 | |
| PCT/US2002/005115 WO2002078693A2 (en) | 2001-03-29 | 2002-03-15 | N-(2-arylethyl)benzylamines as antagonists of the 5-ht6 receptor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL364458A1 PL364458A1 (en) | 2004-12-13 |
| PL220721B1 true PL220721B1 (pl) | 2015-12-31 |
Family
ID=26959969
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL364458A PL220721B1 (pl) | 2001-03-29 | 2002-03-15 | Związki będące pochodnymi N-(indolilo-2-etylo) benzyloaminy, kompozycja farmaceutyczna oraz zastosowanie |
Country Status (28)
| Country | Link |
|---|---|
| US (3) | US7157488B2 (enExample) |
| EP (1) | EP1379239B1 (enExample) |
| JP (1) | JP2004532209A (enExample) |
| KR (1) | KR100894189B1 (enExample) |
| CN (1) | CN1610547A (enExample) |
| AT (1) | ATE372768T1 (enExample) |
| AU (1) | AU2002303094B2 (enExample) |
| BR (1) | BR0208179A (enExample) |
| CA (1) | CA2442114C (enExample) |
| CY (1) | CY1110362T1 (enExample) |
| CZ (1) | CZ305838B6 (enExample) |
| DE (1) | DE60222396T2 (enExample) |
| DK (2) | DK1379239T3 (enExample) |
| DZ (1) | DZ3493A1 (enExample) |
| EA (1) | EA007493B1 (enExample) |
| ES (2) | ES2292758T3 (enExample) |
| HR (1) | HRP20030771B1 (enExample) |
| HU (1) | HU230322B1 (enExample) |
| IL (3) | IL157651A0 (enExample) |
| MX (1) | MXPA03008726A (enExample) |
| NO (1) | NO326160B1 (enExample) |
| NZ (1) | NZ527815A (enExample) |
| PL (1) | PL220721B1 (enExample) |
| PT (2) | PT1859798E (enExample) |
| SI (1) | SI1859798T1 (enExample) |
| SK (1) | SK287463B6 (enExample) |
| WO (1) | WO2002078693A2 (enExample) |
| ZA (1) | ZA200306795B (enExample) |
Families Citing this family (90)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK1379239T3 (da) * | 2001-03-29 | 2008-01-07 | Lilly Co Eli | N(2-aryl-ethyl)-benzyl-aminer som antagonister af 5 HT6 receptoren |
| EP1411925A1 (en) * | 2001-08-03 | 2004-04-28 | PHARMACIA & UPJOHN COMPANY | 5-arylsulfonyl indoles having 5-ht6 receptor affinity |
| BR0312176A (pt) | 2002-06-21 | 2005-04-05 | Suven Life Sciences Ltd | Composto, composição farmaceutica, uso de um composto, método para o tratamento, método para reduzir a morbidez e a mortalidade associadas com o excesso de peso, processo para a preparação de um composto, novo intermediario e processo para a preparação de um novo intermediario |
| AU2003248614B2 (en) * | 2002-07-17 | 2007-08-30 | Lek Pharmaceuticals D.D. | Novel derivatives of pyridylethanol (phenylethyl) amines as inhibitors of cholesterol biosynthesis, processes for their preparation, and pharmaceutical compositions containing them |
| PL212616B1 (pl) | 2002-09-19 | 2012-10-31 | Lilly Co Eli | Eter diarylowy i kompozycja farmaceutyczna zawierajaca ten eter |
| EP2666772B1 (en) * | 2002-12-20 | 2017-03-01 | Basf Se | Synthesis of amines and intermediates for the synthesis thereof |
| BRPI0407616A (pt) | 2003-03-07 | 2006-02-14 | Lilly Co Eli | composto, composição farmacêutica, método para bloquear uma combinação de receptor de mu, capa, delta (heterodìmero) deste em mamìferos, método para tratar ou prevenir obesidade e doenças relacionadas, uso de um composto, e método de suprimir o apetite em um paciente em necessidade deste" |
| WO2004080996A1 (en) | 2003-03-07 | 2004-09-23 | Eli Lilly And Company | Opioid receptor antagonists |
| DE10320782A1 (de) * | 2003-05-09 | 2004-11-25 | Bayer Cropscience Ag | Substituierte Oxyarene |
| JP4198733B2 (ja) | 2003-07-22 | 2008-12-17 | アリーナ ファーマシューティカルズ, インコーポレイテッド | 関連性障害の予防および処置に有用な、5−ht2aセロトニンレセプターのモジュレーターとしてのジアリールおよびアリールへテロアリールウレア誘導体 |
| CN1894240A (zh) | 2003-12-22 | 2007-01-10 | 伊莱利利公司 | 阿片受体拮抗剂 |
| US7381750B2 (en) | 2004-03-12 | 2008-06-03 | Eli Lilly And Company | Amino-phenoxymethyl-benzamide opioid receptor antagonists |
| ES2318472T3 (es) | 2004-03-15 | 2009-05-01 | Eli Lilly And Company | Derivados de 5-(5-(aminoetil)-indol-1-ilmetil)-benzamida y compuestos relacionados como antagonistas del receptor opioide para el tratamiento de la obesidad. |
| CA2557794A1 (en) | 2004-03-15 | 2005-10-06 | Eli Lilly And Company | Opioid receptor antagonists |
| US8354427B2 (en) | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| WO2006002421A2 (en) * | 2004-06-24 | 2006-01-05 | Vertex Pharmaceuticals Incorporated | Modulators of atp-binding cassette transporters |
| EP1632491A1 (en) * | 2004-08-30 | 2006-03-08 | Laboratorios Del Dr. Esteve, S.A. | Substituted indole compounds and their use as 5-HT6 receptor modulators |
| NZ553646A (en) * | 2004-09-22 | 2010-07-30 | Janssen Pharmaceutica Nv | Inhibitors of the interaction between MDM2 and p53 |
| US7459469B2 (en) | 2004-11-10 | 2008-12-02 | Targacept, Inc. | Hydroxybenzoate salts of metanicotine compounds |
| DE102004062542A1 (de) * | 2004-12-24 | 2006-07-06 | Bayer Cropscience Ag | Substituierte Oxyarene |
| JP5170742B2 (ja) | 2005-12-28 | 2013-03-27 | 積水メディカル株式会社 | 凝集測定用試薬及び凝集測定方法 |
| AU2006332726B2 (en) | 2005-12-28 | 2012-12-13 | Vertex Pharmaceuticals Incorporated. | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| EP1973905A4 (en) * | 2006-01-06 | 2010-12-08 | Astrazeneca Ab | COMPOUNDS |
| CA2644643C (en) | 2006-03-22 | 2015-05-19 | Janssen Pharmaceutica N.V. | Inhibitors of the interaction between mdm2 and p53 |
| ATE470665T1 (de) | 2006-03-22 | 2010-06-15 | Janssen Pharmaceutica Nv | Cycloalkylaminderivate als inhibitoren der wechselwirkung zwischen mdm2 und p53 |
| EP2357174A1 (en) | 2006-05-09 | 2011-08-17 | AstraZeneca AB | Salt forms of (2S)-(4E)-N-Methyl-5-[(5-Isopropoxy)pyridin-3-yl]-4-penten-2-amine |
| TWI389889B (zh) | 2006-05-09 | 2013-03-21 | Targacept Inc | (2s)-(4e)-n-甲基-5-〔3-(5-異丙氧基吡啶)基〕-4-戊烯-2-胺之新穎多晶型 |
| EP1953153A1 (en) * | 2007-01-31 | 2008-08-06 | Laboratorios del Dr. Esteve S.A. | Heterocyclyl-substituted sulfonamides for the treatment of cognitive or food ingestion related disorders |
| TW200922557A (en) | 2007-08-06 | 2009-06-01 | Janssen Pharmaceutica Nv | Substituted phenylenediamines as inhibitors of the interaction between MDM2 and p53 |
| JO2704B1 (en) * | 2007-09-21 | 2013-03-03 | جانسين فارماسوتيكا ان في | Interference inhibition factors between MD2 and B53 |
| US20090093513A1 (en) * | 2007-10-09 | 2009-04-09 | Hamann Mark T | Method to Use Compositions Having Antidepressant Anxiolytic and Other Neurological Activity and Compositions of Matter |
| WO2009073118A1 (en) * | 2007-12-04 | 2009-06-11 | Merck & Co., Inc. | Tryptamine sulfonamides as 5-ht6 antagonists |
| EP2508177A1 (en) | 2007-12-12 | 2012-10-10 | Glaxo Group Limited | Combinations comprising 3-phenylsulfonyl-8-piperazinyl-1yl-quinoline |
| AU2009214724A1 (en) * | 2008-02-11 | 2009-08-20 | Organix Inc. | Indole compounds and methods of use thereof |
| US20110021538A1 (en) | 2008-04-02 | 2011-01-27 | Arena Pharmaceuticals, Inc. | Processes for the preparation of pyrazole derivatives useful as modulators of the 5-ht2a serotonin receptor |
| US12458635B2 (en) | 2008-08-13 | 2025-11-04 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
| US9126946B2 (en) | 2008-10-28 | 2015-09-08 | Arena Pharmaceuticals, Inc. | Processes useful for the preparation of 1-[3-(4-bromo-2-methyl-2H-pyrazol-3-yl)-4-methoxy-phenyl]-3-(2,4-difluoro-phenyl)urea and crystalline forms related thereto |
| CA2749209C (en) * | 2009-02-04 | 2017-01-10 | Janssen Pharmaceutica Nv | Indole derivatives as anticancer agents |
| JP5083256B2 (ja) * | 2009-03-20 | 2012-11-28 | 株式会社デンソー | 半導体装置およびその製造方法 |
| AU2010226400B2 (en) | 2009-03-20 | 2016-07-14 | Vertex Pharmaceuticals Incorporated | Process for making modulators of cystic fibrosis transmembrane conductance regulator |
| US8912220B2 (en) | 2009-08-10 | 2014-12-16 | Galenea Pharmaceuticals | Compounds and methods of use thereof |
| EP2311823A1 (en) | 2009-10-15 | 2011-04-20 | AC Immune S.A. | 2,6-Diaminopyridine compounds for treating diseases associated with amyloid proteins or for treating ocular diseases |
| TW201139370A (en) * | 2009-12-23 | 2011-11-16 | Lundbeck & Co As H | Processes for the manufacture of a pharmaceutically active agent |
| FR2961097B1 (fr) * | 2010-06-09 | 2012-07-13 | Oreal | Procede cosmetique de traitement des odeurs corporelles humaines utilisant un compose 6-alkoxy tryptamine |
| FR2961095B1 (fr) * | 2010-06-09 | 2012-06-15 | Oreal | Composition cosmetique et/ou dermatologique comprenant au moins un compose 6-alcoxy tryptamine |
| US8293218B2 (en) * | 2010-07-29 | 2012-10-23 | Conopco, Inc. | Skin care compositions comprising substituted monoamines |
| US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
| CA2865519C (en) | 2012-02-27 | 2018-01-02 | Vertex Pharmaceuticals Incorporated | Pharmaceutical compositions comprising a solid dispersion of n-[2,4-bis(1,1-dimethylethyl0-5-hydroxyphenyl-1]-1,4-dihydro-4-oxoquinolone-3-carboxamide for treating cystic fibrosis |
| CN104220421A (zh) | 2012-03-20 | 2014-12-17 | 阿达梅德公司 | 用于治疗中枢神经系统疾病的苄胺的磺酰胺衍生物 |
| CN102746211B (zh) * | 2012-06-27 | 2015-05-27 | 上海泰坦化学有限公司 | 一种取代吲哚-3-甲醛类化合物的制备方法 |
| JO3459B1 (ar) | 2012-09-09 | 2020-07-05 | H Lundbeck As | تركيبات صيدلانية لعلاج مرض الزهايمر |
| WO2014078568A1 (en) | 2012-11-14 | 2014-05-22 | The Johns Hopkins University | Methods and compositions for treating schizophrenia |
| US20160038484A1 (en) * | 2013-04-03 | 2016-02-11 | The University Of Utah Research Foundation | Application of 5-ht6 receptor antagonists for the alleviation of cognitive deficits of down syndrome |
| CN104725249B (zh) * | 2013-12-20 | 2019-02-12 | 广东东阳光药业有限公司 | 苄胺类衍生物及其在药物上的应用 |
| JO3639B1 (ar) * | 2014-07-04 | 2020-08-27 | H Lundbeck As | صورة متعددة الشكل جديدة لـ n-[2-(6-فلورو-1h-إندول-3-يل)إيثيل]-3-(2،2،3،3-تترا فلورو بروبوكسي)بنزيل أمين هيدروكلوريد |
| CN107250113B (zh) | 2014-10-07 | 2019-03-29 | 弗特克斯药品有限公司 | 囊性纤维化跨膜传导调节蛋白的调节剂的共晶 |
| ES2570452B1 (es) * | 2014-10-15 | 2017-04-19 | Fundación Para La Investigación Biomédida Del Hospital Universitario De La Princesa | Compuestos derivados de acrilato de 3-Alquilamino-1H-Indolilo y su uso en el tratamiento de enfermedades neurodegenerativas |
| CN105175307A (zh) * | 2014-11-18 | 2015-12-23 | 苏州晶云药物科技有限公司 | Lu AE58054的盐酸盐晶型A及其制备方法和用途 |
| CN104529865B (zh) * | 2014-12-12 | 2017-02-01 | 广东东阳光药业有限公司 | 苄胺类衍生物及其在药物上的应用 |
| TW201630881A (zh) | 2014-12-12 | 2016-09-01 | H 朗德貝克公司 | 用於生產艾達魯吡啶之方法 |
| WO2016201373A1 (en) | 2015-06-12 | 2016-12-15 | Axovant Sciences Ltd. | Diaryl and arylheteroaryl urea derivatives useful for the prophylaxis and treatment of rem sleep behavior disorder |
| HK1247555A1 (zh) | 2015-07-15 | 2018-09-28 | Axovant Sciences Gmbh | 用於预防和治疗与神经变性疾病相关的幻觉的作为5-ht2a血清素受体的调节剂的二芳基脲和芳基杂芳基脲衍生物 |
| CN108271369A (zh) | 2015-10-23 | 2018-07-10 | 法尔玛赞公司 | 用于制备色胺及其衍生物的新工艺 |
| EP3440055B1 (en) | 2016-04-08 | 2020-03-11 | H. Lundbeck A/S | A process for the manufacture of idalopirdine via hydrogenation of an imine |
| SI3448430T1 (sl) * | 2016-04-26 | 2023-08-31 | H. Lundbeck A/S | Uporaba inhibitorja acetilholinesteraze in idalopirdina za zmanjšanje padcev pri bolnikih s parkinsonovo boleznijo |
| US10864191B2 (en) | 2016-05-11 | 2020-12-15 | H. Lundbeck A/S | 5-HT6 receptor antagonists for use in the treatment of Alzheimer's disease with apathy as comorbidity |
| WO2018013686A1 (en) * | 2016-07-12 | 2018-01-18 | Concert Pharmaceuticals, Inc. | Deuterated idalopirdine |
| EP3333154A1 (en) | 2016-12-07 | 2018-06-13 | Sandoz Ag | Crystalline form of a selective 5-ht6 receptor antagonist |
| CN106632303A (zh) * | 2017-01-09 | 2017-05-10 | 湖南华腾制药有限公司 | 一种6‑噻唑基吲哚衍生物的制备方法 |
| WO2018191146A1 (en) * | 2017-04-10 | 2018-10-18 | Navitor Pharmaceuticals, Inc. | Heteroaryl rheb inhibitors and uses thereof |
| PL3630098T3 (pl) | 2017-05-24 | 2021-09-06 | H. Lundbeck A/S | Połączenie antagonisty receptora 5-ht6 i inhibitora acetylocholinoesterazy do zastosowania w leczeniu choroby alzheimera w subpopulacji pacjentów posiadających allele apoe4 |
| AU2018358663B2 (en) * | 2017-11-06 | 2022-09-29 | Acelot, Inc. | Small molecule drugs and related methods for treatment of diseases related to AB42 oligomer formation |
| KR20210135521A (ko) | 2019-03-06 | 2021-11-15 | 다이이찌 산쿄 가부시키가이샤 | 피롤로피라졸 유도체 |
| CN109942527A (zh) * | 2019-04-26 | 2019-06-28 | 新乡市润宇新材料科技有限公司 | 一种3-溴二苯并呋喃的合成方法 |
| CA3182156A1 (en) | 2020-05-08 | 2021-11-11 | Psilera Inc. | Novel compositions of matter and pharmaceutical compositions |
| MX2022014605A (es) | 2020-05-19 | 2022-12-16 | Cybin Irl Ltd | Derivados de triptamina deuterada y metodos de uso. |
| JP2023539390A (ja) * | 2020-09-02 | 2023-09-13 | エンベリック バイオサイエンシズ カナダ インコーポレイテッド | ニトロ化サイロシビン誘導体ならびに5-ht2a受容体を調節するためおよび精神障害を処置するためのその使用 |
| AU2022218921A1 (en) * | 2021-02-12 | 2023-09-21 | Enveric Biosciences Canada Inc. | Multi-substituent psilocybin derivatives and methods of using |
| AU2022229695A1 (en) * | 2021-03-02 | 2023-09-28 | Mindset Pharma Inc. | Indole derivatives as serotonergic agents useful for the treatment of disorders related thereto |
| EP4337220A4 (en) * | 2021-05-11 | 2025-07-02 | Saint Josephs Univ | SELECTIVE, PARTIAL, AND POLARIZED 5-HT2A AGONISTS WITH UTILITY IN VARIOUS DISORDERS |
| WO2022251351A1 (en) | 2021-05-25 | 2022-12-01 | ATAI Life Sciences AG | New n,n-dimethyltryptamine salts and crystalline salt forms |
| WO2022261240A2 (en) | 2021-06-08 | 2022-12-15 | ATAI Life Sciences AG | Dimethoxyphenylalkylamine activators of serotonin receptors |
| MX2023014620A (es) | 2021-06-09 | 2024-01-30 | Atai Therapeutics Inc | Nuevos profarmacos y conjugados de dimetiltriptamina. |
| WO2023044577A1 (en) * | 2021-09-24 | 2023-03-30 | Psygen Inc. | Recovery method for tryptamines |
| JP2024547131A (ja) | 2021-12-27 | 2024-12-26 | エーティーエーアイ セラピューティクス,インコーポレイテッド | セロトニン受容体のアミノテトラリン活性化剤 |
| WO2023129956A2 (en) | 2021-12-30 | 2023-07-06 | ATAI Life Sciences AG | Dimethyltryptamine analogues as nitric oxide delivery drugs |
| US12065404B2 (en) | 2022-03-18 | 2024-08-20 | Enveric Biosciences Canada Inc. | C4-carboxylic acid-substituted tryptamine derivatives and methods of using |
| WO2024229149A1 (en) | 2023-05-01 | 2024-11-07 | Atai Therapeutics Inc. | Compositions and methods for treatment of diseases and disorders |
| WO2025160304A1 (en) * | 2024-01-24 | 2025-07-31 | Automera PTE. LTD | Indole derivatives for targeting autophagy |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3597149A (en) * | 1969-04-29 | 1971-08-03 | Showa Denko Kk | Inhibition of gas-fume fading of dyed cellulose acetate material |
| FR2181559A1 (en) | 1972-04-28 | 1973-12-07 | Aec Chimie Organique Bio | N-Phenylalkyl-N-3-indolylalkyl-alkylamines - with sedative, neuroleptic, analgesic, hypotensive, antiserotonin, adrenolytic activity |
| JPS5764632A (en) | 1980-10-09 | 1982-04-19 | Mitsui Toatsu Chem Inc | Novel 2-arylethyl ether derivative and thioether derivative, their production and insecticide and acaricide |
| DE3632329A1 (de) * | 1986-09-24 | 1988-03-31 | Bayer Ag | Substituierte phenylsulfonamide |
| US5202336A (en) * | 1986-09-24 | 1993-04-13 | Bayer Aktiengesellschaft | Antiflammatory quinolin methoxy phenylsulphonamides |
| SE9103745D0 (sv) | 1991-12-18 | 1991-12-18 | Wikstroem Haakan | Aryl-triflates and related compounds |
| DE69411143T2 (de) | 1993-09-01 | 1998-10-22 | Allelix Biopharma | Tryptamin analoge mit 5-ht1d selektivität |
| US5504101A (en) | 1994-05-06 | 1996-04-02 | Allelix Biopharmaceuticals, Inc. | 5-HT-1D receptor ligands |
| CA2302412C (en) | 1997-09-29 | 2005-12-20 | Aventis Pharmaceuticals Inc. | Aminoalkylphenol derivatives and related compounds |
| GB9820113D0 (en) * | 1998-09-15 | 1998-11-11 | Merck Sharp & Dohme | Therapeutic agents |
| DK1149078T3 (da) * | 1998-12-11 | 2006-07-10 | Univ Virginia Commonwealth | Selektive 5-HT6-receptorligander |
| AP2001002228A0 (en) * | 1999-01-13 | 2001-09-30 | Millenium Pharmaceuticals Inc | Functionalized heterocycles as chemokine receptor modulators. |
| US6750348B1 (en) * | 1999-03-24 | 2004-06-15 | Anormed, Inc. | Chemokine receptor binding heterocyclic compounds |
| US6187895B1 (en) * | 1999-08-09 | 2001-02-13 | General Electric Company | Method for preparing polymers by solid state polymerization |
| DK1379239T3 (da) | 2001-03-29 | 2008-01-07 | Lilly Co Eli | N(2-aryl-ethyl)-benzyl-aminer som antagonister af 5 HT6 receptoren |
-
2002
- 2002-03-15 DK DK02731094T patent/DK1379239T3/da active
- 2002-03-15 BR BR0208179-2A patent/BR0208179A/pt not_active Application Discontinuation
- 2002-03-15 EP EP02731094A patent/EP1379239B1/en not_active Expired - Lifetime
- 2002-03-15 ES ES02731094T patent/ES2292758T3/es not_active Expired - Lifetime
- 2002-03-15 CN CNA028105435A patent/CN1610547A/zh active Pending
- 2002-03-15 MX MXPA03008726A patent/MXPA03008726A/es active IP Right Grant
- 2002-03-15 JP JP2002576959A patent/JP2004532209A/ja active Pending
- 2002-03-15 HR HR20030771A patent/HRP20030771B1/xx not_active IP Right Cessation
- 2002-03-15 NZ NZ527815A patent/NZ527815A/en not_active IP Right Cessation
- 2002-03-15 WO PCT/US2002/005115 patent/WO2002078693A2/en not_active Ceased
- 2002-03-15 PT PT70150586T patent/PT1859798E/pt unknown
- 2002-03-15 PT PT02731094T patent/PT1379239E/pt unknown
- 2002-03-15 IL IL15765102A patent/IL157651A0/xx unknown
- 2002-03-15 SI SI200231068A patent/SI1859798T1/sl unknown
- 2002-03-15 CZ CZ2003-2614A patent/CZ305838B6/cs not_active IP Right Cessation
- 2002-03-15 PL PL364458A patent/PL220721B1/pl unknown
- 2002-03-15 EA EA200301073A patent/EA007493B1/ru not_active IP Right Cessation
- 2002-03-15 DK DK07015058.6T patent/DK1859798T3/en active
- 2002-03-15 US US10/472,741 patent/US7157488B2/en not_active Expired - Lifetime
- 2002-03-15 AT AT02731094T patent/ATE372768T1/de active
- 2002-03-15 DZ DZ023493A patent/DZ3493A1/fr active
- 2002-03-15 ES ES07015058.6T patent/ES2566056T3/es not_active Expired - Lifetime
- 2002-03-15 KR KR1020037012694A patent/KR100894189B1/ko not_active Expired - Lifetime
- 2002-03-15 HU HU0303651A patent/HU230322B1/hu unknown
- 2002-03-15 AU AU2002303094A patent/AU2002303094B2/en not_active Expired
- 2002-03-15 CA CA2442114A patent/CA2442114C/en not_active Expired - Lifetime
- 2002-03-15 SK SK1205-2003A patent/SK287463B6/sk unknown
- 2002-03-15 DE DE60222396T patent/DE60222396T2/de not_active Expired - Lifetime
-
2003
- 2003-08-28 IL IL157651A patent/IL157651A/en active IP Right Grant
- 2003-08-29 ZA ZA2003/06795A patent/ZA200306795B/en unknown
- 2003-09-25 NO NO20034289A patent/NO326160B1/no not_active IP Right Cessation
-
2006
- 2006-12-11 US US11/608,922 patent/US20070099909A1/en not_active Abandoned
-
2007
- 2007-09-10 IL IL185871A patent/IL185871A0/en unknown
- 2007-11-27 CY CY20071101516T patent/CY1110362T1/el unknown
-
2009
- 2009-07-16 US US12/504,242 patent/US8044090B2/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2442114C (en) | N-(2-arylethyl)benzylamines as antagonists of the 5-ht6 receptor | |
| AU2002303094A1 (en) | N-(2-arylethyl)benzylamines as antagonists of the 5-HT6 receptor | |
| JP3155008B2 (ja) | セロトニンアゴニストおよびアンタゴニストとしての4−インドール誘導体 | |
| Street et al. | Synthesis and serotonergic activity of 5-(oxadiazolyl) tryptamines: potent agonists for 5-HT1D receptors | |
| ES2272667T3 (es) | Indol-5-il esteres del acido bencenosulfonico como antagonistas de receptor 5-ht6. | |
| NO320647B1 (no) | Anthranilsyreamider og anvendelse derav for fremstilling av medikamenter | |
| JP2007525482A (ja) | イオンチャネルリガンドとしてのアミド化合物およびその使用 | |
| SK19252001A3 (sk) | Indazolové zlúčeniny, farmaceutické prípravky na inhibíciu proteínkináz a ich použitie | |
| KR20080076962A (ko) | 대사성 글루타메이트 수용체 조절제로서의 니코틴산 유도체 | |
| KR20090005354A (ko) | 신규 비-아릴 아민 | |
| TW201127823A (en) | Indole based receptor CRTH2 antagonists | |
| CN116354901B (zh) | 一种噻唑烷二酮类化合物及其制备方法和应用 | |
| CA2720275A1 (en) | Indolinone compound | |
| TW492958B (en) | Compounds having NMDA (n-methyl-d-aspartate)-antagonizing activity, preparation process and pharmaceutical compositions thereof | |
| EP1859798B1 (en) | N-(2-arylethyl) benzylamines as antagonists of the 5-ht6 receptor | |
| CN103709096A (zh) | 一种作为烟酰胺磷酸核糖转移酶抑制剂的脲类衍生物及其制备方法与应用 | |
| HK1061649B (en) | N-(2-arylethyl) benzylamines as antagonists of the 5-ht6 receptor | |
| UA76451C2 (en) | N-(2-arylethyl)benzylamines as antagonists of 5-ht6 receptor, pharmaceutical composition |