HU198039B - Process for production of new substituated derivatives of /1h-imidasole-1-il-methil/-benzimidasole and medical preparatives containing these substances - Google Patents
Process for production of new substituated derivatives of /1h-imidasole-1-il-methil/-benzimidasole and medical preparatives containing these substances Download PDFInfo
- Publication number
- HU198039B HU198039B HU874071A HU407187A HU198039B HU 198039 B HU198039 B HU 198039B HU 874071 A HU874071 A HU 874071A HU 407187 A HU407187 A HU 407187A HU 198039 B HU198039 B HU 198039B
- Authority
- HU
- Hungary
- Prior art keywords
- parts
- formula
- compound
- weight
- imidazol
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 31
- 230000008569 process Effects 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000126 substance Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 285
- -1 1H-imidazol-1-ylmethyl Chemical group 0.000 claims abstract description 150
- 150000003839 salts Chemical class 0.000 claims abstract description 46
- 239000004480 active ingredient Substances 0.000 claims abstract description 17
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 11
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 claims abstract description 8
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 claims abstract description 4
- 239000002585 base Substances 0.000 claims description 125
- 239000000543 intermediate Substances 0.000 claims description 84
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 51
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 41
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 23
- 125000004076 pyridyl group Chemical group 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 19
- 238000002360 preparation method Methods 0.000 claims description 18
- 125000001544 thienyl group Chemical group 0.000 claims description 18
- 150000002431 hydrogen Chemical group 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 239000007858 starting material Substances 0.000 claims description 15
- 229910052751 metal Inorganic materials 0.000 claims description 14
- 239000002184 metal Substances 0.000 claims description 14
- 230000002829 reductive effect Effects 0.000 claims description 14
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 150000002367 halogens Chemical group 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000002883 imidazolyl group Chemical group 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 claims description 8
- 125000002541 furyl group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 claims description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 238000011065 in-situ storage Methods 0.000 claims description 6
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 5
- 239000012458 free base Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 4
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical class NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000005103 alkyl silyl group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 150000001721 carbon Chemical group 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 238000000746 purification Methods 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 238000007126 N-alkylation reaction Methods 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000004202 carbamide Substances 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims 5
- 206010029897 Obsessive thoughts Diseases 0.000 claims 2
- 239000003153 chemical reaction reagent Substances 0.000 claims 2
- 239000012429 reaction media Substances 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims 1
- 230000002051 biphasic effect Effects 0.000 claims 1
- 230000003009 desulfurizing effect Effects 0.000 claims 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 claims 1
- 125000000250 methylamino group Chemical class [H]N(*)C([H])([H])[H] 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical group [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 11
- 239000003098 androgen Substances 0.000 abstract description 10
- 230000002401 inhibitory effect Effects 0.000 abstract description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 346
- 239000000203 mixture Substances 0.000 description 157
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 124
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 97
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 87
- 239000000243 solution Substances 0.000 description 87
- 239000003480 eluent Substances 0.000 description 80
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 80
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 70
- 229960001701 chloroform Drugs 0.000 description 70
- 239000000047 product Substances 0.000 description 59
- 238000003756 stirring Methods 0.000 description 59
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 54
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 53
- 239000011541 reaction mixture Substances 0.000 description 50
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- 239000000284 extract Substances 0.000 description 38
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 238000010898 silica gel chromatography Methods 0.000 description 30
- 239000002904 solvent Substances 0.000 description 30
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- 238000010992 reflux Methods 0.000 description 25
- 239000003054 catalyst Substances 0.000 description 24
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 23
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- 239000000908 ammonium hydroxide Substances 0.000 description 23
- 239000000706 filtrate Substances 0.000 description 21
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 229910021529 ammonia Inorganic materials 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 238000001816 cooling Methods 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000003638 chemical reducing agent Substances 0.000 description 9
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 description 9
- 239000012279 sodium borohydride Substances 0.000 description 9
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 8
- 229910000564 Raney nickel Inorganic materials 0.000 description 8
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 8
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- 229930192474 thiophene Natural products 0.000 description 7
- 0 *C(C=C*(C=O)C=C1)=C1[N+]([O-])=O Chemical compound *C(C=C*(C=O)C=C1)=C1[N+]([O-])=O 0.000 description 6
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- 108010044467 Isoenzymes Proteins 0.000 description 6
- 239000005909 Kieselgur Substances 0.000 description 6
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 6
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- 150000008282 halocarbons Chemical class 0.000 description 6
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 229910002091 carbon monoxide Inorganic materials 0.000 description 5
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 229960003604 testosterone Drugs 0.000 description 5
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 4
- HNPKZIDUJAFHKE-UHFFFAOYSA-N 4-(imidazol-1-ylmethyl)benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1CN1C=NC=C1 HNPKZIDUJAFHKE-UHFFFAOYSA-N 0.000 description 4
- DCGOMTSIZLGUOK-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-2-methyl-1h-benzimidazole Chemical compound C1=C2NC(C)=NC2=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 DCGOMTSIZLGUOK-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 150000001556 benzimidazoles Chemical class 0.000 description 4
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 4
- 229940073608 benzyl chloride Drugs 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 229940088597 hormone Drugs 0.000 description 4
- 239000005556 hormone Substances 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 4
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 4
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 3
- PXICQWWMDWQBBW-UHFFFAOYSA-N 2-chloro-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound C=1C=C2NC(Cl)=NC2=CC=1CN1C=CN=C1 PXICQWWMDWQBBW-UHFFFAOYSA-N 0.000 description 3
- BOUOQESVDURNSB-UHFFFAOYSA-N 2-pyridin-3-yl-1h-benzimidazole Chemical compound N=1C2=CC=CC=C2NC=1C1=CC=CN=C1 BOUOQESVDURNSB-UHFFFAOYSA-N 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 206010060862 Prostate cancer Diseases 0.000 description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 230000001548 androgenic effect Effects 0.000 description 3
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 210000001589 microsome Anatomy 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000003880 polar aprotic solvent Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920000137 polyphosphoric acid Polymers 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- KJUGXTLUAUMXEP-UHFFFAOYSA-N (1-hydroxy-2-methylbenzimidazol-5-yl)-phenylmethanone;hydrochloride Chemical compound Cl.C=1C=C2N(O)C(C)=NC2=CC=1C(=O)C1=CC=CC=C1 KJUGXTLUAUMXEP-UHFFFAOYSA-N 0.000 description 2
- IYFJEWGDTLJUIB-UHFFFAOYSA-N (1-propyl-2-pyridin-3-ylbenzimidazol-5-yl)methanol Chemical compound N=1C2=CC(CO)=CC=C2N(CCC)C=1C1=CC=CN=C1 IYFJEWGDTLJUIB-UHFFFAOYSA-N 0.000 description 2
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 2
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- IGMAFPHZTNBADO-UHFFFAOYSA-N 1-(4-nitrophenyl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OC(C)C1=CC=C([N+]([O-])=O)C=C1 IGMAFPHZTNBADO-UHFFFAOYSA-N 0.000 description 2
- GKIFFEFJVOPZLA-UHFFFAOYSA-N 1-(cyclohexylmethyl)-6-(imidazol-1-ylmethyl)-2-(trifluoromethyl)benzimidazole Chemical compound C1=C2N(CC3CCCCC3)C(C(F)(F)F)=NC2=CC=C1CN1C=CN=C1 GKIFFEFJVOPZLA-UHFFFAOYSA-N 0.000 description 2
- FXWXUFATDLGVJS-UHFFFAOYSA-N 1-[(4-fluoro-3-nitrophenyl)methyl]imidazole Chemical compound C1=C(F)C([N+](=O)[O-])=CC(CN2C=NC=C2)=C1 FXWXUFATDLGVJS-UHFFFAOYSA-N 0.000 description 2
- ZFOIEPBXFBGVCH-UHFFFAOYSA-N 1-[1-(4-nitrophenyl)ethyl]imidazole Chemical compound C1=CN=CN1C(C)C1=CC=C([N+]([O-])=O)C=C1 ZFOIEPBXFBGVCH-UHFFFAOYSA-N 0.000 description 2
- ZTJWSSVLQJKPTJ-UHFFFAOYSA-N 1-pyridin-2-ylbenzimidazole Chemical compound C1=NC2=CC=CC=C2N1C1=CC=CC=N1 ZTJWSSVLQJKPTJ-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- NMGLVHXJOMBIJW-UHFFFAOYSA-N 1h-benzimidazole;dihydrochloride Chemical compound Cl.Cl.C1=CC=C2NC=NC2=C1 NMGLVHXJOMBIJW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- JLANDIPPCNKLAT-UHFFFAOYSA-N 2-phenyl-1-propylbenzimidazole-5-carbonyl chloride;hydrochloride Chemical compound Cl.N=1C2=CC(C(Cl)=O)=CC=C2N(CCC)C=1C1=CC=CC=C1 JLANDIPPCNKLAT-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- LOPVGDXYIZNBTQ-UHFFFAOYSA-N 3-nitro-4-(propylamino)benzaldehyde Chemical compound CCCNC1=CC=C(C=O)C=C1[N+]([O-])=O LOPVGDXYIZNBTQ-UHFFFAOYSA-N 0.000 description 2
- BJXFTLGWQJWGJJ-UHFFFAOYSA-N 4-(1-imidazol-1-yl-2-methylpropyl)benzene-1,2-diamine Chemical compound C1=CN=CN1C(C(C)C)C1=CC=C(N)C(N)=C1 BJXFTLGWQJWGJJ-UHFFFAOYSA-N 0.000 description 2
- YPAZVWHWWKAKRF-UHFFFAOYSA-N 4-(imidazol-1-ylmethyl)-1-n-methylbenzene-1,2-diamine Chemical compound C1=C(N)C(NC)=CC=C1CN1C=NC=C1 YPAZVWHWWKAKRF-UHFFFAOYSA-N 0.000 description 2
- NCXQJEXGEKLAOI-UHFFFAOYSA-N 4-[amino(phenyl)methyl]-2-nitroaniline Chemical compound C=1C=C(N)C([N+]([O-])=O)=CC=1C(N)C1=CC=CC=C1 NCXQJEXGEKLAOI-UHFFFAOYSA-N 0.000 description 2
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 2
- UWOVPQUTAOOROQ-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-1h-benzimidazole-2-carboxylic acid Chemical compound C=1C=C2NC(C(=O)O)=NC2=CC=1CN1C=CN=C1 UWOVPQUTAOOROQ-UHFFFAOYSA-N 0.000 description 2
- DJKIDERRECAXOF-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-3-methyl-1h-benzimidazol-2-one Chemical compound C=1C=C2N(C)C(O)=NC2=CC=1CN1C=CN=C1 DJKIDERRECAXOF-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IYHHRZBKXXKDDY-UHFFFAOYSA-N BI-605906 Chemical compound N=1C=2SC(C(N)=O)=C(N)C=2C(C(F)(F)CC)=CC=1N1CCC(S(C)(=O)=O)CC1 IYHHRZBKXXKDDY-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 2
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 238000010934 O-alkylation reaction Methods 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Natural products OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 210000004404 adrenal cortex Anatomy 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 150000002460 imidazoles Chemical class 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000003228 microsomal effect Effects 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- PZOVYRVKZAPJIW-UHFFFAOYSA-N n-(5-benzoyl-2-nitrophenyl)acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC(C(=O)C=2C=CC=CC=2)=C1 PZOVYRVKZAPJIW-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000000902 placebo Substances 0.000 description 2
- 229940068196 placebo Drugs 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000008057 potassium phosphate buffer Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- LRZTXKVNCQWSKL-UHFFFAOYSA-N (1-methoxy-2-methylbenzimidazol-5-yl)-phenylmethanone Chemical compound C=1C=C2N(OC)C(C)=NC2=CC=1C(=O)C1=CC=CC=C1 LRZTXKVNCQWSKL-UHFFFAOYSA-N 0.000 description 1
- FTLYMKDSHNWQKD-UHFFFAOYSA-N (2,4,5-trichlorophenyl)boronic acid Chemical class OB(O)C1=CC(Cl)=C(Cl)C=C1Cl FTLYMKDSHNWQKD-UHFFFAOYSA-N 0.000 description 1
- YHDFPFVCUVQCCK-UHFFFAOYSA-N (2-methyl-1h-benzimidazol-4-yl)-phenylmethanol Chemical compound C1=CC=C2NC(C)=NC2=C1C(O)C1=CC=CC=C1 YHDFPFVCUVQCCK-UHFFFAOYSA-N 0.000 description 1
- KVKMBXFQSACNIJ-UHFFFAOYSA-N (2-methyl-1h-benzimidazol-4-yl)methanol Chemical compound C1=CC=C2NC(C)=NC2=C1CO KVKMBXFQSACNIJ-UHFFFAOYSA-N 0.000 description 1
- GBJNGHWDPVPOHF-UHFFFAOYSA-N (2-phenyl-1-propylbenzimidazol-5-yl)methanol Chemical compound N=1C2=CC(CO)=CC=C2N(CCC)C=1C1=CC=CC=C1 GBJNGHWDPVPOHF-UHFFFAOYSA-N 0.000 description 1
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- OENYVXQFYOZWRA-UHFFFAOYSA-N (3,4-diaminophenyl)-(3-fluorophenyl)methanone Chemical compound C1=C(N)C(N)=CC=C1C(=O)C1=CC=CC(F)=C1 OENYVXQFYOZWRA-UHFFFAOYSA-N 0.000 description 1
- LZBLUHYPHHBSDO-UHFFFAOYSA-N (3-amino-4-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC(C(=O)C=2C=CC=CC=2)=C1 LZBLUHYPHHBSDO-UHFFFAOYSA-N 0.000 description 1
- PALMHXHTMSPZGC-UHFFFAOYSA-N (3-fluorophenyl)-(2-methyl-3h-benzimidazol-5-yl)methanone Chemical compound C=1C=C2NC(C)=NC2=CC=1C(=O)C1=CC=CC(F)=C1 PALMHXHTMSPZGC-UHFFFAOYSA-N 0.000 description 1
- NGOOFAMQPUEDJM-UHFFFAOYSA-N (4-amino-3-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C(=O)C1=CC=CC=C1 NGOOFAMQPUEDJM-UHFFFAOYSA-N 0.000 description 1
- MKWJZTFMDWSRIH-UHFFFAOYSA-N (4-fluoro-3-nitrophenyl)methanol Chemical compound OCC1=CC=C(F)C([N+]([O-])=O)=C1 MKWJZTFMDWSRIH-UHFFFAOYSA-N 0.000 description 1
- PLFFHJWXOGYWPR-HEDMGYOXSA-N (4r)-4-[(3r,3as,5ar,5br,7as,11as,11br,13ar,13bs)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentan-1-ol Chemical compound C([C@]1(C)[C@H]2CC[C@H]34)CCC(C)(C)[C@@H]1CC[C@@]2(C)[C@]4(C)CC[C@@H]1[C@]3(C)CC[C@@H]1[C@@H](CCCO)C PLFFHJWXOGYWPR-HEDMGYOXSA-N 0.000 description 1
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- VIDOPANCAUPXNH-UHFFFAOYSA-N 1,2,3-triethylbenzene Chemical compound CCC1=CC=CC(CC)=C1CC VIDOPANCAUPXNH-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical class C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- YJUUZFWMKJBVFJ-UHFFFAOYSA-N 1,3-dimethylimidazolidin-4-one Chemical compound CN1CN(C)C(=O)C1 YJUUZFWMKJBVFJ-UHFFFAOYSA-N 0.000 description 1
- YEVPHFIFGUWSMG-UHFFFAOYSA-N 1-(4-chloro-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 YEVPHFIFGUWSMG-UHFFFAOYSA-N 0.000 description 1
- ZILXDWJVIMOFAJ-UHFFFAOYSA-N 1-(chloromethyl)benzimidazole;hydrochloride Chemical compound [Cl-].C1=CC=C2[N+](CCl)=CNC2=C1 ZILXDWJVIMOFAJ-UHFFFAOYSA-N 0.000 description 1
- MNEIJGDSFRHGMS-UHFFFAOYSA-N 1-(phenylmethyl)benzimidazole Chemical compound C1=NC2=CC=CC=C2N1CC1=CC=CC=C1 MNEIJGDSFRHGMS-UHFFFAOYSA-N 0.000 description 1
- DPELZOPZZNAFGI-UHFFFAOYSA-N 1-(thiophen-2-ylmethyl)benzimidazole Chemical compound C1=NC2=CC=CC=C2N1CC1=CC=CS1 DPELZOPZZNAFGI-UHFFFAOYSA-N 0.000 description 1
- QGJAWSWEIOMPOF-UHFFFAOYSA-N 1-N-(cyclohexylmethyl)-4-(imidazol-1-ylmethyl)benzene-1,2-diamine Chemical compound C1(CCCCC1)CNC=1C(=CC(=CC1)CN1C=NC=C1)N QGJAWSWEIOMPOF-UHFFFAOYSA-N 0.000 description 1
- GYCDJWFOQNSSEW-UHFFFAOYSA-N 1-N-cycloheptyl-4-(imidazol-1-ylmethyl)benzene-1,2-diamine Chemical compound C1(CCCCCC1)NC=1C(=CC(=CC1)CN1C=NC=C1)N GYCDJWFOQNSSEW-UHFFFAOYSA-N 0.000 description 1
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 1
- UYQAGCGLXQZHHV-UHFFFAOYSA-N 1-[(4-amino-3-nitrophenyl)-phenylmethyl]-3-(2,2-dimethoxyethyl)thiourea Chemical compound C=1C=C(N)C([N+]([O-])=O)=CC=1C(NC(=S)NCC(OC)OC)C1=CC=CC=C1 UYQAGCGLXQZHHV-UHFFFAOYSA-N 0.000 description 1
- RFMFMDSOEBOCAX-UHFFFAOYSA-N 1-[4-(methylamino)-3-nitrophenyl]ethanone Chemical compound CNC1=CC=C(C(C)=O)C=C1[N+]([O-])=O RFMFMDSOEBOCAX-UHFFFAOYSA-N 0.000 description 1
- QXOGPTXQGKQSJT-UHFFFAOYSA-N 1-amino-4-[4-(3,4-dimethylphenyl)sulfanylanilino]-9,10-dioxoanthracene-2-sulfonic acid Chemical compound Cc1ccc(Sc2ccc(Nc3cc(c(N)c4C(=O)c5ccccc5C(=O)c34)S(O)(=O)=O)cc2)cc1C QXOGPTXQGKQSJT-UHFFFAOYSA-N 0.000 description 1
- VHCQMZOYEMVPOI-UHFFFAOYSA-N 1-benzyl-6-(imidazol-1-ylmethyl)-2-(trifluoromethyl)benzimidazole Chemical compound C1=C2N(CC=3C=CC=CC=3)C(C(F)(F)F)=NC2=CC=C1CN1C=CN=C1 VHCQMZOYEMVPOI-UHFFFAOYSA-N 0.000 description 1
- BNTCXXPEKBQRLU-UHFFFAOYSA-N 1-hydroxy-6-(imidazol-1-ylmethyl)-2-phenylbenzimidazole Chemical compound C1=C2N(O)C(C=3C=CC=CC=3)=NC2=CC=C1CN1C=CN=C1 BNTCXXPEKBQRLU-UHFFFAOYSA-N 0.000 description 1
- QCQBLHXYQBUHMM-UHFFFAOYSA-N 1-hydroxy-6-(imidazol-1-ylmethyl)-2-phenylbenzimidazole;hydrate Chemical compound O.C1=C2N(O)C(C=3C=CC=CC=3)=NC2=CC=C1CN1C=CN=C1 QCQBLHXYQBUHMM-UHFFFAOYSA-N 0.000 description 1
- FGAJNAMCBHHNGP-UHFFFAOYSA-N 1-n-benzyl-4-(imidazol-1-ylmethyl)benzene-1,2-diamine Chemical compound C=1C=C(NCC=2C=CC=CC=2)C(N)=CC=1CN1C=CN=C1 FGAJNAMCBHHNGP-UHFFFAOYSA-N 0.000 description 1
- LCTJVCKLBZGNTC-UHFFFAOYSA-N 1-pentylbenzimidazole Chemical compound C1=CC=C2N(CCCCC)C=NC2=C1 LCTJVCKLBZGNTC-UHFFFAOYSA-N 0.000 description 1
- RYZGHCZALGGMBX-UHFFFAOYSA-N 1h-benzimidazole;nitric acid Chemical compound O[N+]([O-])=O.O[N+]([O-])=O.C1=CC=C2NC=NC2=C1 RYZGHCZALGGMBX-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- SBQRYMGLABMVAQ-UHFFFAOYSA-N 2-(1,2-dihydroxypropyl)propanedioic acid Chemical compound CC(O)C(O)C(C(O)=O)C(O)=O SBQRYMGLABMVAQ-UHFFFAOYSA-N 0.000 description 1
- GWNIBSQWAZQIEJ-UHFFFAOYSA-N 2-(1-hydroxypropyl)propanedioic acid Chemical compound CCC(O)C(C(O)=O)C(O)=O GWNIBSQWAZQIEJ-UHFFFAOYSA-N 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- AZRNESPVUXLXAG-UHFFFAOYSA-N 2-(2-chlorophenyl)-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound ClC1=CC=CC=C1C1=NC2=CC(CN3C=NC=C3)=CC=C2N1 AZRNESPVUXLXAG-UHFFFAOYSA-N 0.000 description 1
- AHUBVCUHFJTWNC-UHFFFAOYSA-N 2-(2-fluorophenyl)-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound FC1=CC=CC=C1C1=NC2=CC(CN3C=NC=C3)=CC=C2N1 AHUBVCUHFJTWNC-UHFFFAOYSA-N 0.000 description 1
- SQFJEVMUZVTOFO-UHFFFAOYSA-N 2-(2-fluorophenyl)-6-[imidazol-1-yl(phenyl)methyl]-1h-benzimidazole Chemical compound FC1=CC=CC=C1C1=NC2=CC(C(C=3C=CC=CC=3)N3C=NC=C3)=CC=C2N1 SQFJEVMUZVTOFO-UHFFFAOYSA-N 0.000 description 1
- AWMBQNHHGQSPDX-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-hydroxy-6-(imidazol-1-ylmethyl)benzimidazole Chemical compound C1=C2N(O)C(C=3C=CC(F)=CC=3)=NC2=CC=C1CN1C=CN=C1 AWMBQNHHGQSPDX-UHFFFAOYSA-N 0.000 description 1
- GIUTUZDGHNZVIA-UHFFFAOYSA-N 2-(ethylamino)acetic acid;hydrochloride Chemical compound Cl.CCNCC(O)=O GIUTUZDGHNZVIA-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- QTMAZYGAVHCKKX-UHFFFAOYSA-N 2-[(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]propane-1,3-diol Chemical compound NC1=NC=NC2=C1C(Br)=CN2COC(CO)CO QTMAZYGAVHCKKX-UHFFFAOYSA-N 0.000 description 1
- IDRUFHLMTBZQBT-IHWYPQMZSA-N 2-[(Z)-prop-1-enyl]propanedioic acid Chemical compound C\C=C/C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-IHWYPQMZSA-N 0.000 description 1
- IDRUFHLMTBZQBT-NSCUHMNNSA-N 2-[(e)-prop-1-enyl]propanedioic acid Chemical compound C\C=C\C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-NSCUHMNNSA-N 0.000 description 1
- MLSPPLIKRUXMBT-UHFFFAOYSA-N 2-[6-(imidazol-1-ylmethyl)-1h-benzimidazol-2-yl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=NC2=CC(CN3C=NC=C3)=CC=C2N1 MLSPPLIKRUXMBT-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- ZUKMGQYDKUNXOO-UHFFFAOYSA-N 2-chloro-3-ethylbenzoic acid Chemical compound CCC1=CC=CC(C(O)=O)=C1Cl ZUKMGQYDKUNXOO-UHFFFAOYSA-N 0.000 description 1
- 102100027324 2-hydroxyacyl-CoA lyase 1 Human genes 0.000 description 1
- QCJQXKHEGZOUER-UHFFFAOYSA-N 2-imidazol-1-yl-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=2)=CC=C1NC=2N1C=CN=C1 QCJQXKHEGZOUER-UHFFFAOYSA-N 0.000 description 1
- LMLTWPRCKDMKLQ-UHFFFAOYSA-N 2-isothiocyanato-1,1-dimethoxyethane Chemical compound COC(OC)CN=C=S LMLTWPRCKDMKLQ-UHFFFAOYSA-N 0.000 description 1
- RRUXUSZQBIKFAP-UHFFFAOYSA-N 2-methyl-1h-benzimidazole-4-carbaldehyde Chemical compound C1=CC=C2NC(C)=NC2=C1C=O RRUXUSZQBIKFAP-UHFFFAOYSA-N 0.000 description 1
- VHHXHCHCYABVNW-UHFFFAOYSA-N 2-phenyl-1-propylbenzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N(CCC)C=1C1=CC=CC=C1 VHHXHCHCYABVNW-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- VQDJODAWOFNASI-UHFFFAOYSA-N 2-propylpropanedioic acid Chemical compound CCCC(C(O)=O)C(O)=O VQDJODAWOFNASI-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- UFQKATWGZBQOMS-UHFFFAOYSA-N 3,4-dihydroxypentanoic acid Chemical compound CC(O)C(O)CC(O)=O UFQKATWGZBQOMS-UHFFFAOYSA-N 0.000 description 1
- DFRAKBCRUYUFNT-UHFFFAOYSA-N 3,8-dicyclohexyl-2,4,7,9-tetrahydro-[1,3]oxazino[5,6-h][1,3]benzoxazine Chemical compound C1CCCCC1N1CC(C=CC2=C3OCN(C2)C2CCCCC2)=C3OC1 DFRAKBCRUYUFNT-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- NCCPBFIZFBAPTB-UHFFFAOYSA-N 3-amino-4-(propylamino)benzoic acid Chemical compound CCCNC1=CC=C(C(O)=O)C=C1N NCCPBFIZFBAPTB-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- IHMRNZPNSDGGMQ-UHFFFAOYSA-N 3h-benzimidazol-5-yl(furan-2-yl)methanol Chemical compound C=1C=C2N=CNC2=CC=1C(O)C1=CC=CO1 IHMRNZPNSDGGMQ-UHFFFAOYSA-N 0.000 description 1
- QMGAQVPUXZTDJI-UHFFFAOYSA-N 4-(1-imidazol-1-yl-2-methylpropyl)-1-n-methylbenzene-1,2-diamine Chemical compound C1=C(N)C(NC)=CC=C1C(C(C)C)N1C=NC=C1 QMGAQVPUXZTDJI-UHFFFAOYSA-N 0.000 description 1
- POZFWUWCRRFCGT-UHFFFAOYSA-N 4-(1-imidazol-1-yl-3-methylbutyl)benzene-1,2-diamine Chemical compound C1=CN=CN1C(CC(C)C)C1=CC=C(N)C(N)=C1 POZFWUWCRRFCGT-UHFFFAOYSA-N 0.000 description 1
- OFIHHAPNQWNUPX-UHFFFAOYSA-N 4-(1-imidazol-1-ylethyl)benzene-1,2-diamine Chemical compound C1=CN=CN1C(C)C1=CC=C(N)C(N)=C1 OFIHHAPNQWNUPX-UHFFFAOYSA-N 0.000 description 1
- AEFSZMFCMXITIT-UHFFFAOYSA-N 4-(1-imidazol-1-ylheptyl)benzene-1,2-diamine Chemical compound C1=CN=CN1C(CCCCCC)C1=CC=C(N)C(N)=C1 AEFSZMFCMXITIT-UHFFFAOYSA-N 0.000 description 1
- HCBZUYSHGIQNTM-UHFFFAOYSA-N 4-(1-imidazol-1-ylpropyl)benzene-1,2-diamine Chemical compound C1=CN=CN1C(CC)C1=CC=C(N)C(N)=C1 HCBZUYSHGIQNTM-UHFFFAOYSA-N 0.000 description 1
- VJJFNUSPBUGGHB-UHFFFAOYSA-N 4-(imidazol-1-ylmethyl)-1-n-(pyridin-3-ylmethyl)benzene-1,2-diamine Chemical compound C=1C=C(NCC=2C=NC=CC=2)C(N)=CC=1CN1C=CN=C1 VJJFNUSPBUGGHB-UHFFFAOYSA-N 0.000 description 1
- ALRKFJDTQNFERN-UHFFFAOYSA-N 4-(imidazol-1-ylmethyl)-2-nitro-n-(pyridin-3-ylmethyl)aniline Chemical compound C=1C=C(NCC=2C=NC=CC=2)C([N+](=O)[O-])=CC=1CN1C=CN=C1 ALRKFJDTQNFERN-UHFFFAOYSA-N 0.000 description 1
- GGUIKTLTNIMAHY-UHFFFAOYSA-N 4-[(3-chlorophenyl)-imidazol-1-ylmethyl]benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1C(N1C=NC=C1)C1=CC=CC(Cl)=C1 GGUIKTLTNIMAHY-UHFFFAOYSA-N 0.000 description 1
- IPTHPLLVEQIQLK-UHFFFAOYSA-N 4-[imidazol-1-yl(phenyl)methyl]-1-n-methylbenzene-1,2-diamine Chemical compound C1=C(N)C(NC)=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 IPTHPLLVEQIQLK-UHFFFAOYSA-N 0.000 description 1
- RJTJMHFDXWPNLQ-UHFFFAOYSA-N 4-[imidazol-1-yl(phenyl)methyl]benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 RJTJMHFDXWPNLQ-UHFFFAOYSA-N 0.000 description 1
- GVCLNACSYKYUHP-UHFFFAOYSA-N 4-amino-7-(2-hydroxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbothioamide Chemical compound C1=NC(N)=C2C(C(=S)N)=CN(COCCO)C2=N1 GVCLNACSYKYUHP-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- HETBKLHJEWXWBM-UHFFFAOYSA-N 4-chloro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(C=O)=CC=C1Cl HETBKLHJEWXWBM-UHFFFAOYSA-N 0.000 description 1
- BBYDXOIZLAWGSL-UHFFFAOYSA-N 4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- KBIWNQVZKHSHTI-UHFFFAOYSA-N 4-n,4-n-dimethylbenzene-1,4-diamine;oxalic acid Chemical compound OC(=O)C(O)=O.CN(C)C1=CC=C(N)C=C1 KBIWNQVZKHSHTI-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- IQZSACWHKCETMI-UHFFFAOYSA-N 5-(chloromethyl)-1,3-dihydrobenzimidazol-2-one Chemical compound ClCC1=CC=C2NC(=O)NC2=C1 IQZSACWHKCETMI-UHFFFAOYSA-N 0.000 description 1
- JYDHPEDXWOZTKG-UHFFFAOYSA-N 5-(chloromethyl)-1-propyl-2-pyridin-3-ylbenzimidazole Chemical compound N=1C2=CC(CCl)=CC=C2N(CCC)C=1C1=CC=CN=C1 JYDHPEDXWOZTKG-UHFFFAOYSA-N 0.000 description 1
- UBXKTZMRHQPCFZ-UHFFFAOYSA-N 5-(hydroxymethyl)-1,3-dihydrobenzimidazol-2-one Chemical compound OCC1=CC=C2NC(=O)NC2=C1 UBXKTZMRHQPCFZ-UHFFFAOYSA-N 0.000 description 1
- SPBGFBFESZVJEZ-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-1,3-dihydrobenzimidazol-2-one Chemical compound C1=C2NC(=O)NC2=CC=C1CN1C=CN=C1 SPBGFBFESZVJEZ-UHFFFAOYSA-N 0.000 description 1
- DCWPVCJVHMVVEF-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-1-(pyridin-3-ylmethyl)benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=C2)=CC=C1N2CC1=CC=CN=C1 DCWPVCJVHMVVEF-UHFFFAOYSA-N 0.000 description 1
- RDBMOJBMABTGAO-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-1-methoxy-2-phenylbenzimidazole Chemical compound C=1C=C2N(OC)C(C=3C=CC=CC=3)=NC2=CC=1CN1C=CN=C1 RDBMOJBMABTGAO-UHFFFAOYSA-N 0.000 description 1
- MLEYQQZVXAZKAK-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-2-methyl-1-(pyridin-3-ylmethyl)benzimidazole Chemical compound C=1C=C2N(CC=3C=NC=CC=3)C(C)=NC2=CC=1CN1C=CN=C1 MLEYQQZVXAZKAK-UHFFFAOYSA-N 0.000 description 1
- PIRSHLWRSORLMC-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-2-nitro-n-(2-phenylethyl)aniline Chemical compound C1=C(NCCC=2C=CC=CC=2)C([N+](=O)[O-])=CC=C1CN1C=CN=C1 PIRSHLWRSORLMC-UHFFFAOYSA-N 0.000 description 1
- PYMCDOKWLOVDDS-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-2-pyridin-3-yl-1-(pyridin-3-ylmethyl)benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=C2C=3C=NC=CC=3)=CC=C1N2CC1=CC=CN=C1 PYMCDOKWLOVDDS-UHFFFAOYSA-N 0.000 description 1
- PVDYMAONVSOABH-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-n-methyl-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(NC)=CC(CN2C=NC=C2)=C1 PVDYMAONVSOABH-UHFFFAOYSA-N 0.000 description 1
- VKLKXFOZNHEBSW-UHFFFAOYSA-N 5-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide Chemical compound O1CCN(CC1)C1=CC=C(C(=O)NC=2C=C(COC=3C=NC=C(C(=O)N)C=3)C=CC=2)C=C1 VKLKXFOZNHEBSW-UHFFFAOYSA-N 0.000 description 1
- OWSSTFMPRICQGU-UHFFFAOYSA-N 5-[imidazol-1-yl(phenyl)methyl]-1,3-dihydrobenzimidazol-2-one Chemical compound C1=C2NC(=O)NC2=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 OWSSTFMPRICQGU-UHFFFAOYSA-N 0.000 description 1
- ZXYSZHQHAKDRCX-UHFFFAOYSA-N 6-(1-imidazol-1-yl-2-methylpropyl)-1h-benzimidazole Chemical compound C=1C=C2NC=NC2=CC=1C(C(C)C)N1C=CN=C1 ZXYSZHQHAKDRCX-UHFFFAOYSA-N 0.000 description 1
- KOQCVSHDMOHAHL-UHFFFAOYSA-N 6-(1-imidazol-1-ylethyl)-2-pyridin-4-yl-1h-benzimidazole Chemical compound C1=CN=CN1C(C)C(C=C1N=2)=CC=C1NC=2C1=CC=NC=C1 KOQCVSHDMOHAHL-UHFFFAOYSA-N 0.000 description 1
- HTDWCFMFBFSMPY-UHFFFAOYSA-N 6-(1-imidazol-1-ylheptyl)-1h-benzimidazole Chemical compound C=1C=C2NC=NC2=CC=1C(CCCCCC)N1C=CN=C1 HTDWCFMFBFSMPY-UHFFFAOYSA-N 0.000 description 1
- VYSWGQNMXSKPNI-UHFFFAOYSA-N 6-(1-imidazol-1-ylpropyl)-2-(trifluoromethyl)-1h-benzimidazole Chemical compound C=1C=C2NC(C(F)(F)F)=NC2=CC=1C(CC)N1C=CN=C1 VYSWGQNMXSKPNI-UHFFFAOYSA-N 0.000 description 1
- NOOHSFRCODFEIQ-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-1,2-diphenylbenzimidazole Chemical compound C1=CN=CN1CC(C=C1N2C=3C=CC=CC=3)=CC=C1N=C2C1=CC=CC=C1 NOOHSFRCODFEIQ-UHFFFAOYSA-N 0.000 description 1
- RILXEDZEXIIPRF-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-1-methoxy-2-phenylbenzimidazole Chemical compound C1=C2N(OC)C(C=3C=CC=CC=3)=NC2=CC=C1CN1C=CN=C1 RILXEDZEXIIPRF-UHFFFAOYSA-N 0.000 description 1
- UQCFYKCLPPESGM-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-methyl-1-phenylbenzimidazole Chemical compound C1=C2N(C=3C=CC=CC=3)C(C)=NC2=CC=C1CN1C=CN=C1 UQCFYKCLPPESGM-UHFFFAOYSA-N 0.000 description 1
- SXQSIYVRFINRSP-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-pyridin-3-yl-1h-benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=2)=CC=C1NC=2C1=CC=CN=C1 SXQSIYVRFINRSP-UHFFFAOYSA-N 0.000 description 1
- YZPJKDULDNOZEW-UHFFFAOYSA-N 6-[di(imidazol-1-yl)methyl]-2-pyridin-3-yl-1h-benzimidazole Chemical compound C1=NC=CN1C(N1C=NC=C1)C1=CC=C(NC(=N2)C=3C=NC=CC=3)C2=C1 YZPJKDULDNOZEW-UHFFFAOYSA-N 0.000 description 1
- IXBGNPXVSIGYPW-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-1h-benzimidazole Chemical compound C1=NC=CN1C(C=1C=C2N=CNC2=CC=1)C1=CC=CC=C1 IXBGNPXVSIGYPW-UHFFFAOYSA-N 0.000 description 1
- GGQZBPVEEBYJAW-SDNWHVSQSA-N 6-[imidazol-1-yl(phenyl)methyl]-2-[(e)-2-phenylethenyl]-1h-benzimidazole Chemical compound N=1C2=CC=C(C(C=3C=CC=CC=3)N3C=NC=C3)C=C2NC=1/C=C/C1=CC=CC=C1 GGQZBPVEEBYJAW-SDNWHVSQSA-N 0.000 description 1
- GMKINOPFTBKHCG-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-2-methoxy-1h-benzimidazole Chemical compound C=1C=C2NC(OC)=NC2=CC=1C(N1C=NC=C1)C1=CC=CC=C1 GMKINOPFTBKHCG-UHFFFAOYSA-N 0.000 description 1
- GDUANFXPOZTYKS-UHFFFAOYSA-N 6-bromo-8-[(2,6-difluoro-4-methoxybenzoyl)amino]-4-oxochromene-2-carboxylic acid Chemical compound FC1=CC(OC)=CC(F)=C1C(=O)NC1=CC(Br)=CC2=C1OC(C(O)=O)=CC2=O GDUANFXPOZTYKS-UHFFFAOYSA-N 0.000 description 1
- NJIAKNWTIVDSDA-FQEVSTJZSA-N 7-[4-(1-methylsulfonylpiperidin-4-yl)phenyl]-n-[[(2s)-morpholin-2-yl]methyl]pyrido[3,4-b]pyrazin-5-amine Chemical compound C1CN(S(=O)(=O)C)CCC1C1=CC=C(C=2N=C(NC[C@H]3OCCNC3)C3=NC=CN=C3C=2)C=C1 NJIAKNWTIVDSDA-FQEVSTJZSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- XASOHFCUIQARJT-UHFFFAOYSA-N 8-methoxy-6-[7-(2-morpholin-4-ylethoxy)imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one Chemical compound C(N1C(=O)C2=C(OC)C=C(C=3N4C(=NC=3)C=C(C=C4)OCCN3CCOCC3)C=C2CC1)C(F)(F)F XASOHFCUIQARJT-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JREQSUJKIZGWDD-UHFFFAOYSA-N C1CCC(C1)N2C=NC3=C2C=C(C=C3)CN4C=CN=C4 Chemical compound C1CCC(C1)N2C=NC3=C2C=C(C=C3)CN4C=CN=C4 JREQSUJKIZGWDD-UHFFFAOYSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- CZWOJIUPEJUQPO-UHFFFAOYSA-N CN1C=NC2=C1C=CC(=C2)C(=O)C3=CC(=CC=C3)F Chemical compound CN1C=NC2=C1C=CC(=C2)C(=O)C3=CC(=CC=C3)F CZWOJIUPEJUQPO-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- SDKRZXAYJWPCPU-UHFFFAOYSA-N Cl.Cl.C1=CC(Cl)=CC=C1C1=NC2=CC(CN3C=NC=C3)=CC=C2N1 Chemical compound Cl.Cl.C1=CC(Cl)=CC=C1C1=NC2=CC(CN3C=NC=C3)=CC=C2N1 SDKRZXAYJWPCPU-UHFFFAOYSA-N 0.000 description 1
- KVQTXUQPJYCGOU-UHFFFAOYSA-N Cl.Cl.N1(C=NC=C1)CC1=CC2=C(NC(=N2)C2=C(C(=O)O)C=CC=C2)C=C1 Chemical compound Cl.Cl.N1(C=NC=C1)CC1=CC2=C(NC(=N2)C2=C(C(=O)O)C=CC=C2)C=C1 KVQTXUQPJYCGOU-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 101100289061 Drosophila melanogaster lili gene Proteins 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- XBLVHTDFJBKJLG-UHFFFAOYSA-N Ethyl nicotinate Chemical compound CCOC(=O)C1=CC=CN=C1 XBLVHTDFJBKJLG-UHFFFAOYSA-N 0.000 description 1
- DULCUDSUACXJJC-UHFFFAOYSA-N Ethyl phenylacetate Chemical compound CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 201000005569 Gout Diseases 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 206010020112 Hirsutism Diseases 0.000 description 1
- 101001009252 Homo sapiens 2-hydroxyacyl-CoA lyase 1 Proteins 0.000 description 1
- 229930186657 Lat Natural products 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- UETYQCLOVDSSQH-UHFFFAOYSA-N O.O.Cl.Cl.C(C1=CC=CC=C1)(=O)O Chemical compound O.O.Cl.Cl.C(C1=CC=CC=C1)(=O)O UETYQCLOVDSSQH-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ORNBQBCIOKFOEO-YQUGOWONSA-N Pregnenolone Natural products O=C(C)[C@@H]1[C@@]2(C)[C@H]([C@H]3[C@@H]([C@]4(C)C(=CC3)C[C@@H](O)CC4)CC2)CC1 ORNBQBCIOKFOEO-YQUGOWONSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- DRBWRJPFNOBNIO-KOLCDFICSA-N [(2r)-1-[(2r)-2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid Chemical compound N([C@H](C)C(=O)N1[C@@H](CCC1)B(O)O)C(=O)C1=CC=NC=C1 DRBWRJPFNOBNIO-KOLCDFICSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 1
- 230000009858 acid secretion Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000005303 alkyl halide derivatives Chemical class 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 229940030486 androgens Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- OTKPPUXRIADSGD-PPRNARJGSA-N avoparcina Chemical compound O([C@@H]1C2=CC=C(C(=C2)Cl)OC=2C=C3C=C(C=2O[C@H]2C([C@@H](O)[C@H](O)[C@@H](CO)O2)O[C@@H]2O[C@@H](C)[C@H](O)[C@H](N)C2)OC2=CC=C(C=C2)[C@@H](O)[C@H](C(N[C@H](C(=O)N[C@H]3C(=O)N[C@H]2C(=O)N[C@@H]1C(N[C@@H](C1=CC(O)=CC(O)=C1C=1C(O)=CC=C2C=1)C(O)=O)=O)C=1C=CC(O)=CC=1)=O)NC(=O)[C@H](NC)C=1C=CC(O[C@H]2[C@@H]([C@H](O)[C@@H](O)[C@H](C)O2)O)=CC=1)[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1 OTKPPUXRIADSGD-PPRNARJGSA-N 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000008641 benzimidazolones Chemical class 0.000 description 1
- KLQNJBAFEFFWQZ-UHFFFAOYSA-N benzoic acid;dihydrochloride Chemical compound Cl.Cl.OC(=O)C1=CC=CC=C1 KLQNJBAFEFFWQZ-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003177 cardiotonic effect Effects 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125877 compound 31 Drugs 0.000 description 1
- 229940125807 compound 37 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000062 cyclohexylmethoxy group Chemical group [H]C([H])(O*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000011928 denatured alcohol Substances 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 238000006477 desulfuration reaction Methods 0.000 description 1
- 230000023556 desulfurization Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- VNEBWJSWMVTSHK-UHFFFAOYSA-L disodium;3-hydroxynaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=CC2=C1 VNEBWJSWMVTSHK-UHFFFAOYSA-L 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- GAZNVIKHDJBJSO-UHFFFAOYSA-N ethyl 1-hydroxy-6-(hydroxymethyl)benzimidazole-2-carboxylate;hydrochloride Chemical compound Cl.C1=C(CO)C=C2N(O)C(C(=O)OCC)=NC2=C1 GAZNVIKHDJBJSO-UHFFFAOYSA-N 0.000 description 1
- SBNFMGRCKKFSLR-UHFFFAOYSA-N ethyl 2,3-diaminobenzoate Chemical compound CCOC(=O)C1=CC=CC(N)=C1N SBNFMGRCKKFSLR-UHFFFAOYSA-N 0.000 description 1
- SFDALSUFTGWIQI-UHFFFAOYSA-N ethyl 2-methyl-1h-benzimidazole-4-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1NC(C)=N2 SFDALSUFTGWIQI-UHFFFAOYSA-N 0.000 description 1
- UBUUIAKWUGMYHA-UHFFFAOYSA-N ethyl 6-(hydroxymethyl)-1-methoxybenzimidazole-2-carboxylate Chemical compound C1=C(CO)C=C2N(OC)C(C(=O)OCC)=NC2=C1 UBUUIAKWUGMYHA-UHFFFAOYSA-N 0.000 description 1
- MODZVIMSNXSQIH-UHFFFAOYSA-N ethyl benzenecarboximidate;hydron;chloride Chemical compound Cl.CCOC(=N)C1=CC=CC=C1 MODZVIMSNXSQIH-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- SGEMMELRMUVIHJ-UHFFFAOYSA-N ethyl cyclopropanecarboximidate;hydrochloride Chemical compound Cl.CCOC(=N)C1CC1 SGEMMELRMUVIHJ-UHFFFAOYSA-N 0.000 description 1
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000002434 gonadorelin derivative Substances 0.000 description 1
- 230000003779 hair growth Effects 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 125000000336 imidazol-5-yl group Chemical group [H]N1C([H])=NC([H])=C1[*] 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 150000004694 iodide salts Chemical group 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 239000008274 jelly Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- UGFHIPBXIWJXNA-UHFFFAOYSA-N liarozole Chemical compound ClC1=CC=CC(C(C=2C=C3NC=NC3=CC=2)N2C=NC=C2)=C1 UGFHIPBXIWJXNA-UHFFFAOYSA-N 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- JFUXCQSSEVTROW-UHFFFAOYSA-N methyl 2,2,2-trifluoroethanimidate Chemical compound COC(=N)C(F)(F)F JFUXCQSSEVTROW-UHFFFAOYSA-N 0.000 description 1
- IOUJFTUGTATUQL-UHFFFAOYSA-N methyl 2-phenyl-1-propylbenzimidazole-5-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N(CCC)C=1C1=CC=CC=C1 IOUJFTUGTATUQL-UHFFFAOYSA-N 0.000 description 1
- BAPDUWJSHQYCLL-UHFFFAOYSA-N methyl 6-(1-imidazol-1-ylethyl)-1h-benzimidazole-2-carboxylate Chemical compound C1=C2NC(C(=O)OC)=NC2=CC=C1C(C)N1C=CN=C1 BAPDUWJSHQYCLL-UHFFFAOYSA-N 0.000 description 1
- WCMGZCGXOTVBAJ-UHFFFAOYSA-N methyl 6-(imidazol-1-ylmethyl)-1h-benzimidazole-2-carboxylate Chemical compound C=1C=C2NC(C(=O)OC)=NC2=CC=1CN1C=CN=C1 WCMGZCGXOTVBAJ-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000003470 mitochondria Anatomy 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- QUTBWBDICHCXTO-UHFFFAOYSA-N n-(cyclohexylmethyl)-5-(imidazol-1-ylmethyl)-2-nitroaniline Chemical compound C1=C(NCC2CCCCC2)C([N+](=O)[O-])=CC=C1CN1C=CN=C1 QUTBWBDICHCXTO-UHFFFAOYSA-N 0.000 description 1
- PZZLCKNSVIVGBZ-UHFFFAOYSA-N n-[2-amino-4-(1-imidazol-1-ylethyl)phenyl]acetamide Chemical compound C1=CN=CN1C(C)C1=CC=C(NC(C)=O)C(N)=C1 PZZLCKNSVIVGBZ-UHFFFAOYSA-N 0.000 description 1
- ALJKMDCIHIWFTG-UHFFFAOYSA-N n-[2-amino-4-(imidazol-1-ylmethyl)phenyl]acetamide Chemical compound C1=C(N)C(NC(=O)C)=CC=C1CN1C=NC=C1 ALJKMDCIHIWFTG-UHFFFAOYSA-N 0.000 description 1
- IHCHOVVAJBADAH-UHFFFAOYSA-N n-[2-hydroxy-4-(1h-pyrazol-4-yl)phenyl]-6-methoxy-3,4-dihydro-2h-chromene-3-carboxamide Chemical compound C1C2=CC(OC)=CC=C2OCC1C(=O)NC(C(=C1)O)=CC=C1C=1C=NNC=1 IHCHOVVAJBADAH-UHFFFAOYSA-N 0.000 description 1
- MBZBIUHDRBPGKV-UHFFFAOYSA-N n-[4-(1-hydroxy-2-methylpropyl)phenyl]acetamide Chemical compound CC(C)C(O)C1=CC=C(NC(C)=O)C=C1 MBZBIUHDRBPGKV-UHFFFAOYSA-N 0.000 description 1
- FTFKGKMDLODEQK-UHFFFAOYSA-N n-[4-(1-imidazol-1-yl-2-methylpropyl)-2-nitrophenyl]acetamide Chemical compound C1=CN=CN1C(C(C)C)C1=CC=C(NC(C)=O)C([N+]([O-])=O)=C1 FTFKGKMDLODEQK-UHFFFAOYSA-N 0.000 description 1
- DJCJANGDPXMRML-UHFFFAOYSA-N n-[4-(1-imidazol-1-ylethyl)-2-nitrophenyl]formamide Chemical compound C1=CN=CN1C(C)C1=CC=C(NC=O)C([N+]([O-])=O)=C1 DJCJANGDPXMRML-UHFFFAOYSA-N 0.000 description 1
- NVHMZOCZCQQSLZ-UHFFFAOYSA-N n-[4-(imidazol-1-ylmethyl)-2-nitrophenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC=C1CN1C=NC=C1 NVHMZOCZCQQSLZ-UHFFFAOYSA-N 0.000 description 1
- CUDSDSWQGMNPOT-UHFFFAOYSA-N n-[4-[imidazol-1-yl(phenyl)methyl]-2-nitrophenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 CUDSDSWQGMNPOT-UHFFFAOYSA-N 0.000 description 1
- YGBMCLDVRUGXOV-UHFFFAOYSA-N n-[6-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]pyridin-3-yl]-1,3-benzothiazol-2-yl]acetamide Chemical compound C1=C2SC(NC(=O)C)=NC2=CC=C1C(C=1)=CN=C(Cl)C=1NS(=O)(=O)C1=CC=C(F)C=C1 YGBMCLDVRUGXOV-UHFFFAOYSA-N 0.000 description 1
- OHXIFXQGQJSOCR-UHFFFAOYSA-N n-benzyl-4-(imidazol-1-ylmethyl)-2-nitroaniline Chemical compound C=1C=C(NCC=2C=CC=CC=2)C([N+](=O)[O-])=CC=1CN1C=CN=C1 OHXIFXQGQJSOCR-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-M octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC([O-])=O QIQXTHQIDYTFRH-UHFFFAOYSA-M 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940098462 oral drops Drugs 0.000 description 1
- 229940100688 oral solution Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- QRKVRHZNLKTPGF-UHFFFAOYSA-N phosphorus pentabromide Chemical compound BrP(Br)(Br)(Br)Br QRKVRHZNLKTPGF-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical class NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 229960000249 pregnenolone Drugs 0.000 description 1
- OZZAYJQNMKMUSD-DMISRAGPSA-N pregnenolone succinate Chemical compound C1C=C2C[C@@H](OC(=O)CCC(O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 OZZAYJQNMKMUSD-DMISRAGPSA-N 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000003127 radioimmunoassay Methods 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical compound [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000008137 solubility enhancer Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 210000001768 subcellular fraction Anatomy 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000002381 testicular Effects 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- AHJWSRRHTXRLAQ-UHFFFAOYSA-N tetramethoxymethane Chemical compound COC(OC)(OC)OC AHJWSRRHTXRLAQ-UHFFFAOYSA-N 0.000 description 1
- RZWIIPASKMUIAC-VQTJNVASSA-N thromboxane Chemical compound CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC RZWIIPASKMUIAC-VQTJNVASSA-N 0.000 description 1
- 239000003768 thromboxane synthase inhibitor Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/06—Antigout agents, e.g. antihyperuricemic or uricosuric agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/24—Drugs for disorders of the endocrine system of the sex hormones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Endocrinology (AREA)
- Diabetes (AREA)
- Dermatology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Physical Education & Sports Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US90790386A | 1986-09-15 | 1986-09-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT45051A HUT45051A (en) | 1988-05-30 |
| HU198039B true HU198039B (en) | 1989-07-28 |
Family
ID=25424835
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU874071A HU198039B (en) | 1986-09-15 | 1987-09-14 | Process for production of new substituated derivatives of /1h-imidasole-1-il-methil/-benzimidasole and medical preparatives containing these substances |
Country Status (23)
| Country | Link |
|---|---|
| EP (1) | EP0260744B1 (OSRAM) |
| JP (1) | JPS6485975A (OSRAM) |
| KR (1) | KR960014353B1 (OSRAM) |
| CN (1) | CN1020903C (OSRAM) |
| AU (1) | AU595064B2 (OSRAM) |
| BG (1) | BG61321B2 (OSRAM) |
| CA (1) | CA1323366C (OSRAM) |
| CY (1) | CY1803A (OSRAM) |
| DE (1) | DE3783107T2 (OSRAM) |
| DK (1) | DK174728B1 (OSRAM) |
| ES (1) | ES2053524T3 (OSRAM) |
| FI (1) | FI87781C (OSRAM) |
| GR (1) | GR3006841T3 (OSRAM) |
| HK (1) | HK123694A (OSRAM) |
| HU (1) | HU198039B (OSRAM) |
| IE (1) | IE60514B1 (OSRAM) |
| IL (1) | IL83892A (OSRAM) |
| NO (1) | NO167202C (OSRAM) |
| NZ (1) | NZ221729A (OSRAM) |
| PH (1) | PH25022A (OSRAM) |
| PT (1) | PT85692B (OSRAM) |
| SU (1) | SU1662350A3 (OSRAM) |
| ZA (1) | ZA876881B (OSRAM) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4826862A (en) * | 1988-02-12 | 1989-05-02 | Janssen Pharmaceutica, N.V. | Anthelminthic [(5(6) (1H-azole-1-ylmethyl)benzimidazole]carbamates |
| CA2002864C (en) * | 1988-11-29 | 1999-11-16 | Eddy J. E. Freyne | (1h-azol-1-ylmethyl) substituted quinoline, quinazoline or quinoxaline derivatives |
| GB8827820D0 (en) * | 1988-11-29 | 1988-12-29 | Janssen Pharmaceutica Nv | (1h-azol-1-ylmethyl)substituted quinoline derivatives |
| CA2002859C (en) * | 1988-11-29 | 1998-12-29 | Jean P. F. Van Wauwe | Method of treating epithelial disorders |
| FR2643903A1 (fr) * | 1989-03-03 | 1990-09-07 | Union Pharma Scient Appl | Nouveaux derives de benzimidazole, leurs procedes de preparation, intermediaires de synthese, compositions pharmaceutiques les contenant, utiles notamment pour le traitement des maladies cardiovasculaires, et des ulceres duodenaux |
| PT95899A (pt) * | 1989-11-17 | 1991-09-13 | Glaxo Group Ltd | Processo para a preparacao de derivados indole |
| US5021448A (en) * | 1990-02-22 | 1991-06-04 | Ciba-Geigy Corporation | Method of reducing serum uric acid and/or increasing renal uric acid clearance with thromboxane synthetase inhibitor inhibitor and/or thromboxane receptor antagonist |
| FR2663028B1 (fr) * | 1990-06-08 | 1994-10-14 | Roussel Uclaf | Nouveaux derives de benzimidazole, leur procede de preparation, les nouveaux intermediaires obtenus, leur application a titre de medicaments et les compositions pharmaceutiques les renfermant. |
| US5216003A (en) * | 1992-01-02 | 1993-06-01 | G. D. Searle & Co. | Diacid-containing benzimidazole compounds for treatment of neurotoxic injury |
| WO1995004723A1 (en) * | 1993-08-04 | 1995-02-16 | Yamanouchi Pharmaceutical Co., Ltd. | Imidazolylalkylamine derivative and pharmaceutical composition thereof |
| HUT75871A (en) * | 1993-09-30 | 1997-05-28 | Yamanouchi Co | Azole derivatives and pharmaceutical compositions thereof |
| SG47122A1 (en) * | 1994-02-18 | 1998-03-20 | Janssen Pharmaceutica Nv | Enantiomerically pure(-)-liarozole |
| SG52325A1 (en) * | 1994-02-18 | 1998-09-28 | Janssen Pharmaceutica Nv | Enantiomerically pure(+)-liarozole |
| GB9418443D0 (en) * | 1994-09-13 | 1994-11-02 | Pfizer Ltd | Therapeutic agents |
| NZ300739A (en) * | 1994-12-22 | 2000-05-26 | Ligand Pharm Inc | Steroid receptor modulator compounds |
| US5688808A (en) * | 1994-12-22 | 1997-11-18 | Ligand Pharmaceuticals Incorporated | Steroid receptor modulator compounds and methods |
| US6696459B1 (en) | 1994-12-22 | 2004-02-24 | Ligand Pharmaceuticals Inc. | Steroid receptor modulator compounds and methods |
| TW316902B (OSRAM) * | 1994-12-28 | 1997-10-01 | Janssen Pharmaceutica Nv | |
| NZ302392A (en) * | 1995-03-01 | 1998-08-26 | Yamanouchi Pharma Co Ltd | Tricyclic substituted imidazole derivatives and medicaments thereof |
| US6288100B1 (en) * | 1995-06-06 | 2001-09-11 | American Home Products Corporation | Benzimidazole derivatives |
| DE19535500A1 (de) * | 1995-09-25 | 1997-03-27 | Bayer Ag | Verfahren zur Herstellung von 3-Chlor-3'-nitro-4'-methoxybenzophenon |
| WO1997024334A1 (en) * | 1995-12-28 | 1997-07-10 | Fujisawa Pharmaceutical Co., Ltd. | Benzimidazole derivatives |
| CA2258165C (en) | 1996-06-27 | 2009-03-03 | Marc Gaston Venet | N-[4-(heteroarylmethyl)phenyl]-heteroarylamines |
| FR2751649B1 (fr) * | 1996-07-26 | 1998-08-28 | Adir | Nouveaux derives de benzimidazole, de benzoxazole et de benzothiazole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| IT1286866B1 (it) * | 1996-10-28 | 1998-07-17 | Menarini Farma Ind | Composti furano-eterociclici,loro preparazione ed uso come inibitori di aromatasi |
| AU730369B2 (en) * | 1996-11-25 | 2001-03-08 | Board Of Regents Of The University Of Nebraska, The | Guanidinyl heterocycle compounds useful as alpha-2 adrenoceptor agonists |
| CA2281598A1 (en) * | 1997-02-21 | 1998-08-27 | Tetsuya Aono | Fused ring compounds, process for producing the same and use thereof |
| TW453999B (en) | 1997-06-27 | 2001-09-11 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| DE69824885T2 (de) | 1997-12-11 | 2005-07-21 | Janssen Pharmaceutica N.V. | Anilide als vitamin-a-säure-mimetika |
| DE19831985A1 (de) | 1998-07-16 | 2000-01-20 | Bayer Ag | Substituierte Benzimidazole, ihre Herstellung und ihre Verwendung als Mittel gegen parasitäre Protozoen |
| US6858598B1 (en) | 1998-12-23 | 2005-02-22 | G. D. Searle & Co. | Method of using a matrix metalloproteinase inhibitor and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| US6833373B1 (en) | 1998-12-23 | 2004-12-21 | G.D. Searle & Co. | Method of using an integrin antagonist and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| CA2375843A1 (en) * | 1999-06-04 | 2000-12-14 | Qi Zhao | Compositions and methods for inhibiting cell death |
| NZ521028A (en) | 2000-03-16 | 2004-07-30 | F | Carboxylic acid derivatives as IP antagonists |
| CA2429133C (en) | 2000-11-17 | 2009-08-18 | Takeda Chemical Industries, Ltd. | Novel imidazole derivatives, production method thereof and use thereof |
| WO2002040470A1 (en) | 2000-11-20 | 2002-05-23 | Takeda Chemical Industries, Ltd. | Imidazole derivatives, process for their preparation and their use |
| CA2431171A1 (en) | 2000-12-08 | 2002-06-13 | Takeda Chemical Industries, Ltd. | Substituted thiazole derivatives bearing 3-pyridyl groups, process for preparing the same and use thereof |
| US7405235B2 (en) | 2001-05-04 | 2008-07-29 | Paratek Pharmaceuticals, Inc. | Transcription factor modulating compounds and methods of use thereof |
| US6492517B1 (en) | 2001-07-19 | 2002-12-10 | Air Products And Chemicals, Inc. | Method for preparing halomethyl heterocyclic compounds |
| US7253154B2 (en) * | 2001-11-16 | 2007-08-07 | Nippon Chemiphar Co., Ltd. | Substituted thiazolopyrimidines as xanthine oxidase inhibitors |
| EP1558341A4 (en) * | 2002-11-01 | 2010-09-08 | Paratek Pharm Innc | TRANSCRIPTION FACTOR MODULATING CONNECTIONS AND THEIR USE |
| WO2005000795A2 (en) * | 2003-06-10 | 2005-01-06 | Smithkline Beecham Corporation | Aniline derivatived androgen-, glucocorticoid-, mineralcorticoid- and progesterone- receptor modulators |
| FR2860235A1 (fr) * | 2003-09-29 | 2005-04-01 | Yang Ji Chemical Company Ltd | Utilisation d'un compose de formule (i) inhibiteur de l'aromatase a des fins therapeutiques et composes de formule (i) en tant que tels |
| US20060160799A1 (en) | 2004-04-23 | 2006-07-20 | Alekshun Michael N | Transcription factor modulating compounds and methods of use thereof |
| CA2582356A1 (en) | 2004-09-30 | 2006-04-13 | Janssen Pharmaceutica N.V. | Novel benzimidazole derivatives useful as selective androgen receptor modulators (sarms) |
| EP1812406B1 (en) | 2004-09-30 | 2018-09-12 | Janssen Pharmaceutica N.V. | Novel benzimidazole derivatives useful as selective androgen receptor modulators (sarms) |
| WO2007087518A2 (en) * | 2006-01-24 | 2007-08-02 | Janssen Pharmaceutica N.V. | 2-substituted benzimidazoles as selective androgen receptor modulators (sarms) |
| CN101379060B (zh) | 2006-02-10 | 2012-05-23 | 转化技术制药公司 | 作为Aurora激酶抑制剂的苯并唑系衍生物、组合物和使用方法 |
| KR101307497B1 (ko) * | 2006-04-19 | 2013-09-11 | 주식회사 동진쎄미켐 | 디이미다졸계 화합물 및 이를 이용한 유기발광소자 |
| CN100496308C (zh) * | 2006-06-02 | 2009-06-10 | 上海烟草(集团)公司 | 造纸法再造烟叶半逆流多级萃取工艺 |
| EP1992228A1 (en) * | 2007-05-14 | 2008-11-19 | Bayer CropScience AG | Insecticidal substituted thiourea derivatives |
| RU2472788C9 (ru) * | 2007-05-23 | 2013-04-20 | Аллерган, Инк. | (бициклогетероарил)имидазолил)метилгетероарильные соединения как агонисты адренергических рецепторов |
| DE102009038950A1 (de) | 2009-08-26 | 2011-03-03 | Bayer Animal Health Gmbh | Neue antiparasitäre Kombination von Wirkstoffen |
| JP2013540145A (ja) * | 2010-10-21 | 2013-10-31 | ウニベルシテート デス ザールランデス | コルチゾール依存性疾患の治療用の選択的cyp11b1阻害剤 |
| EP2760854B1 (en) * | 2011-09-30 | 2017-08-30 | Asana BioSciences, LLC | Imidazole derivatives as cyp17 inhibitors for the treatment of cancer |
| US9199975B2 (en) | 2011-09-30 | 2015-12-01 | Asana Biosciences, Llc | Biaryl imidazole derivatives for regulating CYP17 |
| KR101884447B1 (ko) * | 2015-07-06 | 2018-08-01 | 삼성에스디아이 주식회사 | 모노머, 유기막 조성물, 유기막, 및 패턴형성방법 |
| US20240417486A1 (en) * | 2021-10-04 | 2024-12-19 | Bolt Biotherapeutics, Inc. | Asymmetric bis-benzimidazole sting agonist immunoconjugates and uses thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR75101B (OSRAM) * | 1980-10-23 | 1984-07-13 | Pfizer | |
| GB8307865D0 (en) * | 1983-03-22 | 1983-04-27 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| EP0178413A1 (en) * | 1984-08-17 | 1986-04-23 | Beecham Group Plc | Benzimidazoles |
-
1987
- 1987-09-08 NZ NZ221729A patent/NZ221729A/xx unknown
- 1987-09-09 EP EP87201702A patent/EP0260744B1/en not_active Expired - Lifetime
- 1987-09-09 DE DE8787201702T patent/DE3783107T2/de not_active Expired - Lifetime
- 1987-09-09 CY CY180387A patent/CY1803A/xx unknown
- 1987-09-09 ES ES87201702T patent/ES2053524T3/es not_active Expired - Lifetime
- 1987-09-14 SU SU874203300A patent/SU1662350A3/ru active
- 1987-09-14 HU HU874071A patent/HU198039B/hu unknown
- 1987-09-14 IL IL83892A patent/IL83892A/xx not_active IP Right Cessation
- 1987-09-14 IE IE248787A patent/IE60514B1/en not_active IP Right Cessation
- 1987-09-14 PT PT85692A patent/PT85692B/pt unknown
- 1987-09-14 JP JP62228679A patent/JPS6485975A/ja active Granted
- 1987-09-14 ZA ZA876881A patent/ZA876881B/xx unknown
- 1987-09-14 PH PH35811A patent/PH25022A/en unknown
- 1987-09-14 CA CA000546763A patent/CA1323366C/en not_active Expired - Lifetime
- 1987-09-14 FI FI873977A patent/FI87781C/fi not_active IP Right Cessation
- 1987-09-14 DK DK198704794A patent/DK174728B1/da not_active IP Right Cessation
- 1987-09-14 AU AU78385/87A patent/AU595064B2/en not_active Expired
- 1987-09-14 NO NO873840A patent/NO167202C/no unknown
- 1987-09-15 KR KR1019870010180A patent/KR960014353B1/ko not_active Expired - Lifetime
- 1987-09-15 CN CN87106423A patent/CN1020903C/zh not_active Expired - Lifetime
-
1993
- 1993-01-21 GR GR930400092T patent/GR3006841T3/el unknown
- 1993-07-15 BG BG097951A patent/BG61321B2/bg unknown
-
1994
- 1994-11-10 HK HK123694A patent/HK123694A/en not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU198039B (en) | Process for production of new substituated derivatives of /1h-imidasole-1-il-methil/-benzimidasole and medical preparatives containing these substances | |
| US4859684A (en) | (1H-imidazol-1-ylmethyl) substituted benzimidazole derivatives and use thereof in treating androgen dependent disorders | |
| DE3884055T2 (de) | (1H-Azol-1-ylmethyl)-substituierte Benzotriazol-Derivate. | |
| EP1554272B1 (en) | Benzimidazoles and benzothiazoles as inhibitors of map kinase | |
| KR0184017B1 (ko) | 이미다조[2,1-b][3]벤즈아제핀 유도체,조성물 및 사용방법 | |
| MX2007013154A (es) | Compuestos heterociclicos fusionados. | |
| US7863310B2 (en) | Kinase inhibitors | |
| US5461050A (en) | Imidazo[1,2-a](pyrrolo, thieno or furano) [3,2a-d]azepine derivatives, compositions and methods of use | |
| US5457102A (en) | Pyrroloimidazolyl and imidazopyridinyl substituted 1H-benzimidazole derivatives | |
| AU668708B2 (en) | Pyrroloimidazolyl and imidazopyridinyl substituted 1H-benzimidazole derivatives | |
| US4943574A (en) | (1H-azol-1-ylmethyl) substituted benzotriazole derivatives and pharmaceutical compositions containing them | |
| WO2008059373A1 (en) | Imidazo [1, 2-a] pyrazine derivatives and their use as acid pump antagonists | |
| EP0426225A2 (en) | (6,7-dihydro-5H-pyrrolo[1,2-c]-imidazol-5-yl)- and (5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl) substituted 1H-benzotriazole derivatives | |
| EP3227282B1 (en) | Novel piperidine derivatives | |
| KR960015004B1 (ko) | (1h-이미다졸-1-일메틸)치환된 벤즈이미다졸 유도체의 제조방법 | |
| US5039677A (en) | 6-(1H-azol-1-ylmethyl)-1-(pyrimidinyloxy)-1H benzotriazoles | |
| HUT78019A (hu) | Eljárás szubsztituált nitrogéntartalmú, heterociklusos vegyületek szintézisére | |
| PH26050A (en) | (1H-azol-1=ylmethyl)substituted benzotriazole derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |