FI73682C - Foerfarande foer framstaellning av antiviralt 9-(1,3-dihydroxi-2-propoximetyl)guanin samt mellanprodukt. - Google Patents
Foerfarande foer framstaellning av antiviralt 9-(1,3-dihydroxi-2-propoximetyl)guanin samt mellanprodukt. Download PDFInfo
- Publication number
- FI73682C FI73682C FI821794A FI821794A FI73682C FI 73682 C FI73682 C FI 73682C FI 821794 A FI821794 A FI 821794A FI 821794 A FI821794 A FI 821794A FI 73682 C FI73682 C FI 73682C
- Authority
- FI
- Finland
- Prior art keywords
- compound
- formula
- propoxymethyl
- dihydroxy
- guanine
- Prior art date
Links
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 title description 21
- 101100148710 Clarkia breweri SAMT gene Proteins 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 98
- 150000003839 salts Chemical class 0.000 claims description 34
- IRSCQMHQWWYFCW-UHFFFAOYSA-N ganciclovir Chemical compound O=C1NC(N)=NC2=C1N=CN2COC(CO)CO IRSCQMHQWWYFCW-UHFFFAOYSA-N 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 18
- -1 1,3 -dihydroxy-2-propoxymethyl Chemical group 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims description 9
- 230000000840 anti-viral effect Effects 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000006239 protecting group Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims description 3
- 230000020176 deacylation Effects 0.000 claims description 2
- 238000005947 deacylation reaction Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 claims 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 2
- 235000012000 cholesterol Nutrition 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 208000015181 infectious disease Diseases 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 208000036142 Viral infection Diseases 0.000 description 6
- 241000700605 Viruses Species 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 150000002431 hydrogen Chemical class 0.000 description 6
- 230000009385 viral infection Effects 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 239000006071 cream Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 241000271566 Aves Species 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- ARLSYSVVBAMYKA-UHFFFAOYSA-N 1,3-bis(phenylmethoxy)propan-2-ol Chemical compound C=1C=CC=CC=1COCC(O)COCC1=CC=CC=C1 ARLSYSVVBAMYKA-UHFFFAOYSA-N 0.000 description 3
- 241000251468 Actinopterygii Species 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000005233 alkylalcohol group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- MHSVUSZEHNVFKW-UHFFFAOYSA-N bis-4-nitrophenyl phosphate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1OP(=O)(O)OC1=CC=C([N+]([O-])=O)C=C1 MHSVUSZEHNVFKW-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- GILZZWCROUGLIS-UHFFFAOYSA-N n-(9-acetyl-6-oxo-3h-purin-2-yl)acetamide Chemical compound N1C(NC(=O)C)=NC(=O)C2=C1N(C(C)=O)C=N2 GILZZWCROUGLIS-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000700723 Ictalurid herpesvirus 1 Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000005852 acetolysis reaction Methods 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000004113 cell culture Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000010255 intramuscular injection Methods 0.000 description 2
- 239000007927 intramuscular injection Substances 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000007928 intraperitoneal injection Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000001301 oxygen Chemical group 0.000 description 2
- 229910052760 oxygen Chemical group 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003797 solvolysis reaction Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical group CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 241001529453 unidentified herpesvirus Species 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- QHHLLMASUBEZEZ-UHFFFAOYSA-N 1,3-bis(phenylmethoxy)propan-2-yloxymethyl acetate Chemical compound C=1C=CC=CC=1COCC(OCOC(=O)C)COCC1=CC=CC=C1 QHHLLMASUBEZEZ-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 229930024421 Adenine Natural products 0.000 description 1
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 201000004569 Blindness Diseases 0.000 description 1
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000701022 Cytomegalovirus Species 0.000 description 1
- 239000006145 Eagle's minimal essential medium Substances 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 208000001860 Eye Infections Diseases 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 208000005100 Herpetic Keratitis Diseases 0.000 description 1
- 241000701074 Human alphaherpesvirus 2 Species 0.000 description 1
- 241000701085 Human alphaherpesvirus 3 Species 0.000 description 1
- 241000701044 Human gammaherpesvirus 4 Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 208000006758 Marek Disease Diseases 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 description 1
- 208000010359 Newcastle Disease Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000201940 Oena Species 0.000 description 1
- 206010073938 Ophthalmic herpes simplex Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 241000700584 Simplexvirus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- GDBPXOZUOLBXAR-UHFFFAOYSA-N [2-(chloromethoxy)-3-phenylmethoxypropoxy]methylbenzene Chemical compound C=1C=CC=CC=1COCC(OCCl)COCC1=CC=CC=C1 GDBPXOZUOLBXAR-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 229960000643 adenine Drugs 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000006515 benzyloxy alkyl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000011449 brick Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 1
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 1
- 229940043253 butylated hydroxyanisole Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- CEALXSHFPPCRNM-UHFFFAOYSA-L disodium;carboxylato carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OC([O-])=O CEALXSHFPPCRNM-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- XUFQPHANEAPEMJ-UHFFFAOYSA-N famotidine Chemical group NC(N)=NC1=NC(CSCCC(N)=NS(N)(=O)=O)=CS1 XUFQPHANEAPEMJ-UHFFFAOYSA-N 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000012737 fresh medium Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 201000010884 herpes simplex virus keratitis Diseases 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- DUCKXCGALKOSJF-UHFFFAOYSA-N pentanoyl pentanoate Chemical compound CCCCC(=O)OC(=O)CCCC DUCKXCGALKOSJF-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/18—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 one oxygen and one nitrogen atom, e.g. guanine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/20—Antivirals for DNA viruses
- A61P31/22—Antivirals for DNA viruses for herpes viruses
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Virology (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biotechnology (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US26721081 | 1981-05-21 | ||
| US06267210 US4355032B2 (en) | 1981-05-21 | 1981-05-21 | 9-(1,3-dihydroxy-2-propoxymethyl)guanine as antiviral agent |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI821794A0 FI821794A0 (fi) | 1982-05-20 |
| FI73682B FI73682B (fi) | 1987-07-31 |
| FI73682C true FI73682C (fi) | 1987-11-09 |
Family
ID=23017790
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI821794A FI73682C (fi) | 1981-05-21 | 1982-05-20 | Foerfarande foer framstaellning av antiviralt 9-(1,3-dihydroxi-2-propoximetyl)guanin samt mellanprodukt. |
Country Status (33)
| Country | Link |
|---|---|
| US (1) | US4355032B2 (enExample) |
| EP (1) | EP0066208B1 (enExample) |
| JP (2) | JPS57203086A (enExample) |
| KR (1) | KR890004663B1 (enExample) |
| AR (1) | AR244227A1 (enExample) |
| AT (1) | ATE15899T1 (enExample) |
| AU (1) | AU572086B2 (enExample) |
| BR (1) | BR8202931A (enExample) |
| CA (3) | CA1305139C (enExample) |
| CS (4) | CS235044B2 (enExample) |
| DD (2) | DD203052A5 (enExample) |
| DE (1) | DE3266644D1 (enExample) |
| DK (2) | DK150304C (enExample) |
| ES (7) | ES8404355A1 (enExample) |
| FI (1) | FI73682C (enExample) |
| GR (1) | GR76459B (enExample) |
| HK (1) | HK67088A (enExample) |
| HU (2) | HU186514B (enExample) |
| IE (1) | IE53731B1 (enExample) |
| IL (1) | IL65836A (enExample) |
| IN (1) | IN156469B (enExample) |
| LU (1) | LU88334I2 (enExample) |
| MY (1) | MY8700793A (enExample) |
| NL (2) | NL930022I1 (enExample) |
| NO (2) | NO161740C (enExample) |
| NZ (1) | NZ200691A (enExample) |
| PH (1) | PH17975A (enExample) |
| PL (4) | PL136004B1 (enExample) |
| PT (1) | PT74934B (enExample) |
| RO (2) | RO84860B (enExample) |
| SG (1) | SG81687G (enExample) |
| SU (1) | SU1176841A3 (enExample) |
| ZA (1) | ZA823532B (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5157120A (en) * | 1980-09-16 | 1992-10-20 | Syntex (U.S.A.) Inc. | Guanine derivatives |
| US4347360A (en) * | 1980-09-16 | 1982-08-31 | Ens Bio Logicals Inc. | Ring open nucleoside analogues |
| US4508898A (en) * | 1980-09-16 | 1985-04-02 | Ogilvie Kelvin K | Antiviral triazine compounds |
| US4423050A (en) * | 1981-05-21 | 1983-12-27 | Syntex (U.S.A.) Inc. | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent |
| US4507305A (en) * | 1981-05-21 | 1985-03-26 | Syntex (U.S.A.) Inc. | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent |
| DE3278501D1 (en) * | 1981-08-11 | 1988-06-23 | Wellcome Found | Antiviral compounds |
| NZ201662A (en) * | 1981-08-26 | 1986-07-11 | Merck & Co Inc | 9-(1,3-(and 2,3)-dihydroxy-1-(and 2)-propoxy-methyl)guanine derivatives and methods for their preparation |
| IE830186L (en) * | 1982-02-01 | 1983-08-01 | Syntex Inc | Purines |
| US5250535A (en) * | 1982-02-01 | 1993-10-05 | Syntex Inc. | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent |
| US4902678A (en) * | 1982-02-12 | 1990-02-20 | Syntex (U.S.A.) Inc. | Anti-viral compositions |
| US4609662A (en) * | 1982-10-14 | 1986-09-02 | Burroughs Wellcome Co. | Method for using purine derivatives |
| US4462986A (en) * | 1982-11-04 | 1984-07-31 | Ens Bio Logicals, Inc. | Synergistic anti-herpes compositions |
| US4814335A (en) * | 1982-12-30 | 1989-03-21 | Biomeasure, Incorporated | Antiviral compounds |
| US4461757A (en) * | 1983-02-23 | 1984-07-24 | Ens Bio Logicals Inc. | Dimethylaminomethylenated anti-herpes compounds |
| US5047533A (en) * | 1983-05-24 | 1991-09-10 | Sri International | Acyclic purine phosphonate nucleotide analogs |
| US4880820A (en) * | 1983-06-24 | 1989-11-14 | Merck & Co., Inc. | Guanine derivatives |
| GB8320308D0 (en) * | 1983-07-28 | 1983-09-01 | Wellcome Found | Antiviral combinations |
| EP0138683A3 (en) * | 1983-09-30 | 1988-01-20 | Merck & Co. Inc. | Purine derivatives, their application in anti-viral compositions |
| US4897479A (en) * | 1983-09-30 | 1990-01-30 | Merck & Co., Inc. | Arylsulfonyloxy purine intermediates |
| IE842642L (en) * | 1983-10-31 | 1985-04-30 | Harvard College | Purine Derivatives |
| US4806642A (en) * | 1984-10-05 | 1989-02-21 | Warner-Lambert Company | Purine derivatives |
| IL73682A (en) * | 1983-12-20 | 1991-08-16 | Medivir Ab | Antiviral pharmaceutical compositions containing 9-hydroxy aliphatic derivatives of guanine,some new such derivatives and process for their preparation |
| US4621140A (en) * | 1984-02-23 | 1986-11-04 | Syntex (U.S.A.) Inc. | Process for preparing 2,6-substituted-9-(1,3-dihydroxy-2-propoxymethyl)-purines and certain derivatives |
| US4579849A (en) * | 1984-04-06 | 1986-04-01 | Merck & Co., Inc. | N-alkylguanine acyclonucleosides as antiviral agents |
| EP0190123A1 (en) * | 1984-07-20 | 1986-08-13 | GAUNTT, Charles, O. | Immunoregulatory and anti-viral compound |
| DE3583858D1 (de) * | 1984-12-12 | 1991-09-26 | Syntex Inc | Derivate von alcoxymethylaether und alcoxymethylester. |
| SE8406538D0 (sv) | 1984-12-21 | 1984-12-21 | Astra Laekemedel Ab | Novel derivatives of purine |
| US4642346A (en) * | 1985-06-24 | 1987-02-10 | Syntex (U.S.A.) Inc. | Anhydrous crystalline 9-(1,3-dihydroxy-2-propoxymethyl)guanine |
| US4863927A (en) * | 1987-05-11 | 1989-09-05 | Merck & Co., Inc. | 1-(2-hydroxymethyl)cycloalkylmethyl)-5-substituted uracils |
| DE10299039I1 (de) * | 1988-12-19 | 2003-02-20 | Wellcome Found | Antivirale Pyrimidin- und Purinverbindungen Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Praeparte |
| US5068119A (en) * | 1990-09-28 | 1991-11-26 | Nabisco Brands, Inc. | Acid-hydrolyzable ester derivatives as low calorie fat mimetics |
| GB2260319B (en) | 1991-10-07 | 1995-12-06 | Norsk Hydro As | Acyl derivatives of nucleosides and nucleoside analogues having anti-viral activity |
| WO1995000515A1 (en) * | 1993-06-23 | 1995-01-05 | Merrell Pharmaceuticals Inc. | Carbo-acyclic nucleoside derivatives as antiviral and antineoplastic agents |
| US5840891A (en) * | 1994-07-28 | 1998-11-24 | Syntex (U.S.A.) Inc. | 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol derivative |
| US5543414A (en) * | 1994-07-28 | 1996-08-06 | Syntex (Usa) Inc. | Achiral amino acid acyl esters of ganciclovir and its derivatives |
| US5565565A (en) | 1994-08-04 | 1996-10-15 | Syntex (U.S.A.) Inc. | Preparation of N-9 substituted guanine compounds |
| US5627185A (en) * | 1994-11-23 | 1997-05-06 | Gosselin; Gilles | Acyclovir derivatives as antiviral agents |
| US5840763A (en) * | 1994-12-12 | 1998-11-24 | Smithkline Beecham Plc | Treatment of a latent infection of herpes viruses |
| DE19536164A1 (de) * | 1995-09-28 | 1997-04-03 | Boehringer Ingelheim Kg | Verbessertes Verfahren zur Herstellung von 9-[(2-Hyroxyethoxy)methyl]guanin (Acyclovir) |
| US5700936A (en) * | 1996-01-26 | 1997-12-23 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol valinate |
| US5756736A (en) * | 1996-01-26 | 1998-05-26 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| US6040446A (en) | 1996-01-26 | 2000-03-21 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol derivative |
| US5840890A (en) * | 1996-01-26 | 1998-11-24 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| IN179493B (enExample) * | 1996-02-22 | 1997-10-11 | Lupin Laboraties Ltd | |
| EP0806425B1 (en) * | 1996-04-09 | 2001-08-29 | Lupin Laboratories Limited | An improved regiospecific process for synthesis of acyclic nucleosides |
| US5852208A (en) * | 1996-08-30 | 1998-12-22 | Dixie Chemical Company, Inc. | Method of producing compounds containing acyloxyalkoxy groups from alcohols |
| CN1091445C (zh) * | 1999-12-29 | 2002-09-25 | 湖北省医药工业研究院 | 抗病毒药物中间体、它们的制备及应用 |
| EP2316469A1 (en) | 2002-02-22 | 2011-05-04 | Shire LLC | Delivery system and methods for protecting and administering dextroamphetamine |
| EP1556050A1 (en) * | 2002-10-22 | 2005-07-27 | Ranbaxy Laboratories Limited | Pharmaceutical compositions of ganciclovir |
| US20060142574A1 (en) * | 2002-10-31 | 2006-06-29 | Babu Jayachandra S | Process for the preparation of ganciclovir |
| US7078524B2 (en) * | 2002-11-22 | 2006-07-18 | Ranbaxy Laboratories Limited | Process for the synthesis of ganciclovir |
| US20060234982A1 (en) * | 2003-01-14 | 2006-10-19 | Dahl Terrence C | Compositions and methods for combination antiviral therapy |
| ITMI20031202A1 (it) * | 2003-06-13 | 2004-12-14 | Lyogen Ltd | Forma di cristallina del ganciclovir |
| RU2006109365A (ru) * | 2003-08-28 | 2007-10-10 | Рэнбакси Лабораториз Лимитед (In) | Аморфный гидрохлорид валганцикловира |
| JP4746866B2 (ja) * | 2004-11-19 | 2011-08-10 | Tcm株式会社 | キャリッジ用ガタ抑制装置 |
| TWI375560B (en) | 2005-06-13 | 2012-11-01 | Gilead Sciences Inc | Composition comprising dry granulated emtricitabine and tenofovir df and method for making the same |
| TWI471145B (zh) | 2005-06-13 | 2015-02-01 | Bristol Myers Squibb & Gilead Sciences Llc | 單一式藥學劑量型 |
| EP2085397A1 (en) | 2008-01-21 | 2009-08-05 | Esteve Quimica, S.A. | Crystalline form of abacavir |
| US20110059921A1 (en) * | 2008-03-27 | 2011-03-10 | Ektar Therapeutics | Oligomer-Nitrogenous Base Conjugates |
| US8173621B2 (en) | 2008-06-11 | 2012-05-08 | Gilead Pharmasset Llc | Nucleoside cyclicphosphates |
| MX2011006891A (es) * | 2008-12-23 | 2011-10-06 | Pharmasset Inc | Fosforamidatos de nucleosidos. |
| EA019295B1 (ru) | 2008-12-23 | 2014-02-28 | Джилид Фармассет, Ллс. | Соединения пуриновых нуклеозидов и способ их получения |
| CA2748034A1 (en) * | 2008-12-23 | 2010-07-01 | Pharmasset, Inc. | Purified 2'-deoxy'2'-fluoro-2'-c-methyl-nucleoside-phosphoramidate prodrugs for the treatment of viral infections |
| CN101851239B (zh) * | 2009-04-03 | 2012-11-28 | 上海益威实业有限公司 | 一种更昔洛韦的回收方法 |
| SG184323A1 (en) | 2010-03-31 | 2012-11-29 | Gilead Pharmasett Llc | Stereoselective synthesis of phosphorus containing actives |
| WO2012154698A2 (en) * | 2011-05-06 | 2012-11-15 | Mckenna Charles E | Method to improve antiviral activity of nucleotide analogue drugs |
| CN102627643B (zh) * | 2012-04-10 | 2014-01-08 | 常州康丽制药有限公司 | 更昔洛韦的精制方法 |
| US9227990B2 (en) | 2012-10-29 | 2016-01-05 | Cipla Limited | Antiviral phosphonate analogues and process for preparation thereof |
| WO2014070976A1 (en) * | 2012-11-03 | 2014-05-08 | Boehringer Ingelheim International Gmbh | Inhibitors of cytomegalovirus |
| CN103059023B (zh) * | 2012-12-31 | 2015-09-30 | 浙江车头制药股份有限公司 | 一种制备更昔洛韦晶型ⅱ的方法 |
| US9486530B1 (en) | 2013-08-30 | 2016-11-08 | Exela Pharma Sciences, LLC | Ganciclovir compositions and related methods |
| US20230218644A1 (en) | 2020-04-16 | 2023-07-13 | Som Innovation Biotech, S.A. | Compounds for use in the treatment of viral infections by respiratory syndrome-related coronavirus |
| CN113476413B (zh) * | 2021-08-09 | 2022-06-28 | 海南海灵化学制药有限公司 | 一种注射用更昔洛韦钠冻干粉的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4199574A (en) * | 1974-09-02 | 1980-04-22 | Burroughs Wellcome Co. | Methods and compositions for treating viral infections and guanine acyclic nucleosides |
| GB1523865A (en) * | 1974-09-02 | 1978-09-06 | Wellcome Found | Purine compunds and salts thereof |
| US4060616A (en) * | 1976-03-01 | 1977-11-29 | Burroughs Wellcome Co. | Purine derivatives with repeating unit |
| US4221910A (en) * | 1978-09-15 | 1980-09-09 | Newport Pharmaceuticals International, Inc. | 9-(Hydroxy alkyl)purines |
| US4347360A (en) * | 1980-09-16 | 1982-08-31 | Ens Bio Logicals Inc. | Ring open nucleoside analogues |
| AU7938482A (en) * | 1980-12-22 | 1982-07-20 | Astra Lakemedel Aktiebolag | Novel derivatives of guanine |
| DE3278501D1 (en) * | 1981-08-11 | 1988-06-23 | Wellcome Found | Antiviral compounds |
-
1981
- 1981-05-21 US US06267210 patent/US4355032B2/en not_active Expired - Lifetime
-
1982
- 1982-05-19 AT AT82104433T patent/ATE15899T1/de active
- 1982-05-19 NO NO821676A patent/NO161740C/no not_active IP Right Cessation
- 1982-05-19 DK DK227782A patent/DK150304C/da not_active IP Right Cessation
- 1982-05-19 EP EP82104433A patent/EP0066208B1/en not_active Expired
- 1982-05-19 DE DE8282104433T patent/DE3266644D1/de not_active Expired
- 1982-05-20 IN IN564/CAL/82A patent/IN156469B/en unknown
- 1982-05-20 HU HU821614A patent/HU186514B/hu unknown
- 1982-05-20 IL IL65836A patent/IL65836A/xx not_active IP Right Cessation
- 1982-05-20 PL PL1982242101A patent/PL136004B1/pl unknown
- 1982-05-20 RO RO107610A patent/RO84860B/ro unknown
- 1982-05-20 RO RO82112367A patent/RO87387A/ro unknown
- 1982-05-20 PL PL1982242100A patent/PL136637B1/pl unknown
- 1982-05-20 CA CA000403368A patent/CA1305139C/en not_active Expired - Lifetime
- 1982-05-20 NZ NZ200691A patent/NZ200691A/en unknown
- 1982-05-20 GR GR68199A patent/GR76459B/el unknown
- 1982-05-20 FI FI821794A patent/FI73682C/fi not_active IP Right Cessation
- 1982-05-20 CS CS834404A patent/CS235044B2/cs unknown
- 1982-05-20 CS CS834403A patent/CS235043B2/cs unknown
- 1982-05-20 AU AU83892/82A patent/AU572086B2/en not_active Expired
- 1982-05-20 BR BR8202931A patent/BR8202931A/pt unknown
- 1982-05-20 AR AR82289466A patent/AR244227A1/es active
- 1982-05-20 ES ES512414A patent/ES8404355A1/es not_active Expired
- 1982-05-20 KR KR8202204A patent/KR890004663B1/ko not_active Expired
- 1982-05-20 CS CS834402A patent/CS235042B2/cs unknown
- 1982-05-20 PH PH27320A patent/PH17975A/en unknown
- 1982-05-20 HU HU844011A patent/HU188000B/hu unknown
- 1982-05-20 PT PT74934A patent/PT74934B/pt unknown
- 1982-05-20 IE IE1210/82A patent/IE53731B1/en active Protection Beyond IP Right Term
- 1982-05-20 SU SU823443852A patent/SU1176841A3/ru active
- 1982-05-20 PL PL1982246770A patent/PL136579B1/pl unknown
- 1982-05-20 CA CA000495721A patent/CA1305140C/en not_active Expired - Lifetime
- 1982-05-20 CA CA000604470A patent/CA1305141C/en not_active Expired - Lifetime
- 1982-05-20 PL PL1982236521A patent/PL136332B1/pl unknown
- 1982-05-20 JP JP57085655A patent/JPS57203086A/ja active Granted
- 1982-05-20 CS CS823735A patent/CS235018B2/cs unknown
- 1982-05-21 ZA ZA823532A patent/ZA823532B/xx unknown
- 1982-05-21 DD DD82240075A patent/DD203052A5/de not_active IP Right Cessation
- 1982-05-21 DD DD82256251A patent/DD213218A5/de not_active IP Right Cessation
-
1983
- 1983-03-22 ES ES520849A patent/ES520849A0/es active Granted
- 1983-08-12 ES ES524900A patent/ES524900A0/es active Granted
- 1983-08-12 ES ES524899A patent/ES524899A0/es active Granted
- 1983-11-03 DK DK504183A patent/DK149001C/da not_active IP Right Cessation
-
1984
- 1984-02-01 ES ES529383A patent/ES8606869A1/es not_active Expired
- 1984-02-01 ES ES529384A patent/ES8701496A1/es not_active Expired
- 1984-06-28 ES ES533821A patent/ES8505681A1/es not_active Expired
-
1987
- 1987-10-09 SG SG816/87A patent/SG81687G/en unknown
- 1987-12-30 MY MY793/87A patent/MY8700793A/xx unknown
-
1988
- 1988-08-25 HK HK670/88A patent/HK67088A/en not_active IP Right Cessation
-
1991
- 1991-04-16 JP JP3084045A patent/JPH04217983A/ja active Granted
-
1993
- 1993-03-23 NL NL9300022C patent/NL930022I1/nl unknown
- 1993-06-24 LU LU88334C patent/LU88334I2/fr unknown
- 1993-07-01 NL NL930139C patent/NL930139I2/nl unknown
-
1994
- 1994-07-29 NO NO1994005C patent/NO1994005I1/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI73682C (fi) | Foerfarande foer framstaellning av antiviralt 9-(1,3-dihydroxi-2-propoximetyl)guanin samt mellanprodukt. | |
| DE69232568T2 (de) | Cyclische Harnstoffe und Analoga verwendbar als retrovirale Proteasehemmer | |
| FI79851C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla substituerade 9-(1,3-diacyloxi-2-propoxmetyl) puriner. | |
| KR880000204B1 (ko) | 설포닐 우레아 유도체 | |
| US4423050A (en) | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent | |
| FI74006C (fi) | Foerfarande foer framstaellning av antivirala substituerade 9(1-0- eller 3-0-monosubstituerad- eller 1,3-di-0-substituerad propoximetyl)guaniiner. | |
| GB2073752A (en) | 2,6-diaminobularines | |
| WO1991017164A1 (de) | Neue pyridazine | |
| FI66866B (fi) | Foerfarande foer framstaellning av antiproliferativa 2,4-diamino-6-(dialkoxibensyl)pyrido(2,3-d)pyrimidiner | |
| US4147805A (en) | Alkylthiophenoxyalkylamines and the pharmaceutical use thereof | |
| US4027025A (en) | 8-Azapurine derivatives | |
| US4603219A (en) | 1,3-dibenzyloxy-2-acetoxymethoxypropane, intermediate for 9-(1,3-dihydroxy-2-propoxymethyl)guanine | |
| DE69403695T2 (de) | Indol-sulfonamide als Antitumormittel | |
| US4507305A (en) | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent | |
| EP0180500A1 (fr) | Dérivés de thiéno et furo - [2,3-c]pyrroles, procédés de préparation et médicaments les contenant | |
| KR890004197B1 (ko) | 티아디아졸 항비루스제 | |
| US3892860A (en) | 4,6-Diaryl-pyrimidin-2(1H)-ones as sleep-inducers | |
| US3366660A (en) | Dibenzo cycloheptene thioiminoesters | |
| KR100290533B1 (ko) | 항바이러스 활성을 가지는 2-아미노퓨린 | |
| KR810001651B1 (ko) | 7-(치환된)-7H-피롤로[3, 2-f]퀴나졸린-1, 3-디아민 유도체의 제조방법 | |
| JPH0157114B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ND | Supplementary protection certificate (spc) granted | ||
| SPCG | Supplementary protection certificate granted |
Spc suppl protection certif: L3 Extension date: 20030615 |
|
| MA | Patent expired |
Owner name: SYNTEX (U.S.A.) INC. |