DE2734070C2 - Aminoalkylfuranderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel - Google Patents
Aminoalkylfuranderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende ArzneimittelInfo
- Publication number
- DE2734070C2 DE2734070C2 DE2734070A DE2734070A DE2734070C2 DE 2734070 C2 DE2734070 C2 DE 2734070C2 DE 2734070 A DE2734070 A DE 2734070A DE 2734070 A DE2734070 A DE 2734070A DE 2734070 C2 DE2734070 C2 DE 2734070C2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- compound
- formula
- chno
- furanyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 50
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 8
- 230000008569 process Effects 0.000 title claims description 7
- 239000003814 drug Substances 0.000 title claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 12
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- -1 2-mercaptoethyl Chemical group 0.000 claims description 10
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000004480 active ingredient Substances 0.000 description 19
- 150000001412 amines Chemical class 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 210000002784 stomach Anatomy 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 9
- 229960001340 histamine Drugs 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 230000009858 acid secretion Effects 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000002674 ointment Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 4
- 241001440269 Cutina Species 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 238000006683 Mannich reaction Methods 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000027119 gastric acid secretion Effects 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- IDEZECZCLMOIJN-ONEGZZNKSA-N (2e)-2-(nitromethylidene)-1,3-thiazolidine Chemical compound [O-][N+](=O)\C=C1/NCCS1 IDEZECZCLMOIJN-ONEGZZNKSA-N 0.000 description 3
- JFGCGQJHMUYGLU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)O1 JFGCGQJHMUYGLU-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-DCSYEGIMSA-N Beta-Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-DCSYEGIMSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical class [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000007939 sustained release tablet Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- LARJDTRRRDBHNV-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n-methyl-2-nitroethane-1,1-diamine Chemical compound [O-][N+](=O)CC(NC)NCCSCC1=CC=C(CN(C)C)O1 LARJDTRRRDBHNV-UHFFFAOYSA-N 0.000 description 2
- ZFFTZDQKIXPDAF-UHFFFAOYSA-N 2-Furanmethanethiol Chemical compound SCC1=CC=CO1 ZFFTZDQKIXPDAF-UHFFFAOYSA-N 0.000 description 2
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229960002242 chlorocresol Drugs 0.000 description 2
- 229940097265 cysteamine hydrochloride Drugs 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 230000001804 emulsifying effect Effects 0.000 description 2
- 210000003238 esophagus Anatomy 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 2
- 229960000582 mepyramine Drugs 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 230000010412 perfusion Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- NXGHEDHQXXXTTP-UHFFFAOYSA-N 1,1-bis(methylsulfanyl)-2-nitroethene Chemical group CSC(SC)=C[N+]([O-])=O NXGHEDHQXXXTTP-UHFFFAOYSA-N 0.000 description 1
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical class C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 1
- GANBJDIOIDQSGI-UHFFFAOYSA-N 2-(chloromethyl)furan Chemical compound ClCC1=CC=CO1 GANBJDIOIDQSGI-UHFFFAOYSA-N 0.000 description 1
- ZZDILASZIABWOY-UHFFFAOYSA-N 2-[2-(furan-2-ylmethylsulfanyl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCSCC1=CC=CO1 ZZDILASZIABWOY-UHFFFAOYSA-N 0.000 description 1
- VCCTWUFHIQYYHA-UHFFFAOYSA-N 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]isoindole-1,3-dione Chemical compound O1C(CN(C)C)=CC=C1CSCCN1C(=O)C2=CC=CC=C2C1=O VCCTWUFHIQYYHA-UHFFFAOYSA-N 0.000 description 1
- SPCAMUHZAISWDN-UHFFFAOYSA-N 2-[[1-(methylamino)-2-nitroethyl]amino]ethanethiol Chemical compound SCCNC(C[N+](=O)[O-])NC SPCAMUHZAISWDN-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- HOCPDSKONPQIQM-UHFFFAOYSA-N 4-(2-bromoethyl)isoindole-1,3-dione Chemical compound BrCCC1=CC=CC2=C1C(=O)NC2=O HOCPDSKONPQIQM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241001631457 Cannula Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- FPBPLBWLMYGIQR-UHFFFAOYSA-N Metiamide Chemical compound CNC(=S)NCCSCC=1N=CNC=1C FPBPLBWLMYGIQR-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 210000003815 abdominal wall Anatomy 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 229960004977 anhydrous lactose Drugs 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000011928 denatured alcohol Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- CJYQQUPRURWLOW-YDLUHMIOSA-M dmsc Chemical compound [Na+].OP(=O)=O.OP(=O)=O.OP(=O)=O.[O-]P(=O)=O.O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]1[C@H]2O CJYQQUPRURWLOW-YDLUHMIOSA-M 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Substances OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000007031 hydroxymethylation reaction Methods 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 229960001669 kinetin Drugs 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229960003151 mercaptamine Drugs 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229950003251 metiamide Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/34—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having five-membered rings with one oxygen as the only ring hetero atom, e.g. isosorbide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/64—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB32465/76A GB1565966A (en) | 1976-08-04 | 1976-08-04 | Aminoalkyl furan derivatives |
| GB5068576 | 1976-12-06 | ||
| GB2018777 | 1977-05-13 | ||
| GB28187/78A GB1565967A (en) | 1976-08-04 | 1977-07-22 | Aminoalkyl furan derivatives |
| KR7701808A KR810000355B1 (ko) | 1977-05-13 | 1977-08-04 | 아미노 알킬푸란 유도체의 제조방법 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2734070A1 DE2734070A1 (de) | 1978-02-09 |
| DE2734070C2 true DE2734070C2 (de) | 1983-12-29 |
Family
ID=27516213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2734070A Expired DE2734070C2 (de) | 1976-08-04 | 1977-07-28 | Aminoalkylfuranderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
Country Status (10)
| Country | Link |
|---|---|
| US (3) | US4128658A (OSRAM) |
| JP (3) | JPS5840956B2 (OSRAM) |
| AU (1) | AU515628B2 (OSRAM) |
| BE (1) | BE857388A (OSRAM) |
| CA (1) | CA1099268A (OSRAM) |
| DE (1) | DE2734070C2 (OSRAM) |
| FR (3) | FR2360587B1 (OSRAM) |
| GB (2) | GB1565966A (OSRAM) |
| LU (1) | LU77911A1 (OSRAM) |
| NL (1) | NL178320C (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3915347A1 (de) * | 1988-05-11 | 1989-11-16 | Glaxo Group Ltd | Harzadsorbat und verfahren zu seiner herstellung |
| DE3923638A1 (de) * | 1988-07-18 | 1990-03-01 | Glaxo Group Ltd | Furanderivate |
| DE3546858C2 (de) * | 1984-06-15 | 1995-04-20 | Glaxo Group Ltd | Verfahren zur Herstellung von Ranitidin |
Families Citing this family (166)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5021429A (en) * | 1977-05-17 | 1991-06-04 | Allen & Hansburys Limited | Pharmacologically active aminoalkylphenyl compounds and their use |
| GB1601459A (en) * | 1977-05-17 | 1981-10-28 | Allen & Hanburys Ltd | Aminoalkyl thiophene derivatives |
| JPS5444660A (en) * | 1977-08-29 | 1979-04-09 | Yamanouchi Pharmaceut Co Ltd | Heterocyclic compound and its preparation |
| NZ188625A (en) * | 1977-10-11 | 1981-03-16 | Glaxo Group Ltd | Furan derivatives and pharmaceutical compositions containing them |
| US4233302A (en) * | 1977-12-23 | 1980-11-11 | Glaxo Group Limited | Amine derivatives and pharmaceutical compositions containing them |
| US4539207A (en) * | 1978-02-13 | 1985-09-03 | Smith Kline & French Laboratories Limited | Pyrimidine compounds |
| IN151188B (OSRAM) * | 1978-02-13 | 1983-03-05 | Smith Kline French Lab | |
| AR228941A1 (es) | 1978-04-26 | 1983-05-13 | Glaxo Group Ltd | Procedimiento para preparar nuevos derivados de 3,5-diamino-1,2,4-triazol que son activos contra receptores histaminicos |
| IL57415A (en) * | 1978-05-30 | 1984-08-31 | Smith Kline French Lab | Nitropyrrole compounds,process for preparing them and pharmaceutical compositions containing them |
| IL57416A (en) * | 1978-05-30 | 1983-03-31 | Smith Kline French Lab | Nitro compounds,processes for preparing them and compositions containing them |
| US4405624A (en) * | 1978-05-30 | 1983-09-20 | Smith Kline & French Laboratories Limited | Nitro-substituted dihydropyrroles and tetrahydropyridines, compositions, compounds, and medicinal use |
| US4584384A (en) * | 1978-05-30 | 1986-04-22 | Smith Kline & French Laboratories Limited | Nitro pyrroles |
| ZA793443B (en) * | 1978-07-26 | 1980-12-31 | Glaxo Group Ltd | Heterocyclic derivatives |
| US4200760A (en) * | 1978-09-26 | 1980-04-29 | Bristol-Myers Company | Imidazolylalkylthioalkylamino-ethylene derivatives |
| US4203909A (en) * | 1978-09-26 | 1980-05-20 | Bristol-Myers Company | Furan compounds |
| FR2446829A1 (fr) * | 1978-11-16 | 1980-08-14 | Glaxo Group Ltd | Derives de polymethylene disubstitues en alpha, omega, procede pour leur preparation et compositions pharmaceutiques les contenant |
| US4282363A (en) * | 1978-11-24 | 1981-08-04 | Bristol-Myers Company | 1-Nitro-2-(2-alkynylamino)-2-[(2-pyridylmethylthio)-ethylamino]ethylene derivatives |
| CA1159453A (en) * | 1979-03-02 | 1983-12-27 | John W. Clitherow | Heterocyclic derivatives |
| JPS55120571A (en) * | 1979-03-02 | 1980-09-17 | Glaxo Group Ltd | Heterocyclic derivative |
| ZA801151B (en) * | 1979-03-02 | 1981-02-25 | Glaxo Group Ltd | Heterocyclic derivatives |
| US4220654A (en) * | 1979-06-04 | 1980-09-02 | Merck & Co., Inc. | Cyclic imidazole cyanoguanidines |
| US4293557A (en) * | 1979-07-03 | 1981-10-06 | Teikoku Hormone Mfg. Co., Ltd. | Antiulcer phenoxypropylamine derivatives |
| JPS5610175A (en) * | 1979-07-06 | 1981-02-02 | Fujisawa Pharmaceut Co Ltd | Preparation of imidazole derivative |
| EP0028483B1 (en) * | 1979-10-22 | 1984-04-18 | Glaxo Group Limited | 1,2,4-triazole derivatives, processes for the preparation thereof and pharmaceutical compositions containing them |
| AU539189B2 (en) * | 1979-10-22 | 1984-09-13 | Glaxo Group Limited | 1h-1,2,4-triazole derivatives |
| US4238487A (en) * | 1979-10-31 | 1980-12-09 | Merck & Co., Inc. | Aminoalkyl benzofuran derivatives |
| JPS5681578A (en) * | 1979-12-07 | 1981-07-03 | Shionogi & Co Ltd | Novel thioalkyl amide derivative |
| US4239908A (en) * | 1979-12-10 | 1980-12-16 | G.D. Searle & Co. | N-aralkenyl-N'-cyano-N"-(heterocyclylthioalkyl)-guanidines |
| US4431802A (en) * | 1979-12-10 | 1984-02-14 | G. D. Searle & Co. | N-Heterocyclyl-N-cyano-N-(heterocyclythioalkyl)-guanidines |
| CA1181084A (en) * | 1980-01-08 | 1985-01-15 | Glaxo Group Limited | Process for the preparation of a furan derivative |
| PT72320B (en) * | 1980-01-08 | 1982-07-23 | Glaxo Group Ltd | Process for preparation of a furan derivative |
| CA1171096A (en) * | 1980-01-08 | 1984-07-17 | Glaxo Group Limited | Process for the preparation of a furan derivative |
| YU53681A (en) * | 1980-03-08 | 1983-12-31 | Smith Kline French Lab | Process for obtaining 5-dimethylamino-methyl-2-furane methanol |
| CA1155842A (en) * | 1980-03-29 | 1983-10-25 | Thomas H. Brown | Compounds |
| US4491586A (en) * | 1980-06-05 | 1985-01-01 | Glaxo Group Limited | Amine derivatives |
| US4394508A (en) * | 1980-06-07 | 1983-07-19 | Bristol-Myers Company | Chemical compounds |
| IL63968A (en) * | 1980-10-01 | 1985-10-31 | Glaxo Group Ltd | Form 2 ranitidine hydrochloride,its preparation and pharmaceutical compositions containing it |
| AT407956B (de) * | 1980-10-01 | 2001-07-25 | Glaxo Group Ltd | Verfahren zur herstellung eines arzneimittels |
| US4607107A (en) * | 1980-10-01 | 1986-08-19 | Smith Kline & French Laboratories Ltd. | (4-aminoalkyl-2-pyridyl alkyl)guanidines |
| US4760075A (en) * | 1980-10-02 | 1988-07-26 | Eli Lilly And Company | N-thiazolylmethylthioalkyl-N-alkyl-amidines and related compounds |
| US4904792A (en) * | 1980-10-02 | 1990-02-27 | Eli Lilly And Company | N-thiazolymethylthioalkyl-N'-alkylamidines and related compounds |
| US4490533A (en) * | 1980-12-22 | 1984-12-25 | Merck & Co., Inc. | Aminoalkyl pyridine derivatives |
| EP0055626B1 (en) * | 1980-12-30 | 1985-05-02 | Glaxo Group Limited | Process for the preparation of a furan derivative |
| AR230442A1 (es) * | 1980-12-30 | 1984-04-30 | Glaxo Group Ltd | Procedimiento para la preparacion de n-(12-((5)(dimetilmino)metil(-2-furanilmetil)tto)etil)-ni-metil-1-nitroletenodiamina(ranitidina) |
| DK558181A (da) * | 1981-01-30 | 1982-07-31 | Smithkline Corp | Fremgangsmaade til fremstilling af 3,5-diamino-1,2,4-triazoler |
| EP0057981A3 (en) | 1981-02-09 | 1982-08-25 | Beecham Group Plc | Aromatic compounds, processes for their preparation and their use |
| FI76080C (fi) * | 1981-02-20 | 1988-09-09 | Glaxo Group Ltd | Foerfarande foer framstaellning av furanderivat. |
| DE3108753A1 (de) * | 1981-03-07 | 1982-09-16 | Degussa Ag, 6000 Frankfurt | Neue substituierte alkyl-phenylsulfonylguanidine miteinem heterocyclischen rest |
| FR2501691A1 (fr) * | 1981-03-11 | 1982-09-17 | Sanofi Sa | Thioalkylamides, procede de preparation et compositions pharmaceutiques en contenant |
| US4381395A (en) * | 1981-04-03 | 1983-04-26 | Sk & F Lab Co. | Process for preparing an imidazole derivative |
| AR229878A1 (es) * | 1981-05-07 | 1983-12-30 | Glaxo Group Ltd | Procedimiento para preparar ranitidina |
| US4390701A (en) * | 1981-05-18 | 1983-06-28 | Bristol-Myers Company | 1-Amino-2-[3-(3-piperidinomethylphenoxy)propylamino]cyclobutene-3,4-dione |
| US5171860A (en) * | 1981-06-15 | 1992-12-15 | Merck & Co., Inc. | Diamino isothiazole-1-oxides and 1,1 dioxides as gastric secretion inhibitors |
| BE894285A (fr) * | 1981-09-04 | 1983-03-02 | Glaxo Group Ltd | Composition pharmaceutique contenant un medicament anti-inflammatoire et de la ranitidine ou un sel de ce compose |
| ES507180A0 (es) * | 1981-11-16 | 1982-08-16 | Pharmedical Sa Lab | Procedimiento de preparacion de amino alcosi furanos o tio- fenos. |
| US4525477A (en) * | 1981-12-02 | 1985-06-25 | Smith Kline & French Laboratories Limited | 2-Thiazolyl, isothiazolyl, oxazolyl and isoxazolyl alkylamino-3-nitro-heterocyclic compounds |
| GR77847B (OSRAM) * | 1981-12-14 | 1984-09-25 | American Home Prod | |
| WO1983002113A1 (fr) * | 1981-12-17 | 1983-06-23 | Yuki, Hiroshi | Derives de propenylamine et medicaments les contenant |
| US4411899A (en) * | 1981-12-21 | 1983-10-25 | Merck & Co., Inc. | Substituted derivatives of amino alkane diols as gastric secretion inhibitors |
| DE3213509A1 (de) * | 1982-04-10 | 1983-10-20 | Basf Ag, 6700 Ludwigshafen | N-substituierte imidazol-derivate, ihre herstellung, diese enthaltende arzneimittel und ihre verwendung |
| PT76557B (en) * | 1982-04-16 | 1986-01-21 | Inke Sa | Process for preparing furan derivatives and addition salts thereof and of pharmaceutical compositions containing the same |
| DE3365869D1 (en) * | 1982-07-30 | 1986-10-09 | Smith Kline French Lab | Amino pyrimidinones and their preparation |
| US4590192A (en) * | 1982-10-01 | 1986-05-20 | Beecham Group P.L.C. | Benzisothiazoles, their pharmaceutical compositions, and method of use |
| EP0105732A3 (en) * | 1982-10-01 | 1985-09-04 | Beecham Group Plc | Histamine h2 receptor antagonists of the benzisothiazole amino and benzthiadiazine amino series |
| JPS5988458A (ja) * | 1982-11-12 | 1984-05-22 | Toyama Chem Co Ltd | アミン誘導体およびその塩 |
| US4458077A (en) * | 1982-11-22 | 1984-07-03 | American Home Products Corporation | Heterocyclic anti-ulcer agents |
| YU42819B (en) * | 1982-11-22 | 1988-12-31 | Lek Tovarna Farmacevtskih | Process for preparing n-/2-///5-(dimethyl-amino)-methyl-2-furanyl/methyl/thio/ethyl-n'-methyl-2-nitro-1,1-ethene diamine |
| DE3343884A1 (de) * | 1982-12-08 | 1984-06-14 | Degussa Ag, 6000 Frankfurt | Neue ethendiamin- und guanidin-derivate |
| NL8303965A (nl) * | 1982-12-08 | 1984-07-02 | Degussa | Nieuwe etheendiamine- en guanidine-derivaten; werkwijze voor het bereiden daarvan; geneesmiddelen die ze bevatten; werkwijze voor het bereiden van dergelijke geneesmiddelen; toepassing van de verbindingen voor het bereiden van geneesmiddelen en in de geneeskunde. |
| US4495193A (en) * | 1982-12-30 | 1985-01-22 | Biomeasure, Inc. | Imidazole compounds which reduce gastric acid secretion |
| US4814335A (en) * | 1982-12-30 | 1989-03-21 | Biomeasure, Incorporated | Antiviral compounds |
| US4565815A (en) * | 1982-12-30 | 1986-01-21 | Biomeasure, Inc. | Pyrazolo[1,5-a]-1,3,5-triazines |
| US4665172A (en) * | 1983-01-28 | 1987-05-12 | Ube Industries, Ltd. | Process for producing heterocyclic compound having nitromethylene group as the side chain group |
| US4558044A (en) * | 1983-02-19 | 1985-12-10 | Beecham Group P.L.C. | 1,2,4-Benzothiadiazines |
| DE3306102C1 (de) * | 1983-02-22 | 1984-08-02 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | Pyridin-Pyrimidinon-Derivate,Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| DK169255B1 (da) * | 1983-02-22 | 1994-09-26 | American Home Prod | Analogifremgangsmåde til fremstilling af thieno-isothiazol-1,1-dioxid-derivater og farmaceutisk acceptable salte heraf |
| US4772622A (en) * | 1983-03-25 | 1988-09-20 | Merck & Co., Inc. | 3,5-diamino-1,2,4-oxidiazoles as gastric secretion inhibitors |
| ES521588A0 (es) * | 1983-03-30 | 1984-08-16 | Ferrer Int | Procedimiento de obtencion de nuevas n-ciano-formamidinas. |
| GB8313217D0 (en) * | 1983-05-13 | 1983-06-22 | Glaxo Group Ltd | Pharmaceutical compositions |
| US4567191A (en) * | 1983-06-07 | 1986-01-28 | Merck & Co., Inc. | Amino-phenyl-thiadiazoledioxides as gastric secretion inhibitors |
| US4539416A (en) * | 1983-06-10 | 1985-09-03 | The Dow Chemical Company | Processes for making thioalkyl carboxamides and amines |
| SE457082B (sv) * | 1983-07-15 | 1988-11-28 | Richter Gedeon Vegyeszet | Foerfarande foer framstaellning av hydrokloriden av 1-/2-/5-dimetylaminometyl-2-(furylmetyltio)-etyl//-amino-1-metylamino-2-nitroetylen |
| JPS6067474A (ja) * | 1983-09-24 | 1985-04-17 | Wakamoto Pharmaceut Co Ltd | 新規な1,3,4−チアジアゾ−ル誘導体及びそれを有効成分とする抗潰瘍剤 |
| BG39661A1 (en) * | 1984-04-13 | 1986-08-29 | Ivanova | Antiulcer means |
| HU198196B (en) * | 1984-05-02 | 1989-08-28 | Gyogyszerkutato Intezet | Process for production of basic tioether and its salts |
| IT1196133B (it) * | 1984-06-06 | 1988-11-10 | Ausonia Farma Srl | Derivati furanici con attivita' antiulcera |
| GB8415254D0 (en) | 1984-06-15 | 1984-07-18 | Glaxo Group Ltd | Amine derivatives |
| GB8423804D0 (en) * | 1984-09-20 | 1984-10-24 | Glaxo Group Ltd | Chemical process |
| IT1178026B (it) * | 1984-10-05 | 1987-09-03 | Medosan Ind Biochimi | Derivati del 2-amino-tiazolo |
| FR2571723B1 (fr) * | 1984-10-12 | 1988-08-26 | Lipha | Derives de thieno et furo-(2,3-c) pyrroles, procedes de preparation et medicaments les contenant |
| AU7235287A (en) * | 1986-03-28 | 1987-10-20 | Janus Farmaceutici S.R.L | Synthesis of antiulcer compounds |
| US4814341A (en) * | 1986-08-26 | 1989-03-21 | Reiter Lawrence A | 2-guanidino-4-(2-furyl) thiazoles as antiulcer agents |
| JPH0725745B2 (ja) * | 1986-11-11 | 1995-03-22 | 株式会社日本触媒 | アミン化合物の製造方法 |
| GB8629781D0 (en) * | 1986-12-12 | 1987-01-21 | Glaxo Group Ltd | Pharmaceutical compositions |
| ATE86619T1 (de) * | 1987-04-06 | 1993-03-15 | Heumann Pharma Gmbh & Co | Verfahren zur herstellung von nitroethenderivaten. |
| GB2209163B (en) * | 1987-08-28 | 1991-04-24 | Toyama Chemical Co Ltd | Amine derivative and its salt, process for producing the same, and anti-ulcer agent containing the same |
| JPH01131172A (ja) * | 1987-08-28 | 1989-05-24 | Toyama Chem Co Ltd | アミン誘導体およびその塩、それらの製造法、並びにそれらを含有する抗潰瘍剤 |
| SE8704436D0 (sv) * | 1987-11-13 | 1987-11-13 | Pm Konsult Handelsbolag | Anvendning av antisekretoriska substanser for nya indikationer |
| JPH01138013U (OSRAM) * | 1988-03-16 | 1989-09-21 | ||
| US4880636A (en) * | 1988-05-13 | 1989-11-14 | Franz Robert M | Film coated tablet of ranitidine HCl |
| NZ230701A (en) * | 1988-09-20 | 1992-01-29 | Glaxo Group Ltd | Pharmaceutical compositions comprising ranitidine, alginic acid and a carbonate or bicarbonate |
| GB8904182D0 (en) * | 1989-02-23 | 1989-04-05 | Glaxo Canada | Pharmaceutical compositions |
| ES2012285A6 (es) * | 1989-03-09 | 1990-03-01 | Vinas Lab | Procedimiento para la obtencion de derivados furanicos. |
| JPH0730064B2 (ja) * | 1989-08-17 | 1995-04-05 | 協和醗酵工業株式会社 | フラン誘導体 |
| GB9004328D0 (en) * | 1990-02-27 | 1990-04-25 | Glaxo Group Ltd | Chemical compounds |
| GB9009437D0 (en) * | 1990-04-26 | 1990-06-20 | Glaxo Group Ltd | Chemical compounds |
| HU210849B (en) * | 1990-11-09 | 1995-08-28 | Richter Gedeon Vegyeszet | Process for preparing furil derivatives |
| US5169864A (en) * | 1991-11-15 | 1992-12-08 | Baxter International Inc. | Unbuffered premixed ranitidine formulation |
| US5294433A (en) * | 1992-04-15 | 1994-03-15 | The Procter & Gamble Company | Use of H-2 antagonists for treatment of gingivitis |
| KR950701312A (ko) * | 1992-05-12 | 1995-03-23 | 이베 사치아키 | 신규 4급 암모늄염 및 약제로서 그의 사용 |
| JPH0649615U (ja) * | 1992-12-14 | 1994-07-08 | 日本建鐵株式会社 | ドライシールカーテンウォールの排水構造 |
| WO1995010274A1 (en) * | 1993-10-14 | 1995-04-20 | F.H. Faulding & Co. Limited | Aqueous pharmaceutical composition |
| DE4341310A1 (de) * | 1993-12-03 | 1995-06-08 | Hexal Pharma Gmbh | Tablette oder Kapsel mit einem Gehalt an stabilem Ranitidinhydrochlorid Form 1 |
| US5407687A (en) * | 1994-02-22 | 1995-04-18 | Glaxo Inc. | Ranitidine solid dosage form |
| CA2120874E (en) * | 1994-04-08 | 2002-01-08 | Keshava Murthy | Form of form 1 ranitidine |
| US5670671A (en) * | 1994-04-08 | 1997-09-23 | Brantford Chemicals Inc. | Process for the production of an improved form of form 1 ranitidine |
| IN181698B (OSRAM) * | 1994-05-13 | 1998-09-05 | Ranbaxy Lab Ltd | |
| NZ272054A (en) * | 1994-05-13 | 1996-05-28 | Ranbaxy Lab Ltd | Process for producing form 1 ranitidine hydrochloride |
| IN181699B (OSRAM) * | 1994-05-13 | 1998-09-05 | Ranbaxy Lab Ltd | |
| ES2119268T3 (es) * | 1994-06-24 | 1998-10-01 | Ranbaxy Lab Ltd | Procedimiento para fabricar ranitidina base de calidad farmaceutica. |
| EP0694540B1 (en) | 1994-06-24 | 1998-08-19 | Ranbaxy Laboratories Limited | Process for the manufacture of form 1 ranitidine hydrochloride |
| US5538737A (en) * | 1994-11-30 | 1996-07-23 | Applied Analytical Industries, Inc. | Oral compositions of H2 -antagonists |
| DK0796256T3 (da) * | 1994-12-08 | 2004-05-10 | Aventis Pharma Inc | Fremgangsmåde til fremstilling af ranitidin |
| US5672724A (en) * | 1994-12-08 | 1997-09-30 | Hoechst Marion Roussel, Inc. | Processes for preparing ranitidine |
| US5663381A (en) * | 1995-04-21 | 1997-09-02 | Hexal Pharmaceuticals, Inc. | Process for preparing form 1 ranitidine hydrochloride |
| US5686588A (en) * | 1995-08-16 | 1997-11-11 | Yoo; Seo Hong | Amine acid salt compounds and process for the production thereof |
| EP0861075A1 (en) * | 1995-11-13 | 1998-09-02 | Albany Medical College | Analgesic compounds and uses thereof |
| WO1997035853A1 (en) * | 1996-03-25 | 1997-10-02 | Hoechst Marion Roussel, Inc. | Process for the preparation of form 1 ranitidine hydrochloride |
| RU2131264C1 (ru) * | 1996-06-04 | 1999-06-10 | Московское производственное химико-фармацевтическое объединение им.Н.А.Семашко | Противоязвенное средство в виде таблеток и способ его получения |
| US5998469A (en) * | 1998-01-16 | 1999-12-07 | Centaur Pharmaceuticals, Inc. | Thioether furan nitrone compounds |
| AU4055699A (en) * | 1998-06-17 | 2000-01-05 | Russinsky Limited | Ranitidine adduct |
| YU52598A (sh) * | 1998-11-19 | 2001-05-28 | D.D. Zdravlje- sektor za istraživanje i razvoj | POSTUPAK ZA sintezu N-[2[[[5=[(DIALKILAMINO)METIL]-2= FURANIL]METIL]TIO]ETIL]-N'-ALKIL-2-NITRO 1,1 ALKENDIAMINA I NJIHOVIH HIDROHLORIDA |
| US6262085B1 (en) | 1999-08-26 | 2001-07-17 | Robert R. Whittle | Alkoxy substituted Benzimidazole compounds, pharmaceutical preparations containing the same, and methods of using the same |
| US6326384B1 (en) | 1999-08-26 | 2001-12-04 | Robert R. Whittle | Dry blend pharmaceutical unit dosage form |
| US6316020B1 (en) | 1999-08-26 | 2001-11-13 | Robert R. Whittle | Pharmaceutical formulations |
| US6312712B1 (en) | 1999-08-26 | 2001-11-06 | Robert R. Whittle | Method of improving bioavailability |
| US6312723B1 (en) | 1999-08-26 | 2001-11-06 | Robert R. Whittle | Pharmaceutical unit dosage form |
| US6268385B1 (en) | 1999-08-26 | 2001-07-31 | Robert R. Whittle | Dry blend pharmaceutical formulations |
| US6369087B1 (en) | 1999-08-26 | 2002-04-09 | Robert R. Whittle | Alkoxy substituted benzimidazole compounds, pharmaceutical preparations containing the same, and methods of using the same |
| US6780880B1 (en) | 1999-08-26 | 2004-08-24 | Robert R. Whittle | FT-Raman spectroscopic measurement |
| US6262086B1 (en) | 1999-08-26 | 2001-07-17 | Robert R. Whittle | Pharmaceutical unit dosage form |
| DE10300325A1 (de) * | 2003-01-09 | 2004-07-22 | Hexal Ag | Granulat mit öliger Substanz, Herstellungsverfahren und Tablette |
| US7632521B2 (en) * | 2003-07-15 | 2009-12-15 | Eurand, Inc. | Controlled release potassium chloride tablets |
| US8980894B2 (en) | 2004-03-25 | 2015-03-17 | Boehringer Ingelheim Vetmedica Gmbh | Use of PDE III inhibitors for the treatment of asymptomatic (occult) heart failure |
| EP1579862A1 (en) | 2004-03-25 | 2005-09-28 | Boehringer Ingelheim Vetmedica Gmbh | Use of PDE III inhibitors for the reduction of heart size in mammals suffering from heart failure |
| US20060088593A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US8383159B2 (en) * | 2004-10-27 | 2013-02-26 | Mcneil-Ppc, Inc. | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20070190133A1 (en) * | 2004-10-27 | 2007-08-16 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20060088586A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20070281022A1 (en) * | 2004-10-27 | 2007-12-06 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20060087051A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20060088587A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20080045575A1 (en) * | 2004-12-29 | 2008-02-21 | Van Dyke Thomas E | Delivery of H2 Antagonists |
| CA2500676A1 (en) * | 2005-03-11 | 2006-09-11 | Apotex Pharmachem Inc. | Preparation of acid addition salts of amine bases by solid phase-gas phase reactions |
| EP1920785A1 (en) | 2006-11-07 | 2008-05-14 | Boehringer Ingelheim Vetmedica Gmbh | Liquid preparation comprising a complex of pimobendan and cyclodextrin |
| EP2572713B1 (en) | 2011-09-22 | 2014-08-13 | King Saud University | Extracts and isolated flavonoids from Euphorbia cuneata useful as anti-ulcer agents |
| ES2924478T3 (es) | 2012-03-15 | 2022-10-07 | Boehringer Ingelheim Vetmedica Gmbh | Formulación de comprimidos farmacéuticos para el sector médico veterinario, método de producción y uso de los mismos |
| HRP20251029T1 (hr) | 2013-07-19 | 2025-10-24 | Boehringer Ingelheim Vetmedica Gmbh | Konzervirani eterificirani derivati ciklodekstrina koji sadrže tekući vodeni farmaceutski pripravak |
| PL3106150T3 (pl) | 2013-12-04 | 2022-01-03 | Boehringer Ingelheim Vetmedica Gmbh | Ulepszone kompozycje farmaceutyczne pimobendanu |
| US9457011B2 (en) | 2014-02-25 | 2016-10-04 | Muslim D. Shahid | Compositions and methods for the treatment of acid-related gastrointestinal disorders containing a dithiolane compound and a gastric acid secretion inhibitor |
| WO2015155297A1 (en) | 2014-04-11 | 2015-10-15 | Sanovel Ilac Sanayi Ve Ticaret A.S. | Pharmaceutical combinations of dabigatran and h2-receptor antagonists |
| WO2015169957A1 (en) | 2014-05-09 | 2015-11-12 | Sanovel Ilac Sanayi Ve Ticaret A.S. | Pharmaceutical combinations of rivaroxaban and h2-receptor antagonists |
| US10537570B2 (en) | 2016-04-06 | 2020-01-21 | Boehringer Ingelheim Vetmedica Gmbh | Use of pimobendan for the reduction of heart size and/or the delay of onset of clinical symptoms in patients with asymptomatic heart failure due to mitral valve disease |
| CN108864001A (zh) * | 2018-06-30 | 2018-11-23 | 郑州明泽医药科技有限公司 | 一种合成雷尼替丁的新方法 |
| US20230349922A1 (en) | 2020-08-11 | 2023-11-02 | Université De Strasbourg | H2 Blockers Targeting Liver Macrophages for the Prevention and Treatment of Liver Disease and Cancer |
| CN114605360B (zh) * | 2022-03-09 | 2023-05-05 | 河北海力恒远新材料股份有限公司 | 一种2-[[[5-(二甲氨基)甲基-2-呋喃基]甲基]硫代]乙胺的制备方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2989546A (en) * | 1961-06-20 | Synthesis of furans | ||
| US3097206A (en) * | 1962-03-19 | 1963-07-09 | Smith Kline French Lab | Aminomethylthienyl and furyl alcohol derivatives |
| US3433807A (en) * | 1963-09-26 | 1969-03-18 | Merck & Co Inc | Aminopropoxymethylfurans and intermediates therefor |
| US3393209A (en) * | 1965-10-04 | 1968-07-16 | Dow Chemical Co | Furfuryl and tetrahydrofurfuryl phenyl ureas |
| GB1307539A (en) | 1970-06-25 | 1973-02-21 | Smith Kline French Lab | Thiourea derivatives |
| GB1338169A (en) * | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| GB1397436A (en) | 1972-09-05 | 1975-06-11 | Smith Kline French Lab | Heterocyclic n-cyanoguinidines |
| US4000164A (en) * | 1973-04-02 | 1976-12-28 | Richardson-Merrell Inc. | Hypolipidemic agents |
| US4110351A (en) * | 1973-04-02 | 1978-08-29 | Richardson-Merrell Inc. | Hypolipidemic agents RO- or RS- substituted furoic acids, esters and salts |
| GB1421792A (en) | 1973-05-17 | 1976-01-21 | Smith Kline French Lab | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
| NZ188625A (en) * | 1977-10-11 | 1981-03-16 | Glaxo Group Ltd | Furan derivatives and pharmaceutical compositions containing them |
-
1976
- 1976-08-04 GB GB32465/76A patent/GB1565966A/en not_active Expired
-
1977
- 1977-07-22 GB GB28187/78A patent/GB1565967A/en not_active Expired
- 1977-07-25 US US05/818,762 patent/US4128658A/en not_active Expired - Lifetime
- 1977-07-28 DE DE2734070A patent/DE2734070C2/de not_active Expired
- 1977-07-29 CA CA283,694A patent/CA1099268A/en not_active Expired
- 1977-08-01 AU AU27519/77A patent/AU515628B2/en not_active Expired
- 1977-08-02 BE BE179834A patent/BE857388A/xx not_active IP Right Cessation
- 1977-08-03 LU LU77911A patent/LU77911A1/xx unknown
- 1977-08-03 NL NLAANVRAGE7708601,A patent/NL178320C/xx not_active IP Right Cessation
- 1977-08-04 JP JP52093722A patent/JPS5840956B2/ja not_active Expired
- 1977-08-04 FR FR7724021A patent/FR2360587B1/fr not_active Expired
-
1978
- 1978-05-12 FR FR7814250A patent/FR2384765B1/fr not_active Expired
- 1978-05-12 FR FR7814251A patent/FR2384753B1/fr not_active Expired
- 1978-10-13 US US05/951,026 patent/US4255440A/en not_active Expired - Lifetime
- 1978-10-13 US US05/951,025 patent/US4279819A/en not_active Expired - Lifetime
-
1980
- 1980-03-21 JP JP3601680A patent/JPS55153779A/ja active Granted
- 1980-03-21 JP JP3601580A patent/JPS55153761A/ja active Pending
Non-Patent Citations (2)
| Title |
|---|
| Chem.Abstr. 63, 1965, Sp. 9896/9897 |
| NICHTS-ERMITTELT |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3546858C2 (de) * | 1984-06-15 | 1995-04-20 | Glaxo Group Ltd | Verfahren zur Herstellung von Ranitidin |
| DE3915347A1 (de) * | 1988-05-11 | 1989-11-16 | Glaxo Group Ltd | Harzadsorbat und verfahren zu seiner herstellung |
| DE3915347C2 (de) * | 1988-05-11 | 1994-11-03 | Glaxo Group Ltd | Harzadsorbate, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate |
| DE3923638A1 (de) * | 1988-07-18 | 1990-03-01 | Glaxo Group Ltd | Furanderivate |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2734070A1 (de) | 1978-02-09 |
| JPS55153779A (en) | 1980-11-29 |
| FR2384753A1 (fr) | 1978-10-20 |
| JPS5840956B2 (ja) | 1983-09-08 |
| GB1565966A (en) | 1980-04-23 |
| FR2384765A1 (fr) | 1978-10-20 |
| AU515628B2 (en) | 1981-04-16 |
| BE857388A (fr) | 1978-02-02 |
| LU77911A1 (fr) | 1979-05-23 |
| FR2360587A1 (fr) | 1978-03-03 |
| FR2360587B1 (fr) | 1981-07-17 |
| FR2384753B1 (fr) | 1981-06-12 |
| JPS55153761A (en) | 1980-11-29 |
| FR2384765B1 (fr) | 1982-09-10 |
| US4128658A (en) | 1978-12-05 |
| JPS6132315B2 (OSRAM) | 1986-07-25 |
| AU2751977A (en) | 1979-02-08 |
| NL178320C (nl) | 1986-03-03 |
| CA1099268A (en) | 1981-04-14 |
| NL7708601A (nl) | 1978-02-07 |
| US4255440A (en) | 1981-03-10 |
| JPS5318557A (en) | 1978-02-20 |
| US4279819A (en) | 1981-07-21 |
| GB1565967A (en) | 1980-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2734070C2 (de) | Aminoalkylfuranderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2951675C2 (de) | Guanidinothiazolverbindungen, Verfahren zu deren Herstellung und Arzneimittelzubereitungen | |
| DE2922523A1 (de) | Neue aminothiazole und diese enthaltende arzneimittel | |
| DE2821409A1 (de) | Aminoalkylthiophenverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| CH643238A5 (en) | Aminoalkylbenzene derivatives having a selective action on histamine receptors | |
| DE2724989A1 (de) | Guanidinderivate, verfahren zu ihrer herstellung und arzneimittel | |
| DE2238504B2 (de) | l-Phenoxy-3-alkylaminopropan-2-ol -Derivate | |
| DE2720545C3 (de) | Derivate des 2,4-Diamino-6,7-dimethoxychinazolins, ihre Herstellung und pharmazeutische Mittel | |
| DE69311566T2 (de) | Heterocyclische amine als calmodulin antagonisten | |
| DE2461802A1 (de) | Pyrazinderivate | |
| DE2446758B2 (de) | 2-(2-Fluor-6-trifluormethylphenylaminoMmidazolidin, dessen Säureadditionssalze, Verfahren zur Herstellung dieser Verbindungen und deren Verwendung bei der Bekämpfung der Hypertonie | |
| DE2362754C2 (de) | Cyclopropylalkylaminoreste enthaltende Oxazolinverbindungen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1915230C3 (de) | Hydroxyphenylalkylaminderivate, Verfahren zu deren Herstellung und Arzneimittel auf deren Basis | |
| EP0086453B1 (de) | Thiazaspiranderivate, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE10044905A1 (de) | (2-Azabicyclo[2.2.1]hept-7-yl)methanol-Derivate als nikontinische Acetylcholinrezeptor Agonisten | |
| DE2106038C3 (de) | 2-Imidazolin-2-ylamino-benzo [b] thiophene und diese enthaltende pharmazeutische Präparate | |
| DE2419198A1 (de) | Pyridincarboxamidsulfonylharnstoffe als hypoglykaemische mittel | |
| DE2760097C2 (OSRAM) | ||
| CH640846A5 (en) | Aminoalkylfuran derivative | |
| DD298100A5 (de) | Aminoalkylfuranderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2939914A1 (de) | N-(1-methyl-2-pyrrolidinylmethyl)-2,3- dimethoxy-5-methylsulfamoylbenzamid, verfahren zu seiner herstellung und seine therapeutische verwendung | |
| DD210266A5 (de) | Verfahren zur herstellung von 3-(ureidocyclohexylamino)-propan-1,2-diolderivaten | |
| AT357165B (de) | Verfahren zur herstellung von neuen china- zolinderivaten und ihren salzen | |
| DE2530515A1 (de) | Thienopyridinerivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittelzubereitungen | |
| DE3531504A1 (de) | 3-aminomethylpyrrol-1-yl-alkylamine und diese verbindungen enthaltende therapeutische mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2759959 Format of ref document f/p: P Ref country code: DE Ref document number: 2759960 Format of ref document f/p: P |
|
| AH | Division in |
Ref country code: DE Ref document number: 2759959 Format of ref document f/p: P Ref country code: DE Ref document number: 2759960 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2759960 Ref country code: DE Ref document number: 2759959 |
|
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2760097 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2760097 |
|
| AH | Division in |
Ref country code: DE Ref document number: 2760097 Format of ref document f/p: P Ref country code: DE Ref document number: 2759959 Format of ref document f/p: P Ref country code: DE Ref document number: 2759960 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: DIE IN ANSPRUCH 1 ANGEGEBENE FORMEL II WIRD DAHINGEHEND BERICHTIGT, DASS DIE GRUPPE "NO" DURCH "NO TIEF 2" ERSETZT WIRD. |
|
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 2759959 Format of ref document f/p: P |
|
| AH | Division in |
Ref country code: DE Ref document number: 2760097 Format of ref document f/p: P |