DE2540207C2 - - Google Patents
Info
- Publication number
- DE2540207C2 DE2540207C2 DE19752540207 DE2540207A DE2540207C2 DE 2540207 C2 DE2540207 C2 DE 2540207C2 DE 19752540207 DE19752540207 DE 19752540207 DE 2540207 A DE2540207 A DE 2540207A DE 2540207 C2 DE2540207 C2 DE 2540207C2
- Authority
- DE
- Germany
- Prior art keywords
- melamine
- formaldehyde
- polycondensate
- percent
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000877 Melamine resin Polymers 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 42
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 32
- 238000000465 moulding Methods 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000001556 precipitation Methods 0.000 claims description 10
- 239000003963 antioxidant agent Substances 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 6
- 239000000654 additive Substances 0.000 claims description 5
- 230000003078 antioxidant effect Effects 0.000 claims description 4
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 85
- -1 polyoxymethylene Polymers 0.000 description 40
- 239000000243 solution Substances 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 229920001577 copolymer Polymers 0.000 description 25
- 239000000047 product Substances 0.000 description 23
- 229920006324 polyoxymethylene Polymers 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 19
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 238000004519 manufacturing process Methods 0.000 description 18
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 13
- 229930040373 Paraformaldehyde Natural products 0.000 description 12
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 11
- 239000008367 deionised water Substances 0.000 description 11
- 229910021641 deionized water Inorganic materials 0.000 description 11
- 238000007711 solidification Methods 0.000 description 11
- 230000008023 solidification Effects 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000008098 formaldehyde solution Substances 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- 229920000159 gelatin Polymers 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 230000001681 protective effect Effects 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- 238000007792 addition Methods 0.000 description 7
- 239000001768 carboxy methyl cellulose Substances 0.000 description 7
- 230000000052 comparative effect Effects 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 238000006068 polycondensation reaction Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000084 colloidal system Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 238000012545 processing Methods 0.000 description 5
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 5
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- 108010010803 Gelatin Proteins 0.000 description 4
- 239000001828 Gelatine Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229920001519 homopolymer Polymers 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical class NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 3
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 230000004580 weight loss Effects 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 238000006253 efflorescence Methods 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 229910021485 fumed silica Inorganic materials 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- DXGIRFAFSFKYCF-UHFFFAOYSA-N propanehydrazide Chemical compound CCC(=O)NN DXGIRFAFSFKYCF-UHFFFAOYSA-N 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 206010037844 rash Diseases 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- AUAGGMPIKOZAJZ-UHFFFAOYSA-N 1,3,6-trioxocane Chemical compound C1COCOCCO1 AUAGGMPIKOZAJZ-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- QLCJOAMJPCOIDI-UHFFFAOYSA-N 1-(butoxymethoxy)butane Chemical compound CCCCOCOCCCC QLCJOAMJPCOIDI-UHFFFAOYSA-N 0.000 description 1
- IXAZNYYEGLSHOS-UHFFFAOYSA-N 2-aminoethanol;phosphoric acid Chemical compound NCCO.OP(O)(O)=O IXAZNYYEGLSHOS-UHFFFAOYSA-N 0.000 description 1
- YZEZMSPGIPTEBA-UHFFFAOYSA-N 2-n-(4,6-diamino-1,3,5-triazin-2-yl)-1,3,5-triazine-2,4,6-triamine Chemical compound NC1=NC(N)=NC(NC=2N=C(N)N=C(N)N=2)=N1 YZEZMSPGIPTEBA-UHFFFAOYSA-N 0.000 description 1
- DGZQOKRGJUFPQC-UHFFFAOYSA-N 3,5-ditert-butyl-4-hydroxybenzamide Chemical compound CC(C)(C)C1=CC(C(N)=O)=CC(C(C)(C)C)=C1O DGZQOKRGJUFPQC-UHFFFAOYSA-N 0.000 description 1
- YEXOWHQZWLCHHD-UHFFFAOYSA-N 3,5-ditert-butyl-4-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=CC(C(C)(C)C)=C1O YEXOWHQZWLCHHD-UHFFFAOYSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical class C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical class NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 241001620634 Roger Species 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- SAMOITCGMRRXJU-UHFFFAOYSA-N [3-(2-hydroxybenzoyl)phenyl]-(2-hydroxyphenyl)methanone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC(C(=O)C=2C(=CC=CC=2)O)=C1 SAMOITCGMRRXJU-UHFFFAOYSA-N 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- MASBWURJQFFLOO-UHFFFAOYSA-N ammeline Chemical compound NC1=NC(N)=NC(O)=N1 MASBWURJQFFLOO-UHFFFAOYSA-N 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- WXWQVSOHWXJBDF-UHFFFAOYSA-N benzene-1,3,5-tricarboxamide Chemical compound NC(=O)C1=CC(C(N)=O)=CC(C(N)=O)=C1 WXWQVSOHWXJBDF-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- RXOFZQSGVJHUDI-UHFFFAOYSA-N butyl perchlorate Chemical group CCCCOCl(=O)(=O)=O RXOFZQSGVJHUDI-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- GPLRAVKSCUXZTP-UHFFFAOYSA-N diglycerol Chemical compound OCC(O)COCC(O)CO GPLRAVKSCUXZTP-UHFFFAOYSA-N 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- DMMFKCOJCSSDRD-UHFFFAOYSA-N dioxonane Chemical compound C1CCCOOCCC1 DMMFKCOJCSSDRD-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QZUPTXGVPYNUIT-UHFFFAOYSA-N isophthalamide Chemical compound NC(=O)C1=CC=CC(C(N)=O)=C1 QZUPTXGVPYNUIT-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- WRIRWRKPLXCTFD-UHFFFAOYSA-N malonamide Chemical compound NC(=O)CC(N)=O WRIRWRKPLXCTFD-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical compound [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- SLZVUHUGTAPAFJ-UHFFFAOYSA-N methoxymethyl perchlorate Chemical compound COCOCl(=O)(=O)=O SLZVUHUGTAPAFJ-UHFFFAOYSA-N 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- 229910052982 molybdenum disulfide Inorganic materials 0.000 description 1
- FTWUXYZHDFCGSV-UHFFFAOYSA-N n,n'-diphenyloxamide Chemical compound C=1C=CC=CC=1NC(=O)C(=O)NC1=CC=CC=C1 FTWUXYZHDFCGSV-UHFFFAOYSA-N 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000004792 oxidative damage Effects 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- NAHIZHJHSUSESF-UHFFFAOYSA-N perchloryl acetate Chemical compound CC(=O)OCl(=O)(=O)=O NAHIZHJHSUSESF-UHFFFAOYSA-N 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 150000003138 primary alcohols Chemical group 0.000 description 1
- 239000011164 primary particle Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- RYMZZMVNJRMUDD-HGQWONQESA-N simvastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 RYMZZMVNJRMUDD-HGQWONQESA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- MHSKRLJMQQNJNC-UHFFFAOYSA-N terephthalamide Chemical compound NC(=O)C1=CC=C(C(N)=O)C=C1 MHSKRLJMQQNJNC-UHFFFAOYSA-N 0.000 description 1
- 229920006027 ternary co-polymer Polymers 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Priority Applications (25)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2540207A DE2540207B1 (de) | 1975-09-10 | 1975-09-10 | Polyoxymethylen-Formmassen(I) |
| NLAANVRAGE7606453,A NL181364C (nl) | 1975-09-10 | 1976-06-15 | Werkwijze voor het bereiden van polyoxymethyleen vormmassa's; gevormde voortbrengsels. |
| IL49811A IL49811A (en) | 1975-09-10 | 1976-06-16 | Poloxymethylene moulding compositions |
| SU762372900A SU608482A3 (ru) | 1975-09-10 | 1976-06-21 | Термостабильна формовочна композици |
| GB26270/76A GB1513518A (en) | 1975-09-10 | 1976-06-24 | Polyoxymethylene moulding compositions |
| NO762207A NO145310C (no) | 1975-09-10 | 1976-06-25 | Termisk stabile polyoksymetylen-formmasser. |
| FR7620717A FR2323739A1 (fr) | 1975-09-10 | 1976-07-07 | Matieres a mouler polymethoxyleniques |
| ES449846A ES449846A1 (es) | 1975-09-10 | 1976-07-15 | Procedimiento para estabilizar poli(oximetilenos). |
| US05/715,802 US4139575A (en) | 1975-09-10 | 1976-08-19 | Polyoxymethylene molding composition containing melamine formaldehyde polycondensate |
| BR7605547A BR7605547A (pt) | 1975-09-10 | 1976-08-24 | Massas de moldagem de polioximetileno |
| AU17277/76A AU496976B2 (en) | 1975-09-10 | 1976-08-30 | Polyoxymethlene moulding materials |
| DK401276A DK154439C (da) | 1975-09-10 | 1976-09-06 | Termisk stabile polyoxymethylenformmasser |
| IT51181/76A IT1076810B (it) | 1975-09-10 | 1976-09-08 | Composizione per stampaggio a base di poliossimetilene i |
| CS765825A CS197279B2 (en) | 1975-09-10 | 1976-09-08 | Shaping material based on polyoxymethylene |
| BE6045665A BE845965A (fr) | 1975-09-10 | 1976-09-08 | Compositions de moulage a base de polyoxymethylene |
| DD194690A DD126528A5 (enExample) | 1975-09-10 | 1976-09-08 | |
| SE7609981A SE430698B (sv) | 1975-09-10 | 1976-09-09 | Polyoximetylenformmassor stabiliserade med ett finfordelat, fornetat, vattenolosligt melamin-formaldehyd-polykondensat |
| AT669376A AT349760B (de) | 1975-09-10 | 1976-09-09 | Polyoxymethylen-formmasse |
| PL1976192285A PL101654B1 (pl) | 1975-09-10 | 1976-09-09 | A polyoxymethylene moulding composition |
| ZA765455A ZA765455B (en) | 1975-09-10 | 1976-09-10 | Polyoxymethylene moulding compositions |
| CH1155276A CH602851A5 (enExample) | 1975-09-10 | 1976-09-10 | |
| JP51108691A JPS5233943A (en) | 1975-09-10 | 1976-09-10 | Polyoxymethylene molding material |
| CA260,935A CA1078537A (en) | 1975-09-10 | 1976-09-10 | Poly-oxymethylene molding compounds |
| US05/963,729 US4230606A (en) | 1975-09-10 | 1978-11-27 | Polyoxymethylene molding composition containing melamine formaldehyde polycondensate |
| HK136/79A HK13679A (en) | 1975-09-10 | 1979-03-15 | Polyoxymethylene moulding compositions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2540207A DE2540207B1 (de) | 1975-09-10 | 1975-09-10 | Polyoxymethylen-Formmassen(I) |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2540207B1 DE2540207B1 (de) | 1976-11-18 |
| DE2540207C2 true DE2540207C2 (enExample) | 1977-06-30 |
Family
ID=5956027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2540207A Granted DE2540207B1 (de) | 1975-09-10 | 1975-09-10 | Polyoxymethylen-Formmassen(I) |
Country Status (24)
| Country | Link |
|---|---|
| US (2) | US4139575A (enExample) |
| JP (1) | JPS5233943A (enExample) |
| AT (1) | AT349760B (enExample) |
| AU (1) | AU496976B2 (enExample) |
| BE (1) | BE845965A (enExample) |
| BR (1) | BR7605547A (enExample) |
| CA (1) | CA1078537A (enExample) |
| CH (1) | CH602851A5 (enExample) |
| CS (1) | CS197279B2 (enExample) |
| DD (1) | DD126528A5 (enExample) |
| DE (1) | DE2540207B1 (enExample) |
| DK (1) | DK154439C (enExample) |
| ES (1) | ES449846A1 (enExample) |
| FR (1) | FR2323739A1 (enExample) |
| GB (1) | GB1513518A (enExample) |
| HK (1) | HK13679A (enExample) |
| IL (1) | IL49811A (enExample) |
| IT (1) | IT1076810B (enExample) |
| NL (1) | NL181364C (enExample) |
| NO (1) | NO145310C (enExample) |
| PL (1) | PL101654B1 (enExample) |
| SE (1) | SE430698B (enExample) |
| SU (1) | SU608482A3 (enExample) |
| ZA (1) | ZA765455B (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2540207B1 (de) * | 1975-09-10 | 1976-11-18 | Degussa | Polyoxymethylen-Formmassen(I) |
| DE2840679C2 (de) | 1978-09-19 | 1982-03-18 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Oxymethylencopolymerisat-Formmassen mit geringem Anteil an Restformaldehyd |
| DE2921167A1 (de) * | 1979-05-25 | 1980-12-04 | Basf Ag | Verstaerkte polyoxymethylenformmassen |
| DE3044118A1 (de) * | 1980-11-24 | 1982-06-24 | Basf Ag, 6700 Ludwigshafen | Polyacetale mit erhoehter dauergebrauchstemperatur |
| JPS59105047A (ja) * | 1982-12-07 | 1984-06-18 | Mitsubishi Gas Chem Co Inc | アセタ−ル樹脂組成物 |
| JPS6090250A (ja) * | 1983-10-24 | 1985-05-21 | Mitsubishi Gas Chem Co Inc | オキシメチレン共重合体組成物 |
| DE3518375C1 (de) * | 1985-05-22 | 1986-07-17 | Degussa Ag, 6000 Frankfurt | Oxymethylencopolymerisat-Formmassen mit verminderter Formaldehyd-Emission bei der thermoplastischen Verarbeitung |
| JPS61205907U (enExample) * | 1985-06-14 | 1986-12-26 | ||
| US4801626A (en) * | 1985-10-16 | 1989-01-31 | Celanese Corporation | Glass fiber-reinforced oxymethylene polymer molding compositions having mechanical properties enhanced by amino-formaldehyde resin coupling agents |
| US4652594A (en) * | 1985-10-16 | 1987-03-24 | Celanese Corporation | Glass fiber-reinforced oxymethylene polymer molding compositions having mechanical properties enhanced by amino-formaldehyde resin coupling agents |
| US4718739A (en) * | 1986-11-07 | 1988-01-12 | Engineered Data Products, Inc. | Document storage system |
| US4793741A (en) * | 1986-12-05 | 1988-12-27 | Kuwait Institute For Scientific Research | Method for improving the mechanical properties of soil, a polymeric solution therefore, and a process for preparing polymeric solutions |
| DE3834547A1 (de) * | 1988-10-11 | 1990-04-19 | Basf Ag | Polyoxymethylen-formmassen mit verbesserter thermischer stabilitaet, verfahren zu deren herstellung und deren verwendung |
| US5011890A (en) * | 1989-03-17 | 1991-04-30 | E. I. Du Pont De Nemours And Company | Polyacetal resins containing non-meltable polymer stabilizers |
| US4972014A (en) * | 1989-06-15 | 1990-11-20 | E. I. Du Pont De Nemours And Company | Polyacetal compositions containing a non-meltable polymer stabilizer improved with at least one amide-containing phenolic antioxidant |
| US5063263A (en) * | 1989-06-15 | 1991-11-05 | E. I. Du Pont De Nemours And Company | Polyacetal compositions containing a non-meltable polymer stabilizer improved with a minor amount of at least one meltable co-stabilizer and at least one primary antioxidant |
| US5156913A (en) * | 1989-12-11 | 1992-10-20 | Hoechst Celanese Corp. | Glass reinforced acetal polymer products |
| DE59101468D1 (de) * | 1990-02-21 | 1994-06-01 | Basf Ag | Thermoplastische Massen für die Herstellung keramischer Formkörper. |
| JPH05271516A (ja) * | 1992-03-26 | 1993-10-19 | Polyplastics Co | ポリオキシメチレン組成物 |
| US6966927B1 (en) | 1992-08-07 | 2005-11-22 | Addition Technology, Inc. | Hybrid intrastromal corneal ring |
| JP3167225B2 (ja) * | 1993-08-24 | 2001-05-21 | ポリプラスチックス株式会社 | ポリオキシメチレン組成物及びその成形品 |
| DE4433667C1 (de) * | 1994-09-21 | 1996-04-11 | Degussa | Polyoxymethylen mit verbesserter Stabilität gegen Zink- und/oder Kupferionen sowie Verfahren zu seiner Herstellung und Weiterverarbeitung zu Formteilen |
| DE19528191A1 (de) | 1995-08-01 | 1997-02-06 | Basf Ag | Schlagzähe thermoplastische Formmassen |
| MY114026A (en) * | 1995-09-01 | 2002-07-31 | Asahi Chemical Ind | Polyacetal resin molded article and process for producing the same |
| JPH1143583A (ja) * | 1997-07-28 | 1999-02-16 | Polyplastics Co | ポリオキシメチレン組成物 |
| DE19810659A1 (de) * | 1998-03-12 | 1999-09-16 | Basf Ag | Nukleierte Polyoxymethylenformmassen |
| DE19828797A1 (de) * | 1998-06-27 | 1999-12-30 | Basf Ag | Stabilisierte Polyoxymethylen-Formmassen |
| WO2001005888A1 (en) * | 1999-07-16 | 2001-01-25 | Polyplastics Co., Ltd. | Polyacetal resin composition and process for the production thereof |
| JP5031188B2 (ja) * | 2004-12-14 | 2012-09-19 | ポリプラスチックス株式会社 | ポリオキシメチレン組成物 |
| CN101925637B (zh) | 2008-01-22 | 2012-11-21 | 巴斯夫欧洲公司 | 经涂覆的聚甲醛 |
| CN101952352B (zh) | 2008-02-13 | 2013-03-27 | 巴斯夫欧洲公司 | 经涂覆的聚甲醛 |
| EP2388295A1 (de) | 2010-05-21 | 2011-11-23 | Wietec Technologie KG | Verfahren zur Herstellung eines transparenten Kunststoffmaterials |
| TW201500443A (zh) * | 2013-04-18 | 2015-01-01 | Basf Se | 聚甲醛共聚物及熱塑性pom組成物 |
| EA024002B1 (ru) * | 2014-05-08 | 2016-08-31 | Государственное научное учреждение "Институт механики металлополимерных систем имени В.А. Белого Национальной академии наук Беларуси" | Полиацетальный нанокомпозит |
| JP6867748B2 (ja) * | 2015-12-25 | 2021-05-12 | 旭化成株式会社 | ポリアセタール樹脂組成物 |
| US20220200158A1 (en) | 2019-06-05 | 2022-06-23 | Basf Se | Electromagnetic wave transmission reducing material |
| JP2022536109A (ja) | 2019-06-05 | 2022-08-12 | ビーエーエスエフ ソシエタス・ヨーロピア | 電磁波を吸収する吸収体材料 |
| WO2022112524A1 (en) | 2020-11-30 | 2022-06-02 | Basf Se | Electromagnetic waves absorbing material |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3063960A (en) * | 1958-10-03 | 1962-11-13 | Union Carbide Corp | Alkylene oxide polymers stabilized with amino-formaldehyde condensation products |
| US3200090A (en) * | 1959-09-09 | 1965-08-10 | Celanese Corp | Stabilization of oxymethylene polymers with proteins |
| US3382293A (en) * | 1962-02-12 | 1968-05-07 | Celanese Corp | Polyoxymethylene blended with phenolic novolac |
| US3284538A (en) * | 1962-08-20 | 1966-11-08 | Polymer Corp | Resinous binder of chlorinated oxetane and phenol-formaldehyde or ureaformaldehyde resin |
| US3376361A (en) * | 1963-06-24 | 1968-04-02 | Celanese Corp | Formaldehyde block copolymers |
| NL134523C (enExample) * | 1963-08-23 | |||
| DE1243873B (de) * | 1964-11-16 | 1967-07-06 | Leuna Werke Veb | Stickstoff enthaltende polymere Aldehydkondensate zum Stabilisieren von Polyacetalen |
| CH465870A (de) * | 1965-02-12 | 1968-11-30 | Ciba Geigy | Verfahren zur Herstellung von feinteiligen, unschmelzbaren und unlöslichen Melamin-Formaldehyd-Kondensationsprodukten oder Mischkondensationsprodukten aus Melamin, Formaldehyd und mindestens einem weiteren Aminoplastbildner |
| CH458728A (de) * | 1965-11-01 | 1968-06-30 | Ciba Geigy | Härtbare, stickstoffhaltige Füllstoffe enthaltende Harzmischung |
| DE1694097A1 (de) * | 1966-12-14 | 1971-08-26 | Bayer Ag | Stabilisierung von Mischpolymerisaten des Trioxans |
| CH497477A (de) * | 1967-04-21 | 1970-10-15 | Basf Ag | Verfahren zur Herstellung von stickstoffhaltigen Polykondensaten des Formaldehyds |
| DE1769243C2 (de) * | 1968-04-25 | 1975-05-07 | Basf Ag, 6700 Ludwigshafen | Verfahren zum Stabilisieren von PoIyacetalen |
| BE754592A (fr) * | 1969-08-07 | 1971-02-08 | Hoechst Ag | Matieres a mouler thermoplastiques a base de polyoxymethylene |
| US3560412A (en) * | 1970-01-12 | 1971-02-02 | Joseph J Bernardo | Thermosetting compositions comprising blends of acetal resins and amine-aldehyde resins |
| DE2256355A1 (de) * | 1972-06-01 | 1973-12-13 | Swinson Jun | Verfahren und vorrichtung zum farblichen bestimmen bzw. anpassen von gegenstaenden, beispielsweise zaehnen |
| US3901846A (en) * | 1974-08-12 | 1975-08-26 | Celanese Corp | Thermoplastic polyoxymethylene molding resins |
| DE2540207B1 (de) * | 1975-09-10 | 1976-11-18 | Degussa | Polyoxymethylen-Formmassen(I) |
-
1975
- 1975-09-10 DE DE2540207A patent/DE2540207B1/de active Granted
-
1976
- 1976-06-15 NL NLAANVRAGE7606453,A patent/NL181364C/xx not_active IP Right Cessation
- 1976-06-16 IL IL49811A patent/IL49811A/xx unknown
- 1976-06-21 SU SU762372900A patent/SU608482A3/ru active
- 1976-06-24 GB GB26270/76A patent/GB1513518A/en not_active Expired
- 1976-06-25 NO NO762207A patent/NO145310C/no unknown
- 1976-07-07 FR FR7620717A patent/FR2323739A1/fr active Granted
- 1976-07-15 ES ES449846A patent/ES449846A1/es not_active Expired
- 1976-08-19 US US05/715,802 patent/US4139575A/en not_active Expired - Lifetime
- 1976-08-24 BR BR7605547A patent/BR7605547A/pt unknown
- 1976-08-30 AU AU17277/76A patent/AU496976B2/en not_active Expired
- 1976-09-06 DK DK401276A patent/DK154439C/da not_active IP Right Cessation
- 1976-09-08 BE BE6045665A patent/BE845965A/xx not_active IP Right Cessation
- 1976-09-08 DD DD194690A patent/DD126528A5/xx unknown
- 1976-09-08 IT IT51181/76A patent/IT1076810B/it active
- 1976-09-08 CS CS765825A patent/CS197279B2/cs unknown
- 1976-09-09 SE SE7609981A patent/SE430698B/xx not_active IP Right Cessation
- 1976-09-09 AT AT669376A patent/AT349760B/de not_active IP Right Cessation
- 1976-09-09 PL PL1976192285A patent/PL101654B1/pl unknown
- 1976-09-10 ZA ZA765455A patent/ZA765455B/xx unknown
- 1976-09-10 CA CA260,935A patent/CA1078537A/en not_active Expired
- 1976-09-10 CH CH1155276A patent/CH602851A5/xx not_active IP Right Cessation
- 1976-09-10 JP JP51108691A patent/JPS5233943A/ja active Granted
-
1978
- 1978-11-27 US US05/963,729 patent/US4230606A/en not_active Expired - Lifetime
-
1979
- 1979-03-15 HK HK136/79A patent/HK13679A/xx unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2540207C2 (enExample) | ||
| DE2540207B1 (de) | Polyoxymethylen-Formmassen(I) | |
| EP0029572B1 (de) | Polyoxymethylenfibride, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2840679C2 (de) | Verfahren zur Herstellung von Oxymethylencopolymerisat-Formmassen mit geringem Anteil an Restformaldehyd | |
| DE2150038C3 (de) | Thermoplastische Formmassen auf Polyoxymethylenbasis | |
| DE2735946C3 (de) | Körniges Oxymethylenpolymer mit verbesserten mechanischen Eigenschaften und Verfahren zu dessen Herstellung | |
| EP0480314A2 (de) | Polyoxymethylen-Formmassen mit verbesserter thermischer Stabilität und verminderter Formaldehydemission | |
| US3288880A (en) | Condensation polymers, for stabilizing polymeric structures, composed of hydroxyaromatic ketone, aldehyde, and phenol | |
| CH628657A5 (de) | Verfahren zur herstellung von grobkoernigen polyoxymethylencopolymeren. | |
| DE1669805C3 (de) | Oxymethylen polymere enthaltende thermoplastische Massen | |
| DE2243323C2 (de) | Stabilisierte Formmassen aus Polyoxymethylenen | |
| DE2208168B2 (de) | Thermoplastische Formmasse auf Poly(oxymethylen)-Basis | |
| DE3834547A1 (de) | Polyoxymethylen-formmassen mit verbesserter thermischer stabilitaet, verfahren zu deren herstellung und deren verwendung | |
| DE60127491T2 (de) | Verfahren zur Herstellung von Oxymethylencopolymeren | |
| DE4433667C1 (de) | Polyoxymethylen mit verbesserter Stabilität gegen Zink- und/oder Kupferionen sowie Verfahren zu seiner Herstellung und Weiterverarbeitung zu Formteilen | |
| DE1595722A1 (de) | Verfahren zur Herstellung von hitzehaertbaren Polyarylenaethern | |
| DE4216588A1 (de) | Polyarylenethersulfone mit heller Eigenfarbe und verbesserter Farbkonstanz | |
| DE2166377C3 (de) | Verwendung von verzweigten oder vernetzten Trioxancopolymeren als Nukleierungsmittel | |
| DE2754600A1 (de) | Verfahren zur herstellung von press- und formmassen auf der basis von polyoxymethylenen | |
| DE2540206B1 (de) | Polyoxymethylen-Formmassen (II) | |
| DE2509924C3 (de) | Verfahren zur Herstellung von Oxymethylenpolymeren in körniger Form | |
| DE2549770C2 (de) | Verfahren zur herstellung von oxymethylenpolymeren in koerniger form | |
| DE10248630B4 (de) | Diaminotriazinylverbindungen, Verfahren zu deren Herstellung, Zusammensetzung enthaltend diese und deren Verwendung | |
| DE2508886B2 (de) | Verfahren zur Herstellung von Oxymethylenpolymeren in körniger Form | |
| DE1495117A1 (de) | Verfahren zur Herstellung von Copolymeren des Trioxans |