CH628622A5 - Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. - Google Patents
Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. Download PDFInfo
- Publication number
- CH628622A5 CH628622A5 CH1630976A CH1630976A CH628622A5 CH 628622 A5 CH628622 A5 CH 628622A5 CH 1630976 A CH1630976 A CH 1630976A CH 1630976 A CH1630976 A CH 1630976A CH 628622 A5 CH628622 A5 CH 628622A5
- Authority
- CH
- Switzerland
- Prior art keywords
- sulfamoyl
- ethyl acetate
- solution
- acid
- phenoxy
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 44
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- -1 1-pyrrolyl radical Chemical class 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 26
- 239000005711 Benzoic acid Substances 0.000 claims description 24
- 235000010233 benzoic acid Nutrition 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 123
- 239000000243 solution Substances 0.000 description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 40
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- 150000001875 compounds Chemical class 0.000 description 31
- PCSMJKASWLYICJ-UHFFFAOYSA-N Succinic aldehyde Chemical class O=CCCC=O PCSMJKASWLYICJ-UHFFFAOYSA-N 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 229960000583 acetic acid Drugs 0.000 description 20
- 239000012362 glacial acetic acid Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- 125000002915 carbonyl group Chemical class [*:2]C([*:1])=O 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 7
- 238000002425 crystallisation Methods 0.000 description 7
- 230000008025 crystallization Effects 0.000 description 7
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 150000002085 enols Chemical class 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N sulfur dioxide Inorganic materials O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 150000008063 acylals Chemical class 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OJVAMHKKJGICOG-UHFFFAOYSA-N 2,5-hexanedione Chemical compound CC(=O)CCC(C)=O OJVAMHKKJGICOG-UHFFFAOYSA-N 0.000 description 4
- GVQZPZSQRCXSJI-UHFFFAOYSA-N 3-amino-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound NC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1OC1=CC=CC=C1 GVQZPZSQRCXSJI-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 230000000630 rising effect Effects 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- ZYZWOSIRFVIBRH-UHFFFAOYSA-N chloroform;cyclohexane Chemical compound ClC(Cl)Cl.C1CCCCC1 ZYZWOSIRFVIBRH-UHFFFAOYSA-N 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 150000002373 hemiacetals Chemical class 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- KEHNRUNQZGRQHU-UHFFFAOYSA-N 4-oxopentanal Chemical compound CC(=O)CCC=O KEHNRUNQZGRQHU-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical class C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 150000002084 enol ethers Chemical class 0.000 description 2
- 239000000469 ethanolic extract Substances 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 125000001841 imino group Chemical class [H]N=* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- IVQFYPYBOJPSGG-UHFFFAOYSA-N (1-acetyloxy-4-oxobutyl) acetate Chemical compound CC(=O)OC(OC(C)=O)CCC=O IVQFYPYBOJPSGG-UHFFFAOYSA-N 0.000 description 1
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 1
- NNTMDTSGHWLWKT-UHFFFAOYSA-N (5-acetyloxyoxolan-2-yl) acetate Chemical compound CC(=O)OC1CCC(OC(C)=O)O1 NNTMDTSGHWLWKT-UHFFFAOYSA-N 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- BJRGNROMZGSJDC-UHFFFAOYSA-N 1,1,4,4-tetramethoxybutane Chemical compound COC(OC)CCC(OC)OC BJRGNROMZGSJDC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BNCSCBPQSPQFAW-UHFFFAOYSA-N 2,3-dimethylbutanedial Chemical compound O=CC(C)C(C)C=O BNCSCBPQSPQFAW-UHFFFAOYSA-N 0.000 description 1
- FZBDFWKLMTWREJ-ZVSIBQGLSA-N 2,4-bis[(E)-hydroxyiminomethyl]-6-methoxyphenol Chemical compound COc1cc(\C=N\O)cc(\C=N\O)c1O FZBDFWKLMTWREJ-ZVSIBQGLSA-N 0.000 description 1
- ZLKHNURELCONBB-UHFFFAOYSA-N 2,5-diethoxyoxolane Chemical compound CCOC1CCC(OCC)O1 ZLKHNURELCONBB-UHFFFAOYSA-N 0.000 description 1
- JZMAQAZVYWQWNQ-UHFFFAOYSA-N 3-(2,5-dimethylpyrrol-1-yl)-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound CC1=CC=C(C)N1C1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1OC1=CC=CC=C1 JZMAQAZVYWQWNQ-UHFFFAOYSA-N 0.000 description 1
- YPPGEHJVMODTPO-UHFFFAOYSA-N 3-(2-aminoethyl)-4-phenoxy-5-sulfamoylbenzoic acid;hydrochloride Chemical compound Cl.NCCC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1OC1=CC=CC=C1 YPPGEHJVMODTPO-UHFFFAOYSA-N 0.000 description 1
- XPWNKJUPBKTKSI-UHFFFAOYSA-N 3-amino-4-chloro-5-sulfamoylbenzoic acid Chemical compound NC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1Cl XPWNKJUPBKTKSI-UHFFFAOYSA-N 0.000 description 1
- BBCRLBBRTVEVSP-UHFFFAOYSA-N 3-amino-4-phenoxybenzoic acid Chemical compound NC1=CC(C(O)=O)=CC=C1OC1=CC=CC=C1 BBCRLBBRTVEVSP-UHFFFAOYSA-N 0.000 description 1
- QSLDTUTXSKNRGY-UHFFFAOYSA-N 4-phenoxybuta-1,3-dienoxybenzene Chemical compound C=1C=CC=CC=1OC=CC=COC1=CC=CC=C1 QSLDTUTXSKNRGY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- DUOSWBZKCIIXIT-UHFFFAOYSA-N O.CC(O)=O.CC(O)=O.O=CCCC=O Chemical compound O.CC(O)=O.CC(O)=O.O=CCCC=O DUOSWBZKCIIXIT-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 1
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- XBRCQTOOSIDDOJ-GGWOSOGESA-N [(1e,3e)-4-acetyloxybuta-1,3-dienyl] acetate Chemical compound CC(=O)O\C=C\C=C\OC(C)=O XBRCQTOOSIDDOJ-GGWOSOGESA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000012445 acidic reagent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000007854 aminals Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229960002896 clonidine Drugs 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- MPTQRFCYZCXJFQ-UHFFFAOYSA-L copper(II) chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Cu+2] MPTQRFCYZCXJFQ-UHFFFAOYSA-L 0.000 description 1
- WACQKHWOTAEEFS-UHFFFAOYSA-N cyclohexane;ethyl acetate Chemical compound CCOC(C)=O.C1CCCCC1 WACQKHWOTAEEFS-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- VQKLRVZQQYVIJW-UHFFFAOYSA-N dihydralazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=C1 VQKLRVZQQYVIJW-UHFFFAOYSA-N 0.000 description 1
- 229960002877 dihydralazine Drugs 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-N ethanethioic S-acid Chemical class CC(S)=O DUYAAUVXQSMXQP-UHFFFAOYSA-N 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- PFCHFHIRKBAQGU-UHFFFAOYSA-N ethyl n-propyl ketone Natural products CCCC(=O)CC PFCHFHIRKBAQGU-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- ACGDKVXYNVEAGU-UHFFFAOYSA-N guanethidine Chemical compound NC(N)=NCCN1CCCCCCC1 ACGDKVXYNVEAGU-UHFFFAOYSA-N 0.000 description 1
- 229960003602 guanethidine Drugs 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 229960002474 hydralazine Drugs 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- YBSZEWLCECBDIP-UHFFFAOYSA-N n-[bis(dimethylamino)phosphoryl]-n-methylmethanamine Chemical compound CN(C)P(=O)(N(C)C)N(C)C.CN(C)P(=O)(N(C)C)N(C)C YBSZEWLCECBDIP-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- SQDFHQJTAWCFIB-UHFFFAOYSA-N n-methylidenehydroxylamine Chemical compound ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 1
- 229960003147 reserpine Drugs 0.000 description 1
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
- C07D207/327—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (31)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1630976A CH628622A5 (de) | 1976-12-24 | 1976-12-24 | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
| US05/860,533 US4176190A (en) | 1976-12-24 | 1977-12-14 | Diuretic and saliuretic sulphamoylbenzoic acids |
| NL7713916A NL7713916A (nl) | 1976-12-24 | 1977-12-15 | Werkwijze ter bereiding van nieuwe sulfamoyl- benzoezuurderivaten. |
| GB52249/77A GB1592295A (en) | 1976-12-24 | 1977-12-15 | Sulphamoylbenzoic acids |
| FI773846A FI773846A7 (fi) | 1976-12-24 | 1977-12-19 | Foerfarande foer framstaellning av nya sulfamoylbentsoesyror |
| DE19772756783 DE2756783A1 (de) | 1976-12-24 | 1977-12-20 | Sulfamoylbenzoesaeuren |
| NZ186059A NZ186059A (en) | 1976-12-24 | 1977-12-21 | 3-sulphamoyl-5-pyrrolylal-kylbenzoic acid derivatives and pharmaceutical compositions |
| HU77CI1789A HU177298B (en) | 1976-12-24 | 1977-12-22 | Process for producing new sulfamoyl-benzoic acids |
| IE2608/77A IE46279B1 (en) | 1976-12-24 | 1977-12-22 | Sulphamoylbenzoic acids |
| PL1977211756A PL110887B1 (en) | 1976-12-24 | 1977-12-22 | Method of manufacture of novel 4-substituted 3-sulfamoyl-5-pyrrolylalkylbenzoic acids |
| ZA00777629A ZA777629B (en) | 1976-12-24 | 1977-12-22 | Sulphamoylbenzoic acids |
| DD77202894A DD134641A5 (de) | 1976-12-24 | 1977-12-22 | Verfahren zur herstellung neuer sulfamoylbenzoesaeuren |
| PL1977203248A PL110872B1 (en) | 1976-12-24 | 1977-12-22 | Method of manufacture of novel 4-substituted 3-sulfamoyl-5-pyrrolylalkylbenzoic acids |
| IT52333/77A IT1092247B (it) | 1976-12-24 | 1977-12-22 | Acidi solfammoilbenzoici sostituiti e procedimento per produrli |
| AU31864/77A AU515286B2 (en) | 1976-12-24 | 1977-12-22 | Derivatives of 3-sulphamoyl 5-pyrrolyalkylbenzoic acid |
| SE7714656A SE7714656L (sv) | 1976-12-24 | 1977-12-22 | Sulfamoylbensoesyror |
| FR7738857A FR2375211A1 (fr) | 1976-12-24 | 1977-12-22 | Nouveaux acides sulfamoylbenzoiques, leur preparation et leur application en tant que medicaments |
| CA293,789A CA1083160A (en) | 1976-12-24 | 1977-12-22 | Process for the preparation of new sulphamoylbenzoic acids |
| PL1977211757A PL112696B1 (en) | 1976-12-24 | 1977-12-22 | Process for preparing novel,4-substituted 3-sulfamoyl-5-pyrrolylalkylbenzoic acids |
| DK575177A DK575177A (da) | 1976-12-24 | 1977-12-22 | Fremgangsmaade til fremstilling af sulfamoylbenzoesyrer isaer i4-stilling substituerede 3-sulfamoyl-5-pyrrolylalkylbenzoesyrer og salte deraf |
| BE183803A BE862275A (fr) | 1976-12-24 | 1977-12-23 | Nouveaux acides sulfamoylbenzoiques, leur preparatrion et leur application en tant que medicaments |
| ES465390A ES465390A1 (es) | 1976-12-24 | 1977-12-23 | Procedimiento para la obtencion de acidos 3-sulfamoil-5-pi- rrolilalquibenzoicos-sustituidos. |
| NO774451A NO774451L (no) | 1976-12-24 | 1977-12-23 | Fremgangsmaate til fremstilling av nye sulfamoylbenzoesyrer |
| AT928177A AT362350B (de) | 1976-12-24 | 1977-12-23 | Verfahren zur herstellung neuer in 4-stellung substituierter 3-sulfamoylbenzoesaeuren und ihrer salze |
| JP15510677A JPS5379858A (en) | 1976-12-24 | 1977-12-24 | Sulfamoylbenzoate |
| AT505779A AT362352B (de) | 1976-12-24 | 1979-07-23 | Verfahren zur herstellung von neuen in 4- -stellung substituierten 3-sulfamoyl-5- -pyrrolyl- bzw. pyrrolylalkylbenzoesaeuren und ihren salzen |
| AT505879A AT362353B (de) | 1976-12-24 | 1979-07-23 | Verfahren zur herstellung von neuen in 4- -stellung substituierten 3-sulfamoyl-5-pyrrolyl - oder -5-pyrrolylalkylbenzoesaeuren und ihren salzen |
| AT777479A AT362354B (de) | 1976-12-24 | 1979-12-07 | Verfahren zur herstellung neuer in 4-stellung substituierter 3-sulfamoyl-5-pyrrolyl- bzw. -5-pyrrolylalkyl-benzoesaeuren und ihrer salze |
| CH880580A CH625216A5 (enExample) | 1976-12-24 | 1980-11-27 | |
| CH880680A CH625217A5 (enExample) | 1976-12-24 | 1980-11-27 | |
| CH880480A CH625215A5 (enExample) | 1976-12-24 | 1980-11-27 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1630976A CH628622A5 (de) | 1976-12-24 | 1976-12-24 | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH628622A5 true CH628622A5 (de) | 1982-03-15 |
Family
ID=4416194
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1630976A CH628622A5 (de) | 1976-12-24 | 1976-12-24 | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
| CH880680A CH625217A5 (enExample) | 1976-12-24 | 1980-11-27 | |
| CH880480A CH625215A5 (enExample) | 1976-12-24 | 1980-11-27 | |
| CH880580A CH625216A5 (enExample) | 1976-12-24 | 1980-11-27 |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH880680A CH625217A5 (enExample) | 1976-12-24 | 1980-11-27 | |
| CH880480A CH625215A5 (enExample) | 1976-12-24 | 1980-11-27 | |
| CH880580A CH625216A5 (enExample) | 1976-12-24 | 1980-11-27 |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4176190A (enExample) |
| JP (1) | JPS5379858A (enExample) |
| AT (1) | AT362350B (enExample) |
| AU (1) | AU515286B2 (enExample) |
| BE (1) | BE862275A (enExample) |
| CA (1) | CA1083160A (enExample) |
| CH (4) | CH628622A5 (enExample) |
| DD (1) | DD134641A5 (enExample) |
| DE (1) | DE2756783A1 (enExample) |
| DK (1) | DK575177A (enExample) |
| ES (1) | ES465390A1 (enExample) |
| FI (1) | FI773846A7 (enExample) |
| FR (1) | FR2375211A1 (enExample) |
| GB (1) | GB1592295A (enExample) |
| HU (1) | HU177298B (enExample) |
| IE (1) | IE46279B1 (enExample) |
| IT (1) | IT1092247B (enExample) |
| NL (1) | NL7713916A (enExample) |
| NO (1) | NO774451L (enExample) |
| NZ (1) | NZ186059A (enExample) |
| PL (3) | PL112696B1 (enExample) |
| SE (1) | SE7714656L (enExample) |
| ZA (1) | ZA777629B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7714062A (nl) * | 1976-12-24 | 1978-06-27 | Hoechst Ag | Werkwijze voor de bereiding van pyrrolo-benzoe- zuur-derivaten. |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| DE2966048D1 (en) * | 1978-07-20 | 1983-09-15 | Basf Ag | N-arylsulfonyl pyrroles, their preparation and medicaments containing them |
| DE2917997A1 (de) * | 1979-05-04 | 1980-11-20 | Hoechst Ag | Substituierte pyrrolidinyl-benzoesaeure- derivate und verfahren zu ihrer herstellung |
| CA1341128C (en) * | 1989-06-27 | 2000-10-24 | Borden Chemical, Inc. | Optical fiber array |
| US5908858A (en) | 1996-04-05 | 1999-06-01 | Sankyo Company, Limited | 1,2-diphenylpyrrole derivatives, their preparation and their therapeutic uses |
| AU2008274941A1 (en) | 2007-07-12 | 2009-01-15 | Tragara Pharmaceuticals, Inc. | Methods and compositions for the treatment of cancer, tumors, and tumor-related disorders |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3565920A (en) * | 1966-12-29 | 1971-02-23 | Ciba Geigy Corp | 5-sulfamyl-anthranilic acids |
| US3534027A (en) * | 1968-04-25 | 1970-10-13 | Hoffmann La Roche | Pyrrolyl ethylamino sulfamoyl benzoic acids,esters and salts thereof |
| US3939267A (en) * | 1972-10-13 | 1976-02-17 | Ciba-Geigy Corporation | 4-Ethers of 3-amino-5-sulfamoylbenzoic acids |
| DE2419970C3 (de) * | 1974-04-25 | 1980-06-12 | Hoechst Ag, 6000 Frankfurt | 3-<l-Pyrrolidinyl)-4-phenoxy-5sulfamoylbenzoesäure und Verfahren zu ihrer Herstellung |
| US4093735A (en) * | 1974-04-25 | 1978-06-06 | Hoechst Aktiengesellschaft | 5-Sulfamoylbenzoic acid derivatives carrying a heterocyclic substituent |
| GB1523631A (en) * | 1975-07-08 | 1978-09-06 | Leo Pharm Prod Ltd | Sulphonamide derivatives |
-
1976
- 1976-12-24 CH CH1630976A patent/CH628622A5/de not_active IP Right Cessation
-
1977
- 1977-12-14 US US05/860,533 patent/US4176190A/en not_active Expired - Lifetime
- 1977-12-15 NL NL7713916A patent/NL7713916A/xx not_active Application Discontinuation
- 1977-12-15 GB GB52249/77A patent/GB1592295A/en not_active Expired
- 1977-12-19 FI FI773846A patent/FI773846A7/fi not_active Application Discontinuation
- 1977-12-20 DE DE19772756783 patent/DE2756783A1/de not_active Withdrawn
- 1977-12-21 NZ NZ186059A patent/NZ186059A/xx unknown
- 1977-12-22 IT IT52333/77A patent/IT1092247B/it active
- 1977-12-22 PL PL1977211757A patent/PL112696B1/pl unknown
- 1977-12-22 DK DK575177A patent/DK575177A/da unknown
- 1977-12-22 ZA ZA00777629A patent/ZA777629B/xx unknown
- 1977-12-22 CA CA293,789A patent/CA1083160A/en not_active Expired
- 1977-12-22 HU HU77CI1789A patent/HU177298B/hu unknown
- 1977-12-22 FR FR7738857A patent/FR2375211A1/fr active Granted
- 1977-12-22 IE IE2608/77A patent/IE46279B1/en unknown
- 1977-12-22 AU AU31864/77A patent/AU515286B2/en not_active Expired
- 1977-12-22 PL PL1977203248A patent/PL110872B1/pl unknown
- 1977-12-22 PL PL1977211756A patent/PL110887B1/pl unknown
- 1977-12-22 SE SE7714656A patent/SE7714656L/xx not_active Application Discontinuation
- 1977-12-22 DD DD77202894A patent/DD134641A5/xx unknown
- 1977-12-23 NO NO774451A patent/NO774451L/no unknown
- 1977-12-23 AT AT928177A patent/AT362350B/de not_active IP Right Cessation
- 1977-12-23 BE BE183803A patent/BE862275A/xx unknown
- 1977-12-23 ES ES465390A patent/ES465390A1/es not_active Expired
- 1977-12-24 JP JP15510677A patent/JPS5379858A/ja active Pending
-
1980
- 1980-11-27 CH CH880680A patent/CH625217A5/de not_active IP Right Cessation
- 1980-11-27 CH CH880480A patent/CH625215A5/de not_active IP Right Cessation
- 1980-11-27 CH CH880580A patent/CH625216A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE862275A (fr) | 1978-06-23 |
| FI773846A7 (fi) | 1978-06-25 |
| NO774451L (no) | 1978-06-27 |
| AU515286B2 (en) | 1981-03-26 |
| SE7714656L (sv) | 1978-06-25 |
| NZ186059A (en) | 1979-11-01 |
| CH625215A5 (enExample) | 1981-09-15 |
| IE46279B1 (en) | 1983-04-20 |
| AT362350B (de) | 1981-05-11 |
| CA1083160A (en) | 1980-08-05 |
| ES465390A1 (es) | 1978-09-16 |
| FR2375211A1 (fr) | 1978-07-21 |
| FR2375211B1 (enExample) | 1981-07-17 |
| HU177298B (en) | 1981-09-28 |
| US4176190A (en) | 1979-11-27 |
| IT1092247B (it) | 1985-07-06 |
| IE46279L (en) | 1978-06-24 |
| DK575177A (da) | 1978-06-25 |
| AU3186477A (en) | 1979-06-28 |
| GB1592295A (en) | 1981-07-01 |
| PL203248A1 (pl) | 1978-12-04 |
| CH625217A5 (enExample) | 1981-09-15 |
| ZA777629B (en) | 1978-10-25 |
| ATA928177A (de) | 1980-10-15 |
| PL110887B1 (en) | 1980-08-30 |
| PL110872B1 (en) | 1980-08-30 |
| JPS5379858A (en) | 1978-07-14 |
| DE2756783A1 (de) | 1978-06-29 |
| NL7713916A (nl) | 1978-06-27 |
| PL112696B1 (en) | 1980-10-31 |
| DD134641A5 (de) | 1979-03-14 |
| CH625216A5 (enExample) | 1981-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69112863T2 (de) | Benzimidazo- und Azabenzimidazol-Derivate, Tromboxanrezeptorantagonisten, Verfahren zu deren Herstellung, Herstellungszwischenprodukte, diese enthaltende Zusammenstellungen. | |
| DE2636582C2 (de) | 2-Amino-3-(5- und 6-)benzoylphenylessigsäuren, deren Ester und Metallsalze, Verfahren zur Herstellung dieser Verbindungen und Arzneimittel diese enthaltend | |
| AT363096B (de) | Verfahren zur herstellung von neuen phthalazinderivaten und deren salzen | |
| DE2527937A1 (de) | Benzcycloamidderivate und verfahren zu ihrer herstellung sowie pharmazeutische mittel, worin sie enthalten sind | |
| DD251973A5 (de) | Verfahren zur herstellung von 3(2h)-pyridazinon-derivaten | |
| DE1620442C3 (de) | Verfahren zur Herstellung von 1-Acylindolverbindungen | |
| CH628622A5 (de) | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. | |
| DE3103372A1 (de) | Neue indanyl-derivate, ihre herstellung und verwendung | |
| EP0039519B1 (de) | Substituierte Thienotricyclen, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| IL44311A (en) | Alpha-(5-oxo-10,11-dihydrodibenzo (a,d) cyclohepten-2-yl)-alkanoic acid derivatives processes for their preparation and pharmaceutical compositions containing them | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3102769A1 (de) | "bis-moranolinderivate" | |
| CH647769A5 (de) | Disulfidverbindungen. | |
| CH498125A (de) | Verfahren zur Herstellung von Nitroimidazolen | |
| DE2106038C3 (de) | 2-Imidazolin-2-ylamino-benzo [b] thiophene und diese enthaltende pharmazeutische Präparate | |
| DE1643198B2 (de) | Diary Icy clopropanderivate und Verfahren zu deren Herstellung | |
| DE2234255B2 (de) | Xanthon-2-carbonsäuren, deren pharmakologisch nicht toxische Salze sowie Alkylester mit 1 bis 5 Kohlenstoffatomen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel | |
| DE3232922A1 (de) | Sulfamoylbenzophenon-derivate, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen | |
| DE2512702C2 (de) | Substituierte 1-Amino-3-phenyl-indole, deren Salze und Verfahren zu ihrer Herstellung | |
| DE2319280A1 (de) | 1-substituierte pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| AT354432B (de) | Verfahren zur herstellung von 3-indolylessig- saeuren | |
| DE3445011A1 (de) | Neues anilinderivat, verfahren zu seiner herstellung und seine verwendung | |
| AT373588B (de) | Verfahren zur herstellung von neuen substituierten 1-benzoyl-2-phenylimino-imidazolidinen und von deren salzen | |
| DE1252204B (de) | Verfahren zur Herstellung von 2,4-Dinitropyrrolderivaten | |
| AT253504B (de) | Verfahren zur Herstellung der neuen α-Amino-3-hydroxy-5-isoxazolessigsäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |