SE7714656L - Sulfamoylbensoesyror - Google Patents
SulfamoylbensoesyrorInfo
- Publication number
- SE7714656L SE7714656L SE7714656A SE7714656A SE7714656L SE 7714656 L SE7714656 L SE 7714656L SE 7714656 A SE7714656 A SE 7714656A SE 7714656 A SE7714656 A SE 7714656A SE 7714656 L SE7714656 L SE 7714656L
- Authority
- SE
- Sweden
- Prior art keywords
- acids
- substituted
- lower alkyl
- aryl radical
- unsubstituted
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- 150000007513 acids Chemical class 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 150000005840 aryl radicals Chemical class 0.000 abstract 2
- -1 1-pyrrolyl radical Chemical class 0.000 abstract 1
- KDNIOKSLVIGAAN-UHFFFAOYSA-N 2-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=CC=C1C(O)=O KDNIOKSLVIGAAN-UHFFFAOYSA-N 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000002934 diuretic Substances 0.000 abstract 1
- 229940030606 diuretics Drugs 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 150000002431 hydrogen Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 230000000894 saliuretic effect Effects 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
- C07D207/327—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1630976A CH628622A5 (de) | 1976-12-24 | 1976-12-24 | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE7714656L true SE7714656L (sv) | 1978-06-25 |
Family
ID=4416194
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7714656A SE7714656L (sv) | 1976-12-24 | 1977-12-22 | Sulfamoylbensoesyror |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4176190A (enExample) |
| JP (1) | JPS5379858A (enExample) |
| AT (1) | AT362350B (enExample) |
| AU (1) | AU515286B2 (enExample) |
| BE (1) | BE862275A (enExample) |
| CA (1) | CA1083160A (enExample) |
| CH (4) | CH628622A5 (enExample) |
| DD (1) | DD134641A5 (enExample) |
| DE (1) | DE2756783A1 (enExample) |
| DK (1) | DK575177A (enExample) |
| ES (1) | ES465390A1 (enExample) |
| FI (1) | FI773846A7 (enExample) |
| FR (1) | FR2375211A1 (enExample) |
| GB (1) | GB1592295A (enExample) |
| HU (1) | HU177298B (enExample) |
| IE (1) | IE46279B1 (enExample) |
| IT (1) | IT1092247B (enExample) |
| NL (1) | NL7713916A (enExample) |
| NO (1) | NO774451L (enExample) |
| NZ (1) | NZ186059A (enExample) |
| PL (3) | PL112696B1 (enExample) |
| SE (1) | SE7714656L (enExample) |
| ZA (1) | ZA777629B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7714062A (nl) * | 1976-12-24 | 1978-06-27 | Hoechst Ag | Werkwijze voor de bereiding van pyrrolo-benzoe- zuur-derivaten. |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| DE2966048D1 (en) * | 1978-07-20 | 1983-09-15 | Basf Ag | N-arylsulfonyl pyrroles, their preparation and medicaments containing them |
| DE2917997A1 (de) * | 1979-05-04 | 1980-11-20 | Hoechst Ag | Substituierte pyrrolidinyl-benzoesaeure- derivate und verfahren zu ihrer herstellung |
| CA1341128C (en) * | 1989-06-27 | 2000-10-24 | Borden Chemical, Inc. | Optical fiber array |
| US5908858A (en) | 1996-04-05 | 1999-06-01 | Sankyo Company, Limited | 1,2-diphenylpyrrole derivatives, their preparation and their therapeutic uses |
| AU2008274941A1 (en) | 2007-07-12 | 2009-01-15 | Tragara Pharmaceuticals, Inc. | Methods and compositions for the treatment of cancer, tumors, and tumor-related disorders |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3565920A (en) * | 1966-12-29 | 1971-02-23 | Ciba Geigy Corp | 5-sulfamyl-anthranilic acids |
| US3534027A (en) * | 1968-04-25 | 1970-10-13 | Hoffmann La Roche | Pyrrolyl ethylamino sulfamoyl benzoic acids,esters and salts thereof |
| US3939267A (en) * | 1972-10-13 | 1976-02-17 | Ciba-Geigy Corporation | 4-Ethers of 3-amino-5-sulfamoylbenzoic acids |
| DE2419970C3 (de) * | 1974-04-25 | 1980-06-12 | Hoechst Ag, 6000 Frankfurt | 3-<l-Pyrrolidinyl)-4-phenoxy-5sulfamoylbenzoesäure und Verfahren zu ihrer Herstellung |
| US4093735A (en) * | 1974-04-25 | 1978-06-06 | Hoechst Aktiengesellschaft | 5-Sulfamoylbenzoic acid derivatives carrying a heterocyclic substituent |
| GB1523631A (en) * | 1975-07-08 | 1978-09-06 | Leo Pharm Prod Ltd | Sulphonamide derivatives |
-
1976
- 1976-12-24 CH CH1630976A patent/CH628622A5/de not_active IP Right Cessation
-
1977
- 1977-12-14 US US05/860,533 patent/US4176190A/en not_active Expired - Lifetime
- 1977-12-15 NL NL7713916A patent/NL7713916A/xx not_active Application Discontinuation
- 1977-12-15 GB GB52249/77A patent/GB1592295A/en not_active Expired
- 1977-12-19 FI FI773846A patent/FI773846A7/fi not_active Application Discontinuation
- 1977-12-20 DE DE19772756783 patent/DE2756783A1/de not_active Withdrawn
- 1977-12-21 NZ NZ186059A patent/NZ186059A/xx unknown
- 1977-12-22 IT IT52333/77A patent/IT1092247B/it active
- 1977-12-22 PL PL1977211757A patent/PL112696B1/pl unknown
- 1977-12-22 DK DK575177A patent/DK575177A/da unknown
- 1977-12-22 ZA ZA00777629A patent/ZA777629B/xx unknown
- 1977-12-22 CA CA293,789A patent/CA1083160A/en not_active Expired
- 1977-12-22 HU HU77CI1789A patent/HU177298B/hu unknown
- 1977-12-22 FR FR7738857A patent/FR2375211A1/fr active Granted
- 1977-12-22 IE IE2608/77A patent/IE46279B1/en unknown
- 1977-12-22 AU AU31864/77A patent/AU515286B2/en not_active Expired
- 1977-12-22 PL PL1977203248A patent/PL110872B1/pl unknown
- 1977-12-22 PL PL1977211756A patent/PL110887B1/pl unknown
- 1977-12-22 SE SE7714656A patent/SE7714656L/xx not_active Application Discontinuation
- 1977-12-22 DD DD77202894A patent/DD134641A5/xx unknown
- 1977-12-23 NO NO774451A patent/NO774451L/no unknown
- 1977-12-23 AT AT928177A patent/AT362350B/de not_active IP Right Cessation
- 1977-12-23 BE BE183803A patent/BE862275A/xx unknown
- 1977-12-23 ES ES465390A patent/ES465390A1/es not_active Expired
- 1977-12-24 JP JP15510677A patent/JPS5379858A/ja active Pending
-
1980
- 1980-11-27 CH CH880680A patent/CH625217A5/de not_active IP Right Cessation
- 1980-11-27 CH CH880480A patent/CH625215A5/de not_active IP Right Cessation
- 1980-11-27 CH CH880580A patent/CH625216A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE862275A (fr) | 1978-06-23 |
| FI773846A7 (fi) | 1978-06-25 |
| NO774451L (no) | 1978-06-27 |
| AU515286B2 (en) | 1981-03-26 |
| NZ186059A (en) | 1979-11-01 |
| CH625215A5 (enExample) | 1981-09-15 |
| IE46279B1 (en) | 1983-04-20 |
| AT362350B (de) | 1981-05-11 |
| CA1083160A (en) | 1980-08-05 |
| ES465390A1 (es) | 1978-09-16 |
| FR2375211A1 (fr) | 1978-07-21 |
| FR2375211B1 (enExample) | 1981-07-17 |
| HU177298B (en) | 1981-09-28 |
| US4176190A (en) | 1979-11-27 |
| IT1092247B (it) | 1985-07-06 |
| IE46279L (en) | 1978-06-24 |
| DK575177A (da) | 1978-06-25 |
| AU3186477A (en) | 1979-06-28 |
| GB1592295A (en) | 1981-07-01 |
| PL203248A1 (pl) | 1978-12-04 |
| CH625217A5 (enExample) | 1981-09-15 |
| ZA777629B (en) | 1978-10-25 |
| ATA928177A (de) | 1980-10-15 |
| PL110887B1 (en) | 1980-08-30 |
| CH628622A5 (de) | 1982-03-15 |
| PL110872B1 (en) | 1980-08-30 |
| JPS5379858A (en) | 1978-07-14 |
| DE2756783A1 (de) | 1978-06-29 |
| NL7713916A (nl) | 1978-06-27 |
| PL112696B1 (en) | 1980-10-31 |
| DD134641A5 (de) | 1979-03-14 |
| CH625216A5 (enExample) | 1981-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE8401135D0 (sv) | Forfarande for framstellning av iso-cyklosporin d | |
| ES457050A1 (es) | Un procedimiento para la preparacion de aminoacidos cicli- cos. | |
| JPS56154467A (en) | Novel pyrimidine-2-sulfide compound | |
| FR2375218A1 (fr) | 2-imidazoline-5-ones a substitution chirale | |
| TR24694A (tr) | Boecek oeldueruecue olarak n-fenilpirazol tuerevleri | |
| SE8104783L (sv) | Heterocykliska foreningar | |
| ATE2017T1 (de) | Mischungen von optischen aufhellern und deren verwendung. | |
| FR2390537A1 (fr) | Melanges d'azureurs optiques derivant du stilbene | |
| SE7714656L (sv) | Sulfamoylbensoesyror | |
| ES444913A1 (es) | Perfeccionamientos en-o relacionados con compuestos organi- cos. | |
| SE7704616L (sv) | Sett att framstella nya 11-desoxi-prostaglandin-fÿ2-derivat | |
| FR2375239A1 (fr) | Derives d'acide 7-amino-8-oxo-3-oxa-1-azabicyclo-(4.2.0)octane-2-carboxylique | |
| SE7713704L (sv) | Propionsyraderivat och sett for framstellning av desamma | |
| DK33680A (da) | Derivater af 2-hydroxynaphthalen og diazotypimateriale indeholdende saadanne derivater | |
| SE7514459L (sv) | Alifatiska sulfamat | |
| FR2357558A1 (fr) | 2,6-methano-2h-1-benzoxocines | |
| FR2359832A1 (fr) | 1,3,5-tris-(2-chloroformyl-oxyethyl)-isocyanurate | |
| ATE4554T1 (de) | Mischungen von optischen aufhellern. | |
| SE7903336L (sv) | N-alkenylmoranolin-derivat | |
| FR2446284A1 (fr) | Tetrahydro-benzo(c)quinoleine-9(8h)ones | |
| GB2015557A (en) | Disperse anthraquinone dyes | |
| FR2355823A1 (fr) | Derives isoindoliques | |
| ES388013A1 (es) | Procedimiento para la obtencion de sulfenamidas del acido 2-formilpropil-sulfenico-(2). | |
| SE7701732L (sv) | 1,2,3-oxadiazolamider | |
| GB1511724A (en) | Substituted benzimidazoles |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAV | Patent application has lapsed |
Ref document number: 7714656-1 |