CA1194832A - Acid copper electroplating baths containing brightening and leveling additives - Google Patents
Acid copper electroplating baths containing brightening and leveling additivesInfo
- Publication number
- CA1194832A CA1194832A CA000403086A CA403086A CA1194832A CA 1194832 A CA1194832 A CA 1194832A CA 000403086 A CA000403086 A CA 000403086A CA 403086 A CA403086 A CA 403086A CA 1194832 A CA1194832 A CA 1194832A
- Authority
- CA
- Canada
- Prior art keywords
- group
- carbon atoms
- alkyl
- hydrogen
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 title claims abstract description 67
- 229910052802 copper Inorganic materials 0.000 title claims abstract description 67
- 239000010949 copper Substances 0.000 title claims abstract description 67
- 239000002253 acid Substances 0.000 title claims description 43
- 238000009713 electroplating Methods 0.000 title claims description 25
- 239000000654 additive Substances 0.000 title abstract description 23
- 238000005282 brightening Methods 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 36
- RMGVZKRVHHSUIM-UHFFFAOYSA-N dithionic acid Chemical compound OS(=O)(=O)S(O)(=O)=O RMGVZKRVHHSUIM-UHFFFAOYSA-N 0.000 claims abstract description 29
- 229920000570 polyether Polymers 0.000 claims abstract description 17
- 239000004721 Polyphenylene oxide Substances 0.000 claims abstract description 15
- 229940100198 alkylating agent Drugs 0.000 claims abstract description 14
- 239000002168 alkylating agent Substances 0.000 claims abstract description 14
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 12
- 230000002378 acidificating effect Effects 0.000 claims abstract description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 52
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 42
- 150000002431 hydrogen Chemical group 0.000 claims description 24
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 21
- -1 alkylene halide Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 18
- 125000000623 heterocyclic group Chemical group 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 229910052717 sulfur Inorganic materials 0.000 claims description 14
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 14
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims description 13
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical group ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims description 12
- 229940073608 benzyl chloride Drugs 0.000 claims description 12
- WGJCBBASTRWVJL-UHFFFAOYSA-N 1,3-thiazolidine-2-thione Chemical class SC1=NCCS1 WGJCBBASTRWVJL-UHFFFAOYSA-N 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- 125000004429 atom Chemical class 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 150000002430 hydrocarbons Chemical class 0.000 claims description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 6
- AFEITPOSEVENMK-UHFFFAOYSA-N 1-(2-hydroxyethyl)imidazolidine-2-thione Chemical class OCCN1CCNC1=S AFEITPOSEVENMK-UHFFFAOYSA-N 0.000 claims description 5
- 239000012990 dithiocarbamate Substances 0.000 claims description 5
- 150000003585 thioureas Chemical class 0.000 claims description 5
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical class NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 claims description 4
- NXRIDTLKJCKPOG-UHFFFAOYSA-N 1,4-dihydroimidazole-5-thione Chemical class S=C1CN=CN1 NXRIDTLKJCKPOG-UHFFFAOYSA-N 0.000 claims description 4
- JINXYLZMLZNPAR-UHFFFAOYSA-N 1-sulfanylidene-1,3-benzothiazole Chemical class C1=CC=C2S(=S)C=NC2=C1 JINXYLZMLZNPAR-UHFFFAOYSA-N 0.000 claims description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims 5
- 239000011260 aqueous acid Substances 0.000 claims 4
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 claims 4
- 125000003118 aryl group Chemical group 0.000 claims 3
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical class SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 claims 3
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 claims 2
- 150000002466 imines Chemical class 0.000 claims 1
- 229920001281 polyalkylene Polymers 0.000 claims 1
- 239000002659 electrodeposit Substances 0.000 abstract description 6
- 238000004070 electrodeposition Methods 0.000 abstract description 4
- 229940108928 copper Drugs 0.000 description 29
- 230000000996 additive effect Effects 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000007747 plating Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241001061127 Thione Species 0.000 description 3
- 235000014987 copper Nutrition 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 2
- 229920002873 Polyethylenimine Polymers 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102100038916 Caspase-5 Human genes 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- HJEINPVZRDJRBY-UHFFFAOYSA-N Disul Chemical compound OS(=O)(=O)OCCOC1=CC=C(Cl)C=C1Cl HJEINPVZRDJRBY-UHFFFAOYSA-N 0.000 description 1
- 101100112336 Homo sapiens CASP5 gene Proteins 0.000 description 1
- 101100273286 Mus musculus Casp4 gene Proteins 0.000 description 1
- GMEHFXXZSWDEDB-UHFFFAOYSA-N N-ethylthiourea Chemical compound CCNC(N)=S GMEHFXXZSWDEDB-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229910001651 emery Inorganic materials 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- DHHVAGZRUROJKS-UHFFFAOYSA-N phentermine Chemical compound CC(C)(N)CC1=CC=CC=C1 DHHVAGZRUROJKS-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- DHHZMMARLMPOOK-UHFFFAOYSA-N propyl n-ethylcarbamodithioate Chemical compound CCCSC(=S)NCC DHHZMMARLMPOOK-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/38—Electroplating: Baths therefor from solutions of copper
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electroplating And Plating Baths Therefor (AREA)
- Chemically Coating (AREA)
- Paints Or Removers (AREA)
- Electrolytic Production Of Metals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/277,057 US4376685A (en) | 1981-06-24 | 1981-06-24 | Acid copper electroplating baths containing brightening and leveling additives |
| US277,057 | 1981-06-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1194832A true CA1194832A (en) | 1985-10-08 |
Family
ID=23059225
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000403086A Expired CA1194832A (en) | 1981-06-24 | 1982-05-17 | Acid copper electroplating baths containing brightening and leveling additives |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4376685A (enExample) |
| EP (1) | EP0068807B1 (enExample) |
| JP (1) | JPS583991A (enExample) |
| AT (1) | ATE26312T1 (enExample) |
| AU (1) | AU548506B2 (enExample) |
| CA (1) | CA1194832A (enExample) |
| DE (1) | DE3275936D1 (enExample) |
Families Citing this family (121)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4490220A (en) * | 1982-09-30 | 1984-12-25 | Learonal, Inc. | Electrolytic copper plating solutions |
| US4781801A (en) * | 1987-02-03 | 1988-11-01 | Mcgean-Rohco, Inc. | Method of copper plating gravure rolls |
| US4948474A (en) * | 1987-09-18 | 1990-08-14 | Pennsylvania Research Corporation | Copper electroplating solutions and methods |
| US4786746A (en) * | 1987-09-18 | 1988-11-22 | Pennsylvania Research Corporation | Copper electroplating solutions and methods of making and using them |
| US5051154A (en) * | 1988-08-23 | 1991-09-24 | Shipley Company Inc. | Additive for acid-copper electroplating baths to increase throwing power |
| US6375741B2 (en) | 1991-03-06 | 2002-04-23 | Timothy J. Reardon | Semiconductor processing spray coating apparatus |
| US5232575A (en) * | 1990-07-26 | 1993-08-03 | Mcgean-Rohco, Inc. | Polymeric leveling additive for acid electroplating baths |
| DE4032864A1 (de) * | 1990-10-13 | 1992-04-16 | Schering Ag | Saures bad zur galvanischen abscheidung von kupferueberzuegen und verfahren unter verwendung dieser kombination |
| US5252196A (en) * | 1991-12-05 | 1993-10-12 | Shipley Company Inc. | Copper electroplating solutions and processes |
| US5607570A (en) * | 1994-10-31 | 1997-03-04 | Rohbani; Elias | Electroplating solution |
| GB9526325D0 (en) * | 1995-12-22 | 1996-02-21 | Bp Exploration Operating | Inhibitors |
| GB2323095B (en) * | 1995-12-22 | 2000-06-28 | Bp Exploration Operating | Wax Deposit Inhibitors |
| US6709562B1 (en) | 1995-12-29 | 2004-03-23 | International Business Machines Corporation | Method of making electroplated interconnection structures on integrated circuit chips |
| US6946716B2 (en) * | 1995-12-29 | 2005-09-20 | International Business Machines Corporation | Electroplated interconnection structures on integrated circuit chips |
| US5730854A (en) * | 1996-05-30 | 1998-03-24 | Enthone-Omi, Inc. | Alkoxylated dimercaptans as copper additives and de-polarizing additives |
| US6276072B1 (en) * | 1997-07-10 | 2001-08-21 | Applied Materials, Inc. | Method and apparatus for heating and cooling substrates |
| DE19758121C2 (de) * | 1997-12-17 | 2000-04-06 | Atotech Deutschland Gmbh | Wäßriges Bad und Verfahren zum elektrolytischen Abscheiden von Kupferschichten |
| EP1019954B1 (en) | 1998-02-04 | 2013-05-15 | Applied Materials, Inc. | Method and apparatus for low-temperature annealing of electroplated copper micro-structures in the production of a microelectronic device |
| US7244677B2 (en) * | 1998-02-04 | 2007-07-17 | Semitool. Inc. | Method for filling recessed micro-structures with metallization in the production of a microelectronic device |
| US6632292B1 (en) * | 1998-03-13 | 2003-10-14 | Semitool, Inc. | Selective treatment of microelectronic workpiece surfaces |
| US6113771A (en) * | 1998-04-21 | 2000-09-05 | Applied Materials, Inc. | Electro deposition chemistry |
| EP0991795B1 (en) | 1998-04-21 | 2006-02-22 | Applied Materials, Inc. | Electro-chemical deposition system and method of electroplating on substrates |
| US6416647B1 (en) | 1998-04-21 | 2002-07-09 | Applied Materials, Inc. | Electro-chemical deposition cell for face-up processing of single semiconductor substrates |
| US6994776B2 (en) * | 1998-06-01 | 2006-02-07 | Semitool Inc. | Method and apparatus for low temperature annealing of metallization micro-structure in the production of a microelectronic device |
| US6258220B1 (en) | 1998-11-30 | 2001-07-10 | Applied Materials, Inc. | Electro-chemical deposition system |
| US6267853B1 (en) | 1999-07-09 | 2001-07-31 | Applied Materials, Inc. | Electro-chemical deposition system |
| US6228233B1 (en) | 1998-11-30 | 2001-05-08 | Applied Materials, Inc. | Inflatable compliant bladder assembly |
| US6290865B1 (en) | 1998-11-30 | 2001-09-18 | Applied Materials, Inc. | Spin-rinse-drying process for electroplated semiconductor wafers |
| US6254760B1 (en) | 1999-03-05 | 2001-07-03 | Applied Materials, Inc. | Electro-chemical deposition system and method |
| US6379522B1 (en) | 1999-01-11 | 2002-04-30 | Applied Materials, Inc. | Electrodeposition chemistry for filling of apertures with reflective metal |
| US6544399B1 (en) | 1999-01-11 | 2003-04-08 | Applied Materials, Inc. | Electrodeposition chemistry for filling apertures with reflective metal |
| US7192494B2 (en) * | 1999-03-05 | 2007-03-20 | Applied Materials, Inc. | Method and apparatus for annealing copper films |
| US6136163A (en) * | 1999-03-05 | 2000-10-24 | Applied Materials, Inc. | Apparatus for electro-chemical deposition with thermal anneal chamber |
| US6582578B1 (en) | 1999-04-08 | 2003-06-24 | Applied Materials, Inc. | Method and associated apparatus for tilting a substrate upon entry for metal deposition |
| US6837978B1 (en) | 1999-04-08 | 2005-01-04 | Applied Materials, Inc. | Deposition uniformity control for electroplating apparatus, and associated method |
| US6585876B2 (en) | 1999-04-08 | 2003-07-01 | Applied Materials Inc. | Flow diffuser to be used in electro-chemical plating system and method |
| US6551484B2 (en) | 1999-04-08 | 2003-04-22 | Applied Materials, Inc. | Reverse voltage bias for electro-chemical plating system and method |
| US6662673B1 (en) | 1999-04-08 | 2003-12-16 | Applied Materials, Inc. | Linear motion apparatus and associated method |
| US6571657B1 (en) | 1999-04-08 | 2003-06-03 | Applied Materials Inc. | Multiple blade robot adjustment apparatus and associated method |
| US6557237B1 (en) | 1999-04-08 | 2003-05-06 | Applied Materials, Inc. | Removable modular cell for electro-chemical plating and method |
| US6551488B1 (en) | 1999-04-08 | 2003-04-22 | Applied Materials, Inc. | Segmenting of processing system into wet and dry areas |
| US6516815B1 (en) | 1999-07-09 | 2003-02-11 | Applied Materials, Inc. | Edge bead removal/spin rinse dry (EBR/SRD) module |
| US20030213772A9 (en) * | 1999-07-09 | 2003-11-20 | Mok Yeuk-Fai Edwin | Integrated semiconductor substrate bevel cleaning apparatus and method |
| JP2001073182A (ja) * | 1999-07-15 | 2001-03-21 | Boc Group Inc:The | 改良された酸性銅電気メッキ用溶液 |
| US20040045832A1 (en) * | 1999-10-14 | 2004-03-11 | Nicholas Martyak | Electrolytic copper plating solutions |
| JP4394234B2 (ja) * | 2000-01-20 | 2010-01-06 | 日鉱金属株式会社 | 銅電気めっき液及び銅電気めっき方法 |
| US6913680B1 (en) | 2000-05-02 | 2005-07-05 | Applied Materials, Inc. | Method of application of electrical biasing to enhance metal deposition |
| US6808612B2 (en) | 2000-05-23 | 2004-10-26 | Applied Materials, Inc. | Method and apparatus to overcome anomalies in copper seed layers and to tune for feature size and aspect ratio |
| WO2001096632A2 (en) | 2000-06-15 | 2001-12-20 | Applied Materials, Inc. | A method and apparatus for conditioning electrochemical baths in plating technology |
| US20040079633A1 (en) * | 2000-07-05 | 2004-04-29 | Applied Materials, Inc. | Apparatus for electro chemical deposition of copper metallization with the capability of in-situ thermal annealing |
| US6576110B2 (en) | 2000-07-07 | 2003-06-10 | Applied Materials, Inc. | Coated anode apparatus and associated method |
| US20020112964A1 (en) * | 2000-07-12 | 2002-08-22 | Applied Materials, Inc. | Process window for gap-fill on very high aspect ratio structures using additives in low acid copper baths |
| US6436267B1 (en) | 2000-08-29 | 2002-08-20 | Applied Materials, Inc. | Method for achieving copper fill of high aspect ratio interconnect features |
| US6682642B2 (en) * | 2000-10-13 | 2004-01-27 | Shipley Company, L.L.C. | Seed repair and electroplating bath |
| US7074315B2 (en) * | 2000-10-19 | 2006-07-11 | Atotech Deutschland Gmbh | Copper bath and methods of depositing a matt copper coating |
| DE10058896C1 (de) * | 2000-10-19 | 2002-06-13 | Atotech Deutschland Gmbh | Elektrolytisches Kupferbad, dessen Verwendung und Verfahren zur Abscheidung einer matten Kupferschicht |
| US6776893B1 (en) * | 2000-11-20 | 2004-08-17 | Enthone Inc. | Electroplating chemistry for the CU filling of submicron features of VLSI/ULSI interconnect |
| US6610189B2 (en) | 2001-01-03 | 2003-08-26 | Applied Materials, Inc. | Method and associated apparatus to mechanically enhance the deposition of a metal film within a feature |
| US20040020780A1 (en) * | 2001-01-18 | 2004-02-05 | Hey H. Peter W. | Immersion bias for use in electro-chemical plating system |
| US6478937B2 (en) | 2001-01-19 | 2002-11-12 | Applied Material, Inc. | Substrate holder system with substrate extension apparatus and associated method |
| WO2002068727A2 (en) * | 2001-02-23 | 2002-09-06 | Ebara Corporation | Copper-plating solution, plating method and plating apparatus |
| EP1260614B1 (en) * | 2001-05-24 | 2008-04-23 | Shipley Co. L.L.C. | Tin plating |
| TWI268966B (en) * | 2001-06-07 | 2006-12-21 | Shipley Co Llc | Electrolytic copper plating method |
| US6652731B2 (en) * | 2001-10-02 | 2003-11-25 | Shipley Company, L.L.C. | Plating bath and method for depositing a metal layer on a substrate |
| US6824612B2 (en) | 2001-12-26 | 2004-11-30 | Applied Materials, Inc. | Electroless plating system |
| US6770565B2 (en) | 2002-01-08 | 2004-08-03 | Applied Materials Inc. | System for planarizing metal conductive layers |
| US20030146102A1 (en) * | 2002-02-05 | 2003-08-07 | Applied Materials, Inc. | Method for forming copper interconnects |
| US7316772B2 (en) * | 2002-03-05 | 2008-01-08 | Enthone Inc. | Defect reduction in electrodeposited copper for semiconductor applications |
| US8002962B2 (en) | 2002-03-05 | 2011-08-23 | Enthone Inc. | Copper electrodeposition in microelectronics |
| US6911136B2 (en) * | 2002-04-29 | 2005-06-28 | Applied Materials, Inc. | Method for regulating the electrical power applied to a substrate during an immersion process |
| US7189313B2 (en) * | 2002-05-09 | 2007-03-13 | Applied Materials, Inc. | Substrate support with fluid retention band |
| US20060011488A1 (en) * | 2002-12-25 | 2006-01-19 | Masashi Kumagai | Copper electrolytic solution containing quaternary amine compound polymer with specific skeleton and organo-sulfur compound as additives, and electrolytic copper foil manufactured using the same |
| US7138039B2 (en) * | 2003-01-21 | 2006-11-21 | Applied Materials, Inc. | Liquid isolation of contact rings |
| US7087144B2 (en) * | 2003-01-31 | 2006-08-08 | Applied Materials, Inc. | Contact ring with embedded flexible contacts |
| US7025861B2 (en) | 2003-02-06 | 2006-04-11 | Applied Materials | Contact plating apparatus |
| US6851200B2 (en) * | 2003-03-14 | 2005-02-08 | Hopkins Manufacturing Corporation | Reflecting lighted level |
| US20040200725A1 (en) * | 2003-04-09 | 2004-10-14 | Applied Materials Inc. | Application of antifoaming agent to reduce defects in a semiconductor electrochemical plating process |
| US7205153B2 (en) | 2003-04-11 | 2007-04-17 | Applied Materials, Inc. | Analytical reagent for acid copper sulfate solutions |
| US20040206373A1 (en) * | 2003-04-18 | 2004-10-21 | Applied Materials, Inc. | Spin rinse dry cell |
| US20040206628A1 (en) * | 2003-04-18 | 2004-10-21 | Applied Materials, Inc. | Electrical bias during wafer exit from electrolyte bath |
| US7311810B2 (en) * | 2003-04-18 | 2007-12-25 | Applied Materials, Inc. | Two position anneal chamber |
| US7128822B2 (en) * | 2003-06-04 | 2006-10-31 | Shipley Company, L.L.C. | Leveler compounds |
| DE10337669B4 (de) * | 2003-08-08 | 2006-04-27 | Atotech Deutschland Gmbh | Wässrige, saure Lösung und Verfahren zum galvanischen Abscheiden von Kupferüberzügen sowie Verwendung der Lösung |
| US20050092601A1 (en) * | 2003-10-29 | 2005-05-05 | Harald Herchen | Electrochemical plating cell having a diffusion member |
| US20050092602A1 (en) * | 2003-10-29 | 2005-05-05 | Harald Herchen | Electrochemical plating cell having a membrane stack |
| US20050218000A1 (en) * | 2004-04-06 | 2005-10-06 | Applied Materials, Inc. | Conditioning of contact leads for metal plating systems |
| US7285195B2 (en) * | 2004-06-24 | 2007-10-23 | Applied Materials, Inc. | Electric field reducing thrust plate |
| TW200613586A (en) * | 2004-07-22 | 2006-05-01 | Rohm & Haas Elect Mat | Leveler compounds |
| TWI400365B (zh) | 2004-11-12 | 2013-07-01 | Enthone | 微電子裝置上的銅電沈積 |
| US20060102467A1 (en) * | 2004-11-15 | 2006-05-18 | Harald Herchen | Current collimation for thin seed and direct plating |
| DE602005026333D1 (de) * | 2005-01-25 | 2011-03-24 | Nippon Mining Co | Kupferelektrolyselösung mit einer verbindung mit speziellem gerüst als additiv und daraus hergestelltes elektrolytkupferblech |
| US20060175201A1 (en) * | 2005-02-07 | 2006-08-10 | Hooman Hafezi | Immersion process for electroplating applications |
| DE102005011708B3 (de) | 2005-03-11 | 2007-03-01 | Atotech Deutschland Gmbh | Polyvinylammoniumverbindung und Verfahren zu deren Herstellung sowie diese Verbindung enthaltende saure Lösung und Verfahren zum elektrolytischen Abscheiden eines Kupferniederschlages |
| US20060243599A1 (en) * | 2005-04-28 | 2006-11-02 | Taiwan Semiconductor Manufacturing Company, Ltd. | Electroplating additive for improved reliability |
| US20070014958A1 (en) * | 2005-07-08 | 2007-01-18 | Chaplin Ernest R | Hanger labels, label assemblies and methods for forming the same |
| US7662981B2 (en) * | 2005-07-16 | 2010-02-16 | Rohm And Haas Electronic Materials Llc | Leveler compounds |
| US7851222B2 (en) * | 2005-07-26 | 2010-12-14 | Applied Materials, Inc. | System and methods for measuring chemical concentrations of a plating solution |
| JP4824379B2 (ja) * | 2005-10-05 | 2011-11-30 | 株式会社Adeka | 電解銅メッキ用添加剤、電解銅メッキ浴及び電解銅メッキ方法 |
| US20070178697A1 (en) * | 2006-02-02 | 2007-08-02 | Enthone Inc. | Copper electrodeposition in microelectronics |
| US20090056994A1 (en) * | 2007-08-31 | 2009-03-05 | Kuhr Werner G | Methods of Treating a Surface to Promote Metal Plating and Devices Formed |
| CN101842856B (zh) * | 2007-08-31 | 2013-10-09 | 埃托特克德国有限公司 | 处理表面以促进感兴趣的分子结合的方法、由其形成的涂层和器件 |
| US7905994B2 (en) * | 2007-10-03 | 2011-03-15 | Moses Lake Industries, Inc. | Substrate holder and electroplating system |
| US20090188553A1 (en) * | 2008-01-25 | 2009-07-30 | Emat Technology, Llc | Methods of fabricating solar-cell structures and resulting solar-cell structures |
| CN101638790A (zh) * | 2008-07-30 | 2010-02-03 | 深圳富泰宏精密工业有限公司 | 镁及镁合金的电镀方法 |
| US8262894B2 (en) | 2009-04-30 | 2012-09-11 | Moses Lake Industries, Inc. | High speed copper plating bath |
| US9869029B2 (en) * | 2009-07-30 | 2018-01-16 | Basf Se | Composition for metal plating comprising suppressing agent for void free submicron feature filling |
| US20120175744A1 (en) | 2009-09-28 | 2012-07-12 | Basf Se | Copper electroplating composition |
| WO2011036158A2 (en) | 2009-09-28 | 2011-03-31 | Basf Se | Wafer pretreatment for copper electroplating |
| MY156690A (en) | 2010-03-18 | 2016-03-15 | Basf Se | Composition for metal electroplating comprising leveling agent |
| US9345149B2 (en) | 2010-07-06 | 2016-05-17 | Esionic Corp. | Methods of treating copper surfaces for enhancing adhesion to organic substrates for use in printed circuit boards |
| EP2465976B1 (en) * | 2010-12-15 | 2013-04-03 | Rohm and Haas Electronic Materials LLC | Method of electroplating uniform copper layer on the edge and walls of though holes of a substrate. |
| JP5595301B2 (ja) * | 2011-02-22 | 2014-09-24 | Jx日鉱日石金属株式会社 | 銅電解液 |
| EP2568063A1 (en) | 2011-09-09 | 2013-03-13 | Rohm and Haas Electronic Materials LLC | Low internal stress copper electroplating method |
| US9243339B2 (en) * | 2012-05-25 | 2016-01-26 | Trevor Pearson | Additives for producing copper electrodeposits having low oxygen content |
| US20140238868A1 (en) * | 2013-02-25 | 2014-08-28 | Dow Global Technologies Llc | Electroplating bath |
| TWI510680B (zh) * | 2013-03-15 | 2015-12-01 | Omg Electronic Chemicals Llc | 銅電鍍溶液及其製備與使用方法 |
| US9439294B2 (en) | 2014-04-16 | 2016-09-06 | Rohm And Haas Electronic Materials Llc | Reaction products of heterocyclic nitrogen compounds polyepoxides and polyhalogens |
| US9809891B2 (en) | 2014-06-30 | 2017-11-07 | Rohm And Haas Electronic Materials Llc | Plating method |
| US20160312372A1 (en) * | 2015-04-27 | 2016-10-27 | Rohm And Haas Electronic Materials Llc | Acid copper electroplating bath and method for electroplating low internal stress and good ductiility copper deposits |
| US10988852B2 (en) | 2015-10-27 | 2021-04-27 | Rohm And Haas Electronic Materials Llc | Method of electroplating copper into a via on a substrate from an acid copper electroplating bath |
| EP3415664B1 (en) | 2017-06-16 | 2019-09-18 | ATOTECH Deutschland GmbH | Aqueous acidic copper electroplating bath and method for electrolytically depositing of a copper coating |
Family Cites Families (98)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE24582E (en) | 1958-12-23 | Method and electrolyte for | ||
| US2733198A (en) * | 1956-01-31 | Acid copper plating bath | ||
| US2272489A (en) * | 1935-08-07 | 1942-02-10 | Gen Aniline & Film Corp | Nitrogenous condensation products and a process of producing same |
| US2355070A (en) * | 1937-07-03 | 1944-08-08 | Little Inc A | Electrolytic deposition of metal |
| US2563360A (en) * | 1941-05-24 | 1951-08-07 | Gen Motors Corp | Electrodeposition of copper |
| US2366737A (en) * | 1941-05-27 | 1945-01-09 | Du Pont | 1,3-dioxolane modified organic products |
| US2391289A (en) * | 1941-09-15 | 1945-12-18 | Jr John F Beaver | Bright copper plating |
| US2424887A (en) * | 1941-10-11 | 1947-07-29 | Houdaille Hershey Corp | Method and electrolyte for the electrodeposition of metals |
| US2462870A (en) * | 1942-07-09 | 1949-03-01 | Gen Motors Corp | Electrodeposition of copper |
| US2609339A (en) * | 1948-11-02 | 1952-09-02 | United Chromium Inc | Bright copper plating from cyanide baths |
| US2660554A (en) * | 1950-11-10 | 1953-11-24 | Barnet D Ostrow | Bright gold and gold alloy plating baths |
| US2700019A (en) * | 1951-07-05 | 1955-01-18 | Westinghouse Electric Corp | Acid copper plating |
| BE520210A (enExample) * | 1952-05-26 | |||
| BE520209A (enExample) * | 1952-05-26 | |||
| US2700020A (en) * | 1952-06-02 | 1955-01-18 | Houdaille Hershey Corp | Plating copper |
| US2663684A (en) * | 1952-06-02 | 1953-12-22 | Houdaille Hershey Corp | Method of and composition for plating copper |
| US2737485A (en) * | 1952-09-22 | 1956-03-06 | Gen Motors Corp | Electrodeposition of copper |
| US2758076A (en) * | 1952-10-31 | 1956-08-07 | Metal & Thermit Corp | Bright acid copper plating |
| US2773022A (en) * | 1953-08-17 | 1956-12-04 | Westinghouse Electric Corp | Electrodeposition from copper electrolytes containing dithiocarbamate addition agents |
| NL109804C (enExample) * | 1953-09-19 | |||
| DE962489C (de) * | 1954-02-10 | 1957-04-25 | Dehydag Gmbh | Sparbeizmittel zum Schutze von Metallen bei der Behandlung mit sauren Mitteln |
| US2799634A (en) * | 1954-02-26 | 1957-07-16 | Westinghouse Electric Corp | Combined addition agents for acid copper plating |
| BE534101A (enExample) * | 1954-03-13 | |||
| BE534701A (enExample) * | 1954-03-22 | |||
| DE934508C (de) * | 1954-04-23 | 1955-10-27 | Dehydag Gmbh | Verfahren zur Herstellung galvanischer Metallueberzuege |
| US2738318A (en) * | 1954-12-28 | 1956-03-13 | Udylite Res Corp | Electrodeposition of copper from an acid bath |
| DE1007592B (de) * | 1955-01-19 | 1957-05-02 | Dehydag Gmbh | Bad zur Herstellung von galvanischen Metallueberzuegen |
| US2805194A (en) * | 1955-07-18 | 1957-09-03 | Dayton Bright Copper Company | Bright copper plating |
| US2805193A (en) * | 1955-07-18 | 1957-09-03 | John F Beaver | Bright copper plating |
| US2853444A (en) * | 1955-10-18 | 1958-09-23 | Dow Chemical Co | Electrowinning of metals |
| US2848394A (en) * | 1956-05-04 | 1958-08-19 | Hanson Van Winkle Munning Co | Bright copper plating |
| BE556462A (enExample) * | 1956-06-15 | |||
| BE565994A (enExample) * | 1957-04-16 | |||
| US2882209A (en) * | 1957-05-20 | 1959-04-14 | Udylite Res Corp | Electrodeposition of copper from an acid bath |
| US3021266A (en) * | 1957-08-12 | 1962-02-13 | Barnet D Ostrow | Additive for copper plating bath |
| US2931760A (en) * | 1957-09-25 | 1960-04-05 | Leon R Westbrook | Acid copper plating |
| BE572016A (enExample) * | 1957-11-30 | |||
| BE572186A (enExample) * | 1957-12-17 | |||
| US3030282A (en) * | 1961-05-02 | 1962-04-17 | Metal & Thermit Corp | Electrodeposition of copper |
| NL238490A (enExample) * | 1958-04-26 | |||
| US3018232A (en) * | 1958-06-05 | 1962-01-23 | Westinghouse Electric Corp | Addition agent for cyanide plating baths |
| US2954331A (en) * | 1958-08-14 | 1960-09-27 | Dayton Bright Copper Company | Bright copper plating bath |
| US2999767A (en) * | 1959-01-16 | 1961-09-12 | Remington Arms Co Inc | Coating process and coating promoter compounds for bullets |
| DE1133610B (de) * | 1959-06-06 | 1962-07-19 | Dehydag Gmbh | Saure galvanische Kupferbaeder |
| US2967135A (en) * | 1960-06-08 | 1961-01-03 | Barnet D Ostrow | Electroplating baths for hard bright gold deposits |
| US3037918A (en) * | 1960-07-14 | 1962-06-05 | Barnet D Ostrow | Semi-bright copper |
| NL134137C (enExample) * | 1961-02-02 | |||
| GB872879A (en) * | 1961-02-20 | 1961-07-12 | Dehydag Gmbh | Electrolytic copper-plating baths |
| US3227638A (en) * | 1961-06-16 | 1966-01-04 | Robert H Burnson | Alkali cyanide bath and process for electroplating therewith |
| DE1177142B (de) * | 1961-07-08 | 1964-09-03 | Dehydag Gmbh | Verfahren zur Herstellung von Sulfonsaeure-gruppen enthaltenden Dithiocarbaminsaeure-esterderivaten |
| NL281922A (enExample) * | 1961-08-10 | |||
| DE1184172B (de) * | 1961-08-31 | 1964-12-23 | Dehydag Gmbh | Verfahren zum galvanischen Abscheiden festhaftender und hochglaenzender Kupferueberzuege |
| DE1151159B (de) * | 1961-09-02 | 1963-07-04 | Dehydag Gmbh | Saure galvanische Kupferbaeder |
| US3288690A (en) * | 1962-04-16 | 1966-11-29 | Udylite Corp | Electrodeposition of copper from acidic baths |
| NL291575A (enExample) * | 1962-04-16 | |||
| US3153653A (en) * | 1963-01-11 | 1964-10-20 | Du Pont | 2-(polyfluoroaliphatic thio)-benzo-thiazoles and -benzoxazoles |
| DE1745810B2 (de) * | 1963-05-29 | 1971-12-02 | Espe Fabrik pharmazeutischer Prapa rate GmbH, 8031 Seefeld | Verfahren zur herstellung von formkoerpern auf der basis von aethyleniminverbindungen |
| DE1248415B (de) * | 1964-03-07 | 1967-08-24 | Dehydag Gmbh | Saure galvanische Kupferbaeder |
| US3309293A (en) * | 1964-11-16 | 1967-03-14 | Elechem Corp | Copper cyanide electroplating bath |
| US3460977A (en) * | 1965-02-08 | 1969-08-12 | Minnesota Mining & Mfg | Mechanical plating |
| GB1150748A (en) * | 1965-07-02 | 1969-04-30 | Barnet David Ostrow | Improvements in Electrodeposition of Copper |
| US3393135A (en) * | 1965-08-05 | 1968-07-16 | Enthone | Bright zinc electro-plating |
| US3414493A (en) * | 1965-10-19 | 1968-12-03 | Lea Ronal Inc | Electrodeposition of copper |
| US3313736A (en) * | 1966-03-04 | 1967-04-11 | Petrolite Corp | Inhibiting foam |
| DE1246347B (de) * | 1966-03-08 | 1967-08-03 | Schering Ag | Saures galvanisches Kupferbad |
| US3328273A (en) * | 1966-08-15 | 1967-06-27 | Udylite Corp | Electro-deposition of copper from acidic baths |
| SE322956B (enExample) * | 1966-08-20 | 1970-04-20 | Schering Ag | |
| BE735856A (enExample) * | 1967-04-03 | 1970-01-09 | ||
| US3542655A (en) * | 1968-04-29 | 1970-11-24 | M & T Chemicals Inc | Electrodeposition of copper |
| US3650915A (en) * | 1969-01-23 | 1972-03-21 | Itt | Copper electrodeposition electrolytes and method |
| US3617451A (en) * | 1969-06-10 | 1971-11-02 | Macdermid Inc | Thiosulfate copper plating |
| US3642589A (en) * | 1969-09-29 | 1972-02-15 | Fred I Nobel | Gold alloy electroplating baths |
| US3859297A (en) * | 1969-11-28 | 1975-01-07 | Monsanto Co | Method for preparation of organic azolyl polysulfides |
| DE2028803C3 (de) * | 1970-06-06 | 1980-08-14 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Polymere Phenazoniumverbindungen |
| US3682788A (en) * | 1970-07-28 | 1972-08-08 | M & T Chemicals Inc | Copper electroplating |
| US3841979A (en) * | 1971-08-20 | 1974-10-15 | M & T Chemicals Inc | Method of preparing surfaces for electroplating |
| US3751289A (en) * | 1971-08-20 | 1973-08-07 | M & T Chemicals Inc | Method of preparing surfaces for electroplating |
| US3832291A (en) * | 1971-08-20 | 1974-08-27 | M & T Chemicals Inc | Method of preparing surfaces for electroplating |
| US3791388A (en) * | 1971-09-22 | 1974-02-12 | Ethicon Inc | Covered suture |
| US3770598A (en) * | 1972-01-21 | 1973-11-06 | Oxy Metal Finishing Corp | Electrodeposition of copper from acid baths |
| US3923613A (en) * | 1972-02-22 | 1975-12-02 | Kampschulte & Cie Dr W | Acidic galvanic copper bath |
| US3725220A (en) * | 1972-04-27 | 1973-04-03 | Lea Ronal Inc | Electrodeposition of copper from acidic baths |
| US3804729A (en) * | 1972-06-19 | 1974-04-16 | M & T Chemicals Inc | Electrolyte and process for electro-depositing copper |
| US3976604A (en) * | 1972-08-11 | 1976-08-24 | The United States Of America As Represented By The Secretary Of Agriculture | Preparation of ethylenimine prepolymer |
| US3956078A (en) * | 1972-12-14 | 1976-05-11 | M & T Chemicals Inc. | Electrodeposition of copper |
| US3956079A (en) * | 1972-12-14 | 1976-05-11 | M & T Chemicals Inc. | Electrodeposition of copper |
| US3940320A (en) * | 1972-12-14 | 1976-02-24 | M & T Chemicals Inc. | Electrodeposition of copper |
| GB1526076A (en) * | 1975-03-11 | 1978-09-27 | Oxy Metal Industries Corp | Electrodeposition of copper |
| US4049510A (en) * | 1975-07-07 | 1977-09-20 | Columbia Chemical Corporation | Baths and additives for the electrodeposition of bright zinc |
| US3988219A (en) * | 1975-07-07 | 1976-10-26 | Columbia Chemical Corporation | Baths and additives for the electrodeposition of bright zinc |
| US4007098A (en) * | 1975-09-04 | 1977-02-08 | Columbia Chemical Corporation | Baths and additives for the electrodeposition of bright zinc |
| US4036711A (en) * | 1975-12-18 | 1977-07-19 | M & T Chemicals Inc. | Electrodeposition of copper |
| US4038161A (en) * | 1976-03-05 | 1977-07-26 | R. O. Hull & Company, Inc. | Acid copper plating and additive composition therefor |
| US4100040A (en) * | 1976-10-26 | 1978-07-11 | Columbia Chemical Corporation | Electrodeposition of bright zinc utilizing aliphatic ketones |
| US4134802A (en) * | 1977-10-03 | 1979-01-16 | Oxy Metal Industries Corporation | Electrolyte and method for electrodepositing bright metal deposits |
| DE2746938C2 (de) * | 1977-10-17 | 1987-04-09 | Schering AG, 1000 Berlin und 4709 Bergkamen | Wäßriges saures Bad zur galvanischen Abscheidung von glänzenden und rißfreien Kupferüberzügen und Verwendung dieses Bades |
| SU714508A1 (ru) * | 1977-12-06 | 1980-02-05 | Предприятие П/Я В-8574 | Токопровод ща композици |
| US4134803A (en) * | 1977-12-21 | 1979-01-16 | R. O. Hull & Company, Inc. | Nitrogen and sulfur compositions and acid copper plating baths |
-
1981
- 1981-06-24 US US06/277,057 patent/US4376685A/en not_active Expired - Lifetime
-
1982
- 1982-05-17 CA CA000403086A patent/CA1194832A/en not_active Expired
- 1982-05-20 AU AU83894/82A patent/AU548506B2/en not_active Ceased
- 1982-06-22 JP JP57107510A patent/JPS583991A/ja active Granted
- 1982-06-23 DE DE8282303273T patent/DE3275936D1/de not_active Expired
- 1982-06-23 AT AT82303273T patent/ATE26312T1/de not_active IP Right Cessation
- 1982-06-23 EP EP82303273A patent/EP0068807B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU8389482A (en) | 1983-01-06 |
| JPS583991A (ja) | 1983-01-10 |
| EP0068807B1 (en) | 1987-04-01 |
| DE3275936D1 (en) | 1987-05-07 |
| US4376685A (en) | 1983-03-15 |
| JPH0340113B2 (enExample) | 1991-06-17 |
| AU548506B2 (en) | 1985-12-12 |
| EP0068807A3 (en) | 1984-07-25 |
| ATE26312T1 (de) | 1987-04-15 |
| EP0068807A2 (en) | 1983-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1194832A (en) | Acid copper electroplating baths containing brightening and leveling additives | |
| US4948474A (en) | Copper electroplating solutions and methods | |
| US3682788A (en) | Copper electroplating | |
| CA1050924A (en) | Electrodeposition of copper | |
| US4169772A (en) | Acid zinc plating baths, compositions useful therein, and methods for electrodepositing bright zinc deposits | |
| GB2144769A (en) | Zinc and zinc alloy electroplating | |
| CA1104152A (en) | Nitrogen and sulfur compositions and acid copper plating baths | |
| US4717458A (en) | Zinc and zinc alloy electrolyte and process | |
| US20050133376A1 (en) | Alkaline zinc-nickel alloy plating compositions, processes and articles therefrom | |
| US2663684A (en) | Method of and composition for plating copper | |
| US4045306A (en) | Electroplating zinc and bath therefor | |
| US4786746A (en) | Copper electroplating solutions and methods of making and using them | |
| US3956078A (en) | Electrodeposition of copper | |
| KR101094117B1 (ko) | 구리 퇴적물의 전기분해적 퇴적을 위한 소중합체 페나지늄화합물의 혼합물 및 산조 | |
| CA1075695A (en) | Alkaline zinc electroplating baths and additive compositions therefor | |
| US3940320A (en) | Electrodeposition of copper | |
| US3956079A (en) | Electrodeposition of copper | |
| JPH01100292A (ja) | 光沢のある平滑な銅被膜を電着するための水性酸性浴、電着法及び、光沢のある平滑な銅被膜 | |
| US3956120A (en) | Electrodeposition of copper | |
| CA1255621A (en) | Copper electrodeposition with substituted phthalocyanine and an apo safranine | |
| US3787297A (en) | Zinc plating bath and method | |
| CA1255622A (en) | Process for electrodepositing copper | |
| DE2360892A1 (de) | Waessriges saures galvanisches kupferbad | |
| US3276977A (en) | Metal electroplating process and bath | |
| US3203878A (en) | Acid metal electroplating bath containing an organic sulfonic acid-thioureadithiocarbamic acid reaction product |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |