AT395851B - Piperazin-derivate und verfahren zur herstellung derselben - Google Patents
Piperazin-derivate und verfahren zur herstellung derselben Download PDFInfo
- Publication number
- AT395851B AT395851B AT0047688A AT47688A AT395851B AT 395851 B AT395851 B AT 395851B AT 0047688 A AT0047688 A AT 0047688A AT 47688 A AT47688 A AT 47688A AT 395851 B AT395851 B AT 395851B
- Authority
- AT
- Austria
- Prior art keywords
- formula
- compound
- spiro
- aza
- dione
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 40
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical class C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 title description 7
- 238000004519 manufacturing process Methods 0.000 title description 3
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 56
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 14
- 238000005984 hydrogenation reaction Methods 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 229910052763 palladium Inorganic materials 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- QWCRAEMEVRGPNT-UHFFFAOYSA-N buspirone Chemical compound C1C(=O)N(CCCCN2CCN(CC2)C=2N=CC=CN=2)C(=O)CC21CCCC2 QWCRAEMEVRGPNT-UHFFFAOYSA-N 0.000 claims description 3
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- -1 4-bromo-butyl Chemical class 0.000 description 7
- 238000000746 purification Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- YRTHJMQKDCXPAY-UHFFFAOYSA-N azaspirodecanedione Chemical compound C1C(=O)NC(=O)CC11CCCC1 YRTHJMQKDCXPAY-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical group C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical class CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- MRBFGEHILMYPTF-UHFFFAOYSA-N 1-(2-Pyrimidyl)piperazine Chemical compound C1CNCCN1C1=NC=CC=N1 MRBFGEHILMYPTF-UHFFFAOYSA-N 0.000 description 3
- NIDSRGCVYOEDFW-UHFFFAOYSA-N 1-bromo-4-chlorobutane Chemical compound ClCCCCBr NIDSRGCVYOEDFW-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 2
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- BCNBRBQCDHLCBD-UHFFFAOYSA-N 8-(4-chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)N(CCCCCl)C(=O)CC11CCCC1 BCNBRBQCDHLCBD-UHFFFAOYSA-N 0.000 description 2
- ZRUSNBLPDIBKFF-UHFFFAOYSA-N 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)but-2-enyl]-8-azaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)N(CC=CCN2CCN(CC2)C=2N=CC=CN=2)C(=O)CC21CCCC2 ZRUSNBLPDIBKFF-UHFFFAOYSA-N 0.000 description 2
- GFWLMILMVMCJDI-UHFFFAOYSA-N 8-oxaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)OC(=O)CC11CCCC1 GFWLMILMVMCJDI-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000004791 alkyl magnesium halides Chemical class 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 210000000988 bone and bone Anatomy 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 235000011087 fumaric acid Nutrition 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- XBVZKHPTGUWNEH-UHFFFAOYSA-N 2-[4-(4-chlorobutyl)piperazin-1-yl]pyrimidine Chemical compound C1CN(CCCCCl)CCN1C1=NC=CC=N1 XBVZKHPTGUWNEH-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- GNHMRTZZNHZDDM-UHFFFAOYSA-N 3-chloropropionitrile Chemical compound ClCCC#N GNHMRTZZNHZDDM-UHFFFAOYSA-N 0.000 description 1
- DOQLCJMCQWQQHK-UHFFFAOYSA-N 4-chlorobutanal Chemical compound ClCCCC=O DOQLCJMCQWQQHK-UHFFFAOYSA-N 0.000 description 1
- ZIYUKDFSZYGSSL-UHFFFAOYSA-N 8-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynyl]-8-azaspiro[4.5]decane-7,9-dione Chemical compound N1=C(C=CC=C1)N1CCN(CC1)CC#CCN1C(CC2(CCCC2)CC1=O)=O ZIYUKDFSZYGSSL-UHFFFAOYSA-N 0.000 description 1
- URVJUARKBQLSGJ-UHFFFAOYSA-N 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)but-2-ynyl]-8-azaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)N(CC#CCN2CCN(CC2)C=2N=CC=CN=2)C(=O)CC21CCCC2 URVJUARKBQLSGJ-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- CDKFWIMBZAUBRS-UHFFFAOYSA-M [I-].CC[Mg+] Chemical compound [I-].CC[Mg+] CDKFWIMBZAUBRS-UHFFFAOYSA-M 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- YCCXQARVHOPWFJ-UHFFFAOYSA-M magnesium;ethane;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C YCCXQARVHOPWFJ-UHFFFAOYSA-M 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU71787A HU198204B (en) | 1987-02-25 | 1987-02-25 | Process for production of derivatives of piperasine |
| HU71887A HU198477B (en) | 1987-02-25 | 1987-02-25 | Process for producing pyrimidinyl piperazine derivatives |
| HU71687A HU197313B (en) | 1987-02-25 | 1987-02-25 | Process for producing 8-azaspiro <4.5> decane-7,9-dione-8-propine-/2/ |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA47688A ATA47688A (de) | 1992-08-15 |
| AT395851B true AT395851B (de) | 1993-03-25 |
Family
ID=27269942
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0047688A AT395851B (de) | 1987-02-25 | 1988-02-25 | Piperazin-derivate und verfahren zur herstellung derselben |
Country Status (20)
| Country | Link |
|---|---|
| KR (1) | KR880009955A (enExample) |
| CN (1) | CN88100923A (enExample) |
| AT (1) | AT395851B (enExample) |
| BE (1) | BE1001464A3 (enExample) |
| CA (1) | CA1300141C (enExample) |
| CH (1) | CH677924A5 (enExample) |
| CS (1) | CS274423B2 (enExample) |
| DE (1) | DE3806009C2 (enExample) |
| DK (1) | DK99388A (enExample) |
| ES (1) | ES2009236A6 (enExample) |
| FI (1) | FI880895A7 (enExample) |
| FR (1) | FR2615853B1 (enExample) |
| GB (1) | GB2201417B (enExample) |
| GR (1) | GR1002245B (enExample) |
| IL (1) | IL85545A (enExample) |
| IT (1) | IT1217342B (enExample) |
| NL (1) | NL8800484A (enExample) |
| PL (1) | PL152958B1 (enExample) |
| SE (1) | SE8800651L (enExample) |
| YU (1) | YU46441B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU217129B (hu) * | 1993-07-16 | 1999-11-29 | EGIS Gyógyszergyár Rt. | Eljárás nagy tisztaságú buspiron gyógyászati hatóanyag előállítására |
| KR950014099A (ko) * | 1993-11-10 | 1995-06-15 | 장기하 | N-(2-피리미딜)피페라지닐 부틸아미드의 제조방법 |
| CN119409681B (zh) * | 2024-03-28 | 2025-12-16 | 北京华素制药股份有限公司 | 一种盐酸丁螺环酮的制备方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2057845A1 (de) * | 1969-11-24 | 1971-06-09 | Bristol Myers Co | Heterocyclische Azaspirodecandione und Verfahren zu ihrer Herstellung |
| DE1670019B2 (de) * | 1964-07-03 | 1974-10-17 | Aktiebolaget Astra, Soedertaelje (Schweden) | N-Aminoalkenyl- und -alkinylsuccinimide und sie enthaltende Mittel |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE300422B (enExample) * | 1964-07-03 | 1968-04-29 | Astra Ab | |
| US3354178A (en) * | 1965-04-09 | 1967-11-21 | Sterling Drug Inc | Nu-(4-amino-2-butynyl)-nu-alkylcarboxamides |
| JPS6310786A (ja) * | 1986-07-01 | 1988-01-18 | Sumitomo Pharmaceut Co Ltd | 新規イミド誘導体およびその製造法 |
| JPS6310760A (ja) * | 1986-07-01 | 1988-01-18 | Sumitomo Pharmaceut Co Ltd | イミド誘導体の新規製造法 |
-
1988
- 1988-02-23 CH CH675/88A patent/CH677924A5/de not_active IP Right Cessation
- 1988-02-23 PL PL1988270815A patent/PL152958B1/pl unknown
- 1988-02-24 CN CN198888100923A patent/CN88100923A/zh active Pending
- 1988-02-25 FR FR888802286A patent/FR2615853B1/fr not_active Expired - Lifetime
- 1988-02-25 DE DE3806009A patent/DE3806009C2/de not_active Expired - Fee Related
- 1988-02-25 AT AT0047688A patent/AT395851B/de not_active IP Right Cessation
- 1988-02-25 SE SE8800651A patent/SE8800651L/xx not_active Application Discontinuation
- 1988-02-25 CA CA000559846A patent/CA1300141C/en not_active Expired - Lifetime
- 1988-02-25 IT IT19545/88A patent/IT1217342B/it active
- 1988-02-25 BE BE8800218A patent/BE1001464A3/fr not_active IP Right Cessation
- 1988-02-25 GB GB8804385A patent/GB2201417B/en not_active Expired - Lifetime
- 1988-02-25 CS CS122288A patent/CS274423B2/cs unknown
- 1988-02-25 ES ES8800543A patent/ES2009236A6/es not_active Expired
- 1988-02-25 YU YU36288A patent/YU46441B/sh unknown
- 1988-02-25 GR GR880100108A patent/GR1002245B/el unknown
- 1988-02-25 FI FI880895A patent/FI880895A7/fi not_active Application Discontinuation
- 1988-02-25 DK DK099388A patent/DK99388A/da not_active Application Discontinuation
- 1988-02-25 IL IL85545A patent/IL85545A/xx not_active IP Right Cessation
- 1988-02-25 KR KR1019880001939A patent/KR880009955A/ko not_active Ceased
- 1988-02-25 NL NL8800484A patent/NL8800484A/nl not_active Application Discontinuation
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670019B2 (de) * | 1964-07-03 | 1974-10-17 | Aktiebolaget Astra, Soedertaelje (Schweden) | N-Aminoalkenyl- und -alkinylsuccinimide und sie enthaltende Mittel |
| DE2057845A1 (de) * | 1969-11-24 | 1971-06-09 | Bristol Myers Co | Heterocyclische Azaspirodecandione und Verfahren zu ihrer Herstellung |
| US3907801A (en) * | 1969-11-24 | 1975-09-23 | Mead Johnson & Co | N-{8 (4-pyridyl-piperazino)-alkyl{9 -azaspiroalkanediones |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1217342B (it) | 1990-03-22 |
| FI880895A0 (fi) | 1988-02-25 |
| KR880009955A (ko) | 1988-10-06 |
| DE3806009A1 (de) | 1988-09-08 |
| CA1300141C (en) | 1992-05-05 |
| SE8800651L (sv) | 1988-08-26 |
| YU46441B (sh) | 1993-10-20 |
| CN88100923A (zh) | 1988-09-28 |
| GB2201417A (en) | 1988-09-01 |
| BE1001464A3 (fr) | 1989-11-07 |
| YU36288A (en) | 1989-10-31 |
| PL152958B1 (en) | 1991-02-28 |
| FR2615853B1 (fr) | 1991-01-04 |
| PL270815A1 (en) | 1989-04-03 |
| IT8819545A0 (it) | 1988-02-25 |
| IL85545A0 (en) | 1988-08-31 |
| FR2615853A1 (fr) | 1988-12-02 |
| GR880100108A (el) | 1988-12-16 |
| GB8804385D0 (en) | 1988-03-23 |
| DE3806009C2 (de) | 1996-09-12 |
| GB2201417B (en) | 1990-10-31 |
| SE8800651D0 (sv) | 1988-02-25 |
| CS274423B2 (en) | 1991-04-11 |
| IL85545A (en) | 1992-05-25 |
| ES2009236A6 (es) | 1989-09-16 |
| GR1002245B (en) | 1996-04-22 |
| DK99388D0 (da) | 1988-02-25 |
| ATA47688A (de) | 1992-08-15 |
| DK99388A (da) | 1988-08-26 |
| FI880895A7 (fi) | 1988-08-26 |
| NL8800484A (nl) | 1988-09-16 |
| CH677924A5 (enExample) | 1991-07-15 |
| CS122288A2 (en) | 1990-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69700321T2 (de) | Verfahren zur Herstellung Sildenafil | |
| DE3883456T2 (de) | Verfahren zur Herstellung von substituierten Indolinonderivaten. | |
| DE2060816B2 (de) | 4-Phenylpiperidinderivate Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen enthaltend diese Verbindungen | |
| DE1545924A1 (de) | Neue Pyrrolidinderivate und Verfahren zur Herstellung derselben | |
| DE1595920A1 (de) | 4-(omega-Piperazinoalkyl)-pyrazole,ihre Salze und Verfahren zu ihrer Herstellung | |
| AT395851B (de) | Piperazin-derivate und verfahren zur herstellung derselben | |
| DE68903263T2 (de) | Substituierte aromatische verbindungen mit zentraler nervensystem-wirkung. | |
| DE68911616T2 (de) | Piperazin-Derivate und Verfahren zu deren Herstellung. | |
| EP1607090B1 (de) | Asimadolin für die Behandlung des Irritable Bowel Syndroms | |
| DE60015177T2 (de) | Verfahren zur herstellung von 2-[4-(alpha-phenyl-p-chlorobenzyl)piperazin-1-yl]ethoxyessigsäure und zwischenprodukte dafür | |
| DE949888C (de) | Verfahren zur Herstellung von Pyrrolidinen | |
| EP0152598B1 (de) | Cyanomethyl-(2-cyano-ethyl)-(3-hydroxy-propyl)-amin, seine Verwendung zur Herstellung von 1-(3-Hydroxy-propyl)-1,4-diazepan und 1,4 Bis-[3-(3,4,5-trimethoxy-benzoyloxy)-propyl]-diazepan | |
| EP0612745B1 (de) | Verfahren zur Herstellung von 1,2,3,4,10,14b-Hexahydro-2-methyl-dibenzo[c,f]pyrazino[1,2-a]azepin und seiner Salze | |
| DD281384A5 (de) | Verfahren zur herstellung von piperazin-derivaten | |
| DE2013676C3 (de) | Verfahren zur Herstellung von Piperazin und substituierten Piperazinen | |
| EP0181618B1 (de) | Verfahren zur Herstellung von Substituierten Piperidinen | |
| AT398972B (de) | Verfahren zur herstellung von 1-((diazinylpiperidinyl)-methyl)-2-pyrrolidinon n | |
| DE60318559T2 (de) | Verfahren zur herstellung von morpholinderivaten und zwischenprodukte dafür | |
| DE60213603T2 (de) | Verfahren zur herstellung von 4 methylamino 4 phenylpiperidin | |
| AT302332B (de) | Verfahren zur Herstellung von Arylketonderivaten sowie von Säureadditionssalzen hievon | |
| AT250338B (de) | Verfahren zur Herstellung neuer, basischer Derivate von substituierten Benzofuran-2-carbonsäuren und deren Salzen | |
| DE953803C (de) | Verfahren zur Herstellung von Alkaminestern von 4-Amino-2-oxybenzoesaeure, die am N-und O-Atom alkyliert sind | |
| EP0180890A2 (de) | Verfahren zur diastereoselektiven Reduktion von 3-Amino-1-benzoxepin-5(2H)-onen | |
| DE60308170T2 (de) | Verfahren zur herstellung von chinolinderivaten | |
| DE2004818C3 (de) | Basisch substituierte Chinobenzazepine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| REN | Ceased due to non-payment of the annual fee |