SK15522001A3 - Deriváty kyselín s tromi arylovými zvyškami ako ligandy receptorov PPAR a farmaceutické kompozície, ktoré ich obsahujú - Google Patents
Deriváty kyselín s tromi arylovými zvyškami ako ligandy receptorov PPAR a farmaceutické kompozície, ktoré ich obsahujú Download PDFInfo
- Publication number
- SK15522001A3 SK15522001A3 SK1552-2001A SK15522001A SK15522001A3 SK 15522001 A3 SK15522001 A3 SK 15522001A3 SK 15522001 A SK15522001 A SK 15522001A SK 15522001 A3 SK15522001 A3 SK 15522001A3
- Authority
- SK
- Slovakia
- Prior art keywords
- substituted
- compound
- hydrogen
- fused
- alkyl
- Prior art date
Links
- 239000003446 ligand Substances 0.000 title claims abstract description 25
- 239000002253 acid Substances 0.000 title abstract description 58
- 101150014691 PPARA gene Proteins 0.000 title 1
- 239000000126 substance Substances 0.000 claims abstract description 68
- 125000003118 aryl group Chemical group 0.000 claims abstract description 65
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 63
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 claims abstract description 53
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 claims abstract description 53
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims abstract description 27
- 125000003831 tetrazolyl group Chemical group 0.000 claims abstract description 20
- 125000005349 heteroarylcycloalkyl group Chemical group 0.000 claims abstract description 17
- 125000004350 aryl cycloalkyl group Chemical group 0.000 claims abstract description 13
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 10
- 239000011230 binding agent Substances 0.000 claims abstract description 7
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 claims abstract description 7
- -1 quinazolin-4-onyl Chemical group 0.000 claims description 402
- 150000001875 compounds Chemical class 0.000 claims description 391
- 238000000034 method Methods 0.000 claims description 143
- 125000000217 alkyl group Chemical group 0.000 claims description 124
- 229910052739 hydrogen Inorganic materials 0.000 claims description 115
- 239000001257 hydrogen Substances 0.000 claims description 113
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 100
- 150000003839 salts Chemical class 0.000 claims description 74
- 229910052757 nitrogen Inorganic materials 0.000 claims description 65
- 125000000623 heterocyclic group Chemical group 0.000 claims description 57
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 53
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 46
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 43
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 42
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 38
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- 125000001424 substituent group Chemical group 0.000 claims description 34
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 33
- 125000004122 cyclic group Chemical group 0.000 claims description 30
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 30
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims description 30
- 125000005843 halogen group Chemical group 0.000 claims description 29
- 108010016731 PPAR gamma Proteins 0.000 claims description 27
- 102100038825 Peroxisome proliferator-activated receptor gamma Human genes 0.000 claims description 27
- 102000004877 Insulin Human genes 0.000 claims description 23
- 108090001061 Insulin Proteins 0.000 claims description 23
- 229940125396 insulin Drugs 0.000 claims description 23
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 23
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 22
- 125000004429 atom Chemical group 0.000 claims description 20
- 108091008725 peroxisome proliferator-activated receptors alpha Proteins 0.000 claims description 20
- 102000023984 PPAR alpha Human genes 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 19
- 238000011282 treatment Methods 0.000 claims description 18
- 201000010099 disease Diseases 0.000 claims description 17
- 150000001204 N-oxides Chemical class 0.000 claims description 16
- 206010022489 Insulin Resistance Diseases 0.000 claims description 15
- 125000002252 acyl group Chemical group 0.000 claims description 15
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 206010012601 diabetes mellitus Diseases 0.000 claims description 14
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 13
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 13
- 239000008103 glucose Substances 0.000 claims description 13
- 108010015181 PPAR delta Proteins 0.000 claims description 12
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 12
- 235000021588 free fatty acids Nutrition 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 11
- 230000027455 binding Effects 0.000 claims description 11
- 239000008280 blood Substances 0.000 claims description 11
- 210000004369 blood Anatomy 0.000 claims description 11
- 208000011580 syndromic disease Diseases 0.000 claims description 11
- 125000001544 thienyl group Chemical group 0.000 claims description 11
- 230000000694 effects Effects 0.000 claims description 10
- 201000001421 hyperglycemia Diseases 0.000 claims description 9
- 201000008980 hyperinsulinism Diseases 0.000 claims description 9
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 8
- 125000004104 aryloxy group Chemical group 0.000 claims description 8
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 8
- 150000001721 carbon Chemical group 0.000 claims description 8
- 150000003626 triacylglycerols Chemical class 0.000 claims description 8
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 7
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- 125000004076 pyridyl group Chemical group 0.000 claims description 7
- 125000005493 quinolyl group Chemical group 0.000 claims description 7
- 239000012453 solvate Substances 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 206010020772 Hypertension Diseases 0.000 claims description 6
- 125000003435 aroyl group Chemical group 0.000 claims description 6
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 6
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 5
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 4
- 201000001320 Atherosclerosis Diseases 0.000 claims description 4
- 208000030814 Eating disease Diseases 0.000 claims description 4
- 208000019454 Feeding and Eating disease Diseases 0.000 claims description 4
- 208000031226 Hyperlipidaemia Diseases 0.000 claims description 4
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 4
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 235000014632 disordered eating Nutrition 0.000 claims description 4
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 4
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 claims description 4
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 claims description 4
- 125000003107 substituted aryl group Chemical group 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 3
- 125000002971 oxazolyl group Chemical group 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 2
- 125000001425 triazolyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 21
- 230000002526 effect on cardiovascular system Effects 0.000 claims 3
- 230000003042 antagnostic effect Effects 0.000 claims 2
- 239000003937 drug carrier Substances 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- 230000001270 agonistic effect Effects 0.000 claims 1
- 235000021190 leftovers Nutrition 0.000 claims 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 claims 1
- 102000005962 receptors Human genes 0.000 abstract description 23
- 108020003175 receptors Proteins 0.000 abstract description 23
- 239000000556 agonist Substances 0.000 abstract description 16
- 239000005557 antagonist Substances 0.000 abstract description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 210
- 238000005160 1H NMR spectroscopy Methods 0.000 description 145
- 239000000243 solution Substances 0.000 description 133
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 131
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 111
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 107
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 102
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 84
- 239000000203 mixture Substances 0.000 description 79
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 78
- 235000019439 ethyl acetate Nutrition 0.000 description 76
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 71
- 239000011541 reaction mixture Substances 0.000 description 66
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 60
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 60
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 58
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 57
- 239000000741 silica gel Substances 0.000 description 57
- 229910002027 silica gel Inorganic materials 0.000 description 57
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 56
- 239000000460 chlorine Chemical group 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- 238000006243 chemical reaction Methods 0.000 description 51
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 46
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 44
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 41
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 36
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 35
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 31
- 239000007787 solid Substances 0.000 description 31
- 239000002904 solvent Substances 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000002585 base Substances 0.000 description 30
- 239000012267 brine Substances 0.000 description 29
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- 238000003818 flash chromatography Methods 0.000 description 27
- 238000002844 melting Methods 0.000 description 27
- 230000008018 melting Effects 0.000 description 27
- 239000012044 organic layer Substances 0.000 description 27
- 239000000543 intermediate Substances 0.000 description 26
- 229910000104 sodium hydride Inorganic materials 0.000 description 26
- 229910052717 sulfur Inorganic materials 0.000 description 26
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 23
- 235000019341 magnesium sulphate Nutrition 0.000 description 23
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 23
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 229910052760 oxygen Inorganic materials 0.000 description 21
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 20
- 238000004440 column chromatography Methods 0.000 description 20
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 18
- 239000012074 organic phase Substances 0.000 description 18
- 239000005711 Benzoic acid Substances 0.000 description 17
- 150000002148 esters Chemical class 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- 235000019198 oils Nutrition 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 15
- 239000012312 sodium hydride Substances 0.000 description 15
- 125000004434 sulfur atom Chemical group 0.000 description 15
- 239000012458 free base Substances 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 13
- 239000003153 chemical reaction reagent Substances 0.000 description 13
- 239000012634 fragment Substances 0.000 description 13
- 239000002464 receptor antagonist Substances 0.000 description 13
- 229940044551 receptor antagonist Drugs 0.000 description 13
- 230000009467 reduction Effects 0.000 description 13
- 238000006722 reduction reaction Methods 0.000 description 13
- 238000005481 NMR spectroscopy Methods 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 150000001408 amides Chemical class 0.000 description 12
- 239000001301 oxygen Substances 0.000 description 12
- 229920006395 saturated elastomer Polymers 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 11
- 150000001299 aldehydes Chemical class 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- 235000010233 benzoic acid Nutrition 0.000 description 10
- 238000009835 boiling Methods 0.000 description 10
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 229940126904 hypoglycaemic agent Drugs 0.000 description 10
- 229940095102 methyl benzoate Drugs 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- CHDBKJCPABWQEL-UHFFFAOYSA-N 2-[2-[(3-hydroxyphenoxy)methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(O)C=CC=2)=C1OCC#N CHDBKJCPABWQEL-UHFFFAOYSA-N 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 9
- 210000001789 adipocyte Anatomy 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- 210000004027 cell Anatomy 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 238000009833 condensation Methods 0.000 description 9
- 230000005494 condensation Effects 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 9
- 238000007254 oxidation reaction Methods 0.000 description 9
- 239000007921 spray Substances 0.000 description 9
- LIPCUWYOYHYHLB-UHFFFAOYSA-N 3-(2-methoxyethoxymethoxy)phenol Chemical compound COCCOCOC1=CC=CC(O)=C1 LIPCUWYOYHYHLB-UHFFFAOYSA-N 0.000 description 8
- UFINMQZIYXBSNL-UHFFFAOYSA-N 3-(quinolin-2-ylmethoxy)phenol Chemical compound OC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 UFINMQZIYXBSNL-UHFFFAOYSA-N 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 8
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 8
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical class C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 8
- 241000534944 Thia Species 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- 239000012190 activator Substances 0.000 description 8
- 230000029936 alkylation Effects 0.000 description 8
- 238000005804 alkylation reaction Methods 0.000 description 8
- 125000005110 aryl thio group Chemical group 0.000 description 8
- 125000005997 bromomethyl group Chemical group 0.000 description 8
- 230000004069 differentiation Effects 0.000 description 8
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 8
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 8
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 8
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 8
- 229960003105 metformin Drugs 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 8
- 125000006413 ring segment Chemical group 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- SWBPKWRVRIRWRL-UHFFFAOYSA-N 2-[2-(bromomethyl)-4-chloro-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(CBr)=C1OCC#N SWBPKWRVRIRWRL-UHFFFAOYSA-N 0.000 description 7
- WKZPEPYQSLALEE-UHFFFAOYSA-N 2-[2-(bromomethyl)-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(CBr)=C1OCC#N WKZPEPYQSLALEE-UHFFFAOYSA-N 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 7
- 208000008589 Obesity Diseases 0.000 description 7
- 150000001450 anions Chemical class 0.000 description 7
- 239000003472 antidiabetic agent Substances 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 238000005859 coupling reaction Methods 0.000 description 7
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 7
- 239000012039 electrophile Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 235000020824 obesity Nutrition 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 7
- ZHYUBXMNROZUMC-UHFFFAOYSA-N 1-[3-(2-methoxyethoxymethoxy)phenyl]-n-methylmethanamine Chemical compound CNCC1=CC=CC(OCOCCOC)=C1 ZHYUBXMNROZUMC-UHFFFAOYSA-N 0.000 description 6
- JKNOFAQOAIIQAD-UHFFFAOYSA-N 2-[[3-(chloromethyl)phenoxy]methyl]quinoline;hydrochloride Chemical compound Cl.ClCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 JKNOFAQOAIIQAD-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 102000015779 HDL Lipoproteins Human genes 0.000 description 6
- 108010010234 HDL Lipoproteins Proteins 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 150000001350 alkyl halides Chemical class 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical class COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000000018 receptor agonist Substances 0.000 description 6
- 229940044601 receptor agonist Drugs 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- MJFBPZVOKMFINZ-UHFFFAOYSA-N 2-(aminomethyl)-6-methylbenzoic acid Chemical compound CC1=CC=CC(CN)=C1C(O)=O MJFBPZVOKMFINZ-UHFFFAOYSA-N 0.000 description 5
- WDETYCRYUBGKCE-UHFFFAOYSA-N 2-(chloromethyl)quinolin-1-ium;chloride Chemical compound Cl.C1=CC=CC2=NC(CCl)=CC=C21 WDETYCRYUBGKCE-UHFFFAOYSA-N 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- OFUFXTHGZWIDDB-UHFFFAOYSA-N 2-chloroquinoline Chemical compound C1=CC=CC2=NC(Cl)=CC=C21 OFUFXTHGZWIDDB-UHFFFAOYSA-N 0.000 description 5
- 210000002237 B-cell of pancreatic islet Anatomy 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 206010028980 Neoplasm Diseases 0.000 description 5
- 229940123464 Thiazolidinedione Drugs 0.000 description 5
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 5
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical class CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000013058 crude material Substances 0.000 description 5
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 5
- 230000014509 gene expression Effects 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 5
- 230000001965 increasing effect Effects 0.000 description 5
- 150000002596 lactones Chemical class 0.000 description 5
- 229940050176 methyl chloride Drugs 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000002243 precursor Substances 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- 210000001519 tissue Anatomy 0.000 description 5
- 230000009466 transformation Effects 0.000 description 5
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 4
- DDEAEWMDOSXKBX-UHFFFAOYSA-N 2-(chloromethyl)quinoline Chemical compound C1=CC=CC2=NC(CCl)=CC=C21 DDEAEWMDOSXKBX-UHFFFAOYSA-N 0.000 description 4
- VXIXACNBVFOVLY-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N VXIXACNBVFOVLY-UHFFFAOYSA-N 0.000 description 4
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 4
- PJOOIAZRUIIQMU-UHFFFAOYSA-N 2-hydroxy-4-methoxy-6-methylbenzoic acid ethyl ester Chemical compound CCOC(=O)C1=C(C)C=C(OC)C=C1O PJOOIAZRUIIQMU-UHFFFAOYSA-N 0.000 description 4
- VPDAGUVEZGEHJJ-UHFFFAOYSA-N 2-quinolin-2-ylethanol Chemical compound C1=CC=CC2=NC(CCO)=CC=C21 VPDAGUVEZGEHJJ-UHFFFAOYSA-N 0.000 description 4
- HRQOCTMSQBYACS-UHFFFAOYSA-N 3-[(1,3-benzoxazol-2-ylamino)methyl]phenol Chemical compound OC1=CC=CC(CNC=2OC3=CC=CC=C3N=2)=C1 HRQOCTMSQBYACS-UHFFFAOYSA-N 0.000 description 4
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 4
- OKVJCVWFVRATSG-UHFFFAOYSA-N 3-hydroxybenzyl alcohol Chemical compound OCC1=CC=CC(O)=C1 OKVJCVWFVRATSG-UHFFFAOYSA-N 0.000 description 4
- ANSKJZIDWXDAJW-UHFFFAOYSA-N 4-(chloromethyl)-2-phenyl-1,3-oxazole Chemical compound ClCC1=COC(C=2C=CC=CC=2)=N1 ANSKJZIDWXDAJW-UHFFFAOYSA-N 0.000 description 4
- 239000004342 Benzoyl peroxide Substances 0.000 description 4
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 238000006751 Mitsunobu reaction Methods 0.000 description 4
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Chemical class C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 4
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 230000006978 adaptation Effects 0.000 description 4
- 150000004703 alkoxides Chemical class 0.000 description 4
- 239000003125 aqueous solvent Substances 0.000 description 4
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 4
- 230000003143 atherosclerotic effect Effects 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 235000019400 benzoyl peroxide Nutrition 0.000 description 4
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- 208000029078 coronary artery disease Diseases 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 208000035475 disorder Diseases 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- BNAGKEKBEJEVFJ-UHFFFAOYSA-N ethyl 2-hydroxy-6-methyl-4-phenylmethoxybenzoate Chemical compound C1=C(O)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 BNAGKEKBEJEVFJ-UHFFFAOYSA-N 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 230000028709 inflammatory response Effects 0.000 description 4
- 230000003914 insulin secretion Effects 0.000 description 4
- 229910052740 iodine Chemical group 0.000 description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 4
- 150000002632 lipids Chemical class 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- CXGXJNFJXPUDOV-UHFFFAOYSA-N methyl 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(O)=C1 CXGXJNFJXPUDOV-UHFFFAOYSA-N 0.000 description 4
- YRJIMTHQIPOSJR-UHFFFAOYSA-N methyl 2-hydroxy-6-methoxybenzoate Chemical compound COC(=O)C1=C(O)C=CC=C1OC YRJIMTHQIPOSJR-UHFFFAOYSA-N 0.000 description 4
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 4
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 230000036542 oxidative stress Effects 0.000 description 4
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical group [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 4
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 238000000844 transformation Methods 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 4
- GXPHKUHSUJUWKP-UHFFFAOYSA-N troglitazone Chemical compound C1CC=2C(C)=C(O)C(C)=C(C)C=2OC1(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O GXPHKUHSUJUWKP-UHFFFAOYSA-N 0.000 description 4
- 229960001641 troglitazone Drugs 0.000 description 4
- GXPHKUHSUJUWKP-NTKDMRAZSA-N troglitazone Natural products C([C@@]1(OC=2C(C)=C(C(=C(C)C=2CC1)O)C)C)OC(C=C1)=CC=C1C[C@H]1SC(=O)NC1=O GXPHKUHSUJUWKP-NTKDMRAZSA-N 0.000 description 4
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 3
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 3
- CTTDEBFGDMECPC-UHFFFAOYSA-N 2-(2-formyl-6-methylphenoxy)acetonitrile Chemical compound CC1=CC=CC(C=O)=C1OCC#N CTTDEBFGDMECPC-UHFFFAOYSA-N 0.000 description 3
- OUJMXIPHUCDRAS-UHFFFAOYSA-N 2-(5-ethylpyridin-2-yl)ethanol Chemical compound CCC1=CC=C(CCO)N=C1 OUJMXIPHUCDRAS-UHFFFAOYSA-N 0.000 description 3
- JYWHQBLLIBQGCU-UHFFFAOYSA-N 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethanol Chemical compound OCCC1=C(C)OC(C=2C=CC=CC=2)=N1 JYWHQBLLIBQGCU-UHFFFAOYSA-N 0.000 description 3
- UGPQPVWABPCSIP-UHFFFAOYSA-N 2-(bromomethyl)-6-fluoroquinoline Chemical compound N1=C(CBr)C=CC2=CC(F)=CC=C21 UGPQPVWABPCSIP-UHFFFAOYSA-N 0.000 description 3
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 3
- YGYLYDPPSJSHDL-UHFFFAOYSA-N 2-[2-(bromomethyl)-4,6-dichlorophenoxy]acetonitrile Chemical compound ClC1=CC(Cl)=C(OCC#N)C(CBr)=C1 YGYLYDPPSJSHDL-UHFFFAOYSA-N 0.000 description 3
- SIZIZUJLNDIVKO-UHFFFAOYSA-N 2-[2-(hydroxymethyl)-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(CO)=C1OCC#N SIZIZUJLNDIVKO-UHFFFAOYSA-N 0.000 description 3
- FKUGDVWLSKPQLV-UHFFFAOYSA-N 2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]pyridine Chemical compound COCCOCOC1=CC=CC(COCC=2N=CC=CC=2)=C1 FKUGDVWLSKPQLV-UHFFFAOYSA-N 0.000 description 3
- DIDMHZSHGLQFPU-UHFFFAOYSA-N 2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O DIDMHZSHGLQFPU-UHFFFAOYSA-N 0.000 description 3
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 3
- VUPYBCBTINXJGB-UHFFFAOYSA-N 2-methyl-6-[[3-(2-quinolin-2-ylethenyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(C=CC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O VUPYBCBTINXJGB-UHFFFAOYSA-N 0.000 description 3
- BXGYBSJAZFGIPX-UHFFFAOYSA-N 2-pyridin-2-ylethanol Chemical compound OCCC1=CC=CC=N1 BXGYBSJAZFGIPX-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- GHUWCXKGPZWALP-UHFFFAOYSA-N 3-(2-pyridin-2-ylethoxy)phenol Chemical compound OC1=CC=CC(OCCC=2N=CC=CC=2)=C1 GHUWCXKGPZWALP-UHFFFAOYSA-N 0.000 description 3
- RZENAZZCHMPRHI-UHFFFAOYSA-N 3-(2-quinolin-2-ylethenyl)phenol Chemical compound OC1=CC=CC(C=CC=2N=C3C=CC=CC3=CC=2)=C1 RZENAZZCHMPRHI-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical class OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- SVEGSFSFMLCNFF-UHFFFAOYSA-N 4-(chloromethyl)-2-phenyl-1,3-thiazole Chemical compound ClCC1=CSC(C=2C=CC=CC=2)=N1 SVEGSFSFMLCNFF-UHFFFAOYSA-N 0.000 description 3
- BEDVIIYPOFMZRE-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)quinoline Chemical compound C1=CC=CC2=NC(CCl)=CC(Cl)=C21 BEDVIIYPOFMZRE-UHFFFAOYSA-N 0.000 description 3
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 3
- NTSLROIKFLNUIJ-UHFFFAOYSA-N 5-Ethyl-2-methylpyridine Chemical compound CCC1=CC=C(C)N=C1 NTSLROIKFLNUIJ-UHFFFAOYSA-N 0.000 description 3
- KNCHDRLWPAKSII-UHFFFAOYSA-N 5-ethyl-2-methylpyridine Natural products CCC1=CC=NC(C)=C1 KNCHDRLWPAKSII-UHFFFAOYSA-N 0.000 description 3
- IDDIQDVSYHYORP-UHFFFAOYSA-N 6,7-difluoroquinoline Chemical compound C1=CN=C2C=C(F)C(F)=CC2=C1 IDDIQDVSYHYORP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 208000005623 Carcinogenesis Diseases 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 206010060378 Hyperinsulinaemia Diseases 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 102000007330 LDL Lipoproteins Human genes 0.000 description 3
- 108010007622 LDL Lipoproteins Proteins 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229940100389 Sulfonylurea Drugs 0.000 description 3
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 3
- 230000002159 abnormal effect Effects 0.000 description 3
- 229960002632 acarbose Drugs 0.000 description 3
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 3
- VGZSUPCWNCWDAN-UHFFFAOYSA-N acetohexamide Chemical compound C1=CC(C(=O)C)=CC=C1S(=O)(=O)NC(=O)NC1CCCCC1 VGZSUPCWNCWDAN-UHFFFAOYSA-N 0.000 description 3
- 229960001466 acetohexamide Drugs 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 150000001263 acyl chlorides Chemical class 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- XSEUMFJMFFMCIU-UHFFFAOYSA-N buformin Chemical compound CCCC\N=C(/N)N=C(N)N XSEUMFJMFFMCIU-UHFFFAOYSA-N 0.000 description 3
- 229960004111 buformin Drugs 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 230000036952 cancer formation Effects 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 231100000504 carcinogenesis Toxicity 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- 229960001761 chlorpropamide Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002648 combination therapy Methods 0.000 description 3
- 238000001212 derivatisation Methods 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 238000007306 functionalization reaction Methods 0.000 description 3
- 230000009229 glucose formation Effects 0.000 description 3
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 230000003451 hyperinsulinaemic effect Effects 0.000 description 3
- 206010020718 hyperplasia Diseases 0.000 description 3
- 208000006575 hypertriglyceridemia Diseases 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 125000005647 linker group Chemical group 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 239000003614 peroxisome proliferator Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003138 primary alcohols Chemical class 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical class C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 3
- 150000004892 pyridazines Chemical class 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- 238000012552 review Methods 0.000 description 3
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 3
- 229960001860 salicylate Drugs 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 210000002027 skeletal muscle Anatomy 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000000638 solvent extraction Methods 0.000 description 3
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 150000001467 thiazolidinediones Chemical class 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- BWBONKHPVHMQHE-UHFFFAOYSA-N tiocarlide Chemical group C1=CC(OCCC(C)C)=CC=C1NC(=S)NC1=CC=C(OCCC(C)C)C=C1 BWBONKHPVHMQHE-UHFFFAOYSA-N 0.000 description 3
- 229960002171 tiocarlide Drugs 0.000 description 3
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 3
- 229960002277 tolazamide Drugs 0.000 description 3
- 229960005371 tolbutamide Drugs 0.000 description 3
- 150000003852 triazoles Chemical class 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229910052727 yttrium Inorganic materials 0.000 description 3
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- OXGDKDFWZLJUSQ-UHFFFAOYSA-N 1-(bromomethyl)-4-tert-butylcyclohexane Chemical compound CC(C)(C)C1CCC(CBr)CC1 OXGDKDFWZLJUSQ-UHFFFAOYSA-N 0.000 description 2
- QUYVTGFWFHQVRO-UHFFFAOYSA-N 1-(chloromethyl)-3-phenoxybenzene Chemical compound ClCC1=CC=CC(OC=2C=CC=CC=2)=C1 QUYVTGFWFHQVRO-UHFFFAOYSA-N 0.000 description 2
- CQJGEOKWGXZFBO-UHFFFAOYSA-N 1-[2-hydroxy-4-(quinolin-2-ylmethoxy)phenyl]ethanone Chemical compound C1=C(O)C(C(=O)C)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 CQJGEOKWGXZFBO-UHFFFAOYSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- SULYEHHGGXARJS-UHFFFAOYSA-N 2',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1O SULYEHHGGXARJS-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 2
- GRYVSQPYRHAJTG-UHFFFAOYSA-N 2-(2,4-dichloro-6-formylphenoxy)acetonitrile Chemical compound ClC1=CC(Cl)=C(OCC#N)C(C=O)=C1 GRYVSQPYRHAJTG-UHFFFAOYSA-N 0.000 description 2
- AXRVMKOHOIVYCO-UHFFFAOYSA-N 2-(4-chloro-2,6-dimethylphenoxy)acetonitrile Chemical compound CC1=CC(Cl)=CC(C)=C1OCC#N AXRVMKOHOIVYCO-UHFFFAOYSA-N 0.000 description 2
- XDZCVHVCPDWSGH-UHFFFAOYSA-N 2-(4-chloro-2-formyl-6-methoxyphenoxy)acetonitrile Chemical compound COC1=CC(Cl)=CC(C=O)=C1OCC#N XDZCVHVCPDWSGH-UHFFFAOYSA-N 0.000 description 2
- HLDSBJZEFARTFR-UHFFFAOYSA-N 2-(bromomethyl)-1-methylquinolin-4-one Chemical compound C1=CC=C2N(C)C(CBr)=CC(=O)C2=C1 HLDSBJZEFARTFR-UHFFFAOYSA-N 0.000 description 2
- CJXKXXVHPLUATC-UHFFFAOYSA-N 2-(bromomethyl)-6,8-difluoroquinoline Chemical compound N1=C(CBr)C=CC2=CC(F)=CC(F)=C21 CJXKXXVHPLUATC-UHFFFAOYSA-N 0.000 description 2
- QGXNHCXKWFNKCG-UHFFFAOYSA-N 2-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC=C1C#N QGXNHCXKWFNKCG-UHFFFAOYSA-N 0.000 description 2
- MXANKYKNKHBMTR-UHFFFAOYSA-N 2-(chloromethyl)-3-methylquinoxaline Chemical compound C1=CC=C2N=C(CCl)C(C)=NC2=C1 MXANKYKNKHBMTR-UHFFFAOYSA-N 0.000 description 2
- RFQANNQGIYHMHO-UHFFFAOYSA-N 2-(chloromethyl)-5-ethylpyridine Chemical compound CCC1=CC=C(CCl)N=C1 RFQANNQGIYHMHO-UHFFFAOYSA-N 0.000 description 2
- YJFTUIPJJBKOQG-UHFFFAOYSA-N 2-(chloromethyl)-5-phenylpyridine Chemical compound C1=NC(CCl)=CC=C1C1=CC=CC=C1 YJFTUIPJJBKOQG-UHFFFAOYSA-N 0.000 description 2
- IFOZFMPOHZGLBK-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxyquinoline Chemical compound N1=C(CCl)C=CC2=CC(OC)=CC=C21 IFOZFMPOHZGLBK-UHFFFAOYSA-N 0.000 description 2
- AAUVNJJBLOZTAO-UHFFFAOYSA-N 2-(chloromethyl)quinoxaline Chemical compound C1=CC=CC2=NC(CCl)=CN=C21 AAUVNJJBLOZTAO-UHFFFAOYSA-N 0.000 description 2
- ZILVNHNSYBNLSZ-UHFFFAOYSA-N 2-(diaminomethylideneamino)guanidine Chemical compound NC(N)=NNC(N)=N ZILVNHNSYBNLSZ-UHFFFAOYSA-N 0.000 description 2
- DDXVLAFNBBIABP-UHFFFAOYSA-N 2-(hydroxymethyl)-1-methylquinolin-4-one Chemical compound C1=CC=C2N(C)C(CO)=CC(=O)C2=C1 DDXVLAFNBBIABP-UHFFFAOYSA-N 0.000 description 2
- KMXRDJSJGPWUAY-UHFFFAOYSA-N 2-[2,4-dichloro-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound ClC1=CC(Cl)=C(OCC#N)C(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 KMXRDJSJGPWUAY-UHFFFAOYSA-N 0.000 description 2
- HXJCBLIOQFONHM-UHFFFAOYSA-N 2-[2,4-dichloro-6-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound C1=CC2=CC(F)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC(Cl)=CC(Cl)=C1OCC#N HXJCBLIOQFONHM-UHFFFAOYSA-N 0.000 description 2
- ZSQMTXRRBGIGQS-UHFFFAOYSA-N 2-[2-(bromomethyl)-4-chloro-6-methoxyphenoxy]acetonitrile Chemical compound COC1=CC(Cl)=CC(CBr)=C1OCC#N ZSQMTXRRBGIGQS-UHFFFAOYSA-N 0.000 description 2
- ZNKLCJTVFCPJSR-UHFFFAOYSA-N 2-[2-[3-(2-methoxyethoxymethoxy)phenoxy]ethoxy]pyridine Chemical compound COCCOCOC1=CC=CC(OCCOC=2N=CC=CC=2)=C1 ZNKLCJTVFCPJSR-UHFFFAOYSA-N 0.000 description 2
- VRUOYSZMHTWAHK-UHFFFAOYSA-N 2-[2-[3-(2-methoxyethoxymethoxy)phenyl]ethenyl]quinoline Chemical compound COCCOCOC1=CC=CC(C=CC=2N=C3C=CC=CC3=CC=2)=C1 VRUOYSZMHTWAHK-UHFFFAOYSA-N 0.000 description 2
- ZCLGQOJKHGKPHW-UHFFFAOYSA-N 2-[2-[[3-(bromomethyl)phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CBr)C=CC=2)=C1OCC#N ZCLGQOJKHGKPHW-UHFFFAOYSA-N 0.000 description 2
- MTVQCBMENFSDPQ-UHFFFAOYSA-N 2-[2-[[3-(hydroxymethyl)phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CO)C=CC=2)=C1OCC#N MTVQCBMENFSDPQ-UHFFFAOYSA-N 0.000 description 2
- DUSMHVNEJBQRER-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-4-chloro-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC#N DUSMHVNEJBQRER-UHFFFAOYSA-N 0.000 description 2
- AMXONCBYWLTUTQ-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC#N AMXONCBYWLTUTQ-UHFFFAOYSA-N 0.000 description 2
- WPDDBXJFMRUPHB-UHFFFAOYSA-N 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(Cl)C(Cl)=CC=3)C=CC=2)=C1OCC#N WPDDBXJFMRUPHB-UHFFFAOYSA-N 0.000 description 2
- OQVMFLXEPAELDQ-UHFFFAOYSA-N 2-[2-[[3-[(3-methoxyphenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound COC1=CC=CC(COC=2C=C(OCC=3C(=C(C)C=CC=3)OCC#N)C=CC=2)=C1 OQVMFLXEPAELDQ-UHFFFAOYSA-N 0.000 description 2
- OTINJLUILHTQOL-UHFFFAOYSA-N 2-[2-[[3-[(6,7-dichloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C(Cl)=CC4=CC=3)C=CC=2)=C1OCC#N OTINJLUILHTQOL-UHFFFAOYSA-N 0.000 description 2
- VWUXNZIVGVKCQA-UHFFFAOYSA-N 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C(F)=CC(F)=CC4=CC=3)C=CC=2)=C1OCC#N VWUXNZIVGVKCQA-UHFFFAOYSA-N 0.000 description 2
- UYHRMXSULUMZKE-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC#N UYHRMXSULUMZKE-UHFFFAOYSA-N 0.000 description 2
- QBFUKAMKHKQXRO-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C=CC4=CC=3)C=CC=2)=C1OCC#N QBFUKAMKHKQXRO-UHFFFAOYSA-N 0.000 description 2
- SYWRWYQAXUIVAI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC#N SYWRWYQAXUIVAI-UHFFFAOYSA-N 0.000 description 2
- VTYJIEUZFGCIAR-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-quinolin-2-ylethenyl)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(C=CC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O VTYJIEUZFGCIAR-UHFFFAOYSA-N 0.000 description 2
- SOOBQIALUOBHOG-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-3-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=NC=CC=3)C=CC=2)=C1OCC#N SOOBQIALUOBHOG-UHFFFAOYSA-N 0.000 description 2
- LZPIHYYGBCSCEK-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-4-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CN=CC=3)C=CC=2)=C1OCC#N LZPIHYYGBCSCEK-UHFFFAOYSA-N 0.000 description 2
- HYHBBSYBHUNCPE-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N HYHBBSYBHUNCPE-UHFFFAOYSA-N 0.000 description 2
- LYONMDOUZKMBNY-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxymethyl)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N LYONMDOUZKMBNY-UHFFFAOYSA-N 0.000 description 2
- SJIHWCYJFDYMTO-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1,3,3-trimethyl-2-oxoindol-6-yl)oxymethyl]phenoxy]methyl]phenoxy]acetonitrile Chemical compound C1=C2N(C)C(=O)C(C)(C)C2=CC=C1OCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC#N SJIHWCYJFDYMTO-UHFFFAOYSA-N 0.000 description 2
- PSLFDJBNJYPLSW-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(quinolin-2-ylamino)methyl]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CNC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N PSLFDJBNJYPLSW-UHFFFAOYSA-N 0.000 description 2
- BORMBPIQGSCLLT-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N BORMBPIQGSCLLT-UHFFFAOYSA-N 0.000 description 2
- VHENHMZDUDYJGD-UHFFFAOYSA-N 2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxy]quinoline Chemical compound COCCOCOC1=CC=CC(COC=2N=C3C=CC=CC3=CC=2)=C1 VHENHMZDUDYJGD-UHFFFAOYSA-N 0.000 description 2
- QAMGVCXYKXXKHO-UHFFFAOYSA-N 2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]quinoline Chemical compound COCCOCOC1=CC=CC(COCC=2N=C3C=CC=CC3=CC=2)=C1 QAMGVCXYKXXKHO-UHFFFAOYSA-N 0.000 description 2
- BRTWWLOCLQUDCP-UHFFFAOYSA-N 2-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC=CC=3)Cl)C=CC=2)=C1C(O)=O BRTWWLOCLQUDCP-UHFFFAOYSA-N 0.000 description 2
- GEENREOGYOEXOF-UHFFFAOYSA-N 2-[[3-[(2-cyclohexyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C3CCCCC3)C=CC=2)=C1C(O)=O GEENREOGYOEXOF-UHFFFAOYSA-N 0.000 description 2
- DLSFXWHOMLPHOU-UHFFFAOYSA-N 2-[[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=NOC(C)=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 DLSFXWHOMLPHOU-UHFFFAOYSA-N 0.000 description 2
- NKNOGVREFCHVJA-UHFFFAOYSA-N 2-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(Cl)=CC=3)C=CC=2)=C1C(O)=O NKNOGVREFCHVJA-UHFFFAOYSA-N 0.000 description 2
- WENKSQXOAPQUPS-UHFFFAOYSA-N 2-[[3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(ON=3)C(C)(C)C)C=CC=2)=C1C(O)=O WENKSQXOAPQUPS-UHFFFAOYSA-N 0.000 description 2
- DRDVLUXBTXLAOL-UHFFFAOYSA-N 2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C=CC4=CC=3)C=CC=2)=C1C(O)=O DRDVLUXBTXLAOL-UHFFFAOYSA-N 0.000 description 2
- CSDNADBZCDYVAK-UHFFFAOYSA-N 2-[[3-[2-(5-ethylpyridin-2-yl)ethoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound N1=CC(CC)=CC=C1CCOC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 CSDNADBZCDYVAK-UHFFFAOYSA-N 0.000 description 2
- JYLHSTHXYVMLLU-UHFFFAOYSA-N 2-[[3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C=3C=CC(F)=CC=3)C=CC=2)=C1C(O)=O JYLHSTHXYVMLLU-UHFFFAOYSA-N 0.000 description 2
- KGNOTIUQWRHRCU-UHFFFAOYSA-N 2-[[3-[[2-(chloromethyl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound ClCC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 KGNOTIUQWRHRCU-UHFFFAOYSA-N 0.000 description 2
- IJBQXLGDMPMXAU-UHFFFAOYSA-N 2-[[3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC=1ON=C(C=2C(=CC=CC=2Cl)Cl)C=1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O IJBQXLGDMPMXAU-UHFFFAOYSA-N 0.000 description 2
- FXWFZIRWWNPPOV-UHFFFAOYSA-N 2-aminobenzaldehyde Chemical compound NC1=CC=CC=C1C=O FXWFZIRWWNPPOV-UHFFFAOYSA-N 0.000 description 2
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 2
- BBVQDWDBTWSGHQ-UHFFFAOYSA-N 2-chloro-1,3-benzoxazole Chemical compound C1=CC=C2OC(Cl)=NC2=C1 BBVQDWDBTWSGHQ-UHFFFAOYSA-N 0.000 description 2
- VHKDPJQJCMVQFZ-UHFFFAOYSA-N 2-chloro-6-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC(Cl)=N1 VHKDPJQJCMVQFZ-UHFFFAOYSA-N 0.000 description 2
- JXNAIOCJWBJGFQ-UHFFFAOYSA-N 2-methyl-5-phenylpyridine Chemical compound C1=NC(C)=CC=C1C1=CC=CC=C1 JXNAIOCJWBJGFQ-UHFFFAOYSA-N 0.000 description 2
- XXISGLPLGYCRNR-UHFFFAOYSA-N 2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O XXISGLPLGYCRNR-UHFFFAOYSA-N 0.000 description 2
- XRMDXKOJBGEXNA-UHFFFAOYSA-N 2-methyl-6-[[3-[[5-methyl-2,4-di(propan-2-yl)phenyl]methoxy]phenoxy]methyl]benzoic acid Chemical compound C1=C(C)C(C(C)C)=CC(C(C)C)=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 XRMDXKOJBGEXNA-UHFFFAOYSA-N 0.000 description 2
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 description 2
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical compound CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 2
- ZIMBOQBFCUHTRA-UHFFFAOYSA-N 2-methylpropyl 2-[(3-hydroxyphenyl)sulfanylmethyl]-6-methylbenzoate Chemical compound CC(C)COC(=O)C1=C(C)C=CC=C1CSC1=CC=CC(O)=C1 ZIMBOQBFCUHTRA-UHFFFAOYSA-N 0.000 description 2
- WWPMYEXZBXFQLB-UHFFFAOYSA-N 2-methylpropyl 2-[(3-methoxyphenyl)sulfanylmethyl]-6-methylbenzoate Chemical compound COC1=CC=CC(SCC=2C(=C(C)C=CC=2)C(=O)OCC(C)C)=C1 WWPMYEXZBXFQLB-UHFFFAOYSA-N 0.000 description 2
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical group C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 2
- AXNUZKSSQHTNPZ-UHFFFAOYSA-N 3,4-difluoroaniline Chemical compound NC1=CC=C(F)C(F)=C1 AXNUZKSSQHTNPZ-UHFFFAOYSA-N 0.000 description 2
- VBUZAHLUWZTYIQ-UHFFFAOYSA-N 3-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=CC=CC(C=O)=C1 VBUZAHLUWZTYIQ-UHFFFAOYSA-N 0.000 description 2
- GHXJFONLLJZIQZ-UHFFFAOYSA-N 3-(2-methoxyethoxymethoxy)benzonitrile Chemical compound COCCOCOC1=CC=CC(C#N)=C1 GHXJFONLLJZIQZ-UHFFFAOYSA-N 0.000 description 2
- ISVBGXFYYGKQEZ-UHFFFAOYSA-N 3-(2-pyridin-2-yloxyethoxy)phenol Chemical compound OC1=CC=CC(OCCOC=2N=CC=CC=2)=C1 ISVBGXFYYGKQEZ-UHFFFAOYSA-N 0.000 description 2
- PVOXPZFMSLPPKE-UHFFFAOYSA-N 3-(pyridin-2-ylmethoxymethyl)phenol Chemical compound OC1=CC=CC(COCC=2N=CC=CC=2)=C1 PVOXPZFMSLPPKE-UHFFFAOYSA-N 0.000 description 2
- CQSPRGHJTMPQKM-UHFFFAOYSA-N 3-(quinolin-2-yloxymethyl)phenol Chemical compound OC1=CC=CC(COC=2N=C3C=CC=CC3=CC=2)=C1 CQSPRGHJTMPQKM-UHFFFAOYSA-N 0.000 description 2
- UFKMMBOFOVKGHS-UHFFFAOYSA-N 3-[(4-chloroquinolin-2-yl)methoxymethyl]phenol Chemical compound OC1=CC=CC(COCC=2N=C3C=CC=CC3=C(Cl)C=2)=C1 UFKMMBOFOVKGHS-UHFFFAOYSA-N 0.000 description 2
- LKSUDSMBCAWGGX-UHFFFAOYSA-N 3-[(quinolin-2-ylamino)methyl]phenol Chemical compound OC1=CC=CC(CNC=2N=C3C=CC=CC3=CC=2)=C1 LKSUDSMBCAWGGX-UHFFFAOYSA-N 0.000 description 2
- KYSWPWKDAFDIDD-UHFFFAOYSA-N 3-[[methyl(quinolin-2-yl)amino]methyl]phenol Chemical compound C=1C=C2C=CC=CC2=NC=1N(C)CC1=CC=CC(O)=C1 KYSWPWKDAFDIDD-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- SGHBRHKBCLLVCI-UHFFFAOYSA-N 3-hydroxybenzonitrile Chemical compound OC1=CC=CC(C#N)=C1 SGHBRHKBCLLVCI-UHFFFAOYSA-N 0.000 description 2
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 2
- GVPZSTFLDSJXRT-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole Chemical compound C1=CC(F)=CC=C1C1=NC(CCl)=CO1 GVPZSTFLDSJXRT-UHFFFAOYSA-N 0.000 description 2
- BMFBHBSLWMGSRE-UHFFFAOYSA-N 4-(chloromethyl)-2-cyclohexyl-1,3-oxazole Chemical compound ClCC1=COC(C2CCCCC2)=N1 BMFBHBSLWMGSRE-UHFFFAOYSA-N 0.000 description 2
- VWYKSJIPZHRLNO-UHFFFAOYSA-N 4-chloro-2,6-dimethylphenol Chemical compound CC1=CC(Cl)=CC(C)=C1O VWYKSJIPZHRLNO-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- CKOZVEHVVHCMGD-UHFFFAOYSA-N 5-[(4-fluorophenyl)methyl]-n,n-dimethyltetrazole-1-carboxamide Chemical compound CN(C)C(=O)N1N=NN=C1CC1=CC=C(F)C=C1 CKOZVEHVVHCMGD-UHFFFAOYSA-N 0.000 description 2
- PQKYPMGTDHNSRL-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methoxybenzaldehyde Chemical compound COC1=CC(Cl)=CC(C=O)=C1O PQKYPMGTDHNSRL-UHFFFAOYSA-N 0.000 description 2
- NUDXKJOCNHFUEZ-UHFFFAOYSA-N 5-ethyl-2-methyl-1-oxidopyridin-1-ium Chemical compound CCC1=CC=C(C)[N+]([O-])=C1 NUDXKJOCNHFUEZ-UHFFFAOYSA-N 0.000 description 2
- UUURKCKHQXFBQP-UHFFFAOYSA-N 6,8-difluoro-2-methylquinoline Chemical compound C1=C(F)C=C(F)C2=NC(C)=CC=C21 UUURKCKHQXFBQP-UHFFFAOYSA-N 0.000 description 2
- BBMZNBFIUFTOHL-UHFFFAOYSA-N 6-methoxy-1,3,3-trimethylindol-2-one Chemical compound COC1=CC=C2C(C)(C)C(=O)N(C)C2=C1 BBMZNBFIUFTOHL-UHFFFAOYSA-N 0.000 description 2
- VDRLGRBSQTUUOX-UHFFFAOYSA-N 7-chloro-2-(chloromethyl)quinoline Chemical compound C1=CC(Cl)=CC2=NC(CCl)=CC=C21 VDRLGRBSQTUUOX-UHFFFAOYSA-N 0.000 description 2
- 238000005664 Alder-Rickert cycloaddition reaction Methods 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical compound CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- 239000012988 Dithioester Substances 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 206010014561 Emphysema Diseases 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- 208000013016 Hypoglycemia Diseases 0.000 description 2
- 102000003746 Insulin Receptor Human genes 0.000 description 2
- 108010001127 Insulin Receptor Proteins 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- 238000008214 LDL Cholesterol Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 102000008299 Nitric Oxide Synthase Human genes 0.000 description 2
- 108010021487 Nitric Oxide Synthase Proteins 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 102100038824 Peroxisome proliferator-activated receptor delta Human genes 0.000 description 2
- 101710117029 Peroxisome proliferator-activated receptor delta Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical class C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- HRKAMJBPFPHCSD-UHFFFAOYSA-N Tri-isobutylphosphate Chemical compound CC(C)COP(=O)(OCC(C)C)OCC(C)C HRKAMJBPFPHCSD-UHFFFAOYSA-N 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- FMPAIVMIVVQUDZ-UHFFFAOYSA-N [3-(2-methoxyethoxymethoxy)phenyl]methanamine Chemical compound COCCOCOC1=CC=CC(CN)=C1 FMPAIVMIVVQUDZ-UHFFFAOYSA-N 0.000 description 2
- FARMNDXIOAHJMF-UHFFFAOYSA-N [3-(quinolin-2-ylmethoxy)phenyl]methanol Chemical compound OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 FARMNDXIOAHJMF-UHFFFAOYSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 210000000577 adipose tissue Anatomy 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 2
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 230000001363 autoimmune Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 2
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 125000002993 cycloalkylene group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 125000005022 dithioester group Chemical group 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- QXQQEZSRMZQLEO-UHFFFAOYSA-N ethyl 2-(2,6-dimethylphenoxy)acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1C QXQQEZSRMZQLEO-UHFFFAOYSA-N 0.000 description 2
- YLZFDQDBNKEMCJ-UHFFFAOYSA-N ethyl 2-[[3-[[2-(cyanomethoxy)-3-methylphenyl]methoxy]phenyl]methoxy]-6-methyl-4-phenylmethoxybenzoate Chemical compound C1=C(OCC=2C=C(OCC=3C(=C(C)C=CC=3)OCC#N)C=CC=2)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 YLZFDQDBNKEMCJ-UHFFFAOYSA-N 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 230000037406 food intake Effects 0.000 description 2
- 235000012631 food intake Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 229960004580 glibenclamide Drugs 0.000 description 2
- ZNNLBTZKUZBEKO-UHFFFAOYSA-N glyburide Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZNNLBTZKUZBEKO-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 230000002440 hepatic effect Effects 0.000 description 2
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 2
- 125000005368 heteroarylthio group Chemical group 0.000 description 2
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000002460 imidazoles Chemical class 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 206010024627 liposarcoma Diseases 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- 210000002540 macrophage Anatomy 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- XJMULMWDHLJUKP-UHFFFAOYSA-N methyl 2,6-dimethylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1C XJMULMWDHLJUKP-UHFFFAOYSA-N 0.000 description 2
- UDNSKBMNXZVXKW-UHFFFAOYSA-N methyl 2-(bromomethyl)-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1CBr UDNSKBMNXZVXKW-UHFFFAOYSA-N 0.000 description 2
- ONKMIOBXDYNNGK-UHFFFAOYSA-N methyl 2-[[3-[(3-bromophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=C(Br)C=CC=2)=C1 ONKMIOBXDYNNGK-UHFFFAOYSA-N 0.000 description 2
- WPBWVRJHOQRNEI-UHFFFAOYSA-N methyl 2-[[3-[(4-tert-butylcyclohexyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC2CCC(CC2)C(C)(C)C)=C1 WPBWVRJHOQRNEI-UHFFFAOYSA-N 0.000 description 2
- PYPQECUZMIYIGC-UHFFFAOYSA-N methyl 2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(=CC=2)C(C)(C)C)=C1 PYPQECUZMIYIGC-UHFFFAOYSA-N 0.000 description 2
- OVSILABHTPNMQM-UHFFFAOYSA-N methyl 2-[[3-[(5-ethylpyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound N1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(=O)OC)=C1 OVSILABHTPNMQM-UHFFFAOYSA-N 0.000 description 2
- BWRCJLJJIXYLNV-UHFFFAOYSA-N methyl 2-hydroxy-3-methoxybenzoate Chemical compound COC(=O)C1=CC=CC(OC)=C1O BWRCJLJJIXYLNV-UHFFFAOYSA-N 0.000 description 2
- ZICRWXFGZCVTBZ-UHFFFAOYSA-N methyl 2-hydroxy-4-methoxybenzoate Chemical compound COC(=O)C1=CC=C(OC)C=C1O ZICRWXFGZCVTBZ-UHFFFAOYSA-N 0.000 description 2
- DFNBGZODMHWKKK-UHFFFAOYSA-N methyl 2-hydroxy-5-methoxybenzoate Chemical compound COC(=O)C1=CC(OC)=CC=C1O DFNBGZODMHWKKK-UHFFFAOYSA-N 0.000 description 2
- IKMPYLXZCOHVDD-UHFFFAOYSA-N methyl 2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC=CC=2)=C1 IKMPYLXZCOHVDD-UHFFFAOYSA-N 0.000 description 2
- CQNSNESUAPDCJP-UHFFFAOYSA-N methyl 2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=C3C=CC=CC3=CC=2)=C1 CQNSNESUAPDCJP-UHFFFAOYSA-N 0.000 description 2
- FHPSTJQFPVEYJT-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[(3-methylquinoxalin-2-yl)methoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=NC3=CC=CC=C3N=2)C)=C1 FHPSTJQFPVEYJT-UHFFFAOYSA-N 0.000 description 2
- ZPPQNSIQMGWSCQ-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[(4-propan-2-ylphenyl)methoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(=CC=2)C(C)C)=C1 ZPPQNSIQMGWSCQ-UHFFFAOYSA-N 0.000 description 2
- INQCGTXAYKWHGH-UHFFFAOYSA-N methyl 3-(bromomethyl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1CBr INQCGTXAYKWHGH-UHFFFAOYSA-N 0.000 description 2
- 229960001047 methyl salicylate Drugs 0.000 description 2
- 230000027939 micturition Effects 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 150000002916 oxazoles Chemical class 0.000 description 2
- 210000002824 peroxisome Anatomy 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 230000004526 pharmaceutical effect Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 229960003387 progesterone Drugs 0.000 description 2
- 239000000186 progesterone Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 229960001404 quinidine Drugs 0.000 description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 150000003902 salicylic acid esters Chemical class 0.000 description 2
- 230000003248 secreting effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 2
- 229960002218 sodium chlorite Drugs 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- 230000010009 steroidogenesis Effects 0.000 description 2
- 230000004936 stimulating effect Effects 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- YFNKIDBQEZZDLK-UHFFFAOYSA-N triglyme Chemical compound COCCOCCOCCOC YFNKIDBQEZZDLK-UHFFFAOYSA-N 0.000 description 2
- BRHOKTBAFIQRFX-UHFFFAOYSA-M triphenyl(quinolin-2-ylmethyl)phosphanium;chloride Chemical compound [Cl-].C=1C=C2C=CC=CC2=NC=1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BRHOKTBAFIQRFX-UHFFFAOYSA-M 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- ITYNGVSTWVVPIC-DHGKCCLASA-N (-)-allo-Aromadendrene Chemical compound C([C@@H]1[C@H]2C1(C)C)CC(=C)[C@@H]1[C@H]2[C@H](C)CC1 ITYNGVSTWVVPIC-DHGKCCLASA-N 0.000 description 1
- SHULEACXTONYPS-UHFFFAOYSA-N (3-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 SHULEACXTONYPS-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical class O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- GGWBQKOXLMPNMS-UHFFFAOYSA-N (4-tert-butylcyclohexyl)methanol Chemical compound CC(C)(C)C1CCC(CO)CC1 GGWBQKOXLMPNMS-UHFFFAOYSA-N 0.000 description 1
- GLZPCOQZEFWAFX-JXMROGBWSA-N (E)-Geraniol Chemical compound CC(C)=CCC\C(C)=C\CO GLZPCOQZEFWAFX-JXMROGBWSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 150000005071 1,2,4-oxadiazoles Chemical class 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical class C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- FMGGHNGKHRCJLL-UHFFFAOYSA-N 1,2-bis(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1CCl FMGGHNGKHRCJLL-UHFFFAOYSA-N 0.000 description 1
- QFMZQPDHXULLKC-UHFFFAOYSA-N 1,2-bis(diphenylphosphino)ethane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCP(C=1C=CC=CC=1)C1=CC=CC=C1 QFMZQPDHXULLKC-UHFFFAOYSA-N 0.000 description 1
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 1
- 125000004510 1,3,4-oxadiazol-5-yl group Chemical group O1C=NN=C1* 0.000 description 1
- 150000005072 1,3,4-oxadiazoles Chemical class 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-Bis(diphenylphosphino)propane Substances C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- 125000005838 1,3-cyclopentylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:2])C([H])([H])C1([H])[*:1] 0.000 description 1
- NQPJDJVGBDHCAD-UHFFFAOYSA-N 1,3-diazinan-2-one Chemical compound OC1=NCCCN1 NQPJDJVGBDHCAD-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- 125000000182 1,4-naphthoquinonyl group Chemical group C1(C(=CC(C2=CC=CC=C12)=O)*)=O 0.000 description 1
- WMKGGPCROCCUDY-UHFFFAOYSA-N 1,5-diphenylpenta-1,4-dien-3-one Chemical compound C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1 WMKGGPCROCCUDY-UHFFFAOYSA-N 0.000 description 1
- SWFFFUJOWAJJCH-UHFFFAOYSA-N 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CBr)C(C(F)(F)F)=C1 SWFFFUJOWAJJCH-UHFFFAOYSA-N 0.000 description 1
- WGVYCXYGPNNUQA-UHFFFAOYSA-N 1-(bromomethyl)-2-methylbenzene Chemical group CC1=CC=CC=C1CBr WGVYCXYGPNNUQA-UHFFFAOYSA-N 0.000 description 1
- QZNQSIHCDAGZIA-UHFFFAOYSA-N 1-(bromomethyl)-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(CBr)C=C1 QZNQSIHCDAGZIA-UHFFFAOYSA-N 0.000 description 1
- YHMFTAUOYLECGZ-UHFFFAOYSA-N 1-(chloromethyl)-2,4,5-trimethylbenzene Chemical compound CC1=CC(C)=C(CCl)C=C1C YHMFTAUOYLECGZ-UHFFFAOYSA-N 0.000 description 1
- VGISFWWEOGVMED-UHFFFAOYSA-N 1-(chloromethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CCl)=C1 VGISFWWEOGVMED-UHFFFAOYSA-N 0.000 description 1
- DUBCVXSYZVTCOC-UHFFFAOYSA-N 1-(chloromethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(CCl)C=C1 DUBCVXSYZVTCOC-UHFFFAOYSA-N 0.000 description 1
- HLQZCRVEEQKNMS-UHFFFAOYSA-N 1-(chloromethyl)-4-phenylbenzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=CC=C1 HLQZCRVEEQKNMS-UHFFFAOYSA-N 0.000 description 1
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 1
- WSAAMLRZZHNAGH-UHFFFAOYSA-N 1-(chloromethyl)-5-methyl-2,4-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=C(CCl)C=C1C WSAAMLRZZHNAGH-UHFFFAOYSA-N 0.000 description 1
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 1
- OOSZCNKVJAVHJI-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]piperazine Chemical compound C1=CC(F)=CC=C1CN1CCNCC1 OOSZCNKVJAVHJI-UHFFFAOYSA-N 0.000 description 1
- BNLRVFJSVGTTGG-UHFFFAOYSA-N 1-[3-(chloromethyl)-4-methoxyphenyl]ethanone Chemical compound COC1=CC=C(C(C)=O)C=C1CCl BNLRVFJSVGTTGG-UHFFFAOYSA-N 0.000 description 1
- OFFSPAZVIVZPHU-UHFFFAOYSA-N 1-benzofuran-2-carboxylic acid Chemical class C1=CC=C2OC(C(=O)O)=CC2=C1 OFFSPAZVIVZPHU-UHFFFAOYSA-N 0.000 description 1
- ZPCJPJQUVRIILS-UHFFFAOYSA-N 1-bromo-3-(bromomethyl)benzene Chemical compound BrCC1=CC=CC(Br)=C1 ZPCJPJQUVRIILS-UHFFFAOYSA-N 0.000 description 1
- BASMANVIUSSIIM-UHFFFAOYSA-N 1-chloro-2-(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1Cl BASMANVIUSSIIM-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- WAXIFMGAKWIFDQ-UHFFFAOYSA-N 1-tert-butyl-4-(chloromethyl)benzene Chemical compound CC(C)(C)C1=CC=C(CCl)C=C1 WAXIFMGAKWIFDQ-UHFFFAOYSA-N 0.000 description 1
- VHRUMKCAEVRUBK-GODQJPCRSA-N 15-deoxy-Delta(12,14)-prostaglandin J2 Chemical compound CCCCC\C=C\C=C1/[C@@H](C\C=C/CCCC(O)=O)C=CC1=O VHRUMKCAEVRUBK-GODQJPCRSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- WEVFUSSJCGAVOH-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical group C1=CC=C2OC(C(=O)O)CC2=C1 WEVFUSSJCGAVOH-UHFFFAOYSA-N 0.000 description 1
- ITMGMSZDAOAVNO-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-ylmethanol Chemical compound C1=CC=C2OC(CO)CC2=C1 ITMGMSZDAOAVNO-UHFFFAOYSA-N 0.000 description 1
- NSFIAKFOCAEBER-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(4-methylphenyl)butanedioic acid Chemical class C1=CC(C)=CC=C1C(O)(C(O)=O)C(O)(C(O)=O)C1=CC=C(C)C=C1 NSFIAKFOCAEBER-UHFFFAOYSA-N 0.000 description 1
- FKHNZQFCDGOQGV-UHFFFAOYSA-N 2,3-dimethylquinoxaline Chemical compound C1=CC=C2N=C(C)C(C)=NC2=C1 FKHNZQFCDGOQGV-UHFFFAOYSA-N 0.000 description 1
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 1
- UQSRXQMIXSZGLA-UHFFFAOYSA-N 2,4-dihydroxy-6-methylbenzoic acid ethyl ester Chemical compound CCOC(=O)C1=C(C)C=C(O)C=C1O UQSRXQMIXSZGLA-UHFFFAOYSA-N 0.000 description 1
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical class OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 1
- JSXTUKSOFJPTFV-UHFFFAOYSA-N 2,6-dibromo-1h-pyridazine Chemical compound BrN1NC(Br)=CC=C1 JSXTUKSOFJPTFV-UHFFFAOYSA-N 0.000 description 1
- FEYDZHNIIMENOB-UHFFFAOYSA-N 2,6-dibromopyridine Chemical compound BrC1=CC=CC(Br)=N1 FEYDZHNIIMENOB-UHFFFAOYSA-N 0.000 description 1
- NLHGWRZNSSLVMD-UHFFFAOYSA-N 2-(2-tert-butyl-6-methylphenoxy)acetonitrile Chemical compound CC1=CC=CC(C(C)(C)C)=C1OCC#N NLHGWRZNSSLVMD-UHFFFAOYSA-N 0.000 description 1
- WNKGWGYRZPIHSQ-UHFFFAOYSA-N 2-(bromomethyl)-3-methylnaphthalene Chemical compound C1=CC=C2C=C(CBr)C(C)=CC2=C1 WNKGWGYRZPIHSQ-UHFFFAOYSA-N 0.000 description 1
- WJOPLBNTJYROCF-UHFFFAOYSA-N 2-(bromomethyl)-7-chloroquinoline Chemical compound C1=CC(CBr)=NC2=CC(Cl)=CC=C21 WJOPLBNTJYROCF-UHFFFAOYSA-N 0.000 description 1
- PECXPZGFZFGDRD-UHFFFAOYSA-N 2-(chloromethyl)-1,4-dimethylbenzene Chemical compound CC1=CC=C(C)C(CCl)=C1 PECXPZGFZFGDRD-UHFFFAOYSA-N 0.000 description 1
- MPCHQYWZAVTABQ-UHFFFAOYSA-N 2-(chloromethyl)naphthalene Chemical compound C1=CC=CC2=CC(CCl)=CC=C21 MPCHQYWZAVTABQ-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- LDKLCVRBYMIFQX-UHFFFAOYSA-N 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(O)C=CC=2)=C1C(O)=O LDKLCVRBYMIFQX-UHFFFAOYSA-N 0.000 description 1
- DJVCUYVKSYCIIF-UHFFFAOYSA-N 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]acetonitrile Chemical compound OCC1=CC(Cl)=CC(Cl)=C1OCC#N DJVCUYVKSYCIIF-UHFFFAOYSA-N 0.000 description 1
- LNNVSOTXIKVWGT-UHFFFAOYSA-N 2-[2,4-dichloro-6-[(3-hydroxyphenoxy)methyl]phenoxy]acetonitrile Chemical compound OC1=CC=CC(OCC=2C(=C(Cl)C=C(Cl)C=2)OCC#N)=C1 LNNVSOTXIKVWGT-UHFFFAOYSA-N 0.000 description 1
- LXRWAZPUEYNOOG-UHFFFAOYSA-N 2-[2-(bromomethyl)-6-tert-butylphenoxy]acetonitrile Chemical compound CC(C)(C)C1=CC=CC(CBr)=C1OCC#N LXRWAZPUEYNOOG-UHFFFAOYSA-N 0.000 description 1
- NSRCCOXJCVBKTO-UHFFFAOYSA-N 2-[2-[[2-acetyl-5-(quinolin-2-ylmethoxy)phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC(=O)C1=CC=C(OCC=2N=C3C=CC=CC3=CC=2)C=C1OCC1=CC=CC(C)=C1OCC(O)=O NSRCCOXJCVBKTO-UHFFFAOYSA-N 0.000 description 1
- PSPCKOYRUGINDF-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 PSPCKOYRUGINDF-UHFFFAOYSA-N 0.000 description 1
- GVSIHLPSTLCIOK-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-4-chloro-6-methylphenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC(O)=O GVSIHLPSTLCIOK-UHFFFAOYSA-N 0.000 description 1
- GEQXGIRHYBECGV-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC(O)=O GEQXGIRHYBECGV-UHFFFAOYSA-N 0.000 description 1
- MIZYNPXQUSLLIR-UHFFFAOYSA-N 2-[2-[[3-[(2-ethoxycarbonyl-3-methyl-5-phenylmethoxyphenoxy)methyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound C1=C(OCC=2C=C(OCC=3C(=C(C)C=CC=3)OCC(O)=O)C=CC=2)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 MIZYNPXQUSLLIR-UHFFFAOYSA-N 0.000 description 1
- CPEREQSLHTWRNE-UHFFFAOYSA-N 2-[2-[[3-[(4-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=C(Cl)C=3)C=CC=2)=C1OCC#N CPEREQSLHTWRNE-UHFFFAOYSA-N 0.000 description 1
- JWLGOTYHSFJPKM-UHFFFAOYSA-N 2-[2-[[3-[(4-chloroquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=C(Cl)C=3)C=CC=2)=C1OCC#N JWLGOTYHSFJPKM-UHFFFAOYSA-N 0.000 description 1
- FXBDARZLLNHQPQ-UHFFFAOYSA-N 2-[2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C(C)(C)C)C=CC=2)=C1OCC#N FXBDARZLLNHQPQ-UHFFFAOYSA-N 0.000 description 1
- RQQRTRVYZVCQDQ-UHFFFAOYSA-N 2-[2-[[3-[(6,7-dichloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C(Cl)=CC4=CC=3)C=CC=2)=C1OCC(O)=O RQQRTRVYZVCQDQ-UHFFFAOYSA-N 0.000 description 1
- PTOTVZAWEUUOGT-UHFFFAOYSA-N 2-[2-[[3-[(6,7-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(F)C(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O PTOTVZAWEUUOGT-UHFFFAOYSA-N 0.000 description 1
- VELKRVGZKQTRGV-UHFFFAOYSA-N 2-[2-[[3-[(6,7-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(F)C(F)=CC4=CC=3)C=CC=2)=C1OCC#N VELKRVGZKQTRGV-UHFFFAOYSA-N 0.000 description 1
- FZOKDOIBEPOFEM-UHFFFAOYSA-N 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C(F)=CC(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O FZOKDOIBEPOFEM-UHFFFAOYSA-N 0.000 description 1
- IZZHJLUXOLYQDF-UHFFFAOYSA-N 2-[2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O IZZHJLUXOLYQDF-UHFFFAOYSA-N 0.000 description 1
- ICPTVHSOSWAIMQ-UHFFFAOYSA-N 2-[2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC#N ICPTVHSOSWAIMQ-UHFFFAOYSA-N 0.000 description 1
- CYZMIBOQEHVEPJ-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC(O)=O CYZMIBOQEHVEPJ-UHFFFAOYSA-N 0.000 description 1
- VSRZICINMFCWBJ-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC#N VSRZICINMFCWBJ-UHFFFAOYSA-N 0.000 description 1
- WFYPQWQRAYVDAF-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC(O)=O WFYPQWQRAYVDAF-UHFFFAOYSA-N 0.000 description 1
- YYHNKPLJESGGDT-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroisoquinolin-3-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC4=CC(Cl)=CC=C4C=3)C=CC=2)=C1OCC(O)=O YYHNKPLJESGGDT-UHFFFAOYSA-N 0.000 description 1
- LUTIRPXXOVYXJB-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroisoquinolin-3-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC4=CC(Cl)=CC=C4C=3)C=CC=2)=C1OCC#N LUTIRPXXOVYXJB-UHFFFAOYSA-N 0.000 description 1
- PUDXBHCYYZYANW-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C=CC4=CC=3)C=CC=2)=C1OCC(O)=O PUDXBHCYYZYANW-UHFFFAOYSA-N 0.000 description 1
- MVGHLDMDZLIKDI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-phenoxyethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3C=CC=CC=3)C=CC=2)=C1OCC#N MVGHLDMDZLIKDI-UHFFFAOYSA-N 0.000 description 1
- LAPSQDJGJNGHRP-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O LAPSQDJGJNGHRP-UHFFFAOYSA-N 0.000 description 1
- FICVCSSCGIBJQQ-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-yloxyethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O FICVCSSCGIBJQQ-UHFFFAOYSA-N 0.000 description 1
- JCVNSSXWYKBMJC-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-yloxyethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3N=CC=CC=3)C=CC=2)=C1OCC#N JCVNSSXWYKBMJC-UHFFFAOYSA-N 0.000 description 1
- QQBDDFVFQOPHGM-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-quinolin-2-ylethyl)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(CCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O QQBDDFVFQOPHGM-UHFFFAOYSA-N 0.000 description 1
- HADKUIXOVAOVLD-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(3-phenylpropoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCCC=3C=CC=CC=3)C=CC=2)=C1OCC(O)=O HADKUIXOVAOVLD-UHFFFAOYSA-N 0.000 description 1
- KGSCOSINGNGGGN-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(3-phenylpropoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCCC=3C=CC=CC=3)C=CC=2)=C1OCC#N KGSCOSINGNGGGN-UHFFFAOYSA-N 0.000 description 1
- DCPXFINPOVRPQX-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O DCPXFINPOVRPQX-UHFFFAOYSA-N 0.000 description 1
- XYAUPRHFRMDLHA-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-4-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CN=CC=3)C=CC=2)=C1OCC(O)=O XYAUPRHFRMDLHA-UHFFFAOYSA-N 0.000 description 1
- DJDQMNIWNMDOLS-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propanoic acid Chemical compound OC(=O)C(C)OC1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 DJDQMNIWNMDOLS-UHFFFAOYSA-N 0.000 description 1
- ZNJRCIRPAXGXGV-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxymethyl)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O ZNJRCIRPAXGXGV-UHFFFAOYSA-N 0.000 description 1
- VUIOHECBJUSILI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinoxalin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=NC=3)C=CC=2)=C1OCC#N VUIOHECBJUSILI-UHFFFAOYSA-N 0.000 description 1
- ACQAJMQUDVSGOA-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1-methyl-4-oxoquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C4=CC=CC=C4C(=O)C=3)C)C=CC=2)=C1OCC(O)=O ACQAJMQUDVSGOA-UHFFFAOYSA-N 0.000 description 1
- KGUZHIOQDFSQQG-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1-methyl-4-oxoquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C4=CC=CC=C4C(=O)C=3)C)C=CC=2)=C1OCC#N KGUZHIOQDFSQQG-UHFFFAOYSA-N 0.000 description 1
- ASZXVYRRDIZLQV-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(SC=3)C=3C=CC=CC=3)C=CC=2)=C1OCC#N ASZXVYRRDIZLQV-UHFFFAOYSA-N 0.000 description 1
- ZCYHLBXZRLHXOD-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(3-phenoxyphenyl)methoxy]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(OC=4C=CC=CC=4)C=CC=3)C=CC=2)=C1OCC(O)=O ZCYHLBXZRLHXOD-UHFFFAOYSA-N 0.000 description 1
- LLAWYIQIYGFLTO-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(3-phenoxyphenyl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(OC=4C=CC=CC=4)C=CC=3)C=CC=2)=C1OCC#N LLAWYIQIYGFLTO-UHFFFAOYSA-N 0.000 description 1
- ZEUSAOYJYGRVNX-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(quinolin-2-ylamino)methyl]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(CNC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O ZEUSAOYJYGRVNX-UHFFFAOYSA-N 0.000 description 1
- KLNNLHMQGZKGAC-UHFFFAOYSA-N 2-[2-tert-butyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC(C)(C)C1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N KLNNLHMQGZKGAC-UHFFFAOYSA-N 0.000 description 1
- VKSWAJZLAYAYFF-UHFFFAOYSA-N 2-[3-(2-methoxyethoxymethoxy)phenoxy]ethanol Chemical compound COCCOCOC1=CC=CC(OCCO)=C1 VKSWAJZLAYAYFF-UHFFFAOYSA-N 0.000 description 1
- RDNIYNUQRKFJGM-UHFFFAOYSA-N 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]acetonitrile Chemical compound COC1=CC(Cl)=CC(CO)=C1OCC#N RDNIYNUQRKFJGM-UHFFFAOYSA-N 0.000 description 1
- BYFHGYCJJZACNU-UHFFFAOYSA-N 2-[4-chloro-2-[(3-hydroxyphenoxy)methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(O)C=CC=2)=C1OCC#N BYFHGYCJJZACNU-UHFFFAOYSA-N 0.000 description 1
- JBMBYXHELVQYIF-UHFFFAOYSA-N 2-[4-chloro-2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O JBMBYXHELVQYIF-UHFFFAOYSA-N 0.000 description 1
- ZZEMBFRKBBQGPF-UHFFFAOYSA-N 2-[4-chloro-2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC#N ZZEMBFRKBBQGPF-UHFFFAOYSA-N 0.000 description 1
- LTXVRPJTPXSQET-UHFFFAOYSA-N 2-[4-chloro-2-methoxy-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound COC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O LTXVRPJTPXSQET-UHFFFAOYSA-N 0.000 description 1
- ZIEJGRDYERCCOI-UHFFFAOYSA-N 2-[4-chloro-2-methoxy-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound COC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N ZIEJGRDYERCCOI-UHFFFAOYSA-N 0.000 description 1
- CQIPWMMTGUCRJU-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O CQIPWMMTGUCRJU-UHFFFAOYSA-N 0.000 description 1
- IZCKFAPIJXAPAH-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O IZCKFAPIJXAPAH-UHFFFAOYSA-N 0.000 description 1
- PGDAFULBXYIWGA-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxymethyl]phenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O PGDAFULBXYIWGA-UHFFFAOYSA-N 0.000 description 1
- RXHMGEJKWDSYPA-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxymethyl]phenoxy]acetonitrile Chemical compound ClC1=CC(=C(OCC#N)C(=C1)COCC1=CC(=CC=C1)OCC1=NC2=CC=CC=C2C=C1)C RXHMGEJKWDSYPA-UHFFFAOYSA-N 0.000 description 1
- QZQFCSAFZBNYHK-UHFFFAOYSA-N 2-[[3-(chloromethyl)phenoxy]methyl]quinoline Chemical compound ClCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 QZQFCSAFZBNYHK-UHFFFAOYSA-N 0.000 description 1
- RSQYGTQLMIFUFC-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]-3h-thiophene-2-carboxylic acid Chemical compound C=1C=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1OCC1(C(=O)O)CC=CS1 RSQYGTQLMIFUFC-UHFFFAOYSA-N 0.000 description 1
- MGTGAVXXGVYSEQ-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzonitrile Chemical compound N#CC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 MGTGAVXXGVYSEQ-UHFFFAOYSA-N 0.000 description 1
- QIXDQHOPKLNEPW-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-6-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C=O QIXDQHOPKLNEPW-UHFFFAOYSA-N 0.000 description 1
- BEGUYXNMALYINZ-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-6-(trifluoromethyl)benzoic acid Chemical compound C1=CC=C(C(F)(F)F)C(C(=O)O)=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 BEGUYXNMALYINZ-UHFFFAOYSA-N 0.000 description 1
- LKBRSKGFDWYCQY-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzaldehyde Chemical compound O=CC1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LKBRSKGFDWYCQY-UHFFFAOYSA-N 0.000 description 1
- RCYJXQHSUHJUMJ-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 RCYJXQHSUHJUMJ-UHFFFAOYSA-N 0.000 description 1
- NHAFUWZMASOSOM-UHFFFAOYSA-N 2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1C(O)=O NHAFUWZMASOSOM-UHFFFAOYSA-N 0.000 description 1
- KJZLZAZQYNWERR-UHFFFAOYSA-N 2-[[3-[(2,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC(Cl)=CC=3)Cl)C=CC=2)=C1C(O)=O KJZLZAZQYNWERR-UHFFFAOYSA-N 0.000 description 1
- BRHGEGQEZZJQGV-UHFFFAOYSA-N 2-[[3-[(3-bromophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(Br)C=CC=3)C=CC=2)=C1C(O)=O BRHGEGQEZZJQGV-UHFFFAOYSA-N 0.000 description 1
- DOENYFLVGSGWAK-UHFFFAOYSA-N 2-[[3-[(4-ethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound C1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 DOENYFLVGSGWAK-UHFFFAOYSA-N 0.000 description 1
- FRJWYRVNZRHDFR-UHFFFAOYSA-N 2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C(C)(C)C)C=CC=2)=C1C(O)=O FRJWYRVNZRHDFR-UHFFFAOYSA-N 0.000 description 1
- VCJYCSZQLKYFQA-UHFFFAOYSA-N 2-[[3-[(5-acetyl-2-methoxyphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound COC1=CC=C(C(C)=O)C=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 VCJYCSZQLKYFQA-UHFFFAOYSA-N 0.000 description 1
- ZMKUWXMZEGZWPS-UHFFFAOYSA-N 2-[[3-[(5-ethylpyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound N1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 ZMKUWXMZEGZWPS-UHFFFAOYSA-N 0.000 description 1
- JWVJBZKCCYGHTP-UHFFFAOYSA-N 2-[[3-[(6-chloropyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(Cl)C=CC=3)C=CC=2)=C1C(O)=O JWVJBZKCCYGHTP-UHFFFAOYSA-N 0.000 description 1
- VNHYZAOTVZACNZ-UHFFFAOYSA-N 2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1C(O)=O VNHYZAOTVZACNZ-UHFFFAOYSA-N 0.000 description 1
- OFRVBYWREKKZSV-UHFFFAOYSA-N 2-[[3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC(=CC=3)C(F)(F)F)C(F)(F)F)C=CC=2)=C1C(O)=O OFRVBYWREKKZSV-UHFFFAOYSA-N 0.000 description 1
- YVGZUKGDZUBUCK-UHFFFAOYSA-N 2-[[3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C=3C=C(F)C=CC=3)C=CC=2)=C1C(O)=O YVGZUKGDZUBUCK-UHFFFAOYSA-N 0.000 description 1
- XMDXGGWAXCXIDS-UHFFFAOYSA-N 2-[[3-[[2-(carboxymethoxy)-3-methylphenyl]methoxy]phenyl]methoxy]-6-methyl-4-phenylmethoxybenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COC=3C(=C(C)C=C(OCC=4C=CC=CC=4)C=3)C(O)=O)C=CC=2)=C1OCC(O)=O XMDXGGWAXCXIDS-UHFFFAOYSA-N 0.000 description 1
- QIRNGVVZBINFMX-UHFFFAOYSA-N 2-allylphenol Chemical compound OC1=CC=CC=C1CC=C QIRNGVVZBINFMX-UHFFFAOYSA-N 0.000 description 1
- JJFOBACUIRKUPN-UHFFFAOYSA-N 2-bromoethoxybenzene Chemical compound BrCCOC1=CC=CC=C1 JJFOBACUIRKUPN-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-M 2-bromopropanoate Chemical compound CC(Br)C([O-])=O MONMFXREYOKQTI-UHFFFAOYSA-M 0.000 description 1
- CKUVSPQGYLELRG-UHFFFAOYSA-N 2-chloro-6-methylpyrazine Chemical compound CC1=CN=CC(Cl)=N1 CKUVSPQGYLELRG-UHFFFAOYSA-N 0.000 description 1
- GXZDYRYYNXYPMQ-UHFFFAOYSA-N 2-chloro-6-methylpyridine Chemical compound CC1=CC=CC(Cl)=N1 GXZDYRYYNXYPMQ-UHFFFAOYSA-N 0.000 description 1
- FAKUGVHRTLCKHB-UHFFFAOYSA-N 2-fluoro-6-(trifluoromethyl)benzaldehyde Chemical compound FC1=CC=CC(C(F)(F)F)=C1C=O FAKUGVHRTLCKHB-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical class FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 1
- AAUQLHHARJUJEH-UHFFFAOYSA-N 2-hydroxy-5-methoxybenzoic acid Natural products COC1=CC=CC(O)=C1C(O)=O AAUQLHHARJUJEH-UHFFFAOYSA-N 0.000 description 1
- LIUCWHQVLKSECA-UHFFFAOYSA-N 2-hydroxyacetohydrazide Chemical compound NNC(=O)CO LIUCWHQVLKSECA-UHFFFAOYSA-N 0.000 description 1
- CLNBOXAAONTXKB-UHFFFAOYSA-N 2-iodo-5-methylpyrazine Chemical compound CC1=CN=C(I)C=N1 CLNBOXAAONTXKB-UHFFFAOYSA-N 0.000 description 1
- DJLXWIBENRCEAD-UHFFFAOYSA-N 2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 DJLXWIBENRCEAD-UHFFFAOYSA-N 0.000 description 1
- VVFCAPHHZLEJLT-UHFFFAOYSA-N 2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound C=1C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C(C(O)=O)C(C)=CC=1OCC1=CC=CC=C1 VVFCAPHHZLEJLT-UHFFFAOYSA-N 0.000 description 1
- LEIOBPOJABRNMZ-UHFFFAOYSA-N 2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC=CC=3)C=CC=2)=C1C(O)=O LEIOBPOJABRNMZ-UHFFFAOYSA-N 0.000 description 1
- SUSQZYRRFUDRPY-UHFFFAOYSA-N 2-methyl-6-[[3-(2-pyridin-2-yloxyethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3N=CC=CC=3)C=CC=2)=C1C(O)=O SUSQZYRRFUDRPY-UHFFFAOYSA-N 0.000 description 1
- TYEAMMWZYWMLDA-UHFFFAOYSA-N 2-methyl-6-[[3-(2-quinolin-2-ylethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O TYEAMMWZYWMLDA-UHFFFAOYSA-N 0.000 description 1
- IXBVGBKQVGOAJU-UHFFFAOYSA-N 2-methyl-6-[[3-(2-quinolin-2-ylethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(CCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O IXBVGBKQVGOAJU-UHFFFAOYSA-N 0.000 description 1
- SVXUAODUNFRDMC-UHFFFAOYSA-N 2-methyl-6-[[3-(naphthalen-1-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C4=CC=CC=C4C=CC=3)C=CC=2)=C1C(O)=O SVXUAODUNFRDMC-UHFFFAOYSA-N 0.000 description 1
- VCKAAGSCJHJERU-UHFFFAOYSA-N 2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O VCKAAGSCJHJERU-UHFFFAOYSA-N 0.000 description 1
- PTTCALYQFORLRO-UHFFFAOYSA-N 2-methyl-6-[[3-(pyridin-2-ylmethoxymethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=CC=CC=3)C=CC=2)=C1C(O)=O PTTCALYQFORLRO-UHFFFAOYSA-N 0.000 description 1
- XMXOIKWCPWJDMR-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O XMXOIKWCPWJDMR-UHFFFAOYSA-N 0.000 description 1
- BFEBUERRXPCNJB-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound CC1=CC=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O BFEBUERRXPCNJB-UHFFFAOYSA-N 0.000 description 1
- LERLTLHNYGABKN-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxymethyl]benzoic acid Chemical compound CC1=CC=CC(COCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O LERLTLHNYGABKN-UHFFFAOYSA-N 0.000 description 1
- FHTJHKRKYADKIT-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfanylmethyl]benzoic acid Chemical compound CC1=CC=CC(CSC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O FHTJHKRKYADKIT-UHFFFAOYSA-N 0.000 description 1
- JEMCECRQAGEHRW-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfinylmethyl]benzoic acid Chemical compound CC1=CC=CC(CS(=O)C=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O JEMCECRQAGEHRW-UHFFFAOYSA-N 0.000 description 1
- JZRICEMAQMOOSP-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxymethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O JZRICEMAQMOOSP-UHFFFAOYSA-N 0.000 description 1
- NWASEVYYUFQGDT-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-yloxymethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O NWASEVYYUFQGDT-UHFFFAOYSA-N 0.000 description 1
- MBPTVLZXEGYRPN-UHFFFAOYSA-N 2-methyl-6-[[3-(quinoxalin-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=NC=3)C=CC=2)=C1C(O)=O MBPTVLZXEGYRPN-UHFFFAOYSA-N 0.000 description 1
- CGTLPQBZGZMXBM-UHFFFAOYSA-N 2-methyl-6-[[3-[(2,4,5-trimethylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound C1=C(C)C(C)=CC(C)=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 CGTLPQBZGZMXBM-UHFFFAOYSA-N 0.000 description 1
- ZUIJVTIYWFJTRT-UHFFFAOYSA-N 2-methyl-6-[[3-[(2-methylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 ZUIJVTIYWFJTRT-UHFFFAOYSA-N 0.000 description 1
- SVEFCMFUFYKQJN-UHFFFAOYSA-N 2-methyl-6-[[3-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O SVEFCMFUFYKQJN-UHFFFAOYSA-N 0.000 description 1
- KKXQCCMACGQTCJ-UHFFFAOYSA-N 2-methyl-6-[[3-[(4-propan-2-ylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound C1=CC(C(C)C)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 KKXQCCMACGQTCJ-UHFFFAOYSA-N 0.000 description 1
- HPGPJYHGBOYKNS-UHFFFAOYSA-N 2-methyl-6-[[3-[(6-phenylpyridin-2-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(C=CC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O HPGPJYHGBOYKNS-UHFFFAOYSA-N 0.000 description 1
- GYFDHLLMQDABGH-UHFFFAOYSA-N 2-methyl-6-[[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenoxy]methyl]benzoic acid Chemical compound CC=1OC(C=2C=CC=CC=2)=NC=1CCOC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O GYFDHLLMQDABGH-UHFFFAOYSA-N 0.000 description 1
- PYDMWKLUXOIONG-UHFFFAOYSA-N 2-methyl-6-[[3-[[2-(5-methylthiophen-2-yl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]benzoic acid Chemical compound S1C(C)=CC=C1C1=NC(COC=2C=C(OCC=3C(=C(C)C=CC=3)C(O)=O)C=CC=2)=CO1 PYDMWKLUXOIONG-UHFFFAOYSA-N 0.000 description 1
- SGXJFKLMCVIZGP-UHFFFAOYSA-N 2-methyl-6-phenylmethoxy-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound OC(=O)C=1C(C)=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=CC=1OCC1=CC=CC=C1 SGXJFKLMCVIZGP-UHFFFAOYSA-N 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- DUAYDERMVQWIJD-UHFFFAOYSA-N 2-n,2-n,6-trimethyl-1,3,5-triazine-2,4-diamine Chemical compound CN(C)C1=NC(C)=NC(N)=N1 DUAYDERMVQWIJD-UHFFFAOYSA-N 0.000 description 1
- 125000005979 2-naphthyloxy group Chemical group 0.000 description 1
- BKZXZGWHTRCFPX-UHFFFAOYSA-N 2-tert-butyl-6-methylphenol Chemical compound CC1=CC=CC(C(C)(C)C)=C1O BKZXZGWHTRCFPX-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- FQBABLFSLXFYOQ-UHFFFAOYSA-N 3-(bromomethyl)-7-chloroisoquinoline Chemical compound C1=C(CBr)N=CC2=CC(Cl)=CC=C21 FQBABLFSLXFYOQ-UHFFFAOYSA-N 0.000 description 1
- VEIXFEJMHJPUBS-UHFFFAOYSA-N 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole Chemical compound ClCC1=NOC(C=2C=CC=CC=2)=N1 VEIXFEJMHJPUBS-UHFFFAOYSA-N 0.000 description 1
- UZGLOGCJCWBBIV-UHFFFAOYSA-N 3-(chloromethyl)pyridin-1-ium;chloride Chemical compound Cl.ClCC1=CC=CN=C1 UZGLOGCJCWBBIV-UHFFFAOYSA-N 0.000 description 1
- HDPGVLSPCOHINY-UHFFFAOYSA-N 3-(quinolin-2-ylmethoxymethyl)phenol Chemical compound OC1=CC=CC(COCC=2N=C3C=CC=CC3=CC=2)=C1 HDPGVLSPCOHINY-UHFFFAOYSA-N 0.000 description 1
- CWPFZVYVWJFVJF-UHFFFAOYSA-N 3-[(6-methoxyquinolin-2-yl)methoxymethyl]phenol Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COCC1=CC=CC(O)=C1 CWPFZVYVWJFVJF-UHFFFAOYSA-N 0.000 description 1
- IZRDAHXGGFFNQB-UHFFFAOYSA-N 3-[2-(5-ethylpyridin-2-yl)ethoxy]phenol Chemical compound N1=CC(CC)=CC=C1CCOC1=CC=CC(O)=C1 IZRDAHXGGFFNQB-UHFFFAOYSA-N 0.000 description 1
- XAQJDQZTSUYFGE-UHFFFAOYSA-N 3-[2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenyl]prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 XAQJDQZTSUYFGE-UHFFFAOYSA-N 0.000 description 1
- ASRAZAZWZUNALX-UHFFFAOYSA-N 3-[[1,3-benzoxazol-2-yl(methyl)amino]methyl]phenol Chemical compound N=1C2=CC=CC=C2OC=1N(C)CC1=CC=CC(O)=C1 ASRAZAZWZUNALX-UHFFFAOYSA-N 0.000 description 1
- RACIHBXDZONTQJ-UHFFFAOYSA-N 3-bromo-6-methylpyridazine Chemical compound CC1=CC=C(Br)N=N1 RACIHBXDZONTQJ-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical compound BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- ILYSUJOMLYXAOC-UHFFFAOYSA-N 3-bromopyridazine Chemical class BrC1=CC=CN=N1 ILYSUJOMLYXAOC-UHFFFAOYSA-N 0.000 description 1
- YPIGHNIIXYSPKF-UHFFFAOYSA-N 3-fluorobenzamide Chemical compound NC(=O)C1=CC=CC(F)=C1 YPIGHNIIXYSPKF-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 1
- NICNTKXFRWNCMP-UHFFFAOYSA-N 3-methyl-5-(quinolin-2-ylmethoxy)phenol Chemical compound CC1=CC(O)=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 NICNTKXFRWNCMP-UHFFFAOYSA-N 0.000 description 1
- 125000005977 3-phenylpropyloxy group Chemical group 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- MVLCWAAJDXMPMW-UHFFFAOYSA-N 3-pyridin-3-ylpropane-1-thiol Chemical compound SCCCC1=CC=CN=C1 MVLCWAAJDXMPMW-UHFFFAOYSA-N 0.000 description 1
- 125000004364 3-pyrrolinyl group Chemical group [H]C1=C([H])C([H])([H])N(*)C1([H])[H] 0.000 description 1
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 1
- AGMLELBIDWXNKF-UHFFFAOYSA-N 4-(chloromethyl)-2-(3-fluorophenyl)-1,3-oxazole Chemical compound FC1=CC=CC(C=2OC=C(CCl)N=2)=C1 AGMLELBIDWXNKF-UHFFFAOYSA-N 0.000 description 1
- XIRGVEDJBFANTN-UHFFFAOYSA-N 4-(chloromethyl)-2-(5-methylthiophen-2-yl)-1,3-oxazole Chemical compound S1C(C)=CC=C1C1=NC(CCl)=CO1 XIRGVEDJBFANTN-UHFFFAOYSA-N 0.000 description 1
- NIFAUKBQIAURIM-UHFFFAOYSA-N 4-(chloromethyl)-3,5-dimethyl-1,2-oxazole Chemical compound CC1=NOC(C)=C1CCl NIFAUKBQIAURIM-UHFFFAOYSA-N 0.000 description 1
- PPUGTWAPVDDBEW-UHFFFAOYSA-N 4-(chloromethyl)-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole Chemical compound ClCC1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl PPUGTWAPVDDBEW-UHFFFAOYSA-N 0.000 description 1
- VCTKYTBWZTZPHF-UHFFFAOYSA-N 4-(chloromethyl)-5-methyl-2-phenyl-1,3-oxazole Chemical compound ClCC1=C(C)OC(C=2C=CC=CC=2)=N1 VCTKYTBWZTZPHF-UHFFFAOYSA-N 0.000 description 1
- ZDHKVKPZQKYREU-UHFFFAOYSA-N 4-(chloromethyl)pyridine;hydron;chloride Chemical compound Cl.ClCC1=CC=NC=C1 ZDHKVKPZQKYREU-UHFFFAOYSA-N 0.000 description 1
- NHWLMYADYHMXLT-UHFFFAOYSA-N 4-chloro-2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]quinoline Chemical compound COCCOCOC1=CC=CC(COCC=2N=C3C=CC=CC3=C(Cl)C=2)=C1 NHWLMYADYHMXLT-UHFFFAOYSA-N 0.000 description 1
- VNDHYTGVCGVETQ-UHFFFAOYSA-N 4-fluorobenzamide Chemical compound NC(=O)C1=CC=C(F)C=C1 VNDHYTGVCGVETQ-UHFFFAOYSA-N 0.000 description 1
- ROWJNJUUAJASTJ-UHFFFAOYSA-N 4-methoxy-2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound COC1=CC=C(C(O)=O)C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 ROWJNJUUAJASTJ-UHFFFAOYSA-N 0.000 description 1
- VEHPMWFIFYCDKL-UHFFFAOYSA-N 4-methoxy-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound COC1=CC(C)=C(C(O)=O)C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 VEHPMWFIFYCDKL-UHFFFAOYSA-N 0.000 description 1
- MXGRYXNVQNESIN-UHFFFAOYSA-N 4-tert-butylcyclohexane-1-carbaldehyde Chemical compound CC(C)(C)C1CCC(C=O)CC1 MXGRYXNVQNESIN-UHFFFAOYSA-N 0.000 description 1
- OIVLITBTBDPEFK-UHFFFAOYSA-N 5,6-dihydrouracil Chemical compound O=C1CCNC(=O)N1 OIVLITBTBDPEFK-UHFFFAOYSA-N 0.000 description 1
- ZMGMDXCADSRNCX-UHFFFAOYSA-N 5,6-dihydroxy-1,3-diazepan-2-one Chemical compound OC1CNC(=O)NCC1O ZMGMDXCADSRNCX-UHFFFAOYSA-N 0.000 description 1
- SBLNJPPJMRNDJM-UHFFFAOYSA-N 5-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 SBLNJPPJMRNDJM-UHFFFAOYSA-N 0.000 description 1
- OFKWIQJLYCKDNY-UHFFFAOYSA-N 5-bromo-2-methylpyridine Chemical compound CC1=CC=C(Br)C=N1 OFKWIQJLYCKDNY-UHFFFAOYSA-N 0.000 description 1
- NEDJTEXNSTUKHW-UHFFFAOYSA-N 5-bromo-2-methylpyrimidine Chemical compound CC1=NC=C(Br)C=N1 NEDJTEXNSTUKHW-UHFFFAOYSA-N 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- VWPXLLCWKFJQIH-UHFFFAOYSA-N 5-methoxy-2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 VWPXLLCWKFJQIH-UHFFFAOYSA-N 0.000 description 1
- HKKCYMCHJZENJO-UHFFFAOYSA-N 5-methylthiophene-2-carboxamide Chemical compound CC1=CC=C(C(N)=O)S1 HKKCYMCHJZENJO-UHFFFAOYSA-N 0.000 description 1
- AIVSLDAXUIRICJ-UHFFFAOYSA-N 5-tert-butyl-3-(chloromethyl)-1,2,4-oxadiazole Chemical compound CC(C)(C)C1=NC(CCl)=NO1 AIVSLDAXUIRICJ-UHFFFAOYSA-N 0.000 description 1
- JUKPQDIFUMAWTD-UHFFFAOYSA-N 6,7-dichloro-2-(chloromethyl)quinoline Chemical compound C1=C(Cl)C(Cl)=CC2=NC(CCl)=CC=C21 JUKPQDIFUMAWTD-UHFFFAOYSA-N 0.000 description 1
- XYNNEGCJICWPFL-UHFFFAOYSA-N 6,7-dichloro-2-methylquinoline Chemical compound C1=C(Cl)C(Cl)=CC2=NC(C)=CC=C21 XYNNEGCJICWPFL-UHFFFAOYSA-N 0.000 description 1
- YWMOOBWNYVFLKH-UHFFFAOYSA-N 6,7-difluoro-2-methylquinoline Chemical compound C1=C(F)C(F)=CC2=NC(C)=CC=C21 YWMOOBWNYVFLKH-UHFFFAOYSA-N 0.000 description 1
- VOMMPWVMVDGZEM-UHFFFAOYSA-N 6-bromo-1h-pyridin-2-one Chemical compound OC1=CC=CC(Br)=N1 VOMMPWVMVDGZEM-UHFFFAOYSA-N 0.000 description 1
- GPIARMSVZOEZCV-UHFFFAOYSA-N 6-fluoro-2-methylquinoline Chemical compound C1=C(F)C=CC2=NC(C)=CC=C21 GPIARMSVZOEZCV-UHFFFAOYSA-N 0.000 description 1
- WZADRYDUBBGITL-UHFFFAOYSA-N 6-hydroxy-1,3,3-trimethylindol-2-one Chemical compound C1=C(O)C=C2N(C)C(=O)C(C)(C)C2=C1 WZADRYDUBBGITL-UHFFFAOYSA-N 0.000 description 1
- OXOQGUGIJKUSRP-UHFFFAOYSA-N 6-methoxy-1,3-dihydroindol-2-one Chemical compound COC1=CC=C2CC(=O)NC2=C1 OXOQGUGIJKUSRP-UHFFFAOYSA-N 0.000 description 1
- AZUAKHVXBMTMRY-UHFFFAOYSA-N 6-methoxy-2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]quinoline Chemical compound COCCOCOC1=CC=CC(COCC=2N=C3C=CC(OC)=CC3=CC=2)=C1 AZUAKHVXBMTMRY-UHFFFAOYSA-N 0.000 description 1
- HUWLHNLABRKIED-UHFFFAOYSA-N 6-methoxy-3,3-dimethyl-1h-indol-2-one Chemical compound COC1=CC=C2C(C)(C)C(=O)NC2=C1 HUWLHNLABRKIED-UHFFFAOYSA-N 0.000 description 1
- XWCKMYJGFPERAV-UHFFFAOYSA-N 6-methoxy-3-methyl-1,3-dihydroindol-2-one Chemical compound COC1=CC=C2C(C)C(=O)NC2=C1 XWCKMYJGFPERAV-UHFFFAOYSA-N 0.000 description 1
- FSLPHQAXCJNXEU-UHFFFAOYSA-N 7-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]-1-benzofuran-2-carboxylic acid Chemical compound C1=CC=CC2=NC(COC=3C=CC=C(C=3)OCC=3C=CC=C4C=C(OC4=3)C(=O)O)=CC=C21 FSLPHQAXCJNXEU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical class N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 201000005670 Anovulation Diseases 0.000 description 1
- 206010002659 Anovulatory cycle Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- 206010006458 Bronchitis chronic Diseases 0.000 description 1
- 208000032841 Bulimia Diseases 0.000 description 1
- 206010006550 Bulimia nervosa Diseases 0.000 description 1
- NHWPQMHFMAMOQS-UHFFFAOYSA-L C(CCC)[N+](CCCC)(CCCC)CCCC.[I-].[K+].C(O)([O-])=O Chemical compound C(CCC)[N+](CCCC)(CCCC)CCCC.[I-].[K+].C(O)([O-])=O NHWPQMHFMAMOQS-UHFFFAOYSA-L 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 102100035882 Catalase Human genes 0.000 description 1
- 108010053835 Catalase Proteins 0.000 description 1
- 241001155433 Centrarchus macropterus Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 238000003512 Claisen condensation reaction Methods 0.000 description 1
- 238000005821 Claisen rearrangement reaction Methods 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 208000031288 Combined hyperlipidaemia Diseases 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical group C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 101100326341 Drosophila melanogaster brun gene Proteins 0.000 description 1
- 238000006892 Einhorn-Brunner reaction Methods 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 101710107035 Gamma-glutamyltranspeptidase Proteins 0.000 description 1
- 101710173228 Glutathione hydrolase proenzyme Proteins 0.000 description 1
- 206010019013 Haemorrhagic infarction Diseases 0.000 description 1
- 208000013875 Heart injury Diseases 0.000 description 1
- 206010019851 Hepatotoxicity Diseases 0.000 description 1
- 101000979342 Homo sapiens Nuclear factor NF-kappa-B p105 subunit Proteins 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- 208000035150 Hypercholesterolemia Diseases 0.000 description 1
- 206010020710 Hyperphagia Diseases 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 208000004852 Lung Injury Diseases 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000343235 Maso Species 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 125000001429 N-terminal alpha-amino-acid group Chemical group 0.000 description 1
- GBGHYQRMKHOXSD-UHFFFAOYSA-N N1=C(C=CC2=CC=CC=C12)COC=1C=C(C=CC1)CO.N1=C(C=CC2=CC=CC=C12)COC=1C=C(COC2=C(C=O)C(=CC=C2)C(F)(F)F)C=CC1 Chemical compound N1=C(C=CC2=CC=CC=C12)COC=1C=C(C=CC1)CO.N1=C(C=CC2=CC=CC=C12)COC=1C=C(COC2=C(C=O)C(=CC=C2)C(F)(F)F)C=CC1 GBGHYQRMKHOXSD-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 208000028389 Nerve injury Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102000011779 Nitric Oxide Synthase Type II Human genes 0.000 description 1
- 108010076864 Nitric Oxide Synthase Type II Proteins 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 102100023050 Nuclear factor NF-kappa-B p105 subunit Human genes 0.000 description 1
- 108091028043 Nucleic acid sequence Proteins 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 102100038831 Peroxisome proliferator-activated receptor alpha Human genes 0.000 description 1
- 206010036049 Polycystic ovaries Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 238000006619 Stille reaction Methods 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical class C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- QIOZLISABUUKJY-UHFFFAOYSA-N Thiobenzamide Chemical compound NC(=S)C1=CC=CC=C1 QIOZLISABUUKJY-UHFFFAOYSA-N 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 208000032109 Transient ischaemic attack Diseases 0.000 description 1
- 206010069363 Traumatic lung injury Diseases 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- BBHQVXKRKNSJRS-UHFFFAOYSA-N [3-(2-methoxyethoxymethoxy)phenyl]methanol Chemical compound COCCOCOC1=CC=CC(CO)=C1 BBHQVXKRKNSJRS-UHFFFAOYSA-N 0.000 description 1
- VCVJSWDSNWXXJT-UHFFFAOYSA-N [4-(1-methylpyrazol-3-yl)phenyl]methanol Chemical compound CN1C=CC(C=2C=CC(CO)=CC=2)=N1 VCVJSWDSNWXXJT-UHFFFAOYSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 1
- RBYGDVHOECIAFC-UHFFFAOYSA-L acetonitrile;palladium(2+);dichloride Chemical compound [Cl-].[Cl-].[Pd+2].CC#N.CC#N RBYGDVHOECIAFC-UHFFFAOYSA-L 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000002293 adipogenic effect Effects 0.000 description 1
- 210000003486 adipose tissue brown Anatomy 0.000 description 1
- 230000011759 adipose tissue development Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 238000007083 alkoxycarbonylation reaction Methods 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- CHKQALUEEULCPZ-UHFFFAOYSA-N amino 2,4,6-trimethylbenzenesulfonate Chemical compound CC1=CC(C)=C(S(=O)(=O)ON)C(C)=C1 CHKQALUEEULCPZ-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 210000004102 animal cell Anatomy 0.000 description 1
- 208000022531 anorexia Diseases 0.000 description 1
- 231100000552 anovulation Toxicity 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 230000000879 anti-atherosclerotic effect Effects 0.000 description 1
- 230000003178 anti-diabetic effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 230000002402 anti-lipaemic effect Effects 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical class CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 230000000778 atheroprotective effect Effects 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 210000000227 basophil cell of anterior lobe of hypophysis Anatomy 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 description 1
- KYZHGEFMXZOSJN-UHFFFAOYSA-N benzoic acid isobutyl ester Natural products CC(C)COC(=O)C1=CC=CC=C1 KYZHGEFMXZOSJN-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 102000016959 beta-3 Adrenergic Receptors Human genes 0.000 description 1
- 108010014502 beta-3 Adrenergic Receptors Proteins 0.000 description 1
- 229960000516 bezafibrate Drugs 0.000 description 1
- IIBYAHWJQTYFKB-UHFFFAOYSA-N bezafibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1CCNC(=O)C1=CC=C(Cl)C=C1 IIBYAHWJQTYFKB-UHFFFAOYSA-N 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- 235000010338 boric acid Nutrition 0.000 description 1
- 125000005619 boric acid group Chemical class 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-N bromoacetic acid Chemical compound OC(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-N 0.000 description 1
- 150000005752 bromopyridines Chemical class 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 125000004617 chromonyl group Chemical group O1C(=CC(C2=CC=CC=C12)=O)* 0.000 description 1
- 208000007451 chronic bronchitis Diseases 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 229960001214 clofibrate Drugs 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 150000005676 cyclic carbonates Chemical class 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PNZXMIKHJXIPEK-UHFFFAOYSA-N cyclohexanecarboxamide Chemical compound NC(=O)C1CCCCC1 PNZXMIKHJXIPEK-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 206010061428 decreased appetite Diseases 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 125000005072 dihydrothiopyranyl group Chemical group S1C(CCC=C1)* 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N diisobutylaluminium hydride Substances CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- FFHWGQQFANVOHV-UHFFFAOYSA-N dimethyldioxirane Chemical compound CC1(C)OO1 FFHWGQQFANVOHV-UHFFFAOYSA-N 0.000 description 1
- ASQQEOXYFGEFKQ-UHFFFAOYSA-N dioxirane Chemical compound C1OO1 ASQQEOXYFGEFKQ-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 230000009982 effect on human Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- BADWIIDKTXQYLW-UHFFFAOYSA-N ethenylstannane Chemical compound [SnH3]C=C BADWIIDKTXQYLW-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- FZZMGSQVUQSEEI-UHFFFAOYSA-N ethyl 2-[[3-[(6-chloropyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(Cl)C=CC=2)=C1 FZZMGSQVUQSEEI-UHFFFAOYSA-N 0.000 description 1
- KNBQSOYSGLNBQP-UHFFFAOYSA-N ethyl 2-[[3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC(=CC=2)C(F)(F)F)C(F)(F)F)=C1 KNBQSOYSGLNBQP-UHFFFAOYSA-N 0.000 description 1
- KWXBNUYCDMPLEQ-UHFFFAOYSA-N ethyl 2-hydroxy-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1O KWXBNUYCDMPLEQ-UHFFFAOYSA-N 0.000 description 1
- CXVHNOVIWFFVAP-UHFFFAOYSA-N ethyl 2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate Chemical compound C1=C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 CXVHNOVIWFFVAP-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 229940093858 ethyl acetoacetate Drugs 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 1
- 229960002297 fenofibrate Drugs 0.000 description 1
- 229940125753 fibrate Drugs 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 102000006640 gamma-Glutamyltransferase Human genes 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 230000014101 glucose homeostasis Effects 0.000 description 1
- 230000004190 glucose uptake Effects 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 230000007686 hepatotoxicity Effects 0.000 description 1
- 231100000304 hepatotoxicity Toxicity 0.000 description 1
- 125000004405 heteroalkoxy group Chemical group 0.000 description 1
- 125000005150 heteroarylsulfinyl group Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 230000013632 homeostatic process Effects 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 201000010066 hyperandrogenism Diseases 0.000 description 1
- 230000003345 hyperglycaemic effect Effects 0.000 description 1
- 230000000222 hyperoxic effect Effects 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 125000005945 imidazopyridyl group Chemical group 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- OOYGSFOGFJDDHP-KMCOLRRFSA-N kanamycin A sulfate Chemical group OS(O)(=O)=O.O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N OOYGSFOGFJDDHP-KMCOLRRFSA-N 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 231100000515 lung injury Toxicity 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 150000004667 medium chain fatty acids Chemical class 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 208000030159 metabolic disease Diseases 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical group Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UDWQWRFEUXUBHR-UHFFFAOYSA-N methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate Chemical compound O1C(C)=C(CC(=O)OC)N=C1C1=CC=CC=C1 UDWQWRFEUXUBHR-UHFFFAOYSA-N 0.000 description 1
- KORCHOVGDCPLSX-UHFFFAOYSA-N methyl 2-[2-(hydroxymethyl)-6-methylphenoxy]propanoate Chemical compound COC(=O)C(C)OC1=C(C)C=CC=C1CO KORCHOVGDCPLSX-UHFFFAOYSA-N 0.000 description 1
- LFOROOKWYBROJA-UHFFFAOYSA-N methyl 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propanoate Chemical compound COC(=O)C(C)OC1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LFOROOKWYBROJA-UHFFFAOYSA-N 0.000 description 1
- NERYXMCYIODOSZ-UHFFFAOYSA-N methyl 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate Chemical compound COC(=O)C1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 NERYXMCYIODOSZ-UHFFFAOYSA-N 0.000 description 1
- XAQQKXWRTLIIHP-UHFFFAOYSA-N methyl 2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(CNC=2OC3=CC=CC=C3N=2)=C1 XAQQKXWRTLIIHP-UHFFFAOYSA-N 0.000 description 1
- DCDZQKQCKYWTFV-UHFFFAOYSA-N methyl 2-[[3-[(1,3-benzoxazol-2-ylmethylamino)methyl]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(CNCC=2OC3=CC=CC=C3N=2)=C1 DCDZQKQCKYWTFV-UHFFFAOYSA-N 0.000 description 1
- PIUSHKPCOPHPJF-UHFFFAOYSA-N methyl 2-[[3-[(2,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC(Cl)=CC=2)Cl)=C1 PIUSHKPCOPHPJF-UHFFFAOYSA-N 0.000 description 1
- WJMYZZHDCPTOPX-UHFFFAOYSA-N methyl 2-[[3-[(2,5-dimethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC=C(C)C=2)C)=C1 WJMYZZHDCPTOPX-UHFFFAOYSA-N 0.000 description 1
- CZCSMEGSABDKQV-UHFFFAOYSA-N methyl 2-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC=CC=2)Cl)=C1 CZCSMEGSABDKQV-UHFFFAOYSA-N 0.000 description 1
- HWKMLNOBBANACI-UHFFFAOYSA-N methyl 2-[[3-[(2-cyclohexyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C2CCCCC2)=C1 HWKMLNOBBANACI-UHFFFAOYSA-N 0.000 description 1
- GOSAGHMJTSKBOD-UHFFFAOYSA-N methyl 2-[[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC2=C(ON=C2C)C)=C1 GOSAGHMJTSKBOD-UHFFFAOYSA-N 0.000 description 1
- OXEWWNLHWUQWET-UHFFFAOYSA-N methyl 2-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(Cl)=CC=2)=C1 OXEWWNLHWUQWET-UHFFFAOYSA-N 0.000 description 1
- LEXPHFBVTFXWHQ-UHFFFAOYSA-N methyl 2-[[3-[(4-ethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound C1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(=O)OC)=C1 LEXPHFBVTFXWHQ-UHFFFAOYSA-N 0.000 description 1
- BETKFKYGYMTJON-UHFFFAOYSA-N methyl 2-[[3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(ON=2)C(C)(C)C)=C1 BETKFKYGYMTJON-UHFFFAOYSA-N 0.000 description 1
- PWOPGERPVCAJPK-UHFFFAOYSA-N methyl 2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC(F)=CC3=CC=2)=C1 PWOPGERPVCAJPK-UHFFFAOYSA-N 0.000 description 1
- IJJUPNBBPYGZGR-UHFFFAOYSA-N methyl 2-[[3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C=2C=C(F)C=CC=2)=C1 IJJUPNBBPYGZGR-UHFFFAOYSA-N 0.000 description 1
- SVSSNKPHYQUAFF-UHFFFAOYSA-N methyl 2-[[3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C=2C=CC(F)=CC=2)=C1 SVSSNKPHYQUAFF-UHFFFAOYSA-N 0.000 description 1
- DIWDSBUPTUXHQD-UHFFFAOYSA-N methyl 2-[[3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=NOC=2C)C=2C(=CC=CC=2Cl)Cl)=C1 DIWDSBUPTUXHQD-UHFFFAOYSA-N 0.000 description 1
- SDMBKTYFSDHECZ-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C=2C=CC=CC=2)=C1 SDMBKTYFSDHECZ-UHFFFAOYSA-N 0.000 description 1
- BBXCJXQTYTWFCW-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCCC2=C(OC(=N2)C=2C=CC=CC=2)C)=C1 BBXCJXQTYTWFCW-UHFFFAOYSA-N 0.000 description 1
- BRWROFVPMUPMJQ-UHFFFAOYSA-N methyl 3-methylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1C BRWROFVPMUPMJQ-UHFFFAOYSA-N 0.000 description 1
- XJMIXEAZMCTAGH-UHFFFAOYSA-N methyl 3-oxopentanoate Chemical compound CCC(=O)CC(=O)OC XJMIXEAZMCTAGH-UHFFFAOYSA-N 0.000 description 1
- HCBQTGAZENNMLM-UHFFFAOYSA-N methyl 4-bromo-3-oxopentanoate Chemical compound COC(=O)CC(=O)C(C)Br HCBQTGAZENNMLM-UHFFFAOYSA-N 0.000 description 1
- KJJSHOHQQHACLE-UHFFFAOYSA-N methyl 5-hydroxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(O)=C1 KJJSHOHQQHACLE-UHFFFAOYSA-N 0.000 description 1
- FBZXCCIWGJFHAA-UHFFFAOYSA-N methylsulfonyl benzoate Chemical compound CS(=O)(=O)OC(=O)C1=CC=CC=C1 FBZXCCIWGJFHAA-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 125000004370 n-butenyl group Chemical group [H]\C([H])=C(/[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000005029 naphthylthio group Chemical group C1(=CC=CC2=CC=CC=C12)S* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000008764 nerve damage Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- AMKYESDOVDKZKV-UHFFFAOYSA-N o-orsellinic acid Chemical compound CC1=CC(O)=CC(O)=C1C(O)=O AMKYESDOVDKZKV-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-M oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC([O-])=O ZQPPMHVWECSIRJ-KTKRTIGZSA-M 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000008816 organ damage Effects 0.000 description 1
- 210000003463 organelle Anatomy 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 235000020830 overeating Nutrition 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 description 1
- 125000003145 oxazol-4-yl group Chemical group O1C=NC(=C1)* 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000007248 oxidative elimination reaction Methods 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000004095 oxindolyl group Chemical group N1(C(CC2=CC=CC=C12)=O)* 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical class O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 201000010065 polycystic ovary syndrome Diseases 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 150000003176 prostaglandin J2 derivatives Chemical class 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 150000003216 pyrazines Chemical class 0.000 description 1
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000005030 pyridylthio group Chemical group N1=C(C=CC=C1)S* 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000003642 reactive oxygen metabolite Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- GDESWOTWNNGOMW-UHFFFAOYSA-N resorcinol monobenzoate Chemical compound OC1=CC=CC(OC(=O)C=2C=CC=CC=2)=C1 GDESWOTWNNGOMW-UHFFFAOYSA-N 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000250 revascularization Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940074545 sodium dihydrogen phosphate dihydrate Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 238000010532 solid phase synthesis reaction Methods 0.000 description 1
- 230000000392 somatic effect Effects 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000004588 thienopyridyl group Chemical group S1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 238000007280 thionation reaction Methods 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 230000035922 thirst Effects 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 201000010875 transient cerebral ischemia Diseases 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 239000011995 wilkinson's catalyst Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
- C07C65/24—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/58—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems with hetero atoms directly attached to the ring nitrogen atom
- C07D215/60—N-oxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/74—Quinazolines; Hydrogenated quinazolines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to ring carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/42—Benzopyrazines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/24—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Diabetes (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Urology & Nephrology (AREA)
- Emergency Medicine (AREA)
- Endocrinology (AREA)
- Vascular Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
- Catalysts (AREA)
- Quinoline Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US13145499P | 1999-04-28 | 1999-04-28 | |
PCT/US2000/011490 WO2000064876A1 (en) | 1999-04-28 | 2000-04-28 | Tri-aryl acid derivatives as ppar receptor ligands |
Publications (1)
Publication Number | Publication Date |
---|---|
SK15522001A3 true SK15522001A3 (sk) | 2002-06-04 |
Family
ID=22449538
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
SK1552-2001A SK15522001A3 (sk) | 1999-04-28 | 2000-04-28 | Deriváty kyselín s tromi arylovými zvyškami ako ligandy receptorov PPAR a farmaceutické kompozície, ktoré ich obsahujú |
Country Status (28)
Country | Link |
---|---|
US (1) | US7005440B1 (de) |
EP (1) | EP1177176B1 (de) |
JP (1) | JP2002543065A (de) |
KR (1) | KR100693771B1 (de) |
CN (1) | CN1183113C (de) |
AT (1) | ATE323678T1 (de) |
AU (1) | AU782404B2 (de) |
BR (1) | BR0010126A (de) |
CA (1) | CA2371308A1 (de) |
CY (1) | CY1104899T1 (de) |
CZ (1) | CZ20013834A3 (de) |
DE (1) | DE60027420T2 (de) |
DK (1) | DK1177176T3 (de) |
EE (1) | EE200100558A (de) |
ES (1) | ES2261202T3 (de) |
HK (1) | HK1047098A1 (de) |
HR (1) | HRP20010793A2 (de) |
HU (1) | HUP0200997A3 (de) |
IL (2) | IL145923A0 (de) |
NO (1) | NO20015226L (de) |
NZ (1) | NZ515087A (de) |
PL (1) | PL351470A1 (de) |
PT (1) | PT1177176E (de) |
RU (1) | RU2278860C2 (de) |
SK (1) | SK15522001A3 (de) |
WO (1) | WO2000064876A1 (de) |
YU (1) | YU74701A (de) |
ZA (1) | ZA200108800B (de) |
Families Citing this family (223)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
ES2287016T3 (es) | 1999-04-28 | 2007-12-16 | Sanofi-Aventis Deutschland Gmbh | Derivados de diaril-acido como ligandos del receptor ppar. |
US6414002B1 (en) | 1999-09-22 | 2002-07-02 | Bristol-Myers Squibb Company | Substituted acid derivatives useful as antidiabetic and antiobesity agents and method |
TW200528436A (en) | 1999-09-22 | 2005-09-01 | Bristol Myers Squibb Co | Substituted acid derivatives useful as antiodiabetic and antiobesity agents and method |
IL151517A0 (en) * | 2000-03-09 | 2003-04-10 | Aventis Pharma Gmbh | Therapeutic uses of ppar mediators |
JP2001261654A (ja) * | 2000-03-21 | 2001-09-26 | Mitsui Chemicals Inc | キノリン誘導体およびそれを有効成分として含有する核内レセプター作動薬 |
WO2002040458A1 (fr) * | 2000-11-17 | 2002-05-23 | Takeda Chemical Industries, Ltd. | Derives d'isoxazole |
GB0029974D0 (en) * | 2000-12-08 | 2001-01-24 | Glaxo Group Ltd | Chemical compounds |
EP1357115B1 (de) * | 2000-12-28 | 2009-06-17 | Takeda Pharmaceutical Company Limited | Alkansäurederivate, verfahren zu deren herstellung und deren verwendung |
WO2002064632A2 (en) * | 2001-02-01 | 2002-08-22 | Smithkline Beecham Corporation | Crystallized ppar$g(a) ligand binding domain polypeptide and screening methods employing same |
EP1394154A4 (de) | 2001-03-23 | 2005-05-18 | Takeda Pharmaceutical | Fünfgliedriges heterocyclisches alkansäurederivat |
WO2002079162A1 (fr) * | 2001-03-28 | 2002-10-10 | Eisai Co., Ltd. | Acides carboxyliques |
JP4549021B2 (ja) | 2001-03-30 | 2010-09-22 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | ベンゼン化合物およびその塩 |
TWI311133B (en) | 2001-04-20 | 2009-06-21 | Eisai R&D Man Co Ltd | Carboxylic acid derivativeand the salt thereof |
US20030092736A1 (en) * | 2001-05-30 | 2003-05-15 | Cheng Peter T. | Substituted azole acid derivatives useful as antidiabetic and antiobesity agents and method |
GB0113231D0 (en) | 2001-05-31 | 2001-07-25 | Glaxo Group Ltd | Chemical compounds |
JPWO2002098840A1 (ja) * | 2001-06-04 | 2004-09-16 | エーザイ株式会社 | カルボン酸誘導体及びその塩もしくはそのエステルからなる医薬 |
DK1397130T3 (da) | 2001-06-20 | 2007-11-12 | Wyeth Corp | Substituerede indolsyrederivater som inhibitorer af plasminogenaktivatorinhibitor-1 (PAI-1) |
TWI224101B (en) | 2001-06-20 | 2004-11-21 | Wyeth Corp | Substituted naphthyl indole derivatives as inhibitors of plasminogen activator inhibitor type-1 (PAI-1) |
AR036237A1 (es) | 2001-07-27 | 2004-08-25 | Bayer Corp | Derivados del acido indan acetico, intermediarios, y metodo para su preparacion, composicion farmaceutica y el uso de dichos derivados para la manufactura de un medicamento |
US20110065129A1 (en) | 2001-07-27 | 2011-03-17 | Lowe Derek B | Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
ATE381542T1 (de) * | 2001-08-13 | 2008-01-15 | Phenex Pharmaceuticals Ag | Nr1h4-kern-rezeptor-bindende verbindungen |
WO2003016265A1 (fr) | 2001-08-17 | 2003-02-27 | Eisai Co., Ltd. | Compose cyclique et agoniste du recepteur ppar |
US7399777B2 (en) | 2001-08-31 | 2008-07-15 | Sanofi-Aventis Deutschland Gmbh | Diarylcycloalkyl derivatives, processes for their preparation and their use as pharmceuticals |
US6884812B2 (en) | 2001-08-31 | 2005-04-26 | Aventis Pharma Deutschland Gmbh | Diarylcycloalkyl derivatives, processes for their preparation and their use as pharmaceuticals |
UA76773C2 (uk) * | 2001-08-31 | 2006-09-15 | Санофі-Авентіс Дойчланд Гмбх | Діарилциклоалкільні похідні, спосіб їх одержання і їх застосування як ppar-активаторів |
US6716842B2 (en) | 2002-04-05 | 2004-04-06 | Warner-Lambert Company, Llc | Antidiabetic agents |
US7223796B2 (en) | 2002-04-11 | 2007-05-29 | Sanofi-Aventis Deutschland Gmbh | Acyl-4-carboxyphenylurea derivatives, processes for preparing them and their use |
US7078404B2 (en) | 2002-04-11 | 2006-07-18 | Sanofi-Aventis Deutschland Gmbh | Acyl-3-carboxyphenylurea derivatives, processes for preparing them and their use |
WO2003099793A1 (en) * | 2002-05-24 | 2003-12-04 | Takeda Pharmaceutical Company Limited | 1,2-azole derivatives with hypoglycemic and hypolipidemic activity |
JP2004277397A (ja) * | 2002-05-24 | 2004-10-07 | Takeda Chem Ind Ltd | 1,2−アゾール誘導体 |
US7049341B2 (en) | 2002-06-07 | 2006-05-23 | Aventis Pharma Deutschland Gmbh | N-benzoylureidocinnamic acid derivatives, processes for preparing them and their use |
GB0214149D0 (en) * | 2002-06-19 | 2002-07-31 | Glaxo Group Ltd | Chemical compounds |
SE0201937D0 (sv) | 2002-06-20 | 2002-06-20 | Astrazeneca Ab | Therapeutic agents |
US7351858B2 (en) | 2002-06-20 | 2008-04-01 | Astrazeneca Ab | Ortho-substituted benzoic acid derivatives for the treatment of insulin resistance |
DE60319084T2 (de) | 2002-06-20 | 2009-01-29 | Astrazeneca Ab | Ortho-substituierte benzoesäurederivate zur behandlung von insulinresistenz |
WO2004004665A2 (en) | 2002-07-09 | 2004-01-15 | Bristol-Myers Squibb Company | Substituted heterocyclic derivatives useful as antidiabetic and antiobesity agents and method |
JPWO2004007439A1 (ja) * | 2002-07-10 | 2005-11-10 | 住友製薬株式会社 | ビアリール誘導体 |
DE10231370B4 (de) | 2002-07-11 | 2006-04-06 | Sanofi-Aventis Deutschland Gmbh | Thiophenglycosidderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel |
US7262220B2 (en) | 2002-07-11 | 2007-08-28 | Sanofi-Aventis Deutschland Gmbh | Urea- and urethane-substituted acylureas, process for their preparation and their use |
DE50312261D1 (de) | 2002-07-12 | 2010-02-04 | Sanofi Aventis Deutschland | Heterozyklisch substituierte benzoylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
DE60332738D1 (de) * | 2002-07-30 | 2010-07-08 | Merck Sharp & Dohme | Ppar alpha selektive verbindungen zur behandlung von dyslipidämie und anderen lipidstörungen |
JP2004123732A (ja) * | 2002-09-10 | 2004-04-22 | Takeda Chem Ind Ltd | 5員複素環化合物 |
EP1541564A1 (de) | 2002-09-10 | 2005-06-15 | Takeda Pharmaceutical Company Limited | F nfgliedrige heterocyclische verbindungen |
US20040157922A1 (en) | 2002-10-04 | 2004-08-12 | Aventis Pharma Deutschland Gmbh | Carboxyalkoxy-substituted acyl-carboxyphenylurea derivatives and their use as medicaments |
US7208504B2 (en) | 2002-10-12 | 2007-04-24 | Sanofi-Aventis Deutschland Gmbh | Bicyclic inhibitors of hormone sensitive lipase |
WO2004041266A1 (ja) | 2002-11-08 | 2004-05-21 | Takeda Pharmaceutical Company Limited | 受容体機能調節剤 |
WO2004048349A1 (en) | 2002-11-22 | 2004-06-10 | Smithkline Beecham Corporation | Farnesoid x receptor agonists |
DE60306548T2 (de) | 2002-12-10 | 2007-06-21 | Wyeth | Substituierte 3-carbonyl-1-yl-essigsäure-derivate als plasminogen aktivator inhibitor(pai-1) inhibitoren |
AU2003296324A1 (en) | 2002-12-10 | 2004-06-30 | Wyeth | Aryl, aryloxy, and alkyloxy substituted 1h-indol-3-yl glyoxylic acid derivatives as inhibitors of plasminogen activator inhibitor-1 (pai-1) |
UA80453C2 (en) | 2002-12-10 | 2007-09-25 | Derivatives of substituted dyhydropyranoindol-3,4-dion as inhibitors of plasminogen activator inhibitor-1 (pai-1) | |
CN1723197A (zh) | 2002-12-10 | 2006-01-18 | 惠氏公司 | 作为纤溶酶原激活物抑制剂-1(pai-1)的抑制剂的取代3-烷基和3-芳基烷基1h-吲哚-1-基乙酸衍生物 |
DE10258007B4 (de) | 2002-12-12 | 2006-02-09 | Sanofi-Aventis Deutschland Gmbh | Aromatische Fluorglycosidderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel |
US6653334B1 (en) * | 2002-12-27 | 2003-11-25 | Kowa Co., Ltd. | Benzoxazole compound and pharmaceutical composition containing the same |
JP2006516254A (ja) | 2003-01-06 | 2006-06-29 | イーライ・リリー・アンド・カンパニー | Pparモジュレータとしての縮合ヘテロ環誘導体 |
US20040242583A1 (en) | 2003-01-20 | 2004-12-02 | Aventis Pharma Deutschland Gmbh | Pyrimido[5,4-e][1,2,4]triazine-5,7-diones, processes for preparing them and their use |
US7179941B2 (en) | 2003-01-23 | 2007-02-20 | Sanofi-Aventis Deutschland Gmbh | Carbonylamino-substituted acyl phenyl urea derivatives, process for their preparation and their use |
US7196114B2 (en) | 2003-02-17 | 2007-03-27 | Sanofi-Aventis Deutschland Gmbh | Substituted 3-(benzoylureido) thiophene derivatives, processes for preparing them and their use |
DE10308355A1 (de) * | 2003-02-27 | 2004-12-23 | Aventis Pharma Deutschland Gmbh | Aryl-cycloalkyl substituierte Alkansäurederivate, Verfahren zu ihrer Herstellung und ihre Anwendung als Arzneimittel |
DE10308350B4 (de) * | 2003-02-27 | 2006-06-01 | Sanofi-Aventis Deutschland Gmbh | Verfahren zur Herstellung der enantiomeren Formen von cis-konfigurierten 1,3-Cyclohexandiol-Derivaten |
US7148246B2 (en) | 2003-02-27 | 2006-12-12 | Sanofi-Aventis Deutschland Gmbh | Cycloalkyl derivatives having bioisosteric carboxylic acid groups, processes for their preparation and their use as pharmaceuticals |
DE10308351A1 (de) * | 2003-02-27 | 2004-11-25 | Aventis Pharma Deutschland Gmbh | 1,3-substituierte Cycloalkylderivate mit sauren, meist heterocyclischen Gruppen, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
DE10308353A1 (de) * | 2003-02-27 | 2004-12-02 | Aventis Pharma Deutschland Gmbh | Diarylcycloalkylderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
DE10308354A1 (de) * | 2003-02-27 | 2004-12-23 | Aventis Pharma Deutschland Gmbh | Cycloalkylderivate mit biosteren Carbonsäure-Gruppen, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
DE10308352A1 (de) | 2003-02-27 | 2004-09-09 | Aventis Pharma Deutschland Gmbh | Arylcycloalkylderivate mit verzweigten Seitenketten, Verfahren zu ihrer Herstellung und ihre Anwendung als Arzneimittel |
US7501440B2 (en) | 2003-03-07 | 2009-03-10 | Sanofi-Aventis Deutschland Gmbh | Substituted benzoylureidopyridylpiperidine-and-pyrrolidinecarboxylic acid derivatives, processes for preparing them and their use |
DE10313228A1 (de) * | 2003-03-25 | 2004-10-21 | Aventis Pharma Deutschland Gmbh | Synthese von 2-Chlormethyl-6-methylbenzoesäureestern |
US6989462B2 (en) | 2003-03-25 | 2006-01-24 | Sanofi-Aventis Deutschland Gmbh | Synthesis of 2-chloromethyl-6-methylbenzoic ester |
DE10314610A1 (de) | 2003-04-01 | 2004-11-04 | Aventis Pharma Deutschland Gmbh | Neues Diphenylazetidinon mit verbesserten physiologischen Eigenschaften, Verfahren zu dessen Herstellung, diese Verbindungen enthaltende Arzneimittel und dessen Verwendung |
US7244763B2 (en) * | 2003-04-17 | 2007-07-17 | Warner Lambert Company Llc | Compounds that modulate PPAR activity and methods of preparation |
EP1630152A4 (de) | 2003-05-30 | 2009-09-23 | Takeda Pharmaceutical | Verbindung mit kondensiertem ring |
US7348338B2 (en) | 2003-07-17 | 2008-03-25 | Plexxikon, Inc. | PPAR active compounds |
DK1648867T3 (da) | 2003-07-17 | 2013-12-16 | Plexxikon Inc | Ppar-aktive forbindelser |
US7008957B2 (en) | 2003-07-25 | 2006-03-07 | Sanofi-Aventis Deutschland Gmbh | Bicyclic cyanoheterocycles, process for their preparation and their use as medicaments |
US7094800B2 (en) | 2003-07-25 | 2006-08-22 | Sanofi-Aventis Deutschland Gmbh | Cyanopyrrolidides, process for their preparation and their use as medicaments |
US7094794B2 (en) | 2003-07-28 | 2006-08-22 | Sanofi-Aventis Deutschland Gmbh | Substituted thiazole-benzoisothiazole dioxide derivatives, process for their preparation and their use |
EP1651163B1 (de) * | 2003-08-01 | 2015-03-04 | Biocon Limited | Arylcarbamat-oligomere für hydrolysierbare prodrugs und diese enthaltende prodrugs |
DE10335092B3 (de) | 2003-08-01 | 2005-02-03 | Aventis Pharma Deutschland Gmbh | Substituierte Benzoylureido-o-benzoylamide, Verfahren zu deren Herstellung und deren Verwendung |
DE10335450A1 (de) * | 2003-08-02 | 2005-02-17 | Bayer Ag | Indolin-Sulfanilsäureamide |
WO2005012221A1 (ja) * | 2003-08-04 | 2005-02-10 | Ono Pharmaceutical Co., Ltd. | ジフェニルエーテル化合物、その製造方法および用途 |
ES2441206T3 (es) | 2003-09-03 | 2014-02-03 | Raqualia Pharma Inc. | Compuestos de fenil o piridilamida como antagonistas de la prostaglandina E2 |
BRPI0414536A (pt) * | 2003-09-17 | 2006-11-07 | Novartis Ag | compostos orgánicos |
US7332521B2 (en) | 2003-09-25 | 2008-02-19 | Wyeth | Substituted indoles |
US7268159B2 (en) | 2003-09-25 | 2007-09-11 | Wyeth | Substituted indoles |
US7442805B2 (en) | 2003-09-25 | 2008-10-28 | Wyeth | Substituted sulfonamide-indoles |
US7446201B2 (en) | 2003-09-25 | 2008-11-04 | Wyeth | Substituted heteroaryl benzofuran acids |
US7582773B2 (en) | 2003-09-25 | 2009-09-01 | Wyeth | Substituted phenyl indoles |
US7351726B2 (en) | 2003-09-25 | 2008-04-01 | Wyeth | Substituted oxadiazolidinediones |
US7141592B2 (en) | 2003-09-25 | 2006-11-28 | Wyeth | Substituted oxadiazolidinediones |
US7163954B2 (en) | 2003-09-25 | 2007-01-16 | Wyeth | Substituted naphthyl benzothiophene acids |
US7411083B2 (en) | 2003-09-25 | 2008-08-12 | Wyeth | Substituted acetic acid derivatives |
EP1684752B1 (de) | 2003-10-31 | 2007-05-16 | Janssen Pharmaceutica N.V. | Phenoxyessigsäure-derivate als peroxisom-proliferator-aktivierte rezeptor (ppar) dual-agonisten |
EP2428516A1 (de) | 2003-11-19 | 2012-03-14 | Metabasis Therapeutics, Inc. | Neue Phosphor enthaltende Thyromimetika |
CA2547430A1 (en) | 2003-11-26 | 2005-06-09 | Takeda Pharmaceutical Company Limited | Receptor function regulating agent |
DE10360525B3 (de) * | 2003-12-22 | 2005-08-18 | Aventis Pharma Deutschland Gmbh | Verfahren zur Herstellung von substituierten 2-(Phenoxymethyl)-benzoesäuren |
US7238835B2 (en) | 2003-12-22 | 2007-07-03 | Sanofi-Aventis Deutschland Gmbh | Process for the preparation of substituted 2-(phenoxymethyl) benzoic acids |
BRPI0418148A (pt) | 2003-12-25 | 2007-04-17 | Takeda Pharmaceutical | composto, prodroga de um composto, modulador da função do receptor gpr40, agente farmacêutico, uso de um composto e métodos de modificação de uma função do receptor gpr40 em um mamìfero, de profilaxia ou tratamento de diabetes em um mamìfero e de produção de um composto |
JP4855777B2 (ja) * | 2003-12-26 | 2012-01-18 | 武田薬品工業株式会社 | フェニルプロパン酸誘導体 |
US7470706B2 (en) | 2004-01-31 | 2008-12-30 | Sanofi-Aventis Deutschland Gmbh | Cycloalkyl-substituted 7-amino-4-quinolone-3-carboxylic acid derivatives, process for their preparation and their use as medicaments |
US7498341B2 (en) | 2004-01-31 | 2009-03-03 | Sanofi Aventis Deutschland Gmbh | Heterocyclically substituted 7-amino-4-quinolone-3-carboxylic acid derivatives, process for their preparation and their use as medicaments |
DE102004005172A1 (de) | 2004-02-02 | 2005-08-18 | Aventis Pharma Deutschland Gmbh | Indazolderivate als Inhibitoren der Hormon Sensitiven Lipase |
KR20070004769A (ko) | 2004-02-27 | 2007-01-09 | 암젠 인코포레이션 | 대사 장애의 치료에 사용되는 화합물, 약제학적 조성물 및그 사용방법 |
EP1586573B1 (de) | 2004-04-01 | 2007-02-07 | Sanofi-Aventis Deutschland GmbH | Oxadiazolone, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Pharmazeutika |
US7625949B2 (en) | 2004-04-23 | 2009-12-01 | Roche Palo Alto Llc | Methods for treating retroviral infections |
US7166738B2 (en) | 2004-04-23 | 2007-01-23 | Roche Palo Alto Llc | Non-nucleoside reverse transcriptase inhibitors |
WO2006004030A1 (ja) * | 2004-07-02 | 2006-01-12 | Sankyo Company, Limited | 組織因子産生抑制剤 |
KR20070050475A (ko) | 2004-08-11 | 2007-05-15 | 교린 세이야꾸 가부시키 가이샤 | 신규 환상 아미노 안식향산 유도체 |
DE102004039509B4 (de) * | 2004-08-14 | 2006-09-21 | Sanofi-Aventis Deutschland Gmbh | Aryl-cycloalkyl substituierte Alkansäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
MX2007002178A (es) | 2004-08-23 | 2007-04-02 | Wyeth Corp | Acidos de oxazolo-naftilo como moduladores del inhibidor del activador de plasminogeno tipo 1 (pai-1) util en el tratamiento de trombosis y enfermedades cardiovasculares. |
WO2006044602A2 (en) * | 2004-10-18 | 2006-04-27 | Merck & Co., Inc. | Diphenyl substituted alkanes as flap inhiibitors |
RU2007115900A (ru) | 2004-10-27 | 2008-11-10 | Дайити Санкио Компани, Лимитед (Jp) | Производные бензола, имеющие 2 или более заместителей |
EP1829863A4 (de) * | 2004-11-26 | 2009-04-22 | Takeda Pharmaceutical | Arylalkansäurederivat |
CA2588953A1 (en) | 2004-11-30 | 2006-06-08 | Plexxikon, Inc. | Ppar active compounds |
EP1862464A4 (de) * | 2005-03-23 | 2010-08-25 | Kyorin Seiyaku Kk | Neues cyclisches aminophenylalkansäurederivat |
DE102005026762A1 (de) | 2005-06-09 | 2006-12-21 | Sanofi-Aventis Deutschland Gmbh | Azolopyridin-2-on-derivate als Inhibitoren von Lipasen und Phospholipasen |
AU2006279496A1 (en) | 2005-08-17 | 2007-02-22 | Wyeth | Substituted indoles and use thereof |
RU2008108221A (ru) * | 2005-09-07 | 2009-10-20 | Плекссикон, Инк. (Us) | Соединения, активные в отношении ppar (рецепторов активаторов пролиферации пероксисом) |
CA2624102A1 (en) | 2005-09-29 | 2007-04-12 | Sanofi-Aventis | Phenyl- and pyridinyl- 1, 2 , 4 - oxadiazolone derivatives, processes for their preparation and their use as pharmaceuticals |
WO2007045573A1 (en) | 2005-10-19 | 2007-04-26 | F. Hoffmann-La Roche Ag | Phenyl-acetamide nnrt inhibitors |
DE102006028862A1 (de) | 2006-06-23 | 2007-12-27 | Merck Patent Gmbh | 3-Amino-imidazo[1,2-a]pyridinderivate |
ME00535B (me) | 2006-06-27 | 2011-10-10 | Takeda Pharmaceuticals Co | Fuzionisana ciklična jedinjenja |
US8269010B2 (en) * | 2006-09-21 | 2012-09-18 | Piramal Healthcare Limited | 3-amino-pyridine derivatives for the treatment of metabolic disorders |
DE102007002260A1 (de) | 2007-01-16 | 2008-07-31 | Sanofi-Aventis | Verwendung von substituierten Pyranonsäurederivaten zur Herstellung von Medikamenten zur Behandlung des Metabolischen Syndroms |
DE102007008420A1 (de) | 2007-02-21 | 2008-08-28 | Merck Patent Gmbh | Benzimidazolderivate |
PE20090159A1 (es) | 2007-03-08 | 2009-02-21 | Plexxikon Inc | COMPUESTOS DERIVADOS DE ACIDO INDOL-PROPIONICO COMO MODULADORES PPARs |
RU2480453C2 (ru) * | 2007-03-08 | 2013-04-27 | Альбирео Аб | Новые соединения |
BRPI0701664A2 (pt) * | 2007-05-28 | 2009-01-13 | Fundacao Universidade Fed De Sco Carlos | 4-quinolinonas e quinolinas, processo de preparaÇço, formulaÇÕes farmacÊuticas e uso das mesmas |
EP2025674A1 (de) | 2007-08-15 | 2009-02-18 | sanofi-aventis | Substituierte Tetrahydronaphthaline, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
CN101381302B (zh) * | 2007-09-07 | 2013-04-03 | 上海睿智化学研究有限公司 | 2-溴甲基-6-甲基苯甲酰氯/溴的制备方法 |
DE102007048716A1 (de) | 2007-10-11 | 2009-04-23 | Merck Patent Gmbh | Imidazo[1,2-a]pyrimidinderivate |
DE102007054497B3 (de) | 2007-11-13 | 2009-07-23 | Sanofi-Aventis Deutschland Gmbh | Neue kristalline Diphenylazetidinonhydrate und Verfahren zu deren Herstellung |
WO2009075874A1 (en) * | 2007-12-13 | 2009-06-18 | Amgen Inc. | Gamma secretase modulators |
WO2009078981A2 (en) * | 2007-12-13 | 2009-06-25 | Sri International | Ppar-delta ligands and methods of their use |
KR101235961B1 (ko) * | 2008-02-01 | 2013-02-21 | 판미라 파마슈티칼스, 엘엘씨 | 프로스타글란딘 d2 수용체의 n,n-이치환 아미노알킬비페닐 길항제 |
EP2257536A4 (de) * | 2008-02-14 | 2011-03-23 | Amira Pharmaceuticals Inc | Cyclische diarylether als antagonisten von prostaglandin-d2-rezeptoren |
US8497381B2 (en) | 2008-02-25 | 2013-07-30 | Panmira Pharmaceuticals, Llc | Antagonists of prostaglandin D2 receptors |
JP2011518130A (ja) * | 2008-04-02 | 2011-06-23 | アミラ ファーマシューティカルズ,インク. | プロスタグランジンd2受容体のアミノアルキルフェニルアンタゴニスト |
DE102008017590A1 (de) | 2008-04-07 | 2009-10-08 | Merck Patent Gmbh | Glucopyranosidderivate |
DE102008018675A1 (de) * | 2008-04-14 | 2009-10-15 | Bayer Schering Pharma Aktiengesellschaft | Oxo-heterocyclisch substituierte Carbonsäure-Derivate und ihre Verwendung |
US20110144160A1 (en) * | 2008-07-03 | 2011-06-16 | Amira Pharmaceuticals, Inc. | Antagonists of Prostaglandin D2 Receptors |
UY31968A (es) | 2008-07-09 | 2010-01-29 | Sanofi Aventis | Nuevos derivados heterocíclicos, sus procesos para su preparación, y sus usos terapéuticos |
WO2010009374A1 (en) | 2008-07-18 | 2010-01-21 | Zafgen, Inc. | Methods of treating an overweight or obese subject |
WO2010039977A2 (en) | 2008-10-01 | 2010-04-08 | Amira Pharmaceuticals, Inc. | Heteroaryl antagonists of prostaglandin d2 receptors |
WO2010042652A2 (en) | 2008-10-08 | 2010-04-15 | Amira Pharmaceuticals, Inc. | Heteroalkyl biphenyl antagonists of prostaglandin d2 receptors |
WO2010057118A2 (en) | 2008-11-17 | 2010-05-20 | Amira Pharmaceuticals, Inc. | Heterocyclic antagonists of prostaglandin d2 receptors |
US20120004162A1 (en) | 2008-12-04 | 2012-01-05 | Vath James E | Methods of Treating an Overweight or Obese Subject |
US8642650B2 (en) | 2008-12-04 | 2014-02-04 | Zafgen, Inc. | Methods of treating an overweight or obese subject |
WO2010068601A1 (en) | 2008-12-08 | 2010-06-17 | Sanofi-Aventis | A crystalline heteroaromatic fluoroglycoside hydrate, processes for making, methods of use and pharmaceutical compositions thereof |
US20100173313A1 (en) * | 2009-01-08 | 2010-07-08 | Amira Pharmaceuticals, Inc. | Biomarkers of inflammation |
WO2010093601A1 (en) | 2009-02-10 | 2010-08-19 | Metabasis Therapeutics, Inc. | Novel sulfonic acid-containing thyromimetics, and methods for their use |
EP2440053A4 (de) | 2009-06-09 | 2012-10-31 | California Capital Equity Llc | Benzylsubstituierte triazinderivate und ihre therapeutischen anwendungen |
CN102573480B (zh) | 2009-06-09 | 2015-06-10 | 加利福尼亚资本权益有限责任公司 | 三嗪衍生物及其治疗应用 |
ES2557453T3 (es) | 2009-06-09 | 2016-01-26 | Nantbioscience, Inc. | Derivados de isoquinolina, quinolina y quinazolina como inhibidores de la señalización de Hedgehog |
US8815917B2 (en) * | 2009-08-05 | 2014-08-26 | Panmira Pharmaceuticals, Llc | DP2 antagonist and uses thereof |
SG178880A1 (en) | 2009-08-26 | 2012-04-27 | Sanofi Sa | Novel crystalline heteroaromatic fluoroglycoside hydrates, pharmaceuticals comprising these compounds and their use |
BR112012007349A2 (pt) | 2009-10-02 | 2019-09-24 | Sanofi Sa | uso de composto com atividade inibidora de sglt-1/sglt-2 para produção de medicamentos para tratamento de doenças ósseas. |
CA2777108A1 (en) * | 2009-10-09 | 2011-04-14 | Zafgen Corporation | Sulphone compounds and methods of making and using same |
DE102009046115A1 (de) | 2009-10-28 | 2011-09-08 | Bayer Schering Pharma Aktiengesellschaft | Substituierte 3-Phenylpropansäuren und ihre Verwendung |
JP2013516475A (ja) | 2010-01-06 | 2013-05-13 | アミラ ファーマシューティカルズ,インク. | Dp2アンタゴニストおよびその使用 |
AU2011204267B2 (en) | 2010-01-08 | 2015-12-03 | Zafgen Corporation | Fumagillol type compounds and methods of making and using same |
US8815309B2 (en) | 2010-01-08 | 2014-08-26 | Zafgen, Inc. | Methods of treating a subject with benign prostate hyperplasia |
WO2011107494A1 (de) | 2010-03-03 | 2011-09-09 | Sanofi | Neue aromatische glykosidderivate, diese verbindungen enthaltende arzneimittel und deren verwendung |
WO2011127304A2 (en) | 2010-04-07 | 2011-10-13 | Zafgen Corporation | Methods of treating an overweight subject |
WO2011157827A1 (de) | 2010-06-18 | 2011-12-22 | Sanofi | Azolopyridin-3-on-derivate als inhibitoren von lipasen und phospholipasen |
US8530413B2 (en) | 2010-06-21 | 2013-09-10 | Sanofi | Heterocyclically substituted methoxyphenyl derivatives with an oxo group, processes for preparation thereof and use thereof as medicaments |
TW201215387A (en) | 2010-07-05 | 2012-04-16 | Sanofi Aventis | Spirocyclically substituted 1,3-propane dioxide derivatives, processes for preparation thereof and use thereof as a medicament |
TW201221505A (en) | 2010-07-05 | 2012-06-01 | Sanofi Sa | Aryloxyalkylene-substituted hydroxyphenylhexynoic acids, process for preparation thereof and use thereof as a medicament |
TW201215388A (en) | 2010-07-05 | 2012-04-16 | Sanofi Sa | (2-aryloxyacetylamino)phenylpropionic acid derivatives, processes for preparation thereof and use thereof as medicaments |
JP5830534B2 (ja) | 2010-07-09 | 2015-12-09 | ファイザー・リミテッドPfizer Limited | 化合物 |
EP2593432B1 (de) | 2010-07-12 | 2014-10-22 | Pfizer Limited | N-sulfonylbenzamidderivate als spannungsgesteuerte natriumkanalhemmer |
CA2804716A1 (en) | 2010-07-12 | 2012-01-19 | Pfizer Limited | Chemical compounds |
ES2532357T3 (es) | 2010-07-12 | 2015-03-26 | Pfizer Limited | Derivados de sulfonamida como inhibidores de Nav1.7 para el tratamiento del dolor |
EP2593431B1 (de) | 2010-07-12 | 2014-11-19 | Pfizer Limited | N-sulfonylbenzamide als inhibitoren von spannungsabhängigen natriumkanälen |
US8772343B2 (en) | 2010-07-12 | 2014-07-08 | Pfizer Limited | Chemical compounds |
EP2595988B1 (de) | 2010-07-22 | 2014-12-17 | Zafgen, Inc. | Tricyclische verbindungen und verfahren zu ihrer herstellung |
NZ610569A (en) | 2010-11-09 | 2015-06-26 | Zafgen Inc | Crystalline solids of a metap-2 inhibitor and methods of making and using same |
CA2819251A1 (en) | 2010-11-29 | 2012-06-07 | Zafgen Corporation | Treatment of obesity using non-daily administration of 6 - 0 - (4 - dimethylaminoethoxy) cinnamoyl fumagillol |
EA201300669A1 (ru) | 2010-12-07 | 2013-11-29 | Байер Интеллектчуал Проперти Гмбх | Замещенные 1-бензилциклоалкилкарбоновые кислоты и их применение |
SG191040A1 (en) | 2010-12-23 | 2013-08-30 | Pfizer | Glucagon receptor modulators |
CA2825408A1 (en) | 2011-01-26 | 2012-08-02 | Zafgen, Inc. | Tetrazole compounds and methods of making and using same |
WO2012107850A1 (en) | 2011-02-08 | 2012-08-16 | Pfizer Inc. | Glucagon receptor modulator |
US8871758B2 (en) | 2011-03-08 | 2014-10-28 | Sanofi | Tetrasubstituted oxathiazine derivatives, method for producing them, their use as medicine and drug containing said derivatives and the use thereof |
WO2012120054A1 (de) | 2011-03-08 | 2012-09-13 | Sanofi | Di- und trisubstituierte oxathiazinderivate, verfahren zu deren herstellung, ihre verwendung als medikament sowie sie enthaltendes arzneimittel und deren verwendung |
WO2012122264A1 (en) | 2011-03-08 | 2012-09-13 | Zafgen Corporation | Oxaspiro [2.5] octane derivatives and analogs |
US8828995B2 (en) | 2011-03-08 | 2014-09-09 | Sanofi | Branched oxathiazine derivatives, method for the production thereof, use thereof as medicine and drug containing said derivatives and use thereof |
WO2012120052A1 (de) | 2011-03-08 | 2012-09-13 | Sanofi | Mit carbozyklen oder heterozyklen substituierte oxathiazinderivate, verfahren zu deren herstellung, diese verbindungen enthaltende arzneimittel und deren verwendung |
EP2683699B1 (de) | 2011-03-08 | 2015-06-24 | Sanofi | Di- und trisubstituierte oxathiazinderivate, verfahren zu deren herstellung, ihre verwendung als medikament sowie sie enthaltendes arzneimittel und deren verwendung |
DE102011007272A1 (de) | 2011-04-13 | 2012-10-18 | Bayer Pharma Aktiengesellschaft | Verzweigte 3-Phenylpropionsäure-Derivate und ihre Verwendung |
WO2012154676A1 (en) | 2011-05-06 | 2012-11-15 | Zafgen Corporation | Partially saturated tricyclic compounds and methods of making and using same |
EP2705035B1 (de) | 2011-05-06 | 2016-12-14 | Zafgen, Inc. | Tricyclische pyrazolsulfonamidverbindungen sowie verfahren und herstellung zu ihrer herstellung |
JP5941981B2 (ja) | 2011-05-06 | 2016-06-29 | ザフゲン,インコーポレイテッド | 三環式スルホンアミド化合物ならびにその製造および使用方法 |
EP2734503B1 (de) | 2011-07-22 | 2015-09-16 | Pfizer Inc. | Chinolinylglucagonrezeptor- modulatoren |
EP2744807A4 (de) | 2011-08-15 | 2015-03-04 | Intermune Inc | Verbindungen als lysophosphatidsäure-rezeptorantagonisten |
EP2567959B1 (de) | 2011-09-12 | 2014-04-16 | Sanofi | 6-(4-hydroxy-phenyl)-3-styryl-1h-pyrazolo[3,4-b]pyridin-4-carbonsäureamid-derivate als kinaseinhibitoren |
WO2013037390A1 (en) | 2011-09-12 | 2013-03-21 | Sanofi | 6-(4-hydroxy-phenyl)-3-styryl-1h-pyrazolo[3,4-b]pyridine-4-carboxylic acid amide derivatives as kinase inhibitors |
EP2760862B1 (de) | 2011-09-27 | 2015-10-21 | Sanofi | 6-(4-hydroxy-phenyl)-3-alkyl-1h-pyrazolo[3,4-b]pyridin-4-carbonsäureamidderivate als kinaseinhibitoren |
EP2763671A2 (de) | 2011-10-03 | 2014-08-13 | Zafgen, Inc. | Verfahren zur behandlung von altersbedingten erkrankungen |
US9440943B2 (en) | 2012-01-18 | 2016-09-13 | Zafgen, Inc. | Tricyclic sulfone compounds and methods of making and using same |
WO2013109739A1 (en) | 2012-01-18 | 2013-07-25 | Zafgen, Inc. | Tricyclic sulfonamide compounds and methods of making and using same |
US9260419B2 (en) | 2012-05-07 | 2016-02-16 | Zafgen, Inc. | Polymorphic salt of a metap-2 inhibitor and methods of making and using same |
MX2014013599A (es) | 2012-05-08 | 2015-05-11 | Zafgen Inc | Tratamiento de la obesidad hipotalamica con inhibidores de metap2. |
MX356755B (es) | 2012-05-09 | 2018-06-11 | Zafgen Inc | Compuestos de tipo fumagilol y metodos para su elaboración y uso. |
DE102012208530A1 (de) | 2012-05-22 | 2013-11-28 | Bayer Pharma AG | Substituierte Piperidinoacetamide und ihre Verwendung |
EP2917197B1 (de) | 2012-11-05 | 2019-06-05 | Zafgen, Inc. | Tricyclische verbindungen und verfahren zur herstellung und verwendung davon |
NZ707773A (en) | 2012-11-05 | 2019-05-31 | Zafgen Inc | Methods of treating liver diseases |
WO2014071369A1 (en) | 2012-11-05 | 2014-05-08 | Zafgen, Inc. | Tricyclic compounds for use in the treatment and/or control of obesity |
CA2904353A1 (en) | 2013-03-14 | 2014-09-25 | Zafgen, Inc. | Methods of treating renal disease and other disorders |
CN112500338A (zh) | 2013-03-15 | 2021-03-16 | 全球血液疗法股份有限公司 | 化合物及其用于调节血红蛋白的用途 |
JP6483666B2 (ja) | 2013-10-14 | 2019-03-13 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | 選択的に置換されたキノリン化合物 |
SI3057964T1 (sl) | 2013-10-14 | 2020-03-31 | Eisai R&D Management Co., Ltd. | Selektivno substituirane spojine kinolina |
EA201992707A1 (ru) | 2013-11-18 | 2020-06-30 | Глобал Блад Терапьютикс, Инк. | Соединения и их применения для модуляции гемоглобина |
JP6699011B2 (ja) * | 2014-07-04 | 2020-05-27 | 国立大学法人 東京大学 | 脂肪酸サロゲートを含むリゾホスファチジルセリン誘導体 |
EP2982667A1 (de) * | 2014-08-04 | 2016-02-10 | Fraunhofer Gesellschaft zur Förderung der angewandten Forschung e.V. | Kompetitive PPAR-Gamma-Antagonisten |
KR20170058921A (ko) | 2014-10-10 | 2017-05-29 | 풀모사이드 리미티드 | 신규의 5,6-디하이드로-4H-벤조[b]티에노-[2,3-d]아제핀 유도체 |
CU24413B1 (es) | 2014-12-18 | 2019-05-03 | Bayer Pharma AG | Ácidos piridil-cicloalquil-carboxílicos sustituidos útiles para el tratamiento de enfermedades asociadas al dolor, y para el tratamiento o profilaxis de los síndromes del dolor, de la endometriosis, la adenomiosis y el cáncer |
WO2016097761A1 (en) | 2014-12-18 | 2016-06-23 | Pulmocide Limited | 4,5-dihydro-6h-thieno[3,2-d]benzazepine derivatives and their use to treat respiratory syncytial virus (rsv) infections |
CN106432255A (zh) | 2015-08-11 | 2017-02-22 | 扎夫根公司 | 烟曲霉素醇螺环化合物和制备和使用其的方法 |
AR105671A1 (es) | 2015-08-11 | 2017-10-25 | Zafgen Inc | Compuestos heterocíclicos de fumagillol y sus métodos de elaboración y uso |
TW201920081A (zh) | 2017-07-11 | 2019-06-01 | 美商維泰克斯製藥公司 | 作為鈉通道調節劑的羧醯胺 |
US11612580B2 (en) | 2017-10-16 | 2023-03-28 | The Board Of Regents Of The University Of Texas System | Compositions for inhibiting 3′ repair exonuclease 2 and methods of screening for such compositions |
US10905667B2 (en) | 2018-07-24 | 2021-02-02 | Bayer Pharma Aktiengesellschaft | Orally administrable modified-release pharmaceutical dosage form |
CR20220316A (es) | 2019-12-06 | 2022-10-07 | Vertex Pharma | Tetrahidrofuranos sustituidos como moduladores de canales de sodio |
CN117794920A (zh) | 2021-06-04 | 2024-03-29 | 沃泰克斯药物股份有限公司 | N-(羟烷基(杂)芳基)四氢呋喃甲酰胺作为钠通道调节剂 |
WO2024039864A1 (en) * | 2022-08-19 | 2024-02-22 | Purdue Research Foundation | Protein:protein interaction inhibitors |
Family Cites Families (19)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
ES2059527T3 (es) * | 1987-09-09 | 1994-11-16 | Zeneca Ltd | Fungicidas. |
US4920133A (en) * | 1987-11-03 | 1990-04-24 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene D4 |
US4920132A (en) * | 1987-11-03 | 1990-04-24 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene D4 |
US4920131A (en) * | 1987-11-03 | 1990-04-24 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene D4 |
US5051427A (en) * | 1987-11-03 | 1991-09-24 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Quinoline derivatives as antagonists of leukotriene D4 |
GB8728051D0 (en) * | 1987-12-01 | 1988-01-06 | Leo Pharm Prod Ltd | Chemical compounds |
US4918081A (en) * | 1988-06-20 | 1990-04-17 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene d4 |
JPH05213884A (ja) * | 1991-06-14 | 1993-08-24 | Upjohn Co:The | 新規な4−アミノキノリン類およびこれを有効成分とする高血圧・鬱血性心不全の予防・治療剤 |
US5508408A (en) | 1993-09-10 | 1996-04-16 | Ciba-Geigy Corporation | Quinoline compound |
EP0643045B1 (de) * | 1993-09-10 | 2000-03-08 | Novartis AG | Chinolin-Verbindungen als Leukotriene Antagonisten |
ES2117551B1 (es) * | 1995-12-29 | 1999-04-01 | Menarini Lab | Quinolinas naftalenicas con accion antagonista de los leucotrienos, procedimiento para su preparacion y utilizacion de las mismas. |
WO1997028149A1 (en) * | 1996-02-02 | 1997-08-07 | Merck & Co., Inc. | Method for raising hdl cholesterol levels |
ATE262334T1 (de) * | 1996-02-02 | 2004-04-15 | Merck & Co Inc | Antidiabetisches mittel |
GB9604242D0 (en) * | 1996-02-28 | 1996-05-01 | Glaxo Wellcome Inc | Chemical compounds |
AU719663B2 (en) * | 1996-12-23 | 2000-05-11 | Merck & Co., Inc. | Antidiabetic agents |
AU8559598A (en) * | 1997-08-08 | 1999-03-01 | Ono Pharmaceutical Co. Ltd. | Gamma-type regulators for peroxisome proliferator-activated receptor |
CA2306825A1 (en) * | 1997-10-17 | 1999-04-29 | Avantis Pharmaceuticals Products Inc. | Therapeutic uses of quinoline derivatives |
CN1208326C (zh) * | 1998-04-23 | 2005-06-29 | 雷迪实验室有限公司 | 杂环化合物及其在医药方面的应用、其制备方法及含有它们的药物组合物 |
ES2287016T3 (es) | 1999-04-28 | 2007-12-16 | Sanofi-Aventis Deutschland Gmbh | Derivados de diaril-acido como ligandos del receptor ppar. |
-
2000
- 2000-04-28 SK SK1552-2001A patent/SK15522001A3/sk unknown
- 2000-04-28 IL IL14592300A patent/IL145923A0/xx active IP Right Grant
- 2000-04-28 KR KR1020017013772A patent/KR100693771B1/ko not_active IP Right Cessation
- 2000-04-28 CZ CZ20013834A patent/CZ20013834A3/cs unknown
- 2000-04-28 WO PCT/US2000/011490 patent/WO2000064876A1/en not_active Application Discontinuation
- 2000-04-28 RU RU2001132081/04A patent/RU2278860C2/ru not_active IP Right Cessation
- 2000-04-28 ES ES00930210T patent/ES2261202T3/es not_active Expired - Lifetime
- 2000-04-28 YU YU74701A patent/YU74701A/sh unknown
- 2000-04-28 EE EEP200100558A patent/EE200100558A/xx unknown
- 2000-04-28 CA CA002371308A patent/CA2371308A1/en not_active Abandoned
- 2000-04-28 AU AU48070/00A patent/AU782404B2/en not_active Ceased
- 2000-04-28 BR BR0010126-5A patent/BR0010126A/pt not_active Application Discontinuation
- 2000-04-28 DE DE60027420T patent/DE60027420T2/de not_active Expired - Lifetime
- 2000-04-28 PT PT00930210T patent/PT1177176E/pt unknown
- 2000-04-28 JP JP2000613829A patent/JP2002543065A/ja active Pending
- 2000-04-28 AT AT00930210T patent/ATE323678T1/de not_active IP Right Cessation
- 2000-04-28 CN CNB008068178A patent/CN1183113C/zh not_active Expired - Fee Related
- 2000-04-28 EP EP00930210A patent/EP1177176B1/de not_active Expired - Lifetime
- 2000-04-28 NZ NZ515087A patent/NZ515087A/en unknown
- 2000-04-28 PL PL00351470A patent/PL351470A1/xx not_active IP Right Cessation
- 2000-04-28 DK DK00930210T patent/DK1177176T3/da active
- 2000-04-28 HU HU0200997A patent/HUP0200997A3/hu unknown
- 2000-11-28 US US09/724,496 patent/US7005440B1/en not_active Expired - Lifetime
-
2001
- 2001-10-14 IL IL145923A patent/IL145923A/en not_active IP Right Cessation
- 2001-10-24 ZA ZA200108800A patent/ZA200108800B/en unknown
- 2001-10-25 NO NO20015226A patent/NO20015226L/no not_active Application Discontinuation
- 2001-10-26 HR HR20010793A patent/HRP20010793A2/hr not_active Application Discontinuation
-
2002
- 2002-11-29 HK HK02108625A patent/HK1047098A1/xx not_active IP Right Cessation
-
2006
- 2006-06-21 CY CY20061100831T patent/CY1104899T1/el unknown
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
SK15522001A3 (sk) | Deriváty kyselín s tromi arylovými zvyškami ako ligandy receptorov PPAR a farmaceutické kompozície, ktoré ich obsahujú | |
RU2267484C2 (ru) | Производные диариловой кислоты и фармацевтическая композиция на их основе | |
RU2480463C1 (ru) | Пиридилокси производные, полезные в качестве активатора/модулятора гамма-рецептора, активируемого пролифератором пероксисом (ppar) гамма | |
RU2482112C2 (ru) | Ингибиторы киназ, применимые для лечения миелопролиферативных заболеваний и других пролиферативных заболеваний | |
JP3940430B2 (ja) | C型肝炎ウイルスrna依存rnaポリメラーゼ阻害剤ならびにそれを用いた組成物および治療 | |
US20100311748A1 (en) | Heterocyclic amides useful for the treatment of cancer and psoriasis | |
US20050288515A1 (en) | Chemical compounds | |
JP2010524974A (ja) | 骨髄増殖性疾患および他の増殖性疾患の治療に有用なキナーゼ阻害剤 | |
JP2006516254A (ja) | Pparモジュレータとしての縮合ヘテロ環誘導体 | |
EA011010B1 (ru) | Соединения, модулирующие рецептор gpr40, фармацевтическая композиция, способ лечения заболеваний, чувствительных к модулированию рецептора gpr40 (варианты), способ модулирования функции gpr40 (варианты) и способ модулирования циркулирующей концентрации инсулина | |
JPH10195063A (ja) | エチニルチアゾール誘導体 | |
JP2006514069A (ja) | Ppar調節因子としての融合複素環式誘導体 | |
WO2007081335A1 (en) | Therapeutic compounds for treating dyslipidemic conditions | |
US20080207685A1 (en) | Heterocyclic Compounds As Modulators Of Peroxisome Proliferator Activated Receptors, Useful For The Treatment And/Or Prevention Of Disorders Modulated By A Ppar | |
MXPA01010788A (en) | Tri-aryl acid derivatives as ppar receptor ligands | |
US20070142437A1 (en) | Chemical compounds |