SE453090B - Nya cefalosporinderivat, forfarande for framstellning derav samt farmaceutisk komposition derav - Google Patents
Nya cefalosporinderivat, forfarande for framstellning derav samt farmaceutisk komposition deravInfo
- Publication number
- SE453090B SE453090B SE8105658A SE8105658A SE453090B SE 453090 B SE453090 B SE 453090B SE 8105658 A SE8105658 A SE 8105658A SE 8105658 A SE8105658 A SE 8105658A SE 453090 B SE453090 B SE 453090B
- Authority
- SE
- Sweden
- Prior art keywords
- group
- groups
- salt
- cephalosporin
- alkyl
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims description 48
- 229940124587 cephalosporin Drugs 0.000 title claims description 48
- 150000001780 cephalosporins Chemical class 0.000 title claims description 46
- 238000000034 method Methods 0.000 title claims description 17
- 239000008194 pharmaceutical composition Substances 0.000 title claims 2
- -1 amino, phenylamino, chloroacetylamino, benzyloxycarbonylamino, formylamino Chemical group 0.000 claims description 181
- 150000003839 salts Chemical class 0.000 claims description 75
- 125000000217 alkyl group Chemical group 0.000 claims description 65
- 150000001875 compounds Chemical class 0.000 claims description 50
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 35
- 125000001424 substituent group Chemical group 0.000 claims description 34
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 125000001425 triazolyl group Chemical group 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 20
- 150000002148 esters Chemical class 0.000 claims description 17
- 125000005843 halogen group Chemical group 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 16
- 150000001782 cephems Chemical group 0.000 claims description 16
- 125000006239 protecting group Chemical group 0.000 claims description 15
- 125000004414 alkyl thio group Chemical group 0.000 claims description 14
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 125000004442 acylamino group Chemical group 0.000 claims description 12
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 12
- 125000003277 amino group Chemical group 0.000 claims description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000002541 furyl group Chemical group 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 5
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 3
- 241001465754 Metazoa Species 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 208000022362 bacterial infectious disease Diseases 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 238000011282 treatment Methods 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 12
- 125000004645 (C1-C12) acylamino group Chemical group 0.000 claims 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 2
- 125000000962 organic group Chemical group 0.000 claims 2
- 208000035143 Bacterial infection Diseases 0.000 claims 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical group [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 230000002140 halogenating effect Effects 0.000 claims 1
- 239000000047 product Substances 0.000 claims 1
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 16
- 125000003118 aryl group Chemical group 0.000 description 10
- 125000000623 heterocyclic group Chemical group 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 125000002252 acyl group Chemical group 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 125000003342 alkenyl group Chemical group 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- 125000000753 cycloalkyl group Chemical group 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 241000894006 Bacteria Species 0.000 description 4
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 125000002723 alicyclic group Chemical group 0.000 description 3
- 125000006193 alkinyl group Chemical group 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 description 3
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 125000004043 oxo group Chemical group O=* 0.000 description 3
- 229940049954 penicillin Drugs 0.000 description 3
- 125000005493 quinolyl group Chemical group 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- LXFQSRIDYRFTJW-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-N 0.000 description 2
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 125000001271 cephalosporin group Chemical group 0.000 description 2
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 125000005633 phthalidyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 238000004445 quantitative analysis Methods 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- QGOUKZPSCTVYLX-UHFFFAOYSA-N 5-chloro-1h-1,2,4-triazole Chemical compound ClC1=NC=NN1 QGOUKZPSCTVYLX-UHFFFAOYSA-N 0.000 description 1
- PZKFSRWSQOQYNR-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazole Chemical compound CC1=NC=NN1 PZKFSRWSQOQYNR-UHFFFAOYSA-N 0.000 description 1
- QBQOOUMQVKQIQH-UHFFFAOYSA-N 5-methylsulfanyl-1h-1,2,4-triazole Chemical compound CSC=1N=CNN=1 QBQOOUMQVKQIQH-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000238366 Cephalopoda Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- MJGJPHUUDJCUEC-UHFFFAOYSA-N OC(=O)C[Ca] Chemical compound OC(=O)C[Ca] MJGJPHUUDJCUEC-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 206010043275 Teratogenicity Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 231100000215 acute (single dose) toxicity testing Toxicity 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 238000011047 acute toxicity test Methods 0.000 description 1
- 125000005354 acylalkyl group Chemical group 0.000 description 1
- 125000005035 acylthio group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005206 alkoxycarbonyloxymethyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003275 alpha amino acid group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000005200 aryloxy carbonyloxy group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- PSRFOBQQWDICLU-UHFFFAOYSA-N benzene-1,2,4-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(S(O)(=O)=O)C(S(O)(=O)=O)=C1 PSRFOBQQWDICLU-UHFFFAOYSA-N 0.000 description 1
- RBUBFLVZIXNHTE-UHFFFAOYSA-N benzene-1,3,5-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 RBUBFLVZIXNHTE-UHFFFAOYSA-N 0.000 description 1
- WRUAHXANJKHFIL-UHFFFAOYSA-N benzene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(S(O)(=O)=O)=C1 WRUAHXANJKHFIL-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000005242 carbamoyl alkyl group Chemical group 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- QABCGOSYZHCPGN-UHFFFAOYSA-N chloro(dimethyl)silicon Chemical compound C[Si](C)Cl QABCGOSYZHCPGN-UHFFFAOYSA-N 0.000 description 1
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol group Chemical group [C@@H]1(CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)[C@H](C)CCCC(C)C HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 1
- 229960000956 coumarin Drugs 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000002888 effect on disease Effects 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- DHZYWCBUDKTLGD-UHFFFAOYSA-N ethyl 1h-1,2,4-triazole-5-carboxylate Chemical compound CCOC(=O)C1=NC=NN1 DHZYWCBUDKTLGD-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000005343 heterocyclic alkyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000004129 indan-1-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])([H])C2([H])* 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- REGWOMUKTJWBAW-UHFFFAOYSA-N n-(1h-1,2,4-triazol-5-yl)acetamide Chemical compound CC(=O)NC1=NC=NN1 REGWOMUKTJWBAW-UHFFFAOYSA-N 0.000 description 1
- INMHJULHWVWVFN-UHFFFAOYSA-N naphthalene-1,3,5-trisulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(S(=O)(=O)O)=CC(S(O)(=O)=O)=C21 INMHJULHWVWVFN-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- FITZJYAVATZPMJ-UHFFFAOYSA-N naphthalene-2,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(S(=O)(=O)O)=CC=C21 FITZJYAVATZPMJ-UHFFFAOYSA-N 0.000 description 1
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 210000004197 pelvis Anatomy 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NIXKBAZVOQAHGC-UHFFFAOYSA-N phenylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1 NIXKBAZVOQAHGC-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000001932 seasonal effect Effects 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Chemical group 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 231100000211 teratogenicity Toxicity 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/38—Methylene radicals, substituted by nitrogen atoms; Lactams thereof with the 2-carboxyl group; Methylene radicals substituted by nitrogen-containing hetero rings attached by the ring nitrogen atom; Quaternary compounds thereof
- C07D501/46—Methylene radicals, substituted by nitrogen atoms; Lactams thereof with the 2-carboxyl group; Methylene radicals substituted by nitrogen-containing hetero rings attached by the ring nitrogen atom; Quaternary compounds thereof with the 7-amino radical acylated by carboxylic acids containing hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
- A61K31/542—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame ortho- or peri-condensed with heterocyclic ring systems
- A61K31/545—Compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins, cefaclor, or cephalexine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/38—Methylene radicals, substituted by nitrogen atoms; Lactams thereof with the 2-carboxyl group; Methylene radicals substituted by nitrogen-containing hetero rings attached by the ring nitrogen atom; Quaternary compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/48—Methylene radicals, substituted by hetero rings
- C07D501/56—Methylene radicals, substituted by hetero rings with the 7-amino radical acylated by carboxylic acids containing hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/57—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with a further substituent in position 7, e.g. cephamycines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP55132253A JPS5758689A (en) | 1980-09-25 | 1980-09-25 | Novel preparation of 7-substituted or unsubstituted amino-3-substituted methylcephem carboxylic acids |
JP55158184A JPS5782393A (en) | 1980-11-12 | 1980-11-12 | 7-amino-3-(2-(1,2,3,4-tetrazolyl)methyl)cephem-4-carboxylic acid |
JP55175263A JPS6052755B2 (ja) | 1980-12-13 | 1980-12-13 | 新規セファロスポリン類 |
Publications (2)
Publication Number | Publication Date |
---|---|
SE8105658L SE8105658L (sv) | 1982-05-05 |
SE453090B true SE453090B (sv) | 1988-01-11 |
Family
ID=27316463
Family Applications (5)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
SE8105658A SE453090B (sv) | 1980-09-25 | 1981-09-24 | Nya cefalosporinderivat, forfarande for framstellning derav samt farmaceutisk komposition derav |
SE8600195A SE468477B (sv) | 1980-09-25 | 1986-01-16 | Foerfarande foer framstaellning av 7-amino-3-substituerad cefalosporinsyra |
SE8600192A SE468478B (sv) | 1980-09-25 | 1986-01-16 | Nya cefalosporinderivat vilka aer anvaendbara som intermediat |
SE8600194A SE468476B (sv) | 1980-09-25 | 1986-01-16 | Nya 7-(substituerade eller osubstituerade amino)-3- substituerad metyl- -cefem-4-karboxylsyror |
SE8600193A SE468479B (sv) | 1980-09-25 | 1986-01-16 | Nya cefalosporinderivat vilka aer anvaendbara som intermediat |
Family Applications After (4)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
SE8600195A SE468477B (sv) | 1980-09-25 | 1986-01-16 | Foerfarande foer framstaellning av 7-amino-3-substituerad cefalosporinsyra |
SE8600192A SE468478B (sv) | 1980-09-25 | 1986-01-16 | Nya cefalosporinderivat vilka aer anvaendbara som intermediat |
SE8600194A SE468476B (sv) | 1980-09-25 | 1986-01-16 | Nya 7-(substituerade eller osubstituerade amino)-3- substituerad metyl- -cefem-4-karboxylsyror |
SE8600193A SE468479B (sv) | 1980-09-25 | 1986-01-16 | Nya cefalosporinderivat vilka aer anvaendbara som intermediat |
Country Status (27)
Country | Link |
---|---|
US (4) | US4489072A (forum.php) |
KR (1) | KR860000932B1 (forum.php) |
AR (1) | AR240645A1 (forum.php) |
AT (4) | AT375082B (forum.php) |
AU (3) | AU550330B2 (forum.php) |
CA (2) | CA1204735A (forum.php) |
CH (4) | CH652129A5 (forum.php) |
DD (2) | DD208351A5 (forum.php) |
DE (5) | DE3152935C2 (forum.php) |
DK (1) | DK163877C (forum.php) |
EG (1) | EG17373A (forum.php) |
ES (4) | ES505760A0 (forum.php) |
FI (2) | FI75575C (forum.php) |
FR (2) | FR2509310B1 (forum.php) |
GB (3) | GB2089339B (forum.php) |
HU (1) | HU185850B (forum.php) |
IN (4) | IN155375B (forum.php) |
IT (1) | IT1172201B (forum.php) |
LU (1) | LU83650A1 (forum.php) |
MX (1) | MX155025A (forum.php) |
NL (1) | NL8104386A (forum.php) |
NO (1) | NO161117C (forum.php) |
NZ (1) | NZ198350A (forum.php) |
PH (5) | PH18072A (forum.php) |
PT (1) | PT73727B (forum.php) |
RO (4) | RO86824B (forum.php) |
SE (5) | SE453090B (forum.php) |
Families Citing this family (34)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4703046A (en) * | 1978-09-08 | 1987-10-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds and processes for preparation thereof |
NZ198350A (en) * | 1980-09-25 | 1985-02-28 | Toyama Chemical Co Ltd | Cephalosporins and intermediates;pharmaceutical compositions |
EP0061234A3 (en) * | 1981-03-05 | 1983-11-16 | Beecham Group Plc | Cephalosporin derivatives, process for their preparation and pharmaceutical preparations containing them |
EP0081971A3 (en) * | 1981-12-08 | 1984-09-26 | Tanabe Seiyaku Co., Ltd. | Novel cephalosporin compound and process for preparing the same |
FI75827C (fi) * | 1982-11-17 | 1988-08-08 | Toyama Chemical Co Ltd | Foerfarande foer framstaellning av ett nytt terapeutiskt anvaendbart 7-tiazolyl-3-pyrazinylmetylcefalosporin samt en i foerfarandet anvaendbar mellanprodukt. |
US4618606A (en) * | 1982-11-17 | 1986-10-21 | Toyama Chemical Co., Ltd. | Antibiotic 7-(thiazolyl)-3-(pyrazinylmethyl) or (pyridazinylmethyl) cephalosporins |
JPS6064986A (ja) * | 1983-09-20 | 1985-04-13 | Toyama Chem Co Ltd | セファロスポリン類の製造法 |
JPS60190783A (ja) * | 1983-12-21 | 1985-09-28 | Sumitomo Seiyaku Kk | セフエム系化合物 |
GB8406231D0 (en) * | 1984-03-09 | 1984-04-11 | Fujisawa Pharmaceutical Co | Cephem compounds |
GB2161476B (en) * | 1984-05-25 | 1988-01-27 | Toyama Chemical Co Ltd | 2-aminothiazolyl-2-methoxyimino acetamides and their use in preparing cephalosporins |
AT397086B (de) * | 1984-05-25 | 1994-01-25 | Toyama Chemical Co Ltd | Verfahren zur herstellung von neuen 2-(2-aminothiazol-4-4yl)-2-(syn)-alkoxyimino- acetamiden |
FI851934L (fi) * | 1984-05-30 | 1985-12-01 | Ici Plc | Kefalosporinderivat. |
DE3539901A1 (de) * | 1985-11-11 | 1987-05-14 | Hoechst Ag | Cephalosporinderivate und verfahren zu ihrer herstellung |
JPH064643B2 (ja) * | 1985-12-20 | 1994-01-19 | ファイザー製薬株式会社 | セフアロスポリン化合物 |
US4692517A (en) * | 1986-03-20 | 1987-09-08 | American Home Products Corporation | C-3' acylaminooxy-7-[(2-aminothiazol-4-yl)-α-(substituted-oximino)acetyl]cephalosporin derivatives |
EP0265185A3 (en) * | 1986-10-21 | 1990-03-28 | Beecham Group Plc | Cephalosporins, processes for their preparation and pharmaceutical compositions containing them |
ZA877987B (en) * | 1986-11-12 | 1988-08-31 | Ici Pharma | Antibiotic compounds |
DE3750673T2 (de) * | 1986-11-21 | 1995-03-16 | Ici Pharma | Cephalosporine, Verfahren zu ihrer Herstellung und pharmazeutische Präparate. |
EP0269298B1 (en) * | 1986-11-21 | 1994-10-19 | Ici Pharma | Cephalosporins, process for their preparation and pharmaceutical compositions |
US4870168A (en) * | 1987-02-26 | 1989-09-26 | Bristol-Myers Company | 3-Unsaturated alkyl cephems from 3-triflyl cephems |
GB8816519D0 (en) * | 1987-07-23 | 1988-08-17 | Ici Plc | Antibiotic compounds |
US5232918A (en) * | 1987-07-23 | 1993-08-03 | Imperial Chemical Industries Plc | Cephalosporin derivatives |
GB8811056D0 (en) * | 1988-05-10 | 1988-06-15 | Ici Plc | Antibiotic compounds |
JPH0699443B2 (ja) * | 1989-09-29 | 1994-12-07 | ファイザー製薬株式会社 | セファロスポリン化合物 |
US6800756B2 (en) * | 2002-05-03 | 2004-10-05 | Orchid Chemicals And Pharmaceuticals, Ltd. | Method for the preparation of ceftiofur sodium and its intermediates |
DE602004028111D1 (de) * | 2003-04-16 | 2010-08-26 | Sandoz Ag | Verfahren zur herstellung von cefepim |
US7847093B2 (en) * | 2003-04-16 | 2010-12-07 | Sandoz Ag | Processes for the preparations of cefepime |
WO2005097758A1 (en) * | 2004-03-26 | 2005-10-20 | Amphora Discovery Corporation | Certain triazole-based compounds, compositions, and uses thereof |
US8198434B2 (en) * | 2008-05-07 | 2012-06-12 | Idexx Laboratories, Inc. | Process for preparing cefsulodin sodium |
CA2828114A1 (en) * | 2010-02-26 | 2011-09-01 | Gary Igor DMITRIENKO | Cephalosporin derivatives useful as .beta.-lactamase inhibitors and compositions and methods of use thereof |
CN102351886B (zh) * | 2011-09-07 | 2013-10-16 | 山东罗欣药业股份有限公司 | 头孢特仑新戊酯晶体、其制备方法及含有该晶体的组合物片剂 |
EP3022199A1 (en) | 2013-07-17 | 2016-05-25 | Otsuka Pharmaceutical Co., Ltd. | Cyanotriazole compounds |
CN106046026B (zh) * | 2016-06-30 | 2018-07-06 | 济南康和医药科技有限公司 | 一种头孢特仑新戊酯的制备方法 |
CN112645842B (zh) * | 2020-12-25 | 2022-08-19 | 复旦大学 | 一种氰乙酸叔丁酯的连续流制备方法 |
Family Cites Families (40)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB912541A (en) * | 1958-03-17 | 1962-12-12 | Nat Res Dev | Cephalosporin c compounds |
DE1795484U (de) | 1959-04-21 | 1959-09-10 | Richard Langer | Quertraeger fuer laengsdraehte zum abstuetzen von pflanzen, insbesondere weinreben. |
GB1032641A (en) | 1962-02-16 | 1966-06-15 | Edward Penley Abraham | Cephalosporins |
GB1057883A (en) * | 1962-07-11 | 1967-02-08 | Glaxo Lab Ltd | Improvements in or relating to antibiotics |
US3226384A (en) | 1963-01-25 | 1965-12-28 | Nat Res Dev | Cephalosporin ca derivatives |
BE634644A (forum.php) * | 1963-07-10 | |||
GB1211694A (en) * | 1966-12-15 | 1970-11-11 | Glaxo Lab Ltd | Derivatives of 7-aminocephalosporanic acid |
US3821206A (en) * | 1966-12-15 | 1974-06-28 | Glaxo Lab Ltd | Cephalosporins having a polyazole substituent |
GB1360860A (en) * | 1970-07-08 | 1974-07-24 | Ciba Geigy Ag | Cepham compounds process for their manufacture and compositions containing them |
US3932465A (en) * | 1970-07-08 | 1976-01-13 | Ciba-Geigy Corporation | 3-R-methyl-7-amino-ceph-em-4-carboxylic acid compounds |
GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
US4343937A (en) * | 1971-06-02 | 1982-08-10 | Merck & Co., Inc. | 3-Substituted-7-methoxy-7-amino-3-cephem-4-carboxylic acids |
SU589918A3 (ru) * | 1971-07-14 | 1978-01-25 | Мерк Энд Ко Инк (Фирма) | Способ получени сложного эфира 3-замещенной метил-7-ациломидо-7-метокси-2-цефем -4- карбоноаой кислоты |
JPS5653557B2 (forum.php) * | 1973-10-15 | 1981-12-19 | ||
CH605997A5 (forum.php) * | 1974-08-30 | 1978-10-13 | Ciba Geigy Ag | |
DK43476A (da) * | 1975-02-04 | 1976-08-05 | Fujisawa Pharmaceutical Co | Fremgangsmade til fremstilling af cephemcarboxylsyrer |
GB1547165A (en) * | 1975-08-15 | 1979-06-06 | Beecham Group Ltd | 3-carbamoylbenzyl and 3-(carbamoylpyridylmethyl)-cephems |
GB1575803A (en) * | 1976-03-09 | 1980-10-01 | Fujisawa Pharmaceutical Co | 3,7 disubstituted 3 cephem 4 carboxylic acid compounds andprocesses for the preparation thereof |
US4165430A (en) * | 1976-03-19 | 1979-08-21 | Glaxo Laboratories Limited | Cephalosporins having a 7-carboxy substituted α-etherified oximinoarylacetamido) group |
JPS5946237B2 (ja) * | 1976-04-02 | 1984-11-10 | 武田薬品工業株式会社 | セフアロスポリン誘導体およびその製造法 |
GR63088B (en) * | 1976-04-14 | 1979-08-09 | Takeda Chemical Industries Ltd | Preparation process of novel cephalosporins |
GB1565941A (en) | 1977-02-08 | 1980-04-23 | Toyama Chemical Co Ltd | Process for producing 7-(substituted)amino-3-substituted thiomethyl cephem carboxylic acids |
ES467601A1 (es) * | 1977-03-12 | 1979-06-16 | Hoechst Ag | Procedimiento para la preparacion de derivados de cefem. |
DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
US4148997A (en) * | 1977-11-07 | 1979-04-10 | Yeda Research And Development Co., Ltd. | 7-[Sulfomethyl)phenyl]acetamidocephalosporin derivatives |
AR229883A1 (es) * | 1978-05-26 | 1983-12-30 | Glaxo Group Ltd | Procedimiento para la preparacion de antibiotico(6r,7r)-7-((z)-2-(2-aminotiazol-4-il)-2-(2-carboxiprop-2-oxiimino)-acetamido)-3-(1-piridinometil)-cef-3-em-4-carboxilato |
DE2822861A1 (de) * | 1978-05-26 | 1979-11-29 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
JPS6027677B2 (ja) | 1978-07-06 | 1985-06-29 | 富山化学工業株式会社 | 7−置換又は非置換アミノ−3−置換チオメチルセフエムカルボン酸類の新規製造法 |
CH644868A5 (de) * | 1978-10-27 | 1984-08-31 | Glaxo Group Ltd | In 3- und 7-stellung substituierte cephemcarbonsaeure(ester). |
FI793566A7 (fi) * | 1978-11-15 | 1981-01-01 | Glaxo Group Ltd | Kefalosporiiniantibiootteja. |
CA1144156A (en) * | 1979-02-23 | 1983-04-05 | Barry E. Ayres | Cephalosporin antibiotics |
JPS55139387A (en) | 1979-04-19 | 1980-10-31 | Yamanouchi Pharmaceut Co Ltd | Novel synthetic method of 7-amino-3-heterocyclic thiomethyl-delta3-carboxylic acids |
JPS55153790A (en) | 1979-05-17 | 1980-11-29 | Yamanouchi Pharmaceut Co Ltd | Preparation of 7-amino-3-heterocyclic thiomethyl-delta3- cephem-4-carboxylic acid |
FR2461713A1 (fr) * | 1979-07-19 | 1981-02-06 | Roussel Uclaf | Nouvelles alcoyloximes substituees derivees de l'acide 7-(2-amino 4-thiazolyl) acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
NZ198350A (en) * | 1980-09-25 | 1985-02-28 | Toyama Chemical Co Ltd | Cephalosporins and intermediates;pharmaceutical compositions |
EP0061234A3 (en) * | 1981-03-05 | 1983-11-16 | Beecham Group Plc | Cephalosporin derivatives, process for their preparation and pharmaceutical preparations containing them |
EP0135683B1 (en) * | 1981-09-10 | 1987-07-22 | Takeda Chemical Industries, Ltd. | Method for production of cephalosporin compounds |
JPS6064986A (ja) * | 1983-09-20 | 1985-04-13 | Toyama Chem Co Ltd | セファロスポリン類の製造法 |
GB2161476B (en) * | 1984-05-25 | 1988-01-27 | Toyama Chemical Co Ltd | 2-aminothiazolyl-2-methoxyimino acetamides and their use in preparing cephalosporins |
CA1293719C (en) * | 1986-09-22 | 1991-12-31 | Takao Takaya | Cephem compounds and processes for preparation thereof |
-
1981
- 1981-09-14 NZ NZ198350A patent/NZ198350A/en unknown
- 1981-09-16 GB GB8128011A patent/GB2089339B/en not_active Expired
- 1981-09-16 PH PH26215A patent/PH18072A/en unknown
- 1981-09-16 CA CA000386066A patent/CA1204735A/en not_active Expired
- 1981-09-17 AU AU75438/81A patent/AU550330B2/en not_active Expired
- 1981-09-19 IN IN1045/CAL/81A patent/IN155375B/en unknown
- 1981-09-23 IT IT49348/81A patent/IT1172201B/it active
- 1981-09-23 DE DE3152935A patent/DE3152935C2/de not_active Expired - Lifetime
- 1981-09-23 DE DE3152934A patent/DE3152934C2/de not_active Expired - Lifetime
- 1981-09-23 US US06/304,912 patent/US4489072A/en not_active Expired - Lifetime
- 1981-09-23 DE DE3152931A patent/DE3152931C2/de not_active Expired
- 1981-09-23 NL NL8104386A patent/NL8104386A/xx not_active Application Discontinuation
- 1981-09-23 DE DE19813137854 patent/DE3137854A1/de active Granted
- 1981-09-23 DE DE3152932A patent/DE3152932C2/de not_active Expired - Lifetime
- 1981-09-24 DK DK421881A patent/DK163877C/da active
- 1981-09-24 ES ES505760A patent/ES505760A0/es active Granted
- 1981-09-24 PT PT73727A patent/PT73727B/pt unknown
- 1981-09-24 LU LU83650A patent/LU83650A1/fr unknown
- 1981-09-24 FI FI812980A patent/FI75575C/fi not_active IP Right Cessation
- 1981-09-24 AT AT0410981A patent/AT375082B/de not_active IP Right Cessation
- 1981-09-24 HU HU812759A patent/HU185850B/hu unknown
- 1981-09-24 MX MX7609A patent/MX155025A/es unknown
- 1981-09-24 NO NO813252A patent/NO161117C/no unknown
- 1981-09-24 SE SE8105658A patent/SE453090B/sv not_active IP Right Cessation
- 1981-09-25 CH CH6202/81A patent/CH652129A5/de not_active IP Right Cessation
- 1981-09-25 CH CH4519/84A patent/CH651837A5/de not_active IP Right Cessation
- 1981-09-25 RO RO112112A patent/RO86824B/ro unknown
- 1981-09-25 RO RO112113A patent/RO86825B/ro unknown
- 1981-09-25 CH CH4520/84A patent/CH652130A5/de not_active IP Right Cessation
- 1981-09-25 FR FR8118156A patent/FR2509310B1/fr not_active Expired
- 1981-09-25 DD DD81247292A patent/DD208351A5/de unknown
- 1981-09-25 CH CH4521/84A patent/CH652128A5/de not_active IP Right Cessation
- 1981-09-25 DD DD81233599A patent/DD202436A5/de unknown
- 1981-09-25 RO RO81105405A patent/RO82689A/ro unknown
- 1981-09-25 RO RO112111A patent/RO86823B/ro unknown
- 1981-09-26 EG EG543/81A patent/EG17373A/xx active
-
1982
- 1982-08-02 ES ES514669A patent/ES8306155A1/es not_active Expired
- 1982-08-02 ES ES514671A patent/ES514671A0/es active Granted
- 1982-08-02 ES ES514670A patent/ES8306156A1/es not_active Expired
- 1982-09-22 FR FR8215992A patent/FR2511377B1/fr not_active Expired
-
1983
- 1983-01-07 AR AR29180883A patent/AR240645A1/es active
- 1983-02-18 AT AT0055583A patent/AT378962B/de not_active IP Right Cessation
- 1983-02-18 AT AT0055683A patent/AT378193B/de not_active IP Right Cessation
- 1983-02-18 AT AT0055483A patent/AT378961B/de not_active IP Right Cessation
- 1983-06-17 PH PH29076A patent/PH19147A/en unknown
- 1983-06-17 PH PH29077A patent/PH20221A/en unknown
- 1983-06-17 PH PH29078A patent/PH18484A/en unknown
- 1983-06-17 PH PH29075A patent/PH19251A/en unknown
- 1983-09-01 CA CA000435930A patent/CA1200541A/en not_active Expired
-
1984
- 1984-01-27 GB GB08402250A patent/GB2136420B/en not_active Expired
- 1984-01-27 GB GB08402249A patent/GB2135304B/en not_active Expired
- 1984-08-29 IN IN603/CAL/84A patent/IN159126B/en unknown
- 1984-08-29 IN IN601/CAL/84A patent/IN158589B/en unknown
- 1984-08-29 IN IN602/CAL/84A patent/IN158590B/en unknown
- 1984-09-26 US US06/654,681 patent/US4673738A/en not_active Expired - Lifetime
-
1985
- 1985-11-13 AU AU49862/85A patent/AU558649B2/en not_active Expired
- 1985-11-13 AU AU49861/85A patent/AU568033B2/en not_active Expired
-
1986
- 1986-01-16 SE SE8600195A patent/SE468477B/sv not_active IP Right Cessation
- 1986-01-16 SE SE8600192A patent/SE468478B/sv not_active IP Right Cessation
- 1986-01-16 SE SE8600194A patent/SE468476B/sv not_active IP Right Cessation
- 1986-01-16 SE SE8600193A patent/SE468479B/sv not_active IP Right Cessation
- 1986-03-29 KR KR1019860002383A patent/KR860000932B1/ko not_active Expired
-
1987
- 1987-01-15 FI FI870153A patent/FI80041C/fi not_active IP Right Cessation
- 1987-03-06 US US07/022,433 patent/US4879381A/en not_active Expired - Lifetime
-
1991
- 1991-05-24 US US07/707,221 patent/US5144027A/en not_active Expired - Fee Related
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
SE453090B (sv) | Nya cefalosporinderivat, forfarande for framstellning derav samt farmaceutisk komposition derav | |
JPS6354689B2 (forum.php) | ||
DE2304226A1 (de) | Neue penicillin- und cephalosporinverbindungen | |
US4165430A (en) | Cephalosporins having a 7-carboxy substituted α-etherified oximinoarylacetamido) group | |
NO744621L (forum.php) | ||
CH662120A5 (de) | Verfahren zur herstellung von cephalosporinen. | |
US4321265A (en) | 7α-Methoxycephalosporins | |
US4385177A (en) | Cephalosporins having a carbamoylalkoxyiminoarylacetamido group at 7-position | |
US4144392A (en) | Cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyimino-arylacetamido group and at position-3 the residue of a sulphur nucleophile | |
JPS6052755B2 (ja) | 新規セファロスポリン類 | |
US4263292A (en) | 7α-methoxycephalosporins and pharmaceutical composition comprising the same | |
EP0075169B1 (de) | Beta-Lactam Antibiotica, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
JPH03163069A (ja) | セファロスポリン抗生物質 | |
US4162360A (en) | 3-Carbamoyloxymethyl-7-substituted oximino acetamido cephalosporanic acid derivatives | |
DE3341591C2 (forum.php) | ||
JPH0530836B2 (forum.php) | ||
US4705784A (en) | Cephem compounds | |
KR860000487B1 (ko) | 세팔로스포린의 제조방법 | |
JPH0323552B2 (forum.php) | ||
JPH0121152B2 (forum.php) | ||
CA1097613A (en) | Cephalosporin ethers | |
JPS6053036B2 (ja) | 新規セファロスポリン類 | |
CA1136615A (en) | 7.alpha.-METHOXYCEPHALOSPORINS AND PROCESS FOR PRODUCING THE SAME | |
KR830001593B1 (ko) | 세팔로스포린 항생제의 제조방법 | |
JPH0454676B2 (forum.php) |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
NAL | Patent in force |
Ref document number: 8105658-2 Format of ref document f/p: F |
|
NUG | Patent has lapsed |
Ref document number: 8105658-2 Format of ref document f/p: F |