JP4011109B2 - アニリン誘導体 - Google Patents
アニリン誘導体 Download PDFInfo
- Publication number
- JP4011109B2 JP4011109B2 JP51581696A JP51581696A JP4011109B2 JP 4011109 B2 JP4011109 B2 JP 4011109B2 JP 51581696 A JP51581696 A JP 51581696A JP 51581696 A JP51581696 A JP 51581696A JP 4011109 B2 JP4011109 B2 JP 4011109B2
- Authority
- JP
- Japan
- Prior art keywords
- alkylamino
- amino
- alkoxy
- alkyl
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 title claims abstract description 22
- 150000001875 compounds Chemical class 0.000 claims abstract description 93
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 22
- 229910052717 sulfur Chemical group 0.000 claims abstract description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 15
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims abstract description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 6
- 239000011593 sulfur Chemical group 0.000 claims abstract description 6
- -1 hydroxy, amino, hydroxyamino, ureido Chemical group 0.000 claims description 323
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 58
- 150000003839 salts Chemical class 0.000 claims description 58
- 150000001448 anilines Chemical class 0.000 claims description 50
- 125000001424 substituent group Chemical group 0.000 claims description 45
- 229910005965 SO 2 Inorganic materials 0.000 claims description 36
- 125000001153 fluoro group Chemical group F* 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 18
- 230000001028 anti-proliverative effect Effects 0.000 claims description 17
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 17
- 125000005843 halogen group Chemical group 0.000 claims description 17
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- 241001465754 Metazoa Species 0.000 claims description 14
- 150000002367 halogens Chemical class 0.000 claims description 14
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 11
- 125000001072 heteroaryl group Chemical group 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 9
- 125000004076 pyridyl group Chemical group 0.000 claims description 9
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 claims description 9
- 125000001544 thienyl group Chemical group 0.000 claims description 9
- 125000001246 bromo group Chemical group Br* 0.000 claims description 8
- 125000002883 imidazolyl group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 7
- 125000002971 oxazolyl group Chemical group 0.000 claims description 7
- 125000000335 thiazolyl group Chemical group 0.000 claims description 7
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 6
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000005605 benzo group Chemical group 0.000 claims description 5
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 5
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 4
- PPQDYOBQQWPTIS-UHFFFAOYSA-N 2-(diethylamino)acetamide Chemical compound CCN(CC)CC(N)=O PPQDYOBQQWPTIS-UHFFFAOYSA-N 0.000 claims description 4
- WKJOQYHMXRVQDK-UHFFFAOYSA-N 2-(dimethylamino)acetamide Chemical compound CN(C)CC(N)=O WKJOQYHMXRVQDK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 claims description 4
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 claims description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- UIWVQFSAXYWENY-UHFFFAOYSA-N n'-ethylacetohydrazide Chemical compound CCNNC(C)=O UIWVQFSAXYWENY-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- CEEFKQWFTCGJJQ-UHFFFAOYSA-N n-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C(=C1)F)=CC=C1OCC1=CC=CC=N1 CEEFKQWFTCGJJQ-UHFFFAOYSA-N 0.000 claims description 2
- WZVNALQQCJMGBB-UHFFFAOYSA-N n-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 WZVNALQQCJMGBB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 8
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 5
- 150000002431 hydrogen Chemical group 0.000 claims 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 4
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 4
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims 1
- UJHRUAXEWKLTTK-UHFFFAOYSA-N 7-chloro-n-(4-phenylmethoxyphenyl)quinazolin-4-amine Chemical compound N=1C=NC2=CC(Cl)=CC=C2C=1NC(C=C1)=CC=C1OCC1=CC=CC=C1 UJHRUAXEWKLTTK-UHFFFAOYSA-N 0.000 claims 1
- 125000002431 aminoalkoxy group Chemical group 0.000 claims 1
- 239000004020 conductor Substances 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 110
- 206010028980 Neoplasm Diseases 0.000 abstract description 28
- 201000011510 cancer Diseases 0.000 abstract description 13
- 238000011282 treatment Methods 0.000 abstract description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 9
- 201000010099 disease Diseases 0.000 abstract description 7
- 230000002062 proliferating effect Effects 0.000 abstract description 4
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 abstract description 2
- 239000005483 tyrosine kinase inhibitor Substances 0.000 abstract description 2
- 239000000203 mixture Substances 0.000 description 256
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 156
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 144
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 104
- 239000007858 starting material Substances 0.000 description 103
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 85
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 79
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 78
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 65
- 239000000463 material Substances 0.000 description 61
- 239000000047 product Substances 0.000 description 55
- 238000010992 reflux Methods 0.000 description 52
- 239000000243 solution Substances 0.000 description 52
- 238000012360 testing method Methods 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- 238000002360 preparation method Methods 0.000 description 47
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- 238000000921 elemental analysis Methods 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 38
- 125000003545 alkoxy group Chemical group 0.000 description 37
- 239000012074 organic phase Substances 0.000 description 37
- 238000004440 column chromatography Methods 0.000 description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 32
- 125000003282 alkyl amino group Chemical group 0.000 description 32
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 32
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 32
- 239000003480 eluent Substances 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 25
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 23
- 238000006722 reduction reaction Methods 0.000 description 23
- 125000005236 alkanoylamino group Chemical group 0.000 description 22
- 230000008018 melting Effects 0.000 description 22
- 238000002844 melting Methods 0.000 description 22
- 230000009467 reduction Effects 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- 210000004027 cell Anatomy 0.000 description 20
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- 229910052783 alkali metal Inorganic materials 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- DPHCXXYPSYMICK-UHFFFAOYSA-N 2-chloro-1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(Cl)=C1 DPHCXXYPSYMICK-UHFFFAOYSA-N 0.000 description 16
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 16
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 16
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 16
- 241000894007 species Species 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 15
- 239000012258 stirred mixture Substances 0.000 description 15
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 14
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 14
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 14
- 101800003838 Epidermal growth factor Proteins 0.000 description 13
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 13
- 229940116977 epidermal growth factor Drugs 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- 102400001368 Epidermal growth factor Human genes 0.000 description 12
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 230000002401 inhibitory effect Effects 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 11
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 230000004663 cell proliferation Effects 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 239000012442 inert solvent Substances 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000012267 brine Substances 0.000 description 9
- 239000003701 inert diluent Substances 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 9
- CJHYXQCMUDJUJX-UHFFFAOYSA-N 3-methyl-4-(pyridin-2-ylmethoxy)aniline Chemical compound CC1=CC(N)=CC=C1OCC1=CC=CC=N1 CJHYXQCMUDJUJX-UHFFFAOYSA-N 0.000 description 8
- PLTABDMBEVNMMV-UHFFFAOYSA-N 4-chloro-6,7-dimethoxyquinazoline;hydrochloride Chemical compound Cl.C1=NC(Cl)=C2C=C(OC)C(OC)=CC2=N1 PLTABDMBEVNMMV-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical class [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 8
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 8
- LPWVIVSQYVJOLX-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-phenylmethanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 LPWVIVSQYVJOLX-UHFFFAOYSA-N 0.000 description 7
- XUCYJGMIICONES-UHFFFAOYSA-N 1-fluoro-2-methyl-4-nitrobenzene Chemical compound CC1=CC([N+]([O-])=O)=CC=C1F XUCYJGMIICONES-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- JGXRAVBGXIZHEA-UHFFFAOYSA-N 2-chloro-n-methoxy-n-methyl-4-nitrobenzamide Chemical compound CON(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1Cl JGXRAVBGXIZHEA-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 102000001301 EGF receptor Human genes 0.000 description 6
- 108060006698 EGF receptor Proteins 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 239000002480 mineral oil Substances 0.000 description 6
- 235000010446 mineral oil Nutrition 0.000 description 6
- 230000035755 proliferation Effects 0.000 description 6
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- FCTANEQYJHSXNO-UHFFFAOYSA-N (4-chloroquinazolin-6-yl) acetate;hydrochloride Chemical compound Cl.N1=CN=C(Cl)C2=CC(OC(=O)C)=CC=C21 FCTANEQYJHSXNO-UHFFFAOYSA-N 0.000 description 5
- KTHNITVDTYAHFF-UHFFFAOYSA-N 2-chloro-4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C(Cl)=C1 KTHNITVDTYAHFF-UHFFFAOYSA-N 0.000 description 5
- AYLWKWYGVURTMP-UHFFFAOYSA-N 4-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazoline-4,6-diamine Chemical compound CC1=CC(NC=2C3=CC(N)=CC=C3N=CN=2)=CC=C1OCC1=CC=CC=N1 AYLWKWYGVURTMP-UHFFFAOYSA-N 0.000 description 5
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 5
- 208000026310 Breast neoplasm Diseases 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N acetaldehyde dimethyl acetal Natural products COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 239000012298 atmosphere Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 229940088598 enzyme Drugs 0.000 description 5
- 239000012894 fetal calf serum Substances 0.000 description 5
- 239000003102 growth factor Substances 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 150000003246 quinazolines Chemical class 0.000 description 5
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 4
- VEKOZCQMIHXUDA-UHFFFAOYSA-N 3-chloro-4-(1-methylimidazol-2-yl)sulfanylaniline Chemical compound CN1C=CN=C1SC1=CC=C(N)C=C1Cl VEKOZCQMIHXUDA-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- WOVKYSAHUYNSMH-RRKCRQDMSA-N 5-bromodeoxyuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(Br)=C1 WOVKYSAHUYNSMH-RRKCRQDMSA-N 0.000 description 4
- 206010006187 Breast cancer Diseases 0.000 description 4
- 206010009944 Colon cancer Diseases 0.000 description 4
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 4
- 206010033128 Ovarian cancer Diseases 0.000 description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 201000004681 Psoriasis Diseases 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 102000006747 Transforming Growth Factor alpha Human genes 0.000 description 4
- 101800004564 Transforming growth factor alpha Proteins 0.000 description 4
- 229920004890 Triton X-100 Polymers 0.000 description 4
- 239000013504 Triton X-100 Substances 0.000 description 4
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 230000001093 anti-cancer Effects 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 208000029742 colonic neoplasm Diseases 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- ZHTLPANJEJOVTQ-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(1,3-thiazol-5-yl)methanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CN=CS1 ZHTLPANJEJOVTQ-UHFFFAOYSA-N 0.000 description 3
- CRBMYGLGJDLRAG-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-pyridin-2-ylmethanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=CC=N1 CRBMYGLGJDLRAG-UHFFFAOYSA-N 0.000 description 3
- SDLKYGFWIOTIHR-UHFFFAOYSA-N (4-chloro-6-methoxyquinazolin-7-yl) acetate Chemical compound N1=CN=C2C=C(OC(C)=O)C(OC)=CC2=C1Cl SDLKYGFWIOTIHR-UHFFFAOYSA-N 0.000 description 3
- DYOZNCVZPFIXLU-UHFFFAOYSA-N 1,1,2-trimethoxyethane Chemical compound COCC(OC)OC DYOZNCVZPFIXLU-UHFFFAOYSA-N 0.000 description 3
- LQKRZFVMHBKKNN-UHFFFAOYSA-N 2,4-dimethoxyquinazoline;hydrochloride Chemical compound Cl.C1=CC=CC2=NC(OC)=NC(OC)=C21 LQKRZFVMHBKKNN-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- CBBFWSMELCDMPZ-UHFFFAOYSA-N 2-(methylamino)acetamide Chemical compound CNCC(N)=O CBBFWSMELCDMPZ-UHFFFAOYSA-N 0.000 description 3
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 3
- RREFOYJPTFBZSX-UHFFFAOYSA-N 2-fluoro-4-(pyridin-2-ylmethoxy)aniline Chemical compound C1=C(F)C(N)=CC=C1OCC1=CC=CC=N1 RREFOYJPTFBZSX-UHFFFAOYSA-N 0.000 description 3
- KFJFBKCMYYAWHI-UHFFFAOYSA-N 3-chloro-4-phenoxyaniline Chemical compound ClC1=CC(N)=CC=C1OC1=CC=CC=C1 KFJFBKCMYYAWHI-UHFFFAOYSA-N 0.000 description 3
- CKRNYBQUMRCICU-UHFFFAOYSA-N 3-chloro-4-phenylsulfanylaniline Chemical compound ClC1=CC(N)=CC=C1SC1=CC=CC=C1 CKRNYBQUMRCICU-UHFFFAOYSA-N 0.000 description 3
- FKRQHUCDWCZSBF-UHFFFAOYSA-N 4-(3,3-dimethoxypropyl)morpholine Chemical compound COC(OC)CCN1CCOCC1 FKRQHUCDWCZSBF-UHFFFAOYSA-N 0.000 description 3
- HHILEBOPZIMDOD-UHFFFAOYSA-N 4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenol Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC1=CC=C(O)C(C)=C1 HHILEBOPZIMDOD-UHFFFAOYSA-N 0.000 description 3
- PGIPGIJGCWPBEI-UHFFFAOYSA-N 4-amino-2-chloro-n-phenylbenzamide Chemical compound ClC1=CC(N)=CC=C1C(=O)NC1=CC=CC=C1 PGIPGIJGCWPBEI-UHFFFAOYSA-N 0.000 description 3
- GIYJZSPZGFLFCS-UHFFFAOYSA-N 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline;hydrochloride Chemical compound Cl.C1=NC(Cl)=C2C=C(OCCOC)C(OCCOC)=CC2=N1 GIYJZSPZGFLFCS-UHFFFAOYSA-N 0.000 description 3
- KFKMQYFCQHXZNO-UHFFFAOYSA-N 4-n-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]quinazoline-4,6-diamine Chemical compound C12=CC(N)=CC=C2N=CN=C1NC(C(=C1)F)=CC=C1OCC1=CC=CC=N1 KFKMQYFCQHXZNO-UHFFFAOYSA-N 0.000 description 3
- IOWGWFDLSDBRRB-UHFFFAOYSA-N 6-[3-(dimethylamino)propoxy]-7-methoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C=12C=C(OCCCN(C)C)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 IOWGWFDLSDBRRB-UHFFFAOYSA-N 0.000 description 3
- DMFNJFUESVETPN-UHFFFAOYSA-N 6-methoxy-4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-7-ol Chemical compound N1=CN=C2C=C(O)C(OC)=CC2=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 DMFNJFUESVETPN-UHFFFAOYSA-N 0.000 description 3
- LDZBHFNYAJINRD-UHFFFAOYSA-N 7-methoxy-4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-ol Chemical compound C=12C=C(O)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 LDZBHFNYAJINRD-UHFFFAOYSA-N 0.000 description 3
- QQHGFXGGJHDLSK-UHFFFAOYSA-N 7-methoxy-4-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazoline-4,6-diamine Chemical compound C=12C=C(N)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 QQHGFXGGJHDLSK-UHFFFAOYSA-N 0.000 description 3
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 206010005003 Bladder cancer Diseases 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 241000699660 Mus musculus Species 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 3
- 108091000080 Phosphotransferase Proteins 0.000 description 3
- 208000004403 Prostatic Hyperplasia Diseases 0.000 description 3
- 208000005718 Stomach Neoplasms Diseases 0.000 description 3
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000002246 antineoplastic agent Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 229940125846 compound 25 Drugs 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 206010017758 gastric cancer Diseases 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 210000003494 hepatocyte Anatomy 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000011580 nude mouse model Methods 0.000 description 3
- 231100000590 oncogenic Toxicity 0.000 description 3
- 230000002246 oncogenic effect Effects 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 201000002528 pancreatic cancer Diseases 0.000 description 3
- 208000008443 pancreatic carcinoma Diseases 0.000 description 3
- 102000020233 phosphotransferase Human genes 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 201000011549 stomach cancer Diseases 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- 238000000844 transformation Methods 0.000 description 3
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Substances COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 3
- 201000005112 urinary bladder cancer Diseases 0.000 description 3
- CDQDMLWGTVLQEE-UHFFFAOYSA-N (1-methylimidazol-2-yl)methanol Chemical compound CN1C=CN=C1CO CDQDMLWGTVLQEE-UHFFFAOYSA-N 0.000 description 2
- WXAQVDGXRVRXCI-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-(furan-2-yl)methanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CO1 WXAQVDGXRVRXCI-UHFFFAOYSA-N 0.000 description 2
- CVBBQBQFITWABT-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(1,3-oxazol-2-yl)methanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=NC=CO1 CVBBQBQFITWABT-UHFFFAOYSA-N 0.000 description 2
- HNLDVZLZIOURJW-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(1,3-thiazol-2-yl)methanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=NC=CS1 HNLDVZLZIOURJW-UHFFFAOYSA-N 0.000 description 2
- QZCVIOLKKLVYBW-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(1h-imidazol-2-yl)methanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=NC=CN1 QZCVIOLKKLVYBW-UHFFFAOYSA-N 0.000 description 2
- OUARKLYKVJWLIE-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(furan-2-yl)methanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=CO1 OUARKLYKVJWLIE-UHFFFAOYSA-N 0.000 description 2
- FHURMAIMOMUMFR-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-pyridin-4-ylmethanol Chemical compound ClC1=CC(N)=CC=C1C(O)C1=CC=NC=C1 FHURMAIMOMUMFR-UHFFFAOYSA-N 0.000 description 2
- JBMJFRILTOZWKA-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-thiophen-2-ylmethanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=CS1 JBMJFRILTOZWKA-UHFFFAOYSA-N 0.000 description 2
- CNVGIQPCBBHALV-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-thiophen-3-ylmethanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CSC=C1 CNVGIQPCBBHALV-UHFFFAOYSA-N 0.000 description 2
- DSYIUUXIRMLRQU-UHFFFAOYSA-N (4-chloro-7-methoxyquinazolin-6-yl) acetate;hydrochloride Chemical compound Cl.C1=NC(Cl)=C2C=C(OC(C)=O)C(OC)=CC2=N1 DSYIUUXIRMLRQU-UHFFFAOYSA-N 0.000 description 2
- LSBGXLOBLBWVEN-UHFFFAOYSA-N (4-chloroquinazolin-6-yl) acetate Chemical compound N1=CN=C(Cl)C2=CC(OC(=O)C)=CC=C21 LSBGXLOBLBWVEN-UHFFFAOYSA-N 0.000 description 2
- QHSILJZBWLFQGR-UHFFFAOYSA-N (4-oxo-1h-quinazolin-6-yl) acetate Chemical compound N1=CNC(=O)C2=CC(OC(=O)C)=CC=C21 QHSILJZBWLFQGR-UHFFFAOYSA-N 0.000 description 2
- SOLQIFINSOHAQD-UHFFFAOYSA-N (7-methoxy-4-oxo-1h-quinazolin-6-yl) acetate Chemical compound N1C=NC(=O)C2=C1C=C(OC)C(OC(C)=O)=C2 SOLQIFINSOHAQD-UHFFFAOYSA-N 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 2
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 2
- 125000000586 2-(4-morpholinyl)ethoxy group Chemical group [H]C([H])(O*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 2
- SNFFHBJWQFQMBC-UHFFFAOYSA-N 2-(ethylamino)acetamide Chemical compound CCNCC(N)=O SNFFHBJWQFQMBC-UHFFFAOYSA-N 0.000 description 2
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- GVBXZIANHMNKAK-UHFFFAOYSA-N 2-chloro-4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C(Cl)=C1 GVBXZIANHMNKAK-UHFFFAOYSA-N 0.000 description 2
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 2
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 2
- CXBMZBDYEDCGKC-UHFFFAOYSA-N 3-chloro-4-(1,3-thiazol-2-ylsulfanyl)aniline Chemical compound ClC1=CC(N)=CC=C1SC1=NC=CS1 CXBMZBDYEDCGKC-UHFFFAOYSA-N 0.000 description 2
- UBRLDPJAHDCVFQ-UHFFFAOYSA-N 3-chloro-4-(1h-imidazol-2-ylsulfanyl)aniline Chemical compound ClC1=CC(N)=CC=C1SC1=NC=CN1 UBRLDPJAHDCVFQ-UHFFFAOYSA-N 0.000 description 2
- HYOYKVJOHBIQSH-UHFFFAOYSA-N 3-chloro-4-(2-methylphenyl)sulfanylaniline Chemical compound CC1=CC=CC=C1SC1=CC=C(N)C=C1Cl HYOYKVJOHBIQSH-UHFFFAOYSA-N 0.000 description 2
- JNJVZVDGADYPOE-UHFFFAOYSA-N 3-chloro-4-(furan-3-ylmethoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OCC1=COC=C1 JNJVZVDGADYPOE-UHFFFAOYSA-N 0.000 description 2
- XCAPJQSICQSUJP-UHFFFAOYSA-N 3-chloro-4-(pyridin-2-ylmethoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OCC1=CC=CC=N1 XCAPJQSICQSUJP-UHFFFAOYSA-N 0.000 description 2
- ARPXPMCHQSDZJB-UHFFFAOYSA-N 3-chloro-4-(thiophen-2-ylmethoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OCC1=CC=CS1 ARPXPMCHQSDZJB-UHFFFAOYSA-N 0.000 description 2
- WHSUDOOSFCJKMQ-UHFFFAOYSA-N 3-fluoro-4-(1-methylimidazol-2-yl)sulfanylaniline Chemical compound CN1C=CN=C1SC1=CC=C(N)C=C1F WHSUDOOSFCJKMQ-UHFFFAOYSA-N 0.000 description 2
- OXDOMAKPLZVHCE-UHFFFAOYSA-N 3-methyl-1h-pyridine-2-thione Chemical compound CC1=CC=CNC1=S OXDOMAKPLZVHCE-UHFFFAOYSA-N 0.000 description 2
- VHFFODQAQLNACY-UHFFFAOYSA-N 4,7-dichloro-6-nitroquinazoline Chemical compound N1=CN=C2C=C(Cl)C([N+](=O)[O-])=CC2=C1Cl VHFFODQAQLNACY-UHFFFAOYSA-N 0.000 description 2
- PIAZYBLGBSMNLX-UHFFFAOYSA-N 4-(3-chloropropyl)morpholine Chemical compound ClCCCN1CCOCC1 PIAZYBLGBSMNLX-UHFFFAOYSA-N 0.000 description 2
- UMLFTCYAQPPZER-UHFFFAOYSA-N 4-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=C(C#N)C=C1 UMLFTCYAQPPZER-UHFFFAOYSA-N 0.000 description 2
- UHGGUBCIPFRBIZ-UHFFFAOYSA-N 4-[(4-methoxypyridin-2-yl)methoxy]-3-methylaniline Chemical compound COC1=CC=NC(COC=2C(=CC(N)=CC=2)C)=C1 UHGGUBCIPFRBIZ-UHFFFAOYSA-N 0.000 description 2
- DCQMOHCWPCDYLL-UHFFFAOYSA-N 4-[2-fluoro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-ol Chemical compound C12=CC(O)=CC=C2N=CN=C1NC(C(=C1)F)=CC=C1OCC1=CC=CC=N1 DCQMOHCWPCDYLL-UHFFFAOYSA-N 0.000 description 2
- OEYJORJYAFXZMR-UHFFFAOYSA-N 4-[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenoxy]methyl]benzonitrile Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=C(C#N)C=C1 OEYJORJYAFXZMR-UHFFFAOYSA-N 0.000 description 2
- LZOSFEDULGODDH-UHFFFAOYSA-N 4-chloro-6-nitroquinazoline Chemical compound N1=CN=C(Cl)C2=CC([N+](=O)[O-])=CC=C21 LZOSFEDULGODDH-UHFFFAOYSA-N 0.000 description 2
- NDHNEUUBLJKLCP-UHFFFAOYSA-N 6,7-dimethoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 NDHNEUUBLJKLCP-UHFFFAOYSA-N 0.000 description 2
- WTHGAINQEFHOCX-UHFFFAOYSA-N 6,7-dimethoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine;dihydrochloride Chemical compound Cl.Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 WTHGAINQEFHOCX-UHFFFAOYSA-N 0.000 description 2
- FQWJSDSVRSAJGG-UHFFFAOYSA-N 6-(2-bromoethoxy)-n-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]quinazolin-4-amine Chemical compound CN1C=CN=C1SC(C(=C1)F)=CC=C1NC1=NC=NC2=CC=C(OCCBr)C=C12 FQWJSDSVRSAJGG-UHFFFAOYSA-N 0.000 description 2
- YQGGQOLFZBVSJK-UHFFFAOYSA-N 6-(2-bromoethoxy)-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound CC1=CC(NC=2C3=CC(OCCBr)=CC=C3N=CN=2)=CC=C1OCC1=CC=CC=N1 YQGGQOLFZBVSJK-UHFFFAOYSA-N 0.000 description 2
- OKZIRNNFVQCDSA-UHFFFAOYSA-N 6-hydroxy-7-methoxy-1h-quinazolin-4-one Chemical compound C1=NC(O)=C2C=C(O)C(OC)=CC2=N1 OKZIRNNFVQCDSA-UHFFFAOYSA-N 0.000 description 2
- YIOJEJQULNBTJR-UHFFFAOYSA-N 7-chloro-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]-6-nitroquinazolin-4-amine Chemical compound CC1=CC(NC=2C3=CC(=C(Cl)C=C3N=CN=2)[N+]([O-])=O)=CC=C1OCC1=CC=CC=N1 YIOJEJQULNBTJR-UHFFFAOYSA-N 0.000 description 2
- SJGAVBKBTDJTJK-UHFFFAOYSA-N 7-methoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 SJGAVBKBTDJTJK-UHFFFAOYSA-N 0.000 description 2
- QAYNSPOKTRVZRC-UHFFFAOYSA-N 99-60-5 Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1Cl QAYNSPOKTRVZRC-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 230000006820 DNA synthesis Effects 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 102000009465 Growth Factor Receptors Human genes 0.000 description 2
- 108010009202 Growth Factor Receptors Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 102000004877 Insulin Human genes 0.000 description 2
- 108090001061 Insulin Proteins 0.000 description 2
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- PMDCZENCAXMSOU-UHFFFAOYSA-N N-ethylacetamide Chemical compound CCNC(C)=O PMDCZENCAXMSOU-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 239000012425 OXONE® Substances 0.000 description 2
- 108700020796 Oncogene Proteins 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 229940127361 Receptor Tyrosine Kinase Inhibitors Drugs 0.000 description 2
- 208000015634 Rectal Neoplasms Diseases 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 208000024770 Thyroid neoplasm Diseases 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 206010047741 Vulval cancer Diseases 0.000 description 2
- WNVFFYFPDAZPEA-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethanone;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 WNVFFYFPDAZPEA-UHFFFAOYSA-N 0.000 description 2
- BXADKKQDHKJXFA-UHFFFAOYSA-N [2-chloro-4-[(6-hydroxyquinazolin-4-yl)amino]phenyl]-phenylmethanone Chemical compound C12=CC(O)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 BXADKKQDHKJXFA-UHFFFAOYSA-N 0.000 description 2
- HWNZGWAEZUUTSP-UHFFFAOYSA-N [2-chloro-4-[(6-nitroquinazolin-4-yl)amino]phenyl]-phenylmethanone;hydrochloride Chemical compound Cl.C12=CC([N+](=O)[O-])=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 HWNZGWAEZUUTSP-UHFFFAOYSA-N 0.000 description 2
- NWYUQWZRZOEZNJ-UHFFFAOYSA-N [2-chloro-4-[(7-hydroxy-6-methoxyquinazolin-4-yl)amino]phenyl]-phenylmethanone Chemical compound N1=CN=C2C=C(O)C(OC)=CC2=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 NWYUQWZRZOEZNJ-UHFFFAOYSA-N 0.000 description 2
- LBDGXYYYTZMDAO-UHFFFAOYSA-N [4-(4-benzoyl-3-chloroanilino)-6-methoxyquinazolin-7-yl] acetate Chemical compound N1=CN=C2C=C(OC(C)=O)C(OC)=CC2=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 LBDGXYYYTZMDAO-UHFFFAOYSA-N 0.000 description 2
- GESQIPITAQTBRD-UHFFFAOYSA-N [4-[3-chloro-4-(thiophene-2-carbonyl)anilino]quinazolin-6-yl] acetate;hydrochloride Chemical compound Cl.C12=CC(OC(=O)C)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CS1 GESQIPITAQTBRD-UHFFFAOYSA-N 0.000 description 2
- CMXUFDICCGAKGN-UHFFFAOYSA-N [4-[[6-(2-bromoethoxy)quinazolin-4-yl]amino]-2-chlorophenyl]-phenylmethanone Chemical compound ClC1=CC(NC=2C3=CC(OCCBr)=CC=C3N=CN=2)=CC=C1C(=O)C1=CC=CC=C1 CMXUFDICCGAKGN-UHFFFAOYSA-N 0.000 description 2
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical compound [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 description 2
- XBHMURZSWVSPIV-UHFFFAOYSA-N acetic acid;[2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethanol Chemical compound CC(O)=O.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(O)C1=CC=CC=C1 XBHMURZSWVSPIV-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000000340 anti-metabolite Effects 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000011717 athymic nude mouse Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- KBPUBCVJHFXPOC-UHFFFAOYSA-N ethyl 3,4-dihydroxybenzoate Chemical compound CCOC(=O)C1=CC=C(O)C(O)=C1 KBPUBCVJHFXPOC-UHFFFAOYSA-N 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000011790 ferrous sulphate Substances 0.000 description 2
- 235000003891 ferrous sulphate Nutrition 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 229940125396 insulin Drugs 0.000 description 2
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 201000005202 lung cancer Diseases 0.000 description 2
- 208000020816 lung neoplasm Diseases 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- OJDKENGKKYVJLY-UHFFFAOYSA-N methyl 4-methoxypyridine-2-carboxylate Chemical compound COC(=O)C1=CC(OC)=CC=N1 OJDKENGKKYVJLY-UHFFFAOYSA-N 0.000 description 2
- UIUFBRILCYUWGV-UHFFFAOYSA-N n-(3-chloro-4-phenylsulfanylphenyl)-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1SC1=CC=CC=C1 UIUFBRILCYUWGV-UHFFFAOYSA-N 0.000 description 2
- WUVIVGYLOOWSLU-UHFFFAOYSA-N n-(3-chloro-4-phenylsulfanylphenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1SC1=CC=CC=C1 WUVIVGYLOOWSLU-UHFFFAOYSA-N 0.000 description 2
- BAODTVPCIXSVNF-UHFFFAOYSA-N n-(4-benzyl-3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine;hydroiodide Chemical compound I.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1CC1=CC=CC=C1 BAODTVPCIXSVNF-UHFFFAOYSA-N 0.000 description 2
- MKFJWPCDXGDGJI-UHFFFAOYSA-N n-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine Chemical compound C=1C=C(NC=2C3=CC(OCCCN4CCOCC4)=CC=C3N=CN=2)C(F)=CC=1OCC1=CC=CC=N1 MKFJWPCDXGDGJI-UHFFFAOYSA-N 0.000 description 2
- HHHXIMXVPOLNRR-UHFFFAOYSA-N n-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylphenyl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1SC1=NC=CN1C HHHXIMXVPOLNRR-UHFFFAOYSA-N 0.000 description 2
- OFIVTYIJGCSXQF-UHFFFAOYSA-N n-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1F)=CC=C1OCC1=CC=CC=N1 OFIVTYIJGCSXQF-UHFFFAOYSA-N 0.000 description 2
- DRTQFFVSKBQUMR-UHFFFAOYSA-N n-ethyl-2-methoxyacetamide Chemical compound CCNC(=O)COC DRTQFFVSKBQUMR-UHFFFAOYSA-N 0.000 description 2
- MTSNDBYBIZSILH-UHFFFAOYSA-N n-phenylquinazolin-4-amine Chemical class N=1C=NC2=CC=CC=C2C=1NC1=CC=CC=C1 MTSNDBYBIZSILH-UHFFFAOYSA-N 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229950008882 polysorbate Drugs 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 125000006308 propyl amino group Chemical group 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 206010038038 rectal cancer Diseases 0.000 description 2
- 201000001275 rectum cancer Diseases 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 150000003440 styrenes Chemical class 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 238000002054 transplantation Methods 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- GTRYKHGXRVCFOV-UHFFFAOYSA-N (1-amino-1-oxopropan-2-yl) acetate Chemical compound NC(=O)C(C)OC(C)=O GTRYKHGXRVCFOV-UHFFFAOYSA-N 0.000 description 1
- DMLYTGPBYWHKHU-UHFFFAOYSA-N (2-amino-2-oxoethyl) acetate Chemical compound CC(=O)OCC(N)=O DMLYTGPBYWHKHU-UHFFFAOYSA-N 0.000 description 1
- WSZPYJYHSUKXKF-UHFFFAOYSA-N (2-amino-2-oxoethyl) propanoate Chemical compound CCC(=O)OCC(N)=O WSZPYJYHSUKXKF-UHFFFAOYSA-N 0.000 description 1
- JFGDLRRMBBCXJZ-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-(1,3-oxazol-2-yl)methanol Chemical compound C=1C=C([N+]([O-])=O)C=C(Cl)C=1C(O)C1=NC=CO1 JFGDLRRMBBCXJZ-UHFFFAOYSA-N 0.000 description 1
- AHPJNLFCONYFKM-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-(1,3-oxazol-2-yl)methanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=NC=CO1 AHPJNLFCONYFKM-UHFFFAOYSA-N 0.000 description 1
- BPBMUFILUAAAMI-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-(1,3-thiazol-5-yl)methanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CN=CS1 BPBMUFILUAAAMI-UHFFFAOYSA-N 0.000 description 1
- WPAPYOLGNBQMBZ-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-(1h-imidazol-2-yl)methanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=NC=CN1 WPAPYOLGNBQMBZ-UHFFFAOYSA-N 0.000 description 1
- CRLJLQJXPGAKFU-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-(2-trimethylsilyl-1,3-thiazol-5-yl)methanone Chemical compound S1C([Si](C)(C)C)=NC=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1Cl CRLJLQJXPGAKFU-UHFFFAOYSA-N 0.000 description 1
- PGIPTXFXNUVZFZ-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-phenylmethanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CC=C1 PGIPTXFXNUVZFZ-UHFFFAOYSA-N 0.000 description 1
- DPAFNOGHBNCMQS-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-pyridin-2-ylmethanol Chemical compound C=1C=C([N+]([O-])=O)C=C(Cl)C=1C(O)C1=CC=CC=N1 DPAFNOGHBNCMQS-UHFFFAOYSA-N 0.000 description 1
- DPNBFQCSWAWOEX-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-pyridin-2-ylmethanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CC=N1 DPNBFQCSWAWOEX-UHFFFAOYSA-N 0.000 description 1
- WRZADGJUMXFKAQ-UHFFFAOYSA-N (2-chloro-4-nitrophenyl)-thiophen-3-ylmethanone Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CSC=C1 WRZADGJUMXFKAQ-UHFFFAOYSA-N 0.000 description 1
- DSOBFWPMWSXZGI-UHFFFAOYSA-N (3-amino-3-oxopropyl) acetate Chemical compound CC(=O)OCCC(N)=O DSOBFWPMWSXZGI-UHFFFAOYSA-N 0.000 description 1
- HHIWIPVVIMBNQZ-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(1,3-thiazol-2-yl)methanol Chemical compound ClC1=CC(N)=CC=C1C(O)C1=NC=CS1 HHIWIPVVIMBNQZ-UHFFFAOYSA-N 0.000 description 1
- WIXSUPUXSXRDEZ-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-(4-chlorophenyl)methanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=C(Cl)C=C1 WIXSUPUXSXRDEZ-UHFFFAOYSA-N 0.000 description 1
- DYYMDUZIPXRJLJ-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-pyridin-2-ylmethanol Chemical compound ClC1=CC(N)=CC=C1C(O)C1=CC=CC=N1 DYYMDUZIPXRJLJ-UHFFFAOYSA-N 0.000 description 1
- SQTCZEPDDUQHDP-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-pyridin-3-ylmethanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=CN=C1 SQTCZEPDDUQHDP-UHFFFAOYSA-N 0.000 description 1
- JPIGOCOTRZPAMU-UHFFFAOYSA-N (4-amino-2-chlorophenyl)-pyridin-4-ylmethanone Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=NC=C1 JPIGOCOTRZPAMU-UHFFFAOYSA-N 0.000 description 1
- UEAIOHHGRGSGGJ-UHFFFAOYSA-N (4-chloropyridin-2-yl)methanol Chemical compound OCC1=CC(Cl)=CC=N1 UEAIOHHGRGSGGJ-UHFFFAOYSA-N 0.000 description 1
- GBMRUSRMPOUVEK-UHFFFAOYSA-N (4-methoxypyridin-2-yl)methanol Chemical compound COC1=CC=NC(CO)=C1 GBMRUSRMPOUVEK-UHFFFAOYSA-N 0.000 description 1
- MTYDTSHOQKECQS-UHFFFAOYSA-N (4-methylpyridin-2-yl)methanol Chemical compound CC1=CC=NC(CO)=C1 MTYDTSHOQKECQS-UHFFFAOYSA-N 0.000 description 1
- UVNGEPOWQCFTDI-UHFFFAOYSA-N (6-methoxy-4-oxo-1h-quinazolin-7-yl) acetate Chemical compound N1=CNC(=O)C2=C1C=C(OC(C)=O)C(OC)=C2 UVNGEPOWQCFTDI-UHFFFAOYSA-N 0.000 description 1
- DEIBXAPEZDJDRC-UHFFFAOYSA-M (dimethylaminomethylideneamino)methylidene-dimethylazanium;chloride Chemical compound [Cl-].CN(C)C=NC=[N+](C)C DEIBXAPEZDJDRC-UHFFFAOYSA-M 0.000 description 1
- NQQRXZOPZBKCNF-IHWYPQMZSA-N (z)-but-2-enamide Chemical compound C\C=C/C(N)=O NQQRXZOPZBKCNF-IHWYPQMZSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- SCZNXLWKYFICFV-UHFFFAOYSA-N 1,2,3,4,5,7,8,9-octahydropyrido[1,2-b]diazepine Chemical compound C1CCCNN2CCCC=C21 SCZNXLWKYFICFV-UHFFFAOYSA-N 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- ARCACZWMYGILNI-UHFFFAOYSA-N 1,2,3-trifluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1F ARCACZWMYGILNI-UHFFFAOYSA-N 0.000 description 1
- ROJNMGYMBLNTPK-UHFFFAOYSA-N 1,2,4-trifluoro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(F)=C(F)C=C1F ROJNMGYMBLNTPK-UHFFFAOYSA-N 0.000 description 1
- RUBQQRMAWLSCCJ-UHFFFAOYSA-N 1,2-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1 RUBQQRMAWLSCCJ-UHFFFAOYSA-N 0.000 description 1
- AVWNNVJXXMKAPB-UHFFFAOYSA-N 1,3-difluoro-2-methyl-4-nitrobenzene Chemical compound CC1=C(F)C=CC([N+]([O-])=O)=C1F AVWNNVJXXMKAPB-UHFFFAOYSA-N 0.000 description 1
- OXFSTTJBVAAALW-UHFFFAOYSA-N 1,3-dihydroimidazole-2-thione Chemical compound SC1=NC=CN1 OXFSTTJBVAAALW-UHFFFAOYSA-N 0.000 description 1
- JNHDLNXNYPLBMJ-UHFFFAOYSA-N 1,3-thiazol-2-ylmethanol Chemical compound OCC1=NC=CS1 JNHDLNXNYPLBMJ-UHFFFAOYSA-N 0.000 description 1
- NNQBAGFIYBBAFL-UHFFFAOYSA-N 1-(diethoxymethyl)imidazole Chemical compound CCOC(OCC)N1C=CN=C1 NNQBAGFIYBBAFL-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- JXMZUNPWVXQADG-UHFFFAOYSA-N 1-iodo-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1I JXMZUNPWVXQADG-UHFFFAOYSA-N 0.000 description 1
- SCCCFNJTCDSLCY-UHFFFAOYSA-N 1-iodo-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(I)C=C1 SCCCFNJTCDSLCY-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- GOIWZZQXWJVDOG-UHFFFAOYSA-N 2,2,2-trifluoroethyl trichloromethanesulfonate Chemical compound FC(F)(F)COS(=O)(=O)C(Cl)(Cl)Cl GOIWZZQXWJVDOG-UHFFFAOYSA-N 0.000 description 1
- IURAZHJZJQZXAW-UHFFFAOYSA-N 2,3-difluoro-4-(pyridin-2-ylmethoxy)aniline Chemical compound FC1=C(F)C(N)=CC=C1OCC1=CC=CC=N1 IURAZHJZJQZXAW-UHFFFAOYSA-N 0.000 description 1
- DXYKYEBEKILCJC-UHFFFAOYSA-N 2,5-difluoro-4-(pyridin-2-ylmethoxy)aniline Chemical compound C1=C(F)C(N)=CC(F)=C1OCC1=CC=CC=N1 DXYKYEBEKILCJC-UHFFFAOYSA-N 0.000 description 1
- JLSAVMWCIVUVQQ-UHFFFAOYSA-N 2-(2-chloro-4-nitrophenyl)sulfanyl-1,3-thiazole Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1SC1=NC=CS1 JLSAVMWCIVUVQQ-UHFFFAOYSA-N 0.000 description 1
- LPJDVAQMVBVEKB-UHFFFAOYSA-N 2-(2-chloro-4-nitrophenyl)sulfanyl-1-methylimidazole Chemical compound CN1C=CN=C1SC1=CC=C([N+]([O-])=O)C=C1Cl LPJDVAQMVBVEKB-UHFFFAOYSA-N 0.000 description 1
- BCBKLVPGYDYYCQ-UHFFFAOYSA-N 2-(2-chloro-4-nitrophenyl)sulfanyl-1h-imidazole Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1SC1=NC=CN1 BCBKLVPGYDYYCQ-UHFFFAOYSA-N 0.000 description 1
- CHTFYHLMOYYTEV-UHFFFAOYSA-N 2-(2-chloro-4-nitrophenyl)sulfanyl-3-methylpyridine Chemical compound CC1=CC=CN=C1SC1=CC=C([N+]([O-])=O)C=C1Cl CHTFYHLMOYYTEV-UHFFFAOYSA-N 0.000 description 1
- HJWFRNRCHIIXMH-UHFFFAOYSA-N 2-(2-chloro-4-nitrophenyl)sulfanylthiophene Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1SC1=CC=CS1 HJWFRNRCHIIXMH-UHFFFAOYSA-N 0.000 description 1
- LRIXKEQGKQFQAO-UHFFFAOYSA-N 2-(2-methoxyethoxy)benzoic acid Chemical compound COCCOC1=CC=CC=C1C(O)=O LRIXKEQGKQFQAO-UHFFFAOYSA-N 0.000 description 1
- VRZZMRYGHFNKEN-UHFFFAOYSA-N 2-(4-methylpiperazin-1-yl)acetamide Chemical compound CN1CCN(CC(N)=O)CC1 VRZZMRYGHFNKEN-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- GRWPTSXPZYCYOM-UHFFFAOYSA-N 2-(dimethylamino)acetaldehyde Chemical compound CN(C)CC=O GRWPTSXPZYCYOM-UHFFFAOYSA-N 0.000 description 1
- MBKGOQHJIPZMEP-UHFFFAOYSA-N 2-(dimethylamino)propanamide Chemical compound CN(C)C(C)C(N)=O MBKGOQHJIPZMEP-UHFFFAOYSA-N 0.000 description 1
- NIRIMNKWMCIFJJ-UHFFFAOYSA-N 2-(methylamino)-n-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]acetamide Chemical compound C12=CC(NC(=O)CNC)=CC=C2N=CN=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 NIRIMNKWMCIFJJ-UHFFFAOYSA-N 0.000 description 1
- QKNFFJHHPCWXTH-UHFFFAOYSA-N 2-(methylamino)propanamide Chemical compound CNC(C)C(N)=O QKNFFJHHPCWXTH-UHFFFAOYSA-N 0.000 description 1
- LKZRYXDGZQOPNA-UHFFFAOYSA-N 2-(propylamino)acetamide Chemical compound CCCNCC(N)=O LKZRYXDGZQOPNA-UHFFFAOYSA-N 0.000 description 1
- HYNQTSZBTIOFKH-UHFFFAOYSA-N 2-Amino-5-hydroxybenzoic acid Chemical compound NC1=CC=C(O)C=C1C(O)=O HYNQTSZBTIOFKH-UHFFFAOYSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical compound CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- GWYKHOLLVPAQFF-UHFFFAOYSA-N 2-[(2-chloro-4-nitrophenoxy)methyl]pyridine Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1OCC1=CC=CC=N1 GWYKHOLLVPAQFF-UHFFFAOYSA-N 0.000 description 1
- XHUXOOKSBAFRTA-UHFFFAOYSA-N 2-[(2-chloro-4-nitrophenoxy)methyl]thiophene Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1OCC1=CC=CS1 XHUXOOKSBAFRTA-UHFFFAOYSA-N 0.000 description 1
- JSENHNZZCHYVEF-UHFFFAOYSA-N 2-[(2-methyl-4-nitrophenoxy)methyl]pyridine Chemical compound CC1=CC([N+]([O-])=O)=CC=C1OCC1=CC=CC=N1 JSENHNZZCHYVEF-UHFFFAOYSA-N 0.000 description 1
- QCZSYNSLABZWNC-UHFFFAOYSA-N 2-[(2-methylphenoxy)methyl]pyridine Chemical compound CC1=CC=CC=C1OCC1=CC=CC=N1 QCZSYNSLABZWNC-UHFFFAOYSA-N 0.000 description 1
- HCQZQPNSZFXGGO-UHFFFAOYSA-N 2-[(3-fluoro-4-nitrophenoxy)methyl]pyridine Chemical compound C1=C(F)C([N+](=O)[O-])=CC=C1OCC1=CC=CC=N1 HCQZQPNSZFXGGO-UHFFFAOYSA-N 0.000 description 1
- JYYLQSCZISREGY-UHFFFAOYSA-N 2-amino-4-chlorobenzoic acid Chemical compound NC1=CC(Cl)=CC=C1C(O)=O JYYLQSCZISREGY-UHFFFAOYSA-N 0.000 description 1
- DNPHXICYCDCOAR-UHFFFAOYSA-N 2-amino-5-methoxy-4-phenylmethoxybenzamide Chemical compound COC1=CC(C(N)=O)=C(N)C=C1OCC1=CC=CC=C1 DNPHXICYCDCOAR-UHFFFAOYSA-N 0.000 description 1
- HQMLIDZJXVVKCW-UHFFFAOYSA-N 2-aminopropanamide Chemical compound CC(N)C(N)=O HQMLIDZJXVVKCW-UHFFFAOYSA-N 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- FQXFHRSYMORXKN-UHFFFAOYSA-N 2-chloro-1-iodo-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(I)C(Cl)=C1 FQXFHRSYMORXKN-UHFFFAOYSA-N 0.000 description 1
- GZEFAXPIXDJWPY-UHFFFAOYSA-N 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-n-phenylbenzamide;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)NC1=CC=CC=C1 GZEFAXPIXDJWPY-UHFFFAOYSA-N 0.000 description 1
- KQOOFMWRLDRDAX-UHFFFAOYSA-N 2-chloro-4-fluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1Cl KQOOFMWRLDRDAX-UHFFFAOYSA-N 0.000 description 1
- ZIDYALDTDUSPFJ-UHFFFAOYSA-N 2-chloro-4-nitro-1-phenoxybenzene Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 ZIDYALDTDUSPFJ-UHFFFAOYSA-N 0.000 description 1
- NMOHQMBOJLUYLP-UHFFFAOYSA-N 2-chloro-4-nitro-1-phenylsulfanylbenzene Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1 NMOHQMBOJLUYLP-UHFFFAOYSA-N 0.000 description 1
- HKFKBQGYOFOVFH-UHFFFAOYSA-N 2-chloro-4-nitro-n-phenylbenzamide Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1C(=O)NC1=CC=CC=C1 HKFKBQGYOFOVFH-UHFFFAOYSA-N 0.000 description 1
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 1
- FIVLHRQZTIPSMG-UHFFFAOYSA-N 2-chloro-n-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]acetamide Chemical compound CC1=CC(NC=2C3=CC(NC(=O)CCl)=CC=C3N=CN=2)=CC=C1OCC1=CC=CC=N1 FIVLHRQZTIPSMG-UHFFFAOYSA-N 0.000 description 1
- JUBORNFANZZVJL-UHFFFAOYSA-N 2-chloro-n-ethylacetamide Chemical compound CCNC(=O)CCl JUBORNFANZZVJL-UHFFFAOYSA-N 0.000 description 1
- HOZLOOPIXHWKCI-UHFFFAOYSA-N 2-chloro-n-methylacetamide Chemical compound CNC(=O)CCl HOZLOOPIXHWKCI-UHFFFAOYSA-N 0.000 description 1
- SWJVFAOGXDGTCX-UHFFFAOYSA-N 2-cyanoethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCC#N SWJVFAOGXDGTCX-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- VMJFQIFIWGEWTI-UHFFFAOYSA-N 2-ethoxy-n-methylacetamide Chemical compound CCOCC(=O)NC VMJFQIFIWGEWTI-UHFFFAOYSA-N 0.000 description 1
- OAAKFAXUEYTMHF-UHFFFAOYSA-N 2-ethoxyacetamide Chemical compound CCOCC(N)=O OAAKFAXUEYTMHF-UHFFFAOYSA-N 0.000 description 1
- PLPAUAUREFEBEB-UHFFFAOYSA-N 2-fluoro-3-methyl-4-(pyridin-2-ylmethoxy)aniline Chemical compound CC1=C(F)C(N)=CC=C1OCC1=CC=CC=N1 PLPAUAUREFEBEB-UHFFFAOYSA-N 0.000 description 1
- WFAFGNCZWMJZCK-UHFFFAOYSA-N 2-hydroxy-n-methylacetamide Chemical compound CNC(=O)CO WFAFGNCZWMJZCK-UHFFFAOYSA-N 0.000 description 1
- TZGPACAKMCUCKX-UHFFFAOYSA-N 2-hydroxyacetamide Chemical compound NC(=O)CO TZGPACAKMCUCKX-UHFFFAOYSA-N 0.000 description 1
- DYJPVSYLWLJPEE-UHFFFAOYSA-N 2-methoxy-n-methylacetamide Chemical compound CNC(=O)COC DYJPVSYLWLJPEE-UHFFFAOYSA-N 0.000 description 1
- YSEFYOVWKJXNCH-UHFFFAOYSA-N 2-methoxyacetaldehyde Chemical compound COCC=O YSEFYOVWKJXNCH-UHFFFAOYSA-N 0.000 description 1
- MTEZLAATISORQK-UHFFFAOYSA-N 2-methoxyacetamide Chemical compound COCC(N)=O MTEZLAATISORQK-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- NPCLRBQYESMUPD-UHFFFAOYSA-N 2-methylpropanethioamide Chemical compound CC(C)C(N)=S NPCLRBQYESMUPD-UHFFFAOYSA-N 0.000 description 1
- TTXPTDCYRCXFHQ-UHFFFAOYSA-N 2-methylsulfinylacetamide Chemical compound CS(=O)CC(N)=O TTXPTDCYRCXFHQ-UHFFFAOYSA-N 0.000 description 1
- ZBLUAVADFAWYLL-UHFFFAOYSA-N 2-methylsulfonylacetamide Chemical compound CS(=O)(=O)CC(N)=O ZBLUAVADFAWYLL-UHFFFAOYSA-N 0.000 description 1
- CSAUPSKNPICATP-UHFFFAOYSA-N 2-morpholin-2-ylacetaldehyde Chemical compound O=CCC1CNCCO1 CSAUPSKNPICATP-UHFFFAOYSA-N 0.000 description 1
- BWRNWWSQZROEOA-UHFFFAOYSA-N 2-morpholin-4-ylacetamide Chemical compound NC(=O)CN1CCOCC1 BWRNWWSQZROEOA-UHFFFAOYSA-N 0.000 description 1
- VOBVDLZRCHOSCL-UHFFFAOYSA-N 2-morpholin-4-ylpropanamide Chemical compound NC(=O)C(C)N1CCOCC1 VOBVDLZRCHOSCL-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- VNRJGEMERJZKLQ-UHFFFAOYSA-N 2-piperazin-1-ylacetamide Chemical compound NC(=O)CN1CCNCC1 VNRJGEMERJZKLQ-UHFFFAOYSA-N 0.000 description 1
- DXLMAWKTIWMTIM-UHFFFAOYSA-N 2-piperazin-1-ylpropanamide Chemical compound NC(=O)C(C)N1CCNCC1 DXLMAWKTIWMTIM-UHFFFAOYSA-N 0.000 description 1
- OFILXYRUXDYLLS-UHFFFAOYSA-N 2-piperidin-1-ylacetamide Chemical compound NC(=O)CN1CCCCC1 OFILXYRUXDYLLS-UHFFFAOYSA-N 0.000 description 1
- JWDAQACFBLXJBZ-UHFFFAOYSA-N 2-propoxyacetamide Chemical compound CCCOCC(N)=O JWDAQACFBLXJBZ-UHFFFAOYSA-N 0.000 description 1
- FKBYDGHOPOEEEP-UHFFFAOYSA-N 2-pyridin-2-ylbenzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=CC=N1 FKBYDGHOPOEEEP-UHFFFAOYSA-N 0.000 description 1
- LBTUTDYXOOUODJ-UHFFFAOYSA-N 2-pyrrolidin-1-ylacetamide Chemical compound NC(=O)CN1CCCC1 LBTUTDYXOOUODJ-UHFFFAOYSA-N 0.000 description 1
- FTZIQBGFCYJWKA-UHFFFAOYSA-N 3-(4,5-dimethylthiazol-2-yl)-2,5-diphenyltetrazolium Chemical compound S1C(C)=C(C)N=C1[N+]1=NC(C=2C=CC=CC=2)=NN1C1=CC=CC=C1 FTZIQBGFCYJWKA-UHFFFAOYSA-N 0.000 description 1
- ZJUWJMDINDSGTP-UHFFFAOYSA-N 3-(4-amino-2-chlorobenzoyl)benzonitrile Chemical compound ClC1=CC(N)=CC=C1C(=O)C1=CC=CC(C#N)=C1 ZJUWJMDINDSGTP-UHFFFAOYSA-N 0.000 description 1
- CNQCWYFDIQSALX-UHFFFAOYSA-N 3-(chloromethyl)pyridine Chemical compound ClCC1=CC=CN=C1 CNQCWYFDIQSALX-UHFFFAOYSA-N 0.000 description 1
- GSZKLTJTSQMAOD-UHFFFAOYSA-N 3-(dimethylamino)propanal Chemical compound CN(C)CCC=O GSZKLTJTSQMAOD-UHFFFAOYSA-N 0.000 description 1
- NIXQLMVKRBUSPF-UHFFFAOYSA-N 3-(dimethylamino)propanamide Chemical compound CN(C)CCC(N)=O NIXQLMVKRBUSPF-UHFFFAOYSA-N 0.000 description 1
- FFJLSBFLTYYWII-UHFFFAOYSA-N 3-(methylamino)propanamide Chemical compound CNCCC(N)=O FFJLSBFLTYYWII-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- DBIVLAVBOICUQX-UHFFFAOYSA-N 3-bromopropanamide Chemical compound NC(=O)CCBr DBIVLAVBOICUQX-UHFFFAOYSA-N 0.000 description 1
- XCMISAPCWHTVNG-UHFFFAOYSA-N 3-bromothiophene Chemical compound BrC=1C=CSC=1 XCMISAPCWHTVNG-UHFFFAOYSA-N 0.000 description 1
- HSMSLPVEQDFVRH-UHFFFAOYSA-N 3-chloro-4-(3-chlorophenoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OC1=CC=CC(Cl)=C1 HSMSLPVEQDFVRH-UHFFFAOYSA-N 0.000 description 1
- NZGJNANQDVFJIW-UHFFFAOYSA-N 3-chloro-4-(3-methylpyridin-2-yl)sulfanylaniline Chemical compound CC1=CC=CN=C1SC1=CC=C(N)C=C1Cl NZGJNANQDVFJIW-UHFFFAOYSA-N 0.000 description 1
- ISOUIEYTFVMZSP-UHFFFAOYSA-N 3-chloro-4-pyridin-2-yloxyaniline Chemical compound ClC1=CC(N)=CC=C1OC1=CC=CC=N1 ISOUIEYTFVMZSP-UHFFFAOYSA-N 0.000 description 1
- PACAIUWMHIKTMI-UHFFFAOYSA-N 3-chloro-4-pyridin-2-ylsulfanylaniline Chemical compound ClC1=CC(N)=CC=C1SC1=CC=CC=N1 PACAIUWMHIKTMI-UHFFFAOYSA-N 0.000 description 1
- CEIJLCICZGVRFX-UHFFFAOYSA-N 3-chloro-4-thiophen-2-ylsulfanylaniline Chemical compound ClC1=CC(N)=CC=C1SC1=CC=CS1 CEIJLCICZGVRFX-UHFFFAOYSA-N 0.000 description 1
- LJQNMDZRCXJETK-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine;hydron;chloride Chemical compound Cl.CN(C)CCCCl LJQNMDZRCXJETK-UHFFFAOYSA-N 0.000 description 1
- UZWXYEHTFDWCIS-UHFFFAOYSA-N 3-chloro-n-methylpropanamide Chemical compound CNC(=O)CCCl UZWXYEHTFDWCIS-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- JQDXZJYAUSVHDH-UHFFFAOYSA-N 3-chloropropanamide Chemical compound NC(=O)CCCl JQDXZJYAUSVHDH-UHFFFAOYSA-N 0.000 description 1
- WGVNJQHQQWPGJL-UHFFFAOYSA-N 3-ethoxypropanamide Chemical compound CCOCCC(N)=O WGVNJQHQQWPGJL-UHFFFAOYSA-N 0.000 description 1
- HNQBCXSDSXMOQC-UHFFFAOYSA-N 3-fluoro-4-(pyridin-2-ylmethoxy)aniline Chemical compound FC1=CC(N)=CC=C1OCC1=CC=CC=N1 HNQBCXSDSXMOQC-UHFFFAOYSA-N 0.000 description 1
- CSSGKHVRDGATJL-UHFFFAOYSA-N 3-fluoro-4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C(F)=C1 CSSGKHVRDGATJL-UHFFFAOYSA-N 0.000 description 1
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 1
- SMGLHFBQMBVRCP-UHFFFAOYSA-N 3-hydroxypropanamide Chemical compound NC(=O)CCO SMGLHFBQMBVRCP-UHFFFAOYSA-N 0.000 description 1
- 125000001137 3-hydroxypropoxy group Chemical group [H]OC([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- OXGJKCALURPRCN-UHFFFAOYSA-N 3-methoxypropanal Chemical compound COCCC=O OXGJKCALURPRCN-UHFFFAOYSA-N 0.000 description 1
- BPXCLLWXDHBFRH-UHFFFAOYSA-N 3-methoxypropanamide Chemical compound COCCC(N)=O BPXCLLWXDHBFRH-UHFFFAOYSA-N 0.000 description 1
- MVKDNXIKAWKCCS-UHFFFAOYSA-N 3-methyl-1h-pyridin-2-one Chemical compound CC1=CC=CN=C1O MVKDNXIKAWKCCS-UHFFFAOYSA-N 0.000 description 1
- NIGWVKKWCBOHQV-UHFFFAOYSA-N 3-methyl-4-[(1-methylimidazol-2-yl)methoxy]aniline Chemical compound CC1=CC(N)=CC=C1OCC1=NC=CN1C NIGWVKKWCBOHQV-UHFFFAOYSA-N 0.000 description 1
- UCJPWWWLWVQUCU-UHFFFAOYSA-N 3-methyl-4-[(4-methylpyridin-2-yl)methoxy]aniline Chemical compound CC1=CC=NC(COC=2C(=CC(N)=CC=2)C)=C1 UCJPWWWLWVQUCU-UHFFFAOYSA-N 0.000 description 1
- KSRGJRRNEPDYIR-UHFFFAOYSA-N 3-methyl-4-[(6-methylpyridin-2-yl)methoxy]aniline Chemical compound CC1=CC=CC(COC=2C(=CC(N)=CC=2)C)=N1 KSRGJRRNEPDYIR-UHFFFAOYSA-N 0.000 description 1
- UJCYEHJOKQZZHG-UHFFFAOYSA-N 3-methylsulfanylpropanamide Chemical compound CSCCC(N)=O UJCYEHJOKQZZHG-UHFFFAOYSA-N 0.000 description 1
- DUDILWQIGVONEB-UHFFFAOYSA-N 3-methylsulfinylpropanamide Chemical compound CS(=O)CCC(N)=O DUDILWQIGVONEB-UHFFFAOYSA-N 0.000 description 1
- BKNIWNVWNVXGDI-UHFFFAOYSA-N 3-methylsulfonylpropanamide Chemical compound CS(=O)(=O)CCC(N)=O BKNIWNVWNVXGDI-UHFFFAOYSA-N 0.000 description 1
- ZDIHWYALGKICMJ-UHFFFAOYSA-N 3-morpholin-4-ylpropanamide Chemical compound NC(=O)CCN1CCOCC1 ZDIHWYALGKICMJ-UHFFFAOYSA-N 0.000 description 1
- VVWMANLRLRFZIZ-UHFFFAOYSA-N 3-piperazin-1-ylpropanamide Chemical compound NC(=O)CCN1CCNCC1 VVWMANLRLRFZIZ-UHFFFAOYSA-N 0.000 description 1
- ZMDWVDOBEGZQJC-UHFFFAOYSA-N 3-piperidin-1-ylpropanamide Chemical compound NC(=O)CCN1CCCCC1 ZMDWVDOBEGZQJC-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- CGKYDLSLIFODDP-UHFFFAOYSA-N 3-pyrrolidin-1-ylpropanamide Chemical compound NC(=O)CCN1CCCC1 CGKYDLSLIFODDP-UHFFFAOYSA-N 0.000 description 1
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical compound SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 description 1
- AAALVYBICLMAMA-UHFFFAOYSA-N 4,5-dianilinophthalimide Chemical class C=1C=CC=CC=1NC=1C=C2C(=O)NC(=O)C2=CC=1NC1=CC=CC=C1 AAALVYBICLMAMA-UHFFFAOYSA-N 0.000 description 1
- PJBZBDZWFZJNAW-UHFFFAOYSA-N 4-[(4-chloropyridin-2-yl)methoxy]-3-methylaniline Chemical compound CC1=CC(N)=CC=C1OCC1=CC(Cl)=CC=N1 PJBZBDZWFZJNAW-UHFFFAOYSA-N 0.000 description 1
- CIBFUUBTQBORHL-UHFFFAOYSA-N 4-[(6,7-dimethoxyquinazolin-4-yl)amino]-n-phenylbenzenesulfonamide Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1)=CC=C1S(=O)(=O)NC1=CC=CC=C1 CIBFUUBTQBORHL-UHFFFAOYSA-N 0.000 description 1
- XBKTXRFSSYJBLF-UHFFFAOYSA-N 4-[(6,7-dimethoxyquinazolin-4-yl)amino]-n-phenylbenzenesulfonamide;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1)=CC=C1S(=O)(=O)NC1=CC=CC=C1 XBKTXRFSSYJBLF-UHFFFAOYSA-N 0.000 description 1
- NLHXAWRDMJSVBR-UHFFFAOYSA-N 4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-ol Chemical compound CN1C=CN=C1SC(C(=C1)Cl)=CC=C1NC1=NC=NC2=CC=C(O)C=C12 NLHXAWRDMJSVBR-UHFFFAOYSA-N 0.000 description 1
- GZVPBXATURIORN-UHFFFAOYSA-N 4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-ol Chemical compound CN1C=CN=C1SC(C(=C1)F)=CC=C1NC1=NC=NC2=CC=C(O)C=C12 GZVPBXATURIORN-UHFFFAOYSA-N 0.000 description 1
- RVHXEXYXLWVDMD-UHFFFAOYSA-N 4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-ol Chemical compound CC1=CC(NC=2C3=CC(O)=CC=C3N=CN=2)=CC=C1OCC1=CC=CC=N1 RVHXEXYXLWVDMD-UHFFFAOYSA-N 0.000 description 1
- UDZAWSNTIVQZGI-UHFFFAOYSA-N 4-[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenoxy]methyl]benzamide Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=C(C(N)=O)C=C1 UDZAWSNTIVQZGI-UHFFFAOYSA-N 0.000 description 1
- HDGMAACKJSBLMW-UHFFFAOYSA-N 4-amino-2-methylphenol Chemical compound CC1=CC(N)=CC=C1O HDGMAACKJSBLMW-UHFFFAOYSA-N 0.000 description 1
- YBUXKQSCKVQATK-UHFFFAOYSA-N 4-amino-n-phenylbenzenesulfonamide Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=CC=CC=C1 YBUXKQSCKVQATK-UHFFFAOYSA-N 0.000 description 1
- QEUSEKYHDPJEEK-UHFFFAOYSA-N 4-chloro-6-nitroquinazoline;hydrochloride Chemical compound Cl.N1=CN=C(Cl)C2=CC([N+](=O)[O-])=CC=C21 QEUSEKYHDPJEEK-UHFFFAOYSA-N 0.000 description 1
- NNMYRMGMVLMQAY-UHFFFAOYSA-N 4-chloropyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=CC=N1 NNMYRMGMVLMQAY-UHFFFAOYSA-N 0.000 description 1
- LOESDOAIWSCMKM-UHFFFAOYSA-N 4-hydroxybutanamide Chemical compound NC(=O)CCCO LOESDOAIWSCMKM-UHFFFAOYSA-N 0.000 description 1
- XJXBWJFUCWOLSY-UHFFFAOYSA-N 4-methoxybutanamide Chemical compound COCCCC(N)=O XJXBWJFUCWOLSY-UHFFFAOYSA-N 0.000 description 1
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- PUODYBPRHJNKPP-UHFFFAOYSA-N 4-n-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-6-n-(2-methoxyethyl)quinazoline-4,6-diamine Chemical compound C12=CC(NCCOC)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 PUODYBPRHJNKPP-UHFFFAOYSA-N 0.000 description 1
- PARMXUBWKSQXEW-UHFFFAOYSA-N 4-n-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]quinazoline-4,6-diamine Chemical compound C12=CC(N)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 PARMXUBWKSQXEW-UHFFFAOYSA-N 0.000 description 1
- FIIDVVUUWRJXLF-UHFFFAOYSA-N 4-phenylmethoxyaniline Chemical compound C1=CC(N)=CC=C1OCC1=CC=CC=C1 FIIDVVUUWRJXLF-UHFFFAOYSA-N 0.000 description 1
- PMQWTUWLIGJTQD-UHFFFAOYSA-N 6,7-bis(2-methoxyethoxy)-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C2=C1C=C(OCCOC)C(OCCOC)=C2 PMQWTUWLIGJTQD-UHFFFAOYSA-N 0.000 description 1
- DMSRMHGCZUXCMJ-UHFFFAOYSA-N 6,7-dimethoxy-1h-quinazolin-4-one Chemical compound C1=NC(O)=C2C=C(OC)C(OC)=CC2=N1 DMSRMHGCZUXCMJ-UHFFFAOYSA-N 0.000 description 1
- DGAQOBBTXHLIEQ-UHFFFAOYSA-N 6,7-dimethoxy-n-[3-methyl-4-(pyridin-3-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CN=C1 DGAQOBBTXHLIEQ-UHFFFAOYSA-N 0.000 description 1
- ANEGWORULZVTSS-UHFFFAOYSA-N 6,7-dimethoxy-n-[3-methyl-4-(pyridin-4-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=NC=C1 ANEGWORULZVTSS-UHFFFAOYSA-N 0.000 description 1
- FSDBQLWYAIVHET-UHFFFAOYSA-N 6,7-dimethoxy-n-[3-methyl-4-[(1-methylimidazol-2-yl)methoxy]phenyl]quinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=NC=CN1C FSDBQLWYAIVHET-UHFFFAOYSA-N 0.000 description 1
- VCWJZWZWTKXKGX-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]-7-methoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C=12C=C(OCCN(C)C)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 VCWJZWZWTKXKGX-UHFFFAOYSA-N 0.000 description 1
- HITAVLZSWOLIOE-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C12=CC(OCCN(C)C)=CC=C2N=CN=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 HITAVLZSWOLIOE-UHFFFAOYSA-N 0.000 description 1
- RSBSEVMNDIITQE-UHFFFAOYSA-N 6-[2-(methylamino)ethoxy]-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazolin-4-amine Chemical compound C12=CC(OCCNC)=CC=C2N=CN=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 RSBSEVMNDIITQE-UHFFFAOYSA-N 0.000 description 1
- JFJNDMNYNYLFLJ-UHFFFAOYSA-N 6-bromo-4-chloroquinazoline Chemical compound C1=C(Br)C=C2C(Cl)=NC=NC2=C1 JFJNDMNYNYLFLJ-UHFFFAOYSA-N 0.000 description 1
- QJRNXXLTDWMENM-UHFFFAOYSA-N 6-hydroxy-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C2=CC(O)=CC=C21 QJRNXXLTDWMENM-UHFFFAOYSA-N 0.000 description 1
- ZCUFFSHMOAEEIL-UHFFFAOYSA-N 6-methoxy-7-phenylmethoxy-1h-quinazolin-4-one Chemical compound COC1=CC2=C(O)N=CN=C2C=C1OCC1=CC=CC=C1 ZCUFFSHMOAEEIL-UHFFFAOYSA-N 0.000 description 1
- BBAJZOCQEKSQIT-UHFFFAOYSA-N 6-methoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]-7-(2,2,2-trifluoroethoxy)quinazolin-4-amine Chemical compound N1=CN=C2C=C(OCC(F)(F)F)C(OC)=CC2=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 BBAJZOCQEKSQIT-UHFFFAOYSA-N 0.000 description 1
- JLVBSBMJQUMAMW-UHFFFAOYSA-N 6-methyl-2-pyridinemethanol Chemical compound CC1=CC=CC(CO)=N1 JLVBSBMJQUMAMW-UHFFFAOYSA-N 0.000 description 1
- RQKJODSYMBPFTI-UHFFFAOYSA-N 6-n-(2-methoxyethyl)-4-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]quinazoline-4,6-diamine Chemical compound C12=CC(NCCOC)=CC=C2N=CN=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 RQKJODSYMBPFTI-UHFFFAOYSA-N 0.000 description 1
- MOBNCKURXDGQCB-UHFFFAOYSA-N 6-nitro-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C2=CC([N+](=O)[O-])=CC=C21 MOBNCKURXDGQCB-UHFFFAOYSA-N 0.000 description 1
- PMLONMIODRHERC-UHFFFAOYSA-N 7-chloro-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C=2C1=CC(Cl)=CC=2 PMLONMIODRHERC-UHFFFAOYSA-N 0.000 description 1
- URDYTQYZXZKBQT-UHFFFAOYSA-N 7-chloro-6-nitro-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C2=C1C=C(Cl)C([N+](=O)[O-])=C2 URDYTQYZXZKBQT-UHFFFAOYSA-N 0.000 description 1
- ITCNMPYZXZKAQQ-UHFFFAOYSA-N 7-methoxy-n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]-6-nitroquinazolin-4-amine Chemical compound C=12C=C([N+]([O-])=O)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 ITCNMPYZXZKAQQ-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 101100005765 Arabidopsis thaliana CDF1 gene Proteins 0.000 description 1
- 101100007579 Arabidopsis thaliana CPP1 gene Proteins 0.000 description 1
- XUUXCWCKKCZEAW-YFKPBYRVSA-N Arg-Gly Chemical compound OC(=O)CNC(=O)[C@@H](N)CCCN=C(N)N XUUXCWCKKCZEAW-YFKPBYRVSA-N 0.000 description 1
- 102000015790 Asparaginase Human genes 0.000 description 1
- 108010024976 Asparaginase Proteins 0.000 description 1
- 238000011729 BALB/c nude mouse Methods 0.000 description 1
- WOVKYSAHUYNSMH-UHFFFAOYSA-N BROMODEOXYURIDINE Natural products C1C(O)C(CO)OC1N1C(=O)NC(=O)C(Br)=C1 WOVKYSAHUYNSMH-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 101100127890 Caenorhabditis elegans let-23 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- ZLGYBERBTIVYIM-UHFFFAOYSA-N Cl.C(C)(=O)NC=1C=C2C(=NC=NC2=CC1)NC1=C(C=C(C=C1)OCC1=NC=CC=C1)F Chemical compound Cl.C(C)(=O)NC=1C=C2C(=NC=NC2=CC1)NC1=C(C=C(C=C1)OCC1=NC=CC=C1)F ZLGYBERBTIVYIM-UHFFFAOYSA-N 0.000 description 1
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 1
- 208000009849 Female Genital Neoplasms Diseases 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 206010061968 Gastric neoplasm Diseases 0.000 description 1
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000599951 Homo sapiens Insulin-like growth factor I Proteins 0.000 description 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102100037852 Insulin-like growth factor I Human genes 0.000 description 1
- 102000014150 Interferons Human genes 0.000 description 1
- 108010050904 Interferons Proteins 0.000 description 1
- FFEARJCKVFRZRR-UHFFFAOYSA-N L-Methionine Natural products CSCCC(N)C(O)=O FFEARJCKVFRZRR-UHFFFAOYSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- 229930195722 L-methionine Natural products 0.000 description 1
- 102000007651 Macrophage Colony-Stimulating Factor Human genes 0.000 description 1
- 108010046938 Macrophage Colony-Stimulating Factor Proteins 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- SGXDXUYKISDCAZ-UHFFFAOYSA-N N,N-diethylglycine Chemical compound CCN(CC)CC(O)=O SGXDXUYKISDCAZ-UHFFFAOYSA-N 0.000 description 1
- ZKGNPQKYVKXMGJ-UHFFFAOYSA-N N,N-dimethylacetamide Chemical compound CN(C)C(C)=O.CN(C)C(C)=O ZKGNPQKYVKXMGJ-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 208000002454 Nasopharyngeal Carcinoma Diseases 0.000 description 1
- 206010061306 Nasopharyngeal cancer Diseases 0.000 description 1
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- LSPANGZZENHZNJ-UHFFFAOYSA-N PD-153035 Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC1=CC=CC(Br)=C1 LSPANGZZENHZNJ-UHFFFAOYSA-N 0.000 description 1
- 108010055723 PDGF receptor tyrosine kinase Proteins 0.000 description 1
- 206010033645 Pancreatitis Diseases 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- SWEDAZLCYJDAGW-UHFFFAOYSA-N Thiophene-2-thiol Chemical compound SC1=CC=CS1 SWEDAZLCYJDAGW-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- IVTVGDXNLFLDRM-HNNXBMFYSA-N Tomudex Chemical compound C=1C=C2NC(C)=NC(=O)C2=CC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)S1 IVTVGDXNLFLDRM-HNNXBMFYSA-N 0.000 description 1
- 101710183280 Topoisomerase Proteins 0.000 description 1
- 102000009618 Transforming Growth Factors Human genes 0.000 description 1
- 108010009583 Transforming Growth Factors Proteins 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 208000002495 Uterine Neoplasms Diseases 0.000 description 1
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 1
- 208000004354 Vulvar Neoplasms Diseases 0.000 description 1
- 101100429091 Xiphophorus maculatus xmrk gene Proteins 0.000 description 1
- LUYOGRKEZGZBLY-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-(1,3-thiazol-5-yl)methanone;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CN=CS1 LUYOGRKEZGZBLY-UHFFFAOYSA-N 0.000 description 1
- OOCKRXLFEDGRGJ-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-(4-chlorophenyl)methanone;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CC=C(Cl)C=C1 OOCKRXLFEDGRGJ-UHFFFAOYSA-N 0.000 description 1
- RQYOIFHVYPMEQJ-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethanone Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 RQYOIFHVYPMEQJ-UHFFFAOYSA-N 0.000 description 1
- OBUFMHAPGJYTML-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-pyridin-2-ylmethanone;dihydrochloride Chemical compound Cl.Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=N1 OBUFMHAPGJYTML-UHFFFAOYSA-N 0.000 description 1
- QSDGYRKRSLJNHG-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-pyridin-4-ylmethanol Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(O)C1=CC=NC=C1 QSDGYRKRSLJNHG-UHFFFAOYSA-N 0.000 description 1
- RZGMJZCOXYNCEE-UHFFFAOYSA-N [2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-pyridin-4-ylmethanol;dihydrochloride Chemical compound Cl.Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(O)C1=CC=NC=C1 RZGMJZCOXYNCEE-UHFFFAOYSA-N 0.000 description 1
- RJLQWEJUDMRDEV-UHFFFAOYSA-N [2-chloro-4-[(6-hydroxyquinazolin-4-yl)amino]phenyl]-thiophen-2-ylmethanone Chemical compound C12=CC(O)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CS1 RJLQWEJUDMRDEV-UHFFFAOYSA-N 0.000 description 1
- WBYLMORIIISYSU-UHFFFAOYSA-N [2-chloro-4-[[6-[2-(methylamino)ethoxy]quinazolin-4-yl]amino]phenyl]-phenylmethanone;dihydrochloride Chemical compound Cl.Cl.C12=CC(OCCNC)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 WBYLMORIIISYSU-UHFFFAOYSA-N 0.000 description 1
- GEERTCXMMMXAGH-UHFFFAOYSA-N [2-chloro-4-[[6-[2-(methylamino)ethoxy]quinazolin-4-yl]amino]phenyl]-thiophen-2-ylmethanone;dihydrochloride Chemical compound Cl.Cl.C12=CC(OCCNC)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CS1 GEERTCXMMMXAGH-UHFFFAOYSA-N 0.000 description 1
- AEEJUNMTIPJYGW-UHFFFAOYSA-N [2-chloro-4-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-phenylmethanone Chemical compound C=12C=C(OC)C(OCCOC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 AEEJUNMTIPJYGW-UHFFFAOYSA-N 0.000 description 1
- SQOYRVKGYHMNBC-UHFFFAOYSA-N [4-(4-benzoyl-3-chloroanilino)quinazolin-6-yl] acetate;hydrochloride Chemical compound Cl.C12=CC(OC(=O)C)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 SQOYRVKGYHMNBC-UHFFFAOYSA-N 0.000 description 1
- OLLLONMDVIODMM-UHFFFAOYSA-N [4-[(6-aminoquinazolin-4-yl)amino]-2-chlorophenyl]-phenylmethanone Chemical compound C12=CC(N)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 OLLLONMDVIODMM-UHFFFAOYSA-N 0.000 description 1
- QTTABBWKPULBJE-UHFFFAOYSA-N [4-[2-fluoro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl] acetate Chemical compound C12=CC(OC(=O)C)=CC=C2N=CN=C1NC(C(=C1)F)=CC=C1OCC1=CC=CC=N1 QTTABBWKPULBJE-UHFFFAOYSA-N 0.000 description 1
- NCXFULGFMRNQCJ-UHFFFAOYSA-N [4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate;hydrochloride Chemical compound Cl.C12=CC(OC(=O)C)=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1SC1=NC=CN1C NCXFULGFMRNQCJ-UHFFFAOYSA-N 0.000 description 1
- RDPCAMPFCFLDQU-UHFFFAOYSA-N [4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate Chemical compound C12=CC(OC(=O)C)=CC=C2N=CN=C1NC(C=C1F)=CC=C1SC1=NC=CN1C RDPCAMPFCFLDQU-UHFFFAOYSA-N 0.000 description 1
- XXSHMTARPCRNIN-UHFFFAOYSA-N [4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate;dihydrochloride Chemical compound Cl.Cl.C12=CC(OC(=O)C)=CC=C2N=CN=C1NC(C=C1F)=CC=C1SC1=NC=CN1C XXSHMTARPCRNIN-UHFFFAOYSA-N 0.000 description 1
- WXTSQWRSDDIWCO-UHFFFAOYSA-N [4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-2-chlorophenyl]-phenylmethanone;hydrochloride Chemical compound Cl.C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1C(=O)C1=CC=CC=C1 WXTSQWRSDDIWCO-UHFFFAOYSA-N 0.000 description 1
- ZRTPPMIOPXRXPY-UHFFFAOYSA-N [6-methoxy-4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-7-yl] acetate Chemical compound N1=CN=C2C=C(OC(C)=O)C(OC)=CC2=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 ZRTPPMIOPXRXPY-UHFFFAOYSA-N 0.000 description 1
- CSUSEBVUHOBCHT-UHFFFAOYSA-N [7-methoxy-4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl] acetate Chemical compound C=12C=C(OC(C)=O)C(OC)=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 CSUSEBVUHOBCHT-UHFFFAOYSA-N 0.000 description 1
- ZKHQWZAMYRWXGA-KNYAHOBESA-N [[(2r,3s,4r,5r)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] dihydroxyphosphoryl hydrogen phosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)O[32P](O)(O)=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KNYAHOBESA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 229940009456 adriamycin Drugs 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N ammonium carbonate Chemical class N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000011162 ammonium carbonates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 230000002280 anti-androgenic effect Effects 0.000 description 1
- 229940046836 anti-estrogen Drugs 0.000 description 1
- 230000001833 anti-estrogenic effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000000051 antiandrogen Substances 0.000 description 1
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 1
- 239000013059 antihormonal agent Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 229960003272 asparaginase Drugs 0.000 description 1
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 description 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 1
- ZVSKZLHKADLHSD-UHFFFAOYSA-N benzanilide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CC=C1 ZVSKZLHKADLHSD-UHFFFAOYSA-N 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- RSDOASZYYCOXIB-UHFFFAOYSA-N beta-alaninamide Chemical compound NCCC(N)=O RSDOASZYYCOXIB-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229950004398 broxuridine Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- WPLXTOVHRYJKSG-UHFFFAOYSA-N butanethioamide Chemical compound CCCC(N)=S WPLXTOVHRYJKSG-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 229940097647 casodex Drugs 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- KWYZNESIGBQHJK-UHFFFAOYSA-N chloro-dimethyl-phenylsilane Chemical compound C[Si](C)(Cl)C1=CC=CC=C1 KWYZNESIGBQHJK-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 238000011461 current therapy Methods 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- CKQQMPJQZXIYMJ-UHFFFAOYSA-N dihydrate;dihydrochloride Chemical compound O.O.Cl.Cl CKQQMPJQZXIYMJ-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 201000004101 esophageal cancer Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000328 estrogen antagonist Substances 0.000 description 1
- VOHOFZNVWZWVMA-UHFFFAOYSA-N ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate Chemical compound CCOC(=O)C1=CC(OCCOC)=C(OCCOC)C=C1[N+]([O-])=O VOHOFZNVWZWVMA-UHFFFAOYSA-N 0.000 description 1
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 1
- 229960005420 etoposide Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 230000002055 immunohistochemical effect Effects 0.000 description 1
- 239000000367 immunologic factor Substances 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000012444 intercalating antibiotic Substances 0.000 description 1
- 229940079322 interferon Drugs 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002505 iron Chemical class 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 201000005243 lung squamous cell carcinoma Diseases 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- 229940099607 manganese chloride Drugs 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- PMRYVIKBURPHAH-UHFFFAOYSA-N methimazole Chemical compound CN1C=CNC1=S PMRYVIKBURPHAH-UHFFFAOYSA-N 0.000 description 1
- 229960004452 methionine Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000000394 mitotic effect Effects 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- 238000002703 mutagenesis Methods 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 description 1
- PZBATUNEVLSDIG-UHFFFAOYSA-N n-(2-chloro-4-nitrophenyl)benzenesulfonamide Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1NS(=O)(=O)C1=CC=CC=C1 PZBATUNEVLSDIG-UHFFFAOYSA-N 0.000 description 1
- JPSUAEPUEKOVDH-UHFFFAOYSA-N n-(3-chloro-4-phenoxyphenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=C1 JPSUAEPUEKOVDH-UHFFFAOYSA-N 0.000 description 1
- PCXKPJRDBUEHRV-UHFFFAOYSA-N n-(4-amino-2-chlorophenyl)benzenesulfonamide Chemical compound ClC1=CC(N)=CC=C1NS(=O)(=O)C1=CC=CC=C1 PCXKPJRDBUEHRV-UHFFFAOYSA-N 0.000 description 1
- UAJNJISUUJMOHT-UHFFFAOYSA-N n-(4-benzyl-3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1CC1=CC=CC=C1 UAJNJISUUJMOHT-UHFFFAOYSA-N 0.000 description 1
- FPMFGCIFAVECIN-UHFFFAOYSA-N n-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-6-nitroquinazolin-4-amine Chemical compound C12=CC([N+](=O)[O-])=CC=C2N=CN=C1NC(C(=C1)F)=CC=C1OCC1=CC=CC=N1 FPMFGCIFAVECIN-UHFFFAOYSA-N 0.000 description 1
- VMEQXUVZIDHHAR-UHFFFAOYSA-N n-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylphenyl]-6,7-dimethoxyquinazolin-4-amine;dihydrochloride Chemical compound Cl.Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1SC1=NC=CN1C VMEQXUVZIDHHAR-UHFFFAOYSA-N 0.000 description 1
- QWLWRKLQJOPASY-UHFFFAOYSA-N n-[3-chloro-4-(furan-3-ylmethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine;hydrochloride Chemical compound Cl.C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC=1C=COC=1 QWLWRKLQJOPASY-UHFFFAOYSA-N 0.000 description 1
- DATVKWYPAUBOHE-UHFFFAOYSA-N n-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-6-nitroquinazolin-4-amine Chemical compound C12=CC([N+](=O)[O-])=CC=C2N=CN=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 DATVKWYPAUBOHE-UHFFFAOYSA-N 0.000 description 1
- MYXOZHODRJOIGS-UHFFFAOYSA-N n-[3-chloro-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=NC=CN1C MYXOZHODRJOIGS-UHFFFAOYSA-N 0.000 description 1
- WQKJBMVLWIDDGW-UHFFFAOYSA-N n-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]-6-[2-(methylamino)ethoxy]quinazolin-4-amine Chemical compound C12=CC(OCCNC)=CC=C2N=CN=C1NC(C=C1F)=CC=C1SC1=NC=CN1C WQKJBMVLWIDDGW-UHFFFAOYSA-N 0.000 description 1
- MNZHQETUJMGRSU-UHFFFAOYSA-N n-[3-methyl-4-(pyridin-2-ylmethoxy)phenyl]-6-nitroquinazolin-4-amine Chemical compound CC1=CC(NC=2C3=CC(=CC=C3N=CN=2)[N+]([O-])=O)=CC=C1OCC1=CC=CC=N1 MNZHQETUJMGRSU-UHFFFAOYSA-N 0.000 description 1
- LDNDJYSZYYZWQU-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-chlorophenyl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C=12C=C(OC)C(OC)=CC2=NC=NC=1NC(C=C1Cl)=CC=C1S(=O)(=O)C1=CC=CC=C1 LDNDJYSZYYZWQU-UHFFFAOYSA-N 0.000 description 1
- LVMHDSAEBJTFGP-UHFFFAOYSA-N n-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]acetamide Chemical compound C12=CC(NC(=O)C)=CC=C2N=CN=C1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 LVMHDSAEBJTFGP-UHFFFAOYSA-N 0.000 description 1
- HWVOWKVXWMUGMS-UHFFFAOYSA-N n-ethyl-2-hydroxyacetamide Chemical compound CCNC(=O)CO HWVOWKVXWMUGMS-UHFFFAOYSA-N 0.000 description 1
- SWPMNMYLORDLJE-UHFFFAOYSA-N n-ethylprop-2-enamide Chemical compound CCNC(=O)C=C SWPMNMYLORDLJE-UHFFFAOYSA-N 0.000 description 1
- FZJYKFBXZVSIRY-UHFFFAOYSA-N n-ethylprop-2-ynamide Chemical compound CCNC(=O)C#C FZJYKFBXZVSIRY-UHFFFAOYSA-N 0.000 description 1
- NCCHARWOCKOHIH-UHFFFAOYSA-N n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1 NCCHARWOCKOHIH-UHFFFAOYSA-N 0.000 description 1
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 description 1
- WBVNBTCOCIGBDL-UHFFFAOYSA-N n-methylprop-2-ynamide Chemical compound CNC(=O)C#C WBVNBTCOCIGBDL-UHFFFAOYSA-N 0.000 description 1
- QJQAMHYHNCADNR-UHFFFAOYSA-N n-methylpropanamide Chemical compound CCC(=O)NC QJQAMHYHNCADNR-UHFFFAOYSA-N 0.000 description 1
- 201000011216 nasopharynx carcinoma Diseases 0.000 description 1
- 208000025402 neoplasm of esophagus Diseases 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229940085033 nolvadex Drugs 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229940080469 phosphocellulose Drugs 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 238000006366 phosphorylation reaction Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- FJVZDOGVDJCCCR-UHFFFAOYSA-M potassium periodate Chemical compound [K+].[O-]I(=O)(=O)=O FJVZDOGVDJCCCR-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- VZOPRCCTKLAGPN-ZFJVMAEJSA-L potassium;sodium;(2r,3r)-2,3-dihydroxybutanedioate;tetrahydrate Chemical compound O.O.O.O.[Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O VZOPRCCTKLAGPN-ZFJVMAEJSA-L 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- WPZSAUFQHYFIPG-UHFFFAOYSA-N propanethioamide Chemical compound CCC(N)=S WPZSAUFQHYFIPG-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical compound CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 1
- ADYNJDNYIVZXNK-UHFFFAOYSA-N quinazoline;dihydrochloride Chemical compound Cl.Cl.N1=CN=CC2=CC=CC=C21 ADYNJDNYIVZXNK-UHFFFAOYSA-N 0.000 description 1
- VBUBADWLHFZFDK-UHFFFAOYSA-N quinazoline;hydrochloride Chemical compound Cl.N1=CN=CC2=CC=CC=C21 VBUBADWLHFZFDK-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 229940124617 receptor tyrosine kinase inhibitor Drugs 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000012502 risk assessment Methods 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 1
- PVGBHEUCHKGFQP-UHFFFAOYSA-N sodium;n-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylacetamide Chemical compound [Na+].CC(=O)NS(=O)(=O)C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 PVGBHEUCHKGFQP-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 208000017572 squamous cell neoplasm Diseases 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 229960001603 tamoxifen Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- ZPHGMBGIFODUMF-UHFFFAOYSA-N thiophen-2-ylmethanol Chemical compound OCC1=CC=CS1 ZPHGMBGIFODUMF-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 201000002510 thyroid cancer Diseases 0.000 description 1
- 208000013076 thyroid tumor Diseases 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- VJCHUDDPWPQOLH-UHFFFAOYSA-N trimethyl(1,3-thiazol-2-yl)silane Chemical compound C[Si](C)(C)C1=NC=CS1 VJCHUDDPWPQOLH-UHFFFAOYSA-N 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 206010046766 uterine cancer Diseases 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 229960003048 vinblastine Drugs 0.000 description 1
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 1
- 201000005102 vulva cancer Diseases 0.000 description 1
- 201000004916 vulva carcinoma Diseases 0.000 description 1
- 208000013013 vulvar carcinoma Diseases 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/08—Drugs for disorders of the urinary system of the prostate
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/94—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Urology & Nephrology (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyridine Compounds (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9422866A GB9422866D0 (en) | 1994-11-12 | 1994-11-12 | Aniline derivatives |
| GB9507308.6 | 1995-04-07 | ||
| GBGB9507308.6A GB9507308D0 (en) | 1995-04-07 | 1995-04-07 | Aniline derivatives |
| GB9422866.5 | 1995-04-07 | ||
| PCT/GB1995/002606 WO1996015118A1 (en) | 1994-11-12 | 1995-11-08 | Aniline derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH10508616A JPH10508616A (ja) | 1998-08-25 |
| JP4011109B2 true JP4011109B2 (ja) | 2007-11-21 |
Family
ID=26305974
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP51581696A Expired - Fee Related JP4011109B2 (ja) | 1994-11-12 | 1995-11-08 | アニリン誘導体 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5821246A (show.php) |
| EP (1) | EP0790986B1 (show.php) |
| JP (1) | JP4011109B2 (show.php) |
| AT (1) | ATE175962T1 (show.php) |
| AU (1) | AU703328B2 (show.php) |
| CA (1) | CA2200871C (show.php) |
| DE (1) | DE69507505T2 (show.php) |
| DK (1) | DK0790986T3 (show.php) |
| ES (1) | ES2128092T3 (show.php) |
| FI (1) | FI119933B (show.php) |
| IL (1) | IL115959A (show.php) |
| MX (1) | MX9702956A (show.php) |
| NO (1) | NO307178B1 (show.php) |
| NZ (1) | NZ294917A (show.php) |
| TW (1) | TW321649B (show.php) |
| WO (1) | WO1996015118A1 (show.php) |
Families Citing this family (134)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6645969B1 (en) | 1991-05-10 | 2003-11-11 | Aventis Pharmaceuticals Inc. | Aryl and heteroaryl quinazoline compounds which inhibit CSF-1R receptor tyrosine kinase |
| TW321649B (show.php) * | 1994-11-12 | 1997-12-01 | Zeneca Ltd | |
| GB9424233D0 (en) * | 1994-11-30 | 1995-01-18 | Zeneca Ltd | Quinazoline derivatives |
| GB9508535D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quinazoline derivative |
| GB9508537D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quinazoline derivatives |
| GB9508538D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quinazoline derivatives |
| GB9508565D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quiazoline derivative |
| AU5343096A (en) * | 1995-04-27 | 1996-11-18 | Zeneca Limited | Quinazoline derivatives |
| US5747498A (en) | 1996-05-28 | 1998-05-05 | Pfizer Inc. | Alkynyl and azido-substituted 4-anilinoquinazolines |
| GB9514265D0 (en) * | 1995-07-13 | 1995-09-13 | Wellcome Found | Hetrocyclic compounds |
| GB9624482D0 (en) * | 1995-12-18 | 1997-01-15 | Zeneca Phaema S A | Chemical compounds |
| US5760041A (en) * | 1996-02-05 | 1998-06-02 | American Cyanamid Company | 4-aminoquinazoline EGFR Inhibitors |
| CN1125817C (zh) | 1996-02-13 | 2003-10-29 | 曾尼卡有限公司 | 作为vegf抑制剂的喹唑啉衍生物 |
| GB9603097D0 (en) * | 1996-02-14 | 1996-04-10 | Zeneca Ltd | Quinazoline compounds |
| GB9603095D0 (en) * | 1996-02-14 | 1996-04-10 | Zeneca Ltd | Quinazoline derivatives |
| JP4464466B2 (ja) | 1996-03-05 | 2010-05-19 | アストラゼネカ・ユーケイ・リミテッド | 4―アニリノキナゾリン誘導体 |
| PL190489B1 (pl) | 1996-04-12 | 2005-12-30 | Warner Lambert Co | Nieodwracalne inhibitory kinaz tyrozyny, kompozycja farmaceutyczna je zawierająca i ich zastosowanie |
| GB9607729D0 (en) * | 1996-04-13 | 1996-06-19 | Zeneca Ltd | Quinazoline derivatives |
| KR100365312B1 (ko) | 1996-06-27 | 2003-03-06 | 얀센 파마슈티카 엔.브이. | N-[4-(헤테로아릴메틸)페닐]헤테로아릴아민 |
| HRP970371A2 (en) | 1996-07-13 | 1998-08-31 | Kathryn Jane Smith | Heterocyclic compounds |
| ID19609A (id) | 1996-07-13 | 1998-07-23 | Glaxo Group Ltd | Senyawa-senyawa heterosiklik |
| GB9718972D0 (en) | 1996-09-25 | 1997-11-12 | Zeneca Ltd | Chemical compounds |
| DE19642529A1 (de) | 1996-10-15 | 1998-04-16 | Bayer Ag | Aminophenolderivate |
| US6002008A (en) * | 1997-04-03 | 1999-12-14 | American Cyanamid Company | Substituted 3-cyano quinolines |
| JP4308919B2 (ja) | 1997-04-25 | 2009-08-05 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | ファルネシルトランスフェラーゼ阻害性キナゾリノン類 |
| WO1998050038A1 (en) * | 1997-05-06 | 1998-11-12 | American Cyanamid Company | Use of quinazoline compounds for the treatment of polycystic kidney disease |
| US5929080A (en) * | 1997-05-06 | 1999-07-27 | American Cyanamid Company | Method of treating polycystic kidney disease |
| ZA986732B (en) * | 1997-07-29 | 1999-02-02 | Warner Lambert Co | Irreversible inhibitiors of tyrosine kinases |
| TW436485B (en) * | 1997-08-01 | 2001-05-28 | American Cyanamid Co | Substituted quinazoline derivatives |
| US6251912B1 (en) | 1997-08-01 | 2001-06-26 | American Cyanamid Company | Substituted quinazoline derivatives |
| DE69838172T2 (de) | 1997-08-22 | 2008-04-10 | Astrazeneca Ab | Oxindolylchinazolinderivate als angiogenesehemmer |
| US6323209B1 (en) | 1997-11-06 | 2001-11-27 | American Cyanamid Company | Method of treating or inhibiting colonic polyps |
| GB9800575D0 (en) * | 1998-01-12 | 1998-03-11 | Glaxo Group Ltd | Heterocyclic compounds |
| GB9800569D0 (en) * | 1998-01-12 | 1998-03-11 | Glaxo Group Ltd | Heterocyclic compounds |
| WO1999038845A1 (en) | 1998-01-29 | 1999-08-05 | Tularik Inc. | Ppar-gamma modulators |
| US6583157B2 (en) | 1998-01-29 | 2003-06-24 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| US6706721B1 (en) | 1998-04-29 | 2004-03-16 | Osi Pharmaceuticals, Inc. | N-(3-ethynylphenylamino)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine mesylate anhydrate and monohydrate |
| IL139641A0 (en) | 1998-05-28 | 2002-02-10 | Parker Hughes Inst | Quinazolines for treating brain tumor |
| US6384223B1 (en) | 1998-07-30 | 2002-05-07 | American Home Products Corporation | Substituted quinazoline derivatives |
| US6258820B1 (en) * | 1999-03-19 | 2001-07-10 | Parker Hughes Institute | Synthesis and anti-tumor activity of 6,7-dialkoxy-4-phenylamino-quinazolines |
| US6399743B1 (en) | 1999-05-14 | 2002-06-04 | Dept. Of Veterans Affairs | Isolation and characterization of a rat epidermal growth factor related protein |
| US7049410B2 (en) * | 1999-05-14 | 2006-05-23 | Majumdar Adhip P N | Antibodies to a novel EGF-receptor related protein (ERRP) |
| ES2437103T3 (es) * | 1999-06-30 | 2014-01-08 | Amgen Inc. | Compuestos para la modulacion de la actividad de PPAR gamma |
| US7041691B1 (en) | 1999-06-30 | 2006-05-09 | Amgen Inc. | Compounds for the modulation of PPARγ activity |
| US6933299B1 (en) | 1999-07-09 | 2005-08-23 | Smithkline Beecham Corporation | Anilinoquinazolines as protein tyrosine kinase inhibitors |
| DE60037020T2 (de) | 1999-07-09 | 2008-08-21 | Glaxo Group Ltd., Greenford | Anilinochinazoline als protein-tyrosin-kinasehemmer |
| CN1391561A (zh) * | 1999-09-21 | 2003-01-15 | 阿斯特拉曾尼卡有限公司 | 喹唑啉化合物和含有喹唑啉化合物的药物组合物 |
| JP4870304B2 (ja) * | 1999-09-21 | 2012-02-08 | アストラゼネカ アクチボラグ | キナゾリン誘導体およびそれらの医薬品としての使用 |
| IL149034A0 (en) | 1999-11-05 | 2002-11-10 | Astrazeneca Ab | Quinazoline derivatives as vegf inhibitors |
| UA74803C2 (uk) | 1999-11-11 | 2006-02-15 | Осі Фармасьютікалз, Інк. | Стійкий поліморф гідрохлориду n-(3-етинілфеніл)-6,7-біс(2-метоксіетокси)-4-хіназолінаміну, спосіб його одержання (варіанти) та фармацевтичне застосування |
| US7087613B2 (en) * | 1999-11-11 | 2006-08-08 | Osi Pharmaceuticals, Inc. | Treating abnormal cell growth with a stable polymorph of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine hydrochloride |
| AU779695B2 (en) * | 2000-04-07 | 2005-02-10 | Astrazeneca Ab | Quinazoline compounds |
| WO2001082916A2 (en) | 2000-05-03 | 2001-11-08 | Tularik Inc. | Combination therapeutic compositions and methods of use |
| UA73993C2 (uk) | 2000-06-06 | 2005-10-17 | Астразенека Аб | Хіназолінові похідні для лікування пухлин та фармацевтична композиція |
| EA005525B1 (ru) * | 2000-06-22 | 2005-04-28 | Пфайзер Продактс Инк. | Замещенные бициклические производные для лечения аномального роста клеток |
| US20030171399A1 (en) | 2000-06-28 | 2003-09-11 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| TWI307339B (en) * | 2000-06-30 | 2009-03-11 | Glaxo Group Ltd | Quinazoline ditosylate salt comprounds |
| US7115615B2 (en) | 2000-08-21 | 2006-10-03 | Astrazeneca | Quinazoline derivatives |
| EP1326859A1 (en) | 2000-10-13 | 2003-07-16 | AstraZeneca AB | Quinazoline derivatives with anti-tumour activity |
| ATE502928T1 (de) | 2000-11-01 | 2011-04-15 | Millennium Pharm Inc | Stickstoffhaltige heterozyklische verbindungen und verfahren zu deren herstellung |
| US7105682B2 (en) | 2001-01-12 | 2006-09-12 | Amgen Inc. | Substituted amine derivatives and methods of use |
| US7102009B2 (en) | 2001-01-12 | 2006-09-05 | Amgen Inc. | Substituted amine derivatives and methods of use |
| JP2002293773A (ja) * | 2001-03-30 | 2002-10-09 | Sumika Fine Chemicals Co Ltd | キナゾリン誘導体の製造方法 |
| US7132427B2 (en) | 2001-06-21 | 2006-11-07 | Ariad Pharmaceuticals, Inc. | Quinazolines and uses thereof |
| GB0126433D0 (en) * | 2001-11-03 | 2002-01-02 | Astrazeneca Ab | Compounds |
| ATE423104T1 (de) * | 2001-11-03 | 2009-03-15 | Astrazeneca Ab | Quinazolin derivate als antitumor-mittel |
| EP1448551B1 (en) * | 2001-11-30 | 2007-10-31 | OSI Pharmaceuticals, Inc. | Processes for the preparation of substituted bicyclic derivatives for the treatment of abnormal cell growth |
| EP1463506B1 (en) | 2001-12-24 | 2009-10-21 | Astrazeneca AB | Substituted quinazoline derivatives as inhibitors of aurora kinases |
| CA2473796A1 (en) | 2002-01-17 | 2003-07-31 | Neurogen Corporation | Substituted quinazolin-4-ylamine analogues |
| TW200813014A (en) * | 2002-03-28 | 2008-03-16 | Astrazeneca Ab | Quinazoline derivatives |
| US6924285B2 (en) | 2002-03-30 | 2005-08-02 | Boehringer Ingelheim Pharma Gmbh & Co. | Bicyclic heterocyclic compounds, pharmaceutical compositions containing these compounds, their use and process for preparing them |
| EP1521747B1 (en) | 2002-07-15 | 2018-09-05 | Symphony Evolution, Inc. | Receptor-type kinase modulators and methods of use |
| US7488823B2 (en) * | 2003-11-10 | 2009-02-10 | Array Biopharma, Inc. | Cyanoguanidines and cyanoamidines as ErbB2 and EGFR inhibitors |
| RU2357971C2 (ru) | 2002-12-24 | 2009-06-10 | Астразенека Аб | Производные фосфонооксихиназолина и их фармацевтическое применение |
| WO2004069145A2 (en) * | 2003-02-07 | 2004-08-19 | Dr. Reddy's Laboratories Ltd. | Anticancer compounds, process for their preparation and pharmaceutical compositions containing them |
| MXPA05011076A (es) * | 2003-04-16 | 2006-01-24 | Astrazeneca Ab | Derivados de quinazolina para el tratamiento de cancer. |
| GB0309009D0 (en) * | 2003-04-22 | 2003-05-28 | Astrazeneca Ab | Quinazoline derivatives |
| GB0309850D0 (en) * | 2003-04-30 | 2003-06-04 | Astrazeneca Ab | Quinazoline derivatives |
| EP1636195A1 (en) * | 2003-05-27 | 2006-03-22 | Pfizer Products Inc. | Quinazolines and pyrido[3,4-d]pyrimidines as receptor tyrosine kinase inhibitors |
| ES2308182T3 (es) * | 2003-06-02 | 2008-12-01 | Astrazeneca Ab | Derivadosde (3-((quinazolin-4-il)amino)-1h-pirazol-1-il)acetamida y compuestos relacionados como inhibidores de quinasas aurora para el tratamiento de enfermedades proliferativas tales como el cancer. |
| GB0317665D0 (en) | 2003-07-29 | 2003-09-03 | Astrazeneca Ab | Qinazoline derivatives |
| CA2533345A1 (en) * | 2003-07-29 | 2005-02-10 | Astrazeneca Ab | Piperidyl-quinazoline derivatives as tyrosine kinase inhibitors |
| US7501427B2 (en) | 2003-08-14 | 2009-03-10 | Array Biopharma, Inc. | Quinazoline analogs as receptor tyrosine kinase inhibitors |
| US7452895B2 (en) * | 2003-08-14 | 2008-11-18 | Array Biopharma Inc. | Quinazoline analogs as receptor tyrosine kinase inhibitors |
| ATE353888T1 (de) * | 2003-09-19 | 2007-03-15 | Astrazeneca Ab | Chinazolinderivate |
| PL1667992T3 (pl) * | 2003-09-19 | 2007-05-31 | Astrazeneca Ab | Pochodne chinazoliny |
| US20070043010A1 (en) * | 2003-09-25 | 2007-02-22 | Astrazeneca Uk Limited | Quinazoline derivatives |
| SI2392564T1 (sl) | 2003-09-26 | 2014-02-28 | Exelixis, Inc. | c-Met modulatorji in postopki uporabe |
| US7223761B2 (en) | 2003-10-03 | 2007-05-29 | Amgen Inc. | Salts and polymorphs of a potent antidiabetic compound |
| JP2007512255A (ja) | 2003-11-13 | 2007-05-17 | アンビット バイオサイエンシス コーポレーション | キナーゼ調節因子としての尿素誘導体 |
| GB0326459D0 (en) | 2003-11-13 | 2003-12-17 | Astrazeneca Ab | Quinazoline derivatives |
| UA82577C2 (en) | 2003-12-23 | 2008-04-25 | Пфайзер Инк. | Quinoline derivatives |
| EP1709007A1 (en) * | 2004-01-22 | 2006-10-11 | Altana Pharma AG | N-4-(6-(heteo)aryl-pyrimidin-4-ylaminophenyl)-benzenesulfonamides as kinase inhibitors |
| EP1755394A4 (en) * | 2004-04-16 | 2009-08-05 | Smithkline Beecham Corp | METHOD OF TREATING CANCER |
| MXPA06012756A (es) * | 2004-05-06 | 2007-01-16 | Warner Lambert Co | 4-fenilamino-quinazolin-6-il-amidas. |
| AU2005256659A1 (en) * | 2004-06-28 | 2006-01-05 | Nycomed Gmbh | 4,6-disubstituted pyrimidines and their use as protein kinase inhibitors |
| CA2581516C (en) * | 2004-10-12 | 2013-06-11 | Astrazeneca Ab | Quinazoline derivatives |
| DE602005026865D1 (de) | 2004-12-14 | 2011-04-21 | Astrazeneca Ab | Pyrazolopyrimidinverbindungen als antitumormittel |
| UY29398A1 (es) | 2005-02-26 | 2006-10-02 | Astrazeneca Ab | Derivados de quinazolinas, sussales farmacéuticamente aceptables, composiciones que los contienen, procedimientos de preparación y aplicacións. |
| JP2006347936A (ja) * | 2005-06-15 | 2006-12-28 | Bayer Cropscience Ag | 殺虫性ベンズアニリド類 |
| EP1928861B1 (en) | 2005-09-20 | 2010-11-17 | AstraZeneca AB | 4- (ih-indazol-5-yl-amino)-quinazoline compounds as erbb receptor tyrosine kinase inhibitors for the treatment of cancer |
| GB2431927B (en) | 2005-11-04 | 2010-03-17 | Amira Pharmaceuticals Inc | 5-Lipoxygenase-activating protein (FLAP) inhibitors |
| US7977359B2 (en) | 2005-11-04 | 2011-07-12 | Amira Pharmaceuticals, Inc. | 5-lipdxygenase-activating protein (FLAP) inhibitors |
| US8399666B2 (en) | 2005-11-04 | 2013-03-19 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
| BRPI0618668B1 (pt) | 2005-11-15 | 2021-09-21 | Array Biopharma Inc | Compostos inibidores dos receptores de tirosina quinase do tipo i, composições compreendendo tais compostos, e seus usos |
| WO2007063291A1 (en) | 2005-12-02 | 2007-06-07 | Astrazeneca Ab | 4-anilino-substituted quinazoline derivatives as tyrosine kinase inhibitors |
| CN101003514A (zh) | 2006-01-20 | 2007-07-25 | 上海艾力斯医药科技有限公司 | 喹唑啉衍生物、其制备方法及用途 |
| JP2009528336A (ja) * | 2006-03-02 | 2009-08-06 | アストラゼネカ アクチボラグ | キノリン誘導体 |
| UY30183A1 (es) * | 2006-03-02 | 2007-10-31 | Astrazeneca Ab | Derivados de quinolina |
| US20070231298A1 (en) * | 2006-03-31 | 2007-10-04 | Cell Genesys, Inc. | Cytokine-expressing cancer immunotherapy combinations |
| US20090118314A1 (en) | 2006-06-01 | 2009-05-07 | Japan As Represented By Director General Of Agency Center | Tumor suppressor |
| EP1921070A1 (de) | 2006-11-10 | 2008-05-14 | Boehringer Ingelheim Pharma GmbH & Co. KG | Bicyclische Heterocyclen, diese Verbindungen enthaltende Arzneimittel, deren Verwendung und Verfahren zu ihrer Herstelllung |
| US7998949B2 (en) | 2007-02-06 | 2011-08-16 | Boehringer Ingelheim International Gmbh | Bicyclic heterocycles, drugs containing said compounds, use thereof, and method for production thereof |
| CA2703767A1 (en) | 2007-10-29 | 2009-05-07 | Natco Pharma Limited | Novel 4-(tetrazol-5-yl)-quinazoline derivatives as anti cancer agents |
| CA2711582A1 (en) | 2008-02-07 | 2009-08-13 | Boehringer Ingelheim International Gmbh | Spirocyclic heterocycles, formulations containing said compounds, use thereof and processes for the preparation thereof |
| CA2723989C (en) | 2008-05-13 | 2017-04-25 | Astrazeneca Ab | Fumarate salt of 4-(3-chloro-2-fluoroanilino)-7-methoxy-6-{[1-(n-methylcarbamoylmethyl)piperidin-4-yl]oxy}quinazoline |
| AU2009325091A1 (en) | 2008-05-23 | 2010-06-17 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein inhibitor |
| US8648191B2 (en) | 2008-08-08 | 2014-02-11 | Boehringer Ingelheim International Gmbh | Cyclohexyloxy substituted heterocycles, pharmaceutical compositions containing these compounds and processes for preparing them |
| US8546431B2 (en) | 2008-10-01 | 2013-10-01 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
| EP2241565A1 (en) | 2009-01-15 | 2010-10-20 | Universität Leipzig | Aurora kinase inhibitors compounds |
| MX2011007620A (es) | 2009-01-16 | 2011-11-04 | Exelixis Inc | Sal de malato de n(4-{[6,7-bis(metiloxi)quinolin-4-il]oxi}fenil)-n '-(4-fluorofenil) ciclopropano-1,1-dicarboxamida, y sus formas cristalinas para el tratamiento de cancer. |
| UA108618C2 (uk) | 2009-08-07 | 2015-05-25 | Застосування c-met-модуляторів в комбінації з темозоломідом та/або променевою терапією для лікування раку | |
| ES2781299T3 (es) | 2009-11-13 | 2020-09-01 | Daiichi Sankyo Europe Gmbh | Materiales y métodos para tratar o prevenir las enfermedades asociadas a HER-3 |
| CA2815154A1 (en) | 2010-08-06 | 2012-02-09 | U3 Pharma Gmbh | Use of her3 binding agents in prostate treatment |
| KR20130016041A (ko) * | 2011-08-04 | 2013-02-14 | 재단법인 의약바이오컨버젼스연구단 | 신규한 아닐린 유도체 및 이의 용도 |
| CN102603496A (zh) * | 2011-09-26 | 2012-07-25 | 盘锦兴福化工有限公司 | 2,3—二氟苯丁醚的合成方法 |
| LT3046584T (lt) | 2013-09-16 | 2017-10-10 | Astrazeneca Ab | Terapinės polimerinės nanodalelės ir jų gamybos būdai ir panaudojimas |
| UY36547A (es) | 2015-02-05 | 2016-06-01 | Bayer Cropscience Ag | Derivados heterocíclicos condensados bicíclicos sustituidos por 2-(het)arilo como pesticidas |
| CA2981886A1 (en) | 2015-04-16 | 2016-10-20 | Icahn School Of Medicine At Mount Sinai | Ksr antagonists |
| EP3896066A3 (de) | 2015-08-07 | 2021-12-08 | Bayer CropScience Aktiengesellschaft | 2-(het)aryl-substituierte kondensierte heterocyclen-derivate als schädlingsbekämpfungsmittel |
| CN105461642B (zh) * | 2015-12-03 | 2017-03-22 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1505及其制备方法和应用 |
| CN105399689B (zh) * | 2015-12-03 | 2017-03-01 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1503及其制备方法和应用 |
| CN105418517B (zh) * | 2015-12-03 | 2017-03-22 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1509及其制备方法和应用 |
| CN108358798A (zh) * | 2018-02-12 | 2018-08-03 | 黑龙江鑫创生物科技开发有限公司 | 一种微通道反应器合成厄洛替尼中间体的方法 |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3266990A (en) * | 1963-09-24 | 1966-08-16 | Warner Lambert Pharmaceutical | Derivatives of quinazoline |
| JPS5538325A (en) * | 1978-09-11 | 1980-03-17 | Sankyo Co Ltd | 4-anilinoquinazoline derivative and its preparation |
| US4343940A (en) * | 1979-02-13 | 1982-08-10 | Mead Johnson & Company | Anti-tumor quinazoline compounds |
| GB2160201B (en) * | 1984-06-14 | 1988-05-11 | Wyeth John & Brother Ltd | Quinazoline and cinnoline derivatives |
| DE68917485T2 (de) * | 1988-01-23 | 1995-02-09 | Kyowa Hakko Kogyo Kk | Pyridazinon-Derivate und diese enthaltende pharmazeutische Zubereitungen. |
| IL89029A (en) * | 1988-01-29 | 1993-01-31 | Lilly Co Eli | Fungicidal quinoline and cinnoline derivatives, compositions containing them, and fungicidal methods of using them |
| CA2079113A1 (en) * | 1991-02-22 | 1992-08-23 | Calgene, Inc. | Seed plant fatty acyl reductase proteins and genes |
| US5710158A (en) * | 1991-05-10 | 1998-01-20 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Aryl and heteroaryl quinazoline compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| ES2108120T3 (es) * | 1991-05-10 | 1997-12-16 | Rhone Poulenc Rorer Int | Compuestos bis arilicos y heteroarilicos mono- y biciclicos que inhiben tirosina quinasa receptora de egf y/o pdgf. |
| US5721237A (en) * | 1991-05-10 | 1998-02-24 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Protein tyrosine kinase aryl and heteroaryl quinazoline compounds having selective inhibition of HER-2 autophosphorylation properties |
| NZ243082A (en) * | 1991-06-28 | 1995-02-24 | Ici Plc | 4-anilino-quinazoline derivatives; pharmaceutical compositions, preparatory processes, and use thereof |
| GB9300059D0 (en) * | 1992-01-20 | 1993-03-03 | Zeneca Ltd | Quinazoline derivatives |
| US6177401B1 (en) * | 1992-11-13 | 2001-01-23 | Max-Planck-Gesellschaft Zur Forderung Der Wissenschaften | Use of organic compounds for the inhibition of Flk-1 mediated vasculogenesis and angiogenesis |
| GB9323290D0 (en) * | 1992-12-10 | 1994-01-05 | Zeneca Ltd | Quinazoline derivatives |
| GB9314893D0 (en) * | 1993-07-19 | 1993-09-01 | Zeneca Ltd | Quinazoline derivatives |
| GB9314884D0 (en) * | 1993-07-19 | 1993-09-01 | Zeneca Ltd | Tricyclic derivatives |
| CA2148082A1 (en) * | 1993-09-03 | 1995-03-09 | Daisuke Machii | Imidazoquinazoline derivatives |
| GB9325217D0 (en) * | 1993-12-09 | 1994-02-09 | Zeneca Ltd | Pyrimidine derivatives |
| US5700823A (en) * | 1994-01-07 | 1997-12-23 | Sugen, Inc. | Treatment of platelet derived growth factor related disorders such as cancers |
| IL112248A0 (en) * | 1994-01-25 | 1995-03-30 | Warner Lambert Co | Tricyclic heteroaromatic compounds and pharmaceutical compositions containing them |
| IL112249A (en) * | 1994-01-25 | 2001-11-25 | Warner Lambert Co | Pharmaceutical compositions containing di and tricyclic pyrimidine derivatives for inhibiting tyrosine kinases of the epidermal growth factor receptor family and some new such compounds |
| HUT76291A (en) * | 1994-02-23 | 1997-07-28 | Pfizer | 4-heterocyclyl-substituted quinazoline derivatives and pharmaceutical compositions containing them |
| WO1995024190A2 (en) * | 1994-03-07 | 1995-09-14 | Sugen, Inc. | Receptor tyrosine kinase inhibitors for inhibiting cell proliferative disorders and compositions thereof |
| ES2109796T3 (es) * | 1994-05-03 | 1998-01-16 | Ciba Geigy Ag | Derivados de pirrolopirimidilo con efecto antiproliferante. |
| TW414798B (en) * | 1994-09-07 | 2000-12-11 | Thomae Gmbh Dr K | Pyrimido (5,4-d) pyrimidines, medicaments comprising these compounds, their use and processes for their preparation |
| GB9510757D0 (en) * | 1994-09-19 | 1995-07-19 | Wellcome Found | Therapeuticaly active compounds |
| TW321649B (show.php) * | 1994-11-12 | 1997-12-01 | Zeneca Ltd | |
| GB9424233D0 (en) * | 1994-11-30 | 1995-01-18 | Zeneca Ltd | Quinazoline derivatives |
| AU5108196A (en) * | 1995-03-20 | 1996-10-08 | Dr. Karl Thomae Gmbh | Imidazoquinazolines, drugs containing these compounds, their use and process for their preparation |
| EP0817775B1 (en) * | 1995-03-30 | 2001-09-12 | Pfizer Inc. | Quinazoline derivatives |
| ATE195123T1 (de) * | 1995-04-03 | 2000-08-15 | Novartis Erfind Verwalt Gmbh | Pyrazolderivate und verfahren zu deren herstellung |
| GB9508538D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quinazoline derivatives |
| GB9508535D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quinazoline derivative |
| GB9508537D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quinazoline derivatives |
| GB9508565D0 (en) * | 1995-04-27 | 1995-06-14 | Zeneca Ltd | Quiazoline derivative |
| AU5343096A (en) * | 1995-04-27 | 1996-11-18 | Zeneca Limited | Quinazoline derivatives |
| IL117923A (en) * | 1995-05-03 | 2000-06-01 | Warner Lambert Co | Anti-cancer pharmaceutical compositions containing polysubstituted pyrido¬2,3-d¾pyrimidine derivatives and certain such novel compounds |
| AU716993B2 (en) * | 1995-05-12 | 2000-03-16 | Neurogen Corporation | Novel deazapurine derivatives; a new class of CRF1 specific ligands |
| WO1996040142A1 (en) * | 1995-06-07 | 1996-12-19 | Pfizer Inc. | Heterocyclic ring-fused pyrimidine derivatives |
| AU5984296A (en) * | 1995-06-07 | 1996-12-30 | Sugen, Inc. | Quinazolines and pharmaceutical compositions |
| CA2224435C (en) * | 1995-07-06 | 2008-08-05 | Novartis Ag | Pyrrolopyrimidines and processes for the preparation thereof |
| GB9514265D0 (en) * | 1995-07-13 | 1995-09-13 | Wellcome Found | Hetrocyclic compounds |
| GB9520822D0 (en) * | 1995-10-11 | 1995-12-13 | Wellcome Found | Therapeutically active compounds |
| AR004010A1 (es) * | 1995-10-11 | 1998-09-30 | Glaxo Group Ltd | Compuestos heterociclicos |
| BR9607089A (pt) * | 1995-11-14 | 1997-11-11 | Pharmacia & Upjohn Spa | Compostos de pirimidina condensada biciclica composição farmacéutica utilização e produtos que contém os mesmos e processo para a preparação desses compostos |
| US5760041A (en) * | 1996-02-05 | 1998-06-02 | American Cyanamid Company | 4-aminoquinazoline EGFR Inhibitors |
-
1995
- 1995-10-27 TW TW084111357A patent/TW321649B/zh not_active IP Right Cessation
- 1995-11-08 CA CA002200871A patent/CA2200871C/en not_active Expired - Fee Related
- 1995-11-08 DE DE69507505T patent/DE69507505T2/de not_active Expired - Lifetime
- 1995-11-08 AU AU38130/95A patent/AU703328B2/en not_active Ceased
- 1995-11-08 JP JP51581696A patent/JP4011109B2/ja not_active Expired - Fee Related
- 1995-11-08 ES ES95936044T patent/ES2128092T3/es not_active Expired - Lifetime
- 1995-11-08 US US08/836,362 patent/US5821246A/en not_active Expired - Lifetime
- 1995-11-08 DK DK95936044T patent/DK0790986T3/da active
- 1995-11-08 MX MX9702956A patent/MX9702956A/es unknown
- 1995-11-08 WO PCT/GB1995/002606 patent/WO1996015118A1/en not_active Ceased
- 1995-11-08 EP EP95936044A patent/EP0790986B1/en not_active Expired - Lifetime
- 1995-11-08 NZ NZ294917A patent/NZ294917A/xx not_active IP Right Cessation
- 1995-11-08 AT AT95936044T patent/ATE175962T1/de active
- 1995-11-12 IL IL11595995A patent/IL115959A/en not_active IP Right Cessation
-
1997
- 1997-05-07 FI FI971970A patent/FI119933B/fi not_active IP Right Cessation
- 1997-05-09 NO NO972152A patent/NO307178B1/no not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| WO1996015118A1 (en) | 1996-05-23 |
| MX9702956A (es) | 1997-06-28 |
| FI971970A7 (fi) | 1997-05-07 |
| IL115959A (en) | 2004-06-20 |
| IL115959A0 (en) | 1996-01-31 |
| US5821246A (en) | 1998-10-13 |
| FI119933B (fi) | 2009-05-15 |
| TW321649B (show.php) | 1997-12-01 |
| EP0790986A1 (en) | 1997-08-27 |
| FI971970A0 (fi) | 1997-05-07 |
| EP0790986B1 (en) | 1999-01-20 |
| CA2200871A1 (en) | 1996-05-23 |
| CA2200871C (en) | 2008-08-19 |
| JPH10508616A (ja) | 1998-08-25 |
| DE69507505D1 (de) | 1999-03-04 |
| NO972152L (no) | 1997-05-12 |
| NO972152D0 (no) | 1997-05-09 |
| AU703328B2 (en) | 1999-03-25 |
| AU3813095A (en) | 1996-06-06 |
| NZ294917A (en) | 1999-02-25 |
| NO307178B1 (no) | 2000-02-21 |
| ATE175962T1 (de) | 1999-02-15 |
| DK0790986T3 (da) | 1999-09-13 |
| ES2128092T3 (es) | 1999-05-01 |
| DE69507505T2 (de) | 1999-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4011109B2 (ja) | アニリン誘導体 | |
| JP4106089B2 (ja) | キナゾリン化合物 | |
| JP4074342B2 (ja) | キナゾリン化合物 | |
| US6015814A (en) | Quinazoline derivative | |
| KR100296656B1 (ko) | 퀴나졸린유도체 | |
| JP3545763B2 (ja) | キナゾリン誘導体及びその抗癌剤としての使用 | |
| EP0823901B1 (en) | Quinazoline derivative | |
| EP0892799B1 (en) | Quinazoline derivatives | |
| EP0824525B1 (en) | Quinazoline derivatives | |
| JP4012245B2 (ja) | キナゾリン誘導体 | |
| CZ20013319A3 (cs) | Nové amidové deriváty, způsob jejich přípravy a farmaceutická kompozice, která je obsahuje | |
| WO1996033979A1 (en) | Quinazoline derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RD02 | Notification of acceptance of power of attorney |
Free format text: JAPANESE INTERMEDIATE CODE: A7422 Effective date: 20031212 |
|
| RD04 | Notification of resignation of power of attorney |
Free format text: JAPANESE INTERMEDIATE CODE: A7424 Effective date: 20031216 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20060829 |
|
| A977 | Report on retrieval |
Free format text: JAPANESE INTERMEDIATE CODE: A971007 Effective date: 20060818 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20061129 |
|
| A602 | Written permission of extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A602 Effective date: 20070122 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20070222 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20070410 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20070618 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20070814 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20070905 |
|
| R150 | Certificate of patent or registration of utility model |
Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20100914 Year of fee payment: 3 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20110914 Year of fee payment: 4 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20120914 Year of fee payment: 5 |
|
| LAPS | Cancellation because of no payment of annual fees |