FI77452C - Foerfarande foer framstaellning av farmaceutiskt anvaendbara 4-amino-3-kinolinkarboxylsyraestrar. - Google Patents
Foerfarande foer framstaellning av farmaceutiskt anvaendbara 4-amino-3-kinolinkarboxylsyraestrar. Download PDFInfo
- Publication number
- FI77452C FI77452C FI800910A FI800910A FI77452C FI 77452 C FI77452 C FI 77452C FI 800910 A FI800910 A FI 800910A FI 800910 A FI800910 A FI 800910A FI 77452 C FI77452 C FI 77452C
- Authority
- FI
- Finland
- Prior art keywords
- alkyl
- ethyl
- preparation
- quinolinecarboxylate
- amino
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 77
- 238000000034 method Methods 0.000 title claims description 20
- 230000008569 process Effects 0.000 title claims description 8
- 150000001733 carboxylic acid esters Chemical class 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims description 45
- 150000001875 compounds Chemical class 0.000 claims description 38
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 36
- -1 cyano, hydroxy, carbamoyl Chemical group 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 7
- UEFKMJWKPVAVND-UHFFFAOYSA-N 4-aminoquinoline-3-carboxylic acid Chemical compound C1=CC=C2C(N)=C(C(O)=O)C=NC2=C1 UEFKMJWKPVAVND-UHFFFAOYSA-N 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 4
- 239000013543 active substance Substances 0.000 claims description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims 2
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims 1
- 235000006810 Caesalpinia ciliata Nutrition 0.000 claims 1
- 241000059739 Caesalpinia ciliata Species 0.000 claims 1
- 125000004995 haloalkylthio group Chemical group 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- RJMUSRYZPJIFPJ-UHFFFAOYSA-N niclosamide Chemical compound OC1=CC=C(Cl)C=C1C(=O)NC1=CC=C([N+]([O-])=O)C=C1Cl RJMUSRYZPJIFPJ-UHFFFAOYSA-N 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 26
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 26
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 22
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 16
- 229910052799 carbon Inorganic materials 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 11
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 230000027119 gastric acid secretion Effects 0.000 description 9
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 241000282472 Canis lupus familiaris Species 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WBRPQQSADOCKCH-UHFFFAOYSA-N 2-methylsulfanylaniline Chemical compound CSC1=CC=CC=C1N WBRPQQSADOCKCH-UHFFFAOYSA-N 0.000 description 5
- 208000007107 Stomach Ulcer Diseases 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 210000004211 gastric acid Anatomy 0.000 description 5
- 201000005917 gastric ulcer Diseases 0.000 description 5
- 229960001340 histamine Drugs 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- VBLXCTYLWZJBKA-UHFFFAOYSA-N 2-(trifluoromethyl)aniline Chemical compound NC1=CC=CC=C1C(F)(F)F VBLXCTYLWZJBKA-UHFFFAOYSA-N 0.000 description 3
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 201000006549 dyspepsia Diseases 0.000 description 3
- BBOZDELEERNECG-UHFFFAOYSA-N ethyl 4-chloro-8-methoxyquinoline-3-carboxylate Chemical compound COC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 BBOZDELEERNECG-UHFFFAOYSA-N 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 3
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 3
- CJAAPVQEZPAQNI-UHFFFAOYSA-N (2-methylphenyl)methanamine Chemical compound CC1=CC=CC=C1CN CJAAPVQEZPAQNI-UHFFFAOYSA-N 0.000 description 2
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 2
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 2
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 2
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 2
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- HJSCQRDGGJZGJH-UHFFFAOYSA-N 4-chloroquinoline-3-carboxylic acid Chemical class C1=CC=CC2=C(Cl)C(C(=O)O)=CN=C21 HJSCQRDGGJZGJH-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical group OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 2
- DWXQUAHMZWZXHP-UHFFFAOYSA-N ethyl 4-chloroquinoline-3-carboxylate Chemical class C1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 DWXQUAHMZWZXHP-UHFFFAOYSA-N 0.000 description 2
- YBEOYBKKSWUSBR-UHFFFAOYSA-N ethyl 4-oxo-1h-quinoline-3-carboxylate Chemical class C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 YBEOYBKKSWUSBR-UHFFFAOYSA-N 0.000 description 2
- CRJUJZNGVQRIJL-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C CRJUJZNGVQRIJL-UHFFFAOYSA-N 0.000 description 2
- HCYNWEIHLHVPEW-UHFFFAOYSA-N ethyl 8-methoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1OC HCYNWEIHLHVPEW-UHFFFAOYSA-N 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- NZWOPGCLSHLLPA-UHFFFAOYSA-N methacholine Chemical compound C[N+](C)(C)CC(C)OC(C)=O NZWOPGCLSHLLPA-UHFFFAOYSA-N 0.000 description 2
- 229960002329 methacholine Drugs 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 235000016709 nutrition Nutrition 0.000 description 2
- 230000035764 nutrition Effects 0.000 description 2
- GTDQGKWDWVUKTI-UHFFFAOYSA-N o-aminoacetophenone Chemical compound CC(=O)C1=CC=CC=C1N GTDQGKWDWVUKTI-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- VVAKEQGKZNKUSU-UHFFFAOYSA-N 2,3-dimethylaniline Chemical compound CC1=CC=CC(N)=C1C VVAKEQGKZNKUSU-UHFFFAOYSA-N 0.000 description 1
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- YKOLZVXSPGIIBJ-UHFFFAOYSA-N 2-Isopropylaniline Chemical compound CC(C)C1=CC=CC=C1N YKOLZVXSPGIIBJ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- XAPLMNMYYKRILN-UHFFFAOYSA-N 2-[(3-ethoxycarbonyl-8-phenylquinolin-4-yl)amino]benzoic acid;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(C=3C=CC=CC=3)=CC=CC2=C1NC1=CC=CC=C1C(O)=O XAPLMNMYYKRILN-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- PUBYDOJONNWFJJ-UHFFFAOYSA-N 2-aminoquinoline-3-carboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(N)=NC2=C1 PUBYDOJONNWFJJ-UHFFFAOYSA-N 0.000 description 1
- GBOUQGUQUUPGLO-UHFFFAOYSA-N 2-chloro-5-methoxyaniline Chemical compound COC1=CC=C(Cl)C(N)=C1 GBOUQGUQUUPGLO-UHFFFAOYSA-N 0.000 description 1
- WFNLHDJJZSJARK-UHFFFAOYSA-N 2-chloro-6-methylaniline Chemical compound CC1=CC=CC(Cl)=C1N WFNLHDJJZSJARK-UHFFFAOYSA-N 0.000 description 1
- SIEGTBUPXPEBLB-UHFFFAOYSA-N 2-ethyl-6-methoxybenzoic acid hydrochloride Chemical compound Cl.CCc1cccc(OC)c1C(O)=O SIEGTBUPXPEBLB-UHFFFAOYSA-N 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- PYSGFFTXMUWEOT-UHFFFAOYSA-N 3-(dimethylamino)propan-1-ol Chemical compound CN(C)CCCO PYSGFFTXMUWEOT-UHFFFAOYSA-N 0.000 description 1
- KCHLDNLIJVSRPK-UHFFFAOYSA-N 3-methylsulfanylaniline Chemical compound CSC1=CC=CC(N)=C1 KCHLDNLIJVSRPK-UHFFFAOYSA-N 0.000 description 1
- YKFROQCFVXOUPW-UHFFFAOYSA-N 4-(methylthio) aniline Chemical compound CSC1=CC=C(N)C=C1 YKFROQCFVXOUPW-UHFFFAOYSA-N 0.000 description 1
- IETBAKGCCBATLU-UHFFFAOYSA-N 4-anilinoquinoline-3-carboxylic acid Chemical compound OC(=O)C1=CN=C2C=CC=CC2=C1NC1=CC=CC=C1 IETBAKGCCBATLU-UHFFFAOYSA-N 0.000 description 1
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 1
- DSBIJCMXAIKKKI-UHFFFAOYSA-N 5-nitro-o-toluidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N DSBIJCMXAIKKKI-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- LCPSOBZIRRCLCE-UHFFFAOYSA-N CCOCOC(C(=O)OCC)C(=O)OCC Chemical compound CCOCOC(C(=O)OCC)C(=O)OCC LCPSOBZIRRCLCE-UHFFFAOYSA-N 0.000 description 1
- 101100495845 Caenorhabditis elegans cht-1 gene Proteins 0.000 description 1
- QVSGXIKORIKQFE-UHFFFAOYSA-N Cl.NC1=NC2=CC=CC=C2C=C1C(=O)O Chemical compound Cl.NC1=NC2=CC=CC=C2C=C1C(=O)O QVSGXIKORIKQFE-UHFFFAOYSA-N 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 108010012944 Tetragastrin Proteins 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 230000009858 acid secretion Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 235000020053 arrack Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- FDSGHYHRLSWSLQ-UHFFFAOYSA-N dichloromethane;propan-2-one Chemical compound ClCCl.CC(C)=O FDSGHYHRLSWSLQ-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical class CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- WABGGQNMHPDKMX-UHFFFAOYSA-N ethanol;ethyl 4-(2-carbamoylanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCO.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(N)=O WABGGQNMHPDKMX-UHFFFAOYSA-N 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- HINLPSGAVZPTIW-UHFFFAOYSA-N ethyl 4,8-dichloroquinoline-3-carboxylate Chemical compound ClC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 HINLPSGAVZPTIW-UHFFFAOYSA-N 0.000 description 1
- NOEXJVFTRUYGNJ-UHFFFAOYSA-N ethyl 4-(2,3-dimethylanilino)-8-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC(C)=C1C NOEXJVFTRUYGNJ-UHFFFAOYSA-N 0.000 description 1
- BPRQLHKEHADPED-UHFFFAOYSA-N ethyl 4-(2,4-dimethoxyanilino)-8-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=C(OC)C=C1OC BPRQLHKEHADPED-UHFFFAOYSA-N 0.000 description 1
- IJJNSCKCJMFURY-UHFFFAOYSA-N ethyl 4-(2,6-dichloroanilino)-8-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=C(Cl)C=CC=C1Cl IJJNSCKCJMFURY-UHFFFAOYSA-N 0.000 description 1
- BVMIMZZMWLNHSE-UHFFFAOYSA-N ethyl 4-(2,6-dimethylanilino)-8-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=C(C)C=CC=C1C BVMIMZZMWLNHSE-UHFFFAOYSA-N 0.000 description 1
- GMKXWJUQDZTZQH-UHFFFAOYSA-N ethyl 4-(2-acetylanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(C)=O GMKXWJUQDZTZQH-UHFFFAOYSA-N 0.000 description 1
- RRZNSQNUZMCXSU-UHFFFAOYSA-N ethyl 4-(2-chloro-5-methoxyanilino)-8-methoxyquinoline-3-carboxylate;hydrobromide Chemical compound Br.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC(OC)=CC=C1Cl RRZNSQNUZMCXSU-UHFFFAOYSA-N 0.000 description 1
- WDLHYKPECRHGNX-UHFFFAOYSA-N ethyl 4-(2-chloroanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1Cl WDLHYKPECRHGNX-UHFFFAOYSA-N 0.000 description 1
- SQJKQVCDNMSUBK-UHFFFAOYSA-N ethyl 4-(2-cyanoanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C#N SQJKQVCDNMSUBK-UHFFFAOYSA-N 0.000 description 1
- QZPNMHNGXWHCAY-UHFFFAOYSA-N ethyl 4-(2-ethylanilino)-8-methoxyquinoline-3-carboxylate;phosphoric acid Chemical compound OP(O)(O)=O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1CC QZPNMHNGXWHCAY-UHFFFAOYSA-N 0.000 description 1
- HLIPVESJSJDQQI-UHFFFAOYSA-N ethyl 4-(2-ethylanilino)-8-methoxyquinoline-3-carboxylate;sulfuric acid Chemical compound OS(O)(=O)=O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1CC HLIPVESJSJDQQI-UHFFFAOYSA-N 0.000 description 1
- ZGIIOSQVHPDWCS-UHFFFAOYSA-N ethyl 4-(2-fluoroanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1F ZGIIOSQVHPDWCS-UHFFFAOYSA-N 0.000 description 1
- JKHABEKHODSDRX-UHFFFAOYSA-N ethyl 4-(benzylamino)-8-phenylquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(C=3C=CC=CC=3)=CC=CC2=C1NCC1=CC=CC=C1 JKHABEKHODSDRX-UHFFFAOYSA-N 0.000 description 1
- GJPCPHDRHGPWFU-UHFFFAOYSA-N ethyl 4-(butylamino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.C1=CC=C2C(NCCCC)=C(C(=O)OCC)C=NC2=C1OC GJPCPHDRHGPWFU-UHFFFAOYSA-N 0.000 description 1
- SDROITOLJLLKGZ-UHFFFAOYSA-N ethyl 4-anilino-5,8-dimethoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=C(OC)C2=C1NC1=CC=CC=C1 SDROITOLJLLKGZ-UHFFFAOYSA-N 0.000 description 1
- DEFVNVNONGGPJR-UHFFFAOYSA-N ethyl 4-anilino-6,8-dimethylquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(C)=CC(C)=CC2=C1NC1=CC=CC=C1 DEFVNVNONGGPJR-UHFFFAOYSA-N 0.000 description 1
- NWUNMWHTSWBCEJ-UHFFFAOYSA-N ethyl 4-anilino-8-cyanoquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(C#N)=CC=CC2=C1NC1=CC=CC=C1 NWUNMWHTSWBCEJ-UHFFFAOYSA-N 0.000 description 1
- YMSKONPFQZCVPL-UHFFFAOYSA-N ethyl 4-anilino-8-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1 YMSKONPFQZCVPL-UHFFFAOYSA-N 0.000 description 1
- DGFFVGQOZXGJAE-UHFFFAOYSA-N ethyl 4-anilino-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1 DGFFVGQOZXGJAE-UHFFFAOYSA-N 0.000 description 1
- IJDXCOWIANNOTC-UHFFFAOYSA-N ethyl 4-chloro-5,8-dimethoxyquinoline-3-carboxylate Chemical compound COC1=CC=C(OC)C2=C(Cl)C(C(=O)OCC)=CN=C21 IJDXCOWIANNOTC-UHFFFAOYSA-N 0.000 description 1
- QOCJKSWVYYUBSD-UHFFFAOYSA-N ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate Chemical compound CC1=CC(C)=CC2=C(Cl)C(C(=O)OCC)=CN=C21 QOCJKSWVYYUBSD-UHFFFAOYSA-N 0.000 description 1
- JLVNAMDYLDOJGR-UHFFFAOYSA-N ethyl 4-chloro-8-(dimethylamino)quinoline-3-carboxylate Chemical compound CN(C)C1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 JLVNAMDYLDOJGR-UHFFFAOYSA-N 0.000 description 1
- CIGIGQHDHKBPAZ-UHFFFAOYSA-N ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate Chemical compound FC(F)(F)C1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 CIGIGQHDHKBPAZ-UHFFFAOYSA-N 0.000 description 1
- MHOFAUCLSGVKOH-UHFFFAOYSA-N ethyl 4-chloro-8-cyanoquinoline-3-carboxylate Chemical compound N#CC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 MHOFAUCLSGVKOH-UHFFFAOYSA-N 0.000 description 1
- UNMTVPUUJFYTOJ-UHFFFAOYSA-N ethyl 4-chloro-8-ethoxyquinoline-3-carboxylate Chemical compound CCOC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 UNMTVPUUJFYTOJ-UHFFFAOYSA-N 0.000 description 1
- PGGVUZUNDXCMSS-UHFFFAOYSA-N ethyl 4-chloro-8-methylquinoline-3-carboxylate Chemical compound CC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 PGGVUZUNDXCMSS-UHFFFAOYSA-N 0.000 description 1
- PTGKZGLBFDWBKY-UHFFFAOYSA-N ethyl 4-chloro-8-methylsulfanylquinoline-3-carboxylate Chemical compound CSC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 PTGKZGLBFDWBKY-UHFFFAOYSA-N 0.000 description 1
- VWVPBLLIVVAAPY-UHFFFAOYSA-N ethyl 4-chloro-8-phenylquinoline-3-carboxylate Chemical compound C=1C=CC2=C(Cl)C(C(=O)OCC)=CN=C2C=1C1=CC=CC=C1 VWVPBLLIVVAAPY-UHFFFAOYSA-N 0.000 description 1
- XSNJFNKOHAUNPO-UHFFFAOYSA-N ethyl 4-oxo-8-(trifluoromethyl)-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1C(F)(F)F XSNJFNKOHAUNPO-UHFFFAOYSA-N 0.000 description 1
- ZFOVQQHLWOBEKQ-UHFFFAOYSA-N ethyl 5,8-dimethoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC(OC)=C2C(=O)C(C(=O)OCC)=CNC2=C1OC ZFOVQQHLWOBEKQ-UHFFFAOYSA-N 0.000 description 1
- CVTZGJPEFPRNNB-UHFFFAOYSA-N ethyl 8-chloro-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1Cl CVTZGJPEFPRNNB-UHFFFAOYSA-N 0.000 description 1
- LTPVJDPFDLGLRT-UHFFFAOYSA-N ethyl 8-ethoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OCC)=CC=CC2=C1NC1=CC=CC=C1OC LTPVJDPFDLGLRT-UHFFFAOYSA-N 0.000 description 1
- PIZUEXPYKUOJJJ-UHFFFAOYSA-N ethyl 8-ethoxy-4-(2-methylanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OCC)=CC=CC2=C1NC1=CC=CC=C1C PIZUEXPYKUOJJJ-UHFFFAOYSA-N 0.000 description 1
- TWGHZFJRCAQPRL-UHFFFAOYSA-N ethyl 8-ethoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1OCC TWGHZFJRCAQPRL-UHFFFAOYSA-N 0.000 description 1
- MJNAFZWEKGYYQT-UHFFFAOYSA-N ethyl 8-methoxy-4-(1-phenylethylamino)quinoline-3-carboxylate;hydrate Chemical compound O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC(C)C1=CC=CC=C1 MJNAFZWEKGYYQT-UHFFFAOYSA-N 0.000 description 1
- GWABEZHJVSPHNE-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1OC GWABEZHJVSPHNE-UHFFFAOYSA-N 0.000 description 1
- BGVYJAVIIUVJPD-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methyl-5-nitroanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC([N+]([O-])=O)=CC=C1C BGVYJAVIIUVJPD-UHFFFAOYSA-N 0.000 description 1
- DXCCJYWRCAJAGW-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C DXCCJYWRCAJAGW-UHFFFAOYSA-N 0.000 description 1
- MGXKVCVQJWYAOB-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate;phosphoric acid Chemical compound OP(O)(O)=O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C MGXKVCVQJWYAOB-UHFFFAOYSA-N 0.000 description 1
- GWRHIGMXHHRFEC-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate;sulfuric acid Chemical compound OS(O)(=O)=O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C GWRHIGMXHHRFEC-UHFFFAOYSA-N 0.000 description 1
- LOPISVUVHAYYRS-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylsulfanylanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1SC LOPISVUVHAYYRS-UHFFFAOYSA-N 0.000 description 1
- OPLNDEGFDPLWPZ-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-propan-2-ylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(C)C OPLNDEGFDPLWPZ-UHFFFAOYSA-N 0.000 description 1
- LIWXATRPLXWISO-UHFFFAOYSA-N ethyl 8-methoxy-4-(4-methoxy-2-methylanilino)quinoline-3-carboxylate Chemical compound COC=1C=CC=C2C(=C(C=NC12)C(=O)OCC)NC1=C(C=C(C=C1)OC)C LIWXATRPLXWISO-UHFFFAOYSA-N 0.000 description 1
- CMQSAERRIXCOSV-UHFFFAOYSA-N ethyl 8-methoxy-4-[(2-methoxyphenyl)methylamino]quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NCC1=CC=CC=C1OC CMQSAERRIXCOSV-UHFFFAOYSA-N 0.000 description 1
- WTSHTUPDVKVIMP-UHFFFAOYSA-N ethyl 8-methoxy-4-[2-(trifluoromethyl)anilino]quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(F)(F)F WTSHTUPDVKVIMP-UHFFFAOYSA-N 0.000 description 1
- PKFHECQXAUCDES-UHFFFAOYSA-N ethyl 8-methoxy-5-methyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC(C)=C2C(=O)C(C(=O)OCC)=CNC2=C1OC PKFHECQXAUCDES-UHFFFAOYSA-N 0.000 description 1
- HYUYDOCMASKUMM-UHFFFAOYSA-N ethyl 8-methyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1C HYUYDOCMASKUMM-UHFFFAOYSA-N 0.000 description 1
- MOYXAWSNAWARCE-UHFFFAOYSA-N ethyl 8-methylsulfanyl-4-(2-methylsulfanylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(SC)=CC=CC2=C1NC1=CC=CC=C1SC MOYXAWSNAWARCE-UHFFFAOYSA-N 0.000 description 1
- CJSYBLGRYMXUTM-UHFFFAOYSA-N ethyl 8-methylsulfanyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound CSC1=CC=CC2=C(O)C(C(=O)OCC)=CN=C21 CJSYBLGRYMXUTM-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- ZHPNWZCWUUJAJC-UHFFFAOYSA-N fluorosilicon Chemical compound [Si]F ZHPNWZCWUUJAJC-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000027125 histamine-induced gastric acid secretion Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- CDGNLUSBENXDGG-UHFFFAOYSA-N meta-Cresidine Chemical compound COC1=CC=C(N)C(C)=C1 CDGNLUSBENXDGG-UHFFFAOYSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- CWRATHCADZOYAT-UHFFFAOYSA-N methyl quinoline-3-carboxylate Chemical compound C1=CC=CC2=CC(C(=O)OC)=CN=C21 CWRATHCADZOYAT-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- KEBXGLIHHLGNJH-UHFFFAOYSA-N n-methylsulfanylaniline Chemical compound CSNC1=CC=CC=C1 KEBXGLIHHLGNJH-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- RGYLYUZOGHTBRF-BIHRQFPBSA-N tetragastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C2=CC=CC=C2NC=1)CCSC)C(N)=O)C1=CC=CC=C1 RGYLYUZOGHTBRF-BIHRQFPBSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2398179A | 1979-03-26 | 1979-03-26 | |
| US2398179 | 1979-03-26 | ||
| US06/127,153 US4343804A (en) | 1979-03-26 | 1980-03-04 | 4-Amino-3-quinolinecarboxylic acids and esters-antisecretory anti-ulcer compounds |
| US12715380 | 1980-03-04 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI800910A7 FI800910A7 (fi) | 1980-09-27 |
| FI77452B FI77452B (fi) | 1988-11-30 |
| FI77452C true FI77452C (fi) | 1989-03-10 |
Family
ID=26697875
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI800910A FI77452C (fi) | 1979-03-26 | 1980-03-24 | Foerfarande foer framstaellning av farmaceutiskt anvaendbara 4-amino-3-kinolinkarboxylsyraestrar. |
Country Status (31)
| Country | Link |
|---|---|
| US (1) | US4343804A (enExample) |
| JP (1) | JPH02117663A (enExample) |
| AR (1) | AR230268A1 (enExample) |
| AT (1) | AT372373B (enExample) |
| AU (1) | AU528388B2 (enExample) |
| BR (1) | BR8001779A (enExample) |
| CA (1) | CA1147338A (enExample) |
| CH (1) | CH644105A5 (enExample) |
| DE (1) | DE3011490A1 (enExample) |
| DK (1) | DK156056C (enExample) |
| EG (1) | EG15009A (enExample) |
| ES (1) | ES489887A0 (enExample) |
| FI (1) | FI77452C (enExample) |
| FR (1) | FR2452485B1 (enExample) |
| GB (1) | GB2047244B (enExample) |
| GR (1) | GR68006B (enExample) |
| HK (1) | HK67983A (enExample) |
| IE (1) | IE49577B1 (enExample) |
| IL (1) | IL59628A (enExample) |
| IN (1) | IN151446B (enExample) |
| IT (1) | IT1133079B (enExample) |
| MX (1) | MX6264E (enExample) |
| NL (1) | NL8001752A (enExample) |
| NO (1) | NO153927C (enExample) |
| NZ (1) | NZ193252A (enExample) |
| PH (1) | PH16416A (enExample) |
| PL (1) | PL125030B1 (enExample) |
| PT (1) | PT71008B (enExample) |
| SE (1) | SE435837B (enExample) |
| SG (1) | SG33683G (enExample) |
| YU (1) | YU41702B (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8610981D0 (en) * | 1986-05-06 | 1986-06-11 | Ici America Inc | Quinoline amides |
| GB8621425D0 (en) * | 1986-09-05 | 1986-10-15 | Smith Kline French Lab | Compounds |
| GB8804444D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804447D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804448D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804443D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804445D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804446D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| US5432182A (en) * | 1989-02-23 | 1995-07-11 | Smithkline Beecham Intercredit B.V. | Compounds substituted quinoline derivatives |
| CA2011086A1 (en) * | 1989-03-17 | 1990-09-17 | Karl-Heinz Geiss | 2-alkyl-4-arylmethylaminoquinolines, the use thereof and drugs prepared therefrom |
| DE3917233A1 (de) * | 1989-05-26 | 1990-11-29 | Basf Ag | 8-substituierte 4-(heterocyclylmethylamino)-chinoline, ihre verwendung und daraus hergestellte arzneimittel |
| GB8918265D0 (en) * | 1989-08-10 | 1989-09-20 | Smithkline Beckman Intercredit | Compounds |
| US5362743A (en) * | 1993-03-09 | 1994-11-08 | Pfizer Inc. | Aminoquinoline derivatives |
| US5556863A (en) * | 1993-06-11 | 1996-09-17 | Astra Aktiebolag | Compound for gastric acid secretion inhibition |
| IS4164A (is) * | 1993-06-11 | 1994-12-12 | Ab Astra | Efnasambönd sem hindra flæði magasýru |
| SG52229A1 (en) * | 1993-08-10 | 1998-09-28 | Black James Foundation | Gastrin and cck receptor ligands |
| US5650415A (en) * | 1995-06-07 | 1997-07-22 | Sugen, Inc. | Quinoline compounds |
| KR0169813B1 (ko) * | 1995-07-12 | 1999-01-15 | 김종인 | 4-아미노-3-아실나프티리딘 유도체 |
| US5760041A (en) * | 1996-02-05 | 1998-06-02 | American Cyanamid Company | 4-aminoquinazoline EGFR Inhibitors |
| US6875769B2 (en) * | 1996-05-23 | 2005-04-05 | Pfizer Inc. | Substituted6,6-hetero-bicyclicderivatives |
| US5929080A (en) * | 1997-05-06 | 1999-07-27 | American Cyanamid Company | Method of treating polycystic kidney disease |
| US6251912B1 (en) | 1997-08-01 | 2001-06-26 | American Cyanamid Company | Substituted quinazoline derivatives |
| US6323209B1 (en) | 1997-11-06 | 2001-11-27 | American Cyanamid Company | Method of treating or inhibiting colonic polyps |
| EP1950201A1 (en) | 1998-09-29 | 2008-07-30 | Wyeth Holdings Corporation | Substituted 3-cyanoquinolines as protein tyrosine kinases inhibitors |
| WO2001047891A1 (en) * | 1999-12-28 | 2001-07-05 | Eisai Co., Ltd. | Heterocyclic compounds having sulfonamide groups |
| US6521618B2 (en) | 2000-03-28 | 2003-02-18 | Wyeth | 3-cyanoquinolines, 3-cyano-1,6-naphthyridines, and 3-cyano-1,7-naphthyridines as protein kinase inhibitors |
| US6576644B2 (en) * | 2000-09-06 | 2003-06-10 | Bristol-Myers Squibb Co. | Quinoline inhibitors of cGMP phosphodiesterase |
| UA80393C2 (uk) | 2000-12-07 | 2007-09-25 | Алтана Фарма Аг | Фармацевтична композиція, яка містить інгібітор фде 4, диспергований в матриці |
| MY140561A (en) | 2002-02-20 | 2009-12-31 | Nycomed Gmbh | Dosage form containing pde 4 inhibitor as active ingredient |
| CN102558155A (zh) | 2003-01-14 | 2012-07-11 | 阿伦纳药品公司 | 作为代谢调节剂的芳基和杂芳基衍生物及其所涉及的疾病如糖尿病和高血糖症的预防和治疗 |
| BRPI0406427B8 (pt) | 2003-03-10 | 2021-05-25 | Astrazeneca Ab | processo para a preparação de roflumilast |
| AU2004257267B2 (en) * | 2003-07-14 | 2009-12-03 | Arena Pharmaceuticals,Inc | Fused-aryl and heteroaryl derivatives as modulators of metabolism and the prophylaxis and treatment of disorders related thereto |
| WO2006097456A1 (en) * | 2005-03-16 | 2006-09-21 | Nycomed Gmbh | Taste masked dosage form containing roflumilast |
| WO2011022216A1 (en) * | 2009-08-17 | 2011-02-24 | High Point Pharmaceuticals, Llc | Substituted pyridine derivatives, pharmaceutical compositions, and methods of use to treat oxidative stress |
| EP4148045A1 (en) | 2010-01-27 | 2023-03-15 | Arena Pharmaceuticals, Inc. | Intermediate compounds for the preparation of (r)-2-(7-(4-cyclopentyl-3- (trifluoromethyl)benzyloxy)-1,2,3,4-tetrahydrocyclopenta[b] indol-3-yl)acetic acid and salts thereof |
| EA201390421A1 (ru) | 2010-09-22 | 2013-09-30 | Арена Фармасьютикалз, Инк. | Модуляторы рецептора gpr119 и лечение связанных с ним нарушений |
| EP4445956A3 (en) | 2015-01-06 | 2024-12-04 | Arena Pharmaceuticals, Inc. | Compound for use in treating conditions related to the s1p1 receptor |
| PL3310760T3 (pl) | 2015-06-22 | 2023-03-06 | Arena Pharmaceuticals, Inc. | Krystaliczna sól L-argininy kwasu (R)-2-(7-(4-cyklopentylo-3-(trifluorometylo)benzyloksy)- 1,2,3,4-tetrahydrocyklo-penta[b]indol-3-ilo)octowego do zastosowania w zaburzeniach związanych z receptorem S1P1 |
| PT3538512T (pt) * | 2016-11-11 | 2021-08-16 | Bayer Animal Health Gmbh | Novos derivados de quinolina-3-carboxamida anti-helmínticos |
| CN110520124A (zh) | 2017-02-16 | 2019-11-29 | 艾尼纳制药公司 | 用于治疗原发性胆汁性胆管炎的化合物和方法 |
| EP3700527A4 (en) * | 2017-10-25 | 2021-03-10 | Children's Medical Center Corporation | PAPD5 INHIBITORS AND METHOD OF USING THEM |
| ES2945559T3 (es) | 2018-05-09 | 2023-07-04 | Bayer Animal Health Gmbh | Derivados de quinolina antihelmínticos |
| CA3102136A1 (en) | 2018-06-06 | 2019-12-12 | Arena Pharmaceuticals, Inc. | Methods of treating conditions related to the s1p1 receptor |
| US12486234B2 (en) | 2019-04-24 | 2025-12-02 | Children's Medical Center Corporation | PAPD5 inhibitors and methods of use thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3470186A (en) * | 1967-06-02 | 1969-09-30 | American Cyanamid Co | Substituted 4-anilino-3-quinolinecarboxylic acids and esters |
| JPS4838712A (enExample) * | 1971-09-18 | 1973-06-07 |
-
1980
- 1980-03-04 US US06/127,153 patent/US4343804A/en not_active Expired - Lifetime
- 1980-03-14 IL IL59628A patent/IL59628A/xx unknown
- 1980-03-22 GR GR61513A patent/GR68006B/el unknown
- 1980-03-24 AT AT0156480A patent/AT372373B/de not_active IP Right Cessation
- 1980-03-24 MX MX808722U patent/MX6264E/es unknown
- 1980-03-24 FI FI800910A patent/FI77452C/fi not_active IP Right Cessation
- 1980-03-24 IE IE605/80A patent/IE49577B1/en unknown
- 1980-03-24 FR FR8006516A patent/FR2452485B1/fr not_active Expired
- 1980-03-25 GB GB8009991A patent/GB2047244B/en not_active Expired
- 1980-03-25 PH PH23804A patent/PH16416A/en unknown
- 1980-03-25 BR BR8001779A patent/BR8001779A/pt unknown
- 1980-03-25 IN IN345/CAL/80A patent/IN151446B/en unknown
- 1980-03-25 NZ NZ193252A patent/NZ193252A/en unknown
- 1980-03-25 NL NL8001752A patent/NL8001752A/nl not_active Application Discontinuation
- 1980-03-25 PT PT71008A patent/PT71008B/pt unknown
- 1980-03-25 DK DK128380A patent/DK156056C/da not_active IP Right Cessation
- 1980-03-25 ES ES489887A patent/ES489887A0/es active Granted
- 1980-03-25 DE DE19803011490 patent/DE3011490A1/de active Granted
- 1980-03-25 PL PL1980222993A patent/PL125030B1/pl unknown
- 1980-03-25 CH CH234080A patent/CH644105A5/fr not_active IP Right Cessation
- 1980-03-25 EG EG80174A patent/EG15009A/xx active
- 1980-03-25 NO NO800858A patent/NO153927C/no unknown
- 1980-03-25 SE SE8002292A patent/SE435837B/sv not_active IP Right Cessation
- 1980-03-26 AU AU56848/80A patent/AU528388B2/en not_active Ceased
- 1980-03-26 YU YU844/80A patent/YU41702B/xx unknown
- 1980-03-26 IT IT67465/80A patent/IT1133079B/it active
- 1980-03-26 CA CA000348417A patent/CA1147338A/en not_active Expired
- 1980-03-26 AR AR280455A patent/AR230268A1/es active
-
1983
- 1983-06-13 SG SG336/83A patent/SG33683G/en unknown
- 1983-12-15 HK HK679/83A patent/HK67983A/xx unknown
-
1989
- 1989-09-26 JP JP1250369A patent/JPH02117663A/ja active Pending
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI77452C (fi) | Foerfarande foer framstaellning av farmaceutiskt anvaendbara 4-amino-3-kinolinkarboxylsyraestrar. | |
| DE3486043T2 (de) | Chinolinzwischenprodukte fuer die synthese von 1h-imidazo(4,5-c)chinolinen und 1h-imidazo(4,5-c)chinolin-4-aminen. | |
| DE69322033T2 (de) | Kondensierte Pyridin Derivate als Hemmer von Effekten freier Radikaler | |
| NZ227125A (en) | Quinazoline derivatives and pharmaceutical compositions | |
| IE46849B1 (en) | Pyridopyrimidines | |
| HU186909B (en) | Process for producing heterocyclic carboxamides | |
| DE69330497T2 (de) | Chinazolin-derivate | |
| EP0019811A1 (de) | Pyrimidin-Verbindungen, Verfahren zu ihrer Herstellung, pharmazeutische Präparate enthaltend diese Verbindungen, sowie ihre therapeutische Verwendung | |
| DE2740588A1 (de) | Imidazo- eckige klammer auf 1,2-a eckige klammer zu -chinolin-2-carbon- saeuren und deren derivate sowie pharmazeutische zubereitungen, die diese verbindungen enthalten | |
| NZ264763A (en) | Aminoquinoline derivatives, preparation and pharmaceutical compositions thereof | |
| Khodarahmi et al. | Synthesis of some new quinazolinone derivatives and evaluation of their antimicrobial activities | |
| DE2446821A1 (de) | Substituierte 1,3-dimethyl-1hpyrazol eckige klammer auf 3,4b eckige klammer zu -chinoline | |
| US4209519A (en) | Anti-leishmanial lepidine derivatives | |
| US4529728A (en) | 1H,3H-pyrrolo[1,2-c]thiazole derivatives having anti-allergic and anti-inflammatory activity | |
| KR870000279B1 (ko) | 피리도 [1,4] 벤조디아제핀 및 [2-[(니트로피리디닐) 아미노]페닐] 아릴메타논의 제조방법 | |
| KR840000768B1 (ko) | 4-아미노-3-퀴놀린카복실산 및 에스테르의 제조방법 | |
| US20100286163A1 (en) | Indolo[3,2-c]quinoline compounds | |
| CA1161757A (en) | 4-amino-3-quinolinecarboxylic acids and esters- antisecretory, anti-ulcer compounds | |
| CS216527B2 (cs) | Způsob výroby 4-amino-3-chinolinkarboxylových kyselin a jejich esterů | |
| NL8002119A (nl) | Aminoisochinolinederivaten en werkwijze voor het bereiden van deze verbindingen. | |
| IE54618B1 (en) | Nitro, amino and aroylamino-n-phenylpyridinamines in a process for preparing pyrido (1,4) benzodiazepines | |
| Fur et al. | Optimized and convergent synthesis of potent anti-malarial aminoquinoline compounds: easy access to analogs | |
| DE68910253T2 (de) | Substituierte Imidazo[2,1-b]chinazolin-5(3H)-one und entsprechende tricyclische Verbindungen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: A.H. ROBINS CO INCORPORATED |