FI77026C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 3-(alkyltio, alkylsulfinyl eller alkylsulfonyl)-4-kinoloner. - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 3-(alkyltio, alkylsulfinyl eller alkylsulfonyl)-4-kinoloner. Download PDFInfo
- Publication number
- FI77026C FI77026C FI800923A FI800923A FI77026C FI 77026 C FI77026 C FI 77026C FI 800923 A FI800923 A FI 800923A FI 800923 A FI800923 A FI 800923A FI 77026 C FI77026 C FI 77026C
- Authority
- FI
- Finland
- Prior art keywords
- quinolone
- methyl
- methylsulfinyl
- ethyl
- general formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 71
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 65
- -1 1-ethyl-7-methyl-3-methylsulfinyl-4- quinolone Chemical compound 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 12
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- UZWAHQKAIZUPJV-UHFFFAOYSA-N 1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=CC=C2N(C)C=C(S(C)=O)C(=O)C2=C1 UZWAHQKAIZUPJV-UHFFFAOYSA-N 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- JOMQHTWUPLJMHM-UHFFFAOYSA-N 1-ethyl-3-methylsulfinylquinolin-4-one Chemical compound C1=CC=C2N(CC)C=C(S(C)=O)C(=O)C2=C1 JOMQHTWUPLJMHM-UHFFFAOYSA-N 0.000 claims description 4
- OQNBTANSIYGIDG-UHFFFAOYSA-N 1-methyl-3-methylsulfonylquinolin-4-one Chemical compound C1=CC=C2N(C)C=C(S(C)(=O)=O)C(=O)C2=C1 OQNBTANSIYGIDG-UHFFFAOYSA-N 0.000 claims description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 4
- CVDODZNMQPRAGV-UHFFFAOYSA-N 1,3-dimethylquinoline-4-thione Chemical compound C1=CC=C2C(=S)C(C)=CN(C)C2=C1 CVDODZNMQPRAGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- UYGONJYYUKVHDD-UHFFFAOYSA-N flosequinan Chemical compound C1=C(F)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1 UYGONJYYUKVHDD-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 101150009274 nhr-1 gene Proteins 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- ABNGZIWONIHYOI-UHFFFAOYSA-N 2-methyl-3-methylsulfinyl-3h-quinolin-4-one Chemical compound C1=CC=C2C(=O)C(S(C)=O)C(C)=NC2=C1 ABNGZIWONIHYOI-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 71
- 239000000203 mixture Substances 0.000 description 52
- 239000000243 solution Substances 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 125000001309 chloro group Chemical group Cl* 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethyl sulfoxide Natural products CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 14
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 12
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 150000007660 quinolones Chemical class 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 230000036772 blood pressure Effects 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 150000003462 sulfoxides Chemical class 0.000 description 5
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 4
- 238000007906 compression Methods 0.000 description 4
- 230000006835 compression Effects 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- GEMDGXXVKPNXOV-UHFFFAOYSA-N 7-bromo-3-methylsulfinyl-3h-quinolin-4-one Chemical compound BrC1=CC=C2C(=O)C(S(=O)C)C=NC2=C1 GEMDGXXVKPNXOV-UHFFFAOYSA-N 0.000 description 3
- ZGFPFJNYSUVWHB-UHFFFAOYSA-N 7-fluoro-3-methylsulfinyl-3h-quinolin-4-one Chemical compound FC1=CC=C2C(=O)C(S(=O)C)C=NC2=C1 ZGFPFJNYSUVWHB-UHFFFAOYSA-N 0.000 description 3
- ZCTAXXJVBDEDEK-UHFFFAOYSA-N 7-methoxy-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C=2C1=CC(OC)=CC=2 ZCTAXXJVBDEDEK-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000006286 aqueous extract Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000004967 organic peroxy acids Chemical class 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- FCLWUYJURISLKH-UHFFFAOYSA-N 1-methyl-3-methylsulfinyl-7-(trifluoromethyl)quinolin-4-one Chemical compound C1=C(C(F)(F)F)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1 FCLWUYJURISLKH-UHFFFAOYSA-N 0.000 description 2
- LGPVTNAJFDUWLF-UHFFFAOYSA-N 2-amino-4-fluorobenzoic acid Chemical compound NC1=CC(F)=CC=C1C(O)=O LGPVTNAJFDUWLF-UHFFFAOYSA-N 0.000 description 2
- CMLFRMDBDNHMRA-UHFFFAOYSA-N 2h-1,2-benzoxazine Chemical compound C1=CC=C2C=CNOC2=C1 CMLFRMDBDNHMRA-UHFFFAOYSA-N 0.000 description 2
- BGDOLELXXPTPFX-UHFFFAOYSA-N 3,4-dihydro-2h-1,2-benzoxazine Chemical compound C1=CC=C2ONCCC2=C1 BGDOLELXXPTPFX-UHFFFAOYSA-N 0.000 description 2
- GZQHWCULMKQPMV-UHFFFAOYSA-N 7-chloro-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=C(Cl)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1 GZQHWCULMKQPMV-UHFFFAOYSA-N 0.000 description 2
- PNSCZWXWBWBHSF-UHFFFAOYSA-N 7-chloro-6-methoxy-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C=C(Cl)C(OC)=C2 PNSCZWXWBWBHSF-UHFFFAOYSA-N 0.000 description 2
- YTPAZJSGIQSNME-UHFFFAOYSA-N 7-chloro-6-methoxy-3-methyl-3h-quinoline-4-thione Chemical compound S=C1C(C)C=NC2=C1C=C(OC)C(Cl)=C2 YTPAZJSGIQSNME-UHFFFAOYSA-N 0.000 description 2
- ZKTQPDBLGNGCBO-UHFFFAOYSA-N 7-ethyl-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C=2C1=CC(CC)=CC=2 ZKTQPDBLGNGCBO-UHFFFAOYSA-N 0.000 description 2
- KVGQFTUVCDHXBT-UHFFFAOYSA-N 7-fluoro-1,3-dimethylquinoline-4-thione Chemical compound FC1=CC=C2C(=S)C(C)=CN(C)C2=C1 KVGQFTUVCDHXBT-UHFFFAOYSA-N 0.000 description 2
- LIHRHGSHVXLIOB-UHFFFAOYSA-N 7-tert-butyl-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=C(C(C)(C)C)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1 LIHRHGSHVXLIOB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- OATSQCXMYKYFQO-UHFFFAOYSA-N S-methyl thioacetate Chemical compound CSC(C)=O OATSQCXMYKYFQO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 150000005130 benzoxazines Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- BLEBFDYUDVZRFG-UHFFFAOYSA-N dichloromethane;propan-2-ol Chemical compound ClCCl.CC(C)O BLEBFDYUDVZRFG-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 210000001198 duodenum Anatomy 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- YTJSFYQNRXLOIC-UHFFFAOYSA-N octadecylsilane Chemical compound CCCCCCCCCCCCCCCCCC[SiH3] YTJSFYQNRXLOIC-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- SEYHGPJTLNZDRF-UHFFFAOYSA-N 1,3,5,6-tetramethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C(C)C(C)=CC=C21 SEYHGPJTLNZDRF-UHFFFAOYSA-N 0.000 description 1
- GTCKDDFNAUGPSX-UHFFFAOYSA-N 1,3,5,7-tetramethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C=2C1=CC(C)=CC=2C GTCKDDFNAUGPSX-UHFFFAOYSA-N 0.000 description 1
- PISQUBRUAURAFJ-UHFFFAOYSA-N 1,3,6,7-tetramethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C=C(C)C(C)=C2 PISQUBRUAURAFJ-UHFFFAOYSA-N 0.000 description 1
- PEOBPJSNIMNPPY-UHFFFAOYSA-N 1,5,6-trimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C(C)C(C)=CC=C21 PEOBPJSNIMNPPY-UHFFFAOYSA-N 0.000 description 1
- HAZYXTYCLOYJIL-UHFFFAOYSA-N 1,5,7-trimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C=2C1=CC(C)=CC=2C HAZYXTYCLOYJIL-UHFFFAOYSA-N 0.000 description 1
- IPWWUQHCXIXFRA-UHFFFAOYSA-N 1,6,7-trimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C=C(C)C(C)=C2 IPWWUQHCXIXFRA-UHFFFAOYSA-N 0.000 description 1
- XDRVLQHWGPQSCN-UHFFFAOYSA-N 1,6-dimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=CC(C)=CC=C21 XDRVLQHWGPQSCN-UHFFFAOYSA-N 0.000 description 1
- ZXNFYHLFPXEBGY-UHFFFAOYSA-N 1,7-dimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C=2C1=CC(C)=CC=2 ZXNFYHLFPXEBGY-UHFFFAOYSA-N 0.000 description 1
- VHBJGBWEWWARRW-UHFFFAOYSA-N 1,8-dimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C(C)=CC=C2 VHBJGBWEWWARRW-UHFFFAOYSA-N 0.000 description 1
- MTGDALPXZAZLIV-UHFFFAOYSA-N 1-(1,3-dimethyl-4-sulfanylidenequinolin-5-yl)ethanone Chemical compound CN1C=C(C)C(=S)C2=C1C=CC=C2C(=O)C MTGDALPXZAZLIV-UHFFFAOYSA-N 0.000 description 1
- UAUPCSQPVYZSPA-UHFFFAOYSA-N 1-(1,3-dimethyl-4-sulfanylidenequinolin-6-yl)ethanone Chemical compound CN1C=C(C)C(=S)C2=CC(C(=O)C)=CC=C21 UAUPCSQPVYZSPA-UHFFFAOYSA-N 0.000 description 1
- SQENVUCMPYZOOM-UHFFFAOYSA-N 1-(1,3-dimethyl-4-sulfanylidenequinolin-7-yl)ethanone Chemical compound CN1C=C(C)C(=S)C=2C1=CC(C(=O)C)=CC=2 SQENVUCMPYZOOM-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- KCGIHQJVXLDUKZ-UHFFFAOYSA-N 1-butyl-3-methylsulfinylquinolin-4-one Chemical compound C1=CC=C2N(CCCC)C=C(S(C)=O)C(=O)C2=C1 KCGIHQJVXLDUKZ-UHFFFAOYSA-N 0.000 description 1
- WCBHMVXDXAVQMP-UHFFFAOYSA-N 1-methyl-3-methylsulfanyl-7-(trifluoromethyl)quinolin-4-one Chemical compound FC(F)(F)C1=CC=C2C(=O)C(SC)=CN(C)C2=C1 WCBHMVXDXAVQMP-UHFFFAOYSA-N 0.000 description 1
- AKNVDMJCVKFYSB-UHFFFAOYSA-N 1-methyl-3-methylsulfanyl-7-propan-2-ylquinolin-4-one Chemical compound CC(C)C1=CC=C2C(=O)C(SC)=CN(C)C2=C1 AKNVDMJCVKFYSB-UHFFFAOYSA-N 0.000 description 1
- VVXHQGJZORQMOC-UHFFFAOYSA-N 2-(propylamino)benzoic acid Chemical compound CCCNC1=CC=CC=C1C(O)=O VVXHQGJZORQMOC-UHFFFAOYSA-N 0.000 description 1
- BNNICQAVXPXQAH-UHFFFAOYSA-N 2-amino-4-bromobenzoic acid Chemical compound NC1=CC(Br)=CC=C1C(O)=O BNNICQAVXPXQAH-UHFFFAOYSA-N 0.000 description 1
- CMNRBBYJVYDJTQ-UHFFFAOYSA-N 2-methyl-3-methylsulfonyl-3H-quinolin-4-one Chemical compound CS(=O)(=O)C1C(=NC2=CC=CC=C2C1=O)C CMNRBBYJVYDJTQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- MHZZQJHAYDHFGH-UHFFFAOYSA-N 3-ethyl-n-methylaniline Chemical compound CCC1=CC=CC(NC)=C1 MHZZQJHAYDHFGH-UHFFFAOYSA-N 0.000 description 1
- JRALLVHSYLMVBJ-UHFFFAOYSA-N 3-methylsulfinyl-1-propylquinolin-4-one Chemical compound C1=CC=C2N(CCC)C=C(S(C)=O)C(=O)C2=C1 JRALLVHSYLMVBJ-UHFFFAOYSA-N 0.000 description 1
- DBVVBYBNNNDCHK-UHFFFAOYSA-N 3-methylsulfinyl-3h-quinolin-4-one Chemical compound C1=CC=C2C(=O)C(S(=O)C)C=NC2=C1 DBVVBYBNNNDCHK-UHFFFAOYSA-N 0.000 description 1
- 150000004331 4-hydroxyquinolines Chemical class 0.000 description 1
- DNGHMZZADYDFDW-UHFFFAOYSA-N 5,7-dichloro-1,3-dimethylquinoline-4-thione Chemical compound ClC1=CC(Cl)=C2C(=S)C(C)=CN(C)C2=C1 DNGHMZZADYDFDW-UHFFFAOYSA-N 0.000 description 1
- OAQJIRQEMGLNKC-UHFFFAOYSA-N 5,7-dichloro-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=C(Cl)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1Cl OAQJIRQEMGLNKC-UHFFFAOYSA-N 0.000 description 1
- BTNWNXWHFWYONH-UHFFFAOYSA-N 5-chloro-1-methyl-3,1-benzoxazine-2,4-dione Chemical compound C1=CC(Cl)=C2C(=O)OC(=O)N(C)C2=C1 BTNWNXWHFWYONH-UHFFFAOYSA-N 0.000 description 1
- NIGOFAVNIBBNJV-UHFFFAOYSA-N 5-chloro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2Cl NIGOFAVNIBBNJV-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- MPYIGVKNLKGBFV-UHFFFAOYSA-N 5-ethyl-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C=CC=C2CC MPYIGVKNLKGBFV-UHFFFAOYSA-N 0.000 description 1
- KXGQVAVDANQCLZ-UHFFFAOYSA-N 5-ethyl-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C=CC=C2CC KXGQVAVDANQCLZ-UHFFFAOYSA-N 0.000 description 1
- UHHASTMIDNJNHS-UHFFFAOYSA-N 5-fluoro-1,3-dimethylquinoline-4-thione Chemical compound C1=CC(F)=C2C(=S)C(C)=CN(C)C2=C1 UHHASTMIDNJNHS-UHFFFAOYSA-N 0.000 description 1
- BACOFPPVBVJWHF-UHFFFAOYSA-N 6,7-dimethoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C=C(OC)C(OC)=C2 BACOFPPVBVJWHF-UHFFFAOYSA-N 0.000 description 1
- JSZWWDYNHBBJID-UHFFFAOYSA-N 6-acetyl-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=CC(C(=O)C)=CC=C21 JSZWWDYNHBBJID-UHFFFAOYSA-N 0.000 description 1
- ZMWFZTQQRBMJLA-UHFFFAOYSA-N 6-chloro-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound ClC1=CC=C2N(C)C=C(S(C)=O)C(=O)C2=C1 ZMWFZTQQRBMJLA-UHFFFAOYSA-N 0.000 description 1
- DZCROXKVPWTZNK-UHFFFAOYSA-N 6-chloro-7-methoxy-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C=C(OC)C(Cl)=C2 DZCROXKVPWTZNK-UHFFFAOYSA-N 0.000 description 1
- YHWBIQXVDZFTGO-UHFFFAOYSA-N 6-chloro-7-methoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C=C(OC)C(Cl)=C2 YHWBIQXVDZFTGO-UHFFFAOYSA-N 0.000 description 1
- FAPZZOKJGZOQDH-UHFFFAOYSA-N 6-fluoro-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound FC1=CC=C2N(C)C=C(S(C)=O)C(=O)C2=C1 FAPZZOKJGZOQDH-UHFFFAOYSA-N 0.000 description 1
- JNQOTDDQSHNJJM-UHFFFAOYSA-N 6-methoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=CC(OC)=CC=C21 JNQOTDDQSHNJJM-UHFFFAOYSA-N 0.000 description 1
- HVDKNQBESMWCBM-UHFFFAOYSA-N 7-acetyl-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C=2C1=CC(C(=O)C)=CC=2 HVDKNQBESMWCBM-UHFFFAOYSA-N 0.000 description 1
- CDEMYGPVUKERKI-UHFFFAOYSA-N 7-bromo-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=C(Br)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1 CDEMYGPVUKERKI-UHFFFAOYSA-N 0.000 description 1
- AMGZGWTZKYOUMK-UHFFFAOYSA-N 7-butoxy-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C=2C1=CC(OCCCC)=CC=2 AMGZGWTZKYOUMK-UHFFFAOYSA-N 0.000 description 1
- WNGFDIQSAJGHRS-UHFFFAOYSA-N 7-butoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C=2C1=CC(OCCCC)=CC=2 WNGFDIQSAJGHRS-UHFFFAOYSA-N 0.000 description 1
- VVPJJZWBAGHGHV-UHFFFAOYSA-N 7-chloro-1,3,6-trimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C=C(Cl)C(C)=C2 VVPJJZWBAGHGHV-UHFFFAOYSA-N 0.000 description 1
- HMDMVQYMDYAQFW-UHFFFAOYSA-N 7-chloro-1,6-dimethyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C=C(Cl)C(C)=C2 HMDMVQYMDYAQFW-UHFFFAOYSA-N 0.000 description 1
- CMULQUICGVKUMJ-UHFFFAOYSA-N 7-chloro-1-methyl-3-methylsulfonylquinolin-4-one Chemical compound C1=C(Cl)C=C2N(C)C=C(S(C)(=O)=O)C(=O)C2=C1 CMULQUICGVKUMJ-UHFFFAOYSA-N 0.000 description 1
- OYNHAKCQKUXFGQ-UHFFFAOYSA-N 7-chloro-3-methylsulfinyl-3h-quinolin-4-one Chemical compound ClC1=CC=C2C(=O)C(S(=O)C)C=NC2=C1 OYNHAKCQKUXFGQ-UHFFFAOYSA-N 0.000 description 1
- KUFYVZBJMBNICU-UHFFFAOYSA-N 7-chloro-6-methoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C=C(Cl)C(OC)=C2 KUFYVZBJMBNICU-UHFFFAOYSA-N 0.000 description 1
- AANRGFUCQKJETA-UHFFFAOYSA-N 7-ethyl-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C=2C1=CC(CC)=CC=2 AANRGFUCQKJETA-UHFFFAOYSA-N 0.000 description 1
- ZUMVHPMHCIKNFT-UHFFFAOYSA-N 7-fluoro-1-methyl-3-methylsulfonylquinolin-4-one Chemical compound C1=C(F)C=C2N(C)C=C(S(C)(=O)=O)C(=O)C2=C1 ZUMVHPMHCIKNFT-UHFFFAOYSA-N 0.000 description 1
- CKQUAMJNMYKHBP-UHFFFAOYSA-N 7-fluoro-6-methoxy-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C=C(F)C(OC)=C2 CKQUAMJNMYKHBP-UHFFFAOYSA-N 0.000 description 1
- FVUKRQMXBGREGQ-UHFFFAOYSA-N 7-hydroxy-1,3-dimethylquinoline-4-thione Chemical compound OC1=CC=C2C(C(=CN(C2=C1)C)C)=S FVUKRQMXBGREGQ-UHFFFAOYSA-N 0.000 description 1
- YUABHLLUBMTDHO-UHFFFAOYSA-N 7-methoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C=2C1=CC(OC)=CC=2 YUABHLLUBMTDHO-UHFFFAOYSA-N 0.000 description 1
- KCRDTFGYQBBQLI-UHFFFAOYSA-N 7-tert-butyl-1,3-dimethylquinoline-4-thione Chemical compound CC(C)(C)C1=CC=C2C(=S)C(C)=CN(C)C2=C1 KCRDTFGYQBBQLI-UHFFFAOYSA-N 0.000 description 1
- RPKHNFMTMLTXFN-UHFFFAOYSA-N 7-tert-butyl-1-methyl-3-methylsulfonylquinolin-4-one Chemical compound C1=C(C(C)(C)C)C=C2N(C)C=C(S(C)(=O)=O)C(=O)C2=C1 RPKHNFMTMLTXFN-UHFFFAOYSA-N 0.000 description 1
- LIDIPFARVOJRLY-UHFFFAOYSA-N 8-chloro-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=CC(Cl)=C2N(C)C=C(S(C)=O)C(=O)C2=C1 LIDIPFARVOJRLY-UHFFFAOYSA-N 0.000 description 1
- LJKLKRYBDDMRDL-UHFFFAOYSA-N 8-fluoro-1,3-dimethylquinoline-4-thione Chemical compound C1=CC=C2C(=S)C(C)=CN(C)C2=C1F LJKLKRYBDDMRDL-UHFFFAOYSA-N 0.000 description 1
- HNQFLGCPXBRSRE-UHFFFAOYSA-N 8-fluoro-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound C1=CC(F)=C2N(C)C=C(S(C)=O)C(=O)C2=C1 HNQFLGCPXBRSRE-UHFFFAOYSA-N 0.000 description 1
- PIYUHUAVPNAOGA-UHFFFAOYSA-N 8-methoxy-1,3-dimethylquinoline-4-thione Chemical compound CN1C=C(C)C(=S)C2=C1C(OC)=CC=C2 PIYUHUAVPNAOGA-UHFFFAOYSA-N 0.000 description 1
- GTXJURMEPHQKNS-UHFFFAOYSA-N 8-methoxy-1-methyl-3-methylsulfinylquinolin-4-one Chemical compound CN1C=C(S(C)=O)C(=O)C2=C1C(OC)=CC=C2 GTXJURMEPHQKNS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- HZYCAKGEXXKCDM-UHFFFAOYSA-N Methyl 2-(methylthio)acetate Chemical compound COC(=O)CSC HZYCAKGEXXKCDM-UHFFFAOYSA-N 0.000 description 1
- RLYBUTNJEIGEPK-UHFFFAOYSA-N O-methyl 3-hydroxy-2-methylprop-2-enethioate Chemical compound OC=C(C(=S)OC)C RLYBUTNJEIGEPK-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- RVCMZHSHCNCMDS-UHFFFAOYSA-N bis(phenylmethoxy)methoxymethylbenzene Chemical compound C=1C=CC=CC=1COC(OCC=1C=CC=CC=1)OCC1=CC=CC=C1 RVCMZHSHCNCMDS-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- OBNDYQOFORBMHB-UHFFFAOYSA-N dichloromethane;ethanol;ethyl acetate Chemical compound CCO.ClCCl.CCOC(C)=O OBNDYQOFORBMHB-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- IOSTYTUPOTYMES-UHFFFAOYSA-N methyl 4-fluoro-2-(methylamino)benzoate Chemical compound CNC1=CC(F)=CC=C1C(=O)OC IOSTYTUPOTYMES-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- CRBKJDJZJKXHOD-UHFFFAOYSA-N o-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate Chemical compound COC(=S)C(C)=CNC1=CC=C(OC)C(Cl)=C1 CRBKJDJZJKXHOD-UHFFFAOYSA-N 0.000 description 1
- SQVGTULYLYOGPL-UHFFFAOYSA-N o-methyl prop-2-enethioate Chemical compound COC(=S)C=C SQVGTULYLYOGPL-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- BPLKQGGAXWRFOE-UHFFFAOYSA-M trimethylsulfoxonium iodide Chemical compound [I-].C[S+](C)(C)=O BPLKQGGAXWRFOE-UHFFFAOYSA-M 0.000 description 1
- 238000006175 van Leusen reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/24—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in positions 2 and 4
- C07D265/26—Two oxygen atoms, e.g. isatoic anhydride
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7910558 | 1979-03-27 | ||
| GB7910558 | 1979-03-27 | ||
| GB7939505 | 1979-11-15 | ||
| GB7939505 | 1979-11-15 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI800923A7 FI800923A7 (fi) | 1980-09-28 |
| FI77026B FI77026B (fi) | 1988-09-30 |
| FI77026C true FI77026C (fi) | 1989-01-10 |
Family
ID=26271029
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI800923A FI77026C (fi) | 1979-03-27 | 1980-03-25 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 3-(alkyltio, alkylsulfinyl eller alkylsulfonyl)-4-kinoloner. |
Country Status (34)
| Country | Link |
|---|---|
| US (1) | US4302460A (Direct) |
| KR (1) | KR840001612B1 (Direct) |
| AT (1) | AT379390B (Direct) |
| AU (1) | AU536616B2 (Direct) |
| BG (2) | BG37836A3 (Direct) |
| CA (1) | CA1151652A (Direct) |
| CH (1) | CH644366A5 (Direct) |
| CS (1) | CS221906B2 (Direct) |
| DD (1) | DD149608A5 (Direct) |
| DE (2) | DE3011994A1 (Direct) |
| DK (1) | DK151252C (Direct) |
| EG (1) | EG16606A (Direct) |
| FI (1) | FI77026C (Direct) |
| FR (2) | FR2452484A1 (Direct) |
| GR (1) | GR68007B (Direct) |
| HK (1) | HK94986A (Direct) |
| HU (1) | HU179845B (Direct) |
| IE (1) | IE49562B1 (Direct) |
| IL (1) | IL59710A (Direct) |
| IT (1) | IT1188916B (Direct) |
| KE (1) | KE3649D (Direct) |
| LU (1) | LU82295A1 (Direct) |
| MX (1) | MX6816E (Direct) |
| MY (1) | MY8600668A (Direct) |
| NL (1) | NL191306C (Direct) |
| NO (1) | NO156787C (Direct) |
| NZ (1) | NZ193167A (Direct) |
| PH (1) | PH16758A (Direct) |
| PL (1) | PL124037B1 (Direct) |
| PT (1) | PT71006A (Direct) |
| RO (1) | RO79397A (Direct) |
| SE (1) | SE455422B (Direct) |
| SG (1) | SG60886G (Direct) |
| YU (1) | YU42332B (Direct) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE51542B1 (en) * | 1980-09-26 | 1987-01-07 | Boots Co Ltd | Therapeutic agents |
| PT79031B (en) * | 1983-08-20 | 1986-08-22 | Boots Co Plc | Therapeutic agents |
| DE3578374D1 (de) * | 1984-01-13 | 1990-08-02 | Boots Co Ltd | Verwendung von chinolonen fuer die herstellung eines arzneimittels zur behandlung von herzerkrankungen. |
| DE3576686D1 (de) * | 1984-08-15 | 1990-04-26 | Boots Co Ltd | Chinolinone, verfahren zu ihrer herstellung und die sie enthaltenden pharmazeutischen praeparate. |
| GB8515207D0 (en) * | 1985-06-15 | 1985-07-17 | Boots Co Plc | Therapeutic agents |
| GB8515209D0 (en) * | 1985-06-15 | 1985-07-17 | Boots Co Plc | Therapeutic agents |
| GB8627698D0 (en) * | 1986-11-20 | 1986-12-17 | Boots Co Plc | Therapeutic agents |
| GB8726950D0 (en) * | 1987-11-18 | 1987-12-23 | Boots Co Plc | Chemical process |
| GB8804016D0 (en) * | 1988-02-22 | 1988-03-23 | Boots Co Plc | Therapeutic agents |
| GB8918952D0 (en) * | 1989-08-19 | 1989-10-04 | Boots Co Plc | Therapeutic agents |
| FR2680511B1 (fr) * | 1991-08-20 | 1995-05-19 | Roussel Uclaf | Derives n-substitues de la quinoleine, leur procede de preparation, intermediaires obtenus, leur application comme medicaments et les compositions les renfermant. |
| IL100555A (en) * | 1991-02-07 | 2000-08-31 | Hoechst Marion Roussel Inc | N-substituted quinoline derivatives their preparation their use for the preparation of medicaments and the pharmaceutical compositions containing them |
| FR2684671B1 (fr) * | 1991-11-20 | 1995-05-19 | Roussel Uclaf | Nouveaux derives de la quinoleine, leur procede de preparation et intermediaires et leur application a titre de medicaments. |
| FR2672597B1 (fr) * | 1991-02-07 | 1995-05-19 | Roussel Uclaf | Nouveaux derives n-substitues de la quinoleine, leur procede de preparation, les nouveaux intermediaires obtenus, leur application a titre de medicaments et les compositions pharmaceutiques les renfermant. |
| AU5509099A (en) * | 1998-08-03 | 2000-02-28 | Basf Corporation | Pyridinones for the treatment of sexual dysfunction |
| US6307050B1 (en) * | 2000-08-29 | 2001-10-23 | R. T. Alamo Venture I Llc | Method of synthesizing flosequinan from 4-fluoroanthranilic acid |
| US6562838B2 (en) * | 2001-01-26 | 2003-05-13 | R. T. Alamo Ventures I, L.L.C. | Treatment of cardiovascular disease with quinolinone enantiomers |
| US6458804B1 (en) * | 2001-01-26 | 2002-10-01 | R.T. Alamo Venturesi, Llc | Methods for the treatment of central nervous system disorders in certain patient groups |
| US6451813B1 (en) | 2001-01-26 | 2002-09-17 | R. T. Alamo Ventures I, Llc | Treatment of gastroparesis in certain patient groups |
| US6649764B2 (en) * | 2001-10-25 | 2003-11-18 | R. T. Alamo Ventures I, Llc | Stereospecific enrichment of heterocyclic enantiomers |
| US6730790B2 (en) * | 2002-03-01 | 2004-05-04 | R.T. Alamo Ventures I. Llc | Chlorinated heterocyclic compounds and methods of synthesis |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3178348A (en) * | 1961-02-08 | 1965-04-13 | Norwich Pharma Co | Hypotensive quinolines |
| GB1066918A (en) | 1964-04-03 | 1967-04-26 | Hoffmann La Roche | Novel glycine derivatives |
| DE1770482A1 (de) * | 1968-05-22 | 1971-11-11 | Basf Ag | Verfahren zur Herstellung von 2,4-Dioxychinolinen |
| US3798219A (en) * | 1971-10-18 | 1974-03-19 | Warner Lambert Co | 3-(methylsulfinyl)cinnolinones and their derivatives |
| US3772301A (en) * | 1971-11-22 | 1973-11-13 | Warner Lambert Co | (4-substituted)4-(methylsulfinyl)methylcarbostyrils |
| CH607848A5 (Direct) * | 1974-06-04 | 1978-11-30 | Bayer Ag | |
| GB1488411A (en) * | 1975-01-16 | 1977-10-12 | Wyeth John & Brother Ltd | 3,4-dihydro-4-arylquinolin-4-ol derivatives |
| US4124587A (en) * | 1976-03-01 | 1978-11-07 | Sandoz, Inc. | 4-Hydroxy-3-sulfinyl-quinolin-2(1H)-ones |
| US4127574A (en) * | 1976-03-01 | 1978-11-28 | Sandoz, Inc. | 4-Hydroxy-3-sulfonyl-quinolin-2(1H)-ones |
| DE2616991A1 (de) | 1976-04-17 | 1977-10-27 | Bayer Ag | Heterocyclisch-substituierte schwefelhaltige dihydropyridine, mehrere verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2616995A1 (de) | 1976-04-17 | 1977-10-27 | Bayer Ag | 1.4-dihydropyridine mit schwefelhaltigen substituenten mehrere verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2639257A1 (de) | 1976-09-01 | 1978-03-02 | Bayer Ag | Aminoalkylidenamino-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2639498A1 (de) | 1976-09-02 | 1978-03-09 | Bayer Ag | Neue schwefelhaltige amino-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2641746C2 (de) | 1976-09-16 | 1986-11-06 | Bayer Ag, 5090 Leverkusen | 1,4-Dihydropyridin-Zuckerderivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2658183A1 (de) * | 1976-12-22 | 1978-07-06 | Bayer Ag | In 2-position substituierte 1,4- dihydropyridin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2658804A1 (de) | 1976-12-24 | 1978-07-06 | Bayer Ag | Kreislaufbeeinflussende mittel |
| DE2715182A1 (de) | 1977-04-05 | 1978-10-19 | Bayer Ag | 2-alkylenaminodihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4177278A (en) * | 1977-04-05 | 1979-12-04 | Bayer Aktiengesellschaft | 2-Alkyleneaminodihydropyridines compounds, their production and their medicinal use |
| JPS5424882A (en) * | 1977-07-22 | 1979-02-24 | Yamanouchi Pharmaceut Co Ltd | Novel heterocyclic compounds and their preparation |
| DE2747513A1 (de) | 1977-10-22 | 1979-05-03 | Bayer Ag | Dihydropyridine mit schwefelhaltigen estergruppierungen |
-
1980
- 1980-03-18 NZ NZ193167A patent/NZ193167A/en unknown
- 1980-03-19 IE IE567/80A patent/IE49562B1/en not_active IP Right Cessation
- 1980-03-21 AU AU56702/80A patent/AU536616B2/en not_active Ceased
- 1980-03-22 GR GR61514A patent/GR68007B/el unknown
- 1980-03-24 PH PH23802A patent/PH16758A/en unknown
- 1980-03-24 US US06/133,310 patent/US4302460A/en not_active Expired - Lifetime
- 1980-03-25 LU LU82295A patent/LU82295A1/fr unknown
- 1980-03-25 IL IL59710A patent/IL59710A/xx not_active IP Right Cessation
- 1980-03-25 PT PT71006A patent/PT71006A/pt not_active IP Right Cessation
- 1980-03-25 FI FI800923A patent/FI77026C/fi not_active IP Right Cessation
- 1980-03-25 RO RO80100611A patent/RO79397A/ro unknown
- 1980-03-26 SE SE8002345A patent/SE455422B/sv not_active IP Right Cessation
- 1980-03-26 HU HU8080713A patent/HU179845B/hu not_active IP Right Cessation
- 1980-03-26 BG BG047135A patent/BG37836A3/xx unknown
- 1980-03-26 DK DK130180A patent/DK151252C/da not_active IP Right Cessation
- 1980-03-26 IT IT48262/80A patent/IT1188916B/it active
- 1980-03-26 AT AT0161880A patent/AT379390B/de not_active IP Right Cessation
- 1980-03-26 NO NO800881A patent/NO156787C/no unknown
- 1980-03-26 CA CA000348520A patent/CA1151652A/en not_active Expired
- 1980-03-26 KR KR1019800001266A patent/KR840001612B1/ko not_active Expired
- 1980-03-26 YU YU849/80A patent/YU42332B/xx unknown
- 1980-03-26 BG BG066170A patent/BG37993A3/xx unknown
- 1980-03-26 NL NL8001771A patent/NL191306C/xx not_active IP Right Cessation
- 1980-03-26 CH CH237680A patent/CH644366A5/fr not_active IP Right Cessation
- 1980-03-27 DE DE19803011994 patent/DE3011994A1/de active Granted
- 1980-03-27 MX MX808725U patent/MX6816E/es unknown
- 1980-03-27 FR FR8006811A patent/FR2452484A1/fr active Granted
- 1980-03-27 CS CS802156A patent/CS221906B2/cs unknown
- 1980-03-27 DE DE19803051205 patent/DE3051205C2/de not_active Expired - Lifetime
- 1980-03-27 PL PL1980223050A patent/PL124037B1/pl unknown
- 1980-03-27 DD DD80219973A patent/DD149608A5/de not_active IP Right Cessation
- 1980-03-29 EG EG188/80A patent/EG16606A/xx active
- 1980-10-02 FR FR8021107A patent/FR2468367A1/fr active Granted
-
1986
- 1986-07-08 KE KE3649BD patent/KE3649D/xx unknown
- 1986-07-10 SG SG608/86A patent/SG60886G/en unknown
- 1986-12-04 HK HK949/86A patent/HK94986A/xx not_active IP Right Cessation
- 1986-12-30 MY MY668/86A patent/MY8600668A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI77026C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 3-(alkyltio, alkylsulfinyl eller alkylsulfonyl)-4-kinoloner. | |
| EP0249043B1 (en) | Quinolinecarboxylic acid derivatives | |
| IE63429B1 (en) | 4-amino quinolines and naphthyridines process for their preparation and their use as medicines | |
| HU211339A9 (en) | Antiatherosclerotic and antithrombotic 1-benzopyran-4-ones and 2-amino-1,3-benzoxazine-4-ones | |
| HU177959B (en) | Process for producing 1,2-dihydro-quinoline-2-one derivatives | |
| NO162414B (no) | Fleksibel beholder for transport og lagring av massegods. | |
| PL184860B1 (pl) | Chinoksaliny o własnościach leczniczychĆ zwłaszcza antywirusowychĆ sposób ich wytwarzania i środki lecznicze zawierające chinoksaliny jako substancje czynne | |
| US4442109A (en) | 3-Methylthiomethyl-and 3-methylsulfinylmethyl-4-quinolinones useful for treating hypertension | |
| NO843292L (no) | Fremgangsmaate for fremstilling av nye kinolon-derivater | |
| FI67220C (fi) | Foerfarande foer framstaellning av antitrombotiskt verkande 2-perhydro-1,4-diazino)-pyrimido(5,4-d)pyrimidiner | |
| SK37394A3 (en) | 1,8-benzonaphthyridine derivatives, method of their preparation and compositions containing these derivatives | |
| SU1124886A3 (ru) | Способ получени хинолонов | |
| FI104821B (fi) | Menetelmä bentso[b]naftyridiinijohdannaisten valmistamiseksi | |
| AU623473B2 (en) | New benzo(1,8)naphthyridine derivatives and their preparation | |
| FI105400B (fi) | Uudet 3-karboksyylihappo-fluorikinoliinijohdannaiset, niiden valmistus ja niiden käyttö bentsonaftyridiinijohdannaisten valmistukseen | |
| GB2085441A (en) | Therapeutic agents | |
| HU184968B (en) | Process for preparing quinolone derivatives | |
| CS221907B2 (cs) | Způsob přípravy 3-(alkylthio, alkylsulfinyl nebo alkylsulfonyl)-4-chinolonů | |
| CS228519B2 (cs) | Způsob výroby nových chinolonů | |
| SI8010849A8 (sl) | Postopek za pridobivanje 3-(metiltio, metilsulfinil ali metilsulfonil)-4-kinolonov | |
| SE446736B (sv) | Beta-karbolin-3-karboxylsyraderivat och framstellning derav |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: THE BOOTS CO LTD |