DE69101896T2 - Detergenszusammensetzungen in Tablettenform. - Google Patents
Detergenszusammensetzungen in Tablettenform.Info
- Publication number
- DE69101896T2 DE69101896T2 DE69101896T DE69101896T DE69101896T2 DE 69101896 T2 DE69101896 T2 DE 69101896T2 DE 69101896 T DE69101896 T DE 69101896T DE 69101896 T DE69101896 T DE 69101896T DE 69101896 T2 DE69101896 T2 DE 69101896T2
- Authority
- DE
- Germany
- Prior art keywords
- tablet
- detergent
- sodium
- composition
- percarbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Revoked
Links
- 239000000203 mixture Substances 0.000 title claims description 66
- 239000003599 detergent Substances 0.000 title claims description 55
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 claims description 30
- 229940045872 sodium percarbonate Drugs 0.000 claims description 30
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 29
- 239000007844 bleaching agent Substances 0.000 claims description 29
- 239000004615 ingredient Substances 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 17
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 claims description 17
- 239000012190 activator Substances 0.000 claims description 11
- -1 alkali metal aluminum silicate Chemical class 0.000 claims description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 11
- 239000007921 spray Substances 0.000 claims description 9
- 239000011230 binding agent Substances 0.000 claims description 8
- 229910017053 inorganic salt Inorganic materials 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 238000000926 separation method Methods 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 3
- 230000001627 detrimental effect Effects 0.000 claims description 2
- 239000003826 tablet Substances 0.000 description 80
- 238000003860 storage Methods 0.000 description 15
- 238000005056 compaction Methods 0.000 description 11
- 239000002585 base Substances 0.000 description 10
- 235000017550 sodium carbonate Nutrition 0.000 description 10
- 239000010457 zeolite Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 238000005406 washing Methods 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 8
- 102000004190 Enzymes Human genes 0.000 description 8
- 229910021536 Zeolite Inorganic materials 0.000 description 8
- 238000004061 bleaching Methods 0.000 description 8
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 8
- 229940088598 enzyme Drugs 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 239000002245 particle Substances 0.000 description 8
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- 239000011976 maleic acid Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 238000004090 dissolution Methods 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000003945 anionic surfactant Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000011159 matrix material Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000002736 nonionic surfactant Substances 0.000 description 5
- 229920005646 polycarboxylate Polymers 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000012459 cleaning agent Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 235000012149 noodles Nutrition 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 238000004806 packaging method and process Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229960001922 sodium perborate Drugs 0.000 description 4
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 4
- 239000007916 tablet composition Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000002518 antifoaming agent Substances 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 230000003254 anti-foaming effect Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000007884 disintegrant Substances 0.000 description 2
- PMPJQLCPEQFEJW-GNTLFSRWSA-L disodium;2-[(z)-2-[4-[4-[(z)-2-(2-sulfonatophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1\C=C/C1=CC=C(C=2C=CC(\C=C/C=3C(=CC=CC=3)S([O-])(=O)=O)=CC=2)C=C1 PMPJQLCPEQFEJW-GNTLFSRWSA-L 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 229920005596 polymer binder Polymers 0.000 description 2
- 239000002491 polymer binding agent Substances 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical class OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229920000896 Ethulose Polymers 0.000 description 1
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- JYXGIOKAKDAARW-UHFFFAOYSA-N N-(2-hydroxyethyl)iminodiacetic acid Chemical class OCCN(CC(O)=O)CC(O)=O JYXGIOKAKDAARW-UHFFFAOYSA-N 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- GFUDVONXTOGWEU-UHFFFAOYSA-L O1CCN(CC1)C1=NC(=NC(=N1)NC1=CC=CC=C1)NC1=C(C(=C(C=C1)C=CC1=CC=C(C=C1)NC1=NC(=NC(=N1)N1CCOCC1)NC1=CC=CC=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] Chemical compound O1CCN(CC1)C1=NC(=NC(=N1)NC1=CC=CC=C1)NC1=C(C(=C(C=C1)C=CC1=CC=C(C=C1)NC1=NC(=NC(=N1)N1CCOCC1)NC1=CC=CC=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] GFUDVONXTOGWEU-UHFFFAOYSA-L 0.000 description 1
- QJKBWACVDOINMW-UHFFFAOYSA-N OP(=O)C(=O)C=C Chemical class OP(=O)C(=O)C=C QJKBWACVDOINMW-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- VUJGKADZTYCLIL-YHPRVSEPSA-L disodium;5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate Chemical compound [Na+].[Na+].C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S([O-])(=O)=O)C(S(=O)(=O)[O-])=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 VUJGKADZTYCLIL-YHPRVSEPSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000007922 dissolution test Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008393 encapsulating agent Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 1
- 230000003090 exacerbative effect Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 108010003855 mesentericopeptidase Proteins 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 108010020132 microbial serine proteinases Proteins 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000003405 preventing effect Effects 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 239000000429 sodium aluminium silicate Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- RPQSWSMNPBZEHT-UHFFFAOYSA-M sodium;2-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=CC=C1S([O-])(=O)=O RPQSWSMNPBZEHT-UHFFFAOYSA-M 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000004154 testing of material Methods 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0073—Tablets
- C11D17/0078—Multilayered tablets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3942—Inorganic per-compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB909022724A GB9022724D0 (en) | 1990-10-19 | 1990-10-19 | Detergent compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69101896D1 DE69101896D1 (de) | 1994-06-09 |
| DE69101896T2 true DE69101896T2 (de) | 1994-08-11 |
Family
ID=10683979
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69101896T Revoked DE69101896T2 (de) | 1990-10-19 | 1991-10-17 | Detergenszusammensetzungen in Tablettenform. |
Country Status (11)
| Country | Link |
|---|---|
| EP (1) | EP0481793B1 (ko) |
| JP (1) | JP2628812B2 (ko) |
| KR (1) | KR950005384B1 (ko) |
| AU (1) | AU632713B2 (ko) |
| BR (1) | BR9104512A (ko) |
| CA (1) | CA2053434C (ko) |
| DE (1) | DE69101896T2 (ko) |
| ES (1) | ES2052337T3 (ko) |
| GB (1) | GB9022724D0 (ko) |
| TW (1) | TW224135B (ko) |
| ZA (1) | ZA918338B (ko) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9224015D0 (en) * | 1992-11-16 | 1993-01-06 | Unilever Plc | Detergent compositions |
| GB9422925D0 (en) * | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| GB9422924D0 (en) * | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| ES2201162T3 (es) * | 1995-04-12 | 2004-03-16 | Cleantabs A/S | Comprimido de agentes blanqueantes. |
| EP0842257B1 (de) * | 1995-07-13 | 2000-12-27 | Benckiser N.V. | Geschirrwaschmaschinenspülmittel in form einer tablette |
| US5837663A (en) * | 1996-12-23 | 1998-11-17 | Lever Brothers Company, Division Of Conopco, Inc. | Machine dishwashing tablets containing a peracid |
| JP4428673B2 (ja) * | 1997-01-10 | 2010-03-10 | ゲマーク、トラスト | 洗浄剤 |
| GB2324495A (en) * | 1997-04-22 | 1998-10-28 | Procter & Gamble | Multi-layer detergent tablet |
| GB9711831D0 (en) † | 1997-06-06 | 1997-08-06 | Unilever Plc | Cleaning compositions |
| GB9711829D0 (en) * | 1997-06-06 | 1997-08-06 | Unilever Plc | Detergent compositions |
| GB2327949A (en) * | 1997-08-02 | 1999-02-10 | Procter & Gamble | Detergent tablet |
| US6451754B1 (en) | 1997-08-02 | 2002-09-17 | The Procter & Gamble Company | Process for preparing detergent tablet |
| DE19739384A1 (de) * | 1997-09-09 | 1999-03-11 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit verbesserter Löslichkeit |
| KR100247735B1 (ko) * | 1997-09-11 | 2000-03-15 | 하진규 | 폐합성수지재를 이용한 건설골재 및 그의 제조방법 |
| HUP0004038A3 (en) * | 1997-10-22 | 2001-11-28 | Unilever Nv | Detergent compositions in tablet form and process for producing thereof |
| WO1999024548A1 (en) * | 1997-11-10 | 1999-05-20 | The Procter & Gamble Company | Detergent tablet |
| DE69812403T2 (de) | 1997-11-10 | 2004-01-29 | Procter & Gamble | Verfahren zur herstellung einer waschmitteltablette |
| BR9814021A (pt) * | 1997-11-10 | 2000-09-26 | Procter & Gamble | Tablete de detergente de camadas múltiplas que possui tanto porções comprimidas quanto não comprimidas |
| ES2142784T3 (es) * | 1997-11-26 | 2003-01-16 | Procter & Gamble | Metodo para lavar vajilla. |
| BR9807007A (pt) | 1997-11-26 | 2000-03-14 | Procter & Gamble | Tablete de detergentes de múltiplas camadas tendo tanto porções comprimiidas quanto não comprimidas |
| WO1999027068A1 (en) * | 1997-11-26 | 1999-06-03 | The Procter & Gamble Company | Detergent tablet |
| CA2311721C (en) * | 1997-11-26 | 2004-10-12 | The Procter & Gamble Company | Detergent tablet |
| ES2244096T3 (es) | 1997-11-26 | 2005-12-01 | THE PROCTER & GAMBLE COMPANY | Pastilla detergente. |
| DE19758183A1 (de) * | 1997-12-30 | 1999-07-01 | Henkel Kgaa | Waschaktiver Formkörper mit spezifischer Oberfläche |
| DE19758176A1 (de) * | 1997-12-30 | 1999-07-01 | Henkel Kgaa | Geschirrspülmittelformkörper mit Tensiden |
| DE19758173A1 (de) * | 1997-12-30 | 1999-07-01 | Henkel Kgaa | Geschirrspülmittelformkörper mit spezifischer Geometrie |
| DE19758171A1 (de) * | 1997-12-30 | 1999-07-01 | Henkel Kgaa | Geschirrspülmittelformkörper mit spezifischem Volumenverhältnis |
| EP1051476A1 (en) | 1998-01-26 | 2000-11-15 | The Procter & Gamble Company | Multi-layer detergent tablet |
| DE19803410A1 (de) * | 1998-01-28 | 1999-07-29 | Henkel Kgaa | Mehrphasige Waschmitteltabletten |
| GB9802390D0 (en) * | 1998-02-04 | 1998-04-01 | Unilever Plc | Detergent compositions |
| US6534473B1 (en) | 1998-02-10 | 2003-03-18 | Unilever Patent Holdings Bv | Process for the manufacture of tablet detergent compositions |
| DE19806200A1 (de) * | 1998-02-16 | 1999-08-19 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit Bleichmittel |
| DE19806220A1 (de) * | 1998-02-16 | 1999-08-19 | Henkel Kgaa | Mehrphasen-Formkörper mit optimiertem Phasensplit |
| GB9814968D0 (en) | 1998-07-10 | 1998-09-09 | Hinton Gerald T | Detergent |
| DE69933709T2 (de) * | 1998-07-17 | 2007-08-23 | The Procter & Gamble Company, Cincinnati | Tablettenförmige Waschmittel |
| ES2168835T3 (es) * | 1998-07-17 | 2002-06-16 | Procter & Gamble | Metodo para preparar comprimidos detergentes. |
| US6589932B1 (en) * | 1998-07-17 | 2003-07-08 | The Procter & Gamble Company | Detergent tablet |
| IES990570A2 (en) * | 1998-07-17 | 2000-03-08 | Procter & Gamble | Detergent tablet |
| GB2340842A (en) * | 1998-08-28 | 2000-03-01 | Procter & Gamble | Detergent tablet |
| DE29911484U1 (de) * | 1998-07-17 | 2000-02-24 | Procter & Gamble | Reinigungsmitteltablette |
| GB9815525D0 (en) * | 1998-07-17 | 1998-09-16 | Procter & Gamble | Detergent tablet |
| US6551981B1 (en) * | 1998-07-17 | 2003-04-22 | Patrizio Ricci | Detergent tablet |
| US6551982B1 (en) | 1998-07-17 | 2003-04-22 | Procter & Gamble Company | Detergent tablet |
| DE29911486U1 (de) * | 1998-07-17 | 1999-11-18 | Procter & Gamble | Reinigungsmitteltablette |
| FR2781810B1 (fr) * | 1998-07-31 | 2000-09-15 | Chimiotechnic | Tablette detergente multicouches pour le lavage du linge et procede de fabrication |
| DE19841362A1 (de) * | 1998-09-10 | 2000-03-16 | Henkel Kgaa | ABS-haltige Wasch- und Reinigungsmittelformkörper |
| DE19843778A1 (de) * | 1998-09-24 | 2000-03-30 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit Natriumpercarbonat |
| EP0999262A1 (en) * | 1998-11-05 | 2000-05-10 | The Procter & Gamble Company | Multilayered detergent tablets |
| EP0999261A1 (en) * | 1998-11-05 | 2000-05-10 | The Procter & Gamble Company | Coloured tablet |
| DE19855381A1 (de) * | 1998-12-01 | 2000-06-08 | Henkel Kgaa | Tensidmischung in fester Form zum Einsatz als Wasch- und Reinigungsmittel |
| DE19856214C1 (de) * | 1998-12-05 | 2000-03-09 | Henkel Kgaa | Punkttablette |
| GB9901688D0 (en) | 1999-01-26 | 1999-03-17 | Unilever Plc | Detergent compositions |
| DE19914812A1 (de) * | 1999-03-31 | 2000-10-05 | Henkel Kgaa | Ein- oder mehrphasige Wasch- und Reinigungsmittelformkörper mit speziellen Bleichaktivatoren |
| DE19914353A1 (de) * | 1999-03-31 | 2000-10-05 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit speziellen Bleichaktivatoren |
| DE19920119A1 (de) * | 1999-05-03 | 2000-11-09 | Henkel Kgaa | Waschverfahren mit Waschmitteltabletten |
| GB9911949D0 (en) * | 1999-05-21 | 1999-07-21 | Unilever Plc | Detergent compositions |
| US6818606B1 (en) | 1999-06-16 | 2004-11-16 | Kao Corporation | Article for use in washing in sheet form |
| DE19948669A1 (de) * | 1999-10-08 | 2001-04-19 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| KR20010064564A (ko) * | 1999-12-29 | 2001-07-09 | 김형철 | 폐플라스틱 종말처리품을 이용한 경량 인조골재의제조방법 |
| DE10038845A1 (de) * | 2000-08-04 | 2002-02-21 | Henkel Kgaa | Teilchenförmig konfektionierte Acetonitril-Derivate als Bleichaktivatoren in festen Waschmitteln |
| JP5207161B2 (ja) * | 2006-08-10 | 2013-06-12 | ディバーシー株式会社 | 自動食器洗浄機への洗浄剤供給方法およびそれに用いられる自動食器洗浄機用タブレット洗浄剤組成物、並びにそれを用いた洗浄方法 |
| DE102007059968A1 (de) | 2007-12-11 | 2009-06-18 | Henkel Ag & Co. Kgaa | Reinigungsmittel |
| DE102007059970A1 (de) | 2007-12-11 | 2009-09-10 | Henkel Ag & Co. Kgaa | Reinigungsmittel |
| JP6695103B2 (ja) * | 2015-06-25 | 2020-05-20 | 株式会社ニイタカ | カートリッジ洗浄剤 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB911204A (en) * | 1960-07-28 | 1962-11-21 | Unilever Ltd | Bleaching compositions |
| DE2263939C2 (de) * | 1972-07-03 | 1983-01-13 | Henkel KGaA, 4000 Düsseldorf | Zur Verwendung in perhydrathaltigen Textilwaschmitteln geeignete Bleichaktivator-Tablette |
| JPS5070286A (ko) * | 1973-10-25 | 1975-06-11 | ||
| LU72575A1 (ko) * | 1975-05-23 | 1977-02-10 | ||
| JPS58217599A (ja) * | 1982-06-10 | 1983-12-17 | 花王株式会社 | 漂白洗浄剤組成物 |
| JPS59145300A (ja) * | 1983-02-07 | 1984-08-20 | 日本パ−オキサイド株式会社 | 漂白洗剤 |
| JPS59194000A (ja) * | 1983-04-18 | 1984-11-02 | 花王株式会社 | 漂白洗浄剤組成物 |
| JPS6015500A (ja) * | 1983-07-08 | 1985-01-26 | ライオン株式会社 | 高嵩密度洗剤組成物 |
| DE3417820A1 (de) * | 1984-05-14 | 1985-11-14 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung eines waschzusatzes in tablettenform |
| JPS614879A (ja) * | 1984-06-15 | 1986-01-10 | Atsugi Motor Parts Co Ltd | モ−タ自己冷却型エアポンプ |
| GB8727135D0 (en) * | 1987-11-19 | 1987-12-23 | Unilever Plc | Machine dishwashing composition |
| AU643077B2 (en) * | 1990-10-19 | 1993-11-04 | Unilever Plc | Detergent compositions |
-
1990
- 1990-10-19 GB GB909022724A patent/GB9022724D0/en active Pending
-
1991
- 1991-10-14 TW TW080108090A patent/TW224135B/zh active
- 1991-10-15 AU AU85842/91A patent/AU632713B2/en not_active Ceased
- 1991-10-15 CA CA002053434A patent/CA2053434C/en not_active Expired - Fee Related
- 1991-10-17 DE DE69101896T patent/DE69101896T2/de not_active Revoked
- 1991-10-17 EP EP91309598A patent/EP0481793B1/en not_active Revoked
- 1991-10-17 ES ES91309598T patent/ES2052337T3/es not_active Expired - Lifetime
- 1991-10-17 KR KR1019910018254A patent/KR950005384B1/ko not_active IP Right Cessation
- 1991-10-17 BR BR919104512A patent/BR9104512A/pt not_active IP Right Cessation
- 1991-10-18 ZA ZA918338A patent/ZA918338B/xx unknown
- 1991-10-18 JP JP3271277A patent/JP2628812B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB9022724D0 (en) | 1990-12-05 |
| AU632713B2 (en) | 1993-01-07 |
| JPH04285698A (ja) | 1992-10-09 |
| CA2053434C (en) | 1997-07-22 |
| EP0481793A1 (en) | 1992-04-22 |
| BR9104512A (pt) | 1992-06-09 |
| CA2053434A1 (en) | 1992-04-20 |
| DE69101896D1 (de) | 1994-06-09 |
| KR920008176A (ko) | 1992-05-27 |
| KR950005384B1 (ko) | 1995-05-23 |
| EP0481793B1 (en) | 1994-05-04 |
| TW224135B (ko) | 1994-05-21 |
| AU8584291A (en) | 1992-06-25 |
| JP2628812B2 (ja) | 1997-07-09 |
| ZA918338B (en) | 1993-04-19 |
| ES2052337T3 (es) | 1994-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69101896T2 (de) | Detergenszusammensetzungen in Tablettenform. | |
| DE69109193T2 (de) | Detergenszusammensetzungen. | |
| DE69109192T2 (de) | Detergenszusammensetzungen. | |
| DE69220147T2 (de) | Detergenszusammensetzungen in Tablettenform | |
| EP0743978B1 (de) | Bleichtablette mit buildersubstanzen | |
| DE69819522T2 (de) | Waschmittelzusammensetzungen | |
| DE69819542T3 (de) | Reinigungsmittel | |
| DE69928833T2 (de) | Waschmittelformkörper | |
| DE69024561T2 (de) | Wäschebehandlungsmittel | |
| DE69806406T3 (de) | Tablettenförmige waschmittelzusammensetzungen | |
| DE4112075C2 (ko) | ||
| DE69124334T2 (de) | Detergenszusammensetzungen in Tablettenform | |
| DE69915671T2 (de) | Waschmittelzusammensetzungen | |
| CH678191A5 (ko) | ||
| DE60021557T2 (de) | Waschmittelzusammensetzungen | |
| DE60301968T2 (de) | Waschmitteltabletten | |
| DE60013889T2 (de) | Waschmittelzusammensetzungen | |
| DE60022761T2 (de) | Waschmittelzusammensetzungen | |
| DE69727189T2 (de) | Waschmittelzusammensetzung | |
| DE60113059T2 (de) | Wasch- oder Reinigungsmittel | |
| DE69824564T2 (de) | Waschmittelzusammensetzungen | |
| DE19943237A1 (de) | Cogranulate aus Alkalischichtsilikaten und Sprengmitteln | |
| DE60209658T2 (de) | Waschmittelzusammensetzungen | |
| DE60024095T2 (de) | Wasserenthärtungs- und waschmittelzusammensetzungen | |
| DE60302878T2 (de) | Waschmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |