DE6905504U - Nadelwalse - Google Patents
NadelwalseInfo
- Publication number
- DE6905504U DE6905504U DE6905504U DE6905504U DE6905504U DE 6905504 U DE6905504 U DE 6905504U DE 6905504 U DE6905504 U DE 6905504U DE 6905504 U DE6905504 U DE 6905504U DE 6905504 U DE6905504 U DE 6905504U
- Authority
- DE
- Germany
- Prior art keywords
- alt
- needles
- aaoh
- lad
- roller
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241000283153 Cetacea Species 0.000 title 1
- 238000004873 anchoring Methods 0.000 description 3
- 229910001369 Brass Inorganic materials 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- 206010061592 cardiac fibrillation Diseases 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000002600 fibrillogenic effect Effects 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- ISEIOOAKVBPQFO-AOHZBQACSA-N (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-pyren-1-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound CC1(C)S[C@@H]2[C@H](NC(=O)Cc3ccc4ccc5cccc6ccc3c4c56)C(=O)N2[C@H]1C(O)=O ISEIOOAKVBPQFO-AOHZBQACSA-N 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01G—PRELIMINARY TREATMENT OF FIBRES, e.g. FOR SPINNING
- D01G19/00—Combing machines
- D01G19/06—Details
- D01G19/10—Construction, mounting, or operating features of combing elements
- D01G19/105—Combing cylinders
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Perforating, Stamping-Out Or Severing By Means Other Than Cutting (AREA)
- Folding Of Thin Sheet-Like Materials, Special Discharging Devices, And Others (AREA)
- Spinning Or Twisting Of Yarns (AREA)
- Preliminary Treatment Of Fibers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH155769A CH505919A (de) | 1969-01-31 | 1969-01-31 | Nadelwalze |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE6905504U true DE6905504U (de) | 1970-09-17 |
Family
ID=4213196
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE6905504U Expired DE6905504U (de) | 1969-01-31 | 1969-02-12 | Nadelwalse |
| DE19691907007 Pending DE1907007A1 (de) | 1969-01-31 | 1969-02-12 | Nadelwalze |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691907007 Pending DE1907007A1 (de) | 1969-01-31 | 1969-02-12 | Nadelwalze |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3646639A (enrdf_load_stackoverflow) |
| BE (1) | BE745098A (enrdf_load_stackoverflow) |
| CH (1) | CH505919A (enrdf_load_stackoverflow) |
| DE (2) | DE6905504U (enrdf_load_stackoverflow) |
| FR (1) | FR2029764A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1294930A (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2649486A1 (de) * | 1975-10-28 | 1977-05-12 | Schlumberger Cie N | Streckvorrichtung fuer faserbaender |
| DE4033263A1 (de) * | 1990-10-19 | 1992-04-23 | Staedtler & Uhl | Nadelstab fuer textilmaschinen |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3780399A (en) * | 1972-02-10 | 1973-12-25 | Laroche & Fils Constr Mec | Fiber opening machine |
| GB1571494A (en) * | 1976-04-23 | 1980-07-16 | Mackie & Sons Ltd J | Faller bars |
| CH625275A5 (enrdf_load_stackoverflow) * | 1978-02-01 | 1981-09-15 | Rieter Ag Maschf | |
| CH635137A5 (de) * | 1979-02-16 | 1983-03-15 | Burckhardt Christoph Ag | Zirkularkamm fuer baumwoll- oder wollkaemmaschine. |
| DE3438133A1 (de) * | 1984-10-18 | 1986-04-30 | Staedtler & Uhl, 8540 Schwabach | Aufloesewalze fuer open-end spinnmaschinen |
| DE8430562U1 (de) * | 1984-10-18 | 1985-02-21 | Staedtler & Uhl, 8540 Schwabach | Saegezahn-stanzteil als garnitur fuer ein kaemmsegment einer kammwalze fuer textilmaschinen |
| US4627131A (en) * | 1985-07-11 | 1986-12-09 | Kanai Juyo Kogyo Co., Ltd. | Combing roller for an open-end spinning machine |
| GB2182364A (en) * | 1985-10-17 | 1987-05-13 | James Francis Moore | Faller bars |
| CH669215A5 (de) * | 1986-04-10 | 1989-02-28 | Heinz Buess | Oeffnerwalze. |
| EP0358722B1 (de) * | 1987-08-03 | 1993-09-22 | Stamatech AG | Mit nadeln versehener nadelring für die auflösewalze einer offen-end-spinn-maschine |
| DE8713692U1 (de) * | 1987-10-12 | 1988-01-14 | Hollingsworth Gmbh, 7265 Neubulach | Auflösewalze für Offenend-Spinnmaschine |
| CH681020A5 (enrdf_load_stackoverflow) * | 1990-04-30 | 1992-12-31 | Rieter Ag Maschf | |
| DE19631809A1 (de) * | 1996-08-07 | 1998-02-12 | Gerald Koinzer | Nadelbelag |
| DE29720784U1 (de) * | 1997-11-22 | 1998-01-08 | Blömker GmbH, 49536 Lienen | Walzenkörper |
| DE19800371A1 (de) * | 1998-01-09 | 1999-07-15 | Rieter Ag Maschf | Vorrichtung zum Abtragen von Faserflocken und Verfahren zur Herstellung von Zähnen einer Abtragwalze |
| DE19837499A1 (de) * | 1998-08-13 | 2000-02-17 | Wki Isoliertechnik Gmbh Berlin | Verfahren und Vorrichtung zur Herstellung von fibrillierten Folien aus Polypropylen oder Polyäthylen |
| DE102006030763A1 (de) * | 2006-06-23 | 2008-01-03 | Wilhelm Stahlecker Gmbh | Zahngarnitur für einen Kamm einer Kämm-Maschine |
| BRPI0812918A2 (pt) | 2007-06-21 | 2014-12-09 | Swelltec Ltd | Aparelho e método com corpo dilatável em hidrocarboneto e dilatável em água |
| GB0711979D0 (en) | 2007-06-21 | 2007-08-01 | Swelltec Ltd | Method and apparatus |
| WO2009003771A1 (en) * | 2007-07-04 | 2009-01-08 | Nv Bekaert Sa | Clamping of comb unit |
| US8790228B2 (en) * | 2009-12-13 | 2014-07-29 | Felton, Inc. | Agricultural harvester stripper roller |
| EP2567007A1 (de) * | 2010-05-03 | 2013-03-13 | Oerlikon Textile GmbH & Co. KG | Vorrichtung zum fibrillieren |
| DE102010033546A1 (de) | 2010-08-05 | 2012-02-09 | Oerlikon Textile Gmbh & Co. Kg | Vorrichtung zum Fibrillieren |
| CN102884229A (zh) * | 2010-05-03 | 2013-01-16 | 欧瑞康纺织有限及两合公司 | 用于原纤化合成丝带的方法和装置 |
| US8627610B1 (en) | 2010-11-09 | 2014-01-14 | Prime.Line Products Co. | Privacy enclosure |
| CH704580A1 (de) | 2011-03-01 | 2012-09-14 | Burckhardt Christoph Ag | Nadelvorrichtung. |
| CN110004526B (zh) * | 2019-04-28 | 2020-08-14 | 圣华盾防护科技股份有限公司 | 一种拆换式角钉辊筒 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1431904A (en) * | 1922-10-10 | Half lap for combing machines | ||
| DE552414C (de) * | 1930-03-27 | 1932-06-13 | Ernst Noll Dipl Ing | Kratzenbeschlag |
| US2940129A (en) * | 1956-02-02 | 1960-06-14 | Stewart & Sons Wm R | Hackling machines |
| US3123866A (en) * | 1958-02-25 | 1964-03-10 | figure |
-
1969
- 1969-01-31 CH CH155769A patent/CH505919A/de not_active IP Right Cessation
- 1969-02-12 DE DE6905504U patent/DE6905504U/de not_active Expired
- 1969-02-12 DE DE19691907007 patent/DE1907007A1/de active Pending
-
1970
- 1970-01-28 FR FR7002906A patent/FR2029764A1/fr active Pending
- 1970-01-28 BE BE745098D patent/BE745098A/xx not_active IP Right Cessation
- 1970-01-30 GB GB1294930D patent/GB1294930A/en not_active Expired
- 1970-01-30 US US7082A patent/US3646639A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2649486A1 (de) * | 1975-10-28 | 1977-05-12 | Schlumberger Cie N | Streckvorrichtung fuer faserbaender |
| DE4033263A1 (de) * | 1990-10-19 | 1992-04-23 | Staedtler & Uhl | Nadelstab fuer textilmaschinen |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1907007A1 (de) | 1970-08-06 |
| GB1294930A (enrdf_load_stackoverflow) | 1972-11-01 |
| FR2029764A1 (enrdf_load_stackoverflow) | 1970-10-23 |
| CH505919A (de) | 1971-04-15 |
| BE745098A (fr) | 1970-07-01 |
| US3646639A (en) | 1972-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE6905504U (de) | Nadelwalse | |
| DE2616440C3 (de) | Lösbare Verbindung zweier Teile eines Gestells | |
| DE2531313A1 (de) | Gestell | |
| DE2719760A1 (de) | Verbindungsvorrichtung fuer dreidimensionale raster-konstruktionen | |
| DE8624960U1 (de) | Schläger für Ballspiele, insbesondere Tennisspiele | |
| DE1753034A1 (de) | Nach dem Baukastenprinzip zusammensetzbares Gestell | |
| EP0839934B1 (de) | Kämmgarnitur aus Sägezahnstanzteilen für Walzen und Tragsegmente von Textilmaschinen | |
| DE3609964A1 (de) | Webeschaft mit schaftstaeben aus einem aluminiumprofil | |
| DE3850762T2 (de) | Optischer Massstab. | |
| DE2010321C3 (de) | Schraubverbindung bei metallenen Fenster oder Türrahmen | |
| DE7027744U (de) | Beschlagteil. | |
| DE2909525C2 (de) | Klemmbefestigung für Nadelstreifen in einer U-förmigen Ausnehmung eines Nadelstabes oder einer Nadelwalze | |
| DE2008370B2 (de) | Scharnieranordnung für Deckel aufweisende Toilettensitze | |
| DE1625283A1 (de) | Duebel | |
| DE2438821A1 (de) | Loesbare verbindung einander kreuzender stangen | |
| DE2847529A1 (de) | Werkzeug | |
| CH371413A (de) | Webschaft mit mindestens einer auswechselbaren Zwischenstrebe | |
| DE2061806C (de) | Vorrichtung zum Anschluß eines Hohlprofilstabs od dgl an einem durchlaufenden Stab | |
| DE4001264A1 (de) | Mittelverbinder fuer insbesondere metallische webeschaefte | |
| DE1535904C (de) | Webschaft | |
| DE202020103663U1 (de) | Fixierungselement | |
| DE1535904B1 (de) | Webschaft | |
| DE1774165C3 (de) | Aufspannvorrichtung für Spulenkörper und dergleichen Wickelkerne | |
| DE3510184C1 (de) | Fräswalze für Straßenfräsmaschinen | |
| DE909391C (de) | Zaehl- oder Musterkette, insbesondere fuer flache Kulierwirkmaschinen |