DE2610228C2 - - Google Patents
Info
- Publication number
- DE2610228C2 DE2610228C2 DE2610228A DE2610228A DE2610228C2 DE 2610228 C2 DE2610228 C2 DE 2610228C2 DE 2610228 A DE2610228 A DE 2610228A DE 2610228 A DE2610228 A DE 2610228A DE 2610228 C2 DE2610228 C2 DE 2610228C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- general formula
- phenylethyl
- filtered
- phenylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 alkyl radical Chemical class 0.000 claims description 109
- 150000001875 compounds Chemical class 0.000 claims description 77
- 239000002253 acid Substances 0.000 claims description 47
- 150000003839 salts Chemical class 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 37
- 239000002904 solvent Substances 0.000 claims description 30
- 239000003054 catalyst Substances 0.000 claims description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- 150000003254 radicals Chemical class 0.000 claims description 18
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 15
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical group CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 claims description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 150000001266 acyl halides Chemical class 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 150000007942 carboxylates Chemical class 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 3
- LKRMTUUCKBQGFO-UHFFFAOYSA-N n-phenylpiperidin-4-amine Chemical class C1CNCCC1NC1=CC=CC=C1 LKRMTUUCKBQGFO-UHFFFAOYSA-N 0.000 claims description 3
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- GGCSSNBKKAUURC-UHFFFAOYSA-N sufentanil Chemical compound C1CN(CCC=2SC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 GGCSSNBKKAUURC-UHFFFAOYSA-N 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- OMCWIVZSDHKRRQ-UHFFFAOYSA-N 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylic acid Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(O)=O)N(C(=O)CC)C1=CC=CC=C1 OMCWIVZSDHKRRQ-UHFFFAOYSA-N 0.000 claims 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 235000021190 leftovers Nutrition 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- SIKUJMOJXPGHSR-UHFFFAOYSA-N methyl 1-(1-phenylpropan-2-yl)-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CN(C(C)CC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 SIKUJMOJXPGHSR-UHFFFAOYSA-N 0.000 claims 1
- NFGRCBGXNVMYIM-UHFFFAOYSA-N methyl 4-[n-(cyclopropanecarbonyl)anilino]-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(N(C(=O)C2CC2)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 NFGRCBGXNVMYIM-UHFFFAOYSA-N 0.000 claims 1
- NFENKNXOMHOGEC-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylcyclopropanecarboxamide Chemical compound C1CC(C(=O)C)(N(C(=O)C2CC2)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 NFENKNXOMHOGEC-UHFFFAOYSA-N 0.000 claims 1
- QWGNBDHHZUUXTP-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=CC=C1 QWGNBDHHZUUXTP-UHFFFAOYSA-N 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 186
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 174
- 239000000203 mixture Substances 0.000 description 132
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 132
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 84
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 78
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 77
- 229960001701 chloroform Drugs 0.000 description 74
- 239000000243 solution Substances 0.000 description 72
- 239000003480 eluent Substances 0.000 description 66
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 63
- 239000011541 reaction mixture Substances 0.000 description 61
- 239000000047 product Substances 0.000 description 58
- 239000000284 extract Substances 0.000 description 53
- 239000000543 intermediate Substances 0.000 description 53
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 43
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 42
- 238000004440 column chromatography Methods 0.000 description 40
- 239000000741 silica gel Substances 0.000 description 40
- 229910002027 silica gel Inorganic materials 0.000 description 40
- 238000010992 reflux Methods 0.000 description 39
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 37
- 239000000706 filtrate Substances 0.000 description 37
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 36
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 33
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 31
- 238000003756 stirring Methods 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 238000001816 cooling Methods 0.000 description 25
- 235000011121 sodium hydroxide Nutrition 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 23
- 239000012074 organic phase Substances 0.000 description 23
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 19
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 19
- 239000000908 ammonium hydroxide Substances 0.000 description 19
- 239000002244 precipitate Substances 0.000 description 19
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 17
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 17
- 239000002585 base Substances 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- 239000007858 starting material Substances 0.000 description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000005457 ice water Substances 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 11
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 10
- 239000008346 aqueous phase Substances 0.000 description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 10
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ULOZGJWEIWAWML-UHFFFAOYSA-N Noralfentanil Chemical compound C1CNCCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ULOZGJWEIWAWML-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 6
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical group OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 150000002825 nitriles Chemical class 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 4
- IZIAEPZQNMQAGS-UHFFFAOYSA-N ethyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 IZIAEPZQNMQAGS-UHFFFAOYSA-N 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 125000003386 piperidinyl group Chemical group 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- WTOYUGZUPNQZHG-UHFFFAOYSA-N (4-anilino-1-benzylpiperidin-4-yl)methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 WTOYUGZUPNQZHG-UHFFFAOYSA-N 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 3
- VEDLHCQCGPNHOL-UHFFFAOYSA-N 1-[4-anilino-1-(2-phenylethyl)piperidin-4-yl]ethanone Chemical compound C1CC(C(=O)C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VEDLHCQCGPNHOL-UHFFFAOYSA-N 0.000 description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000004645 aluminates Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000007069 methylation reaction Methods 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- KKOZKXBAPIYWAT-JTQLQIEISA-N (2s)-2-[(4-methylphenyl)sulfonylamino]pentanedioic acid Chemical compound CC1=CC=C(S(=O)(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 KKOZKXBAPIYWAT-JTQLQIEISA-N 0.000 description 2
- CFQDMKNXMQTFCH-UHFFFAOYSA-N 1-(4-anilinopiperidin-4-yl)propan-1-one Chemical compound C=1C=CC=CC=1NC1(C(=O)CC)CCNCC1 CFQDMKNXMQTFCH-UHFFFAOYSA-N 0.000 description 2
- YNAHQBZTIRIXLV-UHFFFAOYSA-N 1-[4-anilino-1-(2-phenylethyl)piperidin-4-yl]propan-1-one Chemical compound C1CC(C(=O)CC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 YNAHQBZTIRIXLV-UHFFFAOYSA-N 0.000 description 2
- QBUUEBUUMUYSIY-UHFFFAOYSA-N 1-benzyl-4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QBUUEBUUMUYSIY-UHFFFAOYSA-N 0.000 description 2
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 2
- KMXUKZCMNKLUTF-UHFFFAOYSA-N 1-chloro-4-(2-chloroethyl)benzene Chemical compound ClCCC1=CC=C(Cl)C=C1 KMXUKZCMNKLUTF-UHFFFAOYSA-N 0.000 description 2
- VMJOFTHFJMLIKL-UHFFFAOYSA-N 2-thiophen-2-ylethanol Chemical compound OCCC1=CC=CS1 VMJOFTHFJMLIKL-UHFFFAOYSA-N 0.000 description 2
- SFKIMFDURHCIKT-UHFFFAOYSA-N 4-(3-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound COC1=CC=CC(NC2(CCN(CCC=3C=CC=CC=3)CC2)C(O)=O)=C1 SFKIMFDURHCIKT-UHFFFAOYSA-N 0.000 description 2
- RTFVPKRWERHIPC-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-(2-phenylethyl)piperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 RTFVPKRWERHIPC-UHFFFAOYSA-N 0.000 description 2
- VWCPMNASPOCMNY-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carbonitrile Chemical compound C1CC(C#N)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VWCPMNASPOCMNY-UHFFFAOYSA-N 0.000 description 2
- DJVCIHFRPVAFAU-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 DJVCIHFRPVAFAU-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-LZFNBGRKSA-N Potassium-45 Chemical group [45K] ZLMJMSJWJFRBEC-LZFNBGRKSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 2
- OJCZPLDERGDQRJ-UHFFFAOYSA-N Sufentanil citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C1CN(CCC=2SC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 OJCZPLDERGDQRJ-UHFFFAOYSA-N 0.000 description 2
- VVJWPSNDGLSAMC-UHFFFAOYSA-N [4-anilino-1-(2-phenylethyl)piperidin-4-yl]methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VVJWPSNDGLSAMC-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- FLKWNFFCSSJANB-UHFFFAOYSA-N bezitramide Chemical compound O=C1N(C(=O)CC)C2=CC=CC=C2N1C(CC1)CCN1CCC(C#N)(C=1C=CC=CC=1)C1=CC=CC=C1 FLKWNFFCSSJANB-UHFFFAOYSA-N 0.000 description 2
- 229960004611 bezitramide Drugs 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- IVLVTNPOHDFFCJ-UHFFFAOYSA-N fentanyl citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1N(C(=O)CC)C(CC1)CCN1CCC1=CC=CC=C1 IVLVTNPOHDFFCJ-UHFFFAOYSA-N 0.000 description 2
- 229960004207 fentanyl citrate Drugs 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000005147 halomethylbenzenes Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- UMJJFEIKYGFCAT-UHFFFAOYSA-N indan-2-one Chemical compound C1=CC=C2CC(=O)CC2=C1 UMJJFEIKYGFCAT-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- HFNFODVRYCEIQL-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CNCCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 HFNFODVRYCEIQL-UHFFFAOYSA-N 0.000 description 2
- IFQWTLUCYHGSSI-UHFFFAOYSA-N methyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 IFQWTLUCYHGSSI-UHFFFAOYSA-N 0.000 description 2
- ULCFSXQHBSJRKV-UHFFFAOYSA-N methyl 4-anilino-3-methyl-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1C(C)C(C(=O)OC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 ULCFSXQHBSJRKV-UHFFFAOYSA-N 0.000 description 2
- 239000012022 methylating agents Substances 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- HLUKWPFQFJTUCB-UHFFFAOYSA-M sodium;4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound [Na+].C1CC(C(=O)[O-])(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 HLUKWPFQFJTUCB-UHFFFAOYSA-M 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PMIAMRAWHYEPNH-UHFFFAOYSA-N 1-(2-chloroethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCCl)C=C1 PMIAMRAWHYEPNH-UHFFFAOYSA-N 0.000 description 1
- YJZWAIODVQBJME-UHFFFAOYSA-N 1-(2-phenylethyl)piperidin-1-ium-4-carboxylate Chemical compound C1CC(C(=O)O)CCN1CCC1=CC=CC=C1 YJZWAIODVQBJME-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- JJFVQGWVNNCWFL-UHFFFAOYSA-N 1-[4-(4-fluoroanilino)-1-(2-phenylethyl)piperidin-4-yl]ethanone Chemical compound C1CC(C(=O)C)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 JJFVQGWVNNCWFL-UHFFFAOYSA-N 0.000 description 1
- PRGVWTUUVSZHJA-UHFFFAOYSA-N 1-[4-anilino-1-(2-thiophen-2-ylethyl)piperidin-4-yl]propan-1-one Chemical compound C1CC(C(=O)CC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CS1 PRGVWTUUVSZHJA-UHFFFAOYSA-N 0.000 description 1
- RNXSAXPSGSHBCG-UHFFFAOYSA-N 1-benzyl-4-(3-methoxyanilino)piperidine-4-carboxylic acid Chemical compound COC1=CC=CC(NC2(CCN(CC=3C=CC=CC=3)CC2)C(O)=O)=C1 RNXSAXPSGSHBCG-UHFFFAOYSA-N 0.000 description 1
- DICTXEPQAOBPNR-UHFFFAOYSA-N 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 DICTXEPQAOBPNR-UHFFFAOYSA-N 0.000 description 1
- UMPXGSMPVDCSPV-UHFFFAOYSA-N 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 UMPXGSMPVDCSPV-UHFFFAOYSA-N 0.000 description 1
- UDRBGVYYKIYOIB-UHFFFAOYSA-N 1-benzyl-4-(4-methoxyanilino)piperidine-4-carboxylic acid Chemical compound C1=CC(OC)=CC=C1NC1(C(O)=O)CCN(CC=2C=CC=CC=2)CC1 UDRBGVYYKIYOIB-UHFFFAOYSA-N 0.000 description 1
- RNBVGDAGXTZAKE-UHFFFAOYSA-N 1-benzyl-4-(methoxymethyl)-n-phenylpiperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 RNBVGDAGXTZAKE-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-DOMIDYPGSA-N 1-bromobutane Chemical compound CCC[14CH2]Br MPPPKRYCTPRNTB-DOMIDYPGSA-N 0.000 description 1
- KBYZZLVTQKGSLB-UHFFFAOYSA-N 1-phenylpropan-2-yl methanesulfonate Chemical compound CS(=O)(=O)OC(C)CC1=CC=CC=C1 KBYZZLVTQKGSLB-UHFFFAOYSA-N 0.000 description 1
- UGBCLQCZBKPTMP-UHFFFAOYSA-N 2-(furan-2-yl)ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CO1 UGBCLQCZBKPTMP-UHFFFAOYSA-N 0.000 description 1
- KKOZKXBAPIYWAT-UHFFFAOYSA-N 2-[(4-methylphenyl)sulfonylamino]pentanedioic acid Chemical class CC1=CC=C(S(=O)(=O)NC(CCC(O)=O)C(O)=O)C=C1 KKOZKXBAPIYWAT-UHFFFAOYSA-N 0.000 description 1
- MLWPHHMHVICYGG-UHFFFAOYSA-N 2-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C=1C=CC=CC=1NC1CC(C(=O)O)CCN1CCC1=CC=CC=C1 MLWPHHMHVICYGG-UHFFFAOYSA-N 0.000 description 1
- WPDWOCRJBPXJFM-UHFFFAOYSA-N 2-bromo-1-phenylpropan-1-one Chemical compound CC(Br)C(=O)C1=CC=CC=C1 WPDWOCRJBPXJFM-UHFFFAOYSA-N 0.000 description 1
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical class ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZSLYVCXNFQPCGT-UHFFFAOYSA-N 3-carboxy-3,5-dihydroxy-5-oxopentanoate;methyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidin-1-ium-4-carboxylate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 ZSLYVCXNFQPCGT-UHFFFAOYSA-N 0.000 description 1
- SZOXZVPHPPKPAI-UHFFFAOYSA-N 4-(4-fluoroanilino)piperidine-1-carboxamide Chemical compound C1CN(C(=O)N)CCC1NC1=CC=C(F)C=C1 SZOXZVPHPPKPAI-UHFFFAOYSA-N 0.000 description 1
- MECVKUYLWNZQTF-UHFFFAOYSA-N 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1=CC(C)=CC=C1NC1(C(N)=O)CCN(CCC=2C=CC=CC=2)CC1 MECVKUYLWNZQTF-UHFFFAOYSA-N 0.000 description 1
- RIMCNXPZHSRMSU-UHFFFAOYSA-N 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1(C(O)=O)CCN(CCC=2C=CC=CC=2)CC1 RIMCNXPZHSRMSU-UHFFFAOYSA-N 0.000 description 1
- PWPGBBMWCFWLQK-UHFFFAOYSA-N 4-(4-methylanilino)piperidine-4-carboxamide Chemical compound C1=CC(C)=CC=C1NC1(C(N)=O)CCNCC1 PWPGBBMWCFWLQK-UHFFFAOYSA-N 0.000 description 1
- ZMYFEFLPUAJLFD-UHFFFAOYSA-N 4-(N-propanoylanilino)piperidine-4-carboxylic acid Chemical compound C1CNCCC1(C(O)=O)N(C(=O)CC)C1=CC=CC=C1 ZMYFEFLPUAJLFD-UHFFFAOYSA-N 0.000 description 1
- HLLSOEKIMZEGFV-UHFFFAOYSA-N 4-(dibutylsulfamoyl)benzoic acid Chemical compound CCCCN(CCCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 HLLSOEKIMZEGFV-UHFFFAOYSA-N 0.000 description 1
- PHLAURNEKNFKNH-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-(2-phenylethyl)piperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PHLAURNEKNFKNH-UHFFFAOYSA-N 0.000 description 1
- MWJKXKBVWIHKOB-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCNCC1 MWJKXKBVWIHKOB-UHFFFAOYSA-N 0.000 description 1
- DPBWFNDFMCCGGJ-UHFFFAOYSA-N 4-Piperidine carboxamide Chemical compound NC(=O)C1CCNCC1 DPBWFNDFMCCGGJ-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- PPQMZAUSWIDYTH-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PPQMZAUSWIDYTH-UHFFFAOYSA-N 0.000 description 1
- PUFOFCNHIWPPNN-UHFFFAOYSA-N 4-anilino-1-benzylpiperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PUFOFCNHIWPPNN-UHFFFAOYSA-N 0.000 description 1
- QNDVTIFLVWHAJR-UHFFFAOYSA-N 4-anilino-1-benzylpiperidine-4-carboxylic acid;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)O)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QNDVTIFLVWHAJR-UHFFFAOYSA-N 0.000 description 1
- FLEAJPXKUFNEKE-UHFFFAOYSA-N 4-anilino-1-ethoxycarbonylpiperidine-4-carboxylic acid Chemical compound C1CN(C(=O)OCC)CCC1(C(O)=O)NC1=CC=CC=C1 FLEAJPXKUFNEKE-UHFFFAOYSA-N 0.000 description 1
- WAIIZELGDHTPRX-UHFFFAOYSA-N 4-anilinopiperidine-4-carboxamide Chemical compound C=1C=CC=CC=1NC1(C(=O)N)CCNCC1 WAIIZELGDHTPRX-UHFFFAOYSA-N 0.000 description 1
- QIJFNINHULHMLY-UHFFFAOYSA-N 4-anilinopiperidine-4-carboxylic acid Chemical compound C=1C=CC=CC=1NC1(C(=O)O)CCNCC1 QIJFNINHULHMLY-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- GYFQXRXJIJYXPB-UHFFFAOYSA-N C(=O)(Cl)Cl.O1CCOCC1 Chemical compound C(=O)(Cl)Cl.O1CCOCC1 GYFQXRXJIJYXPB-UHFFFAOYSA-N 0.000 description 1
- DOEXOEWMHNEJJD-UHFFFAOYSA-N C(C(=O)O)(=O)O.O=C(CC)C1(CCN(CC1)CCC=1SC=CC1)N(C(CC)=O)C1=CC=CC=C1 Chemical compound C(C(=O)O)(=O)O.O=C(CC)C1(CCN(CC1)CCC=1SC=CC1)N(C(CC)=O)C1=CC=CC=C1 DOEXOEWMHNEJJD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- WUVLCFCRSZHYOC-UHFFFAOYSA-N N-[1-heptyl-4-(methoxymethyl)piperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 WUVLCFCRSZHYOC-UHFFFAOYSA-N 0.000 description 1
- KFIABRWWCRCOHZ-UHFFFAOYSA-N N-[1-hexyl-4-(methoxymethyl)piperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 KFIABRWWCRCOHZ-UHFFFAOYSA-N 0.000 description 1
- JEXRGXWMBMKIAC-UHFFFAOYSA-N N-[4-(methoxymethyl)-1-pentylpiperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 JEXRGXWMBMKIAC-UHFFFAOYSA-N 0.000 description 1
- TZZYZBHQQUCDDG-UHFFFAOYSA-N N-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-N-phenylbutanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CCC)C1=CC=CC=C1 TZZYZBHQQUCDDG-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- QHUZJFLMDIJMAJ-UHFFFAOYSA-N [Na].Cl.Cl Chemical compound [Na].Cl.Cl QHUZJFLMDIJMAJ-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RQQGYKUQYGGDFL-UHFFFAOYSA-N benzyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(NC=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 RQQGYKUQYGGDFL-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- YKVDQHUYKKCVIC-UHFFFAOYSA-N ethyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 YKVDQHUYKKCVIC-UHFFFAOYSA-N 0.000 description 1
- QOYROTCVRDQKJR-UHFFFAOYSA-N ethyl 1-benzyl-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QOYROTCVRDQKJR-UHFFFAOYSA-N 0.000 description 1
- PXHXLFIYCYFCBF-UHFFFAOYSA-N ethyl 1-benzyl-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PXHXLFIYCYFCBF-UHFFFAOYSA-N 0.000 description 1
- ZLMQQFXTMZXHIB-UHFFFAOYSA-N ethyl 2,4-dioxo-1-phenyl-3-oxa-1,8-diazaspiro[4.5]decane-8-carboxylate Chemical compound C1CN(C(=O)OCC)CCC21C(=O)OC(=O)N2C1=CC=CC=C1 ZLMQQFXTMZXHIB-UHFFFAOYSA-N 0.000 description 1
- OECKZVXWMJFANW-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 OECKZVXWMJFANW-UHFFFAOYSA-N 0.000 description 1
- FGKAUZKTIULETR-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 FGKAUZKTIULETR-UHFFFAOYSA-N 0.000 description 1
- SPERRCPYPOXSOZ-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=C(F)C=CC=1NC1(C(=O)OCC)CCNCC1 SPERRCPYPOXSOZ-UHFFFAOYSA-N 0.000 description 1
- RCCCDDCOWBHPMR-UHFFFAOYSA-N ethyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 RCCCDDCOWBHPMR-UHFFFAOYSA-N 0.000 description 1
- RPVMTHSREUIZIT-UHFFFAOYSA-N ethyl 4-(n-butanoylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OCC)N(C(=O)CCC)C1=CC=CC=C1 RPVMTHSREUIZIT-UHFFFAOYSA-N 0.000 description 1
- PCFIEJLWZLGRMK-UHFFFAOYSA-N ethyl 4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C=1C=CC=CC=1N(C(=O)CC)C1(C(=O)OCC)CCNCC1 PCFIEJLWZLGRMK-UHFFFAOYSA-N 0.000 description 1
- CPDREELMVQAIKC-UHFFFAOYSA-N ethyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 CPDREELMVQAIKC-UHFFFAOYSA-N 0.000 description 1
- ZSHUDZNARDEKAX-UHFFFAOYSA-N ethyl 4-anilino-4-propanoylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(C(=O)CC)NC1=CC=CC=C1 ZSHUDZNARDEKAX-UHFFFAOYSA-N 0.000 description 1
- DAQQMJRKGXQPAO-UHFFFAOYSA-N ethyl 4-anilinopiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OCC)CCNCC1 DAQQMJRKGXQPAO-UHFFFAOYSA-N 0.000 description 1
- HKSPFTABYQTLQV-UHFFFAOYSA-N ethyl 4-carbamoyl-4-(4-methylanilino)piperidine-1-carboxylate Chemical compound C(C)OC(=O)N1CCC(CC1)(NC1=CC=C(C=C1)C)C(N)=O HKSPFTABYQTLQV-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000004795 grignard reagents Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- IHLVCKWPAMTVTG-UHFFFAOYSA-N lithium;carbanide Chemical compound [Li+].[CH3-] IHLVCKWPAMTVTG-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- ULCFSXQHBSJRKV-AVRDEDQJSA-N methyl (3s,4s)-4-anilino-3-methyl-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C([C@]([C@H](C1)C)(C(=O)OC)NC=2C=CC=CC=2)CN1CCC1=CC=CC=C1 ULCFSXQHBSJRKV-AVRDEDQJSA-N 0.000 description 1
- CXLSUTOBXXFOEV-UHFFFAOYSA-N methyl 1-[2-(4-methylphenyl)ethyl]-4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC(C)=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 CXLSUTOBXXFOEV-UHFFFAOYSA-N 0.000 description 1
- PZTAXFCWFQYJIT-UHFFFAOYSA-N methyl 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 PZTAXFCWFQYJIT-UHFFFAOYSA-N 0.000 description 1
- QKRGHVDSVANHAD-UHFFFAOYSA-N methyl 1-benzyl-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CN(CC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 QKRGHVDSVANHAD-UHFFFAOYSA-N 0.000 description 1
- NYXYAZZWWCNTOT-UHFFFAOYSA-N methyl 1-pentyl-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCC)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 NYXYAZZWWCNTOT-UHFFFAOYSA-N 0.000 description 1
- CBKLICUQYUTWQL-UHFFFAOYSA-N methyl 3-methyl-1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CC(C)C1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 CBKLICUQYUTWQL-UHFFFAOYSA-N 0.000 description 1
- NPOMYZMTQSCHSC-UHFFFAOYSA-N methyl 4-(3-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=C(OC)C=CC=2)CCN1CCC1=CC=CC=C1 NPOMYZMTQSCHSC-UHFFFAOYSA-N 0.000 description 1
- SQYQVMHGGUYZAY-UHFFFAOYSA-N methyl 4-(3-methoxyanilino)piperidine-4-carboxylate Chemical compound C=1C=CC(OC)=CC=1NC1(C(=O)OC)CCNCC1 SQYQVMHGGUYZAY-UHFFFAOYSA-N 0.000 description 1
- YEQHKOKSOZNVNF-UHFFFAOYSA-N methyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 YEQHKOKSOZNVNF-UHFFFAOYSA-N 0.000 description 1
- WUHXITZPBJMGRU-UHFFFAOYSA-N methyl 4-(4-fluoroanilino)piperidine-4-carboxylate Chemical compound C=1C=C(F)C=CC=1NC1(C(=O)OC)CCNCC1 WUHXITZPBJMGRU-UHFFFAOYSA-N 0.000 description 1
- SGDYEKPUQPFDLI-UHFFFAOYSA-N methyl 4-(4-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OC)(NC=2C=CC(OC)=CC=2)CCN1CCC1=CC=CC=C1 SGDYEKPUQPFDLI-UHFFFAOYSA-N 0.000 description 1
- QUXAMUASVHKYOB-UHFFFAOYSA-N methyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 QUXAMUASVHKYOB-UHFFFAOYSA-N 0.000 description 1
- BABZHNGIRGHXSO-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2SC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 BABZHNGIRGHXSO-UHFFFAOYSA-N 0.000 description 1
- NPNNCHCGYDKUTA-UHFFFAOYSA-N methyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 NPNNCHCGYDKUTA-UHFFFAOYSA-N 0.000 description 1
- DVMSHHYWRCBCDO-UHFFFAOYSA-N methyl 4-anilinopiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OC)CCNCC1 DVMSHHYWRCBCDO-UHFFFAOYSA-N 0.000 description 1
- YKFLJYAKACCWMH-UHFFFAOYSA-N methyl piperidine-1-carboxylate Chemical compound COC(=O)N1CCCCC1 YKFLJYAKACCWMH-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- MXNALQRSXHOIEA-UHFFFAOYSA-N n-(2-bromoethyl)aniline;hydrobromide Chemical compound [Br-].BrCC[NH2+]C1=CC=CC=C1 MXNALQRSXHOIEA-UHFFFAOYSA-N 0.000 description 1
- VSWUICYVPZNQCU-UHFFFAOYSA-N n-[1-(2-anilinoethyl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;dihydrochloride Chemical compound Cl.Cl.C1CN(CCNC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 VSWUICYVPZNQCU-UHFFFAOYSA-N 0.000 description 1
- BDLHEYOIAQYADD-UHFFFAOYSA-N n-[1-(2-hydroxy-2-phenylethyl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CC(O)C=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 BDLHEYOIAQYADD-UHFFFAOYSA-N 0.000 description 1
- CKGXIGKMYMSTRC-UHFFFAOYSA-N n-[1-(2-hydroxy-2-phenylethyl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CC(O)C=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 CKGXIGKMYMSTRC-UHFFFAOYSA-N 0.000 description 1
- ZKSJMYRNHNYLOJ-UHFFFAOYSA-N n-[1-[2-(furan-2-yl)ethyl]-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2OC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ZKSJMYRNHNYLOJ-UHFFFAOYSA-N 0.000 description 1
- AFLKBESYVTWUMU-UHFFFAOYSA-N n-[1-benzyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 AFLKBESYVTWUMU-UHFFFAOYSA-N 0.000 description 1
- IUFFNKZCZVDKAA-UHFFFAOYSA-N n-[1-butyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 IUFFNKZCZVDKAA-UHFFFAOYSA-N 0.000 description 1
- RQROMQNDSNIPBS-UHFFFAOYSA-N n-[4-(hydroxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(CO)N(C(=O)CC)C1=CC=CC=C1 RQROMQNDSNIPBS-UHFFFAOYSA-N 0.000 description 1
- VLSVTLOIOQFEOW-UHFFFAOYSA-N n-[4-(hydroxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid;propanoic acid Chemical compound CCC(O)=O.OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(CO)N(C(=O)CC)C1=CC=CC=C1 VLSVTLOIOQFEOW-UHFFFAOYSA-N 0.000 description 1
- SMJQGAOLVOHPAQ-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(C(C)C(=O)C=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 SMJQGAOLVOHPAQ-UHFFFAOYSA-N 0.000 description 1
- CBDJXHNASBILOV-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(1-phenylpropan-2-yl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(C(C)CC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 CBDJXHNASBILOV-UHFFFAOYSA-N 0.000 description 1
- ISLXBYDXENITBB-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-n-phenylcyclopropanecarboxamide;hydrochloride Chemical compound Cl.C1CC(COC)(N(C(=O)C2CC2)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 ISLXBYDXENITBB-UHFFFAOYSA-N 0.000 description 1
- GARXJOUQUSNOGK-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 GARXJOUQUSNOGK-UHFFFAOYSA-N 0.000 description 1
- KYRGRXWWBNRGKR-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(2-pyridin-2-ylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2N=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 KYRGRXWWBNRGKR-UHFFFAOYSA-N 0.000 description 1
- ICWQJSPMXTWWKQ-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-(4-fluorophenyl)propanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=C(F)C=C1 ICWQJSPMXTWWKQ-UHFFFAOYSA-N 0.000 description 1
- DPIKFBCGUGZJES-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=CC=C1 DPIKFBCGUGZJES-UHFFFAOYSA-N 0.000 description 1
- YDJXNYNKKXZBMP-UHFFFAOYSA-N n-phenethyl-4-piperidinone Chemical compound C1CC(=O)CCN1CCC1=CC=CC=C1 YDJXNYNKKXZBMP-UHFFFAOYSA-N 0.000 description 1
- VZZQQOHWILSVFT-UHFFFAOYSA-N n-phenyl-n-[1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-yl]propanamide;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(COCC=1C=CC=CC=1)N(C(=O)CC)C1=CC=CC=C1 VZZQQOHWILSVFT-UHFFFAOYSA-N 0.000 description 1
- MEFSUFUXHLHDHA-UHFFFAOYSA-N n-phenyl-n-[1-(2-phenylethyl)-4-propanoylpiperidin-4-yl]propanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)CC)N(C(=O)CC)C1=CC=CC=C1 MEFSUFUXHLHDHA-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- HWOCNWRPIUYVDF-UHFFFAOYSA-N oxalic acid N-phenyl-1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-amine Chemical compound OC(=O)C(O)=O.C1CC(COCC=2C=CC=CC=2)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 HWOCNWRPIUYVDF-UHFFFAOYSA-N 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 1
- XBXHCBLBYQEYTI-UHFFFAOYSA-N piperidin-4-ylmethanol Chemical compound OCC1CCNCC1 XBXHCBLBYQEYTI-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- ZZLKXZSSZXUNMT-UHFFFAOYSA-M sodium;4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound [Na+].C1=CC(C)=CC=C1NC1(C([O-])=O)CCN(CCC=2C=CC=CC=2)CC1 ZZLKXZSSZXUNMT-UHFFFAOYSA-M 0.000 description 1
- BVMUUCRIMILCIA-UHFFFAOYSA-M sodium;4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound [Na+].C1CC(C(=O)[O-])(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 BVMUUCRIMILCIA-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- KAKQVSNHTBLJCH-UHFFFAOYSA-N trifluoromethanesulfonimidic acid Chemical compound NS(=O)(=O)C(F)(F)F KAKQVSNHTBLJCH-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000012795 verification Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/66—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having a hetero atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pain & Pain Management (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55851175A | 1975-03-14 | 1975-03-14 | |
| US05/648,685 US3998834A (en) | 1975-03-14 | 1976-01-13 | N-(4-piperidinyl)-n-phenylamides and -carbamates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2610228A1 DE2610228A1 (de) | 1976-09-30 |
| DE2610228C2 true DE2610228C2 (ref) | 1990-04-05 |
Family
ID=27071767
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762610228 Granted DE2610228A1 (de) | 1975-03-14 | 1976-03-11 | N-(4-piperidinyl)-n-phenylamide und -carbamate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US3998834A (ref) |
| JP (1) | JPS5946217B2 (ref) |
| AT (1) | AT359493B (ref) |
| AU (1) | AU503632B2 (ref) |
| BG (1) | BG28259A3 (ref) |
| CA (1) | CA1080232A (ref) |
| CH (1) | CH629486A5 (ref) |
| CZ (1) | CZ278060B6 (ref) |
| DE (1) | DE2610228A1 (ref) |
| DK (1) | DK148960C (ref) |
| ES (1) | ES446034A1 (ref) |
| FI (1) | FI61481C (ref) |
| FR (1) | FR2303546A1 (ref) |
| GB (1) | GB1538938A (ref) |
| HU (1) | HU172963B (ref) |
| IE (1) | IE42512B1 (ref) |
| IL (1) | IL49204A (ref) |
| IT (1) | IT1057988B (ref) |
| LU (1) | LU74511A1 (ref) |
| NL (1) | NL185279C (ref) |
| NO (1) | NO146162C (ref) |
| NZ (1) | NZ180096A (ref) |
| PH (1) | PH12746A (ref) |
| PL (1) | PL102474B1 (ref) |
| PT (1) | PT64898B (ref) |
| SE (1) | SE426486B (ref) |
| SU (1) | SU1227109A3 (ref) |
| YU (1) | YU39960B (ref) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179569A (en) * | 1975-03-14 | 1979-12-18 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl)-N-phenylamides |
| US4208418A (en) * | 1975-09-23 | 1980-06-17 | Janssen Pharmaceutica N.V. | N-Aryl-N-(1-alkyl-4-piperidinyl)arylacetamides |
| US4225606A (en) * | 1975-09-23 | 1980-09-30 | Janssen Pharmaceutica N.V. | N-Aryl-N-(1-L-4-piperidinyl)arylacetamides |
| FR2389622B1 (ref) * | 1977-05-05 | 1982-05-21 | Janssen Pharmaceutica Nv | |
| US4167574A (en) * | 1978-03-13 | 1979-09-11 | Janssen Pharmaceutica, N.V. | N-phenyl-N-(4-piperidinyl)amides |
| US4584303A (en) * | 1984-04-09 | 1986-04-22 | The Boc Group, Inc. | N-aryl-N-(4-piperidinyl)amides and pharmaceutical compositions and method employing such compounds |
| FR2608602A1 (fr) * | 1986-12-23 | 1988-06-24 | Cerm Cent Europ Rech Mauvernay | Nouvelles 3-piperidineamines ou 3-azepineamines substituees, leur preparation et leurs applications en therapeutique |
| US4921864A (en) * | 1987-11-02 | 1990-05-01 | Boc, Inc. | 4-Phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4849521A (en) * | 1987-11-02 | 1989-07-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-piperidine compounds and derivatives |
| US4791121A (en) * | 1987-11-02 | 1988-12-13 | The Boc Group, Inc. | 4-phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| USRE33495E (en) * | 1987-11-02 | 1990-12-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-anilino-piperidine compounds and derivatives |
| US4957929A (en) * | 1987-11-02 | 1990-09-18 | Boc, Inc. | 4-phenyl-4-[N-(phenyl)amido]piperidine compounds and pharmaceutical compositions employing such compounds |
| US5013742A (en) * | 1987-11-02 | 1991-05-07 | Boc, Inc. | 4-phenyl-4-N-(phenyl) amido piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4791120A (en) * | 1987-12-31 | 1988-12-13 | The Boc Group, Inc. | 4-heteropentacyclic-4-[N-(phenyl)amino] piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4801615A (en) * | 1987-12-31 | 1989-01-31 | The Boc Group, Inc. | 4-heterohexacyclic-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US5019583A (en) * | 1989-02-15 | 1991-05-28 | Glaxo Inc. | N-phenyl-N-(4-piperidinyl)amides useful as analgesics |
| US5145967A (en) * | 1989-04-20 | 1992-09-08 | Anaquest, Inc. | Method for preparing 4-alkoxyalkyl-4-phenylaminopiperdines and derivatives thereof |
| US5053411A (en) * | 1989-04-20 | 1991-10-01 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
| USRE34201E (en) * | 1989-04-20 | 1993-03-23 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
| US5100903A (en) * | 1989-05-12 | 1992-03-31 | Anaquest, Inc. | N-aryl-n-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
| US4994471A (en) * | 1989-05-12 | 1991-02-19 | Boc, Inc. | N-aryl-N-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
| US4939161A (en) * | 1989-05-12 | 1990-07-03 | Boc, Inc. | Analgesic N-aryl-N-[1-substituted-3,5-dimethyl-4-piperidinyl]amides |
| US5039804A (en) * | 1989-12-13 | 1991-08-13 | Glaxo Inc. | Preparation of substituted alkali metal piperidine-4-carboxylates |
| US5126455A (en) * | 1989-12-13 | 1992-06-30 | Glaxo Inc. | Preparation of substituted alkali metal piperidine-4-carboxylates |
| US5214148A (en) * | 1990-12-18 | 1993-05-25 | Glaxo Inc. | Analgesic N-phenyl-N-(3-OR1 -3-ME-4-piperidinyl)amides |
| US5130321A (en) * | 1990-12-18 | 1992-07-14 | Glaxo Inc. | Analgesic n-phenyl-n-(3-or 1-3-me-4-piperidinyl)amides |
| FR2676054B1 (fr) * | 1991-05-03 | 1993-09-03 | Sanofi Elf | Nouveaux composes n-alkylenepiperidino et leurs enantiomeres, procede pour leur preparation et compositions pharmaceutiques les contenant. |
| GB9316863D0 (en) * | 1993-08-13 | 1993-09-29 | Glaxo Group Ltd | Chemical process |
| US5489689A (en) * | 1993-09-30 | 1996-02-06 | Mallinckrodt Chemical, Inc. | Preparation of piperidine derivatives |
| US6541021B1 (en) | 1999-03-18 | 2003-04-01 | Durect Corporation | Devices and methods for pain management |
| US6835194B2 (en) * | 1999-03-18 | 2004-12-28 | Durect Corporation | Implantable devices and methods for treatment of pain by delivery of fentanyl and fentanyl congeners |
| AU3676000A (en) * | 1999-04-09 | 2000-11-14 | Mochida Pharmaceutical Co., Ltd. | 4-hydroxypiperidine derivatives having antiarrhythmic effect |
| US6677332B1 (en) | 1999-05-25 | 2004-01-13 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US6635661B2 (en) | 2000-05-25 | 2003-10-21 | Sepracor Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US7361666B2 (en) * | 1999-05-25 | 2008-04-22 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US7074935B2 (en) * | 1999-12-06 | 2006-07-11 | Mallinckrodt Inc. | Methods for the syntheses of alfentanil, sufentanil and remifentanil |
| US7074803B2 (en) * | 2001-03-02 | 2006-07-11 | Durect Corporation | Opioid formulations |
| US20040102476A1 (en) * | 2002-11-25 | 2004-05-27 | Chan Tai Wah | High concentration formulations of opioids and opioid derivatives |
| EP1795526A4 (en) * | 2004-09-14 | 2010-10-13 | Nippon Chemiphar Co | N-SUBSTITUTED N- (4-PIPERIDINYL) AMIDE DERIVATIVE |
| JP2008088057A (ja) * | 2005-03-23 | 2008-04-17 | Nippon Chemiphar Co Ltd | N−置換−n−(4−ピペリジニル)アミド誘導体 |
| AU2006317591A1 (en) * | 2005-11-17 | 2007-05-31 | Mallinckrodt Inc. | Process for synthesizing remifentanil |
| JP2009524659A (ja) * | 2006-01-24 | 2009-07-02 | マリンクロッド・インコーポレイテッド | レミフェンタニルの合成方法 |
| EP1867635A1 (en) * | 2006-06-15 | 2007-12-19 | Kern Pharma, S.L. | Process for preparing remifentanil, intermediates thereof, use of said intermediates and processes for their preparation |
| US20080009782A1 (en) * | 2006-06-28 | 2008-01-10 | Alza Corporation | Methods and Devices for Transdermal Electrotransport Delivery of Lofentanil and Carfentanil |
| WO2008005423A1 (en) * | 2006-07-03 | 2008-01-10 | Cambrex Charles City, Inc. | Improved method of making sufentanil |
| AU2007325889A1 (en) * | 2006-11-29 | 2008-06-05 | Mallinckrodt Inc. | New process for remifentanil synthesis |
| US20100056574A1 (en) * | 2008-09-04 | 2010-03-04 | Mallinckrodt Inc. | Crystalline Forms of Sufentanil |
| US8299258B2 (en) * | 2008-11-04 | 2012-10-30 | Cambrex Charles City | Method of making piperidine derivatives |
| PL2616464T3 (pl) | 2010-09-17 | 2018-05-30 | Mallinckrodt Llc | Udoskonalony sposób wytwarzania prekursora zasady sufentanilu |
| EP2455377B1 (de) | 2010-11-11 | 2014-07-09 | hameln rds gmbh | Synthese von Fentanyl Analoga |
| WO2012075337A2 (en) | 2010-12-01 | 2012-06-07 | Spinal Modulation, Inc. | Directed delivery of agents to neural anatomy |
| AU2014244232B2 (en) * | 2013-03-13 | 2019-05-02 | President And Fellows Of Harvard College | Stapled and stitched polypeptides and uses thereof |
| WO2016100940A1 (en) | 2014-12-19 | 2016-06-23 | The Broad Institute, Inc. | Dopamine d2 receptor ligands |
| US10752588B2 (en) | 2014-12-19 | 2020-08-25 | The Broad Institute, Inc. | Dopamine D2 receptor ligands |
| JP2018515580A (ja) | 2015-05-27 | 2018-06-14 | マリンクロッド エルエルシー | スフェンタニルクエン酸塩及びスフェンタニル塩の調合 |
| CN106854203B (zh) * | 2015-12-08 | 2020-12-01 | 江苏恩华药业股份有限公司 | 枸橼酸舒芬太尼的新晶型及其制备方法 |
| EP3199523B1 (en) | 2016-01-29 | 2018-08-15 | Bioka s. r.o. | The new process for producing n-phenyl-n-(4-piperidinyl) amide derivatives such as remifentanil and carfentanil |
| CN108503579B (zh) * | 2018-03-28 | 2021-03-26 | 南京医科大学 | 芬太尼类似物及其应用 |
| CN113214140B (zh) * | 2020-02-03 | 2022-09-09 | 江苏谛奇医药科技有限公司 | 哌啶酰胺类衍生物、其药物组合物及其应用 |
| US11708366B2 (en) | 2020-08-14 | 2023-07-25 | Novartis Ag | Heteroaryl substituted spiropiperidinyl derivatives and pharmaceutical uses thereof |
| CN114262320A (zh) * | 2021-12-28 | 2022-04-01 | 宜昌人福药业有限责任公司 | 一种利用连续流微通道反应器制备苯胺基哌啶类药物的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE623427A (ref) * | 1961-10-10 | |||
| US3171838A (en) * | 1961-10-10 | 1965-03-02 | Res Lab Dr C Janssen N V | Aroylalkyl and hydroxyaralkyl derivatives of 4-(n-arylalkanamido)-piperidines and related compounds |
-
1976
- 1976-01-13 US US05/648,685 patent/US3998834A/en not_active Expired - Lifetime
- 1976-02-23 NO NO760591A patent/NO146162C/no unknown
- 1976-02-24 NZ NZ180096A patent/NZ180096A/xx unknown
- 1976-02-27 CA CA246,697A patent/CA1080232A/en not_active Expired
- 1976-02-27 SE SE7602740A patent/SE426486B/xx active Protection Beyond IP Right Term
- 1976-03-09 LU LU74511A patent/LU74511A1/xx unknown
- 1976-03-10 GB GB9593/76A patent/GB1538938A/en not_active Expired
- 1976-03-10 FR FR7606870A patent/FR2303546A1/fr active Granted
- 1976-03-11 DE DE19762610228 patent/DE2610228A1/de active Granted
- 1976-03-11 HU HU76JA00000751A patent/HU172963B/hu unknown
- 1976-03-12 FI FI760646A patent/FI61481C/fi not_active IP Right Cessation
- 1976-03-12 CZ CS761632A patent/CZ278060B6/cs unknown
- 1976-03-12 AT AT184676A patent/AT359493B/de not_active IP Right Cessation
- 1976-03-12 JP JP51026226A patent/JPS5946217B2/ja not_active Expired
- 1976-03-12 CH CH310476A patent/CH629486A5/de not_active IP Right Cessation
- 1976-03-12 IL IL49204A patent/IL49204A/xx unknown
- 1976-03-12 PH PH18204A patent/PH12746A/en unknown
- 1976-03-12 BG BG032601A patent/BG28259A3/xx unknown
- 1976-03-12 IE IE527/76A patent/IE42512B1/en not_active IP Right Cessation
- 1976-03-12 PT PT64898A patent/PT64898B/pt unknown
- 1976-03-12 DK DK110376A patent/DK148960C/da not_active IP Right Cessation
- 1976-03-12 PL PL1976187910A patent/PL102474B1/pl unknown
- 1976-03-12 NL NLAANVRAGE7602612,A patent/NL185279C/xx not_active IP Right Cessation
- 1976-03-12 IT IT48556/76A patent/IT1057988B/it active
- 1976-03-12 ES ES446034A patent/ES446034A1/es not_active Expired
- 1976-03-12 YU YU652/76A patent/YU39960B/xx unknown
- 1976-03-12 SU SU762332950A patent/SU1227109A3/ru active
- 1976-03-15 AU AU12006/76A patent/AU503632B2/en not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2610228C2 (ref) | ||
| DE69531331T2 (de) | Phenylpiperidinderivate als neurokinin antagonists | |
| DE2636614C2 (ref) | ||
| DE69103206T2 (de) | Neue Derivate des Aminopiperidins, Aminopyrrolidins und des Aminoperhydroazepins, Verfahren zur Herstellung und diese enthaltende Arzneimittel. | |
| DE69918687T2 (de) | 4-Phenylpiperidine zur Behandlung von pruritischen Hauterkrankungen | |
| DE69522355T2 (de) | Neue N-(3,4-Dichlorphenyl-propyl)-piperidin-Derivate als selektive humane NK3-Rezeptorantagonisten | |
| DE69534213T2 (de) | Therapeutisch wirksame Heterocyclen | |
| DE69222352T2 (de) | N-(Aminoalkyl)piperidin-Verbindungen und ihre Enantiomere als Neurokinine-Receptoren Antagonisten, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| DE602004011767T2 (de) | Cyclohexylsulfone als gamma-sekretase-inhibitoren | |
| DE69806141T2 (de) | Indazoleamid-verbindungen als serotoninergene mittel | |
| DE69631784T2 (de) | 3-(4-subst.-piperidinyl-1)-1-(3,4-dichlorophenyl)propylcarbamate und -harnstoffe und andere derivative als neue neurokinin-antagonisten | |
| DE3612337A1 (de) | 4h-1-benzopyran-4-on-derivate, ein verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE69630717T2 (de) | 1-acyl-3-phenyl-3-(3-piperidinopropyl)piperidinderivate als für den menschlichen nk3-rezeptor selektive antagonisten | |
| DE602005001930T2 (de) | Derivate vom aryloxyalkylcarbamat-typ, verfahren zu deren herstellung und deren verwendung in therapeutika | |
| DE2002840A1 (de) | 2,3,5-trisubstit,-2'-Hydroxy-6,7-benzomorphane und Verfahren zu deren Herstellung | |
| CH615173A5 (ref) | ||
| DE69513846T2 (de) | N-substituierte piperidinyl bicyclische benzoatderivate | |
| DE2719211C3 (de) | 1-(2-Phenylamino-äthyl)-4-(N-phenyl-N-propionylamino)-piperidine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2642856C2 (ref) | ||
| DE3785393T2 (de) | 4-(aroylamino)piperidinbutanamide derivate. | |
| JPH05186460A (ja) | 2−(1−ピペリジル)エタノール誘導体、その製造方法およびその治療への適用 | |
| DE2628570A1 (de) | 10- eckige klammer auf omega- (benzoylpiperidinyl)-alkyl eckige klammer zu phenothiazine und verfahren zu ihrer herstellung | |
| DE2819873C2 (ref) | ||
| DE69218414T2 (de) | Verfahren zur herstellung von trans-piperidin-2,5-dicarboxylaten | |
| DE69119282T2 (de) | Aminobenzolverbindungen, Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |