DE2218097A1 - Herbizides Mittel und seine Verwendung - Google Patents
Herbizides Mittel und seine VerwendungInfo
- Publication number
- DE2218097A1 DE2218097A1 DE19722218097 DE2218097A DE2218097A1 DE 2218097 A1 DE2218097 A1 DE 2218097A1 DE 19722218097 DE19722218097 DE 19722218097 DE 2218097 A DE2218097 A DE 2218097A DE 2218097 A1 DE2218097 A1 DE 2218097A1
- Authority
- DE
- Germany
- Prior art keywords
- chcl
- radicals
- alkyl
- radical
- corn
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/22—Y being a hydrogen or a carbon atom, e.g. benzoylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/18—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Description
New York, N.Y. , V .'St.A. '
alkoxyalkyl-, N-Alkyl-N-alkinylcarbamylalkoxyalkyl-, Alkinoxy-, Halogenalkoxy-, Thiocyanatoalkyl-, Alkenylaminoalkyl-, Alkylcarboalkyl-, Cyanoalkyl-, Cyanatoalkyl-, Alkenylaminosulfonoalkyl-, Alkylthioalkyl-, Halogenalkylcarbonyloxyalkyl-, AlJ$yoxycarboalkyl-, Halogenalkenylcarbonyloxyalkyl-, Hydroxy-
eines geeigneten Säurechlorids mit einem entsprechenden Amin syrthetisiert werden. Gegebenenfalls kann ein Lösungsmittel
:;io Benzol eingesetzt werden. Die Reaktion wird vorzugsweise bei verminderten Temperaturen durchgeführt. Nach Abschluß der R«jä3'.tion wird das Endprodukt auf Raumtemperatur gebracht und kann leicht "ib λ'.-.trennt werden.
CH-C-N-CH-CssCH
CHCl2-C-NH-CH2
CH0 0
CM | CM | CM | CM | CM | CM | CM | CM | Πι | W | t— |
W | W | w | PO | w | W | M | W | Ι!Ι | m | |
ο | O | ο | O | ο | ο | ο | ο | O | ||
Il | ■ | H | It | I | D | Il | I | I | O | |
W | W | Ul | W | w | W | CM | I | |||
ο | O | O | O | ο | ο | O | W | |||
I | I | I | I | I | I | ι | O | |||
CM | CM | CM | CM | CM | CM | I | ||||
W | w | W | W | W | W | |||||
ο | ο | ο | O | O | ο | |||||
I | Ι | ι | I | I | ι | |||||
H | H CM |
pel CtJ | |
lie | ν/ |
0) | |
,ο | |
cd | O=O |
I | |
CS |
CM | CM | CM | CM | CM | CM | S | ι;1 | CM | C- | I | O | CM |
W | W | W | FO | W | W | R | Ih | W | . W | O | I | W |
ο | O | O | O | ο | ο | W | ο | ο | ro | I | CM | O |
I | Il | H | Il | Il | D | ο | ι | Il | ο | CM | I | |
W | W | W | W | W | W | ι | CM | W | I | W | ||
O | ο | ϋ | ο | ο | O | CM | W | ο | Ν"\ | W | O | |
I | I | ι | I | ι | I | W | ο | I | W | ο | I | |
CM | CM | CM | CM | CM | CM | ο | I | CM | O | CM | ||
W | W | W | W | W | W | I | W | ν_»· | O | W | ||
ο | ο | ο | O | ο | O | O | O | I | O | |||
I | ι | ι | I | ι | I | I | I | I | ||||
PQ |
U
(P |
O | CM | ITN | CM | ϋ | CM | CM | CM | CM | γΗ | r-l |
CM | I | r-i | Ρ-4 | rH | CM | rH | ■Η | ■Η | H | O | O | |
CM | O | CM | O | m | O | O | O | ϋ | CM | O | ||
W | H | O | W | O | W | ta | 8 | W | W | I | ||
ο | W | O | Il | I | O | I | ο | ο | I | O | O | |
ο | O | r-i | CM | I | I | I | I | I | ||||
W | I | O | ||||||||||
O | O | O | O | |||||||||
I | I | I | I | |||||||||
Verbindung Kr. | . R |
14 | -CCl, |
15 | -CH2Cl |
16 | -CHCl2 |
17 | -CCl, |
18 | -CHCl,, |
-CH2-CH-CH2 | -CHg-CH-CH2 | I |
-C(CHj2-C ^CH | CH | IV) |
-C(CHJ2-C=== CH | H | |
-C(CHj2-C =hCH | ||
-CH, | -CH(CHj)-C-- CH | |
-CHg-CH=CHg | -o | |
-PH, | -CH(CHJ-C=CH | i |
-C^Hg-GH=CHg | -CHg-CH=CHg | ro |
H | -0(CHi)0-CSGH | |
-CHg-CH-CH2 | -CHg-CH=CHg | |
-CH(CH5)-C - CH
-CH(CH5)C --.- CH
CM | M | CM | W | KN | [T] | W | p-f | CM | O | W | CM | |
W | O | W | ο | fr{ | O | ο | O | IiI | ο III |
W | ||
O | II! | O | Hi | O | ir | ί'Ι | !Il | ο | O | O | ||
CM | Il | O | Il | ο | Il | O | ο | ο | I | I | O | Il |
fr-Ht | I | cd | I | I | ι | I | ω | CM | W | |||
ο | O | CM | ο | CVl | O | CM | CM | KV | O | |||
Il | CM | i | I | KN | ,—-χ | I | }Tj | KN | I | |||
O | KN | CM W ο |
KN | CM | W | KN | KN |
CM
K ϋ |
ϋ | W | CM | |
O | I | ι | O | ο | [T] | [χ| | I | ^ω" | O | O | ||
CM
t*Ti |
ϋ | O | I | "hi | CJ | O | O | O | I | |||
PP
O |
O | O | O | O | O | I | I | |||||
t | I | I | ι | I | I | |||||||
CM | CM |
O | ϋ |
I | 1 |
W | |
O | ϋ |
ι | I |
CM | CM |
W | |
ο | O |
CM | ο | CM |
tu | ι | |
ο | ο | |
B | I | |
W | ||
O | ο | |
I | C) I | |
CM | CM | |
W | W | |
O | CJ | |
I | I | |
KN | KN | ON | CJN | KN | KN | KN | CJN | f- | tu | m . | KN | |
CM | CM | CM | H | H | H | H | W | M | KN | KN | ta | |
W | ω | W | W | ^t- | KN | O | O | ο | ||||
KN | H | H | ON | CTN | VO | VD | VD | O | O | I | I | I |
γΗ | γ-Η | O | O | O | O | O | ι | I | ||||
O | O | O | I | I | I | I | I | |||||
I | I | I | ||||||||||
Verbindung Nr. | R | Rl | \ | CH | [ |
52 | -CHj | H | -C(CHj)2-C = | CH | |
53 | -C(CHj)-CH2 | H | -C(CHj)2-C = | ||
54 | -CH-CH-CHj | -CHg-CH-CH2 | -CH2-CH-CH2 | CH | |
55 | -CH-CH-CHj ' | H | -C(CHj)2-C- | CH | |
56 | -CH-C(CHj)2 | -CHj | -CH(CHj)-C^ | CH | |
57 | -CH-C(CHj)2 | H | -C(CHj)2-C-- | ||
58 | -CH-CH-CH-CH-CHj | —CH~—CH=CH^ | -CH2-CH-CH2 | ||
59 | -CH=CH-CH=CH-CHj | H | C(CHj)2C^ CE | ||
60 | „CHg -CH^ I ^ CH~ |
-CH2-CH=CHg | -CHg-CH=CH2 | ||
-CH2-CH-CH2 | -CH2-CH=CH2 | I |
-CH, | -CH(CHj-C.-:? CH | ro |
I | ||
H | -C(CH5)2-C -■ CH | |
-CH2-CH-CH2 | -CH2-CH=CH2 | |
-CH,. | -CH(CHj-C --CH | |
-CHg-CH- | CHg | -CH2-CH=CH2 | -CH | ' I |
-OH, | -GH(CH3)-C. | "CH |
Vj4
N-N 1 |
|
H | -C(CH^)2-C"' | |||
-CHg-CH= | CHg . ' | -OH2-OHpCH2 | -CH | |
-OE3 | -OH(CHj)-C | - CH ' | ||
H | ■* 0 (CHj)2-C: | |||
-CH2-CH- | CHg | -CH2-CH=CHg | ||
W | W | CVi | W | W |
O
Γη |
O
It. |
O
H) |
W | O | CJ | Il |
Ill | III | O | !·! | Li | O |
O | O | R | ο | CJ | I |
I | I | W | I | ι | CM |
ο | |||||
I | ro | ||||
CM | W | W | |||
ο | W | a | O | O | ο |
ο | ο | ν • | |||
W | N ' | I | ο | ||
ο | O | O | O | ||
I | I | I | I | ||
O | O | r |
Il | • | tu |
ir) | O | |
O | I | |
I | ||
CM. | ||
O | ||
I | ||
Verbindung Nr. R
h | , R2 |
-CH2-CH=CH2 | -CHg-CH-CHg |
-CH3 | -CH(CH3)-C~CH |
H | -c(eH3)2-c~t gh |
H | -C(CH3J2-C--. N |
H | -CHg-CH-CHg |
-CH3 | -CH(CH3)C-CH |
-CH2CH=CH2 | -CH2CHiCH2 |
-CH, | -CH(CH3J-C ==! CH |
-CH2-CH-CH2 | -CH2-CH-CH2 |
-CH, | -CH(CHj-C ·-■: CH |
OO
'CH,
ZU | xa | (M | XA- | (M | JTj | (M |
O | XA | O | frj | O | td | |
i | O | O' | O | |||
O | O | Il | O | Il | O | Il |
I | I | td | I | XA | I | JxJ |
CM | O | s—% | O | (M | O | |
NA | I | KA | I | •—s | I | |
NA | »χ« | CM | xa | (M | NA | CM |
O | JTj | O | W | |||
O | V A | O | N ^ | O | O | O |
XA | I | W | I | ν— | I | |
O | O | O | O | |||
I | I | I | ||||
W
O
■Η | rH | M | U |
O | O | ||
I | |||
CHg-CHgCl | -CH2-CH=CH2 | -CH2-CH=CHg | 0 |
CHg-CHgCl | -OE5 | -CH(CH5)-C ^CH | Il |
CHg-CHgCl | H | -C(CH5)g-C-CH | -CH2-CH2-O-C-NH |
CBr(CH5)g | H | -C(CH5J2-C^CH | 0 |
-CH2I , | -CH2-CH-GH2 | -CH2-CH=CH2 | Il |
-CHgI > | -CH5 | -CH(CH5)-C -----CH | |
-CH2I | H | C(CH5)2-C=CH | |
-CHCl2 | -CH2-CHgCl | -CH2-CH2Ci | |
O | |||
Il | |||
-GHCl2 | -CH2-CH2-O-G-IiH-CH5 | ||
0 | |||
ir |
-OH3 | -CH (CH3)-C= CH | 1 | 00 |
H | -C(CHj)2-C "7" CH | CD | |
-CH2-CH^CH2 | -CH2-CH=CH2 | ||
^3 | -CH (CH5) -C-E=F CH | ||
-CH2-CH=CH2 | -CH2rCH=CH2 | ||
CM tu O |
IJ . O I |
CM w- O |
U
ir! |
CM | Il |
O |
W
ο |
|
CM SJ |
. W O |
I CM |
O | O | O |
I | I | I |
CM | a | CM | |
αΰ.
ο κ |
ο |
W
ο . |
|
tu | I | Il | |
ο | O | O | |
CM Hj |
I CM |
||
O I |
CM | W O I |
|
ro
W |
|||
O | |||
CM | |||
CM | O | ||
ta | |||
ο
Il |
tu | ||
W
ο |
|||
I | ι O |
||
CM | t | ||
W | CM | ||
O | |||
N—• - | O | ||
Ϊ25- | O | ||
O | = 00 = | I | |
I | |||
CM | |||
■Όι •τι |
CM Λ O |
||
O | |||
O | |||
I | |||
171 | — CHCl— | -a |
172 | — CHCl— | |
173 | — CHCl — | / N |
174 | /'Ν· \ - -. -CH |
|
\ — |
H | -C(CH3)2-C- | -CH |
-CH2-CH-CH2 | -CH2-CH-CH2 | |
-OE3 | -CH(CH )-C | CH |
H | -C(CHj0-C | .CH |
O=C-O^NH-, C | (CHj)-C | -·Τ CH | -C2H5 | |
179 | -CHCl2 | X-C3H7 | ||
180 | -CHCl2 | |||
195 | -CHCl2 |
196 | -CHCl2 ■ |
197 | Cl |
198 | -CHCl2 |
199 | -CH2Cl |
200 | -0-CHg-C |
201 202 |
-0-C2H Cl -0-CH2-CHCl2 |
-CH2-CH=CH2 -CH2-CH=CH2 |
203 | _o-yT\v.ci | -CH2-CH=CH2 |
204 | -CH2-S-C=N | -CHp-CH=CHp |
205 | -CH2-N(CH2-CH=CH2' | ]2 -CH2-CH=CH2 |
•CH2-CH=CH | 2 | >2 |
•CH2-CH=CH | 2 | |
CH2-CH=CH | 2 | |
CH2-CH=CH | 2 | |
CH2-CH=CH | 2 | |
O | ||
N(CH J-C-CHCl2 | ||
O !I N(C-CHCl2 |
||
CH2CH=CH2 |
-CHg-CH=CH2
219 | -CHCl2 |
220 | -CH2Cl |
221 | -CHCl2 |
222 | -CH2Cl |
H
CO
OO
9
238 | |
N)
O |
239 |
CO | |
5£ | 240 |
an | |
241 |
X-C5H7
252
«©
co
261 | -CHCl2 |
262 | -CHCl2 |
263 | -CHCl0 |
-C |
n-C |
n-C |
n-C |
n-C |
n-C |
2H5 |
3H7 |
?H7 |
3H7 |
3H7 |
3H7 |
χ CH,
Cl
co
co
<CaH,-HH-C-CECl
I 4 5
321 | -CHCl2 |
322 | -CHCl2 |
323 | -CH2Cl |
O
CO
OO
ι
355
555 | -CHCl2 |
33.6· | -CH2Cl |
557 | .-CHCl0 |
σ
ο
342
344
CH2-CH(0CH3)2 | I |
ro
ro |
0 CH2-CH2-NHC-CHCl |
—J ro I 2 |
!809 |
CH2-CH-CH2 | ||
0 Il |
||
CH(ISH-C-CHCl2 )—, | // <\ | |
0 It \j J3L I IH Ω.m* \j mm \j Xj. O JL ο / ""^* |
||
^- NO2 | ||
ΙΌ | 346 |
O | |
co | |
00 | |
*"» | 347 |
σι | |
!18 | |
O' ■ | 348 |
363 | -CH9-CH9-C-O-CH |
364 | -CHCl2' . ^CH |
365 | -CH |
CH,
-C(CHj.
-C^CH?/ρ""^ ξγΟΗ
-C(CH3)2-C - CH
Verbindung | Nr. | E. | |
587 | -CH2Cl | ||
588 | -CCl, | ||
Kr | • | ||
O | |||
tp. | |||
CD | 200 |
O
OH
Verbindung Nr. | K |
405 | -CH2Cl |
406 | -CHgCl |
407 | -CHgCl |
408 | -CHgCl |
409 | -CH2Cl |
410 | -CflgCl |
411 | -CHgCl |
CH,
Verbindung | ITr. | E |
412 | -CH2Cl | |
413 | -GH2Cl |
CjD
CO
-P-'Jt
-CH |
-CH |
-CH |
-CH |
-CH |
-CH |
-CH2 |
-CH2 |
-CH2 |
-CH2 |
2ci |
2ci |
2ci |
2ci |
2ci |
2ci |
Cl |
Cl |
Cl |
Cl |
sec-C | -C | 4H | 9 |
sec | 3H | 4H | 9 |
i-C | -H | 7 | |
i-C | 4H | 7 | |
i-C | 9 | ||
-CH2-CE | 2-O-CH5 |
O
UJ
445 | -CH2Cl |
446 | -CHCl2 |
447 | -Ch2Cl |
448 | -CHCl2 |
449 | -CH2Cl |
450 | -CHCl2 |
451 | -CHCl2 |
452 | -CH2Cl |
,; 455 | -CHCl2 |
454 | -CH2Cl |
455 | -CHCl0 |
-n- |
i-C |
i-C |
i-C |
i-C |
i-C |
V5 |
3H7 |
3B7 |
3H7 |
3B7 |
H |
SeC-C4H9
n-C5Hn
co | 19 ' | 464 |
O | O | |
O | 465 | |
q | ||
IV^ | 466 | |
* | IO O to cc *"- in |
Verbindung Nr. |
■ tf'i | 180 | 467 |
'I J | ||
468 | ||
469 470 |
||
471 |
482 | -CH2Cl |
483 | -CH2Cl |
484 | -CHCl2 |
485 | -CHgCl |
486 | -CHCl2 |
487 | -CHCl2 |
488 | -CHCl0 |
LT\
M |
Y | -CH | LOl | O | |
CNJ | CM | CM | CM | |T"j | CNJ |
Pi | O | O | CNJ | O | |
I | CQ | O | O | CQ | |
■ | I | I | I |
W | r |
O
I CM O |
U | |
O | O | CQ | CQ | PA |
CM | I | I | 1 | VO |
CM | CM | W | ||
O | 'W | W | ro | |
I | O | O | tj | |
I | I | I | ||
CM | rH | f |
rH | O | rH |
O | O | O |
tn | 1 | O |
O | 1 | |
I | ||
506 | -CHCl2 |
507 | -CCl,- |
508 | -CCl,- |
509 | -CCl5- |
511 | -CCl, |
512 | -CH2Cl |
515 | -CHCl0 |
Anwendungs- verhältnis |
Tabelle Hj | Gegenmittel■ | Anwendungs- verhältnis /2 |
Getreide art |
|
0,672 | Verbin dung Nr. |
0,007 | Mais | ||
Herbizid | 0,672 | VJl | 0,014 | Mais | |
EPTC | 0,672 | 6 | 0,056 | Mais | |
EPTC | 0,672 | 6 | 0,112 | Mais | |
EPTC | 0,672 | 6 | 0,224 | Mais | |
EPTC | 0,672 | 6 | 0,560 | Mais | |
EPTC . | - | 6 | 0,560 | Mais | |
EPTC | 0,672 | 6 | 0,014 | Mais | |
- | 0,672 | 1Ό | 0,014 | Mais | |
EPTC | 0,672 | 11 | 0,014 | Mais | |
EPTC | 0,672 | 12 | 0,014 | Mais | |
EPTC | 0,672 | 13 | 0,014 | Mais | |
EPTC | 0,672 | 15 | 0,014, | Mais | |
EPTC | 0,672 | 16 | 0,014 | Mais | |
EPTC | 0,672 | 18 | 0,056 | Mais | |
EPTC | 0,672 | 8 | 0,224 | Mais· | |
EPTC | 0,672 | 8 | 0,224 | Mais | |
EPTC | 7 | ||||
EPTC. | |||||
in °fo nach
0 | 0 | 0 |
0 | 0 | 0 |
0 | 0 | 0 |
ο | 0 | 0 |
0 | 0 | 0 |
0 | 0 | 0 |
0 | 0 | |
20 M | ||
0 | ||
10 M | ||
60 M | ||
0 | ||
10 M | ||
0 | ||
20 M | ||
0 | ||
45 M | ||
EPTC
94 M
in ia nach
Herbizid | Anwendungs- verhältnis |
+ | Yerbm- Anwendungs- dung verhältnis Nr. / 2 |
0,014 | Getreide art |
5 Wochen | 4 Wochen | 6 Wochen | |
EPTG + | 0,672 | 0,224 | |||||||
ftf O co ce |
2-Chlor-4-cyclo- propylamino-6- isopropylamino-s- triazin |
0,112 | + | Mais | 90 M, 1■ | ||||
EPTC + 2,4-3) |
0,672 0,112 |
6 | 0,014 | Mais | 0 | ||||
oo | SPTC + 2,4-D |
9,672 0,112 |
+ | 6 | Mais | 10 V | |||
ο | EPTC .+ 2,4-D . ... |
0,672 0,112 |
+ | Mais | 50 M | ||||
S-Propyldipropyl- thiolcarbamat + 2-Chlor-4-äthyl- amino-6-i.sopropyl- amino-s-triazin |
0,672 0,112 |
+ | 6 | Mais | - | 3 M | |||
S-Propyldipropyl- thiolcarbamat + |
0,672 | ||||||||
2
triazin | 0,112 |
S-Propyldipropyl- | 0,672 + |
thiolcarbamat + | |
2-Chlor-4,6-bis- | |
(äthylamino)-s- | |
triazin | 0,112 |
S-Propyldipropyl- tMolcarbämat + |
0,672 + |
2(4-Chlor-6-äthyl-' | |
amino-s-triazin- | |
2ryl-amino)i-2- | |
methylpropionitril | 0,112 |
S-Propyldipropyl- | |
thiolcarbamat + | 0,672 + |
2(4-chlor-6-äthyl- / | |
amino-s-triazin-2- | |
yl-amino)-2-methyl- | |
propionitril | 0,112 . |
in jo nach
/ 2
0,224
(Jegenmittel | 0,014 | (Jetreide- art |
Schädigung der Pflanzen in fo nach |
|
Anwendungs- Herbizid verhältnis g/m |
Yerbin- Anwendungs dung verhältnis |
0,224 | Mais | 5 Wochen 4 Wochen 6 Wochen |
S-Propyldipropyl- thiolcarbamat 0,672 |
6 | _ | Mais | 0 |
S~Propyldipropyl- thiolcarbamat 0,672 |
• 6 | 0,014 , | Mais | ■ .0 |
S-Propyldipropyl- thiolcarbainat 0,672 |
Mais | ": . , 90 M | ||
S-Äthyldiisobutyl- thiolcarbamat + 0,896 + 2-Chlor-4-äthyI<» amino-6-isopropyl- amino-s-triazin \ 0,112 |
6 | 0,224 | 0 | |
S-Äthyldiisobutyl-' . thiolcarbamat + 0,b?6 + |
Mais | |||
i—Chiοr—4τaxnyχ- amino-6-isöpropyl- amino-s-txiazin 0,112 |
■■■■-..$ | 0 | ||
S-lthyldii.sobutyl- thiolcarbainat + 0,896 + |
thiolcarbamat +
2-Chlor-4,6-bis-()
O φ |
triazin | 0,112 |
CSD | S-ithyldiisobutyl- | |
♦^ | thiolcarbamat + | 0,896 + |
2-Chlor-4,6-bis- | ||
(äthylamino)-s- | ||
triazin | 0,112 | |
CO O |
S-lthyldiisobutyl- | |
thiolcarbamat + | 0,896 + | |
2-Chlor-4,6-bis- | ||
(äthylamino)-s- | ||
triazin | 0,112 |
methylpropionitril | 0,112 |
S-Äthyldiisobutyl- | |
thiolcarbamat + | 0,896 + |
2-Chlor-4-cyolo- | |
propylamino-6-iso- | |
propylamino-s- | |
triazin | 0,112 |
S-ithyldiis obutyl- | |
thi'i/q^carbamat + | 0,896 + |
2-biilor-4-cyclo- | |
propylamino-6-iso- | |
propylamino-s- | |
tTxazin | 0,112 |
S-Äthyldiisobutyl- | |
thiolcarbamat + | 0,896 + |
2,4-D | 0,112 |
Nr. _ /2 ,
Anwendungs- Verhältnis g/m |
Gegenmittel | Anwendungs- verhältnis / 2 g/m |
Getreide art |
Schädigung der Pflanzen in °/o nach |
|
Herbizid | 0,8Q6 + 0,112 |
Verbin dung Nr. |
0,224 | Mais | 3 Wochen 4 Wochen 6 Wochen |
S-Äthyldiisobutyl- thiolcarbamat + 2,4-D |
0,896 + 0,112 |
6 | Mais | 0 | |
S-Äthyldiisobutyl- thiolcarbamat + 2,4-D |
0,896 | 0,014 | Mai s | 0 | |
S-Athyldiisobutyl- thiolcarbamat |
0,896 | 6 | 0,224 | Mals | 0 |
S-A'thyldiisobutyl- thiolcarbamat |
0,896 | 6 | - . | Mais | 0 |
S-Äthyldiisobutyl- thiolcarbamat |
0,896 | - | 0,014 | Mai s | 20 V |
S-2,3,3-Trichlor- allyl-diisopropyl- thiolcarbamat |
0,896 | 6 | Mais | 10 V | |
S-2,3,3-Trichlor- allyl-diisopropyl- thiolcarbamat |
•0,336 | 0,560 | Vi ei ζ en | 30 τ | |
S-2,3,3-Trichlor- allyl-diisopropyl- thioicarbamat |
6 | 70 | |||
g/m
Herbizid | Anwendungs- verhältnis |
Gegenmittel | g/m2 | Schädigung der Pflanzen in °fo nach |
4 Wochen | 6 Wochen | |
g/m | Verbin- Anwendungs dung verhältnis |
0,560 | Getreide art 5 Wochen |
||||
g-Chlor-I-iso- propylacetanilid |
0,336 | Nr. | - | 20 | |||
2-Chlor~N-iso- propylacetanilid |
0,556 | 6 | 0,560 | Weizen | 40 | ||
2098 | K,H-DiallyX-2- chloracetamid |
0,448 | - | en | Weizen | 20 | |
Ort *»» |
0,448 | 6 | - | Mohrenhirse | 70 | ||
diäthylthiol- c&rbamat |
0,672 | - | 0,560 | Mohrenhirse | 50 | ||
diäthylthiol- carbamat |
0,672 | - | Reis | 50 | |||
diäthylthiol- carbasnat |
1,544 | 6 | Reis | 90 | |||
Reis | |||||||
Herbizid | Anv;endungs- verhältnis g/m |
Gegenmittel | Getreide art |
Schädigung der Pflanzen 'in 70 nach |
|
S-4-Chlorbenzyl- diäthylthiol- carbamat |
1,344 | Verbin- Anwendungs- dung verhältnis Nr. / 2 g/m |
Heis | 3 Wochen 4 Wochen 6 Wochen | |
S-4-Chlorbenzyl- diäthylthiol- carbamat |
1,344 | 6 0,560 | Mais | ■ 30 | |
to co Jf- |
S-4-Chlorbenzyl- .diäthylthiol- carbamat |
1,344 | ■ | Mais | 40 |
*ν | S-Äthylcyc1ohexyl- äthylthiocarbamat |
0,672 | 6 -0,560 | Mais , | 0 |
CS | S-Äthylcyclohexyl- äthylthiocarbamat |
O,.672 | 6 0,011 | Mais | 50 M |
80 M | |||||
Anwendungs verhältnis g/m2 |
Gegenmittel | 0,5 | Tabelle ] | Behandeltes Saat gut |
4 Wochen | M | Ünbehandeltes Saatg in der benachbarten Reihe |
|
Verbin- Behand dung lungsver ify hältnis $ Gew./Gew. |
0,5 | [II: | 2 Wochen | 60 v, | M | 2 Wochen 4 Wochen | ||
Herbizid | 0,672 | 0,5 | Schädigung in | 20 M | 40 V, | M | ||
0,672 | 1 | 0,5 | Getrei deart |
10 V | 60 Y, | M | ||
EPTG | 0,672 | 2 | 0,5 | 0 | 70 Y, | M | ||
EPTG | 0,672 | 3 | 0,5 | Mais | 10 V | 30 Y, | ||
EPTC | 0,672 | 4 | 0,5 | Mais | 0 | 0 | ||
EPTC | 0,672 | 5 | 0,05 | Mais | 0 | 50 ν | 0 0 | |
EPTC | 0,672 | 6 | 0,5 | Mais | 0 | |||
EPTG | 0,672 | 7 | 0,5 | Mais | ||||
EPTQ | O,6?2 | θ | 0,5 | Mais | 10 V | 30 M | ||
EPl1C | 0,672 | 9 | 0,5 | Mais | 10 V | 5 M | ||
EPTG | 0,672 | 10 | 0,5 | Mais | 10 V | 10 M | ||
SiPTC | 0,672 | 11 | 0,5 | Mais | 100 K | 5 M | ||
EPTC | 0,672 | 12 | 0,5 | Mais | 100 K | 15 M | ||
SPTC | 0,672 | 13 | 0,5 | Mais | 10 V | 50 M | ||
EPTC | 0,672 | 14 | Mais | 100 K | 5 V | |||
EPTG | 0,672 | 15 | Mais | 10 Y | 5 Y | |||
EPTG | 16 | Mais | ||||||
EPTC | Mais | |||||||
Mais | ||||||||
Herbi zid |
Anwendungs- verhältnis g/m |
Gegenmittel | Behand lungsver hältnis </o Gew./Gew. |
Getrei deart |
Schädigung | ■ in fo | 1 Ui Cl O Vl P Tl | Ünbehandeltes Saatgut in der benachbarten Reihe |
4 Wochen | |
EPTC | 0,672 | Ver bindung Nr. |
0,5 | Mais | Behandeltes Saat gut |
2 Wochen | ||||
EPTC | 0,672 | 17 | 0,5 | Mais | 2 Wochen * | 35 M | ||||
EPTC | 0,672 | 18 | 0,5 | Mais | 20 Y | 5 Y | ||||
EPTC | 0,672 | 19 | 0,5 | Mais | 0 | 10 Y | 50 M | 65 M | ||
NJ | EPTC | 0,672 | 20 | 0,5 | Mais | 0 | 0 | 30 M | 55 M | |
O
CO |
EPTC | 0,672 | 21 | 0,5 | Mais | 10 V . | 70 M | 10 M | 80 M | |
09 £·· |
EPTC | 0,672 | 22 | 0,5 | Mais | 0 | 40 M | 85 M | 80 M | |
tn | ■ EPTC■ | 0,672 | 23 | 0,5 | Mais | "60 M | 10 Y | 85 M | '80 M ' | |
—Λ | EPTC | 0,672 | 24 | 0,5 | Mais | 20 M | 30 M | 75 M ■ | 60 M | |
09 | EPTC | 0,672 | 25 | 0,5 | Mais | 10 V | 10 M | 60 M | 80 M | |
O | EPTC | 0,672 | 26 | 0,5 | Mais | 0 | 83 M | |||
EPTC | 0,672 | 27 , | 0,5 | Mais | 0 | 60 M | ||||
EPTC | 0,672 | 28 | 0,5 | Mais | 70 K | 75 M | ||||
EPTC | 0,672 | 29 | 0,5 ' | Mais | 30 V, M | 70 M | ||||
EPTC | 0,672 | 30 | 0,5 | Mais | 60 M | 70 M | ||||
EPTC | 0,672 | 31 | 0,5 | Mais | 60 M | 80 M | ||||
32 | 70 M | 75 M | ||||||||
60 M | ||||||||||
Herbi zid |
Anwendungs- | Gegenmittel | Behand- | 0,5 | Getrei de art |
Schädigung in io | Unbehandeltes Saatgut | |
EPTC | verhältnis g/m2 |
Ver | bindung lungsver- Nr. hältnis <fo Gew./Gew. |
0,5 . | Mais | Behandeltes Saat- | in der benachbarten Reihe |
|
EPTC | 0,672 | 33 | 0,5 | Mais | gut | 2 Wochen 4 Wochen | ||
EPTC | 0,672 | 34 | 0,5 | Mais | 2 Wochen 4 Wochen | 75 M | ||
EPTC | 0,672 | 35" | 0,5 | Mais | 50 V, M | 80 M | ||
PO | EPTC | 0,672 | 36 | 0,5 | Mais | 60 M | 75 M. | |
O co |
EPTC | 0,672 | 37 | 0,5 | Mais | 50 M | 85 M | |
09 | EPTC | 0,672 | 38 | 0,5 | Mais | 60 M | 85 M | |
un | EPTC | 0,672 | 39 | 0,5 | Mais | 40 V, M | 80 M | |
EPTC | 0,672 | 40 | 0,5 | Mais | 60 M | 70 M | ||
EPTC | 0,672 | 41 | 0,5 | Mais | 60 M | 80 M | ||
as | EPTC | 0,672 | 42 | 0,5 | Mais | 50 M | 75 M 65 M | |
EPTC | 0,672 | 43 | 0,5 | Mais | 10 V,M 50 M | 80 M | ||
EPTC | 0,672 | 44 | 0,5 | Mais | 60 M | 85 M 80 M | ||
EPTC | 0,672 | 45 | 0,5 | Mais | 10 V,M 50 M | 70 M | ||
EPTC | 0,672 | 46 | 0,5 | Mais | 40 M | 85 M | ||
EPTC | 0,672 | 47 | Mais | 60 M | 85 M | |||
0,672 | 48 | 40 V,M | 80 M | |||||
60 M | 80 M | |||||||
50 V,M | ||||||||
Anwendungs- vefhältnis g/m2 |
Gegenmittel | 0,5 | Getrei deart |
Schädigung in fo | Saat- Unbehandeltes Saat gut in der benachbar ten Reihe |
|
Herbi zid |
0,672 | Ver- Behand bindung lungsver- Nr. hältnis ia Gew./Gew. |
0,5 | Mais | Behandeltes gut |
Wochen 2 Wochen 4 Wochen |
0,672 | 49 | 0,5 | Mais | 2 Wochen 4 | 70 M | |
EPTC | 0,672 | 50 | 0,5 | Mais | 60 M | 90 M |
EPTC | 0,672 | ' 51 | 0,5 | Mais | 60 M | 70 M |
EPTG | 0,672 | 52 | 0,5 | Mais | 60 M | 80 M |
SPTC | 0,672 | 55 | 0,5 | Hais | 60 V,M | 70 M |
IPTC | 0,672 | 54 | 0,5 | Mais | 50 M | 70 M |
EPTC | 0,672 | 55 | 0,5 | Mais | 60 M | 80 M |
EPTO | 0,672 | 56 | 0,5 | Mais | 60 M | 80 M. |
EPTC | 0,672 | 57 | 0,5 | Mais | 60 M | 65 M |
EPTG | 0,672 | 58 | 0,5 | Mais | 60 M | 75 M |
EPTC | O9 672 | 59 | 0,5 | Mais | 50 M | 80 M |
EPTC | 0,672 | 60 | 0,5 | Mais | 60 V,M | 75 M |
EPTC | 0,672 | 61 | 0,5 | Mais | 60 V,M | 85 M |
SPTC | 0,672 | 62 | 0,5 | Mais | 60 M | 60 M 80 M 70 M |
EPTC | 0,612 | 63 | Mais , | 40 V,M | 60 M ' 70 M 70 M | |
EPSC | 64 | 30 V,M | 50 M 65 M 70 M | |||
EPSC | 30 VjM | |||||
Gegenmittel | Verbin dung Sr. |
Behandlungs- verhältnis $> Gew./Gew., |
Getrei deart |
Schädigung | in <?o | 4 Wochen | Unbehandeltes Saat gut in der benach barten Reihe |
80 M | |
Eerbi- aid |
Aawendungs- verhältnis |
Behandeltes Saat gut |
70 M | 2 Wochen 4 Wochen | |||||
65 66 |
0,5 0,5 |
Mais Mais |
2 Wochen | 75 M 70 M |
|||||
EPTC EPTC |
0,672 0,672 |
61 | 0,5 | Mais | 60 V,M 50 V,M |
80 M | 70 M | ||
EPTC | 0,672 | 68 | 0,5 | Mais | 40 V,M | 50 M | 80 M | 80 M | |
EPTC | 0,672 | 69 | 0,5 | Mais | 60 M | 50 V,M | 70 M | ||
EPTC | . 0,672 | 70 | 0,5 | Mais | 20 V,M | 80 M | |||
EPTC | 0,672 | 71 | 0,5 | Mais | 40 V,M | 80 M | |||
EPTO | 0,672 | 72 | 0,5 | Mais | 40 V,M | 65 M | |||
EPTC | 0,672 | 75 | 0,5 | Mais | 60 M | 80 M | |||
EPTC | 0,672 | 74 | 0,5 | Mais | 60 M | 80 M | |||
EPTC | 0,672 | 75 | 0,5 | Mais | 60 M | 80 M | |||
EPTC | 0,672 | 76 | 0,5 | Mais | 60 V,M | 75 M | |||
EPSC | 0,672 | 77 | 0,5 | Mais | 50 V,M | 75 M | |||
EPTC | 0,672 | 78 | 0,5 | Mais | 60 M | 75 M | 70 | ||
EPTC | 0,672 | 79 | 0,5 | Mais | 60 V,M | 60 M | 75 M | 50 M | |
BPTC | 0,672 | 80 | 0,5 | Mais | 50 V,M | 20 h | 65 k | 50 M | |
EPTC | 0,672 | 81 | 0,5 | Mais | 60 M | 30 S | 50 M | ||
EPTC | 0,672 | 82 | 0,5 | Mais | 10 V | 50 M | |||
EPTC | 0,672 | 50 V |
Herbi zid |
Gegenmittel | 83 | Behandlungs verhältnis <fo Gew./Sew. |
Getrei- deart |
Schädigung_ | 4 | in <?o | Unbehandeltes Saat gut in der benach barten Reihe |
25 M | |
Anwendungs- Verbin- verhältnis dung ,2 Nr. |
84 | Behandeltes gut |
20 | Saat- | 2 Wochen 4 Wochen | 20 M | ||||
EPTC | 85 | .0,5 | Mais | 2 Wochen | 10 | Wochen | 20. M | 45 M | ||
EPTC | 0,672 | 86 | 0,5 | Mais | 20 V | 10 | S | 15 M | ||
EPTO | 0,672 | 87 | 0,5 | Mais | 10 V | ν | 35 M | |||
EPTC | 0,672 | 88 | 0,5 | Mais | 30 V | V | 75 M | |||
to | EPTC | 0,672 | O ft O j/ |
0,5 | Mais | 50 V,M | 75 M | |||
co | EPTC | 0,672 | 90 | 0,5 | Mais | 30 V,M | 70 M | 80 M | ||
in | EPTC | 0,672 | 91 | 0,5 | Mais | 50 V,M | 30 | 80 M | ||
EPTO | 0,672 | 92 | 0,5 | Mais | 60 M | 80 M | ||||
—» OO |
EPTC | 0,672 . | 93 | 0,5 | Mais | 20 Τ,Μ | V,M | 80 M, | 75 M | |
O | EPTC | 0,672 | 94 | 0,5 | Mais | 40 VjM | 20 | 80 M | ||
EPTC | 0,672 | 95 | 0,5 | Mais | 50 V,M | - ' | 75 M | |||
EPTG | 0,672 | 96 | 0,5 | Mais | 60 Y | V | 80 M | |||
EPTC | 0,672 | 97 | '■ 0,5 . | ■' Mais . | 30 ν,Μ . | 90 μ ' | ||||
EPTC | 0,672 | 0,5 | Mais | 100 K . | 80 M | |||||
EPTC | 0,672 | 0,5 | Mais | 30 Τ,Μ | 75 M , | |||||
0/672 | 30 ν,Μ | |||||||||
Herbi | Anwendungs | Gegenmittel | verhältnis | Getrei | Schädigung in tfo | Unbehandeltes Saat | 4 Wochen | |
zid | verhältnis | Verbin- Behandlungs- | io Gew./Gew. | deart | Behandeltes Saat | ' gut in der benach | ||
EPTC | g/m | dung | gut | barten Eeihe | 80 M | |||
EPTC | 0,672 | Nr. | 0,5 | 2 Wochen | ||||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 75 M | |||
EPTC | 0,672 | 98 | 0,5 | Mais | 60 V,M | 85 M | 80 M | |
EPTC | 0,672 | 99 | 0,5 | Mais | 50 V 50 V,M | 65 M | ||
-—« | EPTC | 0,672 | 100 | 0,5 | Mais | 40 V,M | 75 M | |
CO | EPTC | 0,672 | 101 | 0,5 | Mais | 50 V,M | 85 M | |
CD | EPTC | 0,672 | 102 | 0,5 | Mais | 50 V,M 50 M ■ | 80 M | |
cn | EPTC | 0,672 | 105 | 0,5 | Mais | 50 M | 85 M | 80 M |
-> | EPTC | 0,672 | 104 | 0,5 | Mais | 40 V,M | 85 M | |
00 | EPTC | 0,672 | 105 | 0,5 | Mais | 50 V,M | 80 M | |
O | EPTC | 0,672 | 106 | 0,5 | Mais | 40 V,M | 85 M | |
EPTC | 0,672 | IO7 | 0,5 | Mais | 50 V 20 V,M | 90 M | ||
EPTC | 0,672 | 108 | 0,5 | Mais | 40 V,M | 90 M | 80 M | |
EPTC | 0,672 | 109 | 0,5 | Mais | 50 ν,Μ | 85 M | ||
EPTC | 0,672 | 110 | 0,5 | Mais | 40 V,M | 75 M | ||
0,672 | 111 | 0,5 | Mais | 40 V,M | 85 M | |||
112 | Mais | 60 V,K 50 M | 80 M | |||||
115 | 50 V,M | |||||||
Herbi- | Anwendungs- verhältnis / 2 g/m |
Gegenmittel | 0,5 | Gretrei- deart |
2 | Schädigung in $ | Unbehandeltes Saat gut in der benach barten Reihe |
4 Wochen | |
ZXu | Verbin- Behandlungs- dung Verhältnis . ITr. $ G-ew,/$ew. |
0,5 0,5 · |
40 | Behandeltes Saat gut |
2 Wochen | ||||
EPTC | 0,672 | 0,5/ | Mais | 30 20 |
Wochen 4 Wochen | 90 M | 80 M | ||
EPIC EPIO |
0,672 0,672 |
115 | 0,5 | Mais Mais |
30 | V,M | 75 M 70 M |
||
Ο
ίο· |
EPTC | 0,672 | 116 117 |
0,5 | Mais | 30 | V 30 V V ,M |
70 M | |
tv 00 |
EPTC | 0,672 | 118 | 0,5 | Mais | 30 | V,M | 70 M | |
**» cn |
EPTC | 0,672 | 119 | 0,5 | Mais | 40 | V,M | 75 M | |
BPTC | 0,672 | 120 | 0,5 | Mais | 20 | V1Ii | 75 M | ||
—* Oft |
EPTC | 0,672 | 121 | Qf 5 | Mais | 20 | V,M | 35 M | 20 M |
uv O |
IPTC | 0,672 | 122 | 0,5 | Mais | 30 | V,M | 10 M | |
IPTC | 0,672 | 123 | 0,5 | Mais | 40 | V 20 V | 75 M | ||
SPTQ | 0,672 | 124 | 0,5 | Mais | 40 | V,M | 80 M | ||
■ IfTC | 0,672 | I25 | 0,5 | Mais | 60 | V,M | 80 M | ||
SPTC | 0,672 | 126 | 0,5 | Mais , | 50 | V,M ■ | 80 M | ||
IfTCv | 0,672 | 127 | Mais | ■50 | ■ M ■ . ■ | 55 M | 60 M | ||
EPTC | 0,672 | 128 | Mais | M ■ , ■ ■ ■ | 50 M | ||||
129 | V,B 30 V.B | ||||||||
Herbi zid |
Anwendungs- verhältnis g/m |
Gegenmittel | Behandlungs verhältnis ia Gew./Gew. |
Getrei deart |
Schädigung | in io | • | 40 M | 4 Wochen | I | |
0,672 | Verbin dung Nr. |
Behandeltes gut |
Saat- | Unbehandeltes Saat gut in der benach barten Reihe |
25 M | 60 M | FM) iw3k | ||||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen | 4 Wochen 2 Wochen | 45 M | 55 M | ι C* | |||
EPTC | 0,672 | 130 | 0.5 | Mais | 30 V | 30 V | 65 M | 55 M | |||
EPTO | 0,672 | 131 | 0,5 | Mais | 10 V | 0 | 70 M | te | |||
Ν» | BPTO | 0,672 | 132 | .0,5 | Mais | 0 | 0 | 70 M | |||
O | EPTC | 0,672 | 133 | 0,5 | Mais | 40 M | 80 M | ||||
UmT | EPTC | 0,672 | 134 | 0,5 | Mais | 30 V,M | 85 M | ||||
cn | EPTC | 0,672 | 135 | 0,5 | Mais | 40 V,M | 75 M | ||||
»A | EPTC | 0,672 | 136 | 0,5 | Mais | 50 V,M | 30 M | N) | |||
EPTO | 0,672 | 157 | 0,5 | Mais | 30 V,M | 75 M | N) | ||||
O | EPTQ | 0,672 | 138 | 0,5 | Mais | 30 V,M | 80 M | 18097 | |||
EPTC | 0,672 | 139 | 0,5 | Maie | 50 V1M | 75 M | 80 M | ||||
EPTC | 0,672 | 140 | 0,5 | Mais | 50 V,M | 85 M | 70 M | ||||
EPTC | 0,672 | 141 | 0,5 | Mais | 20 V,M | 30 V,M | 85 M | 80 M | |||
EPTC | 0,67* | 142 | 0,5 | Mais | 20 V,M | 50 M | 80 M | ||||
EPTC | 0,672 | 143 | 0,5 | Mais | 10 ν,Μ | 50 M | 65 M | ||||
EPTC | 0,672 | 144 | 0,5 | Mais | 50 V,M | 70 M | |||||
EPTC | 145 | 0,5 | Mais | 20 V,M | |||||||
146 | 20 V,M | 20 V,M | |||||||||
Anwendungs- .verhältnis g/m |
Gegenmittel | 0,5 | Getrei deart |
Schädigung in. fo | • | |
Herbi- | 0,672 | Verbin- Behandlungs- dung verhältnis Nr. fo Gew./Gew. |
0,5 | Behandeltes Saat gut |
Unbehandeltes Saat gut in der benach barten Reihe |
|
ZIa | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 2 Yvöchen 4 Wochen | |
EPTC | 0,672 | 147 | 0,5 | Mais | 10 V 0 | 75 M 80 M |
EPTC | 0,672 | 148 | 0,5 | Mais | 60 M | 75 M |
EPTO | 0,672 | 149 | 0,5 | Mais | 40 V,M | 75 M |
EPTO | 0,672 | I50 | 0,5 | Mais | 50 V,M | 70 M |
EPTC | 0,672 | 151 | 0,5' | Mais | 50 M | 70 M |
EPTC | 0,672 | I52 | 0,5 | Mais | 40 M | 80 M |
EPTC | 0,672 | 153 | 0,5 | Mais | 50 M | 85 M |
EPTC | 0,672 ' | 154 | 0,5 | Mais | 30 V,M | 75 M |
EPTC | 0,672 | 155 | 0,5 | Mais, - | 20 V,M 40 M | 85 M 80 M |
EPTO | 0,672 . | I56 | 0,5 | Mais | 60 M | 85 M |
EPTC | 0,672 | 157 | 0,5 | Mais | 50 V,M | 80 M |
EPTC | 0,672 | 158 | 0,5 | Mais | 20 V,M | 70M' |
EPTC | 0,672 | 159 | 0,5 | Mais | 30 V,M | 75 M |
EPTC | 0,672. | 160 | 0,5 | Mais | 50 V,M , ■ | 75 M |
EPTC | 0,672 | 161 | Mais | 50 ν,Μ . | 70 M ; | |
EPTC | 162 | Mais | 30 ν,Μ. :. | 65'M | ||
EPTC | 163 | ■ 60 V,M · | 60 M | |||
Anwendungs- verhältnis g/m |
Gegenmittel | Behandlungs verhältnis io Gew./Gew. |
Getrei deart |
Schädigung in $ | Unbehandeltes Saatgut in der be nachbarten Reihe |
|
Herbi- if-, A |
0,672 | Verbin dung Nr. |
Behandeltes Saat gut |
2 Wochen 4 Wochen | ||
ZXCl | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 70 M | |
EPTC | 0,672 | 164 | 0,5 | Mais | 60 M | 75 M |
EPTC | 0,672 | 165 | 0,5 | Mais | 60 M | 75 M 60 M |
EPTC | 0,672 | 166 | 0,5 | Mais | 40 Υ,Μ 60 1 | 75 M |
EPTC | 0,672 | 167 | 0,5 | Mais | 50 V,M | 80 M |
EPTC | 0,672 | 168 | 0,5 | Mais | 60 V,M | 80 M 80 M |
EPTC | 0,672 | 169 | 0,5 | Mais | 50 Y 50 Y | 80 M |
EPTC | 0,672 | 170 | 0,5 | Mais | 50 V,M | 75 M |
EPTC | 0,672 | 171 | 0,5 | Mais | 60 M | 75 M |
EPTC | 0,672 | 172 | 0,5 | Mais | 40 M | 80 M 80 M |
EPTC | 0,672 | 175 | 0,5 | Mais | 50 V,M 50 M | 80 M |
EPTC | 0,672 | 174 | 0,5 | Mais | 60 V,M | 85 M |
EPTC | 0,672 | 175 | 0,5 | Mais | 50 V,M | 85 M |
EPTC | 0,672 | 176 | 0,5 | Mais | 40 V,M | 85 M |
EPTC | ϊ77 | 0,5 | Mais | 50 V,M | 80 M | |
EPTC | 178 | 50 Υ,Μ | ||||
CD
CO
0
0
0
0
0
0
0
0
0
0
0
0
0
0
0
Herbi zid |
Anwendungs- verhältnis g/m |
Gegenmittel | - Behandlungs verhältnis % Gew./Gew. |
Getrei deart |
Schädigung in io | Unbehandeltes Saat gut .in der benach barten Reihe |
80 M | |
EPTC | 0,672 | Verbin dung Nr. |
0,5 | Mais | Behandeltes Saat gut |
2 Wochen 4 Wochen | ||
EPTC | 0,672 | 195 | 0,5 | Mais | 2 Wochen 4 Wochen | 55 M | ||
EPTC | 0,672 | 196 | 0,5 | Mais | 30 V,M | 55 M | ||
EPTC | 0,672 | 197 | 0,5 | Mais | 100 K | 75 M | ||
EPTC | 0,672 | 198 | 0,5 | Mais | 60 M | 75 M | ||
co | EPTC | 0,672 | 199 | 0,5 | Mais | 30 V,M 30 M | 80 M | 50 M |
GO | EPTC | 0,672 | 200 | 0,5 | Mais | 50 V,M | 80 M | |
tn | EPTC | 0,672 | 201 | 0,5 | Mais | 60 M | 88 M | 55 M |
EPTC | 0,672 | 202 | 0,5 | Mais | 40 V,M | 60 M | ||
■mA | EPTC | 0,672 | 203 | 0,5 | Mais | 50 M | 65 M | |
O | EPTC | 0,672 | 204 | 0,5 | Mal a | 50 M | 55 M | 40 M |
EPTC | 0,672 | 205 | 0,5 | Mais | 20 V 10 V | 65 M | ||
EPTC | 0,672 | 206 | 0,5 | Mais | 30 V,M | 40 M | ||
EPTC | 0,672 | 207 | 0,5 | Mais | 20 V,M 20 V,M | 55 M | ||
üiPTC | 0,672 | 208 | o,5 | Mais | 100 K | 70 M | ||
209 | 60 V,M | 30 M | ||||||
0 0 | ||||||||
EPTC
EPTC
EPTC
EPTC
EPTC
EPTC
EPTC
EPfO
EPTC
EPTG
EPTC
EPTC
EPTC
EPTC
EPTC
¥
K
10.V
K
0
0
¥
¥
¥
0
¥
¥
0
ioo κ
¥
¥
¥
Anwendungs verhältnis g/m |
Gegenmittel | Behandlungs verhältnis io Gew»/Gew. |
Getrei deart |
Schädigung in io | 4 Wochen | ,Tlnbehandeltes Saat gut in der benach barten Reihe |
80 M ' | |
erbi- | 0,672 | Verbin dung Nr. |
Behandeltes Saat gut |
10 Y | 2 Wochen 4 Wochen | 80 M | ||
zid | 0,672 | 0,5 | Mais | 2 Wochen | 20 V | 93 M | ||
EPTC | 0,672 | 22$ | 0,5 | Mais | 20 V | 85 M | ||
EPTC | 0,672 | 227 | 0,5. | Mais | 20 V | 93 M | ||
EPTC | 0,672 | 228 | o,5 | Mais | 40 V,M | 90 M | ||
EPTC | 0,672 | 229 | 0,5 | Mais | 40 V,M | 95 M | 60 M | |
EPTC | 0,672 | 23O | o,5 | Mais | 40 V,M | 0 | 88 M | |
EPTC | 0,672 | 23I | 0,5 | Mais | 40 V,M | 55 M | 60 M | |
EPTC | 0,672 | 232 | 0,5 | Mais | 0 | 10 Y | 70 M | 65 M |
EPTC | 0,672 | 233 | 0,5 | Mais | 30 V,M | 10 Y | 55 M | 45 M |
EPTC | 0,672 | 234 | 0,5 | Mais | 0 | 0 | 70 M | 65 M |
EPTC | 0,672 | 235 | 0,5 | Mais | 10 V | 10 V | 30 M | |
EPTC | 0,672 | 236 | 0,5 | Mais | 0 | 65 M | ||
EPTC | 0,672 | 237 | 0,5 | Mais | 0 | 75 μ | 55 M | |
EPTC | 0,672 | 238 | 0,5 | Mais | 30 V,M | 10 M | 80 M | 45 M |
EPTC | 0,672 | 239 | 0,5 | Mais | 50 V,M | 0 | 25 M | |
EPTC | - 240 | 0,5 | Mais | 0 | 45 M | |||
EPTC | 241 | 0 | ||||||
Herbi zid |
Anwendungs- verhältnis, g/m |
Gegenmittel | . Behandlungs verhältnis fo Gew./Gew. |
Getrei deart |
Schädigung in $ | Ünbehandeltes Saat gut in der benach barten Reihe |
|
EPTC | 0,672 | Verbin dung Nr. |
0,5 | Mais | Behandeltes Saat gut |
2 Wochen 4 Wochen | |
EPTC | 0,672 | 242 | 0,5 | Mais | 2 Wochen 4 Wochen | 50 M | |
EPTC | 0,672 | 245 | 0,5 | Mais | 50 V,M | 75 M 70 M | |
EPTC | 0,672 | 244 | 0,5 | Mais | 10 V,M 30 M | 20 M | |
EPTC | 0,672 | 245 | 0,5 | Mais | 0 | 28 M | |
O | EPTC | 0,672 | 246 | °»5 | Mais | 10 V | 8 M |
EPTC | 0,672 | 247 | 0,5 | Mais | 0 | 3 M | |
σι | EPTG | 0,672 | 248 | 0,5 | Mais | 10 V | 70 M |
~A | EPTC | 0,672 | 249 | 0,5 | Mais | 20 V | 70 M |
-Ji | EPTC | 0,672 | 250 | 0,5 | Mais | 10 V | 65 M |
CO O |
EPTC | 0,672 | 251 | 0,5 | Mais | 0 | 20 M |
EPTC | 0,672 | 252 | 0,5 | Mais | 0 | 15 M | |
EPTC | 0,672 | 253 | • 0,5 | Mais | 0 | 8 M | |
EPTC | 0,672 | 254 | 0,5 | Mais | 0 | 50 M | |
EPTC | O1672 | 255 | 0,5 | Mais | 5 M . | 5 M | |
EPTC | 0,672 | 256 | 0,5 | Mais | 0 | 15 M | |
EPTC | 0,672 | 257 | 0,5 | Mais | 0 | 70 M | |
258 | 0 | 10 M | |||||
0 | |||||||
Anwendungs- verhältnis g/m |
Gegenmittel | 0,5 | Getreide art |
Schädigung in | Unbehandeltes Saat gut in der benach barten Reihe |
|
Herbi zid |
0,672 | Verbin- Behandlungs dung verhältnis Hr, <$> Gew./Grew. |
0,5 | Behandeltes Saat gut |
||
0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | |||
EPTC | 0,672 | 259 | 0,5 | Mais | 2 Wochen 4 Y/ochen | 35 M |
EPTC | 0,672 | 260 | 0,5 | Mais | 0 | 15 M |
EPTC | 0,672 | 261 | 0,5 | Mais | 0 | 5 M |
EPTC | 0,672 | 262 | 0,5 | Mais | 0 | 55 M |
EPTC | 0,672 | 265 | 0,5 | Mais | 0 | 60 M |
EPTC | 0,672 | 264 | 0,5 | Maie | 10 M | 15 M |
EPTC | 0.672 | 265 | 0,5 | Mais | 0 | 70 M |
EPTC | 0,672 | 266 | 0,5 | Male | 0 | 50 M |
EPTO | 0,672 | 267 | 0,5 | Mais | 0 | 45 M |
EPTC | 0,672 | 268 | 0,5 | Mais | 0 | 3 M |
EPTC | 0,672 | 269 | 0,5 | Mais | 0 | 35 M |
0,672 | 270 | 0,5 | Mais | 0 | 33 M | |
EPTC | 0,672 | 271 | 0,5 | Mais | 0 | 20 M |
EPTC | 0,672 | 272 | Mais | 0 | 40 M | |
EPTC | 273 | Mais | 0 | 45 M | ||
EPTC | 274 | 0 | 35 M | |||
0 | ||||||
Herbi zid |
Anwendungs- verhältnis /m2 |
Gegenmittel | 0,5 | Getrei deart |
Schädigung in $ | Ünbehandeltes Saatgut in der benachbarten Reihe |
|
Verbin- Behandlungs- dung verhältnis Nr. $ Gew./Gew. |
0,5 | Behandeltes Saat gut |
2 Wochen 4 Wochen | ||||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 40 M | ||
EPTC | 0,672 | 275 | 0,5 | Mais | 0 | 40 M | |
EPTC | 0,672 | 276 | 0,5 | Mais | 0 | 35 M | |
is» | EPTC | 0,672 | 277 | 0,5 | Mais | 10 Y | 40 M |
(O | EPTC | 0,672 | 278 | 0,5 | Mais ■ | 0 | 33 M |
00 | EPTC | 0,672 | 279 | 0,5 | Mais | 0 | 50 M |
cn | EPTC | 0,672 | 280 | 0,5 . | Hais | 0 | 65 M |
•ν» , | EPTC | 0,672 | 281 | 0,5 | Mais | 0 | 38 M |
EPTC | 0,672 | 282 | 0,5 | Mais | 10 B | 80 M | |
O | EPTC | 0,672 | 283 | 0,5 | Mais | 0 | 35 M |
EPTC | 0,672 | 284 | 0,5 | Mais | 0 | 75 M | |
EPTC | 0,672 | 285 | 0,5 | Mais | 0 | 701M | |
EPTC | 0,672 | 286 ' | 0,5 | Mais, | 10 Y | 75 M | |
EPTC | 0,672 v | 287 | 0,5 ' | Mais | 10 Y | 35 M | |
EPTC | 0,672 | 288 | 0,5 | Mais | 10 Y | 35 M | |
EPTC | 0,672 | 289 | Mais | 0 | 50 M | ||
EPTC | 0,672 | 29O | Mais ' | 0 | 50 M : | ||
291 | 0 | ||||||
Anwendungs verhältnis g/m |
Gegenmittel | 0,5 | Getrei deart |
Schädigung in ' | 1° | |
Herbi zid |
0,672 | Verbin- Behandlungs dung verhältnis Kr. $ Gew./Gew. |
0,5 | Behandeltes Saat gut |
Unbehande1tes Saatgut in der be nachbarten Reihe |
|
0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 2 Wochen 4 Wochen | ||
EPTC | 0,672 | 292 | 0,5 | Mais | 0 | 30 M |
EPTC | 0,672 | 293 | 0,5 | Mais | 0 | 55 M |
EPTC | 0,672 | 294 | 0,5 | Mais | 0 | 60 M |
EPTC | 0,672 | 295 | 0,5 | Mais | 0 | 25 M |
EPTC | 0,672 | 296 | 0,5 | Mais | 0 | 15 M |
EPTC | 0,672 | 297 | 0,5 | Mais | 0 | 10 M |
EPTC | 0,672 | 298 | 0,5 | Mais | 0 | 5 M |
EPTC | 0,672 | 299 | 0,5 | Mais | 0 | 20 M |
EPTC | 0,672 | 300 | 0,5 | Mais | 0 | 0 |
EPTC | 0,672 | 301 | 0,5 | Mais | 0 | 23 M |
EPTC | 0,672 | 302 | 0,5 | Mais | 0 | 25 M |
EPTC | 0,672 | 303 | 0,5 | Mais | 0 | 15 M |
EPTC | 0,672 | 304 | 0,5 | Mais | 0 | 40 M |
EPTC | 0,672 | 305 | Mais | 0 | 35 M | |
EPTC | 306 | Mais | 0 | 15 M | ||
EPTC | 307 | 0 | 15 M | |||
Herbi zid |
Anwendungs- ■verhältnis g/m |
Gegenmittel | Behandlungs verhältnis % Gew./Gew. |
Getrei deart |
Schädigung in ' |
β/
7° |
|
0,672 | Verbin dung Hr. |
Behandeltes Saat gut |
ünbehandeltes Saatgut in der benachbarten Reihe |
||||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 2 Wochen 4 Wochen | ||
EPTC | 0,672 | 308 | 0,5 | Mais | ' 0 | 8 M | |
EPTC | 0,672 | 309 | 0,5 | Mais | 0 | 25 M | |
EPTC | 0,672 | 310 | 0,5 | Mais | 0 | 45 M | |
G? <ö |
EPTC | 0,672 | 311 | 0,5 | Mais | 0 | 30 M |
CD ■** |
EPTC | 0,672 | 312 | 0,5 | Mais | 0 | 70 M |
<n ^* |
EPTC | 0,672 | 313 | 0,5 | Mais | 0 | 65 M |
EPTC | 0,672 | 314 | 0,5' | Mais | 30 Y,M | 60 M | |
OO | EPTC | 0,672 | 315 | 0,5 | Mais | 50 M | 70 M |
O | EPTC | 0,672 | 316 | 0,5 | Mais | 0 | 0 |
EPTC | 0,672 | 317 | 0,5 | Mais | 0 | • 70 M | |
EPTC | 0,672 | 318 | 0,5 | Mais | 30 V,M | 60 M | |
EPTC | 0,672 | 319 | 0,5 | Mais | 30 Υ,Μ | 60 M | |
EPTC | 0,672 | 320 | 0,5 | Mais | 0 | 0 | |
EPTC | 0,672 | 321 | 0,5 | Mais | 0 | 65 M | |
EPTC | 322 | 0,5 . | Mais | 10 V | 10 M | ||
323 | 10 Y | 40 M | |||||
Anwendungs- verhältnis g/m |
Gegenmittel | ■ Behandlungs- verhältnis io Gew./Sew. |
Getrei deart |
Schädigung in % | Ünbehandeltes Saatgut in der benachbarten Reihe |
|
Herbi zid |
0,672 | Verbin dung Nr. |
Behandeltes Saat gut |
2 Wochen 4 Wochen | ||
0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 75 M | ||
EPTC | 0,672 | 524 | 0,5 | Mais | 60 M | 80 M |
EPTG | 0,672 | 525 | 0,5 | Mais | 60 M | 70 M |
EPTC | 0,672 | 526 | 0,5 | Mais | 20 V | 75 M |
EPTC | 0,672 | 527 | 0,5 | Mais | 50 Y,M | 75 M |
EPTC | 0,672 | 328 | 0,5 | Mais | 60 V,M | 60 M |
EPTC | 0,672 | 529 | 0,5 | Mais | 0 | 65 M |
EPTC | 0,672 | 550 | 0,5 | Mais | 30 ?,M | 70 M |
EPTC | 0,672 | 551 | 0,5 | Mais | 10 V | 5 M |
EPTC | 0,672 | 552 | 0,5 | Mais | 0 | 15 M |
EPTC | 0,672 | 555 | 0,5 | Mais | 0 | 23 M |
EPTC | 0,672 | 534 | 0,5 | Mais | 0 | 35 M |
EPTC | 0,672 | 355 | 0,5 | Mais | 20 V,B | 30 M |
EPTC | 0,672 | 556 | 0,5 | Mais | 95 ν | 5 M |
EPTC | 0,672 | 337 | 0,5 ■ | Mais | 0 | 60 M |
EPTC | 358 | 0,5 | Mais | 0 | 75 M | |
EPTC | 559 | 30 M | ||||
Anwendunge- .verhältnis g/m |
Gegenmittel |
Behandlungs
verhältnis i» Gew./Gew. |
Getrei deart |
Schädigung in % | Unbehandeltes Saatgut in der be> nachharten Reihe |
|
Herbi zid |
0,672 | Verbin dung Nr. |
Behandeltes Saat gut |
2 Wochen 4 Wochen | ||
0,672 | 0,5 | Hals | 2 Wochen 4 Woohen | 25 M | ||
EPTC | 0,672 | 540 | 0,5 | Mais | 0 | 50 M |
EPTC | 0,672 | 541 | 0,5 | Mais | 0 | BOM |
EPTC | 0,672 | 542 | 0,5 | Mais | 60 M | 45 M |
EPTC | 0,672 | 545 | 0,5 | Mais | O | 75 M |
EPTC | 0,672 | 544 | 0,5 | Mais | 10 V | 75 M |
EPTC | 0,672 | 545 | 0,5 | Mais | 0 | 65 M |
EPTC | 0,672 | 546 | 0,5 | Mais | 10 Y | 80 M |
EPTC | 0,672 | 547 | o,5 | Mais | 50 Υ,Μ | 65 M |
EPTC | 0,672 | 548 | o»5 ' | Mais | 0 | '75 M, ' |
EPTC | 0,672 | 549 | 0,5 | Mais | 60 Υ,Μ | 80 M |
EPTC | 0,672 | 550 | .0,5 | Mais | 60 M | 75 M . |
EPTC | 0,672 | 551 | 0,5 | Mais | 60 V,M | 80 M |
EPTC | 0,672 | ■ 552 | 0,5 | Mais | 60 Υ,Μ | 75 M |
EPTC | 0,672 | 555 | 0,5 . | Mais | 60 Υ,Μ | 80 M |
EPTC | 554 | " 0,5 | Mais | 50 Υ,Μ | 70 M | |
EPTC | 555 : | 60 Υ,Μ | ||||
Anwendungs verhältnis ff/m |
Gegenmittel | Behandlungs verhältnis fo Gew./Gew. |
Getrei deart |
Schädigung in io | ■ Unbehandeltes Saatgut in der be· nachbarten Reihe |
|
Herbi zid |
0,672 | Verbin dung Hr. |
Behandeltes Saat gut |
2 Wochen 4 Wochen | ||
0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 70 M | ||
EPTC | 0,672 | 356 | 0,5 | Mais | 50 Y,B | 80 M |
EPTC | 0,672 | 357 | Q,5 | Mais | 60 M | 75 M |
EPTC | 0,672 | 358. | 0,5 | Mais | 30 γ | 75 M |
EPTC | 0,672 | " 359 | 0,5 | Mais | 30 V,M | 70 M |
EPTC | 0,672 | 360 | 0,5 | Mais | 50 Υ,Μ | 75 M |
EPTC | 0,672 | 361 | 0,5 | Mais | 50 Υ,Μ | 75 M |
EPTC | 0,672 | 362 | 0,5 | Mais | 30 ν | 80 M |
EPTC | 0,672 | 363 | 0,5 | Mais | 30 V,M | 55 M |
EPTC | 0,672 | 364 | 0,5 | Mais | 10 Y | 65 M |
EPTC | 0,672 | 365 | 0,5 | Mais | 50 V,M | 65 M |
EPTC | 0,672 | 366 | 0,5 | Mais | 0 | 75 M |
EPTC | 0,672 | 567 | 0,5 | Mais | 0 | 30 M |
EPTC | 0,672 | 368 | 0,5 | Mais | 0 | 25 M |
EPTC | 0,672 | 369 | 0,5 | Mais | 0 | 80 M 80 M |
EPTC | 370 | 0,5 | Mais | 70 B 70 M | 85 M 80 M | |
EPTC | 371 | 40 V 50 M | ||||
• | Herbi zid ■ |
Anwendungs verhältnis g/m |
Gegenmittel | 0,5 | Getrei deart |
Schädigung in io | V | 4 Wochen | Unbehandeltes Saat gut in der benach barten Reihe |
80 M |
.0,672 | Verbin- Behandlungs dung Verhältnis Nr. <fo Gew./Gew. |
0,5 | Behandeltes Saat gut |
V,M, B |
40 V,M | 2 Wochen ^ Wochen | ||||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen | M | 80 M | ||||
EPTC | 0,672 | 572 | 0,5 | Mais | 50 | V,B | 75,M | 80 M | ||
EPTC | 0,672 | 575. | 0,5 | Mais | 50 | M : | 50 M | 85 M | ||
EPTC | 0,672 | 574 | 0,5 | Mais | 60 | V,M | 90 M : | |||
O co |
EPTC | 0,672 | 575 | 0,5 | Mais | 50 | M | 90 M . | ||
CO. | EPTC | 0,672 | 576 | 0,5 | Mais | 50 | M | 70 M | ||
EPTC | 0,672 | 577 | 0,5 | Mais | 40 | V | 80 M ■ | |||
EPTC | 0,672 | 578 | '· 0,5 | Mais | 80 | V | 20 M | 85 M. | 8OM | |
»', | EPTC | 0,672 | 579 | 0,5 . | Mais | 5Ö | M | 40 M | 90 M | |
ο' ■ | EPTC | 0,672 | 580 | 0,5 | Mais , | 10 | V,B | 85 M | 80 M | |
EPTC | 0,672 | 581 | 0,5 | Mais | 50 | V | 50 V | 80 M | 80. M | |
EPTC | 0,672 | 582 | 0,5 | Mais , | 50 | M | 10 V V.1 | 90 M | ||
EPTC- | 0,672 | 585 | 0,5 | Mais. | 50 | V | 70 M | |||
EPTC - | 0,672 | 584 | 1 0,5 ' , | Mais | 20 | M | 50 M | 85 M | ||
EPTC | .. 0,672 | 585 | Mais | 60 | 75 M | |||||
EPTC | 586 | Mais | 10 | 80 M | ||||||
587 | 60 | |||||||||
Herbi- | Anwendungs- verhältnis / 2 |
Gegenmittel | 0,5 | Getrei- Λ α ο T*^r |
Schädigung in % | Unbehandeltes Saat gut in der benach barten Reihe |
M | |
g/m | Yerbin- Behandlungs- dung verhältnis ITr. fo Gew./Gew. |
0,5 | utiaX ϋ | Behandeltes Saat gut |
2 Wochen' 4 Wochen | M | ||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 55 | M | ||
EPTC | 0,672 | 388 | 0,5 | Mais | 100 K | 75 | M | |
BPTC | 0,672 | 389 | 0,5 | Mais | 10 V 0 | 80 | M | |
tv/ | EPTC | 0,672 | 390 | 0,5 | Mais | 15 Y,M | 80 | M |
co | EPTC | 0,672 | 391 | 0,5 | Mais | 10 V 0 | 75 | M |
co Jf- |
EPTC | 0,672 | 392 | 0,5 | Mais | 60 Y,M | 80 | M |
-*·» | EPTC | 0,672 . | 393 | 0,5 | Mais | 60 M | 80 | M |
EPTC | 0,672 | 394 | 0,5 | Mais | 50 Y,M | 65 | M | |
co | EPTC | 0,672 | 395 | 0,5 | Mais | 10 V 10 M | 75 | M |
EPTC | 0,672 | 396 | 0,5 | Mais | 10 Y 0 | 60 | M | |
EPTC | 0,672 | 397 | 0,5 | Mais | 10 Y 20 M | 80 | M | |
EPTC | 0,672 | 398 | 0,5 | Mais | 60 M | 80 | M | |
EPTC | 0,672 | 399 | 0,5 | Mais | 60 M | 75 | M | |
EPTC | 0,672 | 400 | ο,5 | Mais | 60 M | 80 | M | |
EPTC | 0,672 | 401 | Mais | 60 M | 75 | |||
EPTC | 0,672 | 402 | Mais | 40 Y,M | 80 | |||
403 | 60 Y1M | |||||||
Anwendungs- ■verhältnis g/m |
Gegenmittel | Behandlungs verhältnis fo Gew./Gew. |
Getrei- | Schädigung in fo | kochen 4 Wochen | Unbehandeltes Saatgut in der be nachbarten Reihe |
|
Herbi zid |
0,672 | Verbin dung Nr. |
d e ar t | Behandeltes Saat gut |
M | . 2 Wochen 4 Wochen | |
0,672 | 0,5 | Mais | 2 \ | M | 80 M | ||
EPTC | 0,672 | 404 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 | 405 | 0,5 | Mai s" | 70 | M | 80 M |
EPTC | 0,672 | 406 | , 0,5 | Mais . . | 70 | 1M | 80 M |
EPTC | 0,672 | 407 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 . | 4O8 | 0,5 | Mais | 70 | M | 80 M, |
EPTC | . 0,672 | 409 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 | 410 | 0,5 | Mais | 70 | M | 80. M |
EPTC | 0,672 | 411 | 0,5 | Mais | 60 | M | 80 M, |
EPTC | 0,672 | 412 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 | 415 | 0,5 | Mais | 70 | M | 80 M |
EPTC ■ | 0,672 | 414 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 | 415 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 | 416 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 0,672 | 417 | 0,5 | Mais | 60 | M | 80 M |
EPTC | 0,672 | 418 | 0,5 | Mais | 70 | M | 80 M |
EPTC | 419 | 0,5 | Mais | 70 | 80 M | ||
üiPTC | 420 | 70 | |||||
zid | Anwendungs- | Gegenmittel | verhältnis io Gew./Gew. |
Getrei | Schädigung in % | TJnbehandeltes Saat | |
verhältnis g/m |
Verbin- Behandlungs | deart | Behandeltes Saat | gut in der benach barten Reihe |
|||
EPTC | 0,672 | dung Nr. |
0,5 | Mais | gut | 2 Wochen 4 Wochen | |
EPTC | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 80 M | ||
EPTC | 0,672 | 421 | 0,5 ' | Mais | 70 M | 80 M | |
EPTC | 0,672 | 422 | 0,5 | Mais | 70 M | 80 M | |
K? O |
EPTC | 0,672 | .423 | 0,5 | Mais | 70 M | 80 M |
EPTC | 0,672 | 424 | 0,5 | Mais | 70 M | 80 M | |
OO | EPTC | 0,672 | 425 | 0,5 | Mais | 70 M | 75 M |
cn ■■«. |
EPTC | 0,672 | 426 | 0,5 | Mais | 60 V,M | 75 M |
-· | EPTC | 0,672 | 427 | 0,5 | Mais | 70 M | 75 M |
00 | EPTC | 0,672 | 428 | 0,5 | Mais | 70 M | 80 M |
O | EPTC | 0,672 | 429 | 0,5 | Mais | 70 V,M | 75 M |
EPTC | 0,672 | 430 | 0,5 | Mais | 70 V,M | 80 M | |
EPTC | 0,672 | 431 | .0,5 | Mais | 70 V,M | 80 M | |
EPTC | 0,672 | 432 | 0,5 | Mais | 70 V,M | 80 M | |
-EPTC | 0,672 | 433 | 0,5 | Mais | 70 M | 80 M | |
EPTC | 0,672 | 434 | 0,5 | Mais | 70 V,M | ■75 M | |
435 | 70 M | 75 M | |||||
436 | 60 V,M | ||||||
Herbi zid |
Anwendungs verhältnis g/m |
Gegenmittel | 0,5 | Getrei deart |
Schädigung in $ | TJnbehandeltes Saat gut in der benach barten Eeihe |
|
EPTC | 0,672 | Yerbin- Behandlungs dung verhältnis Nr. fo Gew,/Gew. |
0,5 | Mais | Behandeltes Saat gut |
2 Wochen 4 Wochen | |
EPTC | 0,672 | 457 | 0,5 | Mais | 2 Wochen 4 Wochen | 75 M | |
EPTC | 0,672 | 458 | 0,5 | Mais | 50 Υ,Μ | 80 1 , | |
EPTC | 0,672 | 459 | 0,5 | Mais | 70 V,M | 75 M | |
M O |
EPTC | 0,672 | 440 | 0,5 | Mais | 20 Y | 65 M |
<ö | EPTC | 0,672 | 441 | 0,5 | Mais | 10 V | 75 M |
OO | EPTC | 0,672 | 442 | 0,5 | Mais | 50 V | 70 M |
in | EPTC | 0,672 | 445 | 0,5 | Mais | 10 V | 80 M |
—* | EPTC | 0,672 | 444 | 0,5 | Mais | 10 Y | 65 M |
EPTC | 0,672 | 445 | 0,5 | Mais | 10 Y | 75 M | |
Q | EPTC | 0,672 | 446 | 0,5 | Mais | 70 M | 65 M |
EPTC | 0,672 | 447 | 0,5 | Mais | 20 V | 80 M | |
EPTC | 0,672 | 446 | 0,5 | Mais | 60 M | 70 M | |
EPTC | 0,672 | 449 | 0,5 | Mais | 50 V,M | 80 M | |
EPTC | 0,672' | 450 | Mais | 70 M | 80 M | ||
451 | 60 Υ,Μ | 70 M | |||||
20 V | |||||||
Herbi zid |
Anwendungs verhältnis g/m |
Gegenmittel | 0,5 | Getrei deart |
Schädigung | in io | |
0,672 | Verbin- Behandlungs- dung ■ verhältnis Sr. $ Gew./Gew. |
0,5 | Behandeltes gut |
Saat- Unbehandeltes Saat· gut in der benach barten Reihe |
|||
EPTC | 0,672 | 0,5 | Mais | 2 Y/ochen 4 | Wochen 2 Wochen 4 kochen | ||
EPTC | 0,672 | 452 | 0,5 | Mais | 70 V,M | 80 M | |
EPTC | 0,672 | 453 | 0,5 | Mais | 20 V | 60 M | |
EPTC | 0,672 | 454 | 0,5 | Mais | 70 M | 75 M | |
O CO |
EPTC | 0,672 | 455 | 0,5 | Mais | 20 V | 65 M |
SO *>» |
EPTC | 0,672 | 456 | 0,5 | Mais | 60 V,M | 75 M |
EPTC | 0,672 | 457 | 0,5 | Mais | 70 V,M | 80 M | |
EPTC | 0,672 | 458 | 0,5 | Mais | 50 V,M | 70 M | |
co | EPTC | 0,672 | 459 | 0,5 | Mais | 40 T,M | 80 M |
O | EPTC | 0,672 | 460 | 0,5 | Mais | 60 V,M | 80 M |
EPTC | 0,672 | 461 | 0,5 | Mais | 10 V | 80 M | |
EPTC | 0,672 | 462 | 0,5 | Mais | 30 V,M | 75 M | |
EPTC | 0,672 | 463 | 0,5 . | Mais | 70 M | 80 M | |
EPTC | 0,673 | 464 | Mais | 70 M | 80 M | ||
EPTC | 465 | Mais | 50 V,M | 80 M | |||
466 | 20 V,M | 70 M | |||||
Herbi zid |
Anwendungs- verhältnis g/m |
Gegenmittel | - Behandlungs- verhältnis 'fo Gew./Gew. |
Getrei | Schädigung in $ | Unbehandeltes Saat· gut in der benach barten Reihe |
M | |
0,672 | Verbin dung Nr. |
deart | Behandeltes Saat gut |
2 Wochen 4 Wochen | M | |||
EPTC | 0,672 | 0,5 | Mais | 2 Wochen 4 Wochen | 75 | M | ||
EPTC | 0,672 | 467 | 0,5 | Mais | 0 | 80 | M | |
EPTC | 0,672 | 468 | 0,5 | Mais | 60 V,M | 80 | M | |
NJ | EPTC | 0,672 | 469 | 0,5 | Mais | 10 V | 75 | M |
CD to |
EPTC | 0,672 | 470 | 0,5 | Mais | 60 M | 65 | M |
CO 4?* |
EPTC | 0,672 | 471 | 0,5 | Mais | 50 V,M | 25 | M |
CH | EPTC | 0,672 | 472 | 0,5 | Mais | 20 V,M | 80 | M |
—4 | EPTC | 0,672 | 473 | 0,5 | Mais | 70 M | 80 | M , |
ΛΜθΛ
CO |
EPTC | 0,672 | 474 | 0,5 | Mais | 70 M | 70 | M |
O | EPTC | 0,672 | 475 | 0s5 | Mais | 20 V,M | 75 | M |
EPTC | 0,672 | 476 | 0,5 | Mais | 10 V | 80 | M | |
EPTC | 0,672 | 477 | 0,5 | Mais. | 30 V,M | 80 | M | |
EPTC | 0,672 | 478 | 0,5 ' . | Mais | 20 Y,M | 80 | M | |
EPTC | 0,672. | 479 | . 0,5 | Mais | 60-V,M | 80 | M | |
■ . EPTC | 0,672 . | 480 | 0,5 | Mais | 70 V,M | 80 | ||
EPTC | 481 | 0,5 | Mais | 70 M | 80 | |||
482 | 60 V,M | |||||||
Anwendungs verhältnis g/m |
Gegenmittel | 0,5 | Mais | Schädigung in io | ι 4 Y/ochen | Unbehandeltes Saat gut in der benach barten Reihe |
70 M | I | 85 M | |
Herbi zid |
0,672 | 0,5 | Mais | Behandeltes Saat gut |
2 Wochen 4 Wochen | 70 M | 75 M | |||
0,672 | Verbin- Behandlungs dung verhältnis Getrei- Nr. <fo Gew./Gew. deart |
0,5. | Mais | 2 Wocher | 80 M | 98 M | ||||
EPTC | 0,672 | 0,5 | Mais | 70 V,M | 7.5 M | |||||
EPTC | 0,672 | 483 | 0,5 | Mais | 60 M | 80 M | ||||
EPTC | 0,672 | 484 | 0,5 | Mais | 70 M | 25 M | ||||
EPTC | 0,672 | 485 | 0,5 | Mais | 10 V | 40 M | ||||
EPTC | 0,672 | 486 | 0,5 | Mais | 10 V | 55 M | ||||
EPTC | 0,672 | 487 | 0,5 | Mais | 50 V,M | 30 ν | 0 | |||
EPTC | 0,672 | 488 | 0,5 | Mais | 0 | 50 V5M | 70 | |||
EPTC | 0,672 | 489 | 0,5 | Mais | 10 V | 75 V,M | 70 | |||
EPTC | 0,672 | 490 | 0,5 | Mais | 20 | 80 M | ||||
EPTC | 0,672 | 491 | 0,5 | Mais | 50 | 50 ν,Μ | 80 V5I | |||
EPTC | 0,672 | 492 | 0,5 | Mais | 40 V,M ■ | 0 | 75 Μ | |||
EPTC | 0,672 | 493 | 0,5 | Mais | 0 | 60 ν,Μ | 77 M | |||
EPTC | 0,672 | 494 | 0,5 | Mais | 10 V | 95 M | ||||
EPTC | 0,672 | 495 | 30 V,M | 98 M | ||||||
EPTC | 496 | 50 M | 97 M | |||||||
EPTC | 497 | 30 ν,Μ | ||||||||
498 | ||||||||||
Herbi | Anwendungs- | Gegenmittel | verhältnis | Getrei | Schädigung in $» | 4 Y/ochen | Ünbehandeltes Saat· | der benach- | 97 M | |
zid | verhältnis | Verbin- Behandlungs- | fo Gew./Gew. | deart | Behandeltes Saat | gut in | Reihe | 70 | ||
g/m | dung | gut | 20 Y | barten | 2 Wochen 4 Wochen | 60 M | ||||
EPTC | 0,672 | Nr. | 0,5 | Mais | 20 Y | 98 M | 40 M ' | |||
- EPTC | 0,672 | 0,5 | Mais | 2 V/ochen | 100 K | 78 M | 30 M | |||
SPTC | 0,672 | 499 | . 0,5 | Mais | 60 M | 100 K | 50 M | 0 | ||
EPTC ' | 0,672 | 500 | 0,5 | Mais | 10 Y | 0 | 55 M | |||
ΙΌ | EPTC | 0,672 | 501 | 0,5 | Mais | 10 Y | 30 V | 30 M | ||
Ö | EPTC | 0,672 | 502 | 0,5 | Mais | 100 K | 25 M | 5 M | ||
tO 09 |
EPTC | 0,672 | 503 | 0,5 | Mais | 100 K ■ | 0 | |||
4> ' O"I |
EPTC | 0,672 | 504 | 0,5 | Mais | 0 | 58 M | 94 | ||
EPTC | 0,672 | 505 | 0,5 | Mais | 30 Y | 65 M | 50 M | |||
.1 | EPTC | 0,672 | 506 | 0,5 | Mais | 10 Y . | 0 | 78 M | 0 | |
3D O |
EPTC | 0,672 | 507 | 0,5 | Mais | 20 Y,M | 100 K | 89.M | 0 | |
EPTC | 0,672 | 508 | 0,5 | Mais | 10 V | 100 K | 84 M | |||
EPTC | 0,672 | 509 | 0,5' | Mais | 40 Y,M | 100 K | 45 M | |||
EPTC | 0,672 | 510 | 0,5 | Mais | 0 | 0 | ||||
EPTC | 0,672 | 511 | 0,5 | Mais | 100 K | o ■ | ||||
512 | 100 K | |||||||||
513 | 100 K | |||||||||
O
CO
03
thi ο1c art ama t | 0 | ,112 |
EPTC + | 0 | ,672 + |
2-Chlor-4-äthyl- amino-6-isopropyl- amino-s-triazin |
0 | ,112 |
EPTC + | 0 | ,672 + |
iazin | 0,112 | + | 6 | 0,01 | Mais | 0 | 0 |
EPTC + 2,4-D |
0,672 0,112 |
+ | 6 | 1,0 | Mais | 0 | 0 |
EPTC + 2,4-D |
0,672 0,112 |
6 | 0,01 | Mais | 0 | 0 | |
O | 2-yl-amino)-2- | 0,112 |
CD | methylpropioni- | |
tril | 0,672 + | |
trt | S~Propyldipropyl- | |
thiolcarbamat ■*■ | ||
«■A «■& |
2-Chlor-4-cyclo- | |
SS | propy!amino-6- | 0,112 |
CD | isopropylamino- | |
s-triasin | 0,672 + | |
S-Propyldipropyl- | ||
thiolcarbamat + | ||
2-Chlor-4-cyclo- | ||
propylamino-6-iso- | 0,112 | |
propylamino-s- | ||
triazin | ||
deart
fo Gew./Gew. deart
S^Äthyldiisobutyl- thiolcarbamat + 2-Chlor-4-cyclo- propylamino-6-iso- propylamirio-Srtri*· azin ■ |
0,896 + 0,112 |
6 | 1,0 | Mais | 2 Wochen | 4 Woch | |
2098' | S-Äthyldiisobutyl- thiol-carbamat + 2-Chlor-4-cyclo*- propylamino-6-iso- propylamino-s- triazin |
0,896 + 0,112 |
6 | 0,01 | Mais | 0 | 0 |
15/Ί180 | S-Äthyldiisobutyl- thiolcarbamat + 2,4-D |
0,896 -ί- 0,112 |
β | 1,0 | Mais | 0 | 0 |
S-Äthyldiisobutyl- thiolcarbamat .+ 2,4-D |
0,896 -ι- Ο,112 |
6 | 0,01 | Mais . | 0 | 0 | |
S-Äthyldiisobutyl- thiolcarbamat |
0,896 | 6 | 1,0 | Mais | 0 , | 0 | |
0 | 0 | ||||||
gut Saatgut in der
benachbarten
Reihe
Claims (10)
- Patentansprüche:in der R einen Halogenalkyl-, Halogenalkenyl-, Alkyl-, Alkenyl-, Cycloalkyl- oder einen Cycloalkylalkylrest, ein Halogenatom oder ein Wasserstoffatom, einen Carboalkoxy-, N-Alkenylcarbamylalkyl-, N-Alkenylcarbamyl-, N-Alkyl-N-alkinylcarbamyl-, N-Alkyl-N-alkinylcarbamylalkyl-, N-Alkenylcarbamyl alkoxy alkyl- , N-Alkyl-N-alkinylcarbamylalkoxyalkyl-, Alkinoxy-, Halogenalkoxy-, Thiocyanatoalkyl-, Alkenylaminoalkyl-, Alkylcarboalkyl-, Cyanoalkyl-, Cyanatoalkyl-, Alkenylamxnosulfonoalkyl-, Alkylthioalkyl-, HaIogenalkylcarbonyloxyalkyl-, Alkoxycarboalkyl-, Halogenalkenyl·· carbonyloxyalkyl-, Hydroxyhalogenalkyloxyalkyl-, Hydroxyalkyl carbοalkoxyalkyl-, Hydroxyalkyl-, Alkoxysulfonoalkyl-, Furyl-, Thienyl-, Alkyldithiolenyl-, Thienalkyl- oder einen Phenylrest oder einen durch Halogenatome, Alkyl-, Halogenalkyl-, Alkoxy-,, Carbamyl- oder Nitroreste, Carbonsäurereste und deren Salze oder Halogenalkylcarbamylreste substituierten Phenylrest, einen Phenylalkyl-, Phenylhalogenalkyl- oder einen Phenylalkenylrest oder einen durch Halogenatome, Alkyl- oder Alkoxyreste substituierten Phenylalkenylrest, einen Halogenphenoxy-, Phenylalkoxy-, Phenylalkylcarboxyalkyl-, Phenylcycloalkyl-, Halogenphenylalkenoxy-, Halogenthiophenylalkyl-, Halogenphenoxyalkyl-,ng 2g 09845/1180Bicycloalkyl-, Alkenylcarbamylpyridinyl-, Alkinylcarbamylpyridinyl-, Dialkenylcarbamylbicycloalkenyl- oder einen Alkinylcarbamylbicyeloalkenylrest bedeutet, R und R gleich oder verschieden sein und jeweils Alkenyl- oder Halogenalkenylreste, Wasserstoffatome, Alkyl-, Halogenalky 1-, Alkinyl-, Cyanoalkyl-, Hydroxyalkyl-, Hydroxyhalogenalkyl-, Halogenalkylcarboxyalkyl-, Alkylcarboxyalkyl-, Alkoxycarboxyalkyl-, Thioalkylcarboxyalkyl-, AIkoxycarboalkyl-, Alkylcarbamyloxyalkyl-, Amino-, Formyl-, Halogenalkyl-N-alkylamido-, Halogenalkylamido-, Halogenalky lamidoalkyl-, Halogenalkyl-N-alkylamidoalkyl-, HaIogenalkylamidoalkenyl-, Alkylimino-, Cycloalkyl-, Alkylcycloalkyl-, Alkoxyalkyl-, Alkylsulfonyloxyalkyl-, Mercaptaalkyl-, Alkylaminoalkyl-, Alkoxycarboalkenyl-, HaIogenalkylcarbonyl-, Alkylcarbonyl-^ Alkenylcarbamyloxyalkyl-, Cycloalkylcarbamyloxyalkyl-, Alkoxycarbonyl-, Halogenalkoxycarbonyl-, Halogenphenylcarbamyloxyalkyl-, Cycloalkenyl- oder Phenylreste oder durch Alkylreste, Halogenatome, Halogenalkyl-, Alkoxy-, Halogenalkylamido-, Phthalamido-, Hydroxy-, Alkylcarbamyloxy-, Alkenylcarbamyloxy-, Alkylamirio-, Halogenalkylamido- oder Alkylcarboalkenylreste substituierte Phenylreste, Phenylsulfonyl- oder Phenylalkylreste oder durch Halogenatome, Alkyl-, Dioxyalkylen- oder Halogenphenoxyalkylamidoalkylreste substituierte Phenylalkylreste, Alkylthiodiazolyl-, Piperidylalkyl-, Thiazolyl-, Alkylthiazolyl-, Benzothiazolyl-, Halogenbenzothiazolyl-, oly--, Ben· -, , Purylalkyl-, Pyridyl-, Alkylpyridyl-, Alkyloxazolyl-, Tetrahydrofurylalkyl-, 3-Cyano-4,5-polyalkylen-thienyl-, a-Halogenalkylacetamidophenylalkyl-, a-Halogenalkylacetamidonitrophenylalkyl-, a-Halogenalkylacetamidohalogenphenylalkyl-, oder Cyano-20984H2210097alkenylreste bedeuten können oder auch R1 und R zusammen mit dem Stickstoffatom einen Piperidinyl-, Alkylpiperidinyl-, Alkyltetrahydropyridyl-, Morpholyl-, Alkylmorpholyl-, Azobicyclononyl-, Benzoalkylpyrrolidinyl-, Oxazolidyl-, Alkyloxazolidyl-, Perhydrochinolyl- oder Alkylaminoalkenylrest bilden können, wobei Rp kein Wasserstoffatom oder Halogenphenylrest ist, wenn R1 ein Wasserstoffatom darstellt.
- 2. Herbizides Mittel nach Anspruch 1, dadurch gekennzeichnet, daß es ein Gegenmittel der Formel enthält, worin R ein Wasserstoffatom, ein Halogenatom, einen Alkyl-, Halogenalkyl-, Cycloalkyl-, Cycloalkylalkyl-, Alkenyl-, Halogenalkenyl-, Halogenalkoxy-, Alkinoxy-, Hydroxyalkyl-, Alkylthioalkyl- oder einen Hydroxyhalogenalkoxyalkylrest bedeutet und R1 und R? gleich oder verschieden sein und jeweils Wasserstoffatome, Alkyl-, Halogenalkyl-, Alkenyl-, Halogenalkenyl-, Alkinyl-, Hydroxyalkyl-, Hydroxyhalogenalkyl-, Cycloalkyl-, Alkylcycloalkyl-, Alkoxyälkyl- oder Cycloalkenylreste bedeuten können, wobei R? kein Wasserstoffatom ist, wenn R1 ein Wasserstoffatom darstellt.
- 3. Herbizides Mittel nach Anspruch 1, dadurch gekennzeichnet, daß es ein Gegenmittel der Formel enthält, worin R einen Halogenalkylrest bedeutet und R1 und Rp zusammen mit dem Stickstoffatom einen Piperidinyl-, Alkylpiperidinyl-, Alkyltetrahydropyridyl-, Morpholyl-, Alkylmorpholyl-, Azabicyclononyl-, Benzoalkylpyrrolidinyl-, Oxazolidyl-, Alkyloxazolidyl-, Perhydrochinolyl oder einen Alkylaminoalkenylrest bilden können.2 0 9 8 U F, / 1 1 P- um - ■
- 4. Herbizide^Mittel nach Anspruch 1, dadurch gekennzeichnet, daß es ein Gegenmittel der Formel enthält, worin R einen Phenylrest oder einen durch Halogenatome, ALkyl-, Halogenalkyl-, Alkoxy- oder Nitroreste, Carbonsäuren und deren Salze oder Carbamyl- oder Halogenalkylcarbamylreste substituierten Phenylrest, einen Phenylalkyl-, Phenylhalogenalkyl- oder einen Phenylalkenylrest oder einen durch Halogenatome, Alkyl- oder Alkoxyreste substituierten Phenylalkenylrest, einen Halogenphenoxy-, Phenylalkoxy-, Phenylalkylcarboxyalkyl-, Phenylcycloalkyl-, Halogenphenylalkenoxy-, Halogenthiophenylalkyl- oder einen Halogenphenoxyalkylrest bedeutet und R. und R2 gleich oder verschieden sein und jeweils Wasserstoffatome, Alkyl- , Alkenyl- oder Alkinylreste bedeuten können, wobei R kein Wasserstoffatom ist, wenn R- ein Wasserstoffatom darstellt.
- 5. Herbizides Mittel nach Anspruch 1, dadurch gekennzeichnet, daß es ein Gegenmittel der Formel enthält, worin R einen N-Alftenylcarbamylalkyl-, N-Alkenylcarbamyl-, N-Alkyl-N-alkinylcarbamyl-, N-Alkyl-N-alkinylcarbamylalkyl-, N-Alkenylcarbamylalkoxyalkyl-, N-Alkyl-N-alkinylcarbamyl- alkoxyalkyl-, Dialkenylcarbamylbicycloalkenyl- oder einen Alkinylcarbamylbicycloalkehylrest bedeutet und R^ und Rp gleich oder verschieden sein und jeweils Wasserstoffatome, Alkyl-j Alkenyl- oder Alkinylreste bedeuten können, wobei Rp kein Wasserstoffatom ist, wenn R^ ein Wasserstoffatom' darstellt.
- 6. ' Herbizides Mittel nach Anspruch I5 dadurch gekennzeichnet, daß es ein Gegenmittel der Formel enthält, worin R einen Halogenalkylrest odver ein Wasserstoffatom bedeutet und R1 und R? gleich oder verschieden sein und jeweils209845/Π 80/ίαAlkyl- oder Alkenylreste, Wasserstoffatome, Alkoxyalkyl- oder Phenylreste oder durch Alkylreste, Halogenatome, Halogenalkyl-, Alkoxy-, Halogenalkylamido-, Pthalamido-, Hydroxy-, Alkylcarbamyloxy-, Alkenylcarbamyloxy-, Alkylamido-, Halogenalkylamido oder Alkylcarboalkenylreste substituierte Phenylreste, PhenyIaIkAHyIreste oder durch Halogenatome, Alkyl-, Dioxyalkylen- oder Halogenphenoxyalkylamidoalkylreste substituierte Phenylalkylreste bedeuten können s wobei R- kein Wasserstoffatom ist, wenn R1 ein Wasserstoffatom darstellt.
- 7. Herbizides Mittel nach Anspruch 1, dadurch gekennzeichnet, daß es ein Gegenmittel der Formel enthält, worin R einen Halogenalkyl-, Alkyl-, Cyanoalkyl-, Thiocyanatoalkyl-, Cyanatoalkyl-, Cycloalkyl-, Bicycloalkyl-, Halogenphenyl-, Phenylalkenyl- oder einen Halogenphenylalkenylrest bedeutet und R. und R gleich oder verschieden sein und jeweils Cyanoalkylreste, Wasserstoffatome, Alkenyl- oder Alkylreste bedeuten können, wobei Rp kein Wasserstoffatom ist, wenn R1 ein Wasserstoffatom darstellt.
- 8. Herbizides Mittel nach einem der Ansprüche 1 bis 7, dadurch gekennzeichnet, daß es als herbiziden Wirkstoff S-Ä'thyl-NsN-dipropylthiolcarbamat, S-Äthyldiisobutylthiolcarbamat, S-Propyldipr-opylthiolcarbamat, S-2 ,3,3-Trichlorallyl-diisopropylthiolcarbamat, S-Ä'thylcyclohexyläthylthiocarbamat, 2-Chlor-2' ,ö'-diäthyl-N-imethoxymethyD-acetanilid, S-A'thylhexahydro-lH-azepin-1-carbothioat, 2-Chlor-N-isopropylacetanilid, N,N-Diallyl-2-chloracetamid, S-4-Chlorbenzyldiäthylthiolcarbamat, 2-Chlor-4-äthylamino-6-isopropylamino-s-triazin, 2-Chlor-4s6-bis-(äthylamino)-striazin, 2(4-Chlor-6-äthylamino-s-triazin-2-yl-amino)-2-methylpropionitril, S-Chlor-^-cyclopropylamino-ö-isopropyl-2098A5/1löüamino-s-triazin, 2,4-Dichlorphenoxyessigsäure oder deren Gemische enthält. ' ,,
- 9.. Herbizides Mittel nach einem der Ansprüche 1 bis 7, dadurch gekennzeichnet, daß das Gegenmittel in einer Menge im Bereich von etwa 0,0001 bis etwa 30 Gew.-Teile pro Gew.-Teil des herbiziden Wirkstoffs vorliegt.
- 10. Verfahren zur Bekämpfung von Unkrautarten, dadurch gekennzeichnet, daß man dem Boden, in dem sich die Unkrautarten befinden, eine herbizid wirksame Menge des herbiziden Mittels nach einem der Ansprüche 1 bis 9 zusetzt.Für: Stauffer Chemical Company New York, N.yj , V.St.A.(Dr.H. JM Wolff) Rechtsanwalt209845/1180
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US13486871A | 1971-04-16 | 1971-04-16 | |
US05/208,041 US4137070A (en) | 1971-04-16 | 1971-12-09 | Herbicide compositions |
Publications (2)
Publication Number | Publication Date |
---|---|
DE2218097A1 true DE2218097A1 (de) | 1972-11-02 |
DE2218097C2 DE2218097C2 (de) | 1987-07-30 |
Family
ID=26832761
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19722218097 Granted DE2218097A1 (de) | 1971-04-16 | 1972-04-14 | Herbizides Mittel und seine Verwendung |
Country Status (18)
Country | Link |
---|---|
AR (1) | AR192928A1 (de) |
BE (1) | BE782120A (de) |
CA (1) | CA1174865A (de) |
CH (1) | CH577785A5 (de) |
CS (1) | CS196241B2 (de) |
DD (1) | DD102075A5 (de) |
DE (1) | DE2218097A1 (de) |
DK (1) | DK143583C (de) |
ES (1) | ES401779A1 (de) |
FR (1) | FR2133793B1 (de) |
GB (2) | GB1396941A (de) |
IL (1) | IL39219A (de) |
IT (1) | IT953649B (de) |
MY (1) | MY7700206A (de) |
NL (1) | NL175965C (de) |
PL (1) | PL99481B1 (de) |
RO (3) | RO78996A (de) |
TR (1) | TR18613A (de) |
Cited By (46)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2350800A1 (de) * | 1972-10-13 | 1974-04-25 | Stauffer Chemical Co | Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel |
DE2441741A1 (de) * | 1973-09-04 | 1975-03-13 | Stauffer Chemical Co | Saatschuetzende herbizide zubereitung |
DE2605586A1 (de) * | 1975-02-14 | 1976-08-26 | Stauffer Chemical Co | Halogenacyl- und thiohalogenacylaryl- substituierte oxazolidine und thiazolidine- gegenmittel gegen schaedigungen durch herbizide |
EP0006540A1 (de) * | 1978-06-28 | 1980-01-09 | Bayer Ag | N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung zur Verhütung von Herbizidschäden an Kulturpflanzen sowie selektive herbizide Mittel auf Basis von N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin und herbizid wirksamen Acetaniliden oder Thiolcarbamaten |
EP0007588A1 (de) * | 1978-07-27 | 1980-02-06 | BASF Aktiengesellschaft | Tetrahydro-1,3-oxazine, herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Tetrahydro-1,3-oxazine als antagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
EP0008649A1 (de) * | 1978-07-27 | 1980-03-19 | BASF Aktiengesellschaft | Herbicide Mittel auf der Basis von Acetaniliden und N-Isopropyl-N-propargyl-dichloracetamid und Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
EP0009091A1 (de) * | 1978-07-27 | 1980-04-02 | BASF Aktiengesellschaft | Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwachstum mit herbiziden Mitteln auf Basis von Acetaniliden und N-Dichloracetyl-2,2-dimethyl-1,3-oxazolidin |
EP0009555A1 (de) * | 1978-07-27 | 1980-04-16 | BASF Aktiengesellschaft | Herbizide Mittel auf der Basis eines Thiolcarbamats, die Halogenacylamide als Antagonisten enthalten, und ihre Verwendung in einem Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
DE2905650A1 (de) * | 1978-02-06 | 1980-08-21 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
US4237302A (en) * | 1978-09-29 | 1980-12-02 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
EP0023306A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0023307A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-iso-chinolin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0023287A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0031042A1 (de) * | 1979-12-03 | 1981-07-01 | BASF Aktiengesellschaft | N-Dichloracetyldiazabicycloderivate,Verfahren zu ihrer Herstellung,herbizide Mittel,die Acetanilide als herbizide Wirkstoffe und diese N-Dichloroacetyldiazaantagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
US4279636A (en) * | 1978-09-29 | 1981-07-21 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
EP0035638A2 (de) * | 1980-02-09 | 1981-09-16 | Bayer Ag | Halogenalkylamide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0049760A2 (de) * | 1980-09-19 | 1982-04-21 | Bayer Ag | Heterocyclisch substituierte Amide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0065724A1 (de) * | 1981-05-26 | 1982-12-01 | BASF Aktiengesellschaft | Dihalogenacetamide, Verfahren zu ihrer Herstellung und herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Dihalogenacetamide als antagonistische Mittel enthalten |
US4392882A (en) | 1979-07-26 | 1983-07-12 | Bayer Aktiengesellschaft | N-N-Bis(haloacyl)-diaza-cycloalkanes for protecting plants from herbicide damage |
US4396416A (en) | 1979-09-21 | 1983-08-02 | Bayer Aktiengesellschaft | N-Acyl-piperidon compounds and their use as antidotes for protecting crop plants from herbicidal damage |
DE3426541A1 (de) * | 1983-07-21 | 1985-01-31 | Eszakmagyarországi Vegyimüvek, Sajóbábony | N- und gegebenenfalls n'-substituierte n-(dichloracetyl)-glycinamide und ihre verwendung als antidota fuer herbizide |
US4548639A (en) * | 1979-07-26 | 1985-10-22 | Bayer Aktiengesellschaft | N-Acyl-piperidone ketal compounds and their use as antidotes for protecting crop plants from herbicidal damage |
EP0190105A2 (de) * | 1985-01-31 | 1986-08-06 | Ciba-Geigy Ag | Herbizides Mittel |
US4618361A (en) * | 1983-12-12 | 1986-10-21 | Ciba-Geigy Corporation | Acylamides and compositions for the protection of cultivated plants against the phytotoxic action of herbicides |
US4897109A (en) * | 1984-05-28 | 1990-01-30 | Ciba-Geigy Corporation | Compositions for protecting culture plants from the phytotoxic action of herbicidally active chloracetanilides |
WO2004111042A1 (de) | 2003-06-12 | 2004-12-23 | Bayer Cropscience Aktiengesellschaft | N-heterocyclyl-phenylsubstituierte cyclische ketoenole |
WO2005092897A2 (de) | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische ketoenole |
WO2006000355A1 (de) | 2004-06-25 | 2006-01-05 | Bayer Cropscience Aktiengesellschaft | 3'-alkoxy spirocyclische tetram- und tetronsäuren |
WO2006029799A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische ketoenole |
WO2007073856A2 (de) | 2005-12-15 | 2007-07-05 | Bayer Cropscience Ag | 3'-alkoxy-spirocyclopentyl substituierte tetram- und tetronsäuren |
WO2007096058A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische ketoenole |
US7420062B2 (en) | 2003-07-14 | 2008-09-02 | Bayer Cropscience, Ag | Hetaryl-substituted pyrazolidindione derivatives with pesticidal characteristics |
EP1974607A2 (de) | 2004-07-20 | 2008-10-01 | Bayer CropScience AG | Selektive Insektizide auf Basis von Anthranilsäurediamiden und Safenern |
WO2009015801A1 (de) | 2007-08-02 | 2009-02-05 | Bayer Cropscience Ag | Oxaspirocyclische-spiro-substituierte tetram- und tetronsäure-derivate |
WO2009039975A1 (de) | 2007-09-25 | 2009-04-02 | Bayer Cropscience Ag | Halogenalkoxyspirocyclische tetram- und tetronsäure-derivate |
US7569517B2 (en) | 2003-08-14 | 2009-08-04 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3 5-diones pesticide agent and/or microbicide and/or herbicide |
EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
US7727933B2 (en) | 2003-11-22 | 2010-06-01 | Bayer Cropscience Ag | 2-ethyl-4,6-dimethyl-phenyl-substituted spirocyclic tetramic acid derivatives |
EP2216317A1 (de) | 2004-11-04 | 2010-08-11 | Bayer CropScience AG | Phenylessigsäurehalogenide |
EP2218330A1 (de) | 2003-11-22 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2-Ethyl-4,6-dimethylphenylessigsäure durch Umsetzung von 2-Ethyl-4,6-dimethylbrombenzol mit tert.-Butylacetat |
EP2218710A1 (de) | 2004-11-04 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2,6-Diethyl-4-methylphenylessigsäure |
US8119566B2 (en) | 2003-08-14 | 2012-02-21 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
US8173697B2 (en) | 2006-06-02 | 2012-05-08 | Bayer Cropscience Ag | Alkoxyalkyl-substituted cyclic keto-enols |
US8507537B2 (en) | 2006-10-25 | 2013-08-13 | Bayer Cropscience Ag | Trifluromethoxyphenyl-substituted tetramic acid derivatives pesticides and/or herbicides |
US8993782B2 (en) | 2006-12-04 | 2015-03-31 | Bayer Cropscience Ag | Cis-alkoxyspirocyclic biphenyl-substituted tetramic acid derivatives |
US9000189B2 (en) | 2006-12-04 | 2015-04-07 | Bayer Cropscience Ag | Biphenyl-substituted spirocyclic ketoenols |
Families Citing this family (18)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3931313A (en) | 1972-07-17 | 1976-01-06 | Stauffer Chemical Company | Schiff's base dichloroacetamides |
CH574207A5 (de) * | 1973-01-25 | 1976-04-15 | Ciba Geigy Ag | |
GB1519762A (en) | 1974-08-09 | 1978-08-02 | Wellcome Found | Cinnamamides their preparation and pharmaceutical compositions containing them |
DE2438332A1 (de) * | 1974-08-09 | 1976-02-19 | Consortium Elektrochem Ind | Herbicide mittel |
US4091112A (en) | 1974-08-09 | 1978-05-23 | Burroughs Wellcome Co. | Biologically active amides |
US4166818A (en) * | 1975-06-05 | 1979-09-04 | Lilly Industries Limited | Acylamino derivatives |
US4152442A (en) * | 1975-06-05 | 1979-05-01 | Lilly Industries Limited | Certain acylamino-oxa (or thia) diazoles in treatment of hypersensitivity conditions |
US4013681A (en) * | 1975-06-23 | 1977-03-22 | Hawaiian Sugar Planters' Association | Derivatives of thiophene |
IN144916B (de) * | 1975-08-08 | 1978-07-29 | Stauffer Chemical Co | |
HU178301B (en) * | 1978-02-06 | 1982-04-28 | Nitrokemia Ipartelepek | Herbicide compositions containing naphthaline-carboxylic acid derivatives as antidotes and carbamide derivatives and antidote compositions containing naphthaline-carboxylic acid derivatives |
DE2828222A1 (de) * | 1978-06-28 | 1980-01-10 | Bayer Ag | Gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
DE2828303A1 (de) * | 1978-06-28 | 1980-01-17 | Bayer Ag | Verwendung von n,n-diallyl-dichloracetamid zur verbesserung der kulturpflanzen- vertraeglichkeit von herbizid wirksamen acetaniliden |
HU182177B (en) * | 1980-08-13 | 1983-12-28 | Eszakmagyar Vegyimuevek | Composition for influencing plant growth |
GB2107308B (en) * | 1981-09-30 | 1986-01-15 | Ici Plc | Herbicidal and fungicidal |
DE3364680D1 (de) * | 1982-05-10 | 1986-08-28 | Ciba Geigy Ag | Cyclopropanecarboxylic-acid derivatives |
US4518789A (en) * | 1982-06-30 | 1985-05-21 | Yu Ruey J | Phenyl alpha-acyloxyacetamide derivatives and their therapeutic use |
HU194686B (en) * | 1985-05-10 | 1988-03-28 | Eszakmagyar Vegyimuevek | Herbicidal composition of prolonged action, comprising alpha-chlorine-acetanilide derivatives as active substance |
US5425789A (en) * | 1986-12-22 | 1995-06-20 | Exxon Chemical Patents Inc. | Chemical compositions and their use as fuel additives |
Citations (20)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2973258A (en) * | 1957-12-30 | 1961-02-28 | Monsanto Chemicals | Unsymmetrical alpha-haloacetamide herbicides |
US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
US3133810A (en) * | 1961-04-19 | 1964-05-19 | Monsanto Chemicals | Herbicidal compositions |
US3152884A (en) * | 1961-04-24 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
US3152883A (en) * | 1961-09-12 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
US3154400A (en) * | 1961-11-15 | 1964-10-27 | Monsanto Co | Alkyl substituted chloroacetamide weed control |
US3268526A (en) * | 1962-09-12 | 1966-08-23 | Monsanto Co | Heterocyclic polyhalobenzamide derivatives |
US3321295A (en) * | 1965-11-04 | 1967-05-23 | Monsanto Co | Method of controlling undesired plants |
US3357816A (en) * | 1964-12-08 | 1967-12-12 | Monsanto Co | Herbicidal benzamides and methods |
US3362810A (en) * | 1966-08-01 | 1968-01-09 | Monsanto Co | Herbicidal clay formulation |
US3469966A (en) * | 1967-01-23 | 1969-09-30 | Allied Chem | Bicyclic amides having herbicidal properties |
DE1952910A1 (de) * | 1968-10-25 | 1970-06-25 | Gulf Res And Dev Corp | Verfahren zum Resistentmachen von Getreidesamen gegenueber bestimmten Herbiziden |
DE2007924A1 (de) * | 1969-03-26 | 1970-10-01 | Rohm and Haas Company, Philadelphia, Pa. (V.St.A.) | Di- und trisubstituierte Benzamide |
US3534098A (en) * | 1967-01-10 | 1970-10-13 | Rohm & Haas | 3,5-disubstituted benzamides |
US3551484A (en) * | 1968-04-01 | 1970-12-29 | Rohm & Haas | 3,5-disubstituted benzamides |
DE1618644A1 (de) * | 1966-02-01 | 1971-04-01 | Monsanto Co | Biocide,insbesondere phytotoxische Zubereitungen |
BE762601A (fr) * | 1970-02-06 | 1971-07-16 | Gulf Research Development Co | Nouveaux n-benzylcarboxamides doues d'activite herbicide |
BE765936A (fr) * | 1970-04-21 | 1971-09-16 | Lenning Chemicals Ltd | Compositions pesticides a au moins deux ingredients actifs et leur utilisation comme herbicides |
ZA712246B (en) * | 1970-04-16 | 1972-01-26 | Gulf Research Development Co | Protection of wheat and grain sorghum from herbicidal injury |
IL37610A (en) * | 1970-08-31 | 1974-09-10 | Stauffer Chemical Co | Herbicidal compositions containing s-esters of thiocarbamates,triazines,2,4-dichlorophenoxy acetic acid or mixtures thereof and a haloalkoxysulfonyl derivative as antidote |
-
1972
- 1972-04-06 CA CA000139060A patent/CA1174865A/en not_active Expired
- 1972-04-12 AR AR241425A patent/AR192928A1/es active
- 1972-04-12 DK DK177372A patent/DK143583C/da active
- 1972-04-12 NL NLAANVRAGE7204894,A patent/NL175965C/xx not_active IP Right Cessation
- 1972-04-12 DD DD162258A patent/DD102075A5/xx unknown
- 1972-04-13 CS CS722480A patent/CS196241B2/cs unknown
- 1972-04-14 IL IL39219A patent/IL39219A/xx unknown
- 1972-04-14 FR FR7213316A patent/FR2133793B1/fr not_active Expired
- 1972-04-14 PL PL1972154732A patent/PL99481B1/pl unknown
- 1972-04-14 DE DE19722218097 patent/DE2218097A1/de active Granted
- 1972-04-14 BE BE782120A patent/BE782120A/xx not_active IP Right Cessation
- 1972-04-15 IT IT23209/72A patent/IT953649B/it active
- 1972-04-15 ES ES401779A patent/ES401779A1/es not_active Expired
- 1972-04-16 GB GB1475472A patent/GB1396941A/en not_active Expired
- 1972-04-16 GB GB5447574A patent/GB1396942A/en not_active Expired
- 1972-04-17 TR TR18613A patent/TR18613A/xx unknown
- 1972-04-17 RO RO7270563A patent/RO78996A/ro unknown
- 1972-04-17 RO RO108381A patent/RO83877B/ro unknown
- 1972-04-17 CH CH563772A patent/CH577785A5/xx not_active IP Right Cessation
- 1972-04-17 RO RO108380A patent/RO83875B/ro unknown
-
1977
- 1977-12-30 MY MY206/77A patent/MY7700206A/xx unknown
Patent Citations (20)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2973258A (en) * | 1957-12-30 | 1961-02-28 | Monsanto Chemicals | Unsymmetrical alpha-haloacetamide herbicides |
US3133810A (en) * | 1961-04-19 | 1964-05-19 | Monsanto Chemicals | Herbicidal compositions |
US3152884A (en) * | 1961-04-24 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
US3152883A (en) * | 1961-09-12 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
US3154400A (en) * | 1961-11-15 | 1964-10-27 | Monsanto Co | Alkyl substituted chloroacetamide weed control |
US3268526A (en) * | 1962-09-12 | 1966-08-23 | Monsanto Co | Heterocyclic polyhalobenzamide derivatives |
US3357816A (en) * | 1964-12-08 | 1967-12-12 | Monsanto Co | Herbicidal benzamides and methods |
US3321295A (en) * | 1965-11-04 | 1967-05-23 | Monsanto Co | Method of controlling undesired plants |
DE1618644A1 (de) * | 1966-02-01 | 1971-04-01 | Monsanto Co | Biocide,insbesondere phytotoxische Zubereitungen |
US3362810A (en) * | 1966-08-01 | 1968-01-09 | Monsanto Co | Herbicidal clay formulation |
US3534098A (en) * | 1967-01-10 | 1970-10-13 | Rohm & Haas | 3,5-disubstituted benzamides |
US3469966A (en) * | 1967-01-23 | 1969-09-30 | Allied Chem | Bicyclic amides having herbicidal properties |
US3551484A (en) * | 1968-04-01 | 1970-12-29 | Rohm & Haas | 3,5-disubstituted benzamides |
DE1952910A1 (de) * | 1968-10-25 | 1970-06-25 | Gulf Res And Dev Corp | Verfahren zum Resistentmachen von Getreidesamen gegenueber bestimmten Herbiziden |
DE2007924A1 (de) * | 1969-03-26 | 1970-10-01 | Rohm and Haas Company, Philadelphia, Pa. (V.St.A.) | Di- und trisubstituierte Benzamide |
BE762601A (fr) * | 1970-02-06 | 1971-07-16 | Gulf Research Development Co | Nouveaux n-benzylcarboxamides doues d'activite herbicide |
ZA712246B (en) * | 1970-04-16 | 1972-01-26 | Gulf Research Development Co | Protection of wheat and grain sorghum from herbicidal injury |
BE765936A (fr) * | 1970-04-21 | 1971-09-16 | Lenning Chemicals Ltd | Compositions pesticides a au moins deux ingredients actifs et leur utilisation comme herbicides |
IL37610A (en) * | 1970-08-31 | 1974-09-10 | Stauffer Chemical Co | Herbicidal compositions containing s-esters of thiocarbamates,triazines,2,4-dichlorophenoxy acetic acid or mixtures thereof and a haloalkoxysulfonyl derivative as antidote |
Cited By (64)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2350800A1 (de) * | 1972-10-13 | 1974-04-25 | Stauffer Chemical Co | Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel |
DE2441741A1 (de) * | 1973-09-04 | 1975-03-13 | Stauffer Chemical Co | Saatschuetzende herbizide zubereitung |
DE2605586A1 (de) * | 1975-02-14 | 1976-08-26 | Stauffer Chemical Co | Halogenacyl- und thiohalogenacylaryl- substituierte oxazolidine und thiazolidine- gegenmittel gegen schaedigungen durch herbizide |
DE2905650A1 (de) * | 1978-02-06 | 1980-08-21 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
EP0006540A1 (de) * | 1978-06-28 | 1980-01-09 | Bayer Ag | N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung zur Verhütung von Herbizidschäden an Kulturpflanzen sowie selektive herbizide Mittel auf Basis von N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin und herbizid wirksamen Acetaniliden oder Thiolcarbamaten |
EP0007588A1 (de) * | 1978-07-27 | 1980-02-06 | BASF Aktiengesellschaft | Tetrahydro-1,3-oxazine, herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Tetrahydro-1,3-oxazine als antagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
EP0008649A1 (de) * | 1978-07-27 | 1980-03-19 | BASF Aktiengesellschaft | Herbicide Mittel auf der Basis von Acetaniliden und N-Isopropyl-N-propargyl-dichloracetamid und Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
EP0009091A1 (de) * | 1978-07-27 | 1980-04-02 | BASF Aktiengesellschaft | Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwachstum mit herbiziden Mitteln auf Basis von Acetaniliden und N-Dichloracetyl-2,2-dimethyl-1,3-oxazolidin |
EP0009555A1 (de) * | 1978-07-27 | 1980-04-16 | BASF Aktiengesellschaft | Herbizide Mittel auf der Basis eines Thiolcarbamats, die Halogenacylamide als Antagonisten enthalten, und ihre Verwendung in einem Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
US4237302A (en) * | 1978-09-29 | 1980-12-02 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
US4279636A (en) * | 1978-09-29 | 1981-07-21 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
US4614537A (en) * | 1979-07-26 | 1986-09-30 | Bayer Aktiengesellschaft | N-acyl-piperidone ketal compounds and their use as antidotes for protecting crop plants from herbicidal damage |
US4422866A (en) | 1979-07-26 | 1983-12-27 | Bayer Aktiengesellschaft | Antidotes for protecting plants from herbicide damage |
EP0023287A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
US4392882A (en) | 1979-07-26 | 1983-07-12 | Bayer Aktiengesellschaft | N-N-Bis(haloacyl)-diaza-cycloalkanes for protecting plants from herbicide damage |
US4548639A (en) * | 1979-07-26 | 1985-10-22 | Bayer Aktiengesellschaft | N-Acyl-piperidone ketal compounds and their use as antidotes for protecting crop plants from herbicidal damage |
EP0023306A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0023307A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-iso-chinolin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
US4396416A (en) | 1979-09-21 | 1983-08-02 | Bayer Aktiengesellschaft | N-Acyl-piperidon compounds and their use as antidotes for protecting crop plants from herbicidal damage |
EP0031042A1 (de) * | 1979-12-03 | 1981-07-01 | BASF Aktiengesellschaft | N-Dichloracetyldiazabicycloderivate,Verfahren zu ihrer Herstellung,herbizide Mittel,die Acetanilide als herbizide Wirkstoffe und diese N-Dichloroacetyldiazaantagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
EP0035638A3 (de) * | 1980-02-09 | 1981-10-07 | Bayer Ag | Halogenalkylamide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
US4391626A (en) | 1980-02-09 | 1983-07-05 | Bayer Aktiengesellschaft | Haloalkylamide compounds and herbicidal antidote compositions |
EP0035638A2 (de) * | 1980-02-09 | 1981-09-16 | Bayer Ag | Halogenalkylamide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0049760A2 (de) * | 1980-09-19 | 1982-04-21 | Bayer Ag | Heterocyclisch substituierte Amide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0049760A3 (de) * | 1980-09-19 | 1982-08-18 | Bayer Ag | Heterocyclisch substituierte Amide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
EP0065724A1 (de) * | 1981-05-26 | 1982-12-01 | BASF Aktiengesellschaft | Dihalogenacetamide, Verfahren zu ihrer Herstellung und herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Dihalogenacetamide als antagonistische Mittel enthalten |
DE3426541A1 (de) * | 1983-07-21 | 1985-01-31 | Eszakmagyarországi Vegyimüvek, Sajóbábony | N- und gegebenenfalls n'-substituierte n-(dichloracetyl)-glycinamide und ihre verwendung als antidota fuer herbizide |
US4618361A (en) * | 1983-12-12 | 1986-10-21 | Ciba-Geigy Corporation | Acylamides and compositions for the protection of cultivated plants against the phytotoxic action of herbicides |
US4897109A (en) * | 1984-05-28 | 1990-01-30 | Ciba-Geigy Corporation | Compositions for protecting culture plants from the phytotoxic action of herbicidally active chloracetanilides |
EP0190105A3 (de) * | 1985-01-31 | 1988-10-26 | Ciba-Geigy Ag | Herbizides Mittel |
EP0190105A2 (de) * | 1985-01-31 | 1986-08-06 | Ciba-Geigy Ag | Herbizides Mittel |
WO2004111042A1 (de) | 2003-06-12 | 2004-12-23 | Bayer Cropscience Aktiengesellschaft | N-heterocyclyl-phenylsubstituierte cyclische ketoenole |
US7420062B2 (en) | 2003-07-14 | 2008-09-02 | Bayer Cropscience, Ag | Hetaryl-substituted pyrazolidindione derivatives with pesticidal characteristics |
US7569517B2 (en) | 2003-08-14 | 2009-08-04 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3 5-diones pesticide agent and/or microbicide and/or herbicide |
US8987500B2 (en) | 2003-08-14 | 2015-03-24 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
US8586783B2 (en) | 2003-08-14 | 2013-11-19 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
US8119566B2 (en) | 2003-08-14 | 2012-02-21 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
EP2218330A1 (de) | 2003-11-22 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2-Ethyl-4,6-dimethylphenylessigsäure durch Umsetzung von 2-Ethyl-4,6-dimethylbrombenzol mit tert.-Butylacetat |
US7727933B2 (en) | 2003-11-22 | 2010-06-01 | Bayer Cropscience Ag | 2-ethyl-4,6-dimethyl-phenyl-substituted spirocyclic tetramic acid derivatives |
WO2005092897A2 (de) | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische ketoenole |
WO2006000355A1 (de) | 2004-06-25 | 2006-01-05 | Bayer Cropscience Aktiengesellschaft | 3'-alkoxy spirocyclische tetram- und tetronsäuren |
US8410289B2 (en) | 2004-06-25 | 2013-04-02 | Bayer Cropscience Ag | Spirocyclic 3'-alkoxytetramic acids and-tetronic acids |
EP2246328A1 (de) | 2004-06-25 | 2010-11-03 | Bayer CropScience AG | 3'-Alkoxy spirocyclische Tetronsäuren |
EP1974607A2 (de) | 2004-07-20 | 2008-10-01 | Bayer CropScience AG | Selektive Insektizide auf Basis von Anthranilsäurediamiden und Safenern |
WO2006029799A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische ketoenole |
EP2218710A1 (de) | 2004-11-04 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2,6-Diethyl-4-methylphenylessigsäure |
EP2253207A1 (de) | 2004-11-04 | 2010-11-24 | Bayer CropScience AG | Substituierte Phenylessigsäureester |
EP2216317A1 (de) | 2004-11-04 | 2010-08-11 | Bayer CropScience AG | Phenylessigsäurehalogenide |
EP2216316A1 (de) | 2004-11-04 | 2010-08-11 | Bayer CropScience Aktiengesellschaft | Phenylessigsäurederivate |
WO2007073856A2 (de) | 2005-12-15 | 2007-07-05 | Bayer Cropscience Ag | 3'-alkoxy-spirocyclopentyl substituierte tetram- und tetronsäuren |
US8039014B2 (en) | 2005-12-15 | 2011-10-18 | Bayer Cropscience Ag | 3′-alkoxyspirocyclopentyl-substituted tetramic and tetronic acids |
EP2186805A1 (de) | 2006-02-21 | 2010-05-19 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
WO2007096058A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische ketoenole |
EP2186791A1 (de) | 2006-02-21 | 2010-05-19 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
EP2184275A1 (de) | 2006-02-21 | 2010-05-12 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
US8173697B2 (en) | 2006-06-02 | 2012-05-08 | Bayer Cropscience Ag | Alkoxyalkyl-substituted cyclic keto-enols |
US8507537B2 (en) | 2006-10-25 | 2013-08-13 | Bayer Cropscience Ag | Trifluromethoxyphenyl-substituted tetramic acid derivatives pesticides and/or herbicides |
US8993782B2 (en) | 2006-12-04 | 2015-03-31 | Bayer Cropscience Ag | Cis-alkoxyspirocyclic biphenyl-substituted tetramic acid derivatives |
US9000189B2 (en) | 2006-12-04 | 2015-04-07 | Bayer Cropscience Ag | Biphenyl-substituted spirocyclic ketoenols |
US8859466B2 (en) | 2007-08-02 | 2014-10-14 | Bayer Cropscience Ag | Oxaspirocyclic spiro-substituted tetramic acid and tetronic acid derivatives |
WO2009015801A1 (de) | 2007-08-02 | 2009-02-05 | Bayer Cropscience Ag | Oxaspirocyclische-spiro-substituierte tetram- und tetronsäure-derivate |
WO2009039975A1 (de) | 2007-09-25 | 2009-04-02 | Bayer Cropscience Ag | Halogenalkoxyspirocyclische tetram- und tetronsäure-derivate |
WO2009115262A1 (de) | 2008-03-19 | 2009-09-24 | Bayer Cropscience Ag | 4'4'-dioxaspiro-spirocyclisch substituierte tetramate |
EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
Also Published As
Publication number | Publication date |
---|---|
RO78996A (ro) | 1982-06-25 |
DK143583B (da) | 1981-09-14 |
CA1174865A (en) | 1984-09-25 |
BE782120A (fr) | 1972-10-16 |
IL39219A0 (en) | 1972-07-26 |
CS196241B2 (en) | 1980-03-31 |
RO83877B (ro) | 1984-04-30 |
RO83877A (ro) | 1984-04-02 |
RO83875B (ro) | 1984-04-30 |
DK143583C (da) | 1982-02-01 |
IL39219A (en) | 1978-12-17 |
DD102075A5 (de) | 1973-12-05 |
FR2133793B1 (de) | 1977-06-24 |
ES401779A1 (es) | 1975-11-01 |
GB1396942A (en) | 1975-06-11 |
CH577785A5 (de) | 1976-07-30 |
GB1396941A (en) | 1975-06-11 |
DE2218097C2 (de) | 1987-07-30 |
TR18613A (tr) | 1977-05-13 |
MY7700206A (en) | 1977-12-31 |
PL99481B1 (pl) | 1978-07-31 |
AR192928A1 (es) | 1973-03-21 |
RO83875A (ro) | 1984-04-02 |
NL7204894A (de) | 1972-10-18 |
NL175965C (nl) | 1985-02-01 |
FR2133793A1 (de) | 1972-12-01 |
IT953649B (it) | 1973-08-10 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2218097A1 (de) | Herbizides Mittel und seine Verwendung | |
DE2927480C2 (de) | 1-Acetyl-3-cyano-4-phenylpyrrol-Derivate | |
DE1695968C3 (de) | 4-Methylthiazolyl-5-carboxanilidverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als fungizide Mittel | |
DE2604989A1 (de) | 1,5-alkylen-3-aryl-hydantoin-derivate, verfahren zu ihrer herstellung und mittel mit herbizider und/oder fungizider wirkung | |
CH625394A5 (en) | Herbicidal preparation | |
DE2911865C2 (de) | N-Halogenacetyl-phenylamino-carbonyl-oxime, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel zur Bekämpfung von Unkraut | |
DE1276402B (de) | Herbizide Mittel mit einem Gehalt an Halogenthiobenzamiden | |
DE1618644C3 (de) | zu ihrer Herstellung und sie enthaltende Herbicide | |
DE3002595A1 (de) | N-(heterocyclyl)-methylacetanilide und sie enthaltende herbizide und pflanzenwachstumsregulatoren | |
DD149454A5 (de) | Lepidoptere vertilgende zusammensetzung | |
DE2659404A1 (de) | Neue verbindungen, verfahren zu ihrer herstellung und sie enthaltende herbizide zusammensetzungen | |
DE2524577C3 (de) | Substituierte Tetrahydropyran-3,5dione und 13-Dioxan-4,6-dione, Verfahren zu ihrer Herstellung und ihre Verwendung als selektive Herbicide | |
DD149935A5 (de) | Verfahren zur herstellung von racemen oder optisch aktivem 2-(propargyloxyimino)-1,7,7-trimethylbicyclo(2,2,1)heptan | |
DE1567104A1 (de) | Herbicide Zubereitungen mit neuen Hydrazinverbindungen als Wirkstoff | |
DE3422346C2 (de) | ||
DE2554866A1 (de) | Fungizide zusammensetzung | |
DE2524578C3 (de) | 5-Hydroxylaminomethylen-barbitursäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbicide | |
DE2040580A1 (de) | Thiazolderivate | |
DE2155391A1 (de) | l-Hydrocarbyldithio-3-arylharnstoffe und dieselben enthaltende Herbizide | |
DE2824126A1 (de) | Tetrahydro-1,3,5-thiadiazin-4-on- verbindungen | |
CH635107A5 (de) | Herbizid wirksame alpha-halogenacetamide. | |
DE2510936A1 (de) | Thienylharnstoffe | |
EP0106949B1 (de) | 3,7-Dichlor-8-chinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
DE2601447A1 (de) | Cyclohexen-ester | |
DE2263599A1 (de) | Phosphorylierte thioharnstoffderivate und ihre verwendung als schaedlingsbekaempfungsmittel |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OD | Request for examination | ||
8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2266035 Format of ref document f/p: P |
|
Q171 | Divided out to: |
Ref country code: DE Ref document number: 2266035 |
|
AH | Division in |
Ref country code: DE Ref document number: 2266035 Format of ref document f/p: P |
|
D2 | Grant after examination | ||
AH | Division in |
Ref country code: DE Ref document number: 2266035 Format of ref document f/p: P |
|
8364 | No opposition during term of opposition | ||
8380 | Miscellaneous part iii |
Free format text: DER OT LAUTET RICHTIG: 02.11.72 |