CH644369A5 - 2-amino-4-chlorthiazolverbindungen. - Google Patents
2-amino-4-chlorthiazolverbindungen. Download PDFInfo
- Publication number
- CH644369A5 CH644369A5 CH414279A CH414279A CH644369A5 CH 644369 A5 CH644369 A5 CH 644369A5 CH 414279 A CH414279 A CH 414279A CH 414279 A CH414279 A CH 414279A CH 644369 A5 CH644369 A5 CH 644369A5
- Authority
- CH
- Switzerland
- Prior art keywords
- hydrogen
- formula
- optionally substituted
- phenyl
- group
- Prior art date
Links
- XGWAKKLWGVLLDB-UHFFFAOYSA-N 4-chloro-1,3-thiazol-2-amine Chemical class NC1=NC(Cl)=CS1 XGWAKKLWGVLLDB-UHFFFAOYSA-N 0.000 title description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 56
- 239000001257 hydrogen Substances 0.000 claims description 56
- 150000001875 compounds Chemical class 0.000 claims description 38
- 150000002431 hydrogen Chemical class 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 34
- -1 N-piperidyl Chemical group 0.000 claims description 22
- 125000000304 alkynyl group Chemical group 0.000 claims description 20
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 18
- 239000000975 dye Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 13
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 12
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000002252 acyl group Chemical group 0.000 claims description 11
- 125000001624 naphthyl group Chemical group 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000005521 carbonamide group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000000987 azo dye Substances 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 125000001382 thioacetal group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- DYZMXGCHWXQLCM-UHFFFAOYSA-N 2-[(2-amino-4-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile Chemical compound NC=1SC(=C(N=1)Cl)C=C(C#N)C#N DYZMXGCHWXQLCM-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical group ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- KJRBYUWRYRRPKN-UHFFFAOYSA-N 2-amino-4-chloro-1,3-thiazole-5-carbaldehyde Chemical compound NC1=NC(Cl)=C(C=O)S1 KJRBYUWRYRRPKN-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YBDFGIGPQKUYGW-UHFFFAOYSA-N 2-amino-1,3-thiazol-3-ium-4-one;chloride Chemical compound Cl.NC1=NC(=O)CS1 YBDFGIGPQKUYGW-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical class O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 125000004036 acetal group Chemical group 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 238000006668 aldol addition reaction Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003349 semicarbazides Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000007979 thiazole derivatives Chemical group 0.000 description 1
- 150000003583 thiosemicarbazides Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B23/00—Methine or polymethine dyes, e.g. cyanine dyes
- C09B23/0091—Methine or polymethine dyes, e.g. cyanine dyes having only one heterocyclic ring at one end of the methine chain, e.g. hemicyamines, hemioxonol
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/40—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/42—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH414279A CH644369A5 (de) | 1979-05-03 | 1979-05-03 | 2-amino-4-chlorthiazolverbindungen. |
| DE19803015121 DE3015121A1 (de) | 1979-05-03 | 1980-04-19 | 4-halogen-5-formylthiazolverbindungen |
| GB8014035A GB2056969B (en) | 1979-05-03 | 1980-04-29 | 2 - (amino or imino) - 4 - halothiazoles |
| FR8009618A FR2455591A1 (fr) | 1979-05-03 | 1980-04-29 | Nouveaux derives du thiazole utilisables comme colorants et leur preparation |
| IT48560/80A IT1128154B (it) | 1979-05-03 | 1980-04-30 | Derivati del tiazolo impiegabili come coloranti e loro preparazione |
| BR8002694A BR8002694A (pt) | 1979-05-03 | 1980-04-30 | Processo para a producao de derivados de 4-halo-tiazol e processo para tingimento ou estampagem de substatos organicos sinteticos ou semi-sinteticos, de alto peso molecular, hidrofobicos |
| JP5716380A JPS55147558A (en) | 1979-05-03 | 1980-05-01 | Thiazole compound |
| ES491139A ES8104261A1 (es) | 1979-05-03 | 1980-05-02 | Procedimiento para la preparacion de 2-amino-4-halogeno-5- formil-tiazoleno. |
| US06/264,019 US4395544A (en) | 1979-05-03 | 1981-05-15 | 4-Halo-5-formyl thiazoles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH414279A CH644369A5 (de) | 1979-05-03 | 1979-05-03 | 2-amino-4-chlorthiazolverbindungen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH644369A5 true CH644369A5 (de) | 1984-07-31 |
Family
ID=4270600
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH414279A CH644369A5 (de) | 1979-05-03 | 1979-05-03 | 2-amino-4-chlorthiazolverbindungen. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4395544A (enExample) |
| JP (1) | JPS55147558A (enExample) |
| BR (1) | BR8002694A (enExample) |
| CH (1) | CH644369A5 (enExample) |
| DE (1) | DE3015121A1 (enExample) |
| ES (1) | ES8104261A1 (enExample) |
| FR (1) | FR2455591A1 (enExample) |
| GB (1) | GB2056969B (enExample) |
| IT (1) | IT1128154B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3303704A1 (de) * | 1983-02-04 | 1984-08-09 | Bayer Ag, 5090 Leverkusen | 2,4-dichlor-5-thiazolcarboxaldehyd und ein verfahren zu seiner herstellung |
| CH664762A5 (de) * | 1984-08-30 | 1988-03-31 | Sandoz Ag | Thiophen-azofarbstoffe. |
| JPH02113070A (ja) * | 1988-10-20 | 1990-04-25 | Fuji Photo Film Co Ltd | 色素 |
| DE4010514A1 (de) * | 1990-04-02 | 1991-10-10 | Basf Ag | Verfahren zur herstellung von 2-amino-5-formyl-4-halogenthiazolen |
| DE4120362A1 (de) * | 1991-06-20 | 1992-12-24 | Basf Ag | Thiazolazofarbstoffe mit einer kupplungskomponente aus der diphenylaminreihe |
| DE4215495A1 (de) * | 1992-05-12 | 1993-11-18 | Basf Ag | Azofarbstoffe mit einer acetalisierten Diazokomponente aus der Thiophen- oder Thiazolreihe |
| EP0578870B1 (en) * | 1992-07-14 | 1996-12-11 | Agfa-Gevaert N.V. | Thiazolylazoaniline dyes for use in thermal dye sublimation transfer |
| US5356857A (en) * | 1993-05-17 | 1994-10-18 | Agfa-Gevaert, N.V. | Triazene dyes for use in thermal transfer printing |
| DE4401912A1 (de) * | 1994-01-24 | 1995-07-27 | Basf Ag | Methinfarbstoffe in der nichtlinearen Optik |
| EP0687674A1 (en) * | 1994-06-17 | 1995-12-20 | Agfa-Gevaert N.V. | Preparation of 2-amino-4-alkoxythiazoles being negatively substituted in the 5 position |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1137024B (de) * | 1962-09-27 | Bayer Ag | Verfahren zur Herstellung von substituierten 2-Aminothiazol-(5)-aldehyden | |
| FR925954A (fr) * | 1946-04-05 | 1947-09-18 | Applic Therapeutiques Therapli | Composés thiazoliques chlorés et leur procédé de préparation |
| FR1006623A (fr) * | 1947-02-24 | 1952-04-25 | Applic Therapeutiques Soc Gen | Nouveau produit chimique, utilisable comme hypnotique, et son procédé de préparation |
| DE1182234B (de) * | 1962-11-08 | 1964-11-26 | Bayer Ag | Verfahren zur Herstellung von Thiazol-5-aldehyden |
| FR1533184A (fr) * | 1965-04-06 | 1968-07-19 | Pechiney Saint Gobain | Dérivés du thiazole |
| US3505055A (en) * | 1966-12-07 | 1970-04-07 | Uniroyal Inc | Method of controlling plant growth with carboxamidothiazoles |
| US3444178A (en) * | 1967-06-16 | 1969-05-13 | Monsanto Co | Certain halogenated 2-(2-thiazolyl) aminofuran-5-ones |
| US3573289A (en) * | 1967-10-27 | 1971-03-30 | Eastman Kodak Co | Cationic methine compounds |
| US3829410A (en) * | 1970-03-19 | 1974-08-13 | Eastman Kodak Co | 5-(cyanovinylene)-2-thiazolylazoaniline compounds |
| JPS5537555B2 (enExample) * | 1973-10-24 | 1980-09-29 | ||
| CH622541A5 (enExample) | 1976-07-12 | 1981-04-15 | Sandoz Ag | |
| NZ186965A (en) * | 1977-04-20 | 1980-02-21 | Ici Ltd | Guanidino derivatives and pharmaceutical compositions |
| US4165378A (en) * | 1977-04-20 | 1979-08-21 | Ici Americas Inc. | Guanidine derivatives of imidazoles and thiazoles |
| GB1583377A (en) | 1977-04-25 | 1981-01-28 | Ici Ltd | Disperse azo dyestuffs derived from a 2-aminothiophene-5-aldehyde |
| DE2837121A1 (de) * | 1977-09-05 | 1979-03-15 | Sandoz Ag | Organische verbindungen |
| DE2805177A1 (de) * | 1978-02-08 | 1979-08-09 | Sandoz Ag | Azo-dispersionsfarbstoffe, ihre herstellung und verwendung |
| DD136147A1 (de) * | 1978-04-28 | 1979-06-20 | Harald Niegel | Verfahren zur herstellung von methin-dispersionsfarbstoffen |
-
1979
- 1979-05-03 CH CH414279A patent/CH644369A5/de not_active IP Right Cessation
-
1980
- 1980-04-19 DE DE19803015121 patent/DE3015121A1/de active Granted
- 1980-04-29 FR FR8009618A patent/FR2455591A1/fr active Granted
- 1980-04-29 GB GB8014035A patent/GB2056969B/en not_active Expired
- 1980-04-30 IT IT48560/80A patent/IT1128154B/it active
- 1980-04-30 BR BR8002694A patent/BR8002694A/pt unknown
- 1980-05-01 JP JP5716380A patent/JPS55147558A/ja active Granted
- 1980-05-02 ES ES491139A patent/ES8104261A1/es not_active Expired
-
1981
- 1981-05-15 US US06/264,019 patent/US4395544A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4395544A (en) | 1983-07-26 |
| ES491139A0 (es) | 1981-04-16 |
| BR8002694A (pt) | 1980-12-16 |
| GB2056969A (en) | 1981-03-25 |
| DE3015121A1 (de) | 1980-11-13 |
| FR2455591A1 (fr) | 1980-11-28 |
| FR2455591B1 (enExample) | 1983-05-20 |
| DE3015121C2 (enExample) | 1992-02-27 |
| IT8048560A0 (it) | 1980-04-30 |
| ES8104261A1 (es) | 1981-04-16 |
| JPH0248554B2 (enExample) | 1990-10-25 |
| JPS55147558A (en) | 1980-11-17 |
| IT1128154B (it) | 1986-05-28 |
| GB2056969B (en) | 1983-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3108077C2 (enExample) | ||
| DE1295115B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE3529831C2 (de) | Thiophen-Azofarbstoffe | |
| CH638237A5 (de) | Farbstoffe der cumarinreihe und deren herstellung. | |
| DE2929001C2 (de) | Dispersionsfarbstoffe und Verfahren zu ihrer Herstellung | |
| CH644369A5 (de) | 2-amino-4-chlorthiazolverbindungen. | |
| DE1644328C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH628080A5 (de) | Verfahren zur herstellung von farbstoffen der cumarinreihe. | |
| DE4335261C2 (de) | Dispersionsfarbstoffe | |
| DE2433260C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| CH433662A (de) | Tragvorrichtung für Deckenverkleidung | |
| DE2434207C2 (de) | In Wasser schwer lösliche Monoazoverbindungen, ihre Herstellung und Verwendung | |
| CH622541A5 (enExample) | ||
| DE2222639A1 (de) | In Wasser schwer loesliche Azoverbindungen,ihre Herstellung und Verwendung als Dispersionsfarbstoffe | |
| DE2013791A1 (en) | Yellow basic hydrazone dyes for polyacry-lonitrile etc | |
| DE2334168A1 (de) | Verfahren zur herstellung in wasser schwer loeslicher heterocyclischer verbindungen | |
| DE1935482A1 (de) | Azoverbindungen,ihre Herstellung und Verwendung | |
| DE1644327B2 (de) | Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2460668C2 (de) | Monoazofarbstoffe, ihre Herstellung und Verwendung | |
| DE2036505B2 (de) | Kationische farbstoffe, verfahren zu deren herstellung und deren verwendung | |
| DE2306740A1 (de) | In wasser schwer loesliche cumarinverbindungen, ihre herstellung und verwendung | |
| DE2212755A1 (de) | Wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| DE2721190A1 (de) | Kationische farbstoffe | |
| DE1569734B2 (de) | Mischungen von methinfarbstoffen | |
| DE1644103C3 (de) | Basische kationische Azofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NV | New agent |
Representative=s name: SCHMAUDER & WANN PATENTANWALTSBUERO, INHABER KLAUS |
|
| PUE | Assignment |
Owner name: SANDOZ AG TRANSFER- BASF AKTIENGESELLSCHAFT |
|
| PL | Patent ceased |