DE3015121A1 - 4-halogen-5-formylthiazolverbindungen - Google Patents
4-halogen-5-formylthiazolverbindungenInfo
- Publication number
- DE3015121A1 DE3015121A1 DE19803015121 DE3015121A DE3015121A1 DE 3015121 A1 DE3015121 A1 DE 3015121A1 DE 19803015121 DE19803015121 DE 19803015121 DE 3015121 A DE3015121 A DE 3015121A DE 3015121 A1 DE3015121 A1 DE 3015121A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydrogen
- formula
- group
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 37
- -1 aldehyde compounds Chemical group 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 35
- 150000002431 hydrogen Chemical class 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 239000000460 chlorine Substances 0.000 claims description 23
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 22
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 18
- 229910052794 bromium Inorganic materials 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 10
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 239000000975 dye Substances 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 5
- 125000001302 tertiary amino group Chemical group 0.000 claims description 5
- KJRBYUWRYRRPKN-UHFFFAOYSA-N 2-amino-4-chloro-1,3-thiazole-5-carbaldehyde Chemical compound NC1=NC(Cl)=C(C=O)S1 KJRBYUWRYRRPKN-UHFFFAOYSA-N 0.000 claims description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- 125000005195 alkyl amino carbonyloxy group Chemical group 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 4
- 125000004682 aminothiocarbonyl group Chemical group NC(=S)* 0.000 claims description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- PJOUURZOYJMYPA-UHFFFAOYSA-N OClC#N Chemical compound OClC#N PJOUURZOYJMYPA-UHFFFAOYSA-N 0.000 claims description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 125000001382 thioacetal group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- POXIZPBFFUKMEQ-UHFFFAOYSA-N 2-cyanoethenylideneazanide Chemical group [N-]=C=[C+]C#N POXIZPBFFUKMEQ-UHFFFAOYSA-N 0.000 claims 1
- 125000001054 5 membered carbocyclic group Chemical group 0.000 claims 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000005202 dialkylaminocarbonyloxy group Chemical group 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- 150000003839 salts Chemical group 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical class NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000000987 azo dye Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- IUTKNERGJDQDJC-UHFFFAOYSA-N 2-(5,5-dimethylcyclohex-2-en-1-ylidene)propanedinitrile Chemical compound CC1(C)CC=CC(=C(C#N)C#N)C1 IUTKNERGJDQDJC-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- DYZMXGCHWXQLCM-UHFFFAOYSA-N 2-[(2-amino-4-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile Chemical compound NC=1SC(=C(N=1)Cl)C=C(C#N)C#N DYZMXGCHWXQLCM-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- HYMJHROUVPWYNQ-UHFFFAOYSA-N 2-amino-1,3-thiazol-4-one Chemical compound NC1=NC(=O)CS1 HYMJHROUVPWYNQ-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- REGFWZVTTFGQOJ-UHFFFAOYSA-N 4,5-dihydro-1,3-thiazol-2-amine Chemical compound NC1=NCCS1 REGFWZVTTFGQOJ-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B23/00—Methine or polymethine dyes, e.g. cyanine dyes
- C09B23/0091—Methine or polymethine dyes, e.g. cyanine dyes having only one heterocyclic ring at one end of the methine chain, e.g. hemicyamines, hemioxonol
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/40—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/42—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH414279A CH644369A5 (de) | 1979-05-03 | 1979-05-03 | 2-amino-4-chlorthiazolverbindungen. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3015121A1 true DE3015121A1 (de) | 1980-11-13 |
| DE3015121C2 DE3015121C2 (enExample) | 1992-02-27 |
Family
ID=4270600
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803015121 Granted DE3015121A1 (de) | 1979-05-03 | 1980-04-19 | 4-halogen-5-formylthiazolverbindungen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4395544A (enExample) |
| JP (1) | JPS55147558A (enExample) |
| BR (1) | BR8002694A (enExample) |
| CH (1) | CH644369A5 (enExample) |
| DE (1) | DE3015121A1 (enExample) |
| ES (1) | ES8104261A1 (enExample) |
| FR (1) | FR2455591A1 (enExample) |
| GB (1) | GB2056969B (enExample) |
| IT (1) | IT1128154B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5206376A (en) * | 1990-04-02 | 1993-04-27 | Basf Aktiengesellschaft | Preparation of 2-amino-5-formyl-4-halothiazoles |
| US5298610A (en) * | 1991-06-20 | 1994-03-29 | Basf Aktiengesellschaft | Thiazoleazo dyes having a coupling component of the diphenylamine series |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3303704A1 (de) * | 1983-02-04 | 1984-08-09 | Bayer Ag, 5090 Leverkusen | 2,4-dichlor-5-thiazolcarboxaldehyd und ein verfahren zu seiner herstellung |
| CH664762A5 (de) * | 1984-08-30 | 1988-03-31 | Sandoz Ag | Thiophen-azofarbstoffe. |
| JPH02113070A (ja) * | 1988-10-20 | 1990-04-25 | Fuji Photo Film Co Ltd | 色素 |
| DE4215495A1 (de) * | 1992-05-12 | 1993-11-18 | Basf Ag | Azofarbstoffe mit einer acetalisierten Diazokomponente aus der Thiophen- oder Thiazolreihe |
| ATE146135T1 (de) * | 1992-07-14 | 1996-12-15 | Agfa Gevaert Nv | Thiazolylazoanilinfarbstoffe zur anwendung in der thermischen farbstoffsublimationsübertragung |
| US5356857A (en) * | 1993-05-17 | 1994-10-18 | Agfa-Gevaert, N.V. | Triazene dyes for use in thermal transfer printing |
| DE4401912A1 (de) * | 1994-01-24 | 1995-07-27 | Basf Ag | Methinfarbstoffe in der nichtlinearen Optik |
| EP0687674A1 (en) * | 1994-06-17 | 1995-12-20 | Agfa-Gevaert N.V. | Preparation of 2-amino-4-alkoxythiazoles being negatively substituted in the 5 position |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3573289A (en) * | 1967-10-27 | 1971-03-30 | Eastman Kodak Co | Cationic methine compounds |
| US3829410A (en) * | 1970-03-19 | 1974-08-13 | Eastman Kodak Co | 5-(cyanovinylene)-2-thiazolylazoaniline compounds |
| GB2003495A (en) * | 1977-09-05 | 1979-03-14 | Sandoz Ltd | Improvements in or relating to organic compounds |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1137024B (de) * | 1962-09-27 | Bayer Ag | Verfahren zur Herstellung von substituierten 2-Aminothiazol-(5)-aldehyden | |
| FR925954A (fr) * | 1946-04-05 | 1947-09-18 | Applic Therapeutiques Therapli | Composés thiazoliques chlorés et leur procédé de préparation |
| FR1006623A (fr) * | 1947-02-24 | 1952-04-25 | Applic Therapeutiques Soc Gen | Nouveau produit chimique, utilisable comme hypnotique, et son procédé de préparation |
| DE1182234B (de) * | 1962-11-08 | 1964-11-26 | Bayer Ag | Verfahren zur Herstellung von Thiazol-5-aldehyden |
| FR1533184A (fr) * | 1965-04-06 | 1968-07-19 | Pechiney Saint Gobain | Dérivés du thiazole |
| US3547917A (en) * | 1966-12-07 | 1970-12-15 | Uniroyal Inc | 2-amino-4-methylthiazole-5-carboxamides |
| US3444178A (en) * | 1967-06-16 | 1969-05-13 | Monsanto Co | Certain halogenated 2-(2-thiazolyl) aminofuran-5-ones |
| JPS5537555B2 (enExample) * | 1973-10-24 | 1980-09-29 | ||
| CH622541A5 (enExample) | 1976-07-12 | 1981-04-15 | Sandoz Ag | |
| US4165378A (en) * | 1977-04-20 | 1979-08-21 | Ici Americas Inc. | Guanidine derivatives of imidazoles and thiazoles |
| IE47044B1 (en) * | 1977-04-20 | 1983-12-14 | Ici Ltd | Guanidine derivatives |
| GB1583377A (en) | 1977-04-25 | 1981-01-28 | Ici Ltd | Disperse azo dyestuffs derived from a 2-aminothiophene-5-aldehyde |
| DE2805177A1 (de) * | 1978-02-08 | 1979-08-09 | Sandoz Ag | Azo-dispersionsfarbstoffe, ihre herstellung und verwendung |
| DD136147A1 (de) * | 1978-04-28 | 1979-06-20 | Harald Niegel | Verfahren zur herstellung von methin-dispersionsfarbstoffen |
-
1979
- 1979-05-03 CH CH414279A patent/CH644369A5/de not_active IP Right Cessation
-
1980
- 1980-04-19 DE DE19803015121 patent/DE3015121A1/de active Granted
- 1980-04-29 GB GB8014035A patent/GB2056969B/en not_active Expired
- 1980-04-29 FR FR8009618A patent/FR2455591A1/fr active Granted
- 1980-04-30 BR BR8002694A patent/BR8002694A/pt unknown
- 1980-04-30 IT IT48560/80A patent/IT1128154B/it active
- 1980-05-01 JP JP5716380A patent/JPS55147558A/ja active Granted
- 1980-05-02 ES ES491139A patent/ES8104261A1/es not_active Expired
-
1981
- 1981-05-15 US US06/264,019 patent/US4395544A/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3573289A (en) * | 1967-10-27 | 1971-03-30 | Eastman Kodak Co | Cationic methine compounds |
| US3829410A (en) * | 1970-03-19 | 1974-08-13 | Eastman Kodak Co | 5-(cyanovinylene)-2-thiazolylazoaniline compounds |
| GB2003495A (en) * | 1977-09-05 | 1979-03-14 | Sandoz Ltd | Improvements in or relating to organic compounds |
Non-Patent Citations (1)
| Title |
|---|
| Khim. Geterotsikl. Soedin., 1975, S.85 * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5206376A (en) * | 1990-04-02 | 1993-04-27 | Basf Aktiengesellschaft | Preparation of 2-amino-5-formyl-4-halothiazoles |
| US5298610A (en) * | 1991-06-20 | 1994-03-29 | Basf Aktiengesellschaft | Thiazoleazo dyes having a coupling component of the diphenylamine series |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2056969B (en) | 1983-12-07 |
| FR2455591A1 (fr) | 1980-11-28 |
| US4395544A (en) | 1983-07-26 |
| GB2056969A (en) | 1981-03-25 |
| ES491139A0 (es) | 1981-04-16 |
| IT8048560A0 (it) | 1980-04-30 |
| CH644369A5 (de) | 1984-07-31 |
| FR2455591B1 (enExample) | 1983-05-20 |
| IT1128154B (it) | 1986-05-28 |
| JPS55147558A (en) | 1980-11-17 |
| JPH0248554B2 (enExample) | 1990-10-25 |
| ES8104261A1 (es) | 1981-04-16 |
| BR8002694A (pt) | 1980-12-16 |
| DE3015121C2 (enExample) | 1992-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1966451C2 (de) | Basische Azoverbindungen, Verfahren zu ihrer Herstellung und Verfahren zum Färben oder Bedrucken | |
| DE3108077C2 (enExample) | ||
| DE3529831C2 (de) | Thiophen-Azofarbstoffe | |
| DE2058877A1 (de) | Oxazolyl-essigsaeurederivate und Oxazolyl-cumarine | |
| DE2929001C2 (de) | Dispersionsfarbstoffe und Verfahren zu ihrer Herstellung | |
| DE3015121A1 (de) | 4-halogen-5-formylthiazolverbindungen | |
| DE4335261C2 (de) | Dispersionsfarbstoffe | |
| DE19500228A1 (de) | Dispersionsfarbstoffe | |
| DE2856873A1 (de) | Organische verbindungen, ihre herstellung und verwendung | |
| CH433662A (de) | Tragvorrichtung für Deckenverkleidung | |
| CH622541A5 (enExample) | ||
| DE1644052A1 (de) | Verfahren zur Herstellung von neuen,wasserunloeslichen Azofarbstoffen | |
| DE2724079A1 (de) | Azofarbstoffe | |
| DE19624505A1 (de) | Dispersionsfarbstoffe | |
| CH684408A5 (de) | Azo-Dispersionsfarbstoffe. | |
| DE2616412B2 (de) | Verfahren zur Herstellung konzentrierter Lösungen basischer Farbstoffe und Mittel zum Färben von Polyacrylnitril und sauer modifizierten Polyestern oder Polyamiden | |
| DE2015172A1 (de) | Verfahren zur Herstellung wasserunlöslicher Azofarbstoffe | |
| DE1569674C (de) | Styrylfarbstoffe | |
| DE1925491A1 (de) | Basische Monoazo-Farbstoffe | |
| DE2211959A1 (de) | Indolinfarbstoffe | |
| AT260924B (de) | Verfahren zur Herstellung von neuen Pyrazolinverbindungen | |
| DE1644093A1 (de) | Verfahren zur Herstellung von wasserloeslichen basischen Azofarbstoffen | |
| AT217599B (de) | Verfahren zur Herstellung von neuen wasserlöslichen Farbsalzen | |
| DE2255525C3 (de) | Diaminopyrimidin-DispersionsazoterbsUttte, Verfahren zu deren Herstellung und Ihre Verwendung | |
| AT231032B (de) | Verfahren zur Herstellung von neuen Aminoazoverbindungen der Benzimidazolreihe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: BASF AG, 67063 LUDWIGSHAFEN, DE |
|
| 8339 | Ceased/non-payment of the annual fee | ||
| 8370 | Indication of lapse of patent is to be deleted |