CH626331A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626331A5 CH626331A5 CH854477A CH854477A CH626331A5 CH 626331 A5 CH626331 A5 CH 626331A5 CH 854477 A CH854477 A CH 854477A CH 854477 A CH854477 A CH 854477A CH 626331 A5 CH626331 A5 CH 626331A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- isopropyl
- acetal
- condensation
- nitrile
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 19
- -1 nitrile aldehyde acetal Chemical class 0.000 claims description 10
- 238000009833 condensation Methods 0.000 claims description 7
- 230000005494 condensation Effects 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000011260 aqueous acid Substances 0.000 claims description 3
- 150000007962 benzene acetonitriles Chemical class 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 4
- HNJWKRMESUMDQE-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-n-methylethanamine Chemical compound CNCCC1=CC=C(OC)C(OC)=C1 HNJWKRMESUMDQE-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 4
- 229960001722 verapamil Drugs 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ASLSUMISAQDOOB-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1OC ASLSUMISAQDOOB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- NXHONHDWVLPPCS-UHFFFAOYSA-N 3-chloro-1,1-diethoxypropane Chemical compound CCOC(CCCl)OCC NXHONHDWVLPPCS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 235000011167 hydrochloric acid Nutrition 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910018954 NaNH2 Inorganic materials 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 229910000428 cobalt oxide Inorganic materials 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- IRXRGVFLQOSHOH-UHFFFAOYSA-L dipotassium;oxalate Chemical compound [K+].[K+].[O-]C(=O)C([O-])=O IRXRGVFLQOSHOH-UHFFFAOYSA-L 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2631222A DE2631222C3 (de) | 1976-07-12 | 1976-07-12 | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626331A5 true CH626331A5 (https=) | 1981-11-13 |
Family
ID=5982752
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH854477A CH626331A5 (https=) | 1976-07-12 | 1977-07-11 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4115432A (https=) |
| JP (1) | JPS5325539A (https=) |
| BE (1) | BE856494A (https=) |
| CH (1) | CH626331A5 (https=) |
| DE (1) | DE2631222C3 (https=) |
| DK (1) | DK312477A (https=) |
| FI (1) | FI772083A7 (https=) |
| FR (1) | FR2361356A1 (https=) |
| GB (1) | GB1534213A (https=) |
| HU (1) | HU173747B (https=) |
| IE (1) | IE45162B1 (https=) |
| IL (1) | IL52343A0 (https=) |
| LU (1) | LU77709A1 (https=) |
| NL (1) | NL7707739A (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3034221A1 (de) | 1980-09-11 | 1982-04-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung basisch substituierter phenylacetonitrile |
| DE3121766A1 (de) * | 1981-06-02 | 1982-12-16 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung basisch substituierter phenylacetonitrile |
| JPS6130657A (ja) * | 1984-07-20 | 1986-02-12 | Nippon Carbon Co Ltd | 炭化ケイ素被覆炭素製品の製造方法 |
| DE3642331A1 (de) * | 1986-12-11 | 1988-06-23 | Basf Ag | Basisch substituierte phenylacetonitrile, ihre herstellung und diese enthaltende arzneimittel |
| WO1988006447A1 (en) * | 1987-02-27 | 1988-09-07 | Marvin Sackner | Method for treatment of late phase bronchoconstriction |
| DE3741415C1 (en) * | 1987-12-07 | 1989-07-06 | Luitpold Werk Chem Pharm | Use of 5-[N-(3,4-dimethoxyphenylethyl)-N-methylamino]-2-(3,4-dimethoxyphenyl) -2-isopropylvaleronitril ("verapamil") or its pharmaceutically suitable salts for the percutaneous treatment of chronic venous insufficiency |
| US5247119A (en) * | 1990-12-12 | 1993-09-21 | G. D. Searle & Co. | Phenylacetonitrilehydroxyalkylaminoalkyl-ortho-substituted aryl compounds as immunosuppressives |
| US6268377B1 (en) | 1998-09-28 | 2001-07-31 | Merck & Co., Inc. | Method for treating androgen-related conditions |
| JP5421908B2 (ja) * | 2007-06-20 | 2014-02-19 | マイルストーン ファーマシューティカルズ インコーポレーテッド | 短時間作用型フェニルアルキルアミンカルシウムチャネルブロッカーおよびその使用 |
| EP2222629A1 (en) * | 2007-12-26 | 2010-09-01 | Sicor, Inc. | Process for preparing n-methyl-3, 4 dimethoxyphenylethylamine |
| US10144703B2 (en) | 2015-05-12 | 2018-12-04 | Piramal Enterprises Limited | Process for the preparation of Verapamil hydrochloride |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1154810B (de) * | 1961-04-01 | 1963-09-26 | Knoll Ag | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile |
| US3262977A (en) * | 1962-03-10 | 1966-07-26 | Chinoin Gyogyszer Es Vegyeszet | N-aralkyl-1, 1-diphenyl-propylamine derivatives |
-
1976
- 1976-07-12 DE DE2631222A patent/DE2631222C3/de not_active Expired
-
1977
- 1977-06-20 IL IL52343A patent/IL52343A0/xx not_active IP Right Cessation
- 1977-06-28 GB GB26916/77A patent/GB1534213A/en not_active Expired
- 1977-07-04 FI FI772083A patent/FI772083A7/fi not_active Application Discontinuation
- 1977-07-05 US US05/812,898 patent/US4115432A/en not_active Expired - Lifetime
- 1977-07-05 BE BE179096A patent/BE856494A/xx not_active IP Right Cessation
- 1977-07-08 LU LU77709A patent/LU77709A1/xx unknown
- 1977-07-11 DK DK312477A patent/DK312477A/da not_active Application Discontinuation
- 1977-07-11 HU HU77KO2864A patent/HU173747B/hu not_active IP Right Cessation
- 1977-07-11 IE IE1427/77A patent/IE45162B1/en not_active IP Right Cessation
- 1977-07-11 CH CH854477A patent/CH626331A5/de not_active IP Right Cessation
- 1977-07-12 NL NL7707739A patent/NL7707739A/xx unknown
- 1977-07-12 JP JP8335077A patent/JPS5325539A/ja active Granted
- 1977-07-12 FR FR7721553A patent/FR2361356A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1534213A (en) | 1978-11-29 |
| FI772083A7 (https=) | 1978-01-13 |
| JPS5325539A (en) | 1978-03-09 |
| FR2361356B1 (https=) | 1980-02-08 |
| IE45162B1 (en) | 1982-06-30 |
| NL7707739A (nl) | 1978-01-16 |
| IE45162L (en) | 1978-01-12 |
| LU77709A1 (https=) | 1977-10-05 |
| DK312477A (da) | 1978-01-13 |
| HU173747B (hu) | 1979-08-28 |
| IL52343A0 (en) | 1977-08-31 |
| JPS616815B2 (https=) | 1986-03-01 |
| FR2361356A1 (fr) | 1978-03-10 |
| BE856494A (fr) | 1978-01-05 |
| DE2631222C3 (de) | 1979-01-04 |
| US4115432A (en) | 1978-09-19 |
| DE2631222B2 (de) | 1978-05-03 |
| DE2631222A1 (de) | 1978-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2732825A1 (de) | 2,4,6-trijodbenzoesaeurederivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende roentgenkontrastmittel | |
| CH626331A5 (https=) | ||
| DE2824116A1 (de) | Alpha -fluormethyl- alpha -amino- alkansaeuren | |
| CH417630A (de) | Verfahren zur Herstellung von neuen cyclischen 2,3-O-Acetalen und 2,3-O-Ketalen von Butantetrolestern | |
| DE2165109A1 (de) | Verfahren zur Herstellung von alpha-Methyl-beta-(3,4-dihydroxyphenyl)-alanin | |
| DE1593782B2 (de) | 1-nitrilophenoxy- 2- hydroxy -3- tert.butylaminopropane, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate | |
| DE1249851B (de) | Morel Ariesheim (Schweiz) j Verfahren zur Herstellung neuer Phenoxyessigsäure amide | |
| DE2112778A1 (de) | Verfahren zur Herstellung von 2-Cyan-3,4,5,6-tetrahalogenbenzoesaeurealkylestern | |
| AT228211B (de) | Verfahren zur Herstellung von neuen Phenothiazinderivaten, sowie von Säureadditionssalzen und quartären Salzen dieser Phenothiazinderivate | |
| DE2535766B2 (de) | Verfahren zur Herstellung von racemischem Allethrolon | |
| DE1493484C3 (de) | Verfahren zur Herstellung von L-(-)-aIpha-Methyl-beta-(3,4-dihydroxyphenyl)-alanin | |
| AT211821B (de) | Verfahren zur Herstellung Alkylaminoacetaryliden | |
| DE1593782C3 (de) | 1-Nitrilophenoxy- 2- hydroxy -3- tertbutylaminopropane, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| AT334351B (de) | Verfahren zur herstellung neuer 3- (4-biphenylyl) -buttersauren, ihrer tert. alkylester und salze | |
| DE2612506A1 (de) | 4-hydroxy-alpha- eckige klammer auf (3,4-methylendioxyphenyl)-isopropylaminomethyl eckige klammer zu -3-(methylsulfonylmethyl)-benzylalkohol | |
| AT214434B (de) | Verfahren zur Herstellung von Nitrilen | |
| DE959097C (de) | Verfahren zur Herstellung von basisch substituierten Diarylacetonitrilen | |
| AT163199B (de) | Verfahren zur Herstellung neuer Pyridin- und Piperidinverdungen | |
| AT238186B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| DE2122056A1 (de) | Verfahren zur Herstellung von reinem Viquidil | |
| DE2058237A1 (de) | Verfahren zur Herstellung von trans-4-Aminomethylcyclohexancarbonsaeure-(1) | |
| DE2128001A1 (de) | Verfahren zur Herstellung von 3,4-ungesättigten Nitrilen | |
| CH390940A (de) | Verfahren zur Herstellung von 1,4-Benzdioxanderivaten | |
| DE3934957A1 (de) | Verfahren zur herstellung von 3-trichlormethyl-pyridin | |
| CH581625A5 (en) | 2-dimethylallylbenzomorphans - analgesics |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |