CH472402A - Verfahren zur Herstellung neuer heterocyclischer Derivate - Google Patents
Verfahren zur Herstellung neuer heterocyclischer DerivateInfo
- Publication number
- CH472402A CH472402A CH1481668A CH1481668A CH472402A CH 472402 A CH472402 A CH 472402A CH 1481668 A CH1481668 A CH 1481668A CH 1481668 A CH1481668 A CH 1481668A CH 472402 A CH472402 A CH 472402A
- Authority
- CH
- Switzerland
- Prior art keywords
- heterocyclic derivatives
- preparation
- radical
- carbon atoms
- formula
- Prior art date
Links
- 125000000623 heterocyclic group Chemical group 0.000 title claims description 7
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- -1 aralkyl radical Chemical group 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LWCDQIHWIJCNLO-UHFFFAOYSA-N OC1C2=CC=CC=C2OC=2C(=CC=CC1=2)OCC(CNC(C)C)O Chemical compound OC1C2=CC=CC=C2OC=2C(=CC=CC1=2)OCC(CNC(C)C)O LWCDQIHWIJCNLO-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 description 2
- INOMMIWBMPTNFG-UHFFFAOYSA-N 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]xanthen-9-one Chemical compound OC(COC1=CC=CC=2C(C3=CC=CC=C3OC12)=O)CNC(C)C INOMMIWBMPTNFG-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- BQOWUDKEXDCGQS-UHFFFAOYSA-N [CH]1CCCC1 Chemical compound [CH]1CCCC1 BQOWUDKEXDCGQS-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/18—Ethylenedioxybenzenes, not substituted on the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D321/00—Heterocyclic compounds containing rings having two oxygen atoms as the only ring hetero atoms, not provided for by groups C07D317/00 - C07D319/00
- C07D321/02—Seven-membered rings
- C07D321/10—Seven-membered rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D321/00—Heterocyclic compounds containing rings having two oxygen atoms as the only ring hetero atoms, not provided for by groups C07D317/00 - C07D319/00
- C07D321/12—Eight-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB30135/63A GB1058822A (en) | 1963-07-30 | 1963-07-30 | 3-amino-2-hydroxypropoxy heterocyclic derivatives |
| GB199064 | 1964-01-16 | ||
| CH1587067A CH473800A (de) | 1963-07-30 | 1964-07-20 | Verfahren zur Herstellung neuer heterocyclischer Derivate |
| CH949464A CH468372A (de) | 1963-07-30 | 1964-07-20 | Verfahren zur Herstellung neuer heterocyclischer Derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH472402A true CH472402A (de) | 1969-05-15 |
Family
ID=26237125
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1481668A CH472402A (de) | 1963-07-30 | 1964-07-20 | Verfahren zur Herstellung neuer heterocyclischer Derivate |
| CH949464A CH468372A (de) | 1963-07-30 | 1964-07-20 | Verfahren zur Herstellung neuer heterocyclischer Derivate |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH949464A CH468372A (de) | 1963-07-30 | 1964-07-20 | Verfahren zur Herstellung neuer heterocyclischer Derivate |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3340266A (Direct) |
| BE (1) | BE651032A (Direct) |
| BR (1) | BR6461288D0 (Direct) |
| CH (2) | CH472402A (Direct) |
| DK (2) | DK119432B (Direct) |
| ES (1) | ES302622A1 (Direct) |
| FR (2) | FR1583153A (Direct) |
| GB (1) | GB1058822A (Direct) |
| NL (1) | NL139234B (Direct) |
| SE (4) | SE316781C (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0003758A1 (de) * | 1978-02-09 | 1979-09-05 | Ciba-Geigy Ag | Verätherte Hydroxy-benzodiheterocyclen und ihre Säureadditionssalze, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3509170A (en) * | 1967-06-12 | 1970-04-28 | Du Pont | Heterocyclic amino-oxazolines |
| GB1253709A (en) * | 1968-05-22 | 1971-11-17 | Frosst & Co Charles E | Thiadiazole derivatives |
| US3655661A (en) * | 1968-05-22 | 1972-04-11 | Frosst & Co Charles E | Benzothiadiazole compounds |
| US3668206A (en) * | 1968-10-16 | 1972-06-06 | Venkatachala Lakshmi Narayanan | Heterocyclic amine derivatives of 5,8-dihydronaphthyloxy propanols |
| GB1308191A (en) * | 1970-04-06 | 1973-02-21 | Science Union & Cie | Thiochroman derivatives and a process for preparing them |
| CA989411A (en) * | 1971-05-13 | 1976-05-18 | Kakenyaku Kako Co. | Benzofuran derivatives and preparation thereof |
| US3910924A (en) * | 1972-04-13 | 1975-10-07 | Otsuka Pharma Co Ltd | 3,4-Dihydrocarbostyril derivatives and a process for preparing the same |
| JPS48103590A (Direct) * | 1972-04-13 | 1973-12-25 | ||
| US3856818A (en) * | 1972-07-03 | 1974-12-24 | Squibb & Sons Inc | Tricyclic phenoxy aminopropanols |
| AR207554A1 (es) * | 1972-12-02 | 1976-10-15 | Otsuka Pharma Co Ltd | Procedimiento para producir derivados de 3-alquil-5-((3,4-dihidro-5-carbostiril)oximetil)-oxazolidinona-(2) |
| JPS5239035B2 (Direct) * | 1972-12-14 | 1977-10-03 | ||
| US4073909A (en) * | 1973-10-08 | 1978-02-14 | Sandoz Ltd. | Isoquinoline compounds |
| US3894058A (en) * | 1974-05-17 | 1975-07-08 | Hoechst Co American | Tetrahydrobenzofuranylphenoxypropylamines |
| GB1521471A (en) * | 1974-06-05 | 1978-08-16 | Randall & Son Ltd J | Token-deposit locks |
| FI59246C (fi) * | 1974-06-24 | 1981-07-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av benscykloamidderivat anvaendbara vid trombos- och emboliterapin |
| GB1472959A (en) * | 1974-09-26 | 1977-05-11 | Roche Products Ltd | Benzofuran derivatives and a process for the manufacture thereof |
| FI58329C (fi) * | 1974-11-08 | 1981-01-12 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av i 8-staellning substituerade 5-(3'-alkylamino-2'-hydroxi)propoxi-3,4-dihydrokarbostyrilderivat |
| AR206061A1 (es) * | 1974-11-15 | 1976-06-23 | Knoll Ag | Procedimiento para la produccion de nuevas 2-alcanoil (c1-c4)-1, 2, 3, 4-tetrahidro-8-respectivamente 7-, 6- o 5-(2-hidroxi-3-alquil (c3-c4)-aminopropoxi)-isoquinolinas de 2-alcanoil (c1-c4)-1, 2, 3, 4-tetrahidro-8-respectivamente 7- o 5-(2-hidroxi-3-alquil (c3-c4)-aminopropoxi)-6-metoxi-isoquinolinas y de 2-alcanoil (c1-c4)-1, 2, 3, 4-tetrahidro-8-respectivamente 6- o 5-(2-hidroxi-3-alquil (c3-c4)-aminopropoxi)-7-metoxi-isoquinolinas eventualmente metiladas en la posicion 1 |
| BE839967R (fr) * | 1975-03-26 | 1976-09-24 | Nouveaux derives de l'isoquinoleine, leur preparation et leur application comme medicaments | |
| DK116976A (da) * | 1975-03-26 | 1976-09-27 | Sandoz Ag | Fremgangsmade til fremstilling af isoquinolinderivater |
| US4081447A (en) * | 1975-04-09 | 1978-03-28 | Abbott Laboratories | 5-[2-Hydroxy-3-(3,4-dimethoxy phenethylamino)]-propoxy-3,4-dihydro carbostyril and pharmaceutically acceptable salts thereof |
| GB1504424A (en) * | 1975-08-09 | 1978-03-22 | Beecham Group Ltd | Isoquinoline-derived aminoethers |
| CA1089866A (en) * | 1975-10-20 | 1980-11-18 | Kiyoshi Ito | Benzofuran derivatives, preparation thereof and pharmaceutical compositions thereof |
| US4139537A (en) | 1976-06-29 | 1979-02-13 | Cooper Laboratories, Inc. | 3-Aryloxy-1-(2- or 4-iminodihydro-1-pyridyl)-2-propanol antiarrhythmic compounds |
| DE2704793C2 (de) * | 1977-02-05 | 1979-03-08 | Basf Ag, 6700 Ludwigshafen | 4-Hydroxy-l,2-benzisothiazole |
| DE2704794C3 (de) * | 1977-02-05 | 1979-10-11 | Basf Ag, 6700 Ludwigshafen | Aminopropanolderivate des 4-Hydroxy-l^-benzisothiazols |
| NZ187066A (en) * | 1977-05-03 | 1981-02-11 | Hoffmann La Roche | 4-(3-substitutedamino-2-hydroxypropoxy)-benzimidazolidin-2-(ones or thiones) |
| US4235919A (en) * | 1977-07-21 | 1980-11-25 | Sandoz Ltd. | 1-(Indol-4-yloxy)-3-(2-substituted amino)-2-propanols and pharmaceutical use thereof |
| DE2801980A1 (de) * | 1978-01-18 | 1979-07-19 | Boehringer Mannheim Gmbh | 4-hydroxy-2-benzimidazolin-thion- derivate, verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel |
| US4202978A (en) * | 1978-02-08 | 1980-05-13 | Hoffmann-La Roche Inc. | (S)-1-[2-(4-(2-Hydroxy-s-(1-alkylaminopropoxy)phenylalkyl]-4-phenylpiperazines |
| DE2901336A1 (de) | 1979-01-15 | 1980-07-24 | Boehringer Mannheim Gmbh | Neue arylether, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| IE810250L (en) * | 1980-02-11 | 1981-08-11 | Berlex Lab | N-(3-phenoxy-2-hydroxypropyl) benzimidazole -1-¹alkanamines. |
| FR2479825A1 (fr) * | 1980-04-04 | 1981-10-09 | Fabre Sa Pierre | Benzodioxanne 1,4 methoxy-2 propanolamines, leur preparation et leur application en tant que medicaments |
| US4472427A (en) * | 1980-12-23 | 1984-09-18 | Merck & Co., Inc. | (Aralkylamino-2-OR-propoxy)heterocyclic compounds |
| CA1188311A (en) * | 1981-05-01 | 1985-06-04 | Edwin S. Wu | Antihypertensive agents |
| US4473501A (en) * | 1981-05-04 | 1984-09-25 | G. D. Searle & Co. | Dihydro azino isoquinolines |
| US4471128A (en) * | 1981-09-08 | 1984-09-11 | Ciba-Geigy Corporation | 1,5-Bis-(1,4-benzodioxin-2-yl)-3-azapentane-1,5-diols |
| JPS5846079A (ja) * | 1981-09-12 | 1983-03-17 | Santen Pharmaceut Co Ltd | ベンゾチアゾリン環を有するエ−テル類 |
| FR2588260B1 (fr) * | 1985-10-04 | 1987-11-20 | Adir | Nouveau derive du thiochromanne, son procede de preparation et les compositions pharmaceutiques qui le contiennent |
| DK630987D0 (da) * | 1987-12-01 | 1987-12-01 | Ferrosan As | Aryloxyphenylpropylaminer, deres fremstilling og anvendelse |
| DK391189A (da) * | 1988-08-10 | 1990-02-11 | Otsuka Pharma Co Ltd | Carbostyrilderivater |
| US5198448A (en) * | 1988-08-10 | 1993-03-30 | Otsuka Pharmaceutical Company, Limited | Cardiotonics |
| US5266577A (en) * | 1988-08-10 | 1993-11-30 | Otsuka Pharmaceutical Company Ltd. | Method of treating congestive heart failure using carbostyril derivatives |
| FR2746395B1 (fr) * | 1996-03-22 | 1998-04-17 | Adir | Nouveaux derives d'arylethanolamine et d'aryloxypropanolamine, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| WO1997037967A1 (en) * | 1996-04-09 | 1997-10-16 | Nps Pharmaceuticals, Inc. | Calcilytic compounds |
| US6818660B2 (en) | 1996-04-09 | 2004-11-16 | Nps Pharmaceuticals, Inc. | Calcilytic compounds |
| US7202261B2 (en) | 1996-12-03 | 2007-04-10 | Nps Pharmaceuticals, Inc. | Calcilytic compounds |
| TW483881B (en) | 1996-12-03 | 2002-04-21 | Nps Pharma Inc | Calcilytic compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2807567A (en) * | 1953-06-02 | 1957-09-24 | Saul & Co | Preparation for the treatment of allergic diseases |
| US2872374A (en) * | 1955-02-02 | 1959-02-03 | Nat Drug Co | Muscle-relaxing tranquilizer compositions |
| US2984668A (en) * | 1958-07-31 | 1961-05-16 | Searle & Co | 3-(2-hydroxyethyl)-4-methyl-5-phenyloxazolidine and certain esters |
| US3198806A (en) * | 1963-08-07 | 1965-08-03 | Dow Chemical Co | 2-alkoxy-2-oxazolines |
-
1963
- 1963-07-30 GB GB30135/63A patent/GB1058822A/en not_active Expired - Lifetime
-
1964
- 1964-07-20 CH CH1481668A patent/CH472402A/de not_active IP Right Cessation
- 1964-07-20 US US383940A patent/US3340266A/en not_active Expired - Lifetime
- 1964-07-20 CH CH949464A patent/CH468372A/de unknown
- 1964-07-27 BE BE651032A patent/BE651032A/xx unknown
- 1964-07-29 SE SE922764A patent/SE316781C/xx unknown
- 1964-07-29 NL NL646408650A patent/NL139234B/xx unknown
- 1964-07-29 SE SE7992/66A patent/SE316488B/xx unknown
- 1964-07-30 BR BR161288/64A patent/BR6461288D0/pt unknown
- 1964-07-30 FR FR1583153D patent/FR1583153A/fr not_active Expired - Lifetime
- 1964-07-30 DK DK377564AA patent/DK119432B/da unknown
- 1964-07-30 ES ES0302622A patent/ES302622A1/es not_active Expired
- 1964-10-29 FR FR993196A patent/FR4161M/fr not_active Expired
-
1965
- 1965-12-03 DK DK623065AA patent/DK111267B/da unknown
-
1966
- 1966-06-10 SE SE799066A patent/SE316486C/xx unknown
- 1966-06-10 SE SE799166A patent/SE316487C/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0003758A1 (de) * | 1978-02-09 | 1979-09-05 | Ciba-Geigy Ag | Verätherte Hydroxy-benzodiheterocyclen und ihre Säureadditionssalze, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate |
Also Published As
| Publication number | Publication date |
|---|---|
| US3340266A (en) | 1967-09-05 |
| CH468372A (de) | 1969-02-15 |
| FR1583153A (Direct) | 1969-10-24 |
| DK119432B (da) | 1971-01-04 |
| DK111267B (da) | 1968-07-15 |
| SE316486C (sv) | 1972-11-13 |
| NL139234B (nl) | 1973-07-16 |
| SE316488B (Direct) | 1969-10-27 |
| DE1493853A1 (de) | 1969-06-04 |
| NL6408650A (Direct) | 1965-02-01 |
| SE316486B (sv) | 1969-10-27 |
| SE316487B (sv) | 1969-10-27 |
| SE316781C (sv) | 1972-11-13 |
| SE316487C (sv) | 1972-11-13 |
| GB1058822A (en) | 1967-02-15 |
| BR6461288D0 (pt) | 1973-08-09 |
| FR4161M (Direct) | 1966-05-16 |
| SE316781B (sv) | 1969-11-03 |
| BE651032A (Direct) | 1965-01-27 |
| ES302622A1 (es) | 1965-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH472402A (de) | Verfahren zur Herstellung neuer heterocyclischer Derivate | |
| DE2024001C3 (de) | Tetrahydrofurfuryloxyphenoxypropanolamine und deren pharmakologisch vertragliche Säureadditionssalze und Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| CH515212A (de) | Verfahren zur Herstellung von Alkanolaminderivaten | |
| DE1493856B2 (de) | 1-aryloxy-3-(n-alkylamino)-2-propanole, verfahren zu ihrer herstellung und diese verbindungen enthaltende pharmazeutische mittel | |
| CH447151A (de) | Verfahren zur Herstellung homocyclischer Verbindungen | |
| CH622491A5 (en) | Process for the preparation of novel hydroxypropylamines | |
| DE1212090B (de) | Verfahren zur Herstellung von 10-(Piperazinopropyl)-3-trifluormethyl-phenothiazinverbindungen und ihren Salzen | |
| DE1620007C3 (de) | Decahydroisochinoline | |
| DE1285478B (de) | Verfahren zur Herstellung von neuen 5, 6, 7, 8-Tetrahydropyrido-[4, 3-d]pyrimidinen | |
| CH473800A (de) | Verfahren zur Herstellung neuer heterocyclischer Derivate | |
| DE2822473C2 (de) | Alkanolaminderivate und pharmazeutische Mittel, welche diese Alkanolaminderivate enthalten | |
| DE2638849C2 (de) | 2-Aminopropionsäure-2-trifluormethylphenyl-1,1-dimethyläthylester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2328758C2 (de) | 4,4-Diphenyl-2-methyl-2-hydroxybutylamine und diese enthaltende therapeutische Zubereitungen | |
| AT250375B (de) | Verfahren zur Herstellung von neuen 3-Amino-2-hydroxypropoxyderivaten heterocyclischer Verbindungen | |
| AT283315B (de) | Verfahren zur herstellung von neuen, gemischt substituierten 1-phenoxy-3-alkylaminopropanolen-(2) und deren saeureadditionssalzen | |
| AT246735B (de) | Verfahren zur Herstellung von neuen Naphthalinderivaten und deren Salzen | |
| AT306045B (de) | Verfahren zur Herstellung von neuen Morpholinderivaten und ihren Salzen | |
| AT202147B (de) | Verfahren zur Herstellung von neuen Piperazinderivaten und von deren Salzen | |
| AT252219B (de) | Verfahren zur Herstellung von neuen Alkanolaminderivaten und deren Salzen | |
| AT226723B (de) | Verfahren zur Umwandlung von Thiaxanthenen | |
| AT290503B (de) | Verfahren zur Herstellung von neuen 1-(4'-Acylaminophenoxy)-2-hydroxy-3-aminopropanen und von deren Säureadditionssalzen | |
| DE1543673C3 (de) | Basisch substituierte Benzofuranderivate und deren pharmazeutisch verträgliche Säureadditionssalze sowie Verfahren zu deren Herstellung und Arzneimittel mit einem Gehalt dieser Verbindungen | |
| CH518258A (de) | Verfahren zur Herstellung von Naphthalinderivaten | |
| DE1203786B (de) | Verfahren zur Herstellung von Benzilsaeure-[pyrrolidyl-(2)]-methylestern und deren quaternaeren Ammoniumverbindungen | |
| DE1142614B (de) | Verfahren zur Herstellung von Benzhydrylaethern des Tropins, deren Salzen und quaternaeren Ammoniumverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |