CH395136A - Verfahren zur Herstellung von Xanthenen oder Thiaxanthenen - Google Patents
Verfahren zur Herstellung von Xanthenen oder ThiaxanthenenInfo
- Publication number
- CH395136A CH395136A CH8148359A CH8148359A CH395136A CH 395136 A CH395136 A CH 395136A CH 8148359 A CH8148359 A CH 8148359A CH 8148359 A CH8148359 A CH 8148359A CH 395136 A CH395136 A CH 395136A
- Authority
- CH
- Switzerland
- Prior art keywords
- solution
- ether
- formula
- ethanol
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 22
- 150000003732 xanthenes Chemical class 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 48
- 239000000203 mixture Substances 0.000 claims description 39
- 239000011541 reaction mixture Substances 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 33
- 239000002253 acid Substances 0.000 claims description 23
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 230000008030 elimination Effects 0.000 claims description 13
- 238000003379 elimination reaction Methods 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 10
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 5
- 239000012433 hydrogen halide Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000012024 dehydrating agents Substances 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000000047 product Substances 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims 1
- 125000004193 piperazinyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 170
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 138
- 239000000243 solution Substances 0.000 description 86
- 239000002585 base Substances 0.000 description 53
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 41
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 239000000155 melt Substances 0.000 description 33
- 238000002844 melting Methods 0.000 description 33
- 230000008018 melting Effects 0.000 description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- 239000000126 substance Substances 0.000 description 24
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 21
- 238000001953 recrystallisation Methods 0.000 description 20
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- 238000001816 cooling Methods 0.000 description 14
- 239000003921 oil Substances 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 150000003840 hydrochlorides Chemical class 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 238000000354 decomposition reaction Methods 0.000 description 11
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 10
- 239000006188 syrup Substances 0.000 description 10
- 235000020357 syrup Nutrition 0.000 description 10
- -1 N'-substituted piperazine ring Chemical group 0.000 description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- 239000012458 free base Substances 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 8
- 230000008025 crystallization Effects 0.000 description 8
- 230000007062 hydrolysis Effects 0.000 description 8
- 238000006460 hydrolysis reaction Methods 0.000 description 8
- 239000012452 mother liquor Substances 0.000 description 8
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 7
- 239000012346 acetyl chloride Substances 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- DQEUYIQDSMINEY-UHFFFAOYSA-M magnesium;prop-1-ene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C=C DQEUYIQDSMINEY-UHFFFAOYSA-M 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000011777 magnesium Substances 0.000 description 6
- 229910052749 magnesium Inorganic materials 0.000 description 6
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 5
- 230000018044 dehydration Effects 0.000 description 5
- 238000006297 dehydration reaction Methods 0.000 description 5
- 235000006408 oxalic acid Nutrition 0.000 description 5
- 229940095064 tartrate Drugs 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 4
- 229960001076 chlorpromazine Drugs 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 230000003472 neutralizing effect Effects 0.000 description 4
- 230000003285 pharmacodynamic effect Effects 0.000 description 4
- GSFKAJUYCSTAMQ-UHFFFAOYSA-N 3-(2-chloro-2H-thiopyrano[3,2-b]chromen-10-ylidene)-N,N-dimethylpropan-1-amine Chemical compound ClC1SC=2C(C3=CC=CC=C3OC2C=C1)=CCCN(C)C GSFKAJUYCSTAMQ-UHFFFAOYSA-N 0.000 description 3
- WBPLTQQNDDDJSI-UHFFFAOYSA-N 3-(2-methoxy-2H-thiopyrano[3,2-b]chromen-10-ylidene)-N,N-dimethylpropan-1-amine Chemical compound COC1SC=2C(C3=CC=CC=C3OC2C=C1)=CCCN(C)C WBPLTQQNDDDJSI-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 230000037023 motor activity Effects 0.000 description 3
- 150000003892 tartrate salts Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- JFRMYMMIJXLMBB-UHFFFAOYSA-N xanthydrol Chemical class C1=CC=C2C(O)C3=CC=CC=C3OC2=C1 JFRMYMMIJXLMBB-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- ZCDADJXRUCOCJE-UHFFFAOYSA-N 2-chlorothioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3SC2=C1 ZCDADJXRUCOCJE-UHFFFAOYSA-N 0.000 description 2
- CVEKPEDQESUNSP-UHFFFAOYSA-N 3-(2-methoxyxanthen-9-ylidene)-n,n-dimethylpropan-1-amine Chemical class C1=CC=C2C(=CCCN(C)C)C3=CC(OC)=CC=C3OC2=C1 CVEKPEDQESUNSP-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- IHUVVJPEMFITJC-UHFFFAOYSA-N BrC1SC=2C(C3=CC=CC=C3OC2C=C1)=CCCN(C)C Chemical class BrC1SC=2C(C3=CC=CC=C3OC2C=C1)=CCCN(C)C IHUVVJPEMFITJC-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- JCIMJENMZXHYMT-UHFFFAOYSA-N acetic acid boric acid Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.OB(O)O JCIMJENMZXHYMT-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 2
- YRHRIQCWCFGUEQ-UHFFFAOYSA-N thioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3SC2=C1 YRHRIQCWCFGUEQ-UHFFFAOYSA-N 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 description 2
- DPSDUGKUPNOKCP-UHFFFAOYSA-N 2,8-dichloro-2H-thiopyrano[3,2-b]chromen-10-one Chemical compound ClC1SC=2C(C3=CC(=CC=C3OC2C=C1)Cl)=O DPSDUGKUPNOKCP-UHFFFAOYSA-N 0.000 description 1
- OPFMCJRJNSEKHA-UHFFFAOYSA-N 2-bromothiopyrano[3,2-b]chromene Chemical compound BrC=1SC2=CC3=CC=CC=C3OC2=CC1 OPFMCJRJNSEKHA-UHFFFAOYSA-N 0.000 description 1
- YNIYMLAHPDIBGJ-UHFFFAOYSA-N 2-butylsulfanyl-2H-thiopyrano[3,2-b]chromen-10-one Chemical compound C(CCC)SC1SC=2C(C3=CC=CC=C3OC2C=C1)=O YNIYMLAHPDIBGJ-UHFFFAOYSA-N 0.000 description 1
- PRWJZNITVOUZBU-UHFFFAOYSA-N 2-chloroxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3OC2=C1 PRWJZNITVOUZBU-UHFFFAOYSA-N 0.000 description 1
- GXKBCRHGDRCZLU-UHFFFAOYSA-N 2-methoxy-2H-thiopyrano[3,2-b]chromen-10-one Chemical compound COC1SC=2C(C3=CC=CC=C3OC2C=C1)=O GXKBCRHGDRCZLU-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZDMLKNMVUCBMQS-UHFFFAOYSA-N 3-(2-chloro-2H-thiopyrano[3,2-b]chromen-10-ylidene)-N-methylpropan-1-amine Chemical class ClC1SC=2C(C3=CC=CC=C3OC2C=C1)=CCCNC ZDMLKNMVUCBMQS-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- YNIFSGYVEVLTDH-UHFFFAOYSA-N ClC1=CC=2C(C3=CC=CC=C3OC2C=C1)=CCCN(C)C Chemical compound ClC1=CC=2C(C3=CC=CC=C3OC2C=C1)=CCCN(C)C YNIFSGYVEVLTDH-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 208000000269 Hyperkinesis Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010029333 Neurosis Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 208000001431 Psychomotor Agitation Diseases 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- 206010038743 Restlessness Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 229960004543 anhydrous citric acid Drugs 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229940125717 barbiturate Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000003001 depressive effect Effects 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 229960005139 epinephrine Drugs 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003015 phosphoric acid halides Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical group [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/10—Dibenzothiopyrans; Hydrogenated dibenzothiopyrans
- C07D335/12—Thioxanthenes
- C07D335/20—Thioxanthenes with hydrocarbon radicals, substituted by amino radicals, directly attached in position 9
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/90—Xanthenes with hydrocarbon radicals, substituted by amino radicals, directly attached in position 9
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK447758 | 1958-12-04 | ||
| DK291959A DK107356C (da) | 1959-08-14 | 1959-08-14 | Fremgangsmåde til fremstilling af i 9-stillingen substituerede thiaxantener eller syreadditionssalte heraf. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH395136A true CH395136A (de) | 1965-07-15 |
Family
ID=26066806
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH8148359A CH395136A (de) | 1958-12-04 | 1959-12-04 | Verfahren zur Herstellung von Xanthenen oder Thiaxanthenen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3116291A (Direct) |
| BE (1) | BE585338A (Direct) |
| CH (1) | CH395136A (Direct) |
| DE (1) | DE1418517C2 (Direct) |
| ES (1) | ES253916A1 (Direct) |
| FR (1) | FR505M (Direct) |
| GB (1) | GB932494A (Direct) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3189657A (en) * | 1960-11-03 | 1965-06-15 | Lilly Co Eli | 5-(3-bromopropylidene) dibenzo-[a, d] cyclohepta (1.4)diene |
| CH410961A (de) * | 1961-02-22 | 1966-04-15 | Yoshitomi Pharmaceutical | Verfahren zur Herstellung N-substituierter Piperazinderivate |
| US3285919A (en) * | 1961-05-10 | 1966-11-15 | Sahyun Melville | Piperazinyl alkyl thiaxanthene derivatives |
| NL283292A (Direct) * | 1961-09-29 | |||
| GB1013901A (en) * | 1962-01-26 | 1965-12-22 | Kefalas As | Dihydroanthracene, dibenzocycloheptadiene and dibenzocycloheptatriene derivatives |
| US3609167A (en) * | 1962-04-02 | 1971-09-28 | Smith Kline French Lab | IBENZO{8 b,e{9 {0 THIEPINES |
| US3309404A (en) * | 1962-04-04 | 1967-03-14 | Merck & Co Inc | Derivatives of dibenzocycloheptenes and a process for their preparation |
| US3281469A (en) * | 1962-08-10 | 1966-10-25 | Lilly Co Eli | Process for preparing 5-hydroxy-5-(3-aminoalkynyl) dibenzo [a, d] cyclohepta [1, 4] denes |
| US3282930A (en) * | 1962-08-17 | 1966-11-01 | Smith Kline French Lab | Hydroxyalkylenepiperazine derivatives and analogs thereof |
| US3337407A (en) * | 1965-02-24 | 1967-08-22 | Merck & Co Inc | Uricosuric agent |
| US3474150A (en) * | 1966-10-31 | 1969-10-21 | Merck & Co Inc | Method for the production of 5-gamma-hydroxy - propylidene - substituted dibenzocycloheptenes |
| US3530116A (en) * | 1967-08-21 | 1970-09-22 | Merck & Co Inc | 3(4h)-oxo-2h-thiaxantheno (9,9alpha,1-ef)-1,4-diazepin-8,8-dioxides |
| US3681346A (en) * | 1969-06-20 | 1972-08-01 | Kefalas As | {60 -isomer of the decanoic acid ester of 10-{8 3,-(4-hydroxyethyl-1-piperazinyl)propylidene{9 -2-trifluoro-methyl thiaxanthene, acid addition salts thereof, method of use and compositions |
| GB1453828A (en) * | 1972-12-08 | 1976-10-27 | Kefalas As | Fluoro-substituted thiaxanthene derivatives |
| US4044024A (en) * | 1972-12-08 | 1977-08-23 | Kefalas A/S | Thiaxanthene derivatives |
| CA1010870A (en) * | 1972-12-08 | 1977-05-24 | Niels Lassen | Thiaxanthene derivative and method |
| GB1469108A (en) * | 1973-06-25 | 1977-03-30 | Kefalas As | Thiaxanthene derivative |
| US4076714A (en) * | 1974-11-25 | 1978-02-28 | Merck & Co., Inc. | 1-Methyl-4-(2-carboxy-thioxanthen-9-ylidene)-piperidine an appetite stimulant and antihistaminic agent |
| US4013660A (en) * | 1975-10-30 | 1977-03-22 | Warner-Lambert Company | Indolobenzoxazepines |
| NZ189108A (en) * | 1977-12-29 | 1982-02-23 | Kefalas As | 2-methylthio-6-fluoro-9-(1-methyl-4-piperidylidene)-thioxanthene and pharmaceutical compositions intermediate 2-methylthio-6-fluoro-9-(1-methyl-4-piperidyl)-thioxanthen-9-ol |
| GB8628903D0 (en) * | 1986-12-03 | 1987-01-07 | Lunbeck A S H | Neuroleptic compounds |
| CN103214453A (zh) * | 2013-04-12 | 2013-07-24 | 张家港威胜生物医药有限公司 | 珠氯噻醇的分离纯化方法 |
| CN105348256B (zh) * | 2015-11-16 | 2018-01-30 | 成都倍特药业有限公司 | 一种药用级盐酸氟哌噻吨的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2996503A (en) * | 1955-09-23 | 1961-08-15 | Merck & Co Inc | Derivatives of heterocyclic compounds |
| DE1044103B (de) * | 1956-06-12 | 1958-11-20 | Hoffmann La Roche | Verfahren zur Herstellung von Xanthen- bzw. Thioxanthenderivaten |
| BE557002A (Direct) * | 1956-07-09 | |||
| US2985654A (en) * | 1956-08-09 | 1961-05-23 | Schering Corp | Piperazino derivatives and methods for their manufacture |
| NL102488C (Direct) * | 1957-07-18 | |||
| NL112100C (Direct) * | 1959-06-08 | 1900-01-01 |
-
0
- BE BE585338D patent/BE585338A/xx unknown
-
1959
- 1959-12-01 US US856353A patent/US3116291A/en not_active Expired - Lifetime
- 1959-12-03 GB GB41173/59A patent/GB932494A/en not_active Expired
- 1959-12-03 DE DE1959K0039339 patent/DE1418517C2/de not_active Expired
- 1959-12-03 ES ES0253916A patent/ES253916A1/es not_active Expired
- 1959-12-04 CH CH8148359A patent/CH395136A/de not_active IP Right Cessation
-
1960
- 1960-08-30 FR FR837271A patent/FR505M/fr active Active
Also Published As
| Publication number | Publication date |
|---|---|
| US3116291A (en) | 1963-12-31 |
| DE1795506A1 (de) | 1972-02-10 |
| DE1418517C2 (de) | 1971-05-27 |
| DE1418517B1 (de) | 1970-10-22 |
| GB932494A (en) | 1963-07-31 |
| DE1795506B2 (de) | 1975-12-18 |
| BE585338A (Direct) | |
| ES253916A1 (es) | 1960-05-01 |
| FR505M (Direct) | 1961-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH395136A (de) | Verfahren zur Herstellung von Xanthenen oder Thiaxanthenen | |
| DE3001328C2 (Direct) | ||
| DE1470157A1 (de) | Verfahren zur Herstellung substituierter Thioxanthensulfonamide und ihrer Saeureanlagerungssalze | |
| AT215424B (de) | Verfahren zur Herstellung von Xanthenen bzw. Thiaxanthenen | |
| AT202143B (de) | Verfahren zur Herstellung von neuen Dimethylaminopropylidenxanthenen | |
| CH369759A (de) | Verfahren zur Herstellung von N-Alkylpiperidin-a-carbonsäureaniliden | |
| DE1470157C (de) | 2 Dimethylsulfat!^ 9 eckige Klammer auf 3 (4 methylpiperazino)-propyliden ecki ge Klammer zu thioxanthen, dessen eis/ trans Isomere, deren Salze und Verfahren zur Herstellung dieser Verbindungen | |
| AT226723B (de) | Verfahren zur Umwandlung von Thiaxanthenen | |
| AT216003B (de) | Verfahren zur Herstellung von basisch substituierten Thiaxanthenen sowie von deren Säureadditionssalzen | |
| AT211001B (de) | Verfahren zur Herstellung von neuen Scopin-äthern | |
| AT225196B (de) | Verfahren zur Herstellung des neuen 2,4-Diamino-1-p-chlorphenyl-6,6-3'-methylpentamethylen-1,6-dihydro-s-triazins und seiner Säureadditionssalze | |
| AT214929B (de) | Verfahren zur Herstellung von in 9-Stellung substituierten Thiaxanthenen und deren sauren Additionssalzen | |
| AT201783B (de) | Verfahren zur Herstellung von neuen ätherartigen Derivaten der Tropanreihe | |
| AT265530B (de) | Verfahren zur Herstellung von neuen Isochinolinderivaten | |
| DE2628042B2 (de) | 3-Amino-tricyclo [53.1.0.3A1 -undecan, dessen Säureadditionssalze und Verfahren zur Herstellung dieser Verbindungen | |
| AT233010B (de) | Verfahren zur Herstellung von neuen Benzo-dihydro-1, 2, 4-thiadiazin-1, 1-dioxyden | |
| AT266075B (de) | Verfahren zur Herstellung von neuen Sulfonaniliden und deren Säureadditions- und Metallsalzen | |
| AT218017B (de) | Verfahren zur Herstellung von Ketonen des 4-Hydroxy-cumarins | |
| DE2129991C3 (de) | Verfahren zur Herstellung von 2-(4,5-Dihydro-5-propyl-2(3H)-furyliden) -1,3-cyclopentandion | |
| AT266108B (de) | Verfahren zur Herstellung der neuen 6,7-Dihyroxycumarin-4-methylsulfonsäure und ihrer Salze | |
| AT260920B (de) | Verfahren zur Herstellung von neuen Benzofuranderivaten und ihren Salzen | |
| AT235268B (de) | Verfahren zur Herstellung sekundärer bzw. tertiärer Amine und deren Additionssalze mit Säuren | |
| DE889156C (de) | Verfahren zur Herstellung von Xanthopterinen | |
| AT337199B (de) | Verfahren zur herstellung von neuen, tricyclischen kondensierten imidazol-derivaten | |
| DE1033652B (de) | Verfahren zur Spaltung von racemischem ª‡-Oxy-ª‰, ª‰-dimethyl-ª†-butyrolacton in seine d(-)- und 1(+)-Stereomeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |