CA1321580C - Cephem and cepham compounds and processes for preparation thereof - Google Patents
Cephem and cepham compounds and processes for preparation thereofInfo
- Publication number
- CA1321580C CA1321580C CA000298883A CA298883A CA1321580C CA 1321580 C CA1321580 C CA 1321580C CA 000298883 A CA000298883 A CA 000298883A CA 298883 A CA298883 A CA 298883A CA 1321580 C CA1321580 C CA 1321580C
- Authority
- CA
- Canada
- Prior art keywords
- formula
- compound
- carboxy
- hydrogen
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 109
- 150000001782 cephems Chemical class 0.000 title claims abstract description 8
- 238000002360 preparation method Methods 0.000 title claims description 19
- 150000001781 cephams Chemical class 0.000 title abstract description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 303
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 198
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 112
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 110
- 239000001257 hydrogen Substances 0.000 claims abstract description 110
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 97
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 80
- 150000002367 halogens Chemical class 0.000 claims abstract description 79
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 45
- 125000000335 thiazolyl group Chemical group 0.000 claims abstract description 33
- 125000005179 haloacetyl group Chemical group 0.000 claims abstract description 26
- 125000001113 thiadiazolyl group Chemical group 0.000 claims abstract description 25
- 125000002252 acyl group Chemical group 0.000 claims abstract description 22
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 claims abstract description 19
- QHTOIDKCEPKVCM-ZCFIWIBFSA-N cepham Chemical compound S1CCCN2C(=O)C[C@H]21 QHTOIDKCEPKVCM-ZCFIWIBFSA-N 0.000 claims abstract description 12
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims abstract description 10
- 150000002431 hydrogen Chemical group 0.000 claims abstract 48
- 125000001931 aliphatic group Chemical group 0.000 claims abstract 26
- -1 amino, formamido Chemical group 0.000 claims description 260
- 150000003839 salts Chemical class 0.000 claims description 178
- 239000002253 acid Substances 0.000 claims description 58
- UMGDCJDMYOKAJW-UHFFFAOYSA-N aminothiocarboxamide Natural products NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 39
- 239000003795 chemical substances by application Substances 0.000 claims description 35
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 28
- 238000004519 manufacturing process Methods 0.000 claims description 25
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 21
- 150000002148 esters Chemical class 0.000 claims description 19
- 230000007062 hydrolysis Effects 0.000 claims description 18
- 238000006460 hydrolysis reaction Methods 0.000 claims description 18
- 239000011541 reaction mixture Substances 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 17
- 125000000304 alkynyl group Chemical group 0.000 claims description 16
- 125000006239 protecting group Chemical group 0.000 claims description 15
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 13
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 12
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 10
- 238000003379 elimination reaction Methods 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 claims description 5
- 230000002140 halogenating effect Effects 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- ADLFUPFRVXCDMO-GILAUPEISA-M sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)[O-])C1=O)=NOC.[Na+] ADLFUPFRVXCDMO-GILAUPEISA-M 0.000 claims description 4
- 235000010288 sodium nitrite Nutrition 0.000 claims description 4
- QITDACOZCQXYQY-BAFYGKSASA-N (6r)-7-amino-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C(N)[C@H]21 QITDACOZCQXYQY-BAFYGKSASA-N 0.000 claims description 3
- 125000004512 1,2,3-thiadiazol-4-yl group Chemical group S1N=NC(=C1)* 0.000 claims description 3
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 3
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229930186147 Cephalosporin Natural products 0.000 claims 3
- 125000004442 acylamino group Chemical group 0.000 claims 3
- 229940124587 cephalosporin Drugs 0.000 claims 3
- 150000001780 cephalosporins Chemical class 0.000 claims 3
- 239000003638 chemical reducing agent Substances 0.000 claims 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 150000001768 cations Chemical group 0.000 claims 1
- 150000003951 lactams Chemical class 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 238000010561 standard procedure Methods 0.000 claims 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims 1
- 230000000845 anti-microbial effect Effects 0.000 abstract description 10
- 208000035473 Communicable disease Diseases 0.000 abstract description 4
- 244000000010 microbial pathogen Species 0.000 abstract description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 508
- 239000000243 solution Substances 0.000 description 342
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 183
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 182
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 181
- 229940093499 ethyl acetate Drugs 0.000 description 169
- 235000019439 ethyl acetate Nutrition 0.000 description 169
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 151
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 147
- 239000007864 aqueous solution Substances 0.000 description 140
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 130
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 122
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 110
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 99
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 97
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 93
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 88
- 239000000203 mixture Substances 0.000 description 87
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 82
- 238000001914 filtration Methods 0.000 description 79
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 75
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 75
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 71
- 230000002829 reductive effect Effects 0.000 description 70
- 238000006243 chemical reaction Methods 0.000 description 67
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 66
- 239000010410 layer Substances 0.000 description 66
- 239000000725 suspension Substances 0.000 description 66
- 229960000443 hydrochloric acid Drugs 0.000 description 61
- 235000011167 hydrochloric acid Nutrition 0.000 description 60
- 229920006395 saturated elastomer Polymers 0.000 description 55
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 54
- 235000017557 sodium bicarbonate Nutrition 0.000 description 54
- 239000002244 precipitate Substances 0.000 description 52
- 239000011780 sodium chloride Substances 0.000 description 48
- 238000001816 cooling Methods 0.000 description 45
- 229960003390 magnesium sulfate Drugs 0.000 description 44
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 44
- 235000019341 magnesium sulphate Nutrition 0.000 description 44
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 43
- 239000000284 extract Substances 0.000 description 37
- 239000000706 filtrate Substances 0.000 description 37
- 229960004132 diethyl ether Drugs 0.000 description 36
- 239000000126 substance Substances 0.000 description 34
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 33
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 32
- 239000002904 solvent Substances 0.000 description 30
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 28
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 26
- 229940073584 methylene chloride Drugs 0.000 description 26
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 25
- 238000003756 stirring Methods 0.000 description 24
- 239000003921 oil Substances 0.000 description 23
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 238000012360 testing method Methods 0.000 description 20
- 239000007858 starting material Substances 0.000 description 19
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 17
- 229910000027 potassium carbonate Inorganic materials 0.000 description 16
- 235000011181 potassium carbonates Nutrition 0.000 description 16
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 15
- MZTBTXMUURGGNR-GLGOKHISSA-N (4-nitrophenyl)methyl (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)N)CC=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 MZTBTXMUURGGNR-GLGOKHISSA-N 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000002585 base Substances 0.000 description 14
- 238000004440 column chromatography Methods 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 13
- 229940023032 activated charcoal Drugs 0.000 description 13
- 125000000753 cycloalkyl group Chemical group 0.000 description 13
- 235000019253 formic acid Nutrition 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 244000005700 microbiome Species 0.000 description 12
- 235000017281 sodium acetate Nutrition 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- 108090000371 Esterases Proteins 0.000 description 11
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 11
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 11
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 11
- 230000002411 adverse Effects 0.000 description 11
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 239000000463 material Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 238000005406 washing Methods 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 10
- 238000010531 catalytic reduction reaction Methods 0.000 description 10
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 10
- 150000002500 ions Chemical class 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 239000011369 resultant mixture Substances 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- RJFPBECTFIUTHB-INEUFUBQSA-N (6r,7r)-7-azaniumyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC=C(C(O)=O)N2C(=O)[C@@H](N)[C@H]21 RJFPBECTFIUTHB-INEUFUBQSA-N 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 9
- 229940022663 acetate Drugs 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- 229920005989 resin Polymers 0.000 description 9
- 239000011347 resin Substances 0.000 description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000002440 hydroxy compounds Chemical class 0.000 description 8
- 150000002443 hydroxylamines Chemical class 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000001632 sodium acetate Substances 0.000 description 8
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 8
- NNULBSISHYWZJU-QHDYGNBISA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOC NNULBSISHYWZJU-QHDYGNBISA-N 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 229910001873 dinitrogen Inorganic materials 0.000 description 7
- IACSYDRIOYGJNH-UHFFFAOYSA-N ethyl 2-hydroxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NO)C(C)=O IACSYDRIOYGJNH-UHFFFAOYSA-N 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 238000001179 sorption measurement Methods 0.000 description 7
- ZMBSJDXRIAOGBK-JLOHTSLTSA-N (4-nitrophenyl)methyl (6r)-7-amino-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)N)CC(O)=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 ZMBSJDXRIAOGBK-JLOHTSLTSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000004599 antimicrobial Substances 0.000 description 6
- 150000007529 inorganic bases Chemical class 0.000 description 6
- 229960004592 isopropanol Drugs 0.000 description 6
- 150000007530 organic bases Chemical class 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 6
- 230000001376 precipitating effect Effects 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 230000036961 partial effect Effects 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 5
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 4
- NVIASKNPYJLAOX-UHFFFAOYSA-N 2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCCCON=C(C(O)=O)C1=CSC(NC=O)=N1 NVIASKNPYJLAOX-UHFFFAOYSA-N 0.000 description 4
- BGLAMXJBTZOWLK-UHFFFAOYSA-N 3-[[4-acetyl-2,3,6-trihydroxy-5-(3-methylbut-2-enyl)phenyl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one Chemical compound OC1=C(C(C)=O)C(CC=C(C)C)=C(O)C(CC=2C(OC(C)=C(C)C=2O)=O)=C1O BGLAMXJBTZOWLK-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical class CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 125000004181 carboxyalkyl group Chemical group 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 230000007071 enzymatic hydrolysis Effects 0.000 description 4
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 4
- 239000001963 growth medium Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 229940091250 magnesium supplement Drugs 0.000 description 4
- 239000011259 mixed solution Substances 0.000 description 4
- 125000005646 oximino group Chemical group 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 4
- 238000010998 test method Methods 0.000 description 4
- SNLBPEDWPGTTFV-XCWJXAQQSA-N (4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC SNLBPEDWPGTTFV-XCWJXAQQSA-N 0.000 description 3
- IXPSCFXNKWWDAK-FFFFSGIJSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOC IXPSCFXNKWWDAK-FFFFSGIJSA-N 0.000 description 3
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 3
- NLARCUDOUOQRPB-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(N)=N1 NLARCUDOUOQRPB-UHFFFAOYSA-N 0.000 description 3
- MZXRHHRUCKPYDE-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetic acid Chemical compound CC(C)ON=C(C(O)=O)C1=CSC(N)=N1 MZXRHHRUCKPYDE-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical class NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- 150000001266 acyl halides Chemical class 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 239000006286 aqueous extract Substances 0.000 description 3
- 150000001483 arginine derivatives Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 210000000941 bile Anatomy 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 159000000003 magnesium salts Chemical class 0.000 description 3
- 235000012054 meals Nutrition 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 125000006502 nitrobenzyl group Chemical group 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- XJRIDJAGAYGJCK-UHFFFAOYSA-N (1-acetyl-5-bromoindol-3-yl) acetate Chemical compound C1=C(Br)C=C2C(OC(=O)C)=CN(C(C)=O)C2=C1 XJRIDJAGAYGJCK-UHFFFAOYSA-N 0.000 description 2
- FTIDUDFDYBIQGN-XCWJXAQQSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCC FTIDUDFDYBIQGN-XCWJXAQQSA-N 0.000 description 2
- VLIWZMLYZSNTJX-KPMSDPLLSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC VLIWZMLYZSNTJX-KPMSDPLLSA-N 0.000 description 2
- KMAZBVUCSPNWGZ-UUSAFJCLSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCCC KMAZBVUCSPNWGZ-UUSAFJCLSA-N 0.000 description 2
- UWKKCFFECKNVTD-AVKWCDSFSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2-methylpropoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCC(C)C UWKKCFFECKNVTD-AVKWCDSFSA-N 0.000 description 2
- ZHHYAFRQMPQKLD-GWQXNCQPSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCCCCC ZHHYAFRQMPQKLD-GWQXNCQPSA-N 0.000 description 2
- NNUHKPCYTQNEPP-KPMSDPLLSA-N (4-nitrophenyl)methyl (6R)-7-[[2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1N=NC(=C1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC NNUHKPCYTQNEPP-KPMSDPLLSA-N 0.000 description 2
- QUSLYJRJAKKYQP-XTBNCEIVSA-N (4-nitrophenyl)methyl (6r)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1C(C(N11)=O)N)CC(Cl)=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 QUSLYJRJAKKYQP-XTBNCEIVSA-N 0.000 description 2
- QCUWDJVZLFMUIZ-ASSPZCQQSA-N (4-nitrophenyl)methyl (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1C(C(N11)=O)N)CC=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 QCUWDJVZLFMUIZ-ASSPZCQQSA-N 0.000 description 2
- WXLQJBRZLLFXRM-LESKNEHBSA-N (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOC WXLQJBRZLLFXRM-LESKNEHBSA-N 0.000 description 2
- MSCHWTRLKGAEQT-FFFFSGIJSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(=O)O MSCHWTRLKGAEQT-FFFFSGIJSA-N 0.000 description 2
- QRGJJTYSPCXVCW-OMNKOJBGSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NO QRGJJTYSPCXVCW-OMNKOJBGSA-N 0.000 description 2
- YRIZWEOUOCHLOT-BUDIUTNSSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(C(S2)C)C)C(=O)O)C1=O)=NOC YRIZWEOUOCHLOT-BUDIUTNSSA-N 0.000 description 2
- JVPITNRCLMGFOM-JLOHTSLTSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC#C JVPITNRCLMGFOM-JLOHTSLTSA-N 0.000 description 2
- QMDBRAXQDPPHFM-JLOHTSLTSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCCC QMDBRAXQDPPHFM-JLOHTSLTSA-N 0.000 description 2
- DXINFRJYVWAVKS-FQNRMIAFSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(=O)OC(C)(C)C DXINFRJYVWAVKS-FQNRMIAFSA-N 0.000 description 2
- OATMTDTUJCLNGD-JOPIAHFSSA-N (6R)-7-[[2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOCCCC OATMTDTUJCLNGD-JOPIAHFSSA-N 0.000 description 2
- UVJAWYKDJJXIMZ-BAFYGKSASA-N (6r)-3-hydroxy-5-thia-1-azabicyclo[4.2.0]octan-8-one Chemical compound C1C(O)CS[C@@H]2CC(=O)N21 UVJAWYKDJJXIMZ-BAFYGKSASA-N 0.000 description 2
- VYMQVMHQTNMGLR-JLOHTSLTSA-N (6r)-7-amino-3-(4-methylphenyl)sulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 VYMQVMHQTNMGLR-JLOHTSLTSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- HNURKXXMYARGAY-UHFFFAOYSA-N 2,6-Di-tert-butyl-4-hydroxymethylphenol Chemical compound CC(C)(C)C1=CC(CO)=CC(C(C)(C)C)=C1O HNURKXXMYARGAY-UHFFFAOYSA-N 0.000 description 2
- GBLKPIKZMXOJAP-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-(2-chloroethoxyimino)acetic acid Chemical compound NC1=NC(C(=NOCCCl)C(O)=O)=CS1 GBLKPIKZMXOJAP-UHFFFAOYSA-N 0.000 description 2
- JPTAGANPEAENGI-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-(2-methylpropoxyimino)acetic acid Chemical compound CC(C)CON=C(C(O)=O)C1=CSC(N)=N1 JPTAGANPEAENGI-UHFFFAOYSA-N 0.000 description 2
- YGVBWDRXZDWWRT-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-cyclohexyloxyiminoacetic acid Chemical compound S1C(N)=NC(C(=NOC2CCCCC2)C(O)=O)=C1 YGVBWDRXZDWWRT-UHFFFAOYSA-N 0.000 description 2
- RQMBWYIXVXJFNY-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetic acid Chemical compound CCON=C(C(O)=O)C1=CSC(N)=N1 RQMBWYIXVXJFNY-UHFFFAOYSA-N 0.000 description 2
- ZCPKIBFOMTXZPP-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetic acid Chemical compound CCCCCON=C(C(O)=O)C1=CSC(N)=N1 ZCPKIBFOMTXZPP-UHFFFAOYSA-N 0.000 description 2
- MXEBBKNMRBMCSW-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetic acid Chemical compound CCCON=C(C(O)=O)C1=CSC(N)=N1 MXEBBKNMRBMCSW-UHFFFAOYSA-N 0.000 description 2
- JSKBVWPVMUEVNM-UHFFFAOYSA-N 2-(2-chloroethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound ClCCON=C(C(=O)O)C1=CSC(NC=O)=N1 JSKBVWPVMUEVNM-UHFFFAOYSA-N 0.000 description 2
- VZRKYOWOWILIHD-UHFFFAOYSA-N 2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCOC(=O)CON=C(C(O)=O)C1=CSC(NC=O)=N1 VZRKYOWOWILIHD-UHFFFAOYSA-N 0.000 description 2
- KXGLGLHHMWGCBQ-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetic acid Chemical compound FC(F)(F)CON=C(C(=O)O)C1=CSC(NC=O)=N1 KXGLGLHHMWGCBQ-UHFFFAOYSA-N 0.000 description 2
- VGOYZRAMGMTTOP-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=CSC(NC=O)=N1 VGOYZRAMGMTTOP-UHFFFAOYSA-N 0.000 description 2
- NRRJNSWNWIDHOX-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC=O)=N1 NRRJNSWNWIDHOX-UHFFFAOYSA-N 0.000 description 2
- FMTFFWAQTXIWNN-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetic acid Chemical compound CCCCCON=C(C(O)=O)C1=CSC(NC=O)=N1 FMTFFWAQTXIWNN-UHFFFAOYSA-N 0.000 description 2
- GLHXPMXKDHFXIZ-UHFFFAOYSA-N 2-cyclohexyloxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound C=1SC(NC=O)=NC=1C(C(=O)O)=NOC1CCCCC1 GLHXPMXKDHFXIZ-UHFFFAOYSA-N 0.000 description 2
- WZPOBANFTJLEHD-UHFFFAOYSA-N 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCON=C(C(O)=O)C1=CSC(NC=O)=N1 WZPOBANFTJLEHD-UHFFFAOYSA-N 0.000 description 2
- UDFHIMFWMIISIQ-UHFFFAOYSA-N 2-methoxyimino-2-(thiadiazol-4-yl)acetic acid Chemical compound CON=C(C(O)=O)C1=CSN=N1 UDFHIMFWMIISIQ-UHFFFAOYSA-N 0.000 description 2
- MDEKEOFWAHRGNU-UHFFFAOYSA-N 2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC(=O)C(F)(F)F)=N1 MDEKEOFWAHRGNU-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 2
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 241000861718 Chloris <Aves> Species 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- 230000006179 O-acylation Effects 0.000 description 2
- 239000001888 Peptone Substances 0.000 description 2
- 108010080698 Peptones Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- 241000586779 Protaminobacter Species 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 241000786363 Rhampholeon spectrum Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241000589634 Xanthomonas Species 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000001118 alkylidene group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical compound BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 2
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 150000002085 enols Chemical class 0.000 description 2
- FPMTWGVYYTUCDK-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-(2-methylpropoxyimino)acetate Chemical compound CC(C)CON=C(C(=O)OCC)C1=CSC(N)=N1 FPMTWGVYYTUCDK-UHFFFAOYSA-N 0.000 description 2
- MYCKHVUASDZSES-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetate Chemical compound CCCCON=C(C(=O)OCC)C1=CSC(N)=N1 MYCKHVUASDZSES-UHFFFAOYSA-N 0.000 description 2
- BOIAXGZMWDGXGJ-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-cyclohexyloxyiminoacetate Chemical compound C=1SC(N)=NC=1C(C(=O)OCC)=NOC1CCCCC1 BOIAXGZMWDGXGJ-UHFFFAOYSA-N 0.000 description 2
- IXMJTVHPVCGNHC-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-hexoxyiminoacetate Chemical compound CCCCCCON=C(C(=O)OCC)C1=CSC(N)=N1 IXMJTVHPVCGNHC-UHFFFAOYSA-N 0.000 description 2
- WEDOYODBYFGEFJ-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetate Chemical compound CCCCCON=C(C(=O)OCC)C1=CSC(N)=N1 WEDOYODBYFGEFJ-UHFFFAOYSA-N 0.000 description 2
- IBBFCLMPRISSNU-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetate Chemical compound C#CCON=C(C(=O)OCC)C1=CSC(N)=N1 IBBFCLMPRISSNU-UHFFFAOYSA-N 0.000 description 2
- HAMGKLYOJWNGII-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetate Chemical compound CCCON=C(C(=O)OCC)C1=CSC(N)=N1 HAMGKLYOJWNGII-UHFFFAOYSA-N 0.000 description 2
- JUGFLYSTUIIKNZ-UHFFFAOYSA-N ethyl 2-butoxyimino-3-oxobutanoate Chemical compound CCCCON=C(C(C)=O)C(=O)OCC JUGFLYSTUIIKNZ-UHFFFAOYSA-N 0.000 description 2
- LVUXYNYWXQROJH-UHFFFAOYSA-N ethyl 2-butoxyimino-4-chloro-3-oxobutanoate Chemical compound CCCCON=C(C(=O)CCl)C(=O)OCC LVUXYNYWXQROJH-UHFFFAOYSA-N 0.000 description 2
- KKFBLNMRJSAFAA-UHFFFAOYSA-N ethyl 2-hydroxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate Chemical compound CCOC(=O)C(=NO)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 KKFBLNMRJSAFAA-UHFFFAOYSA-N 0.000 description 2
- HASOOENYFDJEAK-UHFFFAOYSA-N ethyl 2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOC HASOOENYFDJEAK-UHFFFAOYSA-N 0.000 description 2
- BRLUUTKDSNDBBZ-UHFFFAOYSA-N ethyl 3-oxo-2-pentoxyiminobutanoate Chemical compound CCCCCON=C(C(C)=O)C(=O)OCC BRLUUTKDSNDBBZ-UHFFFAOYSA-N 0.000 description 2
- JNVCJNNZBBWSSZ-UHFFFAOYSA-N ethyl 3-oxo-2-prop-2-ynoxyiminobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOCC#C JNVCJNNZBBWSSZ-UHFFFAOYSA-N 0.000 description 2
- XWFABJJRNZCSPV-UHFFFAOYSA-N ethyl 3-oxo-2-propoxyiminobutanoate Chemical compound CCCON=C(C(C)=O)C(=O)OCC XWFABJJRNZCSPV-UHFFFAOYSA-N 0.000 description 2
- OTCCCOMISIFTHS-UHFFFAOYSA-N ethyl 4-chloro-2-(2-methylpropoxyimino)-3-oxobutanoate Chemical compound CCOC(=O)C(C(=O)CCl)=NOCC(C)C OTCCCOMISIFTHS-UHFFFAOYSA-N 0.000 description 2
- DRXTXKHMCOSBBS-UHFFFAOYSA-N ethyl 4-chloro-2-cyclohexyloxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(C(=O)CCl)=NOC1CCCCC1 DRXTXKHMCOSBBS-UHFFFAOYSA-N 0.000 description 2
- KFZUIHBXFDORAU-UHFFFAOYSA-N ethyl 4-chloro-3-oxo-2-pentoxyiminobutanoate Chemical compound CCCCCON=C(C(=O)CCl)C(=O)OCC KFZUIHBXFDORAU-UHFFFAOYSA-N 0.000 description 2
- ZXXWBULXKDPYBM-UHFFFAOYSA-N ethyl 4-chloro-3-oxo-2-propan-2-yloxyiminobutanoate Chemical compound CCOC(=O)C(C(=O)CCl)=NOC(C)C ZXXWBULXKDPYBM-UHFFFAOYSA-N 0.000 description 2
- IMEHCGJFYQOSAS-UHFFFAOYSA-N ethyl 4-chloro-3-oxo-2-propoxyiminobutanoate Chemical compound CCCON=C(C(=O)CCl)C(=O)OCC IMEHCGJFYQOSAS-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 238000000855 fermentation Methods 0.000 description 2
- 230000004151 fermentation Effects 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- IFZADQLLMDQVOK-UHFFFAOYSA-N iodomethyl hexanoate Chemical compound CCCCCC(=O)OCI IFZADQLLMDQVOK-UHFFFAOYSA-N 0.000 description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 2
- 239000001095 magnesium carbonate Substances 0.000 description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 238000007034 nitrosation reaction Methods 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 235000019319 peptone Nutrition 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- DTUQWGWMVIHBKE-UHFFFAOYSA-N phenylacetaldehyde Chemical compound O=CCC1=CC=CC=C1 DTUQWGWMVIHBKE-UHFFFAOYSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000002769 thiazolinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000001131 transforming effect Effects 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000001974 tryptic soy broth Substances 0.000 description 2
- 108010050327 trypticase-soy broth Proteins 0.000 description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- NRRJNSWNWIDHOX-YHYXMXQVSA-N (2z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CO\N=C(/C(O)=O)C1=CSC(NC=O)=N1 NRRJNSWNWIDHOX-YHYXMXQVSA-N 0.000 description 1
- PTHGDVCPCZKZKR-UHFFFAOYSA-N (4-chlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C=C1 PTHGDVCPCZKZKR-UHFFFAOYSA-N 0.000 description 1
- JTAINDUMZOYKLK-XCWJXAQQSA-N (4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCC(F)(F)F JTAINDUMZOYKLK-XCWJXAQQSA-N 0.000 description 1
- UXBNXBNCTUVPBH-FBLFFUNLSA-N (4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCCC UXBNXBNCTUVPBH-FBLFFUNLSA-N 0.000 description 1
- XZYMTXUJJJXEMV-XPKAQORNSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)O)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC XZYMTXUJJJXEMV-XPKAQORNSA-N 0.000 description 1
- GKLDFHWFQIULNO-UUSAFJCLSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC(C)C GKLDFHWFQIULNO-UUSAFJCLSA-N 0.000 description 1
- DDYAGSYSLJFKLM-AVKWCDSFSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCC(=O)OCC DDYAGSYSLJFKLM-AVKWCDSFSA-N 0.000 description 1
- BUQNACFZUGMTKL-XCWJXAQQSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)O)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC BUQNACFZUGMTKL-XCWJXAQQSA-N 0.000 description 1
- BKUNRIQUAJBEBD-LRTDYKAYSA-N (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOC BKUNRIQUAJBEBD-LRTDYKAYSA-N 0.000 description 1
- SNWXBCZBRYZWIU-LMNIDFBRSA-N (4-nitrophenyl)methyl (6R)-7-[[2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NOCCCC SNWXBCZBRYZWIU-LMNIDFBRSA-N 0.000 description 1
- NJIRVDUDJYFGCB-OMOCHNIRSA-N (4-nitrophenyl)methyl (6r)-7-[(4-bromo-3-oxobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CCS[C@H]2N1C(=O)C2NC(=O)CC(=O)CBr NJIRVDUDJYFGCB-OMOCHNIRSA-N 0.000 description 1
- UIVDEOFIOHEVLM-RVFDVJBWSA-N (4-nitrophenyl)methyl (6r)-7-amino-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@H]1N2C(C1N)=O)CC(OC)=C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 UIVDEOFIOHEVLM-RVFDVJBWSA-N 0.000 description 1
- RNKOFZXWWQEQJY-VGAJERRHSA-N (4-nitrophenyl)methyl (6r)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CCS[C@H]2N1C(=O)C2NC(=O)CC1=CC=CC=C1 RNKOFZXWWQEQJY-VGAJERRHSA-N 0.000 description 1
- YLIOIMWNSIRKDG-ZWNOBZJWSA-N (4-nitrophenyl)methyl (6r,7r)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1[C@@H](C(N11)=O)N)CC(Cl)=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 YLIOIMWNSIRKDG-ZWNOBZJWSA-N 0.000 description 1
- QUSLYJRJAKKYQP-HTMVYDOJSA-N (4-nitrophenyl)methyl (6r,7r)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1[C@@H](C(N11)=O)N)CC(Cl)=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 QUSLYJRJAKKYQP-HTMVYDOJSA-N 0.000 description 1
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- WYGLNZLCCSYHSG-LESKNEHBSA-N (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOCC(F)(F)F WYGLNZLCCSYHSG-LESKNEHBSA-N 0.000 description 1
- MMYBPHNLUZIBCE-LESKNEHBSA-N (6R)-3-methoxy-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound FC(C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)OC)C(=O)O)C1=O)=NOC)(F)F MMYBPHNLUZIBCE-LESKNEHBSA-N 0.000 description 1
- LBXLDJXMTZZRKA-PLNQYNMKSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOCC(F)(F)F LBXLDJXMTZZRKA-PLNQYNMKSA-N 0.000 description 1
- BRBSPXLDZLWNHO-QHDYGNBISA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(F)(F)F BRBSPXLDZLWNHO-QHDYGNBISA-N 0.000 description 1
- IUTZHLZTHRLPMX-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2,3,3-trifluoroprop-2-enoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(=C(F)F)F IUTZHLZTHRLPMX-WCRCJTMVSA-N 0.000 description 1
- HLBNPYSHHMVRGJ-FFFFSGIJSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-chloroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCCCl HLBNPYSHHMVRGJ-FFFFSGIJSA-N 0.000 description 1
- CGPLYMUYBCGVDU-SBXXRYSUSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-ethoxy-2-oxoethoxy)iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(=O)OCC CGPLYMUYBCGVDU-SBXXRYSUSA-N 0.000 description 1
- RNDYODVBUVPBSF-LNUXAPHWSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOCCCC RNDYODVBUVPBSF-LNUXAPHWSA-N 0.000 description 1
- DCZZTKNUTOESDR-JOPIAHFSSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)OC)C(=O)O)C1=O)=NOCCCC DCZZTKNUTOESDR-JOPIAHFSSA-N 0.000 description 1
- ZZLCWOXHXZQIBW-XPKAQORNSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(4-methylphenyl)sulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)OS(=O)(=O)C2=CC=C(C)C=C2)C(=O)O)C1=O)=NOC ZZLCWOXHXZQIBW-XPKAQORNSA-N 0.000 description 1
- NUJMLWRJFZHUHI-PLNQYNMKSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOC NUJMLWRJFZHUHI-PLNQYNMKSA-N 0.000 description 1
- OIBNNEXVUACCKV-HYEBNMQDSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrochloride Chemical compound Cl.CON=C(C(=O)NC1[C@H]2SCC(Cl)=C(N2C1=O)C(O)=O)c1csc(N)n1 OIBNNEXVUACCKV-HYEBNMQDSA-N 0.000 description 1
- JETIJFQWDMHVOR-LESKNEHBSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)OC)C(=O)O)C1=O)=NOC JETIJFQWDMHVOR-LESKNEHBSA-N 0.000 description 1
- PFQZVHMDOYXFCA-GILAUPEISA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrochloride Chemical compound Cl.CON=C(C(=O)NC1[C@H]2SCC=C(N2C1=O)C(O)=O)c1csc(N)n1 PFQZVHMDOYXFCA-GILAUPEISA-N 0.000 description 1
- XATQPFJEZUEIRI-WPZCJLIBSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCCCCC XATQPFJEZUEIRI-WPZCJLIBSA-N 0.000 description 1
- WOWORTQLYPRIFP-LNUXAPHWSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)OC)C(=O)O)C1=O)=NOCC#C WOWORTQLYPRIFP-LNUXAPHWSA-N 0.000 description 1
- YGPSPDMXNBPOQU-JLOHTSLTSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOC(C)C YGPSPDMXNBPOQU-JLOHTSLTSA-N 0.000 description 1
- REWCDMVQQUOGNE-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)O)C1=O)=NOCCC REWCDMVQQUOGNE-WCRCJTMVSA-N 0.000 description 1
- QBOYGKXIKXTULV-JLOHTSLTSA-N (6R)-7-[[2-(2-chloroethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCCCl QBOYGKXIKXTULV-JLOHTSLTSA-N 0.000 description 1
- VIPDIJBYRQZXIE-WPZCJLIBSA-N (6R)-7-[[2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(=O)OCC VIPDIJBYRQZXIE-WPZCJLIBSA-N 0.000 description 1
- BTYBYONWHHNTCH-FFFFSGIJSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(F)(F)F BTYBYONWHHNTCH-FFFFSGIJSA-N 0.000 description 1
- BBGMLGLPHJMCJX-WPZCJLIBSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2-methylpropoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(C)C BBGMLGLPHJMCJX-WPZCJLIBSA-N 0.000 description 1
- SKWPZKHCDIORLU-FQNRMIAFSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCCCCC SKWPZKHCDIORLU-FQNRMIAFSA-N 0.000 description 1
- ZMEZBWBWNZVEOP-JLOHTSLTSA-N (6R)-7-[[2-(carboxymethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCC(=O)O ZMEZBWBWNZVEOP-JLOHTSLTSA-N 0.000 description 1
- XNQZTBXJQSGRRD-PVQCJRHBSA-N (6R)-7-[[2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)OC)C(=O)O)C1=O)=NOCCCC XNQZTBXJQSGRRD-PVQCJRHBSA-N 0.000 description 1
- MXYDRCOUCXEGFK-WPZCJLIBSA-N (6R)-7-[[2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOCCCC MXYDRCOUCXEGFK-WPZCJLIBSA-N 0.000 description 1
- NOBVVIHMEGNGSC-FBMWCMRBSA-N (6R)-7-[[2-cyclohexyloxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOC1CCCCC1 NOBVVIHMEGNGSC-FBMWCMRBSA-N 0.000 description 1
- VOZXYFWLFGQTDB-QHDYGNBISA-N (6R)-7-[[2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1N=NC(=C1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NOC VOZXYFWLFGQTDB-QHDYGNBISA-N 0.000 description 1
- PUFISRXUDJCPCB-BUDIUTNSSA-N (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound FC(C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(C(S2)C)C)C(=O)O)C1=O)=NOC)(F)F PUFISRXUDJCPCB-BUDIUTNSSA-N 0.000 description 1
- YURSOQRGSZKXCK-BDPMCISCSA-N (6r)-3-(4-methylphenyl)sulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3C=CC=CC=3)[C@H]2SC1 YURSOQRGSZKXCK-BDPMCISCSA-N 0.000 description 1
- ZUBXPSDFPQTKQN-ZCFIWIBFSA-N (6r)-3-hydroxy-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC(O)=CN2C(=O)C[C@H]21 ZUBXPSDFPQTKQN-ZCFIWIBFSA-N 0.000 description 1
- ASLZBQCVFWAXTG-MPKXYMLHSA-N (6r)-7-amino-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=C(C)C(C)S[C@@H]2C(N)C(=O)N21 ASLZBQCVFWAXTG-MPKXYMLHSA-N 0.000 description 1
- WAQKVEYMZFUOAH-FHJBIJLDSA-N (6r)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride Chemical compound Cl.S1CC(Cl)=C(C(O)=O)N2C(=O)C(N)[C@H]21 WAQKVEYMZFUOAH-FHJBIJLDSA-N 0.000 description 1
- FHJRYYNOYUHGNP-GUNDQUCTSA-N (6r)-7-amino-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride Chemical compound Cl.S1CC(OC)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 FHJRYYNOYUHGNP-GUNDQUCTSA-N 0.000 description 1
- RJFPBECTFIUTHB-BAFYGKSASA-N (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC=C(C(O)=O)N2C(=O)C(N)[C@H]21 RJFPBECTFIUTHB-BAFYGKSASA-N 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- YZWKKMVJZFACSU-UHFFFAOYSA-N 1-bromopentane Chemical compound CCCCCBr YZWKKMVJZFACSU-UHFFFAOYSA-N 0.000 description 1
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 description 1
- BZWJDKJBAVXCMH-UHFFFAOYSA-N 1-diazopropane Chemical compound CCC=[N+]=[N-] BZWJDKJBAVXCMH-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- MLAFRLBDNVSLPE-UHFFFAOYSA-N 1-hydroxyethyl acetate Chemical compound CC(O)OC(C)=O MLAFRLBDNVSLPE-UHFFFAOYSA-N 0.000 description 1
- VRTBBGYZDDZSCW-UHFFFAOYSA-N 1-hydroxyethyl butanoate Chemical compound CCCC(=O)OC(C)O VRTBBGYZDDZSCW-UHFFFAOYSA-N 0.000 description 1
- VXQIQEZJUMCJDJ-UHFFFAOYSA-N 1-hydroxyethyl hexanoate Chemical compound CCCCCC(=O)OC(C)O VXQIQEZJUMCJDJ-UHFFFAOYSA-N 0.000 description 1
- QUCMFLACYLWUKV-UHFFFAOYSA-N 1-hydroxyethyl pentanoate Chemical compound CCCCC(=O)OC(C)O QUCMFLACYLWUKV-UHFFFAOYSA-N 0.000 description 1
- KGZREBGSQBOEQE-UHFFFAOYSA-N 1-hydroxyethyl propanoate Chemical compound CCC(=O)OC(C)O KGZREBGSQBOEQE-UHFFFAOYSA-N 0.000 description 1
- BVABBPZOMBGJEV-UHFFFAOYSA-N 1-hydroxyhexyl hexanoate Chemical compound CCCCCC(O)OC(=O)CCCCC BVABBPZOMBGJEV-UHFFFAOYSA-N 0.000 description 1
- VEGXEWGKYMMJKP-UHFFFAOYSA-N 1-hydroxypropyl acetate Chemical compound CCC(O)OC(C)=O VEGXEWGKYMMJKP-UHFFFAOYSA-N 0.000 description 1
- AUCNXTXSMQPPMK-UHFFFAOYSA-N 1-hydroxypropyl hexanoate Chemical compound CCCCCC(=O)OC(O)CC AUCNXTXSMQPPMK-UHFFFAOYSA-N 0.000 description 1
- UTJLIFNVEXVSDN-UHFFFAOYSA-N 1-hydroxypropyl propanoate Chemical compound CCC(O)OC(=O)CC UTJLIFNVEXVSDN-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- KFYHXDRPFWPYTG-WPZCJLIBSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCOC(C(C)(C)C)=O)C1=O)=NOC KFYHXDRPFWPYTG-WPZCJLIBSA-N 0.000 description 1
- LBCGGKOBNAQPRD-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetic acid Chemical compound CCCCON=C(C(O)=O)C1=CSC(N)=N1 LBCGGKOBNAQPRD-UHFFFAOYSA-N 0.000 description 1
- UUHYXGRSWMTMPP-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetic acid Chemical compound NC1=NC(C(=NOCC#C)C(O)=O)=CS1 UUHYXGRSWMTMPP-UHFFFAOYSA-N 0.000 description 1
- JLXNDAIQKDEBFW-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(2-methylpropoxyimino)acetic acid Chemical compound CC(C)CON=C(C(O)=O)C1=CSC(NC=O)=N1 JLXNDAIQKDEBFW-UHFFFAOYSA-N 0.000 description 1
- FNYCFFFIOYKTGD-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetic acid Chemical compound CC(C)ON=C(C(O)=O)C1=CSC(NC=O)=N1 FNYCFFFIOYKTGD-UHFFFAOYSA-N 0.000 description 1
- BKZUFHOOLCRIDP-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetic acid Chemical compound CCCON=C(C(O)=O)C1=CSC(NC=O)=N1 BKZUFHOOLCRIDP-UHFFFAOYSA-N 0.000 description 1
- JEZNNIFNTWWAPU-UHFFFAOYSA-N 2-(2-methylpropoxyimino)-3-oxobutanoic acid Chemical compound CC(C)CON=C(C(C)=O)C(O)=O JEZNNIFNTWWAPU-UHFFFAOYSA-N 0.000 description 1
- AMOYMEBHYUTMKJ-UHFFFAOYSA-N 2-(2-phenylethoxy)ethylbenzene Chemical compound C=1C=CC=CC=1CCOCCC1=CC=CC=C1 AMOYMEBHYUTMKJ-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- PTTPXKJBFFKCEK-UHFFFAOYSA-N 2-Methyl-4-heptanone Chemical compound CC(C)CC(=O)CC(C)C PTTPXKJBFFKCEK-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- HOYDYOGLPUTFIQ-UHFFFAOYSA-N 2-cyclohexyloxyimino-3-oxobutanoic acid Chemical compound CC(=O)C(C(O)=O)=NOC1CCCCC1 HOYDYOGLPUTFIQ-UHFFFAOYSA-N 0.000 description 1
- ODXCMWLJDMOSSL-UHFFFAOYSA-N 2-ethyl-1,2-benzoxazol-2-ium Chemical class C1=CC=C2O[N+](CC)=CC2=C1 ODXCMWLJDMOSSL-UHFFFAOYSA-N 0.000 description 1
- LBVIWYRIQOZIRO-UHFFFAOYSA-N 2-hydroxyimino-3-oxobutanoic acid Chemical compound CC(=O)C(=NO)C(O)=O LBVIWYRIQOZIRO-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- BRDQVKLQOUEGSK-UHFFFAOYSA-N 2-methoxyimino-3-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]butanoic acid Chemical compound CC(=NNC(=O)OC(C)(C)C)C(=NOC)C(=O)O BRDQVKLQOUEGSK-UHFFFAOYSA-N 0.000 description 1
- MIHIJWOEDDPOLG-UHFFFAOYSA-N 2-methoxyiminoacetic acid Chemical compound CON=CC(O)=O MIHIJWOEDDPOLG-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- MWOOKDULMBMMPN-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonate Chemical compound O1[N+](CC)=CC=C1C1=CC=CC(S([O-])(=O)=O)=C1 MWOOKDULMBMMPN-UHFFFAOYSA-N 0.000 description 1
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 1
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- CNTZZFQWLHVPHZ-UHFFFAOYSA-N 4-chloro-2-hexoxyimino-3-oxobutanoic acid Chemical compound CCCCCCON=C(C(=O)CCl)C(=O)O CNTZZFQWLHVPHZ-UHFFFAOYSA-N 0.000 description 1
- QWNGESOREPKWTG-UHFFFAOYSA-N 4-chloro-2-methoxyimino-3-oxobutanoic acid Chemical compound CON=C(C(O)=O)C(=O)CCl QWNGESOREPKWTG-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- JKTYGPATCNUWKN-UHFFFAOYSA-N 4-nitrobenzyl alcohol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1 JKTYGPATCNUWKN-UHFFFAOYSA-N 0.000 description 1
- ONPGOSVDVDPBCY-CQSZACIVSA-N 6-amino-5-[(1r)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-n-[4-(4-methylpiperazine-1-carbonyl)phenyl]pyridazine-3-carboxamide Chemical compound O([C@H](C)C=1C(=C(F)C=CC=1Cl)Cl)C(C(=NN=1)N)=CC=1C(=O)NC(C=C1)=CC=C1C(=O)N1CCN(C)CC1 ONPGOSVDVDPBCY-CQSZACIVSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000588986 Alcaligenes Species 0.000 description 1
- 241000588813 Alcaligenes faecalis Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000186063 Arthrobacter Species 0.000 description 1
- 241000589151 Azotobacter Species 0.000 description 1
- 241000589149 Azotobacter vinelandii Species 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 241000920701 Batillus Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- YDUPGCJUWJBTJS-FBMWCMRBSA-N BrCC(=O)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NO Chemical compound BrCC(=O)C(C(=O)NC1[C@@H]2N(C(=CCS2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O)=NO YDUPGCJUWJBTJS-FBMWCMRBSA-N 0.000 description 1
- RTONBWTZPZBIAC-UHFFFAOYSA-N Br[P]Br Chemical compound Br[P]Br RTONBWTZPZBIAC-UHFFFAOYSA-N 0.000 description 1
- 241000589174 Bradyrhizobium japonicum Species 0.000 description 1
- 241000186146 Brevibacterium Species 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- 241001453268 Comamonas terrigena Species 0.000 description 1
- 241000186216 Corynebacterium Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101100130497 Drosophila melanogaster Mical gene Proteins 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 241000589565 Flavobacterium Species 0.000 description 1
- LRULVYSBRWUVGR-FCHUYYIVSA-N GSK2879552 Chemical compound C1=CC(C(=O)O)=CC=C1CN1CCC(CN[C@H]2[C@@H](C2)C=2C=CC=CC=2)CC1 LRULVYSBRWUVGR-FCHUYYIVSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 241000588752 Kluyvera Species 0.000 description 1
- 241000191953 Kocuria varians Species 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical class OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- BVHLGVCQOALMSV-JEDNCBNOSA-N L-lysine hydrochloride Chemical compound Cl.NCCCC[C@H](N)C(O)=O BVHLGVCQOALMSV-JEDNCBNOSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000193386 Lysinibacillus sphaericus Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241001467578 Microbacterium Species 0.000 description 1
- 241001006344 Microbacterium flavum Species 0.000 description 1
- 241000192041 Micrococcus Species 0.000 description 1
- 241000191938 Micrococcus luteus Species 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical class CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910020350 Na2WO4 Inorganic materials 0.000 description 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical group O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000004157 Nitrosyl chloride Substances 0.000 description 1
- 241000520330 Otomys irroratus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 241000203720 Pimelobacter simplex Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 101150057388 Reln gene Proteins 0.000 description 1
- 241000589180 Rhizobium Species 0.000 description 1
- 241000158504 Rhodococcus hoagii Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 description 1
- 241000192023 Sarcina Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 241000191963 Staphylococcus epidermidis Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 241000607598 Vibrio Species 0.000 description 1
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229940005347 alcaligenes faecalis Drugs 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 238000004380 ashing Methods 0.000 description 1
- 150000001509 aspartic acid derivatives Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- LFYJSSARVMHQJB-QIXNEVBVSA-N bakuchiol Chemical compound CC(C)=CCC[C@@](C)(C=C)\C=C\C1=CC=C(O)C=C1 LFYJSSARVMHQJB-QIXNEVBVSA-N 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical class C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- IBETYBCRVYRTLY-UHFFFAOYSA-N bis(2-methoxyphenyl)methanol Chemical compound COC1=CC=CC=C1C(O)C1=CC=CC=C1OC IBETYBCRVYRTLY-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- UADDLHRDLMMBQG-UHFFFAOYSA-N butoxyboron Chemical compound [B]OCCCC UADDLHRDLMMBQG-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 108010079058 casein hydrolysate Proteins 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- TXHWYSOQHNMOOU-UHFFFAOYSA-N chloro(diethoxy)phosphane Chemical compound CCOP(Cl)OCC TXHWYSOQHNMOOU-UHFFFAOYSA-N 0.000 description 1
- CBVJWBYNOWIOFJ-UHFFFAOYSA-N chloro(trimethoxy)silane Chemical compound CO[Si](Cl)(OC)OC CBVJWBYNOWIOFJ-UHFFFAOYSA-N 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- DQTRYXANLKJLPK-UHFFFAOYSA-N chlorophosphonous acid Chemical compound OP(O)Cl DQTRYXANLKJLPK-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TVMUHOAONWHJBV-UHFFFAOYSA-N dehydroglycine Chemical compound OC(=O)C=N TVMUHOAONWHJBV-UHFFFAOYSA-N 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- SDJKREQSNPYHJT-UHFFFAOYSA-N dibromo(phenyl)phosphane Chemical compound BrP(Br)C1=CC=CC=C1 SDJKREQSNPYHJT-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- AMNKNFSQSCSJND-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-(2-chloroethoxyimino)acetate Chemical compound ClCCON=C(C(=O)OCC)C1=CSC(N)=N1 AMNKNFSQSCSJND-UHFFFAOYSA-N 0.000 description 1
- POBMBNPEUPDXRS-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(N)=N1 POBMBNPEUPDXRS-UHFFFAOYSA-N 0.000 description 1
- PUZXQANZDPQRRJ-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetate Chemical compound C=CCON=C(C(=O)OCC)C1=CSC(N)=N1 PUZXQANZDPQRRJ-UHFFFAOYSA-N 0.000 description 1
- KLGVOTHZQJDISA-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetate Chemical compound CCOC(=O)C(=NOC(C)C)C1=CSC(N)=N1 KLGVOTHZQJDISA-UHFFFAOYSA-N 0.000 description 1
- PJWCIBFNPRMDNP-UHFFFAOYSA-N ethyl 2-(2-chloroethoxyimino)-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOCCCl PJWCIBFNPRMDNP-UHFFFAOYSA-N 0.000 description 1
- BSPASHUWADVGCC-UHFFFAOYSA-N ethyl 2-(2-methylpropoxyimino)-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOCC(C)C BSPASHUWADVGCC-UHFFFAOYSA-N 0.000 description 1
- IKCYQNSSQXAQHC-UHFFFAOYSA-N ethyl 2-aminooxyacetate;hydrochloride Chemical compound Cl.CCOC(=O)CON IKCYQNSSQXAQHC-UHFFFAOYSA-N 0.000 description 1
- UGHBGWAJKLJSLP-UHFFFAOYSA-N ethyl 2-cyclohexyloxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOC1CCCCC1 UGHBGWAJKLJSLP-UHFFFAOYSA-N 0.000 description 1
- HWGBFHADJQHTOG-UHFFFAOYSA-N ethyl 2-methoxyimino-2-(thiadiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NOC)C1=CSN=N1 HWGBFHADJQHTOG-UHFFFAOYSA-N 0.000 description 1
- ZWDVSWNQKQHHMT-UHFFFAOYSA-N ethyl 2-methoxyimino-3-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]butanoate Chemical compound CCOC(=O)C(=NOC)C(C)=NNC(=O)OC(C)(C)C ZWDVSWNQKQHHMT-UHFFFAOYSA-N 0.000 description 1
- YTCSCPYCWAGPGA-UHFFFAOYSA-N ethyl 2-prop-2-enoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate Chemical compound C=CCON=C(C(=O)OCC)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 YTCSCPYCWAGPGA-UHFFFAOYSA-N 0.000 description 1
- NPXGGKSJMGCVLL-UHFFFAOYSA-N ethyl 2-prop-2-ynoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate Chemical compound C#CCON=C(C(=O)OCC)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 NPXGGKSJMGCVLL-UHFFFAOYSA-N 0.000 description 1
- JQZYTHDHNWNPHI-UHFFFAOYSA-N ethyl 3-oxo-2-propan-2-yloxyiminobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOC(C)C JQZYTHDHNWNPHI-UHFFFAOYSA-N 0.000 description 1
- OTVKRRYPMMESRP-UHFFFAOYSA-N ethyl 4-chloro-2-(2-chloroethoxyimino)-3-oxobutanoate Chemical compound CCOC(=O)C(C(=O)CCl)=NOCCCl OTVKRRYPMMESRP-UHFFFAOYSA-N 0.000 description 1
- HHHLOEDVDMEWKH-UHFFFAOYSA-N ethyl 4-chloro-2-ethoxyimino-3-oxobutanoate Chemical compound CCON=C(C(=O)CCl)C(=O)OCC HHHLOEDVDMEWKH-UHFFFAOYSA-N 0.000 description 1
- QQTHNMBPRSXIHX-UHFFFAOYSA-N ethyl 4-chloro-2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NOC)C(=O)CCl QQTHNMBPRSXIHX-UHFFFAOYSA-N 0.000 description 1
- IWXNQTNNPFDHKR-UHFFFAOYSA-N ethyl 4-chloro-3-oxo-2-prop-2-ynoxyiminobutanoate Chemical compound CCOC(=O)C(C(=O)CCl)=NOCC#C IWXNQTNNPFDHKR-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- MFFXVVHUKRKXCI-UHFFFAOYSA-N ethyl iodoacetate Chemical compound CCOC(=O)CI MFFXVVHUKRKXCI-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 150000002373 hemiacetals Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CORAYEWGXZHKJP-WKGHQIHJSA-N hexanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-chloro-5,8-dioxo-5lambda4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2=O)Cl)C(=O)OCOC(CCCCC)=O)C1=O)=NOC CORAYEWGXZHKJP-WKGHQIHJSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- JYVNDCLJHKQUHE-UHFFFAOYSA-N hydroxymethyl acetate Chemical compound CC(=O)OCO JYVNDCLJHKQUHE-UHFFFAOYSA-N 0.000 description 1
- ZFAVADMJZHASIM-UHFFFAOYSA-N hydroxymethyl butanoate Chemical compound CCCC(=O)OCO ZFAVADMJZHASIM-UHFFFAOYSA-N 0.000 description 1
- DJNFBEQKSSQEQF-UHFFFAOYSA-N hydroxymethyl hexanoate Chemical compound CCCCCC(=O)OCO DJNFBEQKSSQEQF-UHFFFAOYSA-N 0.000 description 1
- XBVIHALCIHIXRI-UHFFFAOYSA-N hydroxymethyl pentanoate Chemical compound CCCCC(=O)OCO XBVIHALCIHIXRI-UHFFFAOYSA-N 0.000 description 1
- NRXWLSVRXIGSKH-UHFFFAOYSA-N hydroxymethyl propanoate Chemical compound CCC(=O)OCO NRXWLSVRXIGSKH-UHFFFAOYSA-N 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000001965 increasing effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000006352 iso-propylthiomethyl group Chemical group [H]C([H])([H])C([H])(SC([H])([H])*)C([H])([H])[H] 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229960005337 lysine hydrochloride Drugs 0.000 description 1
- RAPZNDIXKANUFT-VTELYTRQSA-L magnesium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Mg++].CON=C(C(=O)NC1[C@H]2SCC=C(N2C1=O)C([O-])=O)c1csc(N)n1.CON=C(C(=O)NC1[C@H]2SCC=C(N2C1=O)C([O-])=O)c1csc(N)n1 RAPZNDIXKANUFT-VTELYTRQSA-L 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229960002261 magnesium phosphate Drugs 0.000 description 1
- 229910000157 magnesium phosphate Inorganic materials 0.000 description 1
- 235000010994 magnesium phosphates Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- JKRHDMPWBFBQDZ-UHFFFAOYSA-N n'-hexylmethanediimine Chemical compound CCCCCCN=C=N JKRHDMPWBFBQDZ-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- BHQIGUWUNPQBJY-UHFFFAOYSA-N n-diazomethanesulfonamide Chemical compound CS(=O)(=O)N=[N+]=[N-] BHQIGUWUNPQBJY-UHFFFAOYSA-N 0.000 description 1
- CSDTZUBPSYWZDX-UHFFFAOYSA-N n-pentyl nitrite Chemical compound CCCCCON=O CSDTZUBPSYWZDX-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- BMNDJWSIKZECMH-UHFFFAOYSA-N nitrosyl bromide Chemical compound BrN=O BMNDJWSIKZECMH-UHFFFAOYSA-N 0.000 description 1
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 1
- 235000019392 nitrosyl chloride Nutrition 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- MIQJCHKNVAHUGJ-UHFFFAOYSA-N o-(2,2,2-trifluoroethyl)hydroxylamine;hydrochloride Chemical compound Cl.NOCC(F)(F)F MIQJCHKNVAHUGJ-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 238000006146 oximation reaction Methods 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- 229940100595 phenylacetaldehyde Drugs 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000003607 serino group Chemical class [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- AZMGUEFIPPXHET-QFBOXNNLSA-M sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)Cl)C(=O)[O-])C1=O)=NOCC.[Na+] AZMGUEFIPPXHET-QFBOXNNLSA-M 0.000 description 1
- IFHUYJAXVZEGRA-WAHCDEBTSA-M sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate dihydrate Chemical compound O.O.[Na+].CON=C(C(=O)NC1[C@H]2SCC=C(N2C1=O)C([O-])=O)c1csc(N)n1 IFHUYJAXVZEGRA-WAHCDEBTSA-M 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- CBUBVNGXIHQZSI-YXWLHULHSA-M sodium;(6r)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate Chemical compound [Na+].S([C@@H]12)CC(O)C(C([O-])=O)N1C(=O)C2NC(=O)C(=NOC)C1=CSC(NC=O)=N1 CBUBVNGXIHQZSI-YXWLHULHSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000005556 structure-activity relationship Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- MXJGKTHZWIGRJG-UHFFFAOYSA-N tert-butyl 2-aminooxyacetate Chemical compound CC(C)(C)OC(=O)CON MXJGKTHZWIGRJG-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- NDLIRBZKZSDGSO-UHFFFAOYSA-N tosyl azide Chemical compound CC1=CC=C(S(=O)(=O)[N-][N+]#N)C=C1 NDLIRBZKZSDGSO-UHFFFAOYSA-N 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005369 trialkoxysilyl group Chemical group 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000006150 trypticase soy agar Substances 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000012138 yeast extract Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/587—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with aliphatic hydrocarbon radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms, said aliphatic radicals being substituted in the alpha-position to the ring by a hetero atom, e.g. with m >= 0, Z being a singly or a doubly bound hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/06—1,2,3-Thiadiazoles; Hydrogenated 1,2,3-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000616635A CA1340499C (en) | 1977-03-14 | 1993-03-31 | Thiazolyl derivatives useful as interediates for the preparation of cephem or cepham compounds |
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10699/77 | 1977-03-14 | ||
| GB10699/77A GB1600735A (en) | 1977-03-14 | 1977-03-14 | Cephem and cephem compounds and processes for preparation thereof |
| GB2924577 | 1977-07-12 | ||
| JP29245/77 | 1977-07-12 | ||
| JP42315/77 | 1977-10-11 | ||
| GB4231577 | 1977-10-11 | ||
| JP75/78 | 1978-01-03 | ||
| GB7578 | 1978-01-03 | ||
| KR7802782A KR820001285B1 (ko) | 1977-03-14 | 1978-09-13 | 세펨화합물의 제조방법 |
| KR1019820000231A KR830000455B1 (ko) | 1977-03-14 | 1982-01-18 | 세펨화합물의 제조방법 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000616635A Division CA1340499C (en) | 1977-03-14 | 1993-03-31 | Thiazolyl derivatives useful as interediates for the preparation of cephem or cepham compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1321580C true CA1321580C (en) | 1993-08-24 |
Family
ID=27546433
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000298883A Expired - Lifetime CA1321580C (en) | 1977-03-14 | 1978-03-14 | Cephem and cepham compounds and processes for preparation thereof |
Country Status (21)
| Country | Link |
|---|---|
| US (7) | US4425341A (enExample) |
| JP (7) | JPS53137988A (enExample) |
| AR (2) | AR230452A1 (enExample) |
| AT (1) | AT364456B (enExample) |
| BE (1) | BE864810A (enExample) |
| CA (1) | CA1321580C (enExample) |
| CH (1) | CH637138A5 (enExample) |
| CS (1) | CS217961B2 (enExample) |
| DD (2) | DD144772A5 (enExample) |
| DE (1) | DE2810922C2 (enExample) |
| DK (1) | DK163832C (enExample) |
| ES (8) | ES467828A1 (enExample) |
| FI (1) | FI65779C (enExample) |
| FR (1) | FR2383951A1 (enExample) |
| GR (1) | GR63619B (enExample) |
| NL (2) | NL182401C (enExample) |
| NZ (2) | NZ199860A (enExample) |
| PH (2) | PH17188A (enExample) |
| PT (1) | PT67773A (enExample) |
| SE (3) | SE438677B (enExample) |
| YU (3) | YU41586B (enExample) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE878433A (fr) * | 1978-08-31 | 1980-02-25 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 3-cephem-4-carboxylique 3,7-disubstitue, nouveaux produits ainsi obtenus et leur utilisation pour leur activite antibacterienne |
| US4399133A (en) * | 1977-03-14 | 1983-08-16 | Fujisawa Pharmaceutical Company, Limited | Cephem compounds |
| US4409217A (en) | 1977-03-14 | 1983-10-11 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| US4464369A (en) * | 1977-03-14 | 1984-08-07 | Fujisawa Pharmaceutical Co., Ltd. | 7-Acylamino-3-cephem-4-carboxylic acid derivatives and pharmaceutical compositions |
| FR2399418A1 (fr) * | 1977-03-14 | 1979-03-02 | Fujisawa Pharmaceutical Co | Procede de preparation d'acides iminoacetiques et nouveaux produits ainsi obtenus, utilises pour la synthese d'acides cepham- ou cephem-carboxyliques |
| SE439312B (sv) * | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| JPS5498795A (en) * | 1978-01-13 | 1979-08-03 | Takeda Chem Ind Ltd | Cephalosporin derivative and its preparation |
| FR2432521A1 (fr) * | 1978-03-31 | 1980-02-29 | Roussel Uclaf | Nouvelles oximes o-substituees derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2421907A1 (fr) * | 1978-04-07 | 1979-11-02 | Roussel Uclaf | Nouvelles cephalosporines derivees de l'acide 7-/2-(2-amino 4-thiazolyl)2-(carboxymethoxyimino/acetamido 3-substitue cephalosporanique, leur procede de preparation et leur application comme medicaments |
| US4268509A (en) * | 1978-07-10 | 1981-05-19 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds and processes for preparation thereof |
| US4284631A (en) * | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
| US4372952A (en) | 1978-07-31 | 1983-02-08 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| US4305937A (en) * | 1978-08-17 | 1981-12-15 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds and antibacterial pharmaceutical compositions containing them |
| FR2453161A1 (fr) * | 1978-08-31 | 1980-10-31 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide thiazolylacetique et nouveaux produits ainsi obtenus |
| US4703046A (en) * | 1978-09-08 | 1987-10-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds and processes for preparation thereof |
| US4341775A (en) * | 1978-09-11 | 1982-07-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| DE2967053D1 (en) | 1978-09-12 | 1984-07-19 | Fujisawa Pharmaceutical Co | Starting compounds for preparing cephem compounds and processes for their preparation |
| DE2945248A1 (de) * | 1978-11-13 | 1980-05-22 | Fujisawa Pharmaceutical Co | Cephem-verbindungen, verfahren zu ihrer herstellung und sie enthaltende antibakterielle pharmazeutische mittel |
| FR2444032A2 (fr) * | 1978-12-13 | 1980-07-11 | Roussel Uclaf | Nouveaux produits derives de l'acide 2-(2-tritylamino-4-thiazolyl) acetique et leur procede de preparation |
| AU536842B2 (en) * | 1978-12-29 | 1984-05-24 | Fujisawa Pharmaceutical Co., Ltd. | Cephalosporin antibiotics |
| FR2448543A1 (fr) * | 1979-02-09 | 1980-09-05 | Roussel Uclaf | Nouvelles oximes o-substituees par un radical comportant un ammonium quaternaire et derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2461713A1 (fr) * | 1979-07-19 | 1981-02-06 | Roussel Uclaf | Nouvelles alcoyloximes substituees derivees de l'acide 7-(2-amino 4-thiazolyl) acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| EP0025017A1 (de) * | 1979-08-28 | 1981-03-11 | Ciba-Geigy Ag | Polyazathiaverbindungen, Verfahren zu ihrer Herstellung, pharmazeutische Präparate enthaltend solche Verbindungen und Verwendung von letzteren |
| EP0088454B1 (en) * | 1979-09-03 | 1986-03-05 | Fujisawa Pharmaceutical Co., Ltd. | New starting compounds for preparing cephem compounds and processes for their preparation |
| AU538653B2 (en) * | 1979-10-02 | 1984-08-23 | Glaxo Group Limited | 7-(2-(2-amino thiazol-4-yl)-2-(carboxymethoxyimino) acetamioo)-3-(1-pyridiniammethyl)-ceph-3-em-4-carboxylate |
| US4409215A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical Co., Ltd. | 7-Acylamino-3-substituted cephalosporanic acid derivatives and processes for the preparation thereof |
| US4409214A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical, Co., Ltd. | 7-Acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
| GR78221B (enExample) | 1980-02-01 | 1984-09-26 | Ciba Geigy Ag | |
| FR2476087A1 (fr) * | 1980-02-18 | 1981-08-21 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-alkyloxy ou 3-alkyl-thiomethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| JPS56131591A (en) * | 1980-02-20 | 1981-10-15 | Fujisawa Pharmaceut Co Ltd | 3,7-disubstituted-3-cephem-4-carboxylic acid compound, its salt, preparation thereof and preventing agent and remedy for microbism containing the same as active consitutent |
| JPS5726692A (en) * | 1980-07-22 | 1982-02-12 | Fujisawa Pharmaceut Co Ltd | Preparation of stable crystal of salt of ceftizoxime |
| DK416681A (da) * | 1980-09-26 | 1982-03-27 | Fujisawa Pharmaceutical Co | Femgangsmaade til fremstilling af cephemforbindelser |
| EP0055465B1 (en) * | 1980-12-31 | 1989-08-23 | Fujisawa Pharmaceutical Co., Ltd. | 7-acylaminocephalosporanic acid derivatives and processes for the preparation thereof |
| JPS58986A (ja) * | 1981-05-07 | 1983-01-06 | Fujisawa Pharmaceut Co Ltd | セフェム化合物 |
| JPS57193489A (en) * | 1981-05-21 | 1982-11-27 | Fujisawa Pharmaceut Co Ltd | Syn-isomer of 7-substituted-3-cephem-4-carboxylic acid ester and its preparation |
| FR2506307A1 (fr) * | 1981-05-22 | 1982-11-26 | Roussel Uclaf | Nouveaux derives substitues de l'acide 2-(2-amino 4-thiazolyl) 2-hydroxyimino acetique et leur procede de preparation |
| US4521413A (en) * | 1981-09-14 | 1985-06-04 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| JPS5849382A (ja) * | 1981-09-18 | 1983-03-23 | Kyowa Hakko Kogyo Co Ltd | β−ラクタム化合物 |
| JPS5874680A (ja) * | 1981-10-01 | 1983-05-06 | Kyowa Hakko Kogyo Co Ltd | β−ラクタム化合物 |
| EP0088847B1 (en) * | 1981-11-13 | 1986-02-26 | Glaxo Group Limited | Thiazole derivatives and their use in the manufacture of beta-lactam antibiotics |
| EP0088183B1 (en) * | 1981-11-13 | 1985-08-07 | Glaxo Group Limited | Thiazole derivatives and their use in the manufacture of beta lactam antibiotics |
| JPS58135894A (ja) * | 1982-01-22 | 1983-08-12 | Fujisawa Pharmaceut Co Ltd | 7―置換ブチルアミド―3―ビニルセファロスポラン酸誘導体 |
| JPS58210074A (ja) * | 1982-06-02 | 1983-12-07 | Sankyo Co Ltd | チアゾ−ル酢酸誘導体およびその製造法 |
| FR2532936A1 (fr) * | 1982-09-13 | 1984-03-16 | Roussel Uclaf | Nouveaux derives de l'acide 2-amino-thiazolyl-4-yl acetique comportant une fonction oxime substituee et leur procede de preparation |
| JPS59116291A (ja) * | 1982-12-06 | 1984-07-05 | Fujisawa Pharmaceut Co Ltd | 7−置換−3−セフエム−4−カルボン酸エステルおよびその製法 |
| EP0115770B2 (en) * | 1983-01-07 | 1996-06-19 | Takeda Chemical Industries, Ltd. | Thiazole Derivatives |
| US4480120A (en) * | 1983-03-24 | 1984-10-30 | Eastman Kodak Company | Process for the preparation of alkyl-2-alkoxyimino-3-oxo-4-chlorobutyrates |
| GB8318846D0 (en) * | 1983-07-12 | 1983-08-10 | Fujisawa Pharmaceutical Co | Prophylactic/therapeutic agent against fish diseases |
| JPS6064986A (ja) * | 1983-09-20 | 1985-04-13 | Toyama Chem Co Ltd | セファロスポリン類の製造法 |
| GB8406231D0 (en) * | 1984-03-09 | 1984-04-11 | Fujisawa Pharmaceutical Co | Cephem compounds |
| AT381496B (de) * | 1984-04-10 | 1986-10-27 | Biochemie Gmbh | Verfahren zur herstellung von cephalosporinantibiotika |
| GB8410992D0 (en) * | 1984-04-30 | 1984-06-06 | Glaxo Group Ltd | Process |
| GB8410991D0 (en) * | 1984-04-30 | 1984-06-06 | Glaxo Group Ltd | Process |
| JPH0645625B2 (ja) * | 1984-12-28 | 1994-06-15 | 塩野義製薬株式会社 | ヒドロキシセフアムカルボン酸エステルの製造法 |
| DK500285A (da) * | 1984-11-02 | 1986-05-03 | Glaxo Group Ltd | Cephalosporinantibiotika |
| GB8432295D0 (en) * | 1984-12-20 | 1985-01-30 | Fujisawa Pharmaceutical Co | Cephem compounds |
| GB8519606D0 (en) * | 1985-08-05 | 1985-09-11 | Fujisawa Pharmaceutical Co | 3 7-d substituted-3-cephem compounds |
| CN86107947A (zh) * | 1985-11-22 | 1987-05-27 | 藤沢药品工业株式会社 | 新的头孢烯化合物及其制备方法 |
| JPH0631258B2 (ja) * | 1985-11-29 | 1994-04-27 | 武田薬品工業株式会社 | セフアロスポリン誘導体の製造法 |
| US5373000A (en) * | 1985-12-26 | 1994-12-13 | Eisai Co., Ltd. | 7Beta-(thiadiazolyl)-2-iminoacetamido-3cephem compounds |
| CA1296012C (en) | 1986-03-19 | 1992-02-18 | Susumu Nakagawa | 6,7-dihydroxy-isoquinoline derivatives |
| US4777332A (en) * | 1987-06-22 | 1988-10-11 | Tandem Computers Incorporated | Apparatus for controlling the connection of an electrical module to an electrical receptacle |
| JP2003001718A (ja) * | 2001-06-20 | 2003-01-08 | Aron Kasei Co Ltd | ますの製造方法 |
| WO2004083216A1 (en) * | 2003-03-20 | 2004-09-30 | Orchid Chemicals & Pharmaceuticals Ltd | A process for the preparation of cephalosporins |
| MX352760B (es) | 2011-09-09 | 2017-12-07 | Merck Sharp & Dohme Corp Star | Metodos para tratar infecciones intrapulmonares. |
| US8809314B1 (en) | 2012-09-07 | 2014-08-19 | Cubist Pharmacueticals, Inc. | Cephalosporin compound |
| US8476425B1 (en) | 2012-09-27 | 2013-07-02 | Cubist Pharmaceuticals, Inc. | Tazobactam arginine compositions |
| CN102993117A (zh) * | 2012-11-28 | 2013-03-27 | 张家港市大伟助剂有限公司 | 2-胺基-5-(4-胺基苯基)-噻唑的制备方法 |
| CN102977121A (zh) * | 2012-12-25 | 2013-03-20 | 菏泽睿智科技开发有限公司 | 一种头孢唑肟酸的合成方法 |
| US9320740B2 (en) | 2013-03-15 | 2016-04-26 | Merck Sharp & Dohme Corp. | Ceftolozane-tazobactam pharmaceutical compositions |
| US9872906B2 (en) | 2013-03-15 | 2018-01-23 | Merck Sharp & Dohme Corp. | Ceftolozane antibiotic compositions |
| AU2014227660B2 (en) | 2013-03-15 | 2014-11-06 | Merck Sharp & Dohme Llc | Ceftolozane antibiotic compositions |
| ES2800603T3 (es) | 2013-09-09 | 2021-01-04 | Merck Sharp & Dohme | Tratamiento de infecciones con ceftolozano/tazobactam en sujetos con insuficiencia renal |
| US20150094293A1 (en) | 2013-09-27 | 2015-04-02 | Calixa Therapeutics, Inc. | Solid forms of ceftolozane |
| JP6377570B2 (ja) * | 2014-04-28 | 2018-08-22 | グラクソスミスクライン、インテレクチュアル、プロパティー、ディベロップメント、リミテッドGlaxosmithkline Intellectual Property Development Limited | 2−置換セフェム化合物を含有する医薬組成物 |
| CN105315299B (zh) * | 2015-09-22 | 2017-06-27 | 盐城开元医药化工有限公司 | 一种头孢唑肟母核7‑anca的合成方法 |
| CN114105903B (zh) * | 2021-12-16 | 2023-06-27 | 河北合佳医药科技集团股份有限公司 | 一种高纯度去甲基氨噻肟酸乙酯的制备方法 |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660396A (en) * | 1970-03-04 | 1972-05-02 | Lilly Co Eli | Cephalosporin intermediates and process therefor |
| AR206201A1 (es) * | 1972-06-29 | 1976-07-07 | Ciba Geigy Ag | Procedimiento para la obtencion de compuestos de acido 7beta-amino-3-cefem-3-01-4-carboxilico0-substituidos |
| SE428022B (sv) * | 1972-06-29 | 1983-05-30 | Ciba Geigy Ag | 7beta-amino-cefam-3-on-4-karboxylsyraforeningar till anvendning for framstellning av cefalosporinderivat |
| AR208068A1 (es) * | 1973-02-23 | 1976-11-30 | Lilly Co Eli | Un procedimiento para preparar derivados de acidos 7-acilamido-3-halo-cefem-4-carboxilico los esteres y las sales farmaceuticamente aceptables de los mismos |
| HU172234B (hu) | 1973-12-21 | 1978-07-28 | Glaxo Lab Ltd | Sposob poluchenija novykh proizvodnykh 7-beta-acilamido-cef-3-em-4-karbonovojj kisloty |
| NZ176206A (en) | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins |
| DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
| GB1536281A (en) * | 1975-06-09 | 1978-12-20 | Takeda Chemical Industries Ltd | Cephem compounds |
| AT342197B (de) * | 1975-02-20 | 1978-03-28 | Ciba Geigy Ag | Neues verfahren zur herstellung von 3-cephemverbindungen |
| JPS5919114B2 (ja) * | 1975-08-25 | 1984-05-02 | 武田薬品工業株式会社 | セフアロスポリンの製造法 |
| FR2408613A2 (fr) * | 1977-07-19 | 1979-06-08 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| SE440655B (sv) * | 1976-01-23 | 1985-08-12 | Roussel Uclaf | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra |
| DE2760123C2 (de) * | 1976-01-23 | 1986-04-30 | Roussel-Uclaf, Paris | 7-Aminothiazolyl-syn-oxyiminoacetamidocephalosporansäuren, ihre Herstellung und sie enthaltende pharmazeutische Zusammensetzungen |
| FR2340093A1 (fr) * | 1976-02-05 | 1977-09-02 | Roussel Uclaf | Derives de l'acide 3-carbamoyloxymethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| US4299829A (en) * | 1976-03-12 | 1981-11-10 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem 4-carboxylic acid compounds |
| FR2345153A1 (fr) * | 1976-03-25 | 1977-10-21 | Roussel Uclaf | Nouvelles alcoyloximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| DK162391C (da) | 1976-04-12 | 1992-03-09 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af syn-isomerer af 3,7-disubstituerede 3-cephem-4-carboxylsyreforbindelser |
| US4304770A (en) * | 1976-04-12 | 1981-12-08 | Fujisawa Pharmaceutical Co., Ltd. | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| FR2361895A1 (fr) * | 1976-08-20 | 1978-03-17 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-carbamoyloxymethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| JPS6011713B2 (ja) * | 1976-09-08 | 1985-03-27 | 武田薬品工業株式会社 | セフアロスポリン誘導体およびその製造法 |
| JPS53103493A (en) | 1977-02-18 | 1978-09-08 | Takeda Chem Ind Ltd | Cephalosporin derivatives and process for their preparation |
| FR2384779A1 (fr) * | 1977-03-25 | 1978-10-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-chloro ou 3-methoxy 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| SE439312B (sv) | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
| DE2716677C2 (de) | 1977-04-15 | 1985-10-10 | Hoechst Ag, 6230 Frankfurt | Cephemderivate und Verfahren zu ihrer Herstellung |
| DE2714880A1 (de) | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| FR2410655A1 (fr) | 1977-12-05 | 1979-06-29 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-substitue 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| US4284631A (en) | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
| US4379922A (en) * | 1978-09-12 | 1983-04-12 | Fujisawa Pharmaceutical Co., Ltd. | Cepham compounds |
| JPS5543011A (en) * | 1978-09-20 | 1980-03-26 | Shionogi & Co Ltd | 7-halothiazolylalkoxyiminoacetamido-3-cephem compound |
| FR2448543A1 (fr) | 1979-02-09 | 1980-09-05 | Roussel Uclaf | Nouvelles oximes o-substituees par un radical comportant un ammonium quaternaire et derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2461713A1 (fr) * | 1979-07-19 | 1981-02-06 | Roussel Uclaf | Nouvelles alcoyloximes substituees derivees de l'acide 7-(2-amino 4-thiazolyl) acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| JPS56125392A (en) * | 1980-03-06 | 1981-10-01 | Fujisawa Pharmaceut Co Ltd | Cepham and cephem compound and preparation thereof |
| JPS6238569A (ja) * | 1985-08-13 | 1987-02-19 | Nec Corp | 磁気デイスク制御装置 |
| US5059611A (en) * | 1988-11-18 | 1991-10-22 | Allergan, Inc. | Anti-inflammatory 5-hydroxy-2-furanones |
-
1978
- 1978-03-04 PH PH20877A patent/PH17188A/en unknown
- 1978-03-13 BE BE185864A patent/BE864810A/xx not_active IP Right Cessation
- 1978-03-14 DE DE2810922A patent/DE2810922C2/de not_active Expired
- 1978-03-14 AR AR271413A patent/AR230452A1/es active
- 1978-03-14 CS CS781614A patent/CS217961B2/cs unknown
- 1978-03-14 JP JP2916978A patent/JPS53137988A/ja active Granted
- 1978-03-14 DD DD78214239A patent/DD144772A5/de unknown
- 1978-03-14 FI FI780801A patent/FI65779C/fi not_active IP Right Cessation
- 1978-03-14 NZ NZ199860A patent/NZ199860A/en unknown
- 1978-03-14 FR FR7807360A patent/FR2383951A1/fr active Granted
- 1978-03-14 DD DD78204164A patent/DD136839A5/xx unknown
- 1978-03-14 NZ NZ186679A patent/NZ186679A/xx unknown
- 1978-03-14 PT PT67773A patent/PT67773A/pt unknown
- 1978-03-14 NL NLAANVRAGE7802792,A patent/NL182401C/xx not_active IP Right Cessation
- 1978-03-14 ES ES467828A patent/ES467828A1/es not_active Expired
- 1978-03-14 US US05/886,340 patent/US4425341A/en not_active Expired - Lifetime
- 1978-03-14 SE SE7802933A patent/SE438677B/sv not_active IP Right Cessation
- 1978-03-14 GR GR55704A patent/GR63619B/el unknown
- 1978-03-14 AT AT0181378A patent/AT364456B/de not_active IP Right Cessation
- 1978-03-14 CA CA000298883A patent/CA1321580C/en not_active Expired - Lifetime
- 1978-03-14 DK DK114878A patent/DK163832C/da not_active IP Right Cessation
- 1978-03-14 CH CH278078A patent/CH637138A5/de not_active IP Right Cessation
- 1978-03-14 YU YU608/78A patent/YU41586B/xx unknown
- 1978-12-07 PH PH21907A patent/PH17064A/en unknown
-
1979
- 1979-05-16 ES ES480598A patent/ES480598A1/es not_active Expired
- 1979-10-16 AR AR278528A patent/AR226423A1/es active
-
1980
- 1980-01-16 ES ES487737A patent/ES487737A0/es active Granted
- 1980-01-16 ES ES80487736A patent/ES8100665A1/es not_active Expired
- 1980-02-21 US US06/123,481 patent/US4294960A/en not_active Expired - Lifetime
- 1980-05-06 ES ES491184A patent/ES491184A0/es active Granted
- 1980-05-06 ES ES491183A patent/ES491183A0/es active Granted
- 1980-05-06 ES ES80491182A patent/ES8103751A1/es not_active Expired
- 1980-11-24 ES ES80497084A patent/ES8203865A1/es not_active Expired
-
1981
- 1981-09-15 US US06/302,682 patent/US4447430A/en not_active Expired - Lifetime
-
1982
- 1982-09-30 US US06/428,664 patent/US4460583A/en not_active Expired - Lifetime
- 1982-12-13 YU YU02746/82A patent/YU274682A/xx unknown
- 1982-12-13 YU YU2745/82A patent/YU42061B/xx unknown
-
1983
- 1983-08-29 SE SE8304670A patent/SE8304670D0/xx not_active Application Discontinuation
- 1983-08-29 SE SE8304671A patent/SE456909B/sv not_active IP Right Cessation
- 1983-10-19 US US06/543,297 patent/US4604456A/en not_active Expired - Lifetime
- 1983-11-18 US US06/553,402 patent/US4563522A/en not_active Expired - Lifetime
-
1985
- 1985-05-23 NL NL8501475A patent/NL8501475A/nl not_active Application Discontinuation
-
1986
- 1986-02-19 US US06/830,973 patent/US4822888A/en not_active Expired - Lifetime
-
1987
- 1987-02-20 JP JP62038569A patent/JPS6434974A/ja active Pending
-
1990
- 1990-07-24 JP JP2193985A patent/JPH0639464B2/ja not_active Expired - Lifetime
- 1990-07-24 JP JP2193987A patent/JPH0720947B2/ja not_active Expired - Lifetime
- 1990-07-24 JP JP2193988A patent/JPH03115256A/ja active Granted
- 1990-07-24 JP JP2193989A patent/JPH03115288A/ja active Granted
- 1990-07-24 JP JP2193986A patent/JPH03135972A/ja active Pending
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1321580C (en) | Cephem and cepham compounds and processes for preparation thereof | |
| US4912212A (en) | Cephem compounds | |
| US4370326A (en) | Cephem compounds and composition | |
| EP0007633A2 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| CA1152062A (en) | 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US4341775A (en) | Cephem compounds | |
| US4355160A (en) | Thiazolylacetamido cephalosporin type compounds | |
| US4703046A (en) | Cephem compounds and processes for preparation thereof | |
| US4698337A (en) | Cephem compounds and processes for preparation thereof | |
| GB2025933A (en) | >Cephem and cepham compounds | |
| US4427674A (en) | Cephem compounds | |
| US4923998A (en) | Cephem and cepham compounds and processes for preparation thereof | |
| US4399133A (en) | Cephem compounds | |
| US4400379A (en) | Cephem compounds | |
| US4393059A (en) | Cephem compounds | |
| CA1340499C (en) | Thiazolyl derivatives useful as interediates for the preparation of cephem or cepham compounds | |
| GB2033377A (en) | New Cephem Compounds and Processes for Preparation Thereof | |
| US4841062A (en) | New cephem and cepham compounds and processes for preparation thereof | |
| GB1600735A (en) | Cephem and cephem compounds and processes for preparation thereof | |
| GB2039890A (en) | New cephem compounds | |
| CA1112237A (en) | Cephem compounds and processes for preparation thereof | |
| JPH0354953B2 (enExample) | ||
| CA1112238A (en) | Cephem compounds and processes for preparation thereof | |
| GB2034692A (en) | New cephem compounds and processes for preparation thereof | |
| KR820000902B1 (ko) | 신규의 세펨 및 세팜 화합물의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |
Effective date: 20100824 |