BG60676B1 - Производни на пиридазинамин - Google Patents
Производни на пиридазинамин Download PDFInfo
- Publication number
- BG60676B1 BG60676B1 BG86132A BG8613288A BG60676B1 BG 60676 B1 BG60676 B1 BG 60676B1 BG 86132 A BG86132 A BG 86132A BG 8613288 A BG8613288 A BG 8613288A BG 60676 B1 BG60676 B1 BG 60676B1
- Authority
- BG
- Bulgaria
- Prior art keywords
- formula
- parts
- alkyl
- oxygen
- compound
- Prior art date
Links
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical class NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 title claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 147
- 150000003839 salts Chemical class 0.000 claims abstract description 34
- 239000002253 acid Substances 0.000 claims abstract description 33
- 230000000840 anti-viral effect Effects 0.000 claims abstract description 15
- 150000001412 amines Chemical class 0.000 claims abstract description 13
- 238000005804 alkylation reaction Methods 0.000 claims abstract description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 9
- 239000003814 drug Substances 0.000 claims abstract description 7
- 239000000543 intermediate Substances 0.000 claims description 142
- -1 hydroxy, mercapto Chemical class 0.000 claims description 130
- 239000000203 mixture Substances 0.000 claims description 116
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 65
- 125000000217 alkyl group Chemical group 0.000 claims description 65
- 229910052739 hydrogen Inorganic materials 0.000 claims description 54
- 239000001257 hydrogen Substances 0.000 claims description 53
- 229910052760 oxygen Inorganic materials 0.000 claims description 44
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 40
- 239000001301 oxygen Substances 0.000 claims description 40
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 238000000034 method Methods 0.000 claims description 33
- 150000002431 hydrogen Chemical class 0.000 claims description 30
- 229910052736 halogen Inorganic materials 0.000 claims description 28
- 150000002367 halogens Chemical class 0.000 claims description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 26
- 125000003545 alkoxy group Chemical group 0.000 claims description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 23
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 23
- 125000003118 aryl group Chemical group 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 18
- 239000002585 base Substances 0.000 claims description 17
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 17
- 238000007126 N-alkylation reaction Methods 0.000 claims description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 16
- 239000003153 chemical reaction reagent Substances 0.000 claims description 15
- 239000012442 inert solvent Substances 0.000 claims description 15
- 229910052717 sulfur Inorganic materials 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 12
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 11
- 239000011593 sulfur Chemical group 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 150000002576 ketones Chemical class 0.000 claims description 10
- 239000002609 medium Substances 0.000 claims description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 9
- 230000029936 alkylation Effects 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 7
- 229920000858 Cyclodextrin Polymers 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 230000009467 reduction Effects 0.000 claims description 6
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 5
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 150000001299 aldehydes Chemical class 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000005110 aryl thio group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 2
- 125000005002 aryl methyl group Chemical group 0.000 claims description 2
- 125000005135 aryl sulfinyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 230000003993 interaction Effects 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 125000002524 organometallic group Chemical group 0.000 claims description 2
- 230000009466 transformation Effects 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 2
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 1
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims 1
- 101150065749 Churc1 gene Proteins 0.000 claims 1
- 102100038239 Protein Churchill Human genes 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229960004853 betadex Drugs 0.000 claims 1
- 230000002559 cytogenic effect Effects 0.000 claims 1
- 150000002118 epoxides Chemical class 0.000 claims 1
- 125000001033 ether group Chemical group 0.000 claims 1
- 239000012458 free base Substances 0.000 claims 1
- GDSRMADSINPKSL-HSEONFRVSA-N gamma-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO GDSRMADSINPKSL-HSEONFRVSA-N 0.000 claims 1
- 229940080345 gamma-cyclodextrin Drugs 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 239000008240 homogeneous mixture Substances 0.000 claims 1
- 230000009257 reactivity Effects 0.000 claims 1
- 230000002829 reductive effect Effects 0.000 claims 1
- 201000010099 disease Diseases 0.000 abstract description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 8
- 208000036142 Viral infection Diseases 0.000 abstract description 2
- 208000019622 heart disease Diseases 0.000 abstract description 2
- 208000006454 hepatitis Diseases 0.000 abstract description 2
- 231100000283 hepatitis Toxicity 0.000 abstract description 2
- 150000004892 pyridazines Chemical class 0.000 abstract description 2
- 230000009385 viral infection Effects 0.000 abstract description 2
- 210000003169 central nervous system Anatomy 0.000 abstract 1
- 208000030533 eye disease Diseases 0.000 abstract 1
- 210000001035 gastrointestinal tract Anatomy 0.000 abstract 1
- 208000023504 respiratory system disease Diseases 0.000 abstract 1
- 208000017520 skin disease Diseases 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 135
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 102
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 80
- 239000000047 product Substances 0.000 description 68
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 59
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 54
- 239000011541 reaction mixture Substances 0.000 description 53
- 239000000243 solution Substances 0.000 description 49
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- 239000003054 catalyst Substances 0.000 description 39
- 150000003254 radicals Chemical class 0.000 description 39
- 238000003756 stirring Methods 0.000 description 39
- 239000003480 eluent Substances 0.000 description 36
- 229960004592 isopropanol Drugs 0.000 description 34
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 31
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 30
- 239000000284 extract Substances 0.000 description 30
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 30
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- 229960001701 chloroform Drugs 0.000 description 26
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 238000001816 cooling Methods 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 16
- 239000012044 organic layer Substances 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 229910000029 sodium carbonate Inorganic materials 0.000 description 15
- 235000017550 sodium carbonate Nutrition 0.000 description 15
- 238000004440 column chromatography Methods 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 8
- 241000700605 Viruses Species 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 235000011167 hydrochloric acid Nutrition 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 7
- 150000001266 acyl halides Chemical class 0.000 description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 7
- 239000003610 charcoal Substances 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 239000012258 stirred mixture Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 239000012298 atmosphere Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 5
- 230000000120 cytopathologic effect Effects 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 241000709661 Enterovirus Species 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- 238000011200 topical administration Methods 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- GDOFIYHPLSWJKZ-UHFFFAOYSA-N 3-[4-(2-chloroethyl)piperidin-1-yl]-6-methoxypyridazine Chemical compound N1=NC(OC)=CC=C1N1CCC(CCCl)CC1 GDOFIYHPLSWJKZ-UHFFFAOYSA-N 0.000 description 3
- PLUUXARQNCASOS-UHFFFAOYSA-N 3-[4-(3-hydroxypropyl)piperidin-1-yl]-1h-pyridazin-6-one Chemical compound C1CC(CCCO)CCN1C1=NNC(=O)C=C1 PLUUXARQNCASOS-UHFFFAOYSA-N 0.000 description 3
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 3
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 235000012907 honey Nutrition 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 230000000405 serological effect Effects 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- 230000003612 virological effect Effects 0.000 description 3
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 2
- UXCWXMHKHUTQAQ-UHFFFAOYSA-N 1-ethoxycarbonylpyrrolidine-3-carboxylic acid Chemical compound CCOC(=O)N1CCC(C(O)=O)C1 UXCWXMHKHUTQAQ-UHFFFAOYSA-N 0.000 description 2
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 2
- AFLHSIIXFRTFOO-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-yl)propanenitrile;hydrochloride Chemical compound Cl.C1CC(C(C#N)C)CCN1CC1=CC=CC=C1 AFLHSIIXFRTFOO-UHFFFAOYSA-N 0.000 description 2
- CAEHBUXCGVEDOR-UHFFFAOYSA-N 2-[1-(6-methoxypyridazin-3-yl)piperidin-4-yl]ethanol Chemical compound N1=NC(OC)=CC=C1N1CCC(CCO)CC1 CAEHBUXCGVEDOR-UHFFFAOYSA-N 0.000 description 2
- IBQPXZLAAVGVKK-UHFFFAOYSA-N 2-chloro-1-(3-chloropropoxy)-4-methoxybenzene Chemical compound COC1=CC=C(OCCCCl)C(Cl)=C1 IBQPXZLAAVGVKK-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- LDSQQXKSEFZAPE-UHFFFAOYSA-N 2-piperidin-4-ylethanol Chemical compound OCCC1CCNCC1 LDSQQXKSEFZAPE-UHFFFAOYSA-N 0.000 description 2
- IHRWMVVXSQATHL-UHFFFAOYSA-N 3-(1-benzylpiperidin-4-yl)propan-1-ol Chemical compound C1CC(CCCO)CCN1CC1=CC=CC=C1 IHRWMVVXSQATHL-UHFFFAOYSA-N 0.000 description 2
- USDGMHSZXRXSRW-UHFFFAOYSA-N 3-(1-benzylpiperidin-4-yl)propyl methanesulfonate Chemical compound C1CC(CCCOS(=O)(=O)C)CCN1CC1=CC=CC=C1 USDGMHSZXRXSRW-UHFFFAOYSA-N 0.000 description 2
- LCQFZVFKKNBPCE-UHFFFAOYSA-N 3-(1-ethoxycarbonylpiperidin-4-yl)propanoic acid Chemical compound CCOC(=O)N1CCC(CCC(O)=O)CC1 LCQFZVFKKNBPCE-UHFFFAOYSA-N 0.000 description 2
- IDZHYNJKCNSMRS-UHFFFAOYSA-N 3-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]propan-1-ol Chemical compound C1CC(CCCO)CCN1C1=CC=C(Cl)N=N1 IDZHYNJKCNSMRS-UHFFFAOYSA-N 0.000 description 2
- JTRSXHNHKHFNRY-UHFFFAOYSA-N 3-chloro-6-[4-(2-chloroethyl)piperidin-1-yl]pyridazine Chemical compound C1CC(CCCl)CCN1C1=CC=C(Cl)N=N1 JTRSXHNHKHFNRY-UHFFFAOYSA-N 0.000 description 2
- JEACEWCOOCZDIP-UHFFFAOYSA-N 3-chloro-6-[4-(3-chloropropyl)piperidin-1-yl]pyridazine Chemical compound C1CC(CCCCl)CCN1C1=CC=C(Cl)N=N1 JEACEWCOOCZDIP-UHFFFAOYSA-N 0.000 description 2
- PRORLQAJNJMGAR-UHFFFAOYSA-N 3-chloro-6-methylpyridazine Chemical compound CC1=CC=C(Cl)N=N1 PRORLQAJNJMGAR-UHFFFAOYSA-N 0.000 description 2
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- NECBYQMSWFOUAQ-UHFFFAOYSA-N 4-[(1-benzyl-4-hydroxypiperidin-4-yl)methoxy]-n-(2-hydroxyethyl)benzamide Chemical compound C1=CC(C(=O)NCCO)=CC=C1OCC1(O)CCN(CC=2C=CC=CC=2)CC1 NECBYQMSWFOUAQ-UHFFFAOYSA-N 0.000 description 2
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 241000430519 Human rhinovirus sp. Species 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- 241000709664 Picornaviridae Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000002128 anti-rhinoviral effect Effects 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- 239000007640 basal medium Substances 0.000 description 2
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- KQJZIMAKSPTAFQ-UHFFFAOYSA-N ethyl 3-carbonochloridoylpyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(C(Cl)=O)C1 KQJZIMAKSPTAFQ-UHFFFAOYSA-N 0.000 description 2
- VPCHJOXYXRKPOG-UHFFFAOYSA-N ethyl 3-formylpyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(C=O)C1 VPCHJOXYXRKPOG-UHFFFAOYSA-N 0.000 description 2
- ZFKRHKCQDDIMKT-UHFFFAOYSA-N ethyl 4-(3-chloro-3-oxopropyl)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(CCC(Cl)=O)CC1 ZFKRHKCQDDIMKT-UHFFFAOYSA-N 0.000 description 2
- QGBRYMBJARSELI-UHFFFAOYSA-N ethyl 4-(3-chloropropyl)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(CCCCl)CC1 QGBRYMBJARSELI-UHFFFAOYSA-N 0.000 description 2
- YFNSVTKRYJNZKK-UHFFFAOYSA-N ethyl 4-(3-hydroxypropyl)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(CCCO)CC1 YFNSVTKRYJNZKK-UHFFFAOYSA-N 0.000 description 2
- PGKWGMSAHDORQF-UHFFFAOYSA-N ethyl 4-(3-piperidin-4-ylpropoxy)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCCCC1CCNCC1 PGKWGMSAHDORQF-UHFFFAOYSA-N 0.000 description 2
- RFMPTFWIPCXJPE-UHFFFAOYSA-N ethyl 4-[(1-benzyl-4-hydroxypiperidin-4-yl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1(O)CCN(CC=2C=CC=CC=2)CC1 RFMPTFWIPCXJPE-UHFFFAOYSA-N 0.000 description 2
- IOCSVTIZFJTCCI-UHFFFAOYSA-N ethyl 4-[3-[4-(5,6-dihydro-4h-1,3-oxazin-2-yl)phenoxy]propyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1CCCOC1=CC=C(C=2OCCCN=2)C=C1 IOCSVTIZFJTCCI-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- JFCQEDHGNNZCLN-UHFFFAOYSA-N glutaric acid Chemical compound OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- AILKHAQXUAOOFU-UHFFFAOYSA-N hexanenitrile Chemical compound CCCCCC#N AILKHAQXUAOOFU-UHFFFAOYSA-N 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- CVVIJWRCGSYCMB-UHFFFAOYSA-N hydron;piperazine;dichloride Chemical compound Cl.Cl.C1CNCCN1 CVVIJWRCGSYCMB-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 230000000707 stereoselective effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- OOKAZRDERJMRCJ-KOUAFAAESA-N (3r)-7-[(1s,2s,4ar,6s,8s)-2,6-dimethyl-8-[(2s)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-hydroxy-5-oxoheptanoic acid Chemical compound C1=C[C@H](C)[C@H](CCC(=O)C[C@@H](O)CC(O)=O)C2[C@@H](OC(=O)[C@@H](C)CC)C[C@@H](C)C[C@@H]21 OOKAZRDERJMRCJ-KOUAFAAESA-N 0.000 description 1
- STPKWKPURVSAJF-LJEWAXOPSA-N (4r,5r)-5-[4-[[4-(1-aza-4-azoniabicyclo[2.2.2]octan-4-ylmethyl)phenyl]methoxy]phenyl]-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2h-1$l^{6}-benzothiepin-4-ol Chemical compound O[C@H]1C(CCCC)(CCCC)CS(=O)(=O)C2=CC=C(N(C)C)C=C2[C@H]1C(C=C1)=CC=C1OCC(C=C1)=CC=C1C[N+]1(CC2)CCN2CC1 STPKWKPURVSAJF-LJEWAXOPSA-N 0.000 description 1
- VUEGYUOUAAVYAS-JGGQBBKZSA-N (6ar,9s,10ar)-9-(dimethylsulfamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline Chemical compound C1=CC([C@H]2C[C@@H](CN(C)[C@@H]2C2)NS(=O)(=O)N(C)C)=C3C2=CNC3=C1 VUEGYUOUAAVYAS-JGGQBBKZSA-N 0.000 description 1
- 125000006595 (C1-C3) alkylsulfinyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 description 1
- 125000006619 (C1-C6) dialkylamino group Chemical group 0.000 description 1
- DEVSOMFAQLZNKR-RJRFIUFISA-N (z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-n'-pyrazin-2-ylprop-2-enehydrazide Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2=NN(\C=C/C(=O)NNC=3N=CC=NC=3)C=N2)=C1 DEVSOMFAQLZNKR-RJRFIUFISA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- QLRTYVYDENKBEI-UHFFFAOYSA-N 1,4-dichloro-2-(3-chloropropoxy)-5-methoxybenzene Chemical compound COC1=CC(Cl)=C(OCCCCl)C=C1Cl QLRTYVYDENKBEI-UHFFFAOYSA-N 0.000 description 1
- SJZQJMFKQYZZAT-UHFFFAOYSA-N 1-(3-chloropropoxy)-4-methoxybenzene Chemical compound COC1=CC=C(OCCCCl)C=C1 SJZQJMFKQYZZAT-UHFFFAOYSA-N 0.000 description 1
- PHFUCMDTUDKBLB-UHFFFAOYSA-N 1-(6-chloropyridazin-3-yl)-1,4-diazepane;hydrochloride Chemical compound Cl.N1=NC(Cl)=CC=C1N1CCNCCC1 PHFUCMDTUDKBLB-UHFFFAOYSA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- QEAJGVFGKJXAST-UHFFFAOYSA-N 2,3-dichloro-1-(3-chloropropoxy)-4-methoxybenzene Chemical compound COC1=CC=C(OCCCCl)C(Cl)=C1Cl QEAJGVFGKJXAST-UHFFFAOYSA-N 0.000 description 1
- VCKYXWGUAXTTMK-UHFFFAOYSA-N 2,6-difluoro-1h-pyridazine Chemical compound FN1NC(F)=CC=C1 VCKYXWGUAXTTMK-UHFFFAOYSA-N 0.000 description 1
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 description 1
- FBFPTWSKNJHCGT-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-yl)ethanol Chemical compound C1CC(CCO)CCN1CC1=CC=CC=C1 FBFPTWSKNJHCGT-UHFFFAOYSA-N 0.000 description 1
- OHKSHQLCHROOSK-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-yl)propan-1-ol Chemical compound C1CC(C(CO)C)CCN1CC1=CC=CC=C1 OHKSHQLCHROOSK-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- VCUXVXLUOHDHKK-UHFFFAOYSA-N 2-(2-aminopyrimidin-4-yl)-4-(2-chloro-4-methoxyphenyl)-1,3-thiazole-5-carboxamide Chemical compound ClC1=CC(OC)=CC=C1C1=C(C(N)=O)SC(C=2N=C(N)N=CC=2)=N1 VCUXVXLUOHDHKK-UHFFFAOYSA-N 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZOTJNOZWPQHVMJ-UHFFFAOYSA-N 2-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]ethanol Chemical compound C1CC(CCO)CCN1C1=CC=C(Cl)N=N1 ZOTJNOZWPQHVMJ-UHFFFAOYSA-N 0.000 description 1
- GNOCBMYIZNHZLT-UHFFFAOYSA-N 2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethanol Chemical compound N1=NC(C)=CC=C1N1CCC(CCO)CC1 GNOCBMYIZNHZLT-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- VVCMGAUPZIKYTH-VGHSCWAPSA-N 2-acetyloxybenzoic acid;[(2s,3r)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;1,3,7-trimethylpurine-2,6-dione Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C.C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 VVCMGAUPZIKYTH-VGHSCWAPSA-N 0.000 description 1
- 229940058020 2-amino-2-methyl-1-propanol Drugs 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- GNVRRKLFFYSLGT-UHFFFAOYSA-N 2-chloro-4-methoxyphenol Chemical compound COC1=CC=C(O)C(Cl)=C1 GNVRRKLFFYSLGT-UHFFFAOYSA-N 0.000 description 1
- 125000006012 2-chloroethoxy group Chemical group 0.000 description 1
- AVEFUVDYABVXFL-UHFFFAOYSA-N 2-ethoxyethyl 4-[3-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]propyl]benzoate Chemical compound C1=CC(C(=O)OCCOCC)=CC=C1CCCC1CCN(C=2N=NC(Cl)=CC=2)CC1 AVEFUVDYABVXFL-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 1
- GCLHXKPPHRIJOE-UHFFFAOYSA-N 3,6-diiodopyridazine Chemical compound IC1=CC=C(I)N=N1 GCLHXKPPHRIJOE-UHFFFAOYSA-N 0.000 description 1
- DYUBDHWGYUAYRJ-UHFFFAOYSA-N 3,8-dichloro-2h-phthalazine Chemical compound ClC1=CC=CC2=CN(Cl)NC=C21 DYUBDHWGYUAYRJ-UHFFFAOYSA-N 0.000 description 1
- DFRAKBCRUYUFNT-UHFFFAOYSA-N 3,8-dicyclohexyl-2,4,7,9-tetrahydro-[1,3]oxazino[5,6-h][1,3]benzoxazine Chemical compound C1CCCCC1N1CC(C=CC2=C3OCN(C2)C2CCCCC2)=C3OC1 DFRAKBCRUYUFNT-UHFFFAOYSA-N 0.000 description 1
- ZXFNCQXCFCPCEX-UHFFFAOYSA-N 3-(1-ethoxycarbonylpyrrolidin-3-yl)propanoic acid Chemical compound CCOC(=O)N1CCC(CCC(O)=O)C1 ZXFNCQXCFCPCEX-UHFFFAOYSA-N 0.000 description 1
- NZTJJLCAFTZAGK-UHFFFAOYSA-N 3-(1-phenylmethoxycarbonylpiperidin-4-yl)propanoic acid Chemical compound C1CC(CCC(=O)O)CCN1C(=O)OCC1=CC=CC=C1 NZTJJLCAFTZAGK-UHFFFAOYSA-N 0.000 description 1
- IGBCYKAWLBLEEF-UHFFFAOYSA-N 3-(2-chloroethyl)-8-(6-chloropyridazin-3-yl)-8-azabicyclo[3.2.1]octane Chemical compound C1C(CCCl)CC2CCC1N2C1=CC=C(Cl)N=N1 IGBCYKAWLBLEEF-UHFFFAOYSA-N 0.000 description 1
- PYGOAPOQDSKLCC-UHFFFAOYSA-N 3-(2-chloroethyl)pyrrolidin-1-ium;chloride Chemical compound Cl.ClCCC1CCNC1 PYGOAPOQDSKLCC-UHFFFAOYSA-N 0.000 description 1
- SCDNSKVYZDVDKD-UHFFFAOYSA-N 3-[4-(2-chloroethyl)piperidin-1-yl]-1h-pyridazin-6-one Chemical compound C1CC(CCCl)CCN1C1=NNC(=O)C=C1 SCDNSKVYZDVDKD-UHFFFAOYSA-N 0.000 description 1
- CVQFYSMLUOBBJN-UHFFFAOYSA-N 3-[4-(2-chloroethyl)piperidin-1-yl]-6-methylpyridazine Chemical compound N1=NC(C)=CC=C1N1CCC(CCCl)CC1 CVQFYSMLUOBBJN-UHFFFAOYSA-N 0.000 description 1
- XYJYJBKRXIKRLP-UHFFFAOYSA-N 3-[4-(3-chloropropyl)piperidin-1-yl]-1h-pyridazin-6-one Chemical compound C1CC(CCCCl)CCN1C1=NNC(=O)C=C1 XYJYJBKRXIKRLP-UHFFFAOYSA-N 0.000 description 1
- RGKAZXFQIUEBBS-UHFFFAOYSA-N 3-[4-(3-chloropropyl)piperidin-1-yl]-6-methoxypyridazine;hydrochloride Chemical compound Cl.N1=NC(OC)=CC=C1N1CCC(CCCCl)CC1 RGKAZXFQIUEBBS-UHFFFAOYSA-N 0.000 description 1
- LEUSZECYGDIAPF-UHFFFAOYSA-N 3-[4-(3-chloropropyl)piperidin-1-yl]-6-methylpyridazine Chemical compound N1=NC(C)=CC=C1N1CCC(CCCCl)CC1 LEUSZECYGDIAPF-UHFFFAOYSA-N 0.000 description 1
- CGWCQKPOOBBCFA-UHFFFAOYSA-N 3-[4-(chloromethyl)piperidin-1-yl]-6-methoxypyridazine;hydrochloride Chemical compound Cl.N1=NC(OC)=CC=C1N1CCC(CCl)CC1 CGWCQKPOOBBCFA-UHFFFAOYSA-N 0.000 description 1
- AAUXODXCWIMJPK-UHFFFAOYSA-N 3-[4-(chloromethyl)piperidin-1-yl]-6-methylpyridazine Chemical compound N1=NC(C)=CC=C1N1CCC(CCl)CC1 AAUXODXCWIMJPK-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- ZUYPGQOAHQMNLO-UHFFFAOYSA-N 3-butyl-6-chloropyridazine Chemical compound CCCCC1=CC=C(Cl)N=N1 ZUYPGQOAHQMNLO-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- FDWLZDBSLRBFKM-UHFFFAOYSA-N 3-chloro-6-(3-methylpiperazin-1-yl)pyridazine Chemical compound C1CNC(C)CN1C1=CC=C(Cl)N=N1 FDWLZDBSLRBFKM-UHFFFAOYSA-N 0.000 description 1
- LYFFDJDAWPESSH-UHFFFAOYSA-N 3-chloro-6-(4-fluorophenyl)pyridazine Chemical compound C1=CC(F)=CC=C1C1=CC=C(Cl)N=N1 LYFFDJDAWPESSH-UHFFFAOYSA-N 0.000 description 1
- WXKUPYXPDVJDCN-UHFFFAOYSA-N 3-chloro-6-[4-(4-chlorobutyl)piperidin-1-yl]pyridazine Chemical compound C1CC(CCCCCl)CCN1C1=CC=C(Cl)N=N1 WXKUPYXPDVJDCN-UHFFFAOYSA-N 0.000 description 1
- PKIABHKISGRDOO-UHFFFAOYSA-N 3-chloro-6-[4-(chloromethyl)piperidin-1-yl]pyridazine Chemical compound C1CC(CCl)CCN1C1=CC=C(Cl)N=N1 PKIABHKISGRDOO-UHFFFAOYSA-N 0.000 description 1
- AGFRSOSZUUBXJT-UHFFFAOYSA-N 3-chloro-6-[4-[3-(2-chloro-4-methoxyphenoxy)propyl]piperidin-1-yl]pyridazine Chemical compound ClC1=CC(OC)=CC=C1OCCCC1CCN(C=2N=NC(Cl)=CC=2)CC1 AGFRSOSZUUBXJT-UHFFFAOYSA-N 0.000 description 1
- SYTORMJGKJSEBQ-UHFFFAOYSA-N 3-chloro-6-[4-[3-(4-methoxyphenoxy)propyl]piperazin-1-yl]pyridazine Chemical compound C1=CC(OC)=CC=C1OCCCN1CCN(C=2N=NC(Cl)=CC=2)CC1 SYTORMJGKJSEBQ-UHFFFAOYSA-N 0.000 description 1
- CAZDNMWZZXLBSI-UHFFFAOYSA-N 3-chloro-6-methylsulfanylpyridazine Chemical compound CSC1=CC=C(Cl)N=N1 CAZDNMWZZXLBSI-UHFFFAOYSA-N 0.000 description 1
- DXPPQFXYIZTQCV-UHFFFAOYSA-N 3-chloro-6-piperazin-1-ylpyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCNCC1 DXPPQFXYIZTQCV-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- VQMPTVQCADWACQ-UHFFFAOYSA-N 3-methylpentan-3-amine Chemical compound CCC(C)(N)CC VQMPTVQCADWACQ-UHFFFAOYSA-N 0.000 description 1
- KOAMXHRRVFDWRQ-UHFFFAOYSA-N 4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC=N1 KOAMXHRRVFDWRQ-UHFFFAOYSA-N 0.000 description 1
- TWBKFRCIBBFNED-UHFFFAOYSA-N 4-(3-chloro-3-oxopropyl)piperidine-1-carboxylic acid Chemical compound ClC(=O)CCC1CCN(CC1)C(=O)O TWBKFRCIBBFNED-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZHEBOGJEFDFDSQ-UHFFFAOYSA-N 4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenol Chemical compound CC1(C)COC(C=2C=CC(O)=CC=2)=N1 ZHEBOGJEFDFDSQ-UHFFFAOYSA-N 0.000 description 1
- CLAPHRRFPLSJPN-UHFFFAOYSA-N 4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenol hydrochloride Chemical compound Cl.C1=CC(O)=CC=C1C1=NCCCO1 CLAPHRRFPLSJPN-UHFFFAOYSA-N 0.000 description 1
- INQSIQVUWSKAQV-UHFFFAOYSA-N 4-[3-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]propoxy]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCCCC1CCN(C=2N=NC(Cl)=CC=2)CC1 INQSIQVUWSKAQV-UHFFFAOYSA-N 0.000 description 1
- MPMKMQHJHDHPBE-RUZDIDTESA-N 4-[[(2r)-1-(1-benzothiophene-3-carbonyl)-2-methylazetidine-2-carbonyl]-[(3-chlorophenyl)methyl]amino]butanoic acid Chemical compound O=C([C@@]1(N(CC1)C(=O)C=1C2=CC=CC=C2SC=1)C)N(CCCC(O)=O)CC1=CC=CC(Cl)=C1 MPMKMQHJHDHPBE-RUZDIDTESA-N 0.000 description 1
- DQAZPZIYEOGZAF-UHFFFAOYSA-N 4-ethyl-n-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide Chemical compound C1CN(CC)CCN1C(=O)NC(C(=CC1=NC=N2)OC)=CC1=C2NC1=CC=CC(C#C)=C1 DQAZPZIYEOGZAF-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- ICEKEZSKMGHZNT-UHFFFAOYSA-N 4-phenylmethoxybenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1OCC1=CC=CC=C1 ICEKEZSKMGHZNT-UHFFFAOYSA-N 0.000 description 1
- LMJXSOYPAOSIPZ-UHFFFAOYSA-N 4-sulfanylbenzoic acid Chemical compound OC(=O)C1=CC=C(S)C=C1 LMJXSOYPAOSIPZ-UHFFFAOYSA-N 0.000 description 1
- VKLKXFOZNHEBSW-UHFFFAOYSA-N 5-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide Chemical compound O1CCN(CC1)C1=CC=C(C(=O)NC=2C=C(COC=3C=NC=C(C(=O)N)C=3)C=CC=2)C=C1 VKLKXFOZNHEBSW-UHFFFAOYSA-N 0.000 description 1
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 description 1
- KJKHFQBTYMJFNP-UHFFFAOYSA-N 6-benzyl-1-oxa-6-azaspiro[2.5]octane Chemical compound C=1C=CC=CC=1CN(CC1)CCC21CO2 KJKHFQBTYMJFNP-UHFFFAOYSA-N 0.000 description 1
- GDUANFXPOZTYKS-UHFFFAOYSA-N 6-bromo-8-[(2,6-difluoro-4-methoxybenzoyl)amino]-4-oxochromene-2-carboxylic acid Chemical compound FC1=CC(OC)=CC(F)=C1C(=O)NC1=CC(Br)=CC2=C1OC(C(O)=O)=CC2=O GDUANFXPOZTYKS-UHFFFAOYSA-N 0.000 description 1
- PHOSWLARCIBBJZ-UHFFFAOYSA-N 6-bromohexanenitrile Chemical compound BrCCCCCC#N PHOSWLARCIBBJZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 208000006740 Aseptic Meningitis Diseases 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- NADTUDXSPFPHPK-UHFFFAOYSA-N B.[Na] Chemical compound B.[Na] NADTUDXSPFPHPK-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- NYPPQVOIXNSOGI-UHFFFAOYSA-N C(C)(=O)O.C(C)C1=CC=C(C=C1)OCCC1CCNCC1 Chemical compound C(C)(=O)O.C(C)C1=CC=C(C=C1)OCCC1CCNCC1 NYPPQVOIXNSOGI-UHFFFAOYSA-N 0.000 description 1
- VHIAZKUAFPAAGR-UHFFFAOYSA-N C(C)(=O)O.C(C)C1=CC=C(C=C1)OCCCC1CCNCC1 Chemical compound C(C)(=O)O.C(C)C1=CC=C(C=C1)OCCCC1CCNCC1 VHIAZKUAFPAAGR-UHFFFAOYSA-N 0.000 description 1
- QDDKMKGSQMEUTL-UHFFFAOYSA-N C(C=CC(=O)O)(=O)O.ClC1=CC=C(N=N1)NCCN Chemical compound C(C=CC(=O)O)(=O)O.ClC1=CC=C(N=N1)NCCN QDDKMKGSQMEUTL-UHFFFAOYSA-N 0.000 description 1
- PKMUHQIDVVOXHQ-HXUWFJFHSA-N C[C@H](C1=CC(C2=CC=C(CNC3CCCC3)S2)=CC=C1)NC(C1=C(C)C=CC(NC2CNC2)=C1)=O Chemical compound C[C@H](C1=CC(C2=CC=C(CNC3CCCC3)S2)=CC=C1)NC(C1=C(C)C=CC(NC2CNC2)=C1)=O PKMUHQIDVVOXHQ-HXUWFJFHSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- 206010010741 Conjunctivitis Diseases 0.000 description 1
- 241000709687 Coxsackievirus Species 0.000 description 1
- 206010012735 Diarrhoea Diseases 0.000 description 1
- 241001466953 Echovirus Species 0.000 description 1
- 241000991587 Enterovirus C Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 208000001860 Eye Infections Diseases 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical class OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 201000006219 Herpangina Diseases 0.000 description 1
- 241000710124 Human rhinovirus A2 Species 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 206010027201 Meningitis aseptic Diseases 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- 206010065764 Mucosal infection Diseases 0.000 description 1
- 208000009525 Myocarditis Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 241001144416 Picornavirales Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- HKEPHNYJUWAKIA-UHFFFAOYSA-N acetic acid;3-piperidin-4-ylpropanoic acid Chemical compound CC(O)=O.OC(=O)CCC1CCNCC1 HKEPHNYJUWAKIA-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 201000004484 acute conjunctivitis Diseases 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- HDPRNQWMIFKNKS-UHFFFAOYSA-N benzene;lithium Chemical compound [Li].C1=CC=CC=C1 HDPRNQWMIFKNKS-UHFFFAOYSA-N 0.000 description 1
- LAMJEIALKQRYBY-UHFFFAOYSA-N benzoic acid;but-2-enedioic acid Chemical compound OC(=O)C=CC(O)=O.OC(=O)C1=CC=CC=C1 LAMJEIALKQRYBY-UHFFFAOYSA-N 0.000 description 1
- SQNGFLZBHUXPNB-UHFFFAOYSA-N benzoic acid;butanedioic acid Chemical compound OC(=O)CCC(O)=O.OC(=O)C1=CC=CC=C1 SQNGFLZBHUXPNB-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- ZGSAKMOZVFJWCG-UHFFFAOYSA-N butanedioic acid;ethyl 4-(2-piperidin-4-ylethoxy)benzoate Chemical compound OC(=O)CCC(O)=O.C1=CC(C(=O)OCC)=CC=C1OCCC1CCNCC1 ZGSAKMOZVFJWCG-UHFFFAOYSA-N 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000007541 cellular toxicity Effects 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940126179 compound 72 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 1
- NUOUOKKFHOLVIW-UHFFFAOYSA-N cyclopropylmethyl 4-[2-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]ethoxy]benzoate Chemical compound N1=NC(Cl)=CC=C1N1CCC(CCOC=2C=CC(=CC=2)C(=O)OCC2CC2)CC1 NUOUOKKFHOLVIW-UHFFFAOYSA-N 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002085 enols Chemical group 0.000 description 1
- BJXYHBKEQFQVES-NWDGAFQWSA-N enpatoran Chemical compound N[C@H]1CN(C[C@H](C1)C(F)(F)F)C1=C2C=CC=NC2=C(C=C1)C#N BJXYHBKEQFQVES-NWDGAFQWSA-N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- CYPXEPWPTXKUPL-UHFFFAOYSA-N ethyl 1-benzylpyrrolidine-3-carboxylate Chemical compound C1C(C(=O)OCC)CCN1CC1=CC=CC=C1 CYPXEPWPTXKUPL-UHFFFAOYSA-N 0.000 description 1
- LUSHYPLDRVACQI-UHFFFAOYSA-N ethyl 3-(1-benzylpiperidin-4-yl)propanoate Chemical compound C1CC(CCC(=O)OCC)CCN1CC1=CC=CC=C1 LUSHYPLDRVACQI-UHFFFAOYSA-N 0.000 description 1
- ZEIFBQQAAWWUAI-UHFFFAOYSA-N ethyl 3-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate Chemical compound C1C(CCO)CC2CCC1N2C(=O)OCC ZEIFBQQAAWWUAI-UHFFFAOYSA-N 0.000 description 1
- KBTYOJYSJVKYPX-UHFFFAOYSA-N ethyl 3-(3-hydroxypropyl)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCCC(CCCO)C1 KBTYOJYSJVKYPX-UHFFFAOYSA-N 0.000 description 1
- GWNFQAKCJYEJEW-UHFFFAOYSA-N ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate Chemical compound CCOC(=O)C1=CC(NC(=O)CCCCCCCSC2=NN=C(CC3=NN(C)C(=O)C4=CC=CC=C34)N2C)=CC=C1 GWNFQAKCJYEJEW-UHFFFAOYSA-N 0.000 description 1
- MWSMNBYIEBRXAL-UHFFFAOYSA-N ethyl 3-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=CC(O)=C1 MWSMNBYIEBRXAL-UHFFFAOYSA-N 0.000 description 1
- FPJQQOGGORNYLH-UHFFFAOYSA-N ethyl 4-(3-oxopropyl)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(CCC=O)CC1 FPJQQOGGORNYLH-UHFFFAOYSA-N 0.000 description 1
- DADQRMCKVNBYGG-UHFFFAOYSA-N ethyl 4-[[1-(6-chloropyridazin-3-yl)-3,6-dihydro-2h-pyridin-4-yl]methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CCN(C=2N=NC(Cl)=CC=2)CC1 DADQRMCKVNBYGG-UHFFFAOYSA-N 0.000 description 1
- RPEIDUWVOFFAMB-UHFFFAOYSA-N ethyl 4-[[1-(6-methoxypyridazin-3-yl)piperidin-4-yl]methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1CCN(C=2N=NC(OC)=CC=2)CC1 RPEIDUWVOFFAMB-UHFFFAOYSA-N 0.000 description 1
- AXULIEDRBVKUGD-UHFFFAOYSA-N ethyl 4-[[4-(6-chloropyridazin-3-yl)piperazin-1-yl]methyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1CN1CCN(C=2N=NC(Cl)=CC=2)CC1 AXULIEDRBVKUGD-UHFFFAOYSA-N 0.000 description 1
- SNZISULERDBYGD-UHFFFAOYSA-N ethyl 4-formylpiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(C=O)CC1 SNZISULERDBYGD-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- LNOQURRKNJKKBU-UHFFFAOYSA-N ethyl piperazine-1-carboxylate Chemical compound CCOC(=O)N1CCNCC1 LNOQURRKNJKKBU-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- SMQNBMQUPLFFGS-UHFFFAOYSA-N hydron;piperazine-1-carboxylic acid;chloride Chemical compound Cl.OC(=O)N1CCNCC1 SMQNBMQUPLFFGS-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-M hydrosulfide Chemical compound [SH-] RWSOTUBLDIXVET-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M isovalerate Chemical compound CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 235000011147 magnesium chloride Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- DSNBYIFUWOOUNT-UHFFFAOYSA-N methyl 3-(2-hydroxyethyl)pyrrolidine-1-carboxylate Chemical compound COC(=O)N1CCC(CCO)C1 DSNBYIFUWOOUNT-UHFFFAOYSA-N 0.000 description 1
- JWXGBLNGCIGLBH-UHFFFAOYSA-N methyl 3-methyl-4-oxopiperidine-1-carboxylate Chemical compound COC(=O)N1CCC(=O)C(C)C1 JWXGBLNGCIGLBH-UHFFFAOYSA-N 0.000 description 1
- BOOGWBWPSBNSJK-UHFFFAOYSA-N methyl 4-(2-ethoxy-2-oxoethylidene)-3-methylpiperidine-1-carboxylate Chemical compound CCOC(=O)C=C1CCN(C(=O)OC)CC1C BOOGWBWPSBNSJK-UHFFFAOYSA-N 0.000 description 1
- VLCYQQGKLJYAFI-UHFFFAOYSA-N methyl 4-[(1-benzyl-4-hydroxypiperidin-4-yl)methoxy]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCC1(O)CCN(CC=2C=CC=CC=2)CC1 VLCYQQGKLJYAFI-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- QXCVHGTYKQENBU-UHFFFAOYSA-N n-(2-hydroxyethyl)-4-[(4-hydroxypiperidin-4-yl)methoxy]benzamide Chemical compound C1=CC(C(=O)NCCO)=CC=C1OCC1(O)CCNCC1 QXCVHGTYKQENBU-UHFFFAOYSA-N 0.000 description 1
- ZKSYUNLBFSOENV-UHFFFAOYSA-N n-(2-hydroxyethyl)benzamide Chemical compound OCCNC(=O)C1=CC=CC=C1 ZKSYUNLBFSOENV-UHFFFAOYSA-N 0.000 description 1
- YGBMCLDVRUGXOV-UHFFFAOYSA-N n-[6-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]pyridin-3-yl]-1,3-benzothiazol-2-yl]acetamide Chemical compound C1=C2SC(NC(=O)C)=NC2=CC=C1C(C=1)=CN=C(Cl)C=1NS(=O)(=O)C1=CC=C(F)C=C1 YGBMCLDVRUGXOV-UHFFFAOYSA-N 0.000 description 1
- XVDBWWRIXBMVJV-UHFFFAOYSA-N n-[bis(dimethylamino)phosphanyl]-n-methylmethanamine Chemical compound CN(C)P(N(C)C)N(C)C XVDBWWRIXBMVJV-UHFFFAOYSA-N 0.000 description 1
- 201000009240 nasopharyngitis Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001979 organolithium group Chemical group 0.000 description 1
- 125000002734 organomagnesium group Chemical group 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 208000008494 pericarditis Diseases 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- QRKVRHZNLKTPGF-UHFFFAOYSA-N phosphorus pentabromide Chemical compound BrP(Br)(Br)(Br)Br QRKVRHZNLKTPGF-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- BITYAPCSNKJESK-UHFFFAOYSA-N potassiosodium Chemical compound [Na].[K] BITYAPCSNKJESK-UHFFFAOYSA-N 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- JADFCQKRKICRKI-UHFFFAOYSA-N quinoline;sulfane Chemical compound S.N1=CC=CC2=CC=CC=C21 JADFCQKRKICRKI-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000007655 standard test method Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 125000005497 tetraalkylphosphonium group Chemical group 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000011426 transformation method Methods 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/50—Pyridazines; Hydrogenated pyridazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Virology (AREA)
- Epidemiology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyrrole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12453087A | 1987-11-23 | 1987-11-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| BG86132A BG86132A (bg) | 1993-12-24 |
| BG60676B1 true BG60676B1 (bg) | 1995-12-29 |
Family
ID=22415413
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG86132A BG60676B1 (bg) | 1987-11-23 | 1988-11-21 | Производни на пиридазинамин |
Country Status (26)
| Country | Link |
|---|---|
| EP (1) | EP0320032B1 (es) |
| JP (1) | JPH0629255B2 (es) |
| KR (1) | KR0125280B1 (es) |
| CN (1) | CN1021328C (es) |
| AT (1) | ATE117296T1 (es) |
| AU (1) | AU611504B2 (es) |
| BG (1) | BG60676B1 (es) |
| CA (1) | CA1327573C (es) |
| DE (1) | DE3852816T2 (es) |
| DK (1) | DK651288A (es) |
| ES (1) | ES2070126T3 (es) |
| FI (1) | FI92584C (es) |
| GR (1) | GR3015816T3 (es) |
| HU (1) | HU200762B (es) |
| IE (1) | IE65768B1 (es) |
| IL (1) | IL88429A (es) |
| JO (1) | JO1552B1 (es) |
| MA (1) | MA21446A1 (es) |
| MY (1) | MY104343A (es) |
| NO (1) | NO171980C (es) |
| NZ (1) | NZ226920A (es) |
| PH (1) | PH26670A (es) |
| PT (1) | PT89047B (es) |
| SU (1) | SU1724013A3 (es) |
| TN (1) | TNSN88128A1 (es) |
| ZA (1) | ZA888744B (es) |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5106973A (en) * | 1987-11-23 | 1992-04-21 | Janssen Pharmaceutica N.V. | Pyridzainamine derivatives |
| US5070090A (en) * | 1989-05-15 | 1991-12-03 | Janssen Pharmaceutica N.V. | Antipicorpaviral herterocyclic-substituted morpholinyl alkylphenol ethers |
| GB8911158D0 (en) * | 1989-05-16 | 1989-07-05 | Janssen Pharmaceutica Nv | Antiviral pyridazinamines |
| JO1645B1 (en) * | 1989-12-26 | 1991-11-27 | شركة جانسين فارماسوتيكا ان. في | Pyridazine compounds are antibacterial viruses |
| US5169855A (en) * | 1990-03-28 | 1992-12-08 | Du Pont Merck Pharmaceutical Company | Piperidine ether derivatives as psychotropic drugs or plant fungicides |
| IE912759A1 (en) * | 1990-08-06 | 1992-02-12 | Smith Kline French Lab | Compounds |
| FR2668151A1 (fr) * | 1990-10-23 | 1992-04-24 | Rhone Poulenc Agrochimie | Composes a groupe triazolopyridazine leurs preparations et compositions herbicides les contenant. |
| HU214320B (hu) * | 1991-12-20 | 1998-03-02 | EGIS Gyógyszergyár Rt. | Eljárás új 3(2H)-piridazinon-származékok és ezeket tartalmazó gyógyszerkészítmények előállítására |
| US5242924A (en) * | 1992-07-02 | 1993-09-07 | Sterling Winthrop Inc. | Tetrazolyl-(phenoxy and phenoxyalkyl)-piperidinylpyridazines as antiviral agents |
| CA2099630A1 (en) * | 1992-07-02 | 1994-01-03 | Guy Dominic Diana | Heterocyclyl-phenoxyalkyl-piperidinylpyridazines as antiviral agents |
| US5364865A (en) * | 1992-12-30 | 1994-11-15 | Sterling Winthrop Inc. | Phenoxy- and phenoxyalkyl-piperidines as antiviral agents |
| PL310889A1 (en) * | 1993-03-29 | 1996-01-08 | Zeneca Ltd | Heterocyclic derivatives as inhibitors of thrombocytes aggregation |
| US5652242A (en) * | 1993-03-29 | 1997-07-29 | Zeneca Limited | Heterocyclic derivatives |
| US5750754A (en) * | 1993-03-29 | 1998-05-12 | Zeneca Limited | Heterocyclic compounds |
| NZ262942A (en) * | 1993-03-29 | 1997-07-27 | Zeneca Ltd | Pyridyl substituted piperazine and various other derivatives of azaheteroaryl substituted piperazines; pharmaceutical compositions |
| US5753659A (en) * | 1993-03-29 | 1998-05-19 | Zeneca Limited | Heterocyclic compouds |
| WO1999021834A1 (en) * | 1997-10-27 | 1999-05-06 | Neurosearch A/S | Heteroaryl diazacycloalkanes as cholinergic ligands at nicotinic acetylcholine receptors |
| US6683100B2 (en) | 1999-01-19 | 2004-01-27 | Novartis Ag | Organic compounds |
| BR9909369A (pt) | 1998-02-19 | 2000-11-28 | Eisai Co Ltd | Compostos de ftalazina e agentes terapêuticos para disfunção eréctil |
| US6194181B1 (en) | 1998-02-19 | 2001-02-27 | Novartis Ag | Fermentative preparation process for and crystal forms of cytostatics |
| US6316500B1 (en) * | 1999-01-05 | 2001-11-13 | Isp Investments Inc. | Aliphatically unsaturated hydroxy benzoates and preservative compositions thereof |
| AUPR213700A0 (en) * | 2000-12-18 | 2001-01-25 | Biota Scientific Management Pty Ltd | Antiviral agents |
| MXPA04001353A (es) | 2001-08-15 | 2004-10-27 | Icos Corp | 2h-ftalazin-1-onas y metodos para su uso. |
| US7390813B1 (en) | 2001-12-21 | 2008-06-24 | Xenon Pharmaceuticals Inc. | Pyridylpiperazines and aminonicotinamides and their use as therapeutic agents |
| CA2507509A1 (en) * | 2002-11-25 | 2004-06-10 | Mochida Pharmaceutical Co., Ltd. | Therapeutic agent for respiratory disease containing 4-hydroxypiperidine derivative as active ingredient |
| ES2568769T3 (es) | 2003-07-30 | 2016-05-04 | Xenon Pharmaceuticals Inc. | Derivados de piperazina y su uso como agentes terapéuticos |
| US7759348B2 (en) | 2003-07-30 | 2010-07-20 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutic agents |
| JP4831577B2 (ja) * | 2003-07-30 | 2011-12-07 | ゼノン・ファーマシューティカルズ・インコーポレイテッド | ピリダジン誘導体および治療剤としての用途 |
| US7754711B2 (en) | 2003-07-30 | 2010-07-13 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutic agents |
| ES2563954T3 (es) * | 2004-06-30 | 2016-03-16 | Janssen Pharmaceutica Nv | Derivados de ftalazina como inhibidores de PARP |
| BRPI0515478A (pt) | 2004-09-20 | 2008-07-22 | Xenon Pharmaceuticals Inc | derivados heterocìclicos e seu uso como mediadores de estearoil-coa-desaturase |
| TW200626154A (en) | 2004-09-20 | 2006-08-01 | Xenon Pharmaceuticals Inc | Heterocyclic derivatives and their use as therapeutic agents |
| TW200626155A (en) | 2004-09-20 | 2006-08-01 | Xenon Pharmaceuticals Inc | Heterocyclic derivatives and their use as therapeutic agents |
| CN101084207A (zh) | 2004-09-20 | 2007-12-05 | 泽农医药公司 | 杂环衍生物及其作为硬脂酰CoA去饱和酶抑制剂的用途 |
| WO2006034279A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as therapeutic agents |
| AU2005329423A1 (en) | 2004-09-20 | 2006-09-28 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| CN101083982A (zh) | 2004-09-20 | 2007-12-05 | 泽农医药公司 | 用于治疗硬脂酰CoA去饱和酶介导的疾病的杂环衍生物 |
| BRPI0611187A2 (pt) | 2005-06-03 | 2010-08-24 | Xenon Pharmaceuticals Inc | derivados aminotiazàis como inibidores da estearoil-coa desaturase humana |
| EP2308840A1 (en) * | 2005-06-30 | 2011-04-13 | Prosidion Limited | GPCR agonists |
| CN1887875B (zh) * | 2005-06-30 | 2011-04-06 | 深圳市东阳光实业发展有限公司 | 哒嗪胺衍生物及其用于制备小rna病毒抑制剂的用途 |
| CA2614116A1 (en) | 2005-07-04 | 2007-01-11 | Novo Nordisk A/S | Novel medicaments |
| CN102295606A (zh) | 2006-05-29 | 2011-12-28 | 高点制药有限责任公司 | 合成3-（1，3-苯并间二氧杂环戊烯-5-基）-6-（4-环丙基哌嗪-1-基）-哒嗪的方法及其适用的中间体 |
| EP2014656A3 (en) | 2007-06-11 | 2011-08-24 | High Point Pharmaceuticals, LLC | New heteocyclic h3 antagonists |
| CN101864003B (zh) * | 2010-06-11 | 2012-05-02 | 漆又毛 | 一种6-脱氧硫醚氨基酸环糊精衍生物的合成方法 |
| CN102344416B (zh) * | 2010-08-02 | 2015-09-16 | 中国人民解放军军事医学科学院毒物药物研究所 | 哒嗪衍生物及其作为抗小rna病毒感染药物的用途 |
| CN102485717B (zh) * | 2010-12-06 | 2015-12-02 | 中国人民解放军军事医学科学院毒物药物研究所 | 噻唑胺衍生物及其作为抗小rna病毒感染药物的用途 |
| TW201329025A (zh) | 2011-11-01 | 2013-07-16 | Astex Therapeutics Ltd | 醫藥化合物 |
| CN111683976B (zh) | 2018-02-05 | 2022-11-18 | 生物辐射实验室股份有限公司 | 具有阴离子交换-疏水混合模式配体的色谱树脂 |
| CN118047485B (zh) * | 2024-04-08 | 2024-06-25 | 西安文理学院 | 一种污水治理的复合微生物菌剂及其制备方法和应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES8802151A1 (es) * | 1985-07-31 | 1988-04-01 | Janssen Pharmaceutica Nv | Un procedimiento para la preparacion de nuevos piridazinaminas. |
-
1988
- 1988-10-26 MY MYPI88001214A patent/MY104343A/en unknown
- 1988-11-02 CA CA000581965A patent/CA1327573C/en not_active Expired - Fee Related
- 1988-11-09 NZ NZ226920A patent/NZ226920A/xx unknown
- 1988-11-17 DE DE3852816T patent/DE3852816T2/de not_active Expired - Fee Related
- 1988-11-17 AT AT88202572T patent/ATE117296T1/de not_active IP Right Cessation
- 1988-11-17 EP EP88202572A patent/EP0320032B1/en not_active Expired - Lifetime
- 1988-11-17 ES ES88202572T patent/ES2070126T3/es not_active Expired - Lifetime
- 1988-11-18 AU AU25751/88A patent/AU611504B2/en not_active Ceased
- 1988-11-21 TN TNTNSN88128A patent/TNSN88128A1/fr unknown
- 1988-11-21 IL IL88429A patent/IL88429A/xx not_active IP Right Cessation
- 1988-11-21 BG BG86132A patent/BG60676B1/bg unknown
- 1988-11-22 JO JO19881552A patent/JO1552B1/en active
- 1988-11-22 NO NO885190A patent/NO171980C/no unknown
- 1988-11-22 IE IE348688A patent/IE65768B1/en not_active IP Right Cessation
- 1988-11-22 JP JP63293739A patent/JPH0629255B2/ja not_active Expired - Fee Related
- 1988-11-22 HU HU885991A patent/HU200762B/hu not_active IP Right Cessation
- 1988-11-22 DK DK651288A patent/DK651288A/da not_active Application Discontinuation
- 1988-11-22 ZA ZA888744A patent/ZA888744B/xx unknown
- 1988-11-22 FI FI885409A patent/FI92584C/fi not_active IP Right Cessation
- 1988-11-22 MA MA21689A patent/MA21446A1/fr unknown
- 1988-11-22 SU SU884356881A patent/SU1724013A3/ru active
- 1988-11-22 PT PT89047A patent/PT89047B/pt not_active IP Right Cessation
- 1988-11-23 CN CN88108173A patent/CN1021328C/zh not_active Expired - Fee Related
- 1988-11-23 KR KR1019880015415A patent/KR0125280B1/ko not_active IP Right Cessation
- 1988-11-23 PH PH37851A patent/PH26670A/en unknown
-
1995
- 1995-04-17 GR GR950400946T patent/GR3015816T3/el unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG60676B1 (bg) | Производни на пиридазинамин | |
| JP2704984B2 (ja) | 含窒素二環化合物の製造方法 | |
| KR101406433B1 (ko) | Ｈ-ｐｇｄｓ 억제제로서 다중헤테로아릴 화합물 및 프로스타글란딘 ｄ2 매개된 질병의 치료를 위한 그의 용도 | |
| US4992433A (en) | Novel pyridazinamine derivatives | |
| JP5426543B2 (ja) | ピリダジノン誘導体 | |
| DE69008366T2 (de) | 2-Aminopyrimidinon-Derivate. | |
| US5231184A (en) | Pridazinamine derivatives | |
| CA2603939A1 (en) | Bicyclic [3.1.0] heteroaryl amides as type i glycine transport inhibitors | |
| WO2008029825A1 (fr) | Dérivé d'imidazole | |
| DE102008062826A1 (de) | Pyridazinonderivate | |
| RU2051149C1 (ru) | Производные пиридазинаминов, а также их соли или стереохимические изомерные формы, антивирусная композиция и гетероциклические производные | |
| CZ283070B6 (cs) | Fenoxy- a fenoxyalkylpiperidiny jako protivirově účinné látky | |
| US8420649B2 (en) | Pyrido[3,2-d]pyridazine-2(1H)-one compounds as p38 modulators and methods of use thereof | |
| US8497269B2 (en) | Phthalazine compounds as p38 map kinase modulators and methods of use thereof | |
| EA026062B1 (ru) | Производные пиразолкарбоксамида в качестве модуляторов рецепторов следовых аминов (taar) для применения при лечении различных расстройств, таких как депрессия, диабет и болезнь паркинсона | |
| AU619111B2 (en) | Antirhinoviral (thio) morpholinyl and piperazinyl alkylphenol ethers | |
| CA3001649A1 (en) | Dopamine d3 receptor antagonists having a morpholine moiety | |
| US5106973A (en) | Pyridzainamine derivatives | |
| EP0398427B1 (en) | Antirhinoviral pyridazinamines | |
| US5112825A (en) | Antirhinoviral heteroamine-substituted pyridazines | |
| HUE033448T2 (en) | Janus kinase inhibitor N-cyanomethylamides | |
| JP2017532356A (ja) | アルドステロン合成酵素阻害剤としての新規ジヒドロキノリンピラゾリル化合物 | |
| AU2007213744A1 (en) | Piperidine derivatives as CXCR3 receptor antagonists |