AT283330B - Verfahren zur Herstellung neuer, substituierter γ-Phenyl-β-hydroxybuttersäureamide - Google Patents
Verfahren zur Herstellung neuer, substituierter γ-Phenyl-β-hydroxybuttersäureamideInfo
- Publication number
- AT283330B AT283330B AT1099568A AT1099568A AT283330B AT 283330 B AT283330 B AT 283330B AT 1099568 A AT1099568 A AT 1099568A AT 1099568 A AT1099568 A AT 1099568A AT 283330 B AT283330 B AT 283330B
- Authority
- AT
- Austria
- Prior art keywords
- solution
- methanol
- phenyl
- hydroxybutyric acid
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 4
- MEYAGVCRWQSMPR-UHFFFAOYSA-N 3-hydroxy-4-phenylbutanamide Chemical class OC(CC(=O)N)CC1=CC=CC=C1 MEYAGVCRWQSMPR-UHFFFAOYSA-N 0.000 title 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 54
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 claims description 10
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 10
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 claims description 9
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims description 7
- 239000000706 filtrate Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 239000001103 potassium chloride Substances 0.000 claims description 5
- 235000011164 potassium chloride Nutrition 0.000 claims description 5
- OLQHWMVTGZBGLG-UHFFFAOYSA-N 3-hydroxy-4-phenylbutanoic acid Chemical compound OC(=O)CC(O)CC1=CC=CC=C1 OLQHWMVTGZBGLG-UHFFFAOYSA-N 0.000 claims description 2
- 125000004494 ethyl ester group Chemical group 0.000 claims description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims 2
- 150000007513 acids Chemical class 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- -1 p-biphenylyl Chemical group 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/06—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB51987/67A GB1171670A (en) | 1967-11-15 | 1967-11-15 | Derivatives of 4-Aryl-3-Hydroxybutyric Acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT283330B true AT283330B (de) | 1970-08-10 |
Family
ID=10462202
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1099568A AT283330B (de) | 1967-11-15 | 1968-11-12 | Verfahren zur Herstellung neuer, substituierter γ-Phenyl-β-hydroxybuttersäureamide |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3641123A (enFirst) |
| AT (1) | AT283330B (enFirst) |
| BE (1) | BE723917A (enFirst) |
| BR (1) | BR6804068D0 (enFirst) |
| CH (1) | CH507206A (enFirst) |
| DK (1) | DK124536B (enFirst) |
| FR (1) | FR1591547A (enFirst) |
| GB (1) | GB1171670A (enFirst) |
| IE (1) | IE32535B1 (enFirst) |
| NL (1) | NL6816143A (enFirst) |
| NO (1) | NO125272B (enFirst) |
| SE (1) | SE363503B (enFirst) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2128277B2 (enFirst) * | 1970-05-05 | 1979-06-22 | Rorer Inc William H | |
| US4061668A (en) * | 1974-12-06 | 1977-12-06 | Societa Italo-Britannica L. Manetti - H. Roberts & C. | Process for the preparation of 2-(4-isobutylphenyl)-propiohydroxamic acid |
| US4144351A (en) * | 1974-12-20 | 1979-03-13 | Klinge Pharma Gmbh & Co. | Substituted propanol-(2) derivatives and their preparation and use as hypolipemic drugs |
| NL7614113A (nl) * | 1976-12-18 | 1978-06-20 | Akzo Nv | Hydroxamzuren. |
| US4173652A (en) * | 1976-12-18 | 1979-11-06 | Akzona Incorporated | Pharmaceutical hydroxamic acid compositions and uses thereof |
| FR2433505A1 (fr) * | 1978-08-18 | 1980-03-14 | Soissonnais Sucrerie | Procede de fabrication des acides phenoxylactiques, de leurs derives et produits obtenus |
| GB2185479B (en) * | 1986-01-20 | 1990-03-14 | Chinese Acad Med Science | Novel amides, pharmacologically active compositions thereof, processes for the preparation thereof and their medical use |
| US8242282B2 (en) * | 2010-05-18 | 2012-08-14 | Taipei Medical University | Histone deacetylase inhibitors |
| CN102267923B (zh) * | 2010-06-04 | 2015-07-15 | 台北医学大学 | 组蛋白去乙酰化酶抑制剂 |
-
1967
- 1967-11-15 GB GB51987/67A patent/GB1171670A/en not_active Expired
-
1968
- 1968-10-31 IE IE1309/68A patent/IE32535B1/xx unknown
- 1968-11-12 AT AT1099568A patent/AT283330B/de not_active IP Right Cessation
- 1968-11-13 NL NL6816143A patent/NL6816143A/xx unknown
- 1968-11-14 BR BR204068/68A patent/BR6804068D0/pt unknown
- 1968-11-14 FR FR1591547D patent/FR1591547A/fr not_active Expired
- 1968-11-14 BE BE723917D patent/BE723917A/xx unknown
- 1968-11-14 NO NO4515/68A patent/NO125272B/no unknown
- 1968-11-15 DK DK557868AA patent/DK124536B/da unknown
- 1968-11-15 CH CH1708268A patent/CH507206A/de not_active IP Right Cessation
- 1968-11-15 SE SE15526/68A patent/SE363503B/xx unknown
- 1968-11-15 US US776264A patent/US3641123A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1171670A (en) | 1969-11-26 |
| IE32535L (en) | 1969-05-15 |
| CH507206A (de) | 1971-05-15 |
| BE723917A (enFirst) | 1969-04-16 |
| DK124536B (da) | 1972-10-30 |
| SE363503B (enFirst) | 1974-01-21 |
| IE32535B1 (en) | 1973-09-05 |
| NL6816143A (enFirst) | 1969-05-19 |
| US3641123A (en) | 1972-02-08 |
| BR6804068D0 (pt) | 1973-01-11 |
| FR1591547A (enFirst) | 1970-04-27 |
| NO125272B (enFirst) | 1972-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT283330B (de) | Verfahren zur Herstellung neuer, substituierter γ-Phenyl-β-hydroxybuttersäureamide | |
| DE2155406C3 (de) | 3- eckige Klammer auf 2-(3-Bromphenyl)-5-tetrazolyl eckige Klammer zu -propionsäureamide | |
| CH616406A5 (en) | Process for the preparation of novel oxime derivatives | |
| DE1151516B (de) | Verfahren zur Herstellung von ª†-Aminoalkoholen mit quartaerem ª‰-C-Atom | |
| AT240851B (de) | Verfahren zur Herstellung des neuen Thiodiglykol-di-[β-(9-carbazolyl)-propionats] | |
| AT202125B (de) | Verfahren zur Herstellung von neuen α-Mercapto-Säureamiden | |
| AT246729B (de) | Verfahren zur Herstellung von neuen substituierten Benzoesäureamiden | |
| AT228804B (de) | Verfahren zur Herstellung von Thionothiolphosphorsäureestern | |
| AT215430B (de) | Verfahren zur Herstellung neuer Ferrocenderivate | |
| AT231442B (de) | Verfahren zur Herstellung der neuen niederen Dialkylester der 1, 2, 5 - Thiadiazol-3, 4-dicarbonsäure | |
| AT208348B (de) | Verfahren zur Herstellung von neuen substituierten Säurehydraziden | |
| AT219043B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten | |
| AT213883B (de) | Verfahren zur Herstellung von neuen 3-Phenyl-3-pyrrolidinol-Verbindungen | |
| AT218521B (de) | Verfahren zur Herstellung von neuen Derivaten des Piperidins und Tetrahydropyridins | |
| AT219583B (de) | Verfahren zur Herstellung von disubstituierten Carbonsäurehydraziden | |
| AT204554B (de) | Verfahren zur Herstellung von N-Alkyl-α-piperidincarbonsäureaniliden | |
| AT226696B (de) | Verfahren zur Herstellung von neuen Derivaten des Phthalimidins bzw. deren quaternären Ammoniumverbindungen | |
| AT254855B (de) | Verfahren zur Herstellung neuer 3-Amino-2,4,6-trijodbenzoesäuarederivative | |
| AT214582B (de) | Verfahren zur Herstellung von 3β-Hydroxy- oder 3β-Acyloxy-6-methyl-25D-spirost-5-en | |
| AT339277B (de) | Verfahren zur herstellung von neuen 11-amino-benzo(b) bicyclo (3,3,1)nona-3,6a(10a)dienen und deren saureadditionssalzen | |
| AT227262B (de) | Verfahren zur Herstellung von neuen Flavon-7-oxy-essigsäureamiden | |
| AT213884B (de) | Verfahren zur Herstellung von neuen 3-Phenyl-3-pyrrolidinol-Verbindungen | |
| AT360007B (de) | Verfahren zur herstellung von 2-(phenylamino)- imidazolin-(2)derivaten und deren salzen | |
| AT240354B (de) | Verfahren zur Herstellung von neuen basischen 3, 5-Dimethoxy-4-substituierten-benzoesäureestern mit ihren Salzen | |
| DE1470133C (de) | Substituierte alpha Pyrazinyl succinimide und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |